GUI2 Framework as a standalone NPM Library
There are a few changes going on here
1) The fw part of GUI has been moved out in to its own project
a) several files are renamed (files 21-83)
b) the project has its own BUILD file (file 5)
c) there are a few files created by Angular CLI here - mostly script generated (files 7-20)
d) package-lock.json is a big generated file that has to be versioned (file 13)
2) The view in the main GUI2 project now refer to this library (see BUILD file 110)
a) some useless files were removed (files 115 - 139)
b) several files are changed to update references (files 140-202)
c) this breaks the BUCK build so I've removed the BUCK file and references to it (file 109)
Change-Id: I48bc3253edfcf5947f1582731ba739a1296012f5
diff --git a/web/gui2-fw-lib/.editorconfig b/web/gui2-fw-lib/.editorconfig
new file mode 100644
index 0000000..9b73521
--- /dev/null
+++ b/web/gui2-fw-lib/.editorconfig
@@ -0,0 +1,13 @@
+# Editor configuration, see http://editorconfig.org
+root = true
+
+[*]
+charset = utf-8
+indent_style = space
+indent_size = 4
+insert_final_newline = true
+trim_trailing_whitespace = true
+
+[*.md]
+max_line_length = off
+trim_trailing_whitespace = false
diff --git a/web/gui2-fw-lib/.gitignore b/web/gui2-fw-lib/.gitignore
new file mode 100644
index 0000000..ee5c9d8
--- /dev/null
+++ b/web/gui2-fw-lib/.gitignore
@@ -0,0 +1,39 @@
+# See http://help.github.com/ignore-files/ for more about ignoring files.
+
+# compiled output
+/dist
+/tmp
+/out-tsc
+
+# dependencies
+/node_modules
+
+# IDEs and editors
+/.idea
+.project
+.classpath
+.c9/
+*.launch
+.settings/
+*.sublime-workspace
+
+# IDE - VSCode
+.vscode/*
+!.vscode/settings.json
+!.vscode/tasks.json
+!.vscode/launch.json
+!.vscode/extensions.json
+
+# misc
+/.sass-cache
+/connect.lock
+/coverage
+/libpeerconnection.log
+npm-debug.log
+yarn-error.log
+testem.log
+/typings
+
+# System Files
+.DS_Store
+Thumbs.db
diff --git a/web/gui2-fw-lib/BUILD b/web/gui2-fw-lib/BUILD
new file mode 100644
index 0000000..e21f1d3
--- /dev/null
+++ b/web/gui2-fw-lib/BUILD
@@ -0,0 +1,326 @@
+"""
+ Copyright 2018-present Open Networking Foundation
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+"""
+
+"""
+ Rules to build the ONOS GUI 2 FW Lib
+
+ The GUI2 Angular 6 elements are built here with Angular CLI 'ng'
+ Some work is being done in the Bazel community to integrate Bazel and
+ Angular 6, (Angular Buildtools Convergence -
+ https://docs.google.com/document/d/1OlyiUnoTirUj4gecGxJeZBcjHcFr36RvLsvpBl2mxA8/preview)
+ but it is in the very early stages (Aug'18) and not yet fit
+ for production and at present it works as a replacement for Angular CLI
+ (which is not desirable).
+
+ There are plans to extend Bazel it to work with Angular CLI, and if works
+ well this Bazel file may be rearchiteced in future.
+
+ Bazel and npm are incompatibe in how they deal with files. npm likes to
+ follow links to get back to the original canonical path names, and bazel
+ uses links extensively when populating the sandbox. To get around these
+ problems, the rules that follow use filegroups to specify the files as
+ dependencies and then use a genrule to convert the files into a tar ball.
+ Once the tar ball is unrolled into the sandbox, the links are broken, but
+ the build is still hermetic since those files are referred to as dependencies in the genrule.
+"""
+
+COMPILE_DEPS = CORE_DEPS + JACKSON + KRYO + [
+ "@javax_ws_rs_api//jar",
+ "@servlet_api//jar",
+ "@jetty_websocket//jar",
+ "@jetty_util//jar",
+ "@jersey_media_multipart//jar",
+ "@jersey_server//jar",
+ "//utils/rest:onlab-rest",
+ "//core/store/serializers:onos-core-serializers",
+]
+
+TEST_DEPS = TEST + [
+ "//core/api:onos-api-tests",
+ "//drivers/default:onos-drivers-default",
+]
+
+"""
+ Files that get put at the top level of the tar ball
+"""
+
+filegroup(
+ name = "_root_level_files",
+ srcs =
+ [
+ ":angular.json",
+ ":package.json",
+ ":package-lock.json",
+ ":tsconfig.json",
+ ":tslint.json",
+ ],
+)
+
+filegroup(
+ name = "_e2e_test_files",
+ srcs = [
+ ":e2e/protractor.conf.js",
+ ":e2e/src/app.e2e-spec.ts",
+ ":e2e/src/app.po.ts",
+ ":e2e/tsconfig.e2e.json",
+ ],
+)
+
+"""
+ Make a group file of all the webapp files.
+"""
+
+filegroup(
+ name = "_gui2_fw_lib_src",
+ srcs = glob(
+ [
+ "projects/gui2-fw-lib/**",
+ ],
+ exclude = [
+ "projects/gui2-fw-lib/**/*.spec.*", # Don't track tests here
+ "projects/gui2-fw-lib/karma.conf.js",
+ "projects/gui2-fw-lib/src/test.ts",
+ ],
+ ),
+)
+
+"""
+ Make a group of all the webapp qpp files.
+"""
+
+filegroup(
+ name = "_gui2_app_files",
+ srcs = glob(
+ [
+ "src/**/*",
+ ],
+ ),
+)
+
+"""
+ Make a jar file of all the webapp test (*.spec.ts) files.
+"""
+
+genrule(
+ name = "_gui2_fw_lib_tests",
+ srcs = glob(
+ [
+ "projects/gui2-fw-lib/karma.conf.js",
+ "projects/gui2-fw-lib/src/test.ts",
+ "projects/gui2-fw-lib/tsconfig.spec.json",
+ "projects/gui2-fw-lib/**/*.spec.ts",
+ ],
+ exclude = [
+ "projects/gui2-fw-lib/ng-package.json",
+ "projects/gui2-fw-lib/ng-package.prod.json",
+ "projects/gui2-fw-lib/package.json",
+ "projects/gui2-fw-lib/tsconfig.lib.json",
+ "projects/gui2-fw-lib/tslint.json",
+ "projects/gui2-fw-lib/src/public_api.ts",
+ ],
+ ),
+ outs = ["gui2_fw_lib_tests.jar"],
+ cmd = "cd web/gui2-fw-lib &&" +
+ " jar Mcf ../../$@ .",
+)
+
+"""
+ Make a jar file of all the CSS files we want to reuse in the target.
+"""
+
+genrule(
+ name = "gui2_fw_lib_ext_css",
+ srcs = glob(
+ [
+ "projects/gui2-fw-lib/src/lib/widget/panel.css",
+ "projects/gui2-fw-lib/src/lib/widget/panel-theme.css",
+ "projects/gui2-fw-lib/src/lib/widget/table.css",
+ "projects/gui2-fw-lib/src/lib/widget/table.theme.css",
+ "projects/gui2-fw-lib/src/lib/widget/table.theme.css",
+ "projects/gui2-fw-lib/src/lib/layer/loading.service.css",
+ ],
+ ),
+ outs = ["gui2_fw_lib_css.jar"],
+ cmd = " ROOT=`pwd` &&" +
+ " cd web/gui2-fw-lib/projects/gui2-fw-lib/src/lib &&" +
+ " jar Mcf $$ROOT/$@ .",
+ visibility = ["//visibility:public"],
+)
+
+"""
+ Install npm packages listed in package.json in web/gui2
+ See bazel-genfiles/web/gui2/onos-gui2-npm-install.log for details of the 'npm install'
+"""
+
+genrule(
+ name = "onos-gui2-fw-npm-install",
+ srcs = [
+ "@nodejs//:bin/npm",
+ "@nodejs//:bin/node",
+ "@nodejs//:bin/node.js",
+ "@nodejs//:bin/nodejs/bin/node",
+ "@nodejs//:bin/nodejs/bin/npm",
+ ":_root_level_files",
+ ],
+ outs = [
+ "onos-gui2-npm-install.jar",
+ "onos-gui2-npm-install.log",
+ ],
+ cmd = " ROOT=`pwd` &&" +
+ " export HOME=. &&" +
+ " export XDG_CONFIG_HOME=$(@D)/config &&" + # npm config cache to the sandbox
+ " export BABEL_DISABLE_CACHE=1 &&" + # turn off babel cache
+ ' if [[ ! -z $${HTTP_PROXY-} ]]; then NPM_ARGS="--proxy $$HTTP_PROXY --without-ssl --insecure"; else NPM_ARGS=""; fi &&' +
+ " NPM=$(location @nodejs//:bin/npm) &&" +
+ " export PATH=$$ROOT/$$(dirname $${NPM}):$$PATH &&" +
+ " npm -v > $$ROOT/$(location onos-gui2-npm-install.log) 2>&1 &&" +
+ " cd web/gui2-fw-lib && " +
+ " npm $$NPM_ARGS install --no-cache >> $$ROOT/$(location onos-gui2-npm-install.log) 2>&1 &&" +
+ " jar Mcf $$ROOT/$(location onos-gui2-npm-install.jar) node_modules &&" +
+ " touch $$ROOT/$(location onos-gui2-npm-install.log)", # to get the log always as the 2nd file
+ message = "NodeJS npm install",
+ visibility = ["//visibility:public"],
+)
+
+"""
+ Run ng build to create outputs in production mode
+ See bazel-genfiles/web/gui2/onos-gui2-ng-build-prod.log for details of the Angular CLI output
+"""
+
+genrule(
+ name = "onos-gui2-fw-ng-build",
+ srcs = [
+ "@nodejs//:bin/npm",
+ "@nodejs//:bin/node",
+ "@nodejs//:bin/node.js",
+ "@nodejs//:bin/nodejs/bin/node",
+ "@nodejs//:bin/nodejs/bin/npm",
+ ":onos-gui2-fw-npm-install",
+ ":_root_level_files",
+ ":_gui2_fw_lib_src",
+ ],
+ outs = [
+ "gui2-fw-ng-build-prod.log",
+ "gui2-fw-lib-ver.tgz",
+ ],
+ cmd = "ROOT=`pwd` &&" +
+ " export HOME=. &&" +
+ " export XDG_CONFIG_HOME=$(@D)/config &&" +
+ " NODE=$(location @nodejs//:bin/node) &&" +
+ " INSTALL_FILES=($(locations :onos-gui2-fw-npm-install)) &&" + # An array of filenames - sorted by time created
+ " cd web/gui2-fw-lib &&" +
+ " jar xf $$ROOT/$${INSTALL_FILES[0]} &&" +
+ " chmod +x $$ROOT/web/gui2-fw-lib/node_modules/@angular/cli/bin/ng &&" +
+ " export PATH=$$ROOT/$$(dirname $${NODE}):$$ROOT/web/gui2-fw-lib/node_modules/@angular/cli/bin:$$PATH &&" +
+ " node -v > ../../$(location gui2-fw-ng-build-prod.log) &&" +
+ " npm -v >> ../../$(location gui2-fw-ng-build-prod.log) &&" +
+ " ng -v >> ../../$(location gui2-fw-ng-build-prod.log);" +
+ " ng build --prod gui2-fw-lib >> $$ROOT/$(location gui2-fw-ng-build-prod.log) 2>&1 ||" +
+ " if [ $$? -eq 0 ]; then echo 'Successfully built GUI FW library';" +
+ " else " +
+ " echo 'Error running \'ng build gui2-fw-lib\' on \'//web/gui2-fw-lib:onos-gui2-fw-ng-build\'. \\\n" +
+ " See bazel-genfiles/web/gui2-fw-lib/gui2-fw-ng-build-prod.log for more details' >&2;" +
+ " exit 1;" +
+ " fi;" +
+ " cd dist/gui2-fw-lib &&" +
+ " npm pack &&" +
+ " mv gui2-fw-lib-*.tgz $$ROOT/$(location gui2-fw-lib-ver.tgz) &&" +
+ " touch $$ROOT/$(location gui2-fw-ng-build-prod.log)", # to get the log always as the 2nd file
+ message = "GUI FW Lib build",
+ visibility = ["//visibility:public"],
+)
+
+"""
+ Run 'ng test' to run Angular test and 'ng lint' for checkstyle
+ See bazel-genfiles/web/gui2/onos-gui2-fw-ng-lint.log or
+ bazel-genfiles/web/gui2/onos-gui2-fw-ng-test.log for details of the Angular CLI output
+"""
+
+genrule(
+ name = "_onos-gui2-fw-ng-test",
+ srcs = [
+ "@nodejs//:bin/npm",
+ "@nodejs//:bin/node",
+ "@nodejs//:bin/node.js",
+ "@nodejs//:bin/nodejs/bin/node",
+ "@nodejs//:bin/nodejs/bin/npm",
+ ":onos-gui2-fw-npm-install",
+ ":_root_level_files",
+ ":_gui2_fw_lib_src",
+ ":_gui2_fw_lib_tests",
+ ":_e2e_test_files",
+ ],
+ outs = [
+ "onos-gui2-fw-ng-ver.log",
+ "onos-gui2-fw-ng-lint.log",
+ "onos-gui2-fw-ng-test.log",
+ ],
+ cmd = " ROOT=`pwd` &&" +
+ " export HOME=. &&" +
+ " export XDG_CONFIG_HOME=$(@D)/config &&" +
+ " NODE=$(location @nodejs//:bin/node) &&" +
+ " INSTALL_FILES=($(locations :onos-gui2-fw-npm-install)) &&" + # An array of filenames - sorted by time created
+ " mkdir -p web/gui2-fw-lib &&" +
+ " cd web/gui2-fw-lib &&" +
+ " jar xf ../../$(location :_gui2_fw_lib_tests) &&" +
+ " jar xf $$ROOT/$${INSTALL_FILES[0]} &&" +
+ " chmod +x $$ROOT/web/gui2-fw-lib/node_modules/@angular/cli/bin/ng &&" +
+ " export PATH=$$ROOT/$$(dirname $${NODE}):$$ROOT/web/gui2-fw-lib/node_modules/@angular/cli/bin:$$PATH &&" +
+ " node -v > ../../$(location onos-gui2-fw-ng-ver.log) &&" +
+ " npm -v >> ../../$(location onos-gui2-fw-ng-ver.log) &&" +
+ " ng -v >> ../../$(location onos-gui2-fw-ng-ver.log) &&" +
+ " ng lint gui2-fw-lib > ../../$(location onos-gui2-fw-ng-lint.log);" +
+ " if [ -f /usr/bin/chromium-browser ]; then " + # Add to this for Mac and Chrome
+ " export CHROME_BIN=/usr/bin/chromium-browser; " +
+ " elif [ -f /opt/google/chrome/chrome ]; then " +
+ " export CHROME_BIN=/opt/google/chrome/chrome; " +
+ " else " +
+ " MSG='Warning: Step _onos-gui2-fw-ng-test skipped because \\n" +
+ " no binary for ChromeHeadless browser was found at /usr/bin/chromium-browser. \\n" +
+ " Install Google Chrome or Chromium Browser to allow this step to run.';" +
+ " echo -e $$MSG >&2;" +
+ " echo -e $$MSG > ../../$(location onos-gui2-fw-ng-test.log);" +
+ " exit 0;" +
+ " fi;" +
+ " ng test --preserve-symlinks --code-coverage --browsers=ChromeHeadless" +
+ " --watch=false gui2-fw-lib > ../../$(location onos-gui2-fw-ng-test.log) 2>&1 ||" +
+ " if [ $$? -eq 0 ]; then echo 'Successfully ran tests';" +
+ " else " +
+ " echo 'Error running \'ng test\' on \'//web/gui2-fw-lib:onos-gui2-fw-ng-test\'. \\\n" +
+ " See bazel-genfiles/web/gui2-fw-lib/onos-gui2-fw-ng-test.log for more details' >&2;" +
+ #" tail -n 100 ../../$(location onos-gui2-fw-ng-test.log) >&2;" +
+ " exit 1;" +
+ " fi;",
+ message = "GUI FW lib lint and test",
+)
+
+"""
+ Wrap the genrule for testing in a test
+"""
+
+sh_test(
+ name = "onos-gui2-ng-tests",
+ size = "small",
+ srcs = [
+ ":ng-test.sh",
+ ],
+ data = [
+ ":_onos-gui2-fw-ng-test",
+ ],
+ deps = [
+ "@bazel_tools//tools/bash/runfiles",
+ ],
+)
diff --git a/web/gui2-fw-lib/README.md b/web/gui2-fw-lib/README.md
new file mode 100644
index 0000000..e7e6944
--- /dev/null
+++ b/web/gui2-fw-lib/README.md
@@ -0,0 +1,55 @@
+# Gui2FwLibApp
+
+This project separates out the Framework part of the ONOS GUI2 project in to a separate Angular library
+
+It is separate to the main ONOS GUI2 project which is in ~/onos/web/gui2
+
+The reason this has been separated out in to a separate library is to allow
+external applications e.g. YangGUI to use it, without bringing along the
+whole of GUI 2
+
+This project was generated with [Angular CLI](https://github.com/angular/angular-cli) version 6.0.0.
+
+A couple of good articles on the creation and use of __libraries__ in Angular 6 is given in
+
+[The Angular Library Series - Creating a Library with the Angular CLI](https://blog.angularindepth.com/creating-a-library-in-angular-6-87799552e7e5)
+
+and
+
+[The Angular Library Series - Building and Packaging](https://blog.angularindepth.com/creating-a-library-in-angular-6-part-2-6e2bc1e14121)
+
+The Bazel build of this library handles the building and packaging of the library
+so that other projects and libraries can use it.
+
+## Development server
+
+To build the library project using Angular CLI run 'ng build --prod gui2-fw-lib'
+inside the ~/onos/web/gui2-fw-lib folder
+
+To make the library in to an NPM package use 'npm pack' inside the project/gui2-fw-lib folder
+
+To build the app that surrounds the library run 'ng build'. This app is not
+part of the ONOS GUI and is there as a placeholder for testing the library
+
+Run `ng serve` for a dev server. Navigate to `http://localhost:4200/`.
+The app will automatically reload if you change any of the source files.
+
+## Code scaffolding
+
+Run `ng generate component component-name --project=gui2-fw-lib` to generate a new component. You can also use `ng generate directive|pipe|service|class|guard|interface|enum|module`.
+
+## Build
+
+Run `ng build` to build the project. The build artifacts will be stored in the `dist/` directory. Use the `--prod` flag for a production build.
+
+## Running unit tests
+
+Run `ng test` to execute the unit tests via [Karma](https://karma-runner.github.io).
+
+## Running end-to-end tests
+
+Run `ng e2e` to execute the end-to-end tests via [Protractor](http://www.protractortest.org/).
+
+## Further help
+
+To get more help on the Angular CLI use `ng help` or go check out the [Angular CLI README](https://github.com/angular/angular-cli/blob/master/README.md).
diff --git a/web/gui2-fw-lib/angular.json b/web/gui2-fw-lib/angular.json
new file mode 100644
index 0000000..739ee9f
--- /dev/null
+++ b/web/gui2-fw-lib/angular.json
@@ -0,0 +1,162 @@
+{
+ "$schema": "./node_modules/@angular/cli/lib/config/schema.json",
+ "version": 1,
+ "newProjectRoot": "projects",
+ "projects": {
+ "gui2-fw-lib-app": {
+ "root": "",
+ "sourceRoot": "src",
+ "projectType": "application",
+ "prefix": "app",
+ "schematics": {},
+ "architect": {
+ "build": {
+ "builder": "@angular-devkit/build-angular:browser",
+ "options": {
+ "outputPath": "dist/gui2-fw-lib-app",
+ "index": "src/index.html",
+ "main": "src/main.ts",
+ "polyfills": "src/polyfills.ts",
+ "tsConfig": "src/tsconfig.app.json",
+ "assets": [
+ "src/favicon.ico",
+ "src/assets"
+ ],
+ "styles": [
+ "src/styles.css"
+ ],
+ "scripts": []
+ },
+ "configurations": {
+ "production": {
+ "fileReplacements": [
+ {
+ "replace": "src/environments/environment.ts",
+ "with": "src/environments/environment.prod.ts"
+ }
+ ],
+ "optimization": true,
+ "outputHashing": "all",
+ "sourceMap": false,
+ "extractCss": true,
+ "namedChunks": false,
+ "aot": true,
+ "extractLicenses": true,
+ "vendorChunk": false,
+ "buildOptimizer": true
+ }
+ }
+ },
+ "serve": {
+ "builder": "@angular-devkit/build-angular:dev-server",
+ "options": {
+ "browserTarget": "gui2-fw-lib-app:build"
+ },
+ "configurations": {
+ "production": {
+ "browserTarget": "gui2-fw-lib-app:build:production"
+ }
+ }
+ },
+ "extract-i18n": {
+ "builder": "@angular-devkit/build-angular:extract-i18n",
+ "options": {
+ "browserTarget": "gui2-fw-lib-app:build"
+ }
+ },
+ "test": {
+ "builder": "@angular-devkit/build-angular:karma",
+ "options": {
+ "main": "src/test.ts",
+ "polyfills": "src/polyfills.ts",
+ "tsConfig": "src/tsconfig.spec.json",
+ "karmaConfig": "src/karma.conf.js",
+ "styles": [
+ "styles.css"
+ ],
+ "scripts": [],
+ "assets": [
+ "src/favicon.ico",
+ "src/assets"
+ ]
+ }
+ },
+ "lint": {
+ "builder": "@angular-devkit/build-angular:tslint",
+ "options": {
+ "tsConfig": [
+ "src/tsconfig.app.json",
+ "src/tsconfig.spec.json"
+ ],
+ "exclude": [
+ "**/node_modules/**"
+ ]
+ }
+ }
+ }
+ },
+ "gui2-fw-lib-app-e2e": {
+ "root": "e2e/",
+ "projectType": "application",
+ "architect": {
+ "e2e": {
+ "builder": "@angular-devkit/build-angular:protractor",
+ "options": {
+ "protractorConfig": "e2e/protractor.conf.js",
+ "devServerTarget": "gui2-fw-lib-app:serve"
+ }
+ },
+ "lint": {
+ "builder": "@angular-devkit/build-angular:tslint",
+ "options": {
+ "tsConfig": "e2e/tsconfig.e2e.json",
+ "exclude": [
+ "**/node_modules/**"
+ ]
+ }
+ }
+ }
+ },
+ "gui2-fw-lib": {
+ "root": "projects/gui2-fw-lib",
+ "sourceRoot": "projects/gui2-fw-lib/src",
+ "projectType": "library",
+ "prefix": "onos",
+ "architect": {
+ "build": {
+ "builder": "@angular-devkit/build-ng-packagr:build",
+ "options": {
+ "tsConfig": "projects/gui2-fw-lib/tsconfig.lib.json",
+ "project": "projects/gui2-fw-lib/ng-package.json"
+ },
+ "configurations": {
+ "production": {
+ "project": "projects/gui2-fw-lib/ng-package.prod.json"
+ }
+ }
+ },
+ "test": {
+ "builder": "@angular-devkit/build-angular:karma",
+ "options": {
+ "main": "projects/gui2-fw-lib/src/test.ts",
+ "tsConfig": "projects/gui2-fw-lib/tsconfig.spec.json",
+ "karmaConfig": "projects/gui2-fw-lib/karma.conf.js"
+ }
+ },
+ "lint": {
+ "builder": "@angular-devkit/build-angular:tslint",
+ "options": {
+ "tsConfig": [
+ "projects/gui2-fw-lib/tsconfig.lib.json",
+ "projects/gui2-fw-lib/tsconfig.spec.json"
+ ],
+ "exclude": [
+ "**/node_modules/**"
+ ]
+ }
+ }
+ }
+ }
+ },
+ "defaultProject": "gui2-fw-lib-app"
+}
\ No newline at end of file
diff --git a/web/gui2-fw-lib/e2e/protractor.conf.js b/web/gui2-fw-lib/e2e/protractor.conf.js
new file mode 100644
index 0000000..86776a3
--- /dev/null
+++ b/web/gui2-fw-lib/e2e/protractor.conf.js
@@ -0,0 +1,28 @@
+// Protractor configuration file, see link for more information
+// https://github.com/angular/protractor/blob/master/lib/config.ts
+
+const { SpecReporter } = require('jasmine-spec-reporter');
+
+exports.config = {
+ allScriptsTimeout: 11000,
+ specs: [
+ './src/**/*.e2e-spec.ts'
+ ],
+ capabilities: {
+ 'browserName': 'chrome'
+ },
+ directConnect: true,
+ baseUrl: 'http://localhost:4200/',
+ framework: 'jasmine',
+ jasmineNodeOpts: {
+ showColors: true,
+ defaultTimeoutInterval: 30000,
+ print: function() {}
+ },
+ onPrepare() {
+ require('ts-node').register({
+ project: require('path').join(__dirname, './tsconfig.e2e.json')
+ });
+ jasmine.getEnv().addReporter(new SpecReporter({ spec: { displayStacktrace: true } }));
+ }
+};
\ No newline at end of file
diff --git a/web/gui2-fw-lib/e2e/src/app.e2e-spec.ts b/web/gui2-fw-lib/e2e/src/app.e2e-spec.ts
new file mode 100644
index 0000000..e42d1f9
--- /dev/null
+++ b/web/gui2-fw-lib/e2e/src/app.e2e-spec.ts
@@ -0,0 +1,14 @@
+import { AppPage } from './app.po';
+
+describe('workspace-project App', () => {
+ let page: AppPage;
+
+ beforeEach(() => {
+ page = new AppPage();
+ });
+
+ it('should display welcome message', () => {
+ page.navigateTo();
+ expect(page.getParagraphText()).toEqual('Welcome to app!');
+ });
+});
diff --git a/web/gui2-fw-lib/e2e/src/app.po.ts b/web/gui2-fw-lib/e2e/src/app.po.ts
new file mode 100644
index 0000000..82ea75b
--- /dev/null
+++ b/web/gui2-fw-lib/e2e/src/app.po.ts
@@ -0,0 +1,11 @@
+import { browser, by, element } from 'protractor';
+
+export class AppPage {
+ navigateTo() {
+ return browser.get('/');
+ }
+
+ getParagraphText() {
+ return element(by.css('app-root h1')).getText();
+ }
+}
diff --git a/web/gui2-fw-lib/e2e/tsconfig.e2e.json b/web/gui2-fw-lib/e2e/tsconfig.e2e.json
new file mode 100644
index 0000000..a6dd622
--- /dev/null
+++ b/web/gui2-fw-lib/e2e/tsconfig.e2e.json
@@ -0,0 +1,13 @@
+{
+ "extends": "../tsconfig.json",
+ "compilerOptions": {
+ "outDir": "../out-tsc/app",
+ "module": "commonjs",
+ "target": "es5",
+ "types": [
+ "jasmine",
+ "jasminewd2",
+ "node"
+ ]
+ }
+}
\ No newline at end of file
diff --git a/web/gui2-fw-lib/ng-test.sh b/web/gui2-fw-lib/ng-test.sh
new file mode 100755
index 0000000..ba8a3dd
--- /dev/null
+++ b/web/gui2-fw-lib/ng-test.sh
@@ -0,0 +1,29 @@
+#!/bin/bash
+set -euo pipefail
+# --- begin runfiles.bash initialization ---
+if [[ ! -d "${RUNFILES_DIR:-/dev/null}" && ! -f "${RUNFILES_MANIFEST_FILE:-/dev/null}" ]]; then
+ if [[ -f "$0.runfiles_manifest" ]]; then
+ export RUNFILES_MANIFEST_FILE="$0.runfiles_manifest"
+ elif [[ -f "$0.runfiles/MANIFEST" ]]; then
+ export RUNFILES_MANIFEST_FILE="$0.runfiles/MANIFEST"
+ elif [[ -f "$0.runfiles/bazel_tools/tools/bash/runfiles/runfiles.bash" ]]; then
+ export RUNFILES_DIR="$0.runfiles"
+ fi
+fi
+
+if [[ -f "${RUNFILES_DIR:-/dev/null}/bazel_tools/tools/bash/runfiles/runfiles.bash" ]]; then
+ source "${RUNFILES_DIR}/bazel_tools/tools/bash/runfiles/runfiles.bash"
+elif [[ -f "${RUNFILES_MANIFEST_FILE:-/dev/null}" ]]; then
+ source "$(grep -m1 "^bazel_tools/tools/bash/runfiles/runfiles.bash " \
+ "$RUNFILES_MANIFEST_FILE" | cut -d ' ' -f 2-)"
+else
+ echo >&2 "ERROR: cannot find @bazel_tools//tools/bash/runfiles:runfiles.bash"
+ exit 1
+fi
+
+# --- end runfiles.bash initialization ---
+echo "Test results for Angular CLI commands run in _onos-gui2-fw-ng-test outputs at:"
+ls $(rlocation org_onosproject_onos/web/gui2-fw-lib/onos-gui2-fw-ng-ver.log)
+ls $(rlocation org_onosproject_onos/web/gui2-fw-lib/onos-gui2-fw-ng-lint.log)
+ls $(rlocation org_onosproject_onos/web/gui2-fw-lib/onos-gui2-fw-ng-test.log)
+
diff --git a/web/gui2-fw-lib/package-lock.json b/web/gui2-fw-lib/package-lock.json
new file mode 100644
index 0000000..165e482
--- /dev/null
+++ b/web/gui2-fw-lib/package-lock.json
@@ -0,0 +1,12538 @@
+{
+ "name": "gui2-fw-lib-app",
+ "version": "2.0.0",
+ "lockfileVersion": 1,
+ "requires": true,
+ "dependencies": {
+ "@angular-devkit/architect": {
+ "version": "0.6.8",
+ "resolved": "https://registry.npmjs.org/@angular-devkit/architect/-/architect-0.6.8.tgz",
+ "integrity": "sha512-ZKTm/zC61iY9IBHOEAKoMSzZpvhkmv+1O/HHzpHEuR551jCzu6vSyCmMY9Z7GBcccscCV+hjeSMwgFrFRcqlkw==",
+ "dev": true,
+ "requires": {
+ "@angular-devkit/core": "0.6.8",
+ "rxjs": "6.3.2"
+ }
+ },
+ "@angular-devkit/build-angular": {
+ "version": "0.6.8",
+ "resolved": "https://registry.npmjs.org/@angular-devkit/build-angular/-/build-angular-0.6.8.tgz",
+ "integrity": "sha512-VGqYAk8jpISraz2UHfsDre270NOUmV0CTSZw2p9sm5g/XIr5m+IHetFZz3gpoAr9+If2aFTs8Rt3sGdCRzwBqA==",
+ "dev": true,
+ "requires": {
+ "@angular-devkit/architect": "0.6.8",
+ "@angular-devkit/build-optimizer": "0.6.8",
+ "@angular-devkit/core": "0.6.8",
+ "@ngtools/webpack": "6.0.8",
+ "ajv": "6.4.0",
+ "autoprefixer": "8.6.5",
+ "cache-loader": "1.2.2",
+ "chalk": "2.2.2",
+ "circular-dependency-plugin": "5.0.2",
+ "clean-css": "4.2.1",
+ "copy-webpack-plugin": "4.5.2",
+ "file-loader": "1.1.11",
+ "glob": "7.1.3",
+ "html-webpack-plugin": "3.2.0",
+ "istanbul": "0.4.5",
+ "istanbul-instrumenter-loader": "3.0.1",
+ "karma-source-map-support": "1.3.0",
+ "less": "3.8.1",
+ "less-loader": "4.1.0",
+ "license-webpack-plugin": "1.4.0",
+ "lodash": "4.17.10",
+ "memory-fs": "0.4.1",
+ "mini-css-extract-plugin": "0.4.2",
+ "minimatch": "3.0.4",
+ "node-sass": "4.9.3",
+ "opn": "5.3.0",
+ "parse5": "4.0.0",
+ "portfinder": "1.0.17",
+ "postcss": "6.0.23",
+ "postcss-import": "11.1.0",
+ "postcss-loader": "2.1.6",
+ "postcss-url": "7.3.2",
+ "raw-loader": "0.5.1",
+ "resolve": "1.8.1",
+ "rxjs": "6.3.2",
+ "sass-loader": "7.1.0",
+ "silent-error": "1.1.0",
+ "source-map-support": "0.5.9",
+ "stats-webpack-plugin": "0.6.2",
+ "style-loader": "0.21.0",
+ "stylus": "0.54.5",
+ "stylus-loader": "3.0.2",
+ "tree-kill": "1.2.0",
+ "uglifyjs-webpack-plugin": "1.3.0",
+ "url-loader": "1.1.1",
+ "webpack": "4.8.3",
+ "webpack-dev-middleware": "3.2.0",
+ "webpack-dev-server": "3.1.7",
+ "webpack-merge": "4.1.4",
+ "webpack-sources": "1.2.0",
+ "webpack-subresource-integrity": "1.1.0-rc.4"
+ }
+ },
+ "@angular-devkit/build-ng-packagr": {
+ "version": "0.6.8",
+ "resolved": "https://registry.npmjs.org/@angular-devkit/build-ng-packagr/-/build-ng-packagr-0.6.8.tgz",
+ "integrity": "sha512-xcv3BwfB4PkL34PwXt2F+UpkxDajGRoPBGVj7FCD+Js4OY3S2G94BcdnDdOcwZzV+vjf5ZUxRC0IJ80YLJFSRQ==",
+ "dev": true,
+ "requires": {
+ "@angular-devkit/architect": "0.6.8",
+ "@angular-devkit/core": "0.6.8",
+ "resolve": "1.8.1",
+ "rxjs": "6.3.2"
+ }
+ },
+ "@angular-devkit/build-optimizer": {
+ "version": "0.6.8",
+ "resolved": "https://registry.npmjs.org/@angular-devkit/build-optimizer/-/build-optimizer-0.6.8.tgz",
+ "integrity": "sha512-of5syQbv3uNPp4AQkfRecfnp8AE8kvffbfYi+FFPZ6OGr7e59T1fGwk6+Zgb2qQFQg8HO2tzWI/uygtLIqmbmw==",
+ "dev": true,
+ "requires": {
+ "loader-utils": "1.1.0",
+ "source-map": "0.5.7",
+ "typescript": "2.9.2",
+ "webpack-sources": "1.2.0"
+ },
+ "dependencies": {
+ "typescript": {
+ "version": "2.9.2",
+ "resolved": "https://registry.npmjs.org/typescript/-/typescript-2.9.2.tgz",
+ "integrity": "sha512-Gr4p6nFNaoufRIY4NMdpQRNmgxVIGMs4Fcu/ujdYk3nAZqk7supzBE9idmvfZIlH/Cuj//dvi+019qEue9lV0w==",
+ "dev": true
+ }
+ }
+ },
+ "@angular-devkit/core": {
+ "version": "0.6.8",
+ "resolved": "https://registry.npmjs.org/@angular-devkit/core/-/core-0.6.8.tgz",
+ "integrity": "sha512-rkIa1OSVWTt4g9leLSK/PsqOj3HZbDKHbZjqlslyfVa3AyCeiumFoOgViOVXlYgPX3HHDbE5uH24nyUWSD8uww==",
+ "dev": true,
+ "requires": {
+ "ajv": "6.4.0",
+ "chokidar": "2.0.4",
+ "rxjs": "6.3.2",
+ "source-map": "0.5.7"
+ }
+ },
+ "@angular-devkit/schematics": {
+ "version": "0.6.8",
+ "resolved": "https://registry.npmjs.org/@angular-devkit/schematics/-/schematics-0.6.8.tgz",
+ "integrity": "sha512-R4YqAUdo62wtrhX/5HSRGSKXNTWqfQb66ZE6m8jj6GEJNFKdNXMdxOchxr07LCiKTxfh1w6G3nGzxIsu/+D4KA==",
+ "dev": true,
+ "requires": {
+ "@angular-devkit/core": "0.6.8",
+ "rxjs": "6.3.2"
+ }
+ },
+ "@angular/animations": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/animations/-/animations-6.1.7.tgz",
+ "integrity": "sha512-bjX3VEVEh5scGDDmxEKPzYI8DWUbqOFA34aYDY2cHPnDkLM0I7pEtO44qb72FSbWwXn77sYlby/dx2gtRayOOA==",
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "@angular/cli": {
+ "version": "6.0.8",
+ "resolved": "https://registry.npmjs.org/@angular/cli/-/cli-6.0.8.tgz",
+ "integrity": "sha512-DhH1Zq5Yonthw6zh6W07fhf+9XrAZbD1fcQ0MrmbxlieCfLlTAdBqyK2LavFCKwSZkUMLF6UHM3+jiNRVZSSIg==",
+ "dev": true,
+ "requires": {
+ "@angular-devkit/architect": "0.6.8",
+ "@angular-devkit/core": "0.6.8",
+ "@angular-devkit/schematics": "0.6.8",
+ "@schematics/angular": "0.6.8",
+ "@schematics/update": "0.6.8",
+ "opn": "5.3.0",
+ "resolve": "1.8.1",
+ "rxjs": "6.3.2",
+ "semver": "5.5.1",
+ "silent-error": "1.1.0",
+ "symbol-observable": "1.2.0",
+ "yargs-parser": "10.1.0"
+ },
+ "dependencies": {
+ "camelcase": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz",
+ "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=",
+ "dev": true
+ },
+ "yargs-parser": {
+ "version": "10.1.0",
+ "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-10.1.0.tgz",
+ "integrity": "sha512-VCIyR1wJoEBZUqk5PA+oOBF6ypbwh5aNB3I50guxAL/quggdfs4TtNHQrSazFA3fYZ+tEqfs0zIGlv0c/rgjbQ==",
+ "dev": true,
+ "requires": {
+ "camelcase": "4.1.0"
+ }
+ }
+ }
+ },
+ "@angular/common": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/common/-/common-6.1.7.tgz",
+ "integrity": "sha512-zFK2xM0hqR2ZWIfUsn+06jg+0K5PolzTxPjfUtVQDCZo+JHHKTVHEwtfORUaMTMfH9EqKrvfB3t6fCwK0523ag==",
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "@angular/compiler": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/compiler/-/compiler-6.1.7.tgz",
+ "integrity": "sha512-JKuK/fzKNCF+mNPmPmGQjr0uHVpfxmrOqXBriJMklCtdsKeQW94BLUoNjn8h1H10rFbUqYuD5v9AAKdH77FgnA==",
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "@angular/compiler-cli": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/compiler-cli/-/compiler-cli-6.1.7.tgz",
+ "integrity": "sha512-HzrwmtvrgKwUowfkPTsb6AOqdoQajY3Uso3i0jNc9/bXvpeikH0vj0YIKuQzAJDemluHsowHk/ImEsVGGr2w9g==",
+ "dev": true,
+ "requires": {
+ "chokidar": "1.7.0",
+ "minimist": "1.2.0",
+ "reflect-metadata": "0.1.12",
+ "tsickle": "0.32.1"
+ },
+ "dependencies": {
+ "anymatch": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-1.3.2.tgz",
+ "integrity": "sha512-0XNayC8lTHQ2OI8aljNCN3sSx6hsr/1+rlcDAotXJR7C1oZZHCNsfpbKwMjRA3Uqb5tF1Rae2oloTr4xpq+WjA==",
+ "dev": true,
+ "requires": {
+ "micromatch": "2.3.11",
+ "normalize-path": "2.1.1"
+ }
+ },
+ "arr-diff": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-2.0.0.tgz",
+ "integrity": "sha1-jzuCf5Vai9ZpaX5KQlasPOrjVs8=",
+ "dev": true,
+ "requires": {
+ "arr-flatten": "1.1.0"
+ }
+ },
+ "array-unique": {
+ "version": "0.2.1",
+ "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.2.1.tgz",
+ "integrity": "sha1-odl8yvy8JiXMcPrc6zalDFiwGlM=",
+ "dev": true
+ },
+ "braces": {
+ "version": "1.8.5",
+ "resolved": "https://registry.npmjs.org/braces/-/braces-1.8.5.tgz",
+ "integrity": "sha1-uneWLhLf+WnWt2cR6RS3N4V79qc=",
+ "dev": true,
+ "requires": {
+ "expand-range": "1.8.2",
+ "preserve": "0.2.0",
+ "repeat-element": "1.1.3"
+ }
+ },
+ "chokidar": {
+ "version": "1.7.0",
+ "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-1.7.0.tgz",
+ "integrity": "sha1-eY5ol3gVHIB2tLNg5e3SjNortGg=",
+ "dev": true,
+ "requires": {
+ "anymatch": "1.3.2",
+ "async-each": "1.0.1",
+ "fsevents": "1.2.4",
+ "glob-parent": "2.0.0",
+ "inherits": "2.0.3",
+ "is-binary-path": "1.0.1",
+ "is-glob": "2.0.1",
+ "path-is-absolute": "1.0.1",
+ "readdirp": "2.1.0"
+ }
+ },
+ "expand-brackets": {
+ "version": "0.1.5",
+ "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-0.1.5.tgz",
+ "integrity": "sha1-3wcoTjQqgHzXM6xa9yQR5YHRF3s=",
+ "dev": true,
+ "requires": {
+ "is-posix-bracket": "0.1.1"
+ }
+ },
+ "extglob": {
+ "version": "0.3.2",
+ "resolved": "https://registry.npmjs.org/extglob/-/extglob-0.3.2.tgz",
+ "integrity": "sha1-Lhj/PS9JqydlzskCPwEdqo2DSaE=",
+ "dev": true,
+ "requires": {
+ "is-extglob": "1.0.0"
+ }
+ },
+ "glob-parent": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-2.0.0.tgz",
+ "integrity": "sha1-gTg9ctsFT8zPUzbaqQLxgvbtuyg=",
+ "dev": true,
+ "requires": {
+ "is-glob": "2.0.1"
+ }
+ },
+ "is-extglob": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-1.0.0.tgz",
+ "integrity": "sha1-rEaBd8SUNAWgkvyPKXYMb/xiBsA=",
+ "dev": true
+ },
+ "is-glob": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-2.0.1.tgz",
+ "integrity": "sha1-0Jb5JqPe1WAPP9/ZEZjLCIjC2GM=",
+ "dev": true,
+ "requires": {
+ "is-extglob": "1.0.0"
+ }
+ },
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ },
+ "micromatch": {
+ "version": "2.3.11",
+ "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-2.3.11.tgz",
+ "integrity": "sha1-hmd8l9FyCzY0MdBNDRUpO9OMFWU=",
+ "dev": true,
+ "requires": {
+ "arr-diff": "2.0.0",
+ "array-unique": "0.2.1",
+ "braces": "1.8.5",
+ "expand-brackets": "0.1.5",
+ "extglob": "0.3.2",
+ "filename-regex": "2.0.1",
+ "is-extglob": "1.0.0",
+ "is-glob": "2.0.1",
+ "kind-of": "3.2.2",
+ "normalize-path": "2.1.1",
+ "object.omit": "2.0.1",
+ "parse-glob": "3.0.4",
+ "regex-cache": "0.4.4"
+ }
+ },
+ "minimist": {
+ "version": "1.2.0",
+ "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+ "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+ "dev": true
+ }
+ }
+ },
+ "@angular/core": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/core/-/core-6.1.7.tgz",
+ "integrity": "sha512-3MtS8EQy+saNcImDWghphOr/h3l5CpFnZW6aaHiL8T5CpTBNdB86uEmAwtiNQkJ0UeO+cztF1zNCzhm9R93/3w==",
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "@angular/forms": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/forms/-/forms-6.1.7.tgz",
+ "integrity": "sha512-McCElnn6Abr+HAjwxa1ldvIMs101TT0NGq8EHXLyF9QcKG24dU7425+MdLuW0OrtgBql2+RjlqnSiKuxDQHxJA==",
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "@angular/http": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/http/-/http-6.1.7.tgz",
+ "integrity": "sha512-N0wXHpEL/CsNM4l44Z+dU51Y994mBEHjt9yb0SeKf02mdrsTJK+cEvfZ0JkVDjGddqdWHvWFn3zSmkR79qLrSQ==",
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "@angular/language-service": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/language-service/-/language-service-6.1.7.tgz",
+ "integrity": "sha512-L6upXuyO42Z5XhtvbDoDuQEmXEOdSYeGOBmXSxb3ywb/0eh8kHk1Xft+8aaKKtazYjol0t+M+DlZgehqvk4vEA==",
+ "dev": true
+ },
+ "@angular/platform-browser": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/platform-browser/-/platform-browser-6.1.7.tgz",
+ "integrity": "sha512-YOYg944aefCWElJhnma8X+3wJDb6nHf6aBAVN+YPg0bUplEFacR4y6PeM9QR8vjh5Y0kbGG9ZPGDT/WwP2t4sQ==",
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "@angular/platform-browser-dynamic": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/platform-browser-dynamic/-/platform-browser-dynamic-6.1.7.tgz",
+ "integrity": "sha512-sSF7n4SpwPiP1fMwocu/RUegpp/45jHK/+r9biXUXUBD12zO5QMcLHU393sjoNi7e6+meuXEH0pnWa66dTznjw==",
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "@angular/router": {
+ "version": "6.1.7",
+ "resolved": "https://registry.npmjs.org/@angular/router/-/router-6.1.7.tgz",
+ "integrity": "sha512-YaOTq2icKAd9FDls2qo2Qp8FrmLGke3eA+bZ3FvOhFydxyUAvlU96N9Y9Gb05tXTtBaQNzAInov2bbp2YMFEFA==",
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "@compodoc/compodoc": {
+ "version": "1.1.5",
+ "resolved": "https://registry.npmjs.org/@compodoc/compodoc/-/compodoc-1.1.5.tgz",
+ "integrity": "sha512-PwUa42qCYEIrbXX25oUVkWck+IhACXBRSScPSV0Fr6+Nd3d6BcxUx8hllzZRVMBVv2a85fojSF7Sk6BfLqraRg==",
+ "dev": true,
+ "requires": {
+ "@compodoc/ngd-transformer": "2.0.0",
+ "chalk": "2.4.1",
+ "cheerio": "1.0.0-rc.2",
+ "chokidar": "2.0.4",
+ "colors": "1.3.2",
+ "commander": "2.17.1",
+ "cosmiconfig": "5.0.6",
+ "fancy-log": "1.3.2",
+ "findit2": "2.2.3",
+ "fs-extra": "7.0.0",
+ "glob": "7.1.3",
+ "handlebars": "4.0.10",
+ "html-entities": "1.2.1",
+ "i18next": "11.7.0",
+ "inside": "1.0.0",
+ "json5": "2.0.1",
+ "live-server": "1.1.0",
+ "lodash": "4.17.10",
+ "lunr": "2.3.2",
+ "marked": "0.4.0",
+ "os-name": "2.0.1",
+ "traverse": "0.6.6",
+ "ts-simple-ast": "12.4.0",
+ "uuid": "3.3.2"
+ },
+ "dependencies": {
+ "camelcase": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-1.2.1.tgz",
+ "integrity": "sha1-m7UwTS4LVmmLLHWLCKPqqdqlijk=",
+ "dev": true,
+ "optional": true
+ },
+ "chalk": {
+ "version": "2.4.1",
+ "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.1.tgz",
+ "integrity": "sha512-ObN6h1v2fTJSmUXoS3nMQ92LbDK9be4TV+6G+omQlGJFdcUX5heKi1LZ1YnRMIgwTLEj3E24bT6tYni50rlCfQ==",
+ "dev": true,
+ "requires": {
+ "ansi-styles": "3.2.1",
+ "escape-string-regexp": "1.0.5",
+ "supports-color": "5.5.0"
+ }
+ },
+ "cliui": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/cliui/-/cliui-2.1.0.tgz",
+ "integrity": "sha1-S0dXYP+AJkx2LDoXGQMukcf+oNE=",
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "center-align": "0.1.3",
+ "right-align": "0.1.3",
+ "wordwrap": "0.0.2"
+ }
+ },
+ "colors": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/colors/-/colors-1.3.2.tgz",
+ "integrity": "sha512-rhP0JSBGYvpcNQj4s5AdShMeE5ahMop96cTeDl/v9qQQm2fYClE2QXZRi8wLzc+GmXSxdIqqbOIAhyObEXDbfQ==",
+ "dev": true
+ },
+ "cosmiconfig": {
+ "version": "5.0.6",
+ "resolved": "https://registry.npmjs.org/cosmiconfig/-/cosmiconfig-5.0.6.tgz",
+ "integrity": "sha512-6DWfizHriCrFWURP1/qyhsiFvYdlJzbCzmtFWh744+KyWsJo5+kPzUZZaMRSSItoYc0pxFX7gEO7ZC1/gN/7AQ==",
+ "dev": true,
+ "requires": {
+ "is-directory": "0.3.1",
+ "js-yaml": "3.12.0",
+ "parse-json": "4.0.0"
+ }
+ },
+ "fs-extra": {
+ "version": "7.0.0",
+ "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-7.0.0.tgz",
+ "integrity": "sha512-EglNDLRpmaTWiD/qraZn6HREAEAHJcJOmxNEYwq6xeMKnVMAy3GUcFB+wXt2C6k4CNvB/mP1y/U3dzvKKj5OtQ==",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "jsonfile": "4.0.0",
+ "universalify": "0.1.2"
+ }
+ },
+ "handlebars": {
+ "version": "4.0.10",
+ "resolved": "https://registry.npmjs.org/handlebars/-/handlebars-4.0.10.tgz",
+ "integrity": "sha1-PTDHGLCaPZbyPqTMH0A8TTup/08=",
+ "dev": true,
+ "requires": {
+ "async": "1.5.2",
+ "optimist": "0.6.1",
+ "source-map": "0.4.4",
+ "uglify-js": "2.8.29"
+ }
+ },
+ "json5": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/json5/-/json5-2.0.1.tgz",
+ "integrity": "sha512-t6N/86QDIRYvOL259jR5c5TbtMnekl2Ib314mGeMh37zAwjgbWHieqijPH7pWaogmJq1F2I4Sphg19U1s+ZnXQ==",
+ "dev": true,
+ "requires": {
+ "minimist": "1.2.0"
+ }
+ },
+ "minimist": {
+ "version": "1.2.0",
+ "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+ "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+ "dev": true
+ },
+ "parse-json": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz",
+ "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=",
+ "dev": true,
+ "requires": {
+ "error-ex": "1.3.2",
+ "json-parse-better-errors": "1.0.2"
+ }
+ },
+ "source-map": {
+ "version": "0.4.4",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.4.4.tgz",
+ "integrity": "sha1-66T12pwNyZneaAMti092FzZSA2s=",
+ "dev": true,
+ "requires": {
+ "amdefine": "1.0.1"
+ }
+ },
+ "uglify-js": {
+ "version": "2.8.29",
+ "resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-2.8.29.tgz",
+ "integrity": "sha1-KcVzMUgFe7Th913zW3qcty5qWd0=",
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "source-map": "0.5.7",
+ "uglify-to-browserify": "1.0.2",
+ "yargs": "3.10.0"
+ },
+ "dependencies": {
+ "source-map": {
+ "version": "0.5.7",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz",
+ "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=",
+ "dev": true,
+ "optional": true
+ }
+ }
+ },
+ "wordwrap": {
+ "version": "0.0.2",
+ "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-0.0.2.tgz",
+ "integrity": "sha1-t5Zpu0LstAn4PVg8rVLKF+qhZD8=",
+ "dev": true,
+ "optional": true
+ },
+ "yargs": {
+ "version": "3.10.0",
+ "resolved": "http://registry.npmjs.org/yargs/-/yargs-3.10.0.tgz",
+ "integrity": "sha1-9+572FfdfB0tOMDnTvvWgdFDH9E=",
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "camelcase": "1.2.1",
+ "cliui": "2.1.0",
+ "decamelize": "1.2.0",
+ "window-size": "0.1.0"
+ }
+ }
+ }
+ },
+ "@compodoc/ngd-core": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/@compodoc/ngd-core/-/ngd-core-2.0.0.tgz",
+ "integrity": "sha512-6HpYvXRZBdIYFojWxW5EVNkhYPmblytCve62CNoYBSWfy++vTGH7Ypg2Bhjg2CsqeV8JOVxrPO7JM9M3MgWKEA==",
+ "dev": true,
+ "requires": {
+ "ansi-colors": "1.1.0",
+ "fancy-log": "1.3.2",
+ "typescript": "2.7.2"
+ },
+ "dependencies": {
+ "ansi-colors": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-1.1.0.tgz",
+ "integrity": "sha512-SFKX67auSNoVR38N3L+nvsPjOE0bybKTYbkf5tRvushrAPQ9V75huw0ZxBkKVeRU9kqH3d6HA4xTckbwZ4ixmA==",
+ "dev": true,
+ "requires": {
+ "ansi-wrap": "0.1.0"
+ }
+ }
+ }
+ },
+ "@compodoc/ngd-transformer": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/@compodoc/ngd-transformer/-/ngd-transformer-2.0.0.tgz",
+ "integrity": "sha512-9J0KkmuuuvDHxH0oREgrgbqdEFqcltQXIBofeYdIyMKzI3A+pN1Ji4zfi7x1ql0Ax7qQKemp8XWP+cCpP0qY+w==",
+ "dev": true,
+ "requires": {
+ "@compodoc/ngd-core": "2.0.0",
+ "dot": "1.1.2",
+ "fs-extra": "4.0.3",
+ "viz.js": "1.8.2"
+ },
+ "dependencies": {
+ "fs-extra": {
+ "version": "4.0.3",
+ "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-4.0.3.tgz",
+ "integrity": "sha512-q6rbdDd1o2mAnQreO7YADIxf/Whx4AHBiRf6d+/cVT8h44ss+lHgxf1FemcqDnQt9X3ct4McHr+JMGlYSsK7Cg==",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "jsonfile": "4.0.0",
+ "universalify": "0.1.2"
+ }
+ }
+ }
+ },
+ "@dsherret/to-absolute-glob": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/@dsherret/to-absolute-glob/-/to-absolute-glob-2.0.2.tgz",
+ "integrity": "sha1-H2R13IvZdM6gei2vOGSzF7HdMyw=",
+ "dev": true,
+ "requires": {
+ "is-absolute": "1.0.0",
+ "is-negated-glob": "1.0.0"
+ }
+ },
+ "@mrmlnc/readdir-enhanced": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/@mrmlnc/readdir-enhanced/-/readdir-enhanced-2.2.1.tgz",
+ "integrity": "sha512-bPHp6Ji8b41szTOcaP63VlnbbO5Ny6dwAATtY6JTjh5N2OLrb5Qk/Th5cRkRQhkWCt+EJsYrNB0MiL+Gpn6e3g==",
+ "dev": true,
+ "requires": {
+ "call-me-maybe": "1.0.1",
+ "glob-to-regexp": "0.3.0"
+ }
+ },
+ "@ngtools/json-schema": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/@ngtools/json-schema/-/json-schema-1.1.0.tgz",
+ "integrity": "sha1-w6DFRNYjkqzCgTpCyKDcb1j4aSI=",
+ "dev": true
+ },
+ "@ngtools/webpack": {
+ "version": "6.0.8",
+ "resolved": "https://registry.npmjs.org/@ngtools/webpack/-/webpack-6.0.8.tgz",
+ "integrity": "sha512-jorGpTd82ILbyUwg4JQekovHFaYwSMlZan4f7x+sd3+2WgyL3Z1+ZbVSGKvXZWKS/mAVx7eLkRikzJkuC4FgHw==",
+ "dev": true,
+ "requires": {
+ "@angular-devkit/core": "0.6.8",
+ "tree-kill": "1.2.0",
+ "webpack-sources": "1.2.0"
+ }
+ },
+ "@nodelib/fs.stat": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-1.1.2.tgz",
+ "integrity": "sha512-yprFYuno9FtNsSHVlSWd+nRlmGoAbqbeCwOryP6sC/zoCjhpArcRMYp19EvpSUSizJAlsXEwJv+wcWS9XaXdMw==",
+ "dev": true
+ },
+ "@schematics/angular": {
+ "version": "0.6.8",
+ "resolved": "https://registry.npmjs.org/@schematics/angular/-/angular-0.6.8.tgz",
+ "integrity": "sha512-9kRphqTYG5Df/I8fvnT1zMsw0YNDPO9tl18tQZXj4am4raT7l9UCr+WkwJdlBoA5pwG6baWE9sL0iGWV/bzF/g==",
+ "dev": true,
+ "requires": {
+ "@angular-devkit/core": "0.6.8",
+ "@angular-devkit/schematics": "0.6.8",
+ "typescript": "2.7.2"
+ }
+ },
+ "@schematics/update": {
+ "version": "0.6.8",
+ "resolved": "https://registry.npmjs.org/@schematics/update/-/update-0.6.8.tgz",
+ "integrity": "sha512-1Uq7LYnwL2wBwGVCgNz76QAR13ghAk+2vDDHOi+VX5+usHManxydrpoMGeX66OBPd+y5D3D2MFb+8mYHE7mygg==",
+ "dev": true,
+ "requires": {
+ "@angular-devkit/core": "0.6.8",
+ "@angular-devkit/schematics": "0.6.8",
+ "npm-registry-client": "8.6.0",
+ "rxjs": "6.3.2",
+ "semver": "5.5.1",
+ "semver-intersect": "1.4.0"
+ }
+ },
+ "@types/estree": {
+ "version": "0.0.39",
+ "resolved": "https://registry.npmjs.org/@types/estree/-/estree-0.0.39.tgz",
+ "integrity": "sha512-EYNwp3bU+98cpU4lAWYYL7Zz+2gryWH1qbdDTidVd6hkiR6weksdbMadyXKXNPEkQFhXM+hVO9ZygomHXp+AIw==",
+ "dev": true
+ },
+ "@types/jasmine": {
+ "version": "2.8.8",
+ "resolved": "https://registry.npmjs.org/@types/jasmine/-/jasmine-2.8.8.tgz",
+ "integrity": "sha512-OJSUxLaxXsjjhob2DBzqzgrkLmukM3+JMpRp0r0E4HTdT1nwDCWhaswjYxazPij6uOdzHCJfNbDjmQ1/rnNbCg==",
+ "dev": true
+ },
+ "@types/jasminewd2": {
+ "version": "2.0.3",
+ "resolved": "https://registry.npmjs.org/@types/jasminewd2/-/jasminewd2-2.0.3.tgz",
+ "integrity": "sha512-hYDVmQZT5VA2kigd4H4bv7vl/OhlympwREUemqBdOqtrYTo5Ytm12a5W5/nGgGYdanGVxj0x/VhZ7J3hOg/YKg==",
+ "dev": true,
+ "requires": {
+ "@types/jasmine": "2.8.8"
+ }
+ },
+ "@types/node": {
+ "version": "8.9.5",
+ "resolved": "http://registry.npmjs.org/@types/node/-/node-8.9.5.tgz",
+ "integrity": "sha512-jRHfWsvyMtXdbhnz5CVHxaBgnV6duZnPlQuRSo/dm/GnmikNcmZhxIES4E9OZjUmQ8C+HCl4KJux+cXN/ErGDQ==",
+ "dev": true
+ },
+ "@types/q": {
+ "version": "0.0.32",
+ "resolved": "https://registry.npmjs.org/@types/q/-/q-0.0.32.tgz",
+ "integrity": "sha1-vShOV8hPEyXacCur/IKlMoGQwMU=",
+ "dev": true
+ },
+ "@types/selenium-webdriver": {
+ "version": "2.53.43",
+ "resolved": "https://registry.npmjs.org/@types/selenium-webdriver/-/selenium-webdriver-2.53.43.tgz",
+ "integrity": "sha512-UBYHWph6P3tutkbXpW6XYg9ZPbTKjw/YC2hGG1/GEvWwTbvezBUv3h+mmUFw79T3RFPnmedpiXdOBbXX+4l0jg==",
+ "dev": true
+ },
+ "@webassemblyjs/ast": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.4.3.tgz",
+ "integrity": "sha512-S6npYhPcTHDYe9nlsKa9CyWByFi8Vj8HovcAgtmMAQZUOczOZbQ8CnwMYKYC5HEZzxEE+oY0jfQk4cVlI3J59Q==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/helper-wasm-bytecode": "1.4.3",
+ "@webassemblyjs/wast-parser": "1.4.3",
+ "debug": "3.1.0",
+ "webassemblyjs": "1.4.3"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+ "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ }
+ }
+ },
+ "@webassemblyjs/floating-point-hex-parser": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/floating-point-hex-parser/-/floating-point-hex-parser-1.4.3.tgz",
+ "integrity": "sha512-3zTkSFswwZOPNHnzkP9ONq4bjJSeKVMcuahGXubrlLmZP8fmTIJ58dW7h/zOVWiFSuG2em3/HH3BlCN7wyu9Rw==",
+ "dev": true
+ },
+ "@webassemblyjs/helper-buffer": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-buffer/-/helper-buffer-1.4.3.tgz",
+ "integrity": "sha512-e8+KZHh+RV8MUvoSRtuT1sFXskFnWG9vbDy47Oa166xX+l0dD5sERJ21g5/tcH8Yo95e9IN3u7Jc3NbhnUcSkw==",
+ "dev": true,
+ "requires": {
+ "debug": "3.1.0"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+ "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ }
+ }
+ },
+ "@webassemblyjs/helper-code-frame": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-code-frame/-/helper-code-frame-1.4.3.tgz",
+ "integrity": "sha512-9FgHEtNsZQYaKrGCtsjswBil48Qp1agrzRcPzCbQloCoaTbOXLJ9IRmqT+uEZbenpULLRNFugz3I4uw18hJM8w==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/wast-printer": "1.4.3"
+ }
+ },
+ "@webassemblyjs/helper-fsm": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-fsm/-/helper-fsm-1.4.3.tgz",
+ "integrity": "sha512-JINY76U+702IRf7ePukOt037RwmtH59JHvcdWbTTyHi18ixmQ+uOuNhcdCcQHTquDAH35/QgFlp3Y9KqtyJsCQ==",
+ "dev": true
+ },
+ "@webassemblyjs/helper-wasm-bytecode": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-bytecode/-/helper-wasm-bytecode-1.4.3.tgz",
+ "integrity": "sha512-I7bS+HaO0K07Io89qhJv+z1QipTpuramGwUSDkwEaficbSvCcL92CUZEtgykfNtk5wb0CoLQwWlmXTwGbNZUeQ==",
+ "dev": true
+ },
+ "@webassemblyjs/helper-wasm-section": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-section/-/helper-wasm-section-1.4.3.tgz",
+ "integrity": "sha512-p0yeeO/h2r30PyjnJX9xXSR6EDcvJd/jC6xa/Pxg4lpfcNi7JUswOpqDToZQ55HMMVhXDih/yqkaywHWGLxqyQ==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/ast": "1.4.3",
+ "@webassemblyjs/helper-buffer": "1.4.3",
+ "@webassemblyjs/helper-wasm-bytecode": "1.4.3",
+ "@webassemblyjs/wasm-gen": "1.4.3",
+ "debug": "3.1.0"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+ "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ }
+ }
+ },
+ "@webassemblyjs/leb128": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/leb128/-/leb128-1.4.3.tgz",
+ "integrity": "sha512-4u0LJLSPzuRDWHwdqsrThYn+WqMFVqbI2ltNrHvZZkzFPO8XOZ0HFQ5eVc4jY/TNHgXcnwrHjONhPGYuuf//KQ==",
+ "dev": true,
+ "requires": {
+ "leb": "0.3.0"
+ }
+ },
+ "@webassemblyjs/validation": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/validation/-/validation-1.4.3.tgz",
+ "integrity": "sha512-R+rRMKfhd9mq0rj2mhU9A9NKI2l/Rw65vIYzz4lui7eTKPcCu1l7iZNi4b9Gen8D42Sqh/KGiaQNk/x5Tn/iBQ==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/ast": "1.4.3"
+ }
+ },
+ "@webassemblyjs/wasm-edit": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-edit/-/wasm-edit-1.4.3.tgz",
+ "integrity": "sha512-qzuwUn771PV6/LilqkXcS0ozJYAeY/OKbXIWU3a8gexuqb6De2p4ya/baBeH5JQ2WJdfhWhSvSbu86Vienttpw==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/ast": "1.4.3",
+ "@webassemblyjs/helper-buffer": "1.4.3",
+ "@webassemblyjs/helper-wasm-bytecode": "1.4.3",
+ "@webassemblyjs/helper-wasm-section": "1.4.3",
+ "@webassemblyjs/wasm-gen": "1.4.3",
+ "@webassemblyjs/wasm-opt": "1.4.3",
+ "@webassemblyjs/wasm-parser": "1.4.3",
+ "@webassemblyjs/wast-printer": "1.4.3",
+ "debug": "3.1.0"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+ "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ }
+ }
+ },
+ "@webassemblyjs/wasm-gen": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-gen/-/wasm-gen-1.4.3.tgz",
+ "integrity": "sha512-eR394T8dHZfpLJ7U/Z5pFSvxl1L63JdREebpv9gYc55zLhzzdJPAuxjBYT4XqevUdW67qU2s0nNA3kBuNJHbaQ==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/ast": "1.4.3",
+ "@webassemblyjs/helper-wasm-bytecode": "1.4.3",
+ "@webassemblyjs/leb128": "1.4.3"
+ }
+ },
+ "@webassemblyjs/wasm-opt": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-opt/-/wasm-opt-1.4.3.tgz",
+ "integrity": "sha512-7Gp+nschuKiDuAL1xmp4Xz0rgEbxioFXw4nCFYEmy+ytynhBnTeGc9W9cB1XRu1w8pqRU2lbj2VBBA4cL5Z2Kw==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/ast": "1.4.3",
+ "@webassemblyjs/helper-buffer": "1.4.3",
+ "@webassemblyjs/wasm-gen": "1.4.3",
+ "@webassemblyjs/wasm-parser": "1.4.3",
+ "debug": "3.1.0"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+ "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ }
+ }
+ },
+ "@webassemblyjs/wasm-parser": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-parser/-/wasm-parser-1.4.3.tgz",
+ "integrity": "sha512-KXBjtlwA3BVukR/yWHC9GF+SCzBcgj0a7lm92kTOaa4cbjaTaa47bCjXw6cX4SGQpkncB9PU2hHGYVyyI7wFRg==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/ast": "1.4.3",
+ "@webassemblyjs/helper-wasm-bytecode": "1.4.3",
+ "@webassemblyjs/leb128": "1.4.3",
+ "@webassemblyjs/wasm-parser": "1.4.3",
+ "webassemblyjs": "1.4.3"
+ }
+ },
+ "@webassemblyjs/wast-parser": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-parser/-/wast-parser-1.4.3.tgz",
+ "integrity": "sha512-QhCsQzqV0CpsEkRYyTzQDilCNUZ+5j92f+g35bHHNqS22FppNTywNFfHPq8ZWZfYCgbectc+PoghD+xfzVFh1Q==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/ast": "1.4.3",
+ "@webassemblyjs/floating-point-hex-parser": "1.4.3",
+ "@webassemblyjs/helper-code-frame": "1.4.3",
+ "@webassemblyjs/helper-fsm": "1.4.3",
+ "long": "3.2.0",
+ "webassemblyjs": "1.4.3"
+ }
+ },
+ "@webassemblyjs/wast-printer": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-printer/-/wast-printer-1.4.3.tgz",
+ "integrity": "sha512-EgXk4anf8jKmuZJsqD8qy5bz2frEQhBvZruv+bqwNoLWUItjNSFygk8ywL3JTEz9KtxTlAmqTXNrdD1d9gNDtg==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/ast": "1.4.3",
+ "@webassemblyjs/wast-parser": "1.4.3",
+ "long": "3.2.0"
+ }
+ },
+ "abbrev": {
+ "version": "1.0.9",
+ "resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.0.9.tgz",
+ "integrity": "sha1-kbR5JYinc4wl813W9jdSovh3YTU=",
+ "dev": true
+ },
+ "accepts": {
+ "version": "1.3.5",
+ "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.5.tgz",
+ "integrity": "sha1-63d99gEXI6OxTopywIBcjoZ0a9I=",
+ "dev": true,
+ "requires": {
+ "mime-types": "2.1.20",
+ "negotiator": "0.6.1"
+ }
+ },
+ "acorn": {
+ "version": "5.7.2",
+ "resolved": "https://registry.npmjs.org/acorn/-/acorn-5.7.2.tgz",
+ "integrity": "sha512-cJrKCNcr2kv8dlDnbw+JPUGjHZzo4myaxOLmpOX8a+rgX94YeTcTMv/LFJUSByRpc+i4GgVnnhLxvMu/2Y+rqw==",
+ "dev": true
+ },
+ "acorn-dynamic-import": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/acorn-dynamic-import/-/acorn-dynamic-import-3.0.0.tgz",
+ "integrity": "sha512-zVWV8Z8lislJoOKKqdNMOB+s6+XV5WERty8MnKBeFgwA+19XJjJHs2RP5dzM57FftIs+jQnRToLiWazKr6sSWg==",
+ "dev": true,
+ "requires": {
+ "acorn": "5.7.2"
+ }
+ },
+ "adm-zip": {
+ "version": "0.4.4",
+ "resolved": "https://registry.npmjs.org/adm-zip/-/adm-zip-0.4.4.tgz",
+ "integrity": "sha1-ph7VrmkFw66lizplfSUDMJEFJzY=",
+ "dev": true
+ },
+ "after": {
+ "version": "0.8.2",
+ "resolved": "https://registry.npmjs.org/after/-/after-0.8.2.tgz",
+ "integrity": "sha1-/ts5T58OAqqXaOcCvaI7UF+ufh8=",
+ "dev": true
+ },
+ "agent-base": {
+ "version": "4.2.1",
+ "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-4.2.1.tgz",
+ "integrity": "sha512-JVwXMr9nHYTUXsBFKUqhJwvlcYU/blreOEUkhNR2eXZIvwd+c+o5V4MgDPKWnMS/56awN3TRzIP+KoPn+roQtg==",
+ "dev": true,
+ "requires": {
+ "es6-promisify": "5.0.0"
+ }
+ },
+ "ajv": {
+ "version": "6.4.0",
+ "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.4.0.tgz",
+ "integrity": "sha1-06/3jpJ3VJdx2vAWTP9ISCt1T8Y=",
+ "dev": true,
+ "requires": {
+ "fast-deep-equal": "1.1.0",
+ "fast-json-stable-stringify": "2.0.0",
+ "json-schema-traverse": "0.3.1",
+ "uri-js": "3.0.2"
+ }
+ },
+ "ajv-errors": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/ajv-errors/-/ajv-errors-1.0.0.tgz",
+ "integrity": "sha1-7PAh+hCP0X37Xms4Py3SM+Mf/Fk=",
+ "dev": true
+ },
+ "ajv-keywords": {
+ "version": "3.2.0",
+ "resolved": "https://registry.npmjs.org/ajv-keywords/-/ajv-keywords-3.2.0.tgz",
+ "integrity": "sha1-6GuBnGAs+IIa1jdBNpjx3sAhhHo=",
+ "dev": true
+ },
+ "align-text": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/align-text/-/align-text-0.1.4.tgz",
+ "integrity": "sha1-DNkKVhCT810KmSVsIrcGlDP60Rc=",
+ "dev": true,
+ "requires": {
+ "kind-of": "3.2.2",
+ "longest": "1.0.1",
+ "repeat-string": "1.6.1"
+ },
+ "dependencies": {
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ }
+ }
+ },
+ "ambi": {
+ "version": "2.5.0",
+ "resolved": "http://registry.npmjs.org/ambi/-/ambi-2.5.0.tgz",
+ "integrity": "sha1-fI43K+SIkRV+fOoBy2+RQ9H3QiA=",
+ "dev": true,
+ "requires": {
+ "editions": "1.3.4",
+ "typechecker": "4.5.0"
+ }
+ },
+ "amdefine": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/amdefine/-/amdefine-1.0.1.tgz",
+ "integrity": "sha1-SlKCrBZHKek2Gbz9OtFR+BfOkfU=",
+ "dev": true
+ },
+ "ansi-align": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/ansi-align/-/ansi-align-2.0.0.tgz",
+ "integrity": "sha1-w2rsy6VjuJzrVW82kPCx2eNUf38=",
+ "dev": true,
+ "requires": {
+ "string-width": "2.1.1"
+ },
+ "dependencies": {
+ "ansi-regex": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz",
+ "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=",
+ "dev": true
+ },
+ "is-fullwidth-code-point": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz",
+ "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=",
+ "dev": true
+ },
+ "string-width": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz",
+ "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==",
+ "dev": true,
+ "requires": {
+ "is-fullwidth-code-point": "2.0.0",
+ "strip-ansi": "4.0.0"
+ }
+ },
+ "strip-ansi": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz",
+ "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=",
+ "dev": true,
+ "requires": {
+ "ansi-regex": "3.0.0"
+ }
+ }
+ }
+ },
+ "ansi-colors": {
+ "version": "3.0.5",
+ "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-3.0.5.tgz",
+ "integrity": "sha512-VVjWpkfaphxUBFarydrQ3n26zX5nIK7hcbT3/ielrvwDDyBBjuh2vuSw1P9zkPq0cfqvdw7lkYHnu+OLSfIBsg==",
+ "dev": true
+ },
+ "ansi-gray": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/ansi-gray/-/ansi-gray-0.1.1.tgz",
+ "integrity": "sha1-KWLPVOyXksSFEKPetSRDaGHvclE=",
+ "dev": true,
+ "requires": {
+ "ansi-wrap": "0.1.0"
+ }
+ },
+ "ansi-html": {
+ "version": "0.0.7",
+ "resolved": "https://registry.npmjs.org/ansi-html/-/ansi-html-0.0.7.tgz",
+ "integrity": "sha1-gTWEAhliqenm/QOflA0S9WynhZ4=",
+ "dev": true
+ },
+ "ansi-regex": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz",
+ "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=",
+ "dev": true
+ },
+ "ansi-styles": {
+ "version": "3.2.1",
+ "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
+ "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
+ "dev": true,
+ "requires": {
+ "color-convert": "1.9.3"
+ }
+ },
+ "ansi-wrap": {
+ "version": "0.1.0",
+ "resolved": "https://registry.npmjs.org/ansi-wrap/-/ansi-wrap-0.1.0.tgz",
+ "integrity": "sha1-qCJQ3bABXponyoLoLqYDu/pF768=",
+ "dev": true
+ },
+ "anymatch": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz",
+ "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==",
+ "dev": true,
+ "requires": {
+ "micromatch": "3.1.10",
+ "normalize-path": "2.1.1"
+ }
+ },
+ "apache-crypt": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/apache-crypt/-/apache-crypt-1.1.2.tgz",
+ "integrity": "sha1-ggeCozu2pf0nEggvDtOiTjybAhQ=",
+ "dev": true,
+ "requires": {
+ "unix-crypt-td-js": "1.0.0"
+ }
+ },
+ "apache-md5": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/apache-md5/-/apache-md5-1.0.6.tgz",
+ "integrity": "sha1-RwI51AxU58Mt2dbrEbw1eOzJA8I=",
+ "dev": true
+ },
+ "app-root-path": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/app-root-path/-/app-root-path-2.1.0.tgz",
+ "integrity": "sha1-mL9lmTJ+zqGZMJhm6BQDaP0uZGo=",
+ "dev": true
+ },
+ "append-transform": {
+ "version": "0.4.0",
+ "resolved": "https://registry.npmjs.org/append-transform/-/append-transform-0.4.0.tgz",
+ "integrity": "sha1-126/jKlNJ24keja61EpLdKthGZE=",
+ "dev": true,
+ "requires": {
+ "default-require-extensions": "1.0.0"
+ }
+ },
+ "aproba": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz",
+ "integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==",
+ "dev": true
+ },
+ "are-we-there-yet": {
+ "version": "1.1.5",
+ "resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz",
+ "integrity": "sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==",
+ "dev": true,
+ "requires": {
+ "delegates": "1.0.0",
+ "readable-stream": "2.3.6"
+ }
+ },
+ "argparse": {
+ "version": "1.0.10",
+ "resolved": "https://registry.npmjs.org/argparse/-/argparse-1.0.10.tgz",
+ "integrity": "sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==",
+ "dev": true,
+ "requires": {
+ "sprintf-js": "1.0.3"
+ }
+ },
+ "arr-diff": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-4.0.0.tgz",
+ "integrity": "sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA=",
+ "dev": true
+ },
+ "arr-flatten": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/arr-flatten/-/arr-flatten-1.1.0.tgz",
+ "integrity": "sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg==",
+ "dev": true
+ },
+ "arr-union": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/arr-union/-/arr-union-3.1.0.tgz",
+ "integrity": "sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ=",
+ "dev": true
+ },
+ "array-differ": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/array-differ/-/array-differ-1.0.0.tgz",
+ "integrity": "sha1-7/UuN1gknTO+QCuLuOVkuytdQDE=",
+ "dev": true
+ },
+ "array-find-index": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/array-find-index/-/array-find-index-1.0.2.tgz",
+ "integrity": "sha1-3wEKoSh+Fku9pvlyOwqWoexBh6E=",
+ "dev": true
+ },
+ "array-flatten": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-2.1.1.tgz",
+ "integrity": "sha1-Qmu52oQJDBg42BLIFQryCoMx4pY=",
+ "dev": true
+ },
+ "array-slice": {
+ "version": "0.2.3",
+ "resolved": "https://registry.npmjs.org/array-slice/-/array-slice-0.2.3.tgz",
+ "integrity": "sha1-3Tz7gO15c6dRF82sabC5nshhhvU=",
+ "dev": true
+ },
+ "array-union": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/array-union/-/array-union-1.0.2.tgz",
+ "integrity": "sha1-mjRBDk9OPaI96jdb5b5w8kd47Dk=",
+ "dev": true,
+ "requires": {
+ "array-uniq": "1.0.3"
+ }
+ },
+ "array-uniq": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/array-uniq/-/array-uniq-1.0.3.tgz",
+ "integrity": "sha1-r2rId6Jcx/dOBYiUdThY39sk/bY=",
+ "dev": true
+ },
+ "array-unique": {
+ "version": "0.3.2",
+ "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.3.2.tgz",
+ "integrity": "sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=",
+ "dev": true
+ },
+ "arraybuffer.slice": {
+ "version": "0.0.6",
+ "resolved": "https://registry.npmjs.org/arraybuffer.slice/-/arraybuffer.slice-0.0.6.tgz",
+ "integrity": "sha1-8zshWfBTKj8xB6JywMz70a0peco=",
+ "dev": true
+ },
+ "arrify": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/arrify/-/arrify-1.0.1.tgz",
+ "integrity": "sha1-iYUI2iIm84DfkEcoRWhJwVAaSw0=",
+ "dev": true
+ },
+ "asap": {
+ "version": "2.0.6",
+ "resolved": "https://registry.npmjs.org/asap/-/asap-2.0.6.tgz",
+ "integrity": "sha1-5QNHYR1+aQlDIIu9r+vLwvuGbUY=",
+ "dev": true,
+ "optional": true
+ },
+ "asn1": {
+ "version": "0.2.4",
+ "resolved": "https://registry.npmjs.org/asn1/-/asn1-0.2.4.tgz",
+ "integrity": "sha512-jxwzQpLQjSmWXgwaCZE9Nz+glAG01yF1QnWgbhGwHI5A6FRIEY6IVqtHhIepHqI7/kyEyQEagBC5mBEFlIYvdg==",
+ "dev": true,
+ "requires": {
+ "safer-buffer": "2.1.2"
+ }
+ },
+ "asn1.js": {
+ "version": "4.10.1",
+ "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-4.10.1.tgz",
+ "integrity": "sha512-p32cOF5q0Zqs9uBiONKYLm6BClCoBCM5O9JfeUSlnQLBTxYdTK+pW+nXflm8UkKd2UYlEbYz5qEi0JuZR9ckSw==",
+ "dev": true,
+ "requires": {
+ "bn.js": "4.11.8",
+ "inherits": "2.0.3",
+ "minimalistic-assert": "1.0.1"
+ }
+ },
+ "assert": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/assert/-/assert-1.4.1.tgz",
+ "integrity": "sha1-mZEtWRg2tab1s0XA8H7vwI/GXZE=",
+ "dev": true,
+ "requires": {
+ "util": "0.10.3"
+ },
+ "dependencies": {
+ "inherits": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.1.tgz",
+ "integrity": "sha1-sX0I0ya0Qj5Wjv9xn5GwscvfafE=",
+ "dev": true
+ },
+ "util": {
+ "version": "0.10.3",
+ "resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz",
+ "integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.1"
+ }
+ }
+ }
+ },
+ "assert-plus": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/assert-plus/-/assert-plus-1.0.0.tgz",
+ "integrity": "sha1-8S4PPF13sLHN2RRpQuTpbB5N1SU=",
+ "dev": true
+ },
+ "assign-symbols": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/assign-symbols/-/assign-symbols-1.0.0.tgz",
+ "integrity": "sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c=",
+ "dev": true
+ },
+ "async": {
+ "version": "1.5.2",
+ "resolved": "https://registry.npmjs.org/async/-/async-1.5.2.tgz",
+ "integrity": "sha1-7GphrlZIDAw8skHJVhjiCJL5Zyo=",
+ "dev": true
+ },
+ "async-each": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/async-each/-/async-each-1.0.1.tgz",
+ "integrity": "sha1-GdOGodntxufByF04iu28xW0zYC0=",
+ "dev": true
+ },
+ "async-foreach": {
+ "version": "0.1.3",
+ "resolved": "https://registry.npmjs.org/async-foreach/-/async-foreach-0.1.3.tgz",
+ "integrity": "sha1-NhIfhFwFeBct5Bmpfb6x0W7DRUI=",
+ "dev": true
+ },
+ "asynckit": {
+ "version": "0.4.0",
+ "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz",
+ "integrity": "sha1-x57Zf380y48robyXkLzDZkdLS3k=",
+ "dev": true
+ },
+ "atob": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/atob/-/atob-2.1.2.tgz",
+ "integrity": "sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg==",
+ "dev": true
+ },
+ "autoprefixer": {
+ "version": "8.6.5",
+ "resolved": "https://registry.npmjs.org/autoprefixer/-/autoprefixer-8.6.5.tgz",
+ "integrity": "sha512-PLWJN3Xo/rycNkx+mp8iBDMTm3FeWe4VmYaZDSqL5QQB9sLsQkG5k8n+LNDFnhh9kdq2K+egL/icpctOmDHwig==",
+ "dev": true,
+ "requires": {
+ "browserslist": "3.2.8",
+ "caniuse-lite": "1.0.30000885",
+ "normalize-range": "0.1.2",
+ "num2fraction": "1.2.2",
+ "postcss": "6.0.23",
+ "postcss-value-parser": "3.3.0"
+ }
+ },
+ "aws-sign2": {
+ "version": "0.7.0",
+ "resolved": "https://registry.npmjs.org/aws-sign2/-/aws-sign2-0.7.0.tgz",
+ "integrity": "sha1-tG6JCTSpWR8tL2+G1+ap8bP+dqg=",
+ "dev": true
+ },
+ "aws4": {
+ "version": "1.8.0",
+ "resolved": "https://registry.npmjs.org/aws4/-/aws4-1.8.0.tgz",
+ "integrity": "sha512-ReZxvNHIOv88FlT7rxcXIIC0fPt4KZqZbOlivyWtXLt8ESx84zd3kMC6iK5jVeS2qt+g7ftS7ye4fi06X5rtRQ==",
+ "dev": true
+ },
+ "babel-code-frame": {
+ "version": "6.26.0",
+ "resolved": "https://registry.npmjs.org/babel-code-frame/-/babel-code-frame-6.26.0.tgz",
+ "integrity": "sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=",
+ "dev": true,
+ "requires": {
+ "chalk": "1.1.3",
+ "esutils": "2.0.2",
+ "js-tokens": "3.0.2"
+ },
+ "dependencies": {
+ "ansi-styles": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz",
+ "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=",
+ "dev": true
+ },
+ "chalk": {
+ "version": "1.1.3",
+ "resolved": "http://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz",
+ "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=",
+ "dev": true,
+ "requires": {
+ "ansi-styles": "2.2.1",
+ "escape-string-regexp": "1.0.5",
+ "has-ansi": "2.0.0",
+ "strip-ansi": "3.0.1",
+ "supports-color": "2.0.0"
+ }
+ },
+ "supports-color": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz",
+ "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=",
+ "dev": true
+ }
+ }
+ },
+ "babel-generator": {
+ "version": "6.26.1",
+ "resolved": "https://registry.npmjs.org/babel-generator/-/babel-generator-6.26.1.tgz",
+ "integrity": "sha512-HyfwY6ApZj7BYTcJURpM5tznulaBvyio7/0d4zFOeMPUmfxkCjHocCuoLa2SAGzBI8AREcH3eP3758F672DppA==",
+ "dev": true,
+ "requires": {
+ "babel-messages": "6.23.0",
+ "babel-runtime": "6.26.0",
+ "babel-types": "6.26.0",
+ "detect-indent": "4.0.0",
+ "jsesc": "1.3.0",
+ "lodash": "4.17.10",
+ "source-map": "0.5.7",
+ "trim-right": "1.0.1"
+ }
+ },
+ "babel-messages": {
+ "version": "6.23.0",
+ "resolved": "https://registry.npmjs.org/babel-messages/-/babel-messages-6.23.0.tgz",
+ "integrity": "sha1-8830cDhYA1sqKVHG7F7fbGLyYw4=",
+ "dev": true,
+ "requires": {
+ "babel-runtime": "6.26.0"
+ }
+ },
+ "babel-runtime": {
+ "version": "6.26.0",
+ "resolved": "https://registry.npmjs.org/babel-runtime/-/babel-runtime-6.26.0.tgz",
+ "integrity": "sha1-llxwWGaOgrVde/4E/yM3vItWR/4=",
+ "dev": true,
+ "requires": {
+ "core-js": "2.5.7",
+ "regenerator-runtime": "0.11.1"
+ }
+ },
+ "babel-template": {
+ "version": "6.26.0",
+ "resolved": "https://registry.npmjs.org/babel-template/-/babel-template-6.26.0.tgz",
+ "integrity": "sha1-3gPi0WOWsGn0bdn/+FIfsaDjXgI=",
+ "dev": true,
+ "requires": {
+ "babel-runtime": "6.26.0",
+ "babel-traverse": "6.26.0",
+ "babel-types": "6.26.0",
+ "babylon": "6.18.0",
+ "lodash": "4.17.10"
+ }
+ },
+ "babel-traverse": {
+ "version": "6.26.0",
+ "resolved": "https://registry.npmjs.org/babel-traverse/-/babel-traverse-6.26.0.tgz",
+ "integrity": "sha1-RqnL1+3MYsjlwGTi0tjQ9ANXZu4=",
+ "dev": true,
+ "requires": {
+ "babel-code-frame": "6.26.0",
+ "babel-messages": "6.23.0",
+ "babel-runtime": "6.26.0",
+ "babel-types": "6.26.0",
+ "babylon": "6.18.0",
+ "debug": "2.6.9",
+ "globals": "9.18.0",
+ "invariant": "2.2.4",
+ "lodash": "4.17.10"
+ }
+ },
+ "babel-types": {
+ "version": "6.26.0",
+ "resolved": "https://registry.npmjs.org/babel-types/-/babel-types-6.26.0.tgz",
+ "integrity": "sha1-o7Bz+Uq0nrb6Vc1lInozQ4BjJJc=",
+ "dev": true,
+ "requires": {
+ "babel-runtime": "6.26.0",
+ "esutils": "2.0.2",
+ "lodash": "4.17.10",
+ "to-fast-properties": "1.0.3"
+ }
+ },
+ "babylon": {
+ "version": "6.18.0",
+ "resolved": "https://registry.npmjs.org/babylon/-/babylon-6.18.0.tgz",
+ "integrity": "sha512-q/UEjfGJ2Cm3oKV71DJz9d25TPnq5rhBVL2Q4fA5wcC3jcrdn7+SssEybFIxwAvvP+YCsCYNKughoF33GxgycQ==",
+ "dev": true
+ },
+ "backo2": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/backo2/-/backo2-1.0.2.tgz",
+ "integrity": "sha1-MasayLEpNjRj41s+u2n038+6eUc=",
+ "dev": true
+ },
+ "balanced-match": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz",
+ "integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c=",
+ "dev": true
+ },
+ "base": {
+ "version": "0.11.2",
+ "resolved": "https://registry.npmjs.org/base/-/base-0.11.2.tgz",
+ "integrity": "sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==",
+ "dev": true,
+ "requires": {
+ "cache-base": "1.0.1",
+ "class-utils": "0.3.6",
+ "component-emitter": "1.2.1",
+ "define-property": "1.0.0",
+ "isobject": "3.0.1",
+ "mixin-deep": "1.3.1",
+ "pascalcase": "0.1.1"
+ },
+ "dependencies": {
+ "define-property": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
+ "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
+ "dev": true,
+ "requires": {
+ "is-descriptor": "1.0.2"
+ }
+ },
+ "is-accessor-descriptor": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
+ "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
+ "dev": true,
+ "requires": {
+ "kind-of": "6.0.2"
+ }
+ },
+ "is-data-descriptor": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
+ "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
+ "dev": true,
+ "requires": {
+ "kind-of": "6.0.2"
+ }
+ },
+ "is-descriptor": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
+ "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
+ "dev": true,
+ "requires": {
+ "is-accessor-descriptor": "1.0.0",
+ "is-data-descriptor": "1.0.0",
+ "kind-of": "6.0.2"
+ }
+ }
+ }
+ },
+ "base64-arraybuffer": {
+ "version": "0.1.5",
+ "resolved": "https://registry.npmjs.org/base64-arraybuffer/-/base64-arraybuffer-0.1.5.tgz",
+ "integrity": "sha1-c5JncZI7Whl0etZmqlzUv5xunOg=",
+ "dev": true
+ },
+ "base64-js": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.3.0.tgz",
+ "integrity": "sha512-ccav/yGvoa80BQDljCxsmmQ3Xvx60/UpBIij5QN21W3wBi/hhIC9OoO+KLpu9IJTS9j4DRVJ3aDDF9cMSoa2lw==",
+ "dev": true
+ },
+ "base64id": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/base64id/-/base64id-1.0.0.tgz",
+ "integrity": "sha1-R2iMuZu2gE8OBtPnY7HDLlfY5rY=",
+ "dev": true
+ },
+ "basic-auth": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/basic-auth/-/basic-auth-2.0.0.tgz",
+ "integrity": "sha1-AV2z81PgLlY3d1X5YnQuiYHnu7o=",
+ "dev": true,
+ "requires": {
+ "safe-buffer": "5.1.1"
+ },
+ "dependencies": {
+ "safe-buffer": {
+ "version": "5.1.1",
+ "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.1.tgz",
+ "integrity": "sha512-kKvNJn6Mm93gAczWVJg7wH+wGYWNrDHdWvpUmHyEsgCtIwwo3bqPtV4tR5tuPaUhTOo/kvhVwd8XwwOllGYkbg==",
+ "dev": true
+ }
+ }
+ },
+ "batch": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/batch/-/batch-0.6.1.tgz",
+ "integrity": "sha1-3DQxT05nkxgJP8dgJyUl+UvyXBY=",
+ "dev": true
+ },
+ "bcrypt-pbkdf": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.2.tgz",
+ "integrity": "sha1-pDAdOJtqQ/m2f/PKEaP2Y342Dp4=",
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "tweetnacl": "0.14.5"
+ }
+ },
+ "better-assert": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/better-assert/-/better-assert-1.0.2.tgz",
+ "integrity": "sha1-QIZrnhueC1W0gYlDEeaPr/rrxSI=",
+ "dev": true,
+ "requires": {
+ "callsite": "1.0.0"
+ }
+ },
+ "big.js": {
+ "version": "3.2.0",
+ "resolved": "https://registry.npmjs.org/big.js/-/big.js-3.2.0.tgz",
+ "integrity": "sha512-+hN/Zh2D08Mx65pZ/4g5bsmNiZUuChDiQfTUQ7qJr4/kuopCr88xZsAXv6mBoZEsUI4OuGHlX59qE94K2mMW8Q==",
+ "dev": true
+ },
+ "binary-extensions": {
+ "version": "1.11.0",
+ "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.11.0.tgz",
+ "integrity": "sha1-RqoXUftqL5PuXmibsQh9SxTGwgU=",
+ "dev": true
+ },
+ "blob": {
+ "version": "0.0.4",
+ "resolved": "https://registry.npmjs.org/blob/-/blob-0.0.4.tgz",
+ "integrity": "sha1-vPEwUspURj8w+fx+lbmkdjCpSSE=",
+ "dev": true
+ },
+ "block-stream": {
+ "version": "0.0.9",
+ "resolved": "https://registry.npmjs.org/block-stream/-/block-stream-0.0.9.tgz",
+ "integrity": "sha1-E+v+d4oDIFz+A3UUgeu0szAMEmo=",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3"
+ }
+ },
+ "blocking-proxy": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/blocking-proxy/-/blocking-proxy-1.0.1.tgz",
+ "integrity": "sha512-KE8NFMZr3mN2E0HcvCgRtX7DjhiIQrwle+nSVJVC/yqFb9+xznHl2ZcoBp2L9qzkI4t4cBFJ1efXF8Dwi132RA==",
+ "dev": true,
+ "requires": {
+ "minimist": "1.2.0"
+ },
+ "dependencies": {
+ "minimist": {
+ "version": "1.2.0",
+ "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+ "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+ "dev": true
+ }
+ }
+ },
+ "bluebird": {
+ "version": "3.5.2",
+ "resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.5.2.tgz",
+ "integrity": "sha512-dhHTWMI7kMx5whMQntl7Vr9C6BvV10lFXDAasnqnrMYhXVCzzk6IO9Fo2L75jXHT07WrOngL1WDXOp+yYS91Yg==",
+ "dev": true
+ },
+ "bn.js": {
+ "version": "4.11.8",
+ "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.8.tgz",
+ "integrity": "sha512-ItfYfPLkWHUjckQCk8xC+LwxgK8NYcXywGigJgSwOP8Y2iyWT4f2vsZnoOXTTbo+o5yXmIUJ4gn5538SO5S3gA==",
+ "dev": true
+ },
+ "body-parser": {
+ "version": "1.18.2",
+ "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.18.2.tgz",
+ "integrity": "sha1-h2eKGdhLR9hZuDGZvVm84iKxBFQ=",
+ "dev": true,
+ "requires": {
+ "bytes": "3.0.0",
+ "content-type": "1.0.4",
+ "debug": "2.6.9",
+ "depd": "1.1.2",
+ "http-errors": "1.6.3",
+ "iconv-lite": "0.4.19",
+ "on-finished": "2.3.0",
+ "qs": "6.5.1",
+ "raw-body": "2.3.2",
+ "type-is": "1.6.16"
+ },
+ "dependencies": {
+ "qs": {
+ "version": "6.5.1",
+ "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.1.tgz",
+ "integrity": "sha512-eRzhrN1WSINYCDCbrz796z37LOe3m5tmW7RQf6oBntukAG1nmovJvhnwHHRMAfeoItc1m2Hk02WER2aQ/iqs+A==",
+ "dev": true
+ }
+ }
+ },
+ "bonjour": {
+ "version": "3.5.0",
+ "resolved": "https://registry.npmjs.org/bonjour/-/bonjour-3.5.0.tgz",
+ "integrity": "sha1-jokKGD2O6aI5OzhExpGkK897yfU=",
+ "dev": true,
+ "requires": {
+ "array-flatten": "2.1.1",
+ "deep-equal": "1.0.1",
+ "dns-equal": "1.0.0",
+ "dns-txt": "2.0.2",
+ "multicast-dns": "6.2.3",
+ "multicast-dns-service-types": "1.1.0"
+ }
+ },
+ "boolbase": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/boolbase/-/boolbase-1.0.0.tgz",
+ "integrity": "sha1-aN/1++YMUes3cl6p4+0xDcwed24=",
+ "dev": true
+ },
+ "boxen": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/boxen/-/boxen-1.3.0.tgz",
+ "integrity": "sha512-TNPjfTr432qx7yOjQyaXm3dSR0MH9vXp7eT1BFSl/C51g+EFnOR9hTg1IreahGBmDNCehscshe45f+C1TBZbLw==",
+ "dev": true,
+ "requires": {
+ "ansi-align": "2.0.0",
+ "camelcase": "4.1.0",
+ "chalk": "2.2.2",
+ "cli-boxes": "1.0.0",
+ "string-width": "2.1.1",
+ "term-size": "1.2.0",
+ "widest-line": "2.0.0"
+ },
+ "dependencies": {
+ "ansi-regex": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz",
+ "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=",
+ "dev": true
+ },
+ "camelcase": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz",
+ "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=",
+ "dev": true
+ },
+ "is-fullwidth-code-point": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz",
+ "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=",
+ "dev": true
+ },
+ "string-width": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz",
+ "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==",
+ "dev": true,
+ "requires": {
+ "is-fullwidth-code-point": "2.0.0",
+ "strip-ansi": "4.0.0"
+ }
+ },
+ "strip-ansi": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz",
+ "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=",
+ "dev": true,
+ "requires": {
+ "ansi-regex": "3.0.0"
+ }
+ }
+ }
+ },
+ "brace-expansion": {
+ "version": "1.1.11",
+ "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
+ "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
+ "dev": true,
+ "requires": {
+ "balanced-match": "1.0.0",
+ "concat-map": "0.0.1"
+ }
+ },
+ "braces": {
+ "version": "2.3.2",
+ "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz",
+ "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==",
+ "dev": true,
+ "requires": {
+ "arr-flatten": "1.1.0",
+ "array-unique": "0.3.2",
+ "extend-shallow": "2.0.1",
+ "fill-range": "4.0.0",
+ "isobject": "3.0.1",
+ "repeat-element": "1.1.3",
+ "snapdragon": "0.8.2",
+ "snapdragon-node": "2.1.1",
+ "split-string": "3.1.0",
+ "to-regex": "3.0.2"
+ },
+ "dependencies": {
+ "extend-shallow": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+ "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+ "dev": true,
+ "requires": {
+ "is-extendable": "0.1.1"
+ }
+ }
+ }
+ },
+ "brorand": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/brorand/-/brorand-1.1.0.tgz",
+ "integrity": "sha1-EsJe/kCkXjwyPrhnWgoM5XsiNx8=",
+ "dev": true
+ },
+ "browserify-aes": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz",
+ "integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==",
+ "dev": true,
+ "requires": {
+ "buffer-xor": "1.0.3",
+ "cipher-base": "1.0.4",
+ "create-hash": "1.2.0",
+ "evp_bytestokey": "1.0.3",
+ "inherits": "2.0.3",
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "browserify-cipher": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/browserify-cipher/-/browserify-cipher-1.0.1.tgz",
+ "integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==",
+ "dev": true,
+ "requires": {
+ "browserify-aes": "1.2.0",
+ "browserify-des": "1.0.2",
+ "evp_bytestokey": "1.0.3"
+ }
+ },
+ "browserify-des": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/browserify-des/-/browserify-des-1.0.2.tgz",
+ "integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==",
+ "dev": true,
+ "requires": {
+ "cipher-base": "1.0.4",
+ "des.js": "1.0.0",
+ "inherits": "2.0.3",
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "browserify-rsa": {
+ "version": "4.0.1",
+ "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.0.1.tgz",
+ "integrity": "sha1-IeCr+vbyApzy+vsTNWenAdQTVSQ=",
+ "dev": true,
+ "requires": {
+ "bn.js": "4.11.8",
+ "randombytes": "2.0.6"
+ }
+ },
+ "browserify-sign": {
+ "version": "4.0.4",
+ "resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.0.4.tgz",
+ "integrity": "sha1-qk62jl17ZYuqa/alfmMMvXqT0pg=",
+ "dev": true,
+ "requires": {
+ "bn.js": "4.11.8",
+ "browserify-rsa": "4.0.1",
+ "create-hash": "1.2.0",
+ "create-hmac": "1.1.7",
+ "elliptic": "6.4.1",
+ "inherits": "2.0.3",
+ "parse-asn1": "5.1.1"
+ }
+ },
+ "browserify-zlib": {
+ "version": "0.2.0",
+ "resolved": "https://registry.npmjs.org/browserify-zlib/-/browserify-zlib-0.2.0.tgz",
+ "integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==",
+ "dev": true,
+ "requires": {
+ "pako": "1.0.6"
+ }
+ },
+ "browserslist": {
+ "version": "3.2.8",
+ "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-3.2.8.tgz",
+ "integrity": "sha512-WHVocJYavUwVgVViC0ORikPHQquXwVh939TaelZ4WDqpWgTX/FsGhl/+P4qBUAGcRvtOgDgC+xftNWWp2RUTAQ==",
+ "dev": true,
+ "requires": {
+ "caniuse-lite": "1.0.30000885",
+ "electron-to-chromium": "1.3.63"
+ }
+ },
+ "buffer": {
+ "version": "4.9.1",
+ "resolved": "http://registry.npmjs.org/buffer/-/buffer-4.9.1.tgz",
+ "integrity": "sha1-bRu2AbB6TvztlwlBMgkwJ8lbwpg=",
+ "dev": true,
+ "requires": {
+ "base64-js": "1.3.0",
+ "ieee754": "1.1.12",
+ "isarray": "1.0.0"
+ }
+ },
+ "buffer-alloc": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/buffer-alloc/-/buffer-alloc-1.2.0.tgz",
+ "integrity": "sha512-CFsHQgjtW1UChdXgbyJGtnm+O/uLQeZdtbDo8mfUgYXCHSM1wgrVxXm6bSyrUuErEb+4sYVGCzASBRot7zyrow==",
+ "dev": true,
+ "requires": {
+ "buffer-alloc-unsafe": "1.1.0",
+ "buffer-fill": "1.0.0"
+ }
+ },
+ "buffer-alloc-unsafe": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/buffer-alloc-unsafe/-/buffer-alloc-unsafe-1.1.0.tgz",
+ "integrity": "sha512-TEM2iMIEQdJ2yjPJoSIsldnleVaAk1oW3DBVUykyOLsEsFmEc9kn+SFFPz+gl54KQNxlDnAwCXosOS9Okx2xAg==",
+ "dev": true
+ },
+ "buffer-fill": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/buffer-fill/-/buffer-fill-1.0.0.tgz",
+ "integrity": "sha1-+PeLdniYiO858gXNY39o5wISKyw=",
+ "dev": true
+ },
+ "buffer-from": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.1.tgz",
+ "integrity": "sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==",
+ "dev": true
+ },
+ "buffer-indexof": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/buffer-indexof/-/buffer-indexof-1.1.1.tgz",
+ "integrity": "sha512-4/rOEg86jivtPTeOUUT61jJO1Ya1TrR/OkqCSZDyq84WJh3LuuiphBYJN+fm5xufIk4XAFcEwte/8WzC8If/1g==",
+ "dev": true
+ },
+ "buffer-xor": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/buffer-xor/-/buffer-xor-1.0.3.tgz",
+ "integrity": "sha1-JuYe0UIvtw3ULm42cp7VHYVf6Nk=",
+ "dev": true
+ },
+ "builtin-modules": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/builtin-modules/-/builtin-modules-1.1.1.tgz",
+ "integrity": "sha1-Jw8HbFpywC9bZaR9+Uxf46J4iS8=",
+ "dev": true
+ },
+ "builtin-status-codes": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz",
+ "integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug=",
+ "dev": true
+ },
+ "builtins": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/builtins/-/builtins-1.0.3.tgz",
+ "integrity": "sha1-y5T662HIaWRR2zZTThQi+U8K7og=",
+ "dev": true
+ },
+ "bytes": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.0.0.tgz",
+ "integrity": "sha1-0ygVQE1olpn4Wk6k+odV3ROpYEg=",
+ "dev": true
+ },
+ "cacache": {
+ "version": "10.0.4",
+ "resolved": "https://registry.npmjs.org/cacache/-/cacache-10.0.4.tgz",
+ "integrity": "sha512-Dph0MzuH+rTQzGPNT9fAnrPmMmjKfST6trxJeK7NQuHRaVw24VzPRWTmg9MpcwOVQZO0E1FBICUlFeNaKPIfHA==",
+ "dev": true,
+ "requires": {
+ "bluebird": "3.5.2",
+ "chownr": "1.0.1",
+ "glob": "7.1.3",
+ "graceful-fs": "4.1.11",
+ "lru-cache": "4.1.3",
+ "mississippi": "2.0.0",
+ "mkdirp": "0.5.1",
+ "move-concurrently": "1.0.1",
+ "promise-inflight": "1.0.1",
+ "rimraf": "2.6.2",
+ "ssri": "5.3.0",
+ "unique-filename": "1.1.0",
+ "y18n": "4.0.0"
+ }
+ },
+ "cache-base": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/cache-base/-/cache-base-1.0.1.tgz",
+ "integrity": "sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==",
+ "dev": true,
+ "requires": {
+ "collection-visit": "1.0.0",
+ "component-emitter": "1.2.1",
+ "get-value": "2.0.6",
+ "has-value": "1.0.0",
+ "isobject": "3.0.1",
+ "set-value": "2.0.0",
+ "to-object-path": "0.3.0",
+ "union-value": "1.0.0",
+ "unset-value": "1.0.0"
+ }
+ },
+ "cache-loader": {
+ "version": "1.2.2",
+ "resolved": "https://registry.npmjs.org/cache-loader/-/cache-loader-1.2.2.tgz",
+ "integrity": "sha512-rsGh4SIYyB9glU+d0OcHwiXHXBoUgDhHZaQ1KAbiXqfz1CDPxtTboh1gPbJ0q2qdO8a9lfcjgC5CJ2Ms32y5bw==",
+ "dev": true,
+ "requires": {
+ "loader-utils": "1.1.0",
+ "mkdirp": "0.5.1",
+ "neo-async": "2.5.2",
+ "schema-utils": "0.4.7"
+ }
+ },
+ "call-me-maybe": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/call-me-maybe/-/call-me-maybe-1.0.1.tgz",
+ "integrity": "sha1-JtII6onje1y95gJQoV8DHBak1ms=",
+ "dev": true
+ },
+ "callsite": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/callsite/-/callsite-1.0.0.tgz",
+ "integrity": "sha1-KAOY5dZkvXQDi28JBRU+borxvCA=",
+ "dev": true
+ },
+ "camel-case": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/camel-case/-/camel-case-3.0.0.tgz",
+ "integrity": "sha1-yjw2iKTpzzpM2nd9xNy8cTJJz3M=",
+ "dev": true,
+ "requires": {
+ "no-case": "2.3.2",
+ "upper-case": "1.1.3"
+ }
+ },
+ "camelcase": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-2.1.1.tgz",
+ "integrity": "sha1-fB0W1nmhu+WcoCys7PsBHiAfWh8=",
+ "dev": true
+ },
+ "camelcase-keys": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-2.1.0.tgz",
+ "integrity": "sha1-MIvur/3ygRkFHvodkyITyRuPkuc=",
+ "dev": true,
+ "requires": {
+ "camelcase": "2.1.1",
+ "map-obj": "1.0.1"
+ }
+ },
+ "caniuse-lite": {
+ "version": "1.0.30000885",
+ "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30000885.tgz",
+ "integrity": "sha512-cXKbYwpxBLd7qHyej16JazPoUacqoVuDhvR61U7Fr5vSxMUiodzcYa1rQYRYfZ5GexV03vGZHd722vNPLjPJGQ==",
+ "dev": true
+ },
+ "capture-stack-trace": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/capture-stack-trace/-/capture-stack-trace-1.0.1.tgz",
+ "integrity": "sha512-mYQLZnx5Qt1JgB1WEiMCf2647plpGeQ2NMR/5L0HNZzGQo4fuSPnK+wjfPnKZV0aiJDgzmWqqkV/g7JD+DW0qw==",
+ "dev": true
+ },
+ "caseless": {
+ "version": "0.12.0",
+ "resolved": "https://registry.npmjs.org/caseless/-/caseless-0.12.0.tgz",
+ "integrity": "sha1-G2gcIf+EAzyCZUMJBolCDRhxUdw=",
+ "dev": true
+ },
+ "center-align": {
+ "version": "0.1.3",
+ "resolved": "https://registry.npmjs.org/center-align/-/center-align-0.1.3.tgz",
+ "integrity": "sha1-qg0yYptu6XIgBBHL1EYckHvCt60=",
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "align-text": "0.1.4",
+ "lazy-cache": "1.0.4"
+ }
+ },
+ "chalk": {
+ "version": "2.2.2",
+ "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.2.2.tgz",
+ "integrity": "sha512-LvixLAQ4MYhbf7hgL4o5PeK32gJKvVzDRiSNIApDofQvyhl8adgG2lJVXn4+ekQoK7HL9RF8lqxwerpe0x2pCw==",
+ "dev": true,
+ "requires": {
+ "ansi-styles": "3.2.1",
+ "escape-string-regexp": "1.0.5",
+ "supports-color": "4.5.0"
+ },
+ "dependencies": {
+ "has-flag": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-2.0.0.tgz",
+ "integrity": "sha1-6CB68cx7MNRGzHC3NLXovhj4jVE=",
+ "dev": true
+ },
+ "supports-color": {
+ "version": "4.5.0",
+ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-4.5.0.tgz",
+ "integrity": "sha1-vnoN5ITexcXN34s9WRJQRJEvY1s=",
+ "dev": true,
+ "requires": {
+ "has-flag": "2.0.0"
+ }
+ }
+ }
+ },
+ "cheerio": {
+ "version": "1.0.0-rc.2",
+ "resolved": "https://registry.npmjs.org/cheerio/-/cheerio-1.0.0-rc.2.tgz",
+ "integrity": "sha1-S59TqBsn5NXawxwP/Qz6A8xoMNs=",
+ "dev": true,
+ "requires": {
+ "css-select": "1.2.0",
+ "dom-serializer": "0.1.0",
+ "entities": "1.1.1",
+ "htmlparser2": "3.9.2",
+ "lodash": "4.17.10",
+ "parse5": "3.0.3"
+ },
+ "dependencies": {
+ "domhandler": {
+ "version": "2.4.2",
+ "resolved": "https://registry.npmjs.org/domhandler/-/domhandler-2.4.2.tgz",
+ "integrity": "sha512-JiK04h0Ht5u/80fdLMCEmV4zkNh2BcoMFBmZ/91WtYZ8qVXSKjiw7fXMgFPnHcSZgOo3XdinHvmnDUeMf5R4wA==",
+ "dev": true,
+ "requires": {
+ "domelementtype": "1.3.0"
+ }
+ },
+ "htmlparser2": {
+ "version": "3.9.2",
+ "resolved": "https://registry.npmjs.org/htmlparser2/-/htmlparser2-3.9.2.tgz",
+ "integrity": "sha1-G9+HrMoPP55T+k/M6w9LTLsAszg=",
+ "dev": true,
+ "requires": {
+ "domelementtype": "1.3.0",
+ "domhandler": "2.4.2",
+ "domutils": "1.5.1",
+ "entities": "1.1.1",
+ "inherits": "2.0.3",
+ "readable-stream": "2.3.6"
+ }
+ },
+ "parse5": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/parse5/-/parse5-3.0.3.tgz",
+ "integrity": "sha512-rgO9Zg5LLLkfJF9E6CCmXlSE4UVceloys8JrFqCcHloC3usd/kJCyPDwH2SOlzix2j3xaP9sUX3e8+kvkuleAA==",
+ "dev": true,
+ "requires": {
+ "@types/node": "8.9.5"
+ }
+ }
+ }
+ },
+ "chokidar": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.0.4.tgz",
+ "integrity": "sha512-z9n7yt9rOvIJrMhvDtDictKrkFHeihkNl6uWMmZlmL6tJtX9Cs+87oK+teBx+JIgzvbX3yZHT3eF8vpbDxHJXQ==",
+ "dev": true,
+ "requires": {
+ "anymatch": "2.0.0",
+ "async-each": "1.0.1",
+ "braces": "2.3.2",
+ "fsevents": "1.2.4",
+ "glob-parent": "3.1.0",
+ "inherits": "2.0.3",
+ "is-binary-path": "1.0.1",
+ "is-glob": "4.0.0",
+ "lodash.debounce": "4.0.8",
+ "normalize-path": "2.1.1",
+ "path-is-absolute": "1.0.1",
+ "readdirp": "2.1.0",
+ "upath": "1.1.0"
+ }
+ },
+ "chownr": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/chownr/-/chownr-1.0.1.tgz",
+ "integrity": "sha1-4qdQQqlVGQi+vSW4Uj1fl2nXkYE=",
+ "dev": true
+ },
+ "chrome-trace-event": {
+ "version": "0.1.3",
+ "resolved": "https://registry.npmjs.org/chrome-trace-event/-/chrome-trace-event-0.1.3.tgz",
+ "integrity": "sha512-sjndyZHrrWiu4RY7AkHgjn80GfAM2ZSzUkZLV/Js59Ldmh6JDThf0SUmOHU53rFu2rVxxfCzJ30Ukcfch3Gb/A==",
+ "dev": true
+ },
+ "ci-info": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/ci-info/-/ci-info-1.4.0.tgz",
+ "integrity": "sha512-Oqmw2pVfCl8sCL+1QgMywPfdxPJPkC51y4usw0iiE2S9qnEOAqXy8bwl1CpMpnoU39g4iKJTz6QZj+28FvOnjQ==",
+ "dev": true
+ },
+ "cipher-base": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/cipher-base/-/cipher-base-1.0.4.tgz",
+ "integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3",
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "circular-dependency-plugin": {
+ "version": "5.0.2",
+ "resolved": "https://registry.npmjs.org/circular-dependency-plugin/-/circular-dependency-plugin-5.0.2.tgz",
+ "integrity": "sha512-oC7/DVAyfcY3UWKm0sN/oVoDedQDQiw/vIiAnuTWTpE5s0zWf7l3WY417Xw/Fbi/QbAjctAkxgMiS9P0s3zkmA==",
+ "dev": true
+ },
+ "class-utils": {
+ "version": "0.3.6",
+ "resolved": "https://registry.npmjs.org/class-utils/-/class-utils-0.3.6.tgz",
+ "integrity": "sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==",
+ "dev": true,
+ "requires": {
+ "arr-union": "3.1.0",
+ "define-property": "0.2.5",
+ "isobject": "3.0.1",
+ "static-extend": "0.1.2"
+ },
+ "dependencies": {
+ "define-property": {
+ "version": "0.2.5",
+ "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
+ "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
+ "dev": true,
+ "requires": {
+ "is-descriptor": "0.1.6"
+ }
+ }
+ }
+ },
+ "clean-css": {
+ "version": "4.2.1",
+ "resolved": "https://registry.npmjs.org/clean-css/-/clean-css-4.2.1.tgz",
+ "integrity": "sha512-4ZxI6dy4lrY6FHzfiy1aEOXgu4LIsW2MhwG0VBKdcoGoH/XLFgaHSdLTGr4O8Be6A8r3MOphEiI8Gc1n0ecf3g==",
+ "dev": true,
+ "requires": {
+ "source-map": "0.6.1"
+ },
+ "dependencies": {
+ "source-map": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+ "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+ "dev": true
+ }
+ }
+ },
+ "cli-boxes": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/cli-boxes/-/cli-boxes-1.0.0.tgz",
+ "integrity": "sha1-T6kXw+WclKAEzWH47lCdplFocUM=",
+ "dev": true
+ },
+ "cliui": {
+ "version": "3.2.0",
+ "resolved": "https://registry.npmjs.org/cliui/-/cliui-3.2.0.tgz",
+ "integrity": "sha1-EgYBU3qRbSmUD5NNo7SNWFo5IT0=",
+ "dev": true,
+ "requires": {
+ "string-width": "1.0.2",
+ "strip-ansi": "3.0.1",
+ "wrap-ansi": "2.1.0"
+ }
+ },
+ "clone": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/clone/-/clone-2.1.2.tgz",
+ "integrity": "sha1-G39Ln1kfHo+DZwQBYANFoCiHQ18=",
+ "dev": true
+ },
+ "clone-deep": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/clone-deep/-/clone-deep-2.0.2.tgz",
+ "integrity": "sha512-SZegPTKjCgpQH63E+eN6mVEEPdQBOUzjyJm5Pora4lrwWRFS8I0QAxV/KD6vV/i0WuijHZWQC1fMsPEdxfdVCQ==",
+ "dev": true,
+ "requires": {
+ "for-own": "1.0.0",
+ "is-plain-object": "2.0.4",
+ "kind-of": "6.0.2",
+ "shallow-clone": "1.0.0"
+ }
+ },
+ "co": {
+ "version": "4.6.0",
+ "resolved": "https://registry.npmjs.org/co/-/co-4.6.0.tgz",
+ "integrity": "sha1-bqa989hTrlTMuOR7+gvz+QMfsYQ=",
+ "dev": true
+ },
+ "code-block-writer": {
+ "version": "7.2.1",
+ "resolved": "https://registry.npmjs.org/code-block-writer/-/code-block-writer-7.2.1.tgz",
+ "integrity": "sha512-SYGE48EEUA1yeu7dcd93McZIc4+eLjMiw9uC9+Q3TMe8GibkgjVVLLz43kfTCSOA6wAAZKjdACEVZmcdW6m8ag==",
+ "dev": true
+ },
+ "code-point-at": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/code-point-at/-/code-point-at-1.1.0.tgz",
+ "integrity": "sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=",
+ "dev": true
+ },
+ "codelyzer": {
+ "version": "4.2.1",
+ "resolved": "https://registry.npmjs.org/codelyzer/-/codelyzer-4.2.1.tgz",
+ "integrity": "sha512-CKwfgpfkqi9dyzy4s6ELaxJ54QgJ6A8iTSsM4bzHbLuTpbKncvNc3DUlCvpnkHBhK47gEf4qFsWoYqLrJPhy6g==",
+ "dev": true,
+ "requires": {
+ "app-root-path": "2.1.0",
+ "css-selector-tokenizer": "0.7.0",
+ "cssauron": "1.4.0",
+ "semver-dsl": "1.0.1",
+ "source-map": "0.5.7",
+ "sprintf-js": "1.0.3"
+ }
+ },
+ "collection-visit": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/collection-visit/-/collection-visit-1.0.0.tgz",
+ "integrity": "sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=",
+ "dev": true,
+ "requires": {
+ "map-visit": "1.0.0",
+ "object-visit": "1.0.1"
+ }
+ },
+ "color-convert": {
+ "version": "1.9.3",
+ "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz",
+ "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==",
+ "dev": true,
+ "requires": {
+ "color-name": "1.1.3"
+ }
+ },
+ "color-name": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz",
+ "integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=",
+ "dev": true
+ },
+ "color-support": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/color-support/-/color-support-1.1.3.tgz",
+ "integrity": "sha512-qiBjkpbMLO/HL68y+lh4q0/O1MZFj2RX6X/KmMa3+gJD3z+WwI1ZzDHysvqHGS3mP6mznPckpXmw1nI9cJjyRg==",
+ "dev": true
+ },
+ "colors": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/colors/-/colors-1.1.2.tgz",
+ "integrity": "sha1-FopHAXVran9RoSzgyXv6KMCE7WM=",
+ "dev": true
+ },
+ "combine-lists": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/combine-lists/-/combine-lists-1.0.1.tgz",
+ "integrity": "sha1-RYwH4J4NkA/Ci3Cj/sLazR0st/Y=",
+ "dev": true,
+ "requires": {
+ "lodash": "4.17.10"
+ }
+ },
+ "combined-stream": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.6.tgz",
+ "integrity": "sha1-cj599ugBrFYTETp+RFqbactjKBg=",
+ "dev": true,
+ "requires": {
+ "delayed-stream": "1.0.0"
+ }
+ },
+ "commander": {
+ "version": "2.17.1",
+ "resolved": "https://registry.npmjs.org/commander/-/commander-2.17.1.tgz",
+ "integrity": "sha512-wPMUt6FnH2yzG95SA6mzjQOEKUU3aLaDEmzs1ti+1E9h+CsrZghRlqEM/EJ4KscsQVG8uNN4uVreUeT8+drlgg=="
+ },
+ "commondir": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/commondir/-/commondir-1.0.1.tgz",
+ "integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs=",
+ "dev": true
+ },
+ "component-bind": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/component-bind/-/component-bind-1.0.0.tgz",
+ "integrity": "sha1-AMYIq33Nk4l8AAllGx06jh5zu9E=",
+ "dev": true
+ },
+ "component-emitter": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.2.1.tgz",
+ "integrity": "sha1-E3kY1teCg/ffemt8WmPhQOaUJeY=",
+ "dev": true
+ },
+ "component-inherit": {
+ "version": "0.0.3",
+ "resolved": "https://registry.npmjs.org/component-inherit/-/component-inherit-0.0.3.tgz",
+ "integrity": "sha1-ZF/ErfWLcrZJ1crmUTVhnbJv8UM=",
+ "dev": true
+ },
+ "compressible": {
+ "version": "2.0.14",
+ "resolved": "https://registry.npmjs.org/compressible/-/compressible-2.0.14.tgz",
+ "integrity": "sha1-MmxfUH+7BV9UEWeCuWmoG2einac=",
+ "dev": true,
+ "requires": {
+ "mime-db": "1.36.0"
+ }
+ },
+ "compression": {
+ "version": "1.7.3",
+ "resolved": "https://registry.npmjs.org/compression/-/compression-1.7.3.tgz",
+ "integrity": "sha512-HSjyBG5N1Nnz7tF2+O7A9XUhyjru71/fwgNb7oIsEVHR0WShfs2tIS/EySLgiTe98aOK18YDlMXpzjCXY/n9mg==",
+ "dev": true,
+ "requires": {
+ "accepts": "1.3.5",
+ "bytes": "3.0.0",
+ "compressible": "2.0.14",
+ "debug": "2.6.9",
+ "on-headers": "1.0.1",
+ "safe-buffer": "5.1.2",
+ "vary": "1.1.2"
+ }
+ },
+ "concat-map": {
+ "version": "0.0.1",
+ "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz",
+ "integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=",
+ "dev": true
+ },
+ "concat-stream": {
+ "version": "1.6.2",
+ "resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-1.6.2.tgz",
+ "integrity": "sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==",
+ "dev": true,
+ "requires": {
+ "buffer-from": "1.1.1",
+ "inherits": "2.0.3",
+ "readable-stream": "2.3.6",
+ "typedarray": "0.0.6"
+ }
+ },
+ "configstore": {
+ "version": "3.1.2",
+ "resolved": "https://registry.npmjs.org/configstore/-/configstore-3.1.2.tgz",
+ "integrity": "sha512-vtv5HtGjcYUgFrXc6Kx747B83MRRVS5R1VTEQoXvuP+kMI+if6uywV0nDGoiydJRy4yk7h9od5Og0kxx4zUXmw==",
+ "dev": true,
+ "requires": {
+ "dot-prop": "4.2.0",
+ "graceful-fs": "4.1.11",
+ "make-dir": "1.3.0",
+ "unique-string": "1.0.0",
+ "write-file-atomic": "2.3.0",
+ "xdg-basedir": "3.0.0"
+ }
+ },
+ "connect": {
+ "version": "3.6.6",
+ "resolved": "https://registry.npmjs.org/connect/-/connect-3.6.6.tgz",
+ "integrity": "sha1-Ce/2xVr3I24TcTWnJXSFi2eG9SQ=",
+ "dev": true,
+ "requires": {
+ "debug": "2.6.9",
+ "finalhandler": "1.1.0",
+ "parseurl": "1.3.2",
+ "utils-merge": "1.0.1"
+ },
+ "dependencies": {
+ "finalhandler": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.0.tgz",
+ "integrity": "sha1-zgtoVbRYU+eRsvzGgARtiCU91/U=",
+ "dev": true,
+ "requires": {
+ "debug": "2.6.9",
+ "encodeurl": "1.0.2",
+ "escape-html": "1.0.3",
+ "on-finished": "2.3.0",
+ "parseurl": "1.3.2",
+ "statuses": "1.3.1",
+ "unpipe": "1.0.0"
+ }
+ },
+ "statuses": {
+ "version": "1.3.1",
+ "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.3.1.tgz",
+ "integrity": "sha1-+vUbnrdKrvOzrPStX2Gr8ky3uT4=",
+ "dev": true
+ }
+ }
+ },
+ "connect-history-api-fallback": {
+ "version": "1.5.0",
+ "resolved": "https://registry.npmjs.org/connect-history-api-fallback/-/connect-history-api-fallback-1.5.0.tgz",
+ "integrity": "sha1-sGhzk0vF40T+9hGhlqb6rgruAVo=",
+ "dev": true
+ },
+ "console-browserify": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.1.0.tgz",
+ "integrity": "sha1-8CQcRXMKn8YyOyBtvzjtx0HQuxA=",
+ "dev": true,
+ "requires": {
+ "date-now": "0.1.4"
+ }
+ },
+ "console-control-strings": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz",
+ "integrity": "sha1-PXz0Rk22RG6mRL9LOVB/mFEAjo4=",
+ "dev": true
+ },
+ "constants-browserify": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/constants-browserify/-/constants-browserify-1.0.0.tgz",
+ "integrity": "sha1-wguW2MYXdIqvHBYCF2DNJ/y4y3U=",
+ "dev": true
+ },
+ "content-disposition": {
+ "version": "0.5.2",
+ "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.2.tgz",
+ "integrity": "sha1-DPaLud318r55YcOoUXjLhdunjLQ=",
+ "dev": true
+ },
+ "content-type": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.4.tgz",
+ "integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==",
+ "dev": true
+ },
+ "convert-source-map": {
+ "version": "1.6.0",
+ "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.6.0.tgz",
+ "integrity": "sha512-eFu7XigvxdZ1ETfbgPBohgyQ/Z++C0eEhTor0qRwBw9unw+L0/6V8wkSuGgzdThkiS5lSpdptOQPD8Ak40a+7A==",
+ "dev": true,
+ "requires": {
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "cookie": {
+ "version": "0.3.1",
+ "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.3.1.tgz",
+ "integrity": "sha1-5+Ch+e9DtMi6klxcWpboBtFoc7s=",
+ "dev": true
+ },
+ "cookie-signature": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz",
+ "integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=",
+ "dev": true
+ },
+ "copy-concurrently": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/copy-concurrently/-/copy-concurrently-1.0.5.tgz",
+ "integrity": "sha512-f2domd9fsVDFtaFcbaRZuYXwtdmnzqbADSwhSWYxYB/Q8zsdUUFMXVRwXGDMWmbEzAn1kdRrtI1T/KTFOL4X2A==",
+ "dev": true,
+ "requires": {
+ "aproba": "1.2.0",
+ "fs-write-stream-atomic": "1.0.10",
+ "iferr": "0.1.5",
+ "mkdirp": "0.5.1",
+ "rimraf": "2.6.2",
+ "run-queue": "1.0.3"
+ }
+ },
+ "copy-descriptor": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/copy-descriptor/-/copy-descriptor-0.1.1.tgz",
+ "integrity": "sha1-Z29us8OZl8LuGsOpJP1hJHSPV40=",
+ "dev": true
+ },
+ "copy-webpack-plugin": {
+ "version": "4.5.2",
+ "resolved": "https://registry.npmjs.org/copy-webpack-plugin/-/copy-webpack-plugin-4.5.2.tgz",
+ "integrity": "sha512-zmC33E8FFSq3AbflTvqvPvBo621H36Afsxlui91d+QyZxPIuXghfnTsa1CuqiAaCPgJoSUWfTFbKJnadZpKEbQ==",
+ "dev": true,
+ "requires": {
+ "cacache": "10.0.4",
+ "find-cache-dir": "1.0.0",
+ "globby": "7.1.1",
+ "is-glob": "4.0.0",
+ "loader-utils": "1.1.0",
+ "minimatch": "3.0.4",
+ "p-limit": "1.3.0",
+ "serialize-javascript": "1.5.0"
+ }
+ },
+ "core-js": {
+ "version": "2.5.7",
+ "resolved": "https://registry.npmjs.org/core-js/-/core-js-2.5.7.tgz",
+ "integrity": "sha512-RszJCAxg/PP6uzXVXL6BsxSXx/B05oJAQ2vkJRjyjrEcNVycaqOmNb5OTxZPE3xa5gwZduqza6L9JOCenh/Ecw=="
+ },
+ "core-util-is": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz",
+ "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=",
+ "dev": true
+ },
+ "cors": {
+ "version": "2.8.4",
+ "resolved": "https://registry.npmjs.org/cors/-/cors-2.8.4.tgz",
+ "integrity": "sha1-K9OB8usgECAQXNUOpZ2mMJBpRoY=",
+ "dev": true,
+ "requires": {
+ "object-assign": "4.1.1",
+ "vary": "1.1.2"
+ }
+ },
+ "cosmiconfig": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/cosmiconfig/-/cosmiconfig-4.0.0.tgz",
+ "integrity": "sha512-6e5vDdrXZD+t5v0L8CrurPeybg4Fmf+FCSYxXKYVAqLUtyCSbuyqE059d0kDthTNRzKVjL7QMgNpEUlsoYH3iQ==",
+ "dev": true,
+ "requires": {
+ "is-directory": "0.3.1",
+ "js-yaml": "3.12.0",
+ "parse-json": "4.0.0",
+ "require-from-string": "2.0.2"
+ },
+ "dependencies": {
+ "parse-json": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz",
+ "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=",
+ "dev": true,
+ "requires": {
+ "error-ex": "1.3.2",
+ "json-parse-better-errors": "1.0.2"
+ }
+ }
+ }
+ },
+ "create-ecdh": {
+ "version": "4.0.3",
+ "resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.3.tgz",
+ "integrity": "sha512-GbEHQPMOswGpKXM9kCWVrremUcBmjteUaQ01T9rkKCPDXfUHX0IoP9LpHYo2NPFampa4e+/pFDc3jQdxrxQLaw==",
+ "dev": true,
+ "requires": {
+ "bn.js": "4.11.8",
+ "elliptic": "6.4.1"
+ }
+ },
+ "create-error-class": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/create-error-class/-/create-error-class-3.0.2.tgz",
+ "integrity": "sha1-Br56vvlHo/FKMP1hBnHUAbyot7Y=",
+ "dev": true,
+ "requires": {
+ "capture-stack-trace": "1.0.1"
+ }
+ },
+ "create-hash": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz",
+ "integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==",
+ "dev": true,
+ "requires": {
+ "cipher-base": "1.0.4",
+ "inherits": "2.0.3",
+ "md5.js": "1.3.4",
+ "ripemd160": "2.0.2",
+ "sha.js": "2.4.11"
+ }
+ },
+ "create-hmac": {
+ "version": "1.1.7",
+ "resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz",
+ "integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==",
+ "dev": true,
+ "requires": {
+ "cipher-base": "1.0.4",
+ "create-hash": "1.2.0",
+ "inherits": "2.0.3",
+ "ripemd160": "2.0.2",
+ "safe-buffer": "5.1.2",
+ "sha.js": "2.4.11"
+ }
+ },
+ "cross-spawn": {
+ "version": "3.0.1",
+ "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-3.0.1.tgz",
+ "integrity": "sha1-ElYDfsufDF9549bvE14wdwGEuYI=",
+ "dev": true,
+ "requires": {
+ "lru-cache": "4.1.3",
+ "which": "1.3.1"
+ }
+ },
+ "crypto-browserify": {
+ "version": "3.12.0",
+ "resolved": "https://registry.npmjs.org/crypto-browserify/-/crypto-browserify-3.12.0.tgz",
+ "integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==",
+ "dev": true,
+ "requires": {
+ "browserify-cipher": "1.0.1",
+ "browserify-sign": "4.0.4",
+ "create-ecdh": "4.0.3",
+ "create-hash": "1.2.0",
+ "create-hmac": "1.1.7",
+ "diffie-hellman": "5.0.3",
+ "inherits": "2.0.3",
+ "pbkdf2": "3.0.16",
+ "public-encrypt": "4.0.2",
+ "randombytes": "2.0.6",
+ "randomfill": "1.0.4"
+ }
+ },
+ "crypto-random-string": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/crypto-random-string/-/crypto-random-string-1.0.0.tgz",
+ "integrity": "sha1-ojD2T1aDEOFJgAmUB5DsmVRbyn4=",
+ "dev": true
+ },
+ "csextends": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/csextends/-/csextends-1.2.0.tgz",
+ "integrity": "sha512-S/8k1bDTJIwuGgQYmsRoE+8P+ohV32WhQ0l4zqrc0XDdxOhjQQD7/wTZwCzoZX53jSX3V/qwjT+OkPTxWQcmjg==",
+ "dev": true
+ },
+ "css-parse": {
+ "version": "1.7.0",
+ "resolved": "https://registry.npmjs.org/css-parse/-/css-parse-1.7.0.tgz",
+ "integrity": "sha1-Mh9s9zeCpv91ERE5D8BeLGV9jJs=",
+ "dev": true
+ },
+ "css-select": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/css-select/-/css-select-1.2.0.tgz",
+ "integrity": "sha1-KzoRBTnFNV8c2NMUYj6HCxIeyFg=",
+ "dev": true,
+ "requires": {
+ "boolbase": "1.0.0",
+ "css-what": "2.1.0",
+ "domutils": "1.5.1",
+ "nth-check": "1.0.1"
+ }
+ },
+ "css-selector-tokenizer": {
+ "version": "0.7.0",
+ "resolved": "https://registry.npmjs.org/css-selector-tokenizer/-/css-selector-tokenizer-0.7.0.tgz",
+ "integrity": "sha1-5piEdK6MlTR3v15+/s/OzNnPTIY=",
+ "dev": true,
+ "requires": {
+ "cssesc": "0.1.0",
+ "fastparse": "1.1.1",
+ "regexpu-core": "1.0.0"
+ }
+ },
+ "css-what": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/css-what/-/css-what-2.1.0.tgz",
+ "integrity": "sha1-lGfQMsOM+u+58teVASUwYvh/ob0=",
+ "dev": true
+ },
+ "cssauron": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/cssauron/-/cssauron-1.4.0.tgz",
+ "integrity": "sha1-pmAt/34EqDBtwNuaVR6S6LVmKtg=",
+ "dev": true,
+ "requires": {
+ "through": "2.3.8"
+ }
+ },
+ "cssesc": {
+ "version": "0.1.0",
+ "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-0.1.0.tgz",
+ "integrity": "sha1-yBSQPkViM3GgR3tAEJqq++6t27Q=",
+ "dev": true
+ },
+ "cuint": {
+ "version": "0.2.2",
+ "resolved": "https://registry.npmjs.org/cuint/-/cuint-0.2.2.tgz",
+ "integrity": "sha1-QICG1AlVDCYxFVYZ6fp7ytw7mRs=",
+ "dev": true
+ },
+ "currently-unhandled": {
+ "version": "0.4.1",
+ "resolved": "https://registry.npmjs.org/currently-unhandled/-/currently-unhandled-0.4.1.tgz",
+ "integrity": "sha1-mI3zP+qxke95mmE2nddsF635V+o=",
+ "dev": true,
+ "requires": {
+ "array-find-index": "1.0.2"
+ }
+ },
+ "custom-event": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/custom-event/-/custom-event-1.0.1.tgz",
+ "integrity": "sha1-XQKkaFCt8bSjF5RqOSj8y1v9BCU=",
+ "dev": true
+ },
+ "cyclist": {
+ "version": "0.2.2",
+ "resolved": "https://registry.npmjs.org/cyclist/-/cyclist-0.2.2.tgz",
+ "integrity": "sha1-GzN5LhHpFKL9bW7WRHRkRE5fpkA=",
+ "dev": true
+ },
+ "d3": {
+ "version": "5.7.0",
+ "resolved": "https://registry.npmjs.org/d3/-/d3-5.7.0.tgz",
+ "integrity": "sha512-8KEIfx+dFm8PlbJN9PI0suazrZ41QcaAufsKE9PRcqYPWLngHIyWJZX96n6IQKePGgeSu0l7rtlueSSNq8Zc3g==",
+ "requires": {
+ "d3-array": "1.2.4",
+ "d3-axis": "1.0.12",
+ "d3-brush": "1.0.6",
+ "d3-chord": "1.0.6",
+ "d3-collection": "1.0.7",
+ "d3-color": "1.2.3",
+ "d3-contour": "1.3.2",
+ "d3-dispatch": "1.0.5",
+ "d3-drag": "1.2.3",
+ "d3-dsv": "1.0.10",
+ "d3-ease": "1.0.5",
+ "d3-fetch": "1.1.2",
+ "d3-force": "1.1.2",
+ "d3-format": "1.3.2",
+ "d3-geo": "1.11.1",
+ "d3-hierarchy": "1.1.8",
+ "d3-interpolate": "1.3.2",
+ "d3-path": "1.0.7",
+ "d3-polygon": "1.0.5",
+ "d3-quadtree": "1.0.5",
+ "d3-random": "1.1.2",
+ "d3-scale": "2.1.2",
+ "d3-scale-chromatic": "1.3.3",
+ "d3-selection": "1.3.2",
+ "d3-shape": "1.2.2",
+ "d3-time": "1.0.10",
+ "d3-time-format": "2.1.3",
+ "d3-timer": "1.0.9",
+ "d3-transition": "1.1.3",
+ "d3-voronoi": "1.1.4",
+ "d3-zoom": "1.7.3"
+ }
+ },
+ "d3-array": {
+ "version": "1.2.4",
+ "resolved": "https://registry.npmjs.org/d3-array/-/d3-array-1.2.4.tgz",
+ "integrity": "sha512-KHW6M86R+FUPYGb3R5XiYjXPq7VzwxZ22buHhAEVG5ztoEcZZMLov530mmccaqA1GghZArjQV46fuc8kUqhhHw=="
+ },
+ "d3-axis": {
+ "version": "1.0.12",
+ "resolved": "https://registry.npmjs.org/d3-axis/-/d3-axis-1.0.12.tgz",
+ "integrity": "sha512-ejINPfPSNdGFKEOAtnBtdkpr24c4d4jsei6Lg98mxf424ivoDP2956/5HDpIAtmHo85lqT4pruy+zEgvRUBqaQ=="
+ },
+ "d3-brush": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/d3-brush/-/d3-brush-1.0.6.tgz",
+ "integrity": "sha512-lGSiF5SoSqO5/mYGD5FAeGKKS62JdA1EV7HPrU2b5rTX4qEJJtpjaGLJngjnkewQy7UnGstnFd3168wpf5z76w==",
+ "requires": {
+ "d3-dispatch": "1.0.5",
+ "d3-drag": "1.2.3",
+ "d3-interpolate": "1.3.2",
+ "d3-selection": "1.3.2",
+ "d3-transition": "1.1.3"
+ }
+ },
+ "d3-chord": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/d3-chord/-/d3-chord-1.0.6.tgz",
+ "integrity": "sha512-JXA2Dro1Fxw9rJe33Uv+Ckr5IrAa74TlfDEhE/jfLOaXegMQFQTAgAw9WnZL8+HxVBRXaRGCkrNU7pJeylRIuA==",
+ "requires": {
+ "d3-array": "1.2.4",
+ "d3-path": "1.0.7"
+ }
+ },
+ "d3-collection": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/d3-collection/-/d3-collection-1.0.7.tgz",
+ "integrity": "sha512-ii0/r5f4sjKNTfh84Di+DpztYwqKhEyUlKoPrzUFfeSkWxjW49xU2QzO9qrPrNkpdI0XJkfzvmTu8V2Zylln6A=="
+ },
+ "d3-color": {
+ "version": "1.2.3",
+ "resolved": "https://registry.npmjs.org/d3-color/-/d3-color-1.2.3.tgz",
+ "integrity": "sha512-x37qq3ChOTLd26hnps36lexMRhNXEtVxZ4B25rL0DVdDsGQIJGB18S7y9XDwlDD6MD/ZBzITCf4JjGMM10TZkw=="
+ },
+ "d3-contour": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/d3-contour/-/d3-contour-1.3.2.tgz",
+ "integrity": "sha512-hoPp4K/rJCu0ladiH6zmJUEz6+u3lgR+GSm/QdM2BBvDraU39Vr7YdDCicJcxP1z8i9B/2dJLgDC1NcvlF8WCg==",
+ "requires": {
+ "d3-array": "1.2.4"
+ }
+ },
+ "d3-dispatch": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/d3-dispatch/-/d3-dispatch-1.0.5.tgz",
+ "integrity": "sha512-vwKx+lAqB1UuCeklr6Jh1bvC4SZgbSqbkGBLClItFBIYH4vqDJCA7qfoy14lXmJdnBOdxndAMxjCbImJYW7e6g=="
+ },
+ "d3-drag": {
+ "version": "1.2.3",
+ "resolved": "https://registry.npmjs.org/d3-drag/-/d3-drag-1.2.3.tgz",
+ "integrity": "sha512-8S3HWCAg+ilzjJsNtWW1Mutl74Nmzhb9yU6igspilaJzeZVFktmY6oO9xOh5TDk+BM2KrNFjttZNoJJmDnkjkg==",
+ "requires": {
+ "d3-dispatch": "1.0.5",
+ "d3-selection": "1.3.2"
+ }
+ },
+ "d3-dsv": {
+ "version": "1.0.10",
+ "resolved": "https://registry.npmjs.org/d3-dsv/-/d3-dsv-1.0.10.tgz",
+ "integrity": "sha512-vqklfpxmtO2ZER3fq/B33R/BIz3A1PV0FaZRuFM8w6jLo7sUX1BZDh73fPlr0s327rzq4H6EN1q9U+eCBCSN8g==",
+ "requires": {
+ "commander": "2.17.1",
+ "iconv-lite": "0.4.19",
+ "rw": "1.3.3"
+ }
+ },
+ "d3-ease": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/d3-ease/-/d3-ease-1.0.5.tgz",
+ "integrity": "sha512-Ct1O//ly5y5lFM9YTdu+ygq7LleSgSE4oj7vUt9tPLHUi8VCV7QoizGpdWRWAwCO9LdYzIrQDg97+hGVdsSGPQ=="
+ },
+ "d3-fetch": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/d3-fetch/-/d3-fetch-1.1.2.tgz",
+ "integrity": "sha512-S2loaQCV/ZeyTyIF2oP8D1K9Z4QizUzW7cWeAOAS4U88qOt3Ucf6GsmgthuYSdyB2HyEm4CeGvkQxWsmInsIVA==",
+ "requires": {
+ "d3-dsv": "1.0.10"
+ }
+ },
+ "d3-force": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/d3-force/-/d3-force-1.1.2.tgz",
+ "integrity": "sha512-p1vcHAUF1qH7yR+e8ip7Bs61AHjLeKkIn8Z2gzwU2lwEf2wkSpWdjXG0axudTHsVFnYGlMkFaEsVy2l8tAg1Gw==",
+ "requires": {
+ "d3-collection": "1.0.7",
+ "d3-dispatch": "1.0.5",
+ "d3-quadtree": "1.0.5",
+ "d3-timer": "1.0.9"
+ }
+ },
+ "d3-format": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/d3-format/-/d3-format-1.3.2.tgz",
+ "integrity": "sha512-Z18Dprj96ExragQ0DeGi+SYPQ7pPfRMtUXtsg/ChVIKNBCzjO8XYJvRTC1usblx52lqge56V5ect+frYTQc8WQ=="
+ },
+ "d3-geo": {
+ "version": "1.11.1",
+ "resolved": "https://registry.npmjs.org/d3-geo/-/d3-geo-1.11.1.tgz",
+ "integrity": "sha512-GsG7x9G9sykseLviOVSJ3h5yjw0ItLopOtuDQKUt1TRklEegCw5WAmnIpYYiCkSH/QgUMleAeE2xZK38Qb+1+Q==",
+ "requires": {
+ "d3-array": "1.2.4"
+ }
+ },
+ "d3-hierarchy": {
+ "version": "1.1.8",
+ "resolved": "https://registry.npmjs.org/d3-hierarchy/-/d3-hierarchy-1.1.8.tgz",
+ "integrity": "sha512-L+GHMSZNwTpiq4rt9GEsNcpLa4M96lXMR8M/nMG9p5hBE0jy6C+3hWtyZMenPQdwla249iJy7Nx0uKt3n+u9+w=="
+ },
+ "d3-interpolate": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/d3-interpolate/-/d3-interpolate-1.3.2.tgz",
+ "integrity": "sha512-NlNKGopqaz9qM1PXh9gBF1KSCVh+jSFErrSlD/4hybwoNX/gt1d8CDbDW+3i+5UOHhjC6s6nMvRxcuoMVNgL2w==",
+ "requires": {
+ "d3-color": "1.2.3"
+ }
+ },
+ "d3-path": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/d3-path/-/d3-path-1.0.7.tgz",
+ "integrity": "sha512-q0cW1RpvA5c5ma2rch62mX8AYaiLX0+bdaSM2wxSU9tXjU4DNvkx9qiUvjkuWCj3p22UO/hlPivujqMiR9PDzA=="
+ },
+ "d3-polygon": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/d3-polygon/-/d3-polygon-1.0.5.tgz",
+ "integrity": "sha512-RHhh1ZUJZfhgoqzWWuRhzQJvO7LavchhitSTHGu9oj6uuLFzYZVeBzaWTQ2qSO6bz2w55RMoOCf0MsLCDB6e0w=="
+ },
+ "d3-quadtree": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/d3-quadtree/-/d3-quadtree-1.0.5.tgz",
+ "integrity": "sha512-U2tjwDFbZ75JRAg8A+cqMvqPg1G3BE7UTJn3h8DHjY/pnsAfWdbJKgyfcy7zKjqGtLAmI0q8aDSeG1TVIKRaHQ=="
+ },
+ "d3-random": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/d3-random/-/d3-random-1.1.2.tgz",
+ "integrity": "sha512-6AK5BNpIFqP+cx/sreKzNjWbwZQCSUatxq+pPRmFIQaWuoD+NrbVWw7YWpHiXpCQ/NanKdtGDuB+VQcZDaEmYQ=="
+ },
+ "d3-scale": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/d3-scale/-/d3-scale-2.1.2.tgz",
+ "integrity": "sha512-bESpd64ylaKzCDzvULcmHKZTlzA/6DGSVwx7QSDj/EnX9cpSevsdiwdHFYI9ouo9tNBbV3v5xztHS2uFeOzh8Q==",
+ "requires": {
+ "d3-array": "1.2.4",
+ "d3-collection": "1.0.7",
+ "d3-format": "1.3.2",
+ "d3-interpolate": "1.3.2",
+ "d3-time": "1.0.10",
+ "d3-time-format": "2.1.3"
+ }
+ },
+ "d3-scale-chromatic": {
+ "version": "1.3.3",
+ "resolved": "https://registry.npmjs.org/d3-scale-chromatic/-/d3-scale-chromatic-1.3.3.tgz",
+ "integrity": "sha512-BWTipif1CimXcYfT02LKjAyItX5gKiwxuPRgr4xM58JwlLocWbjPLI7aMEjkcoOQXMkYsmNsvv3d2yl/OKuHHw==",
+ "requires": {
+ "d3-color": "1.2.3",
+ "d3-interpolate": "1.3.2"
+ }
+ },
+ "d3-selection": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/d3-selection/-/d3-selection-1.3.2.tgz",
+ "integrity": "sha512-OoXdv1nZ7h2aKMVg3kaUFbLLK5jXUFAMLD/Tu5JA96mjf8f2a9ZUESGY+C36t8R1WFeWk/e55hy54Ml2I62CRQ=="
+ },
+ "d3-shape": {
+ "version": "1.2.2",
+ "resolved": "https://registry.npmjs.org/d3-shape/-/d3-shape-1.2.2.tgz",
+ "integrity": "sha512-hUGEozlKecFZ2bOSNt7ENex+4Tk9uc/m0TtTEHBvitCBxUNjhzm5hS2GrrVRD/ae4IylSmxGeqX5tWC2rASMlQ==",
+ "requires": {
+ "d3-path": "1.0.7"
+ }
+ },
+ "d3-time": {
+ "version": "1.0.10",
+ "resolved": "https://registry.npmjs.org/d3-time/-/d3-time-1.0.10.tgz",
+ "integrity": "sha512-hF+NTLCaJHF/JqHN5hE8HVGAXPStEq6/omumPE/SxyHVrR7/qQxusFDo0t0c/44+sCGHthC7yNGFZIEgju0P8g=="
+ },
+ "d3-time-format": {
+ "version": "2.1.3",
+ "resolved": "https://registry.npmjs.org/d3-time-format/-/d3-time-format-2.1.3.tgz",
+ "integrity": "sha512-6k0a2rZryzGm5Ihx+aFMuO1GgelgIz+7HhB4PH4OEndD5q2zGn1mDfRdNrulspOfR6JXkb2sThhDK41CSK85QA==",
+ "requires": {
+ "d3-time": "1.0.10"
+ }
+ },
+ "d3-timer": {
+ "version": "1.0.9",
+ "resolved": "https://registry.npmjs.org/d3-timer/-/d3-timer-1.0.9.tgz",
+ "integrity": "sha512-rT34J5HnQUHhcLvhSB9GjCkN0Ddd5Y8nCwDBG2u6wQEeYxT/Lf51fTFFkldeib/sE/J0clIe0pnCfs6g/lRbyg=="
+ },
+ "d3-transition": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/d3-transition/-/d3-transition-1.1.3.tgz",
+ "integrity": "sha512-tEvo3qOXL6pZ1EzcXxFcPNxC/Ygivu5NoBY6mbzidATAeML86da+JfVIUzon3dNM6UX6zjDx+xbYDmMVtTSjuA==",
+ "requires": {
+ "d3-color": "1.2.3",
+ "d3-dispatch": "1.0.5",
+ "d3-ease": "1.0.5",
+ "d3-interpolate": "1.3.2",
+ "d3-selection": "1.3.2",
+ "d3-timer": "1.0.9"
+ }
+ },
+ "d3-voronoi": {
+ "version": "1.1.4",
+ "resolved": "https://registry.npmjs.org/d3-voronoi/-/d3-voronoi-1.1.4.tgz",
+ "integrity": "sha512-dArJ32hchFsrQ8uMiTBLq256MpnZjeuBtdHpaDlYuQyjU0CVzCJl/BVW+SkszaAeH95D/8gxqAhgx0ouAWAfRg=="
+ },
+ "d3-zoom": {
+ "version": "1.7.3",
+ "resolved": "https://registry.npmjs.org/d3-zoom/-/d3-zoom-1.7.3.tgz",
+ "integrity": "sha512-xEBSwFx5Z9T3/VrwDkMt+mr0HCzv7XjpGURJ8lWmIC8wxe32L39eWHIasEe/e7Ox8MPU4p1hvH8PKN2olLzIBg==",
+ "requires": {
+ "d3-dispatch": "1.0.5",
+ "d3-drag": "1.2.3",
+ "d3-interpolate": "1.3.2",
+ "d3-selection": "1.3.2",
+ "d3-transition": "1.1.3"
+ }
+ },
+ "dashdash": {
+ "version": "1.14.1",
+ "resolved": "https://registry.npmjs.org/dashdash/-/dashdash-1.14.1.tgz",
+ "integrity": "sha1-hTz6D3y+L+1d4gMmuN1YEDX24vA=",
+ "dev": true,
+ "requires": {
+ "assert-plus": "1.0.0"
+ }
+ },
+ "date-now": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/date-now/-/date-now-0.1.4.tgz",
+ "integrity": "sha1-6vQ5/U1ISK105cx9vvIAZyueNFs=",
+ "dev": true
+ },
+ "debug": {
+ "version": "2.6.9",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
+ "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ },
+ "decamelize": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz",
+ "integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=",
+ "dev": true
+ },
+ "decode-uri-component": {
+ "version": "0.2.0",
+ "resolved": "https://registry.npmjs.org/decode-uri-component/-/decode-uri-component-0.2.0.tgz",
+ "integrity": "sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU=",
+ "dev": true
+ },
+ "deep-equal": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/deep-equal/-/deep-equal-1.0.1.tgz",
+ "integrity": "sha1-9dJgKStmDghO/0zbyfCK0yR0SLU=",
+ "dev": true
+ },
+ "deep-extend": {
+ "version": "0.6.0",
+ "resolved": "https://registry.npmjs.org/deep-extend/-/deep-extend-0.6.0.tgz",
+ "integrity": "sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==",
+ "dev": true
+ },
+ "deep-is": {
+ "version": "0.1.3",
+ "resolved": "https://registry.npmjs.org/deep-is/-/deep-is-0.1.3.tgz",
+ "integrity": "sha1-s2nW+128E+7PUk+RsHD+7cNXzzQ=",
+ "dev": true
+ },
+ "default-gateway": {
+ "version": "2.7.2",
+ "resolved": "https://registry.npmjs.org/default-gateway/-/default-gateway-2.7.2.tgz",
+ "integrity": "sha512-lAc4i9QJR0YHSDFdzeBQKfZ1SRDG3hsJNEkrpcZa8QhBfidLAilT60BDEIVUUGqosFp425KOgB3uYqcnQrWafQ==",
+ "dev": true,
+ "requires": {
+ "execa": "0.10.0",
+ "ip-regex": "2.1.0"
+ }
+ },
+ "default-require-extensions": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/default-require-extensions/-/default-require-extensions-1.0.0.tgz",
+ "integrity": "sha1-836hXT4T/9m0N9M+GnW1+5eHTLg=",
+ "dev": true,
+ "requires": {
+ "strip-bom": "2.0.0"
+ }
+ },
+ "define-properties": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz",
+ "integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==",
+ "dev": true,
+ "requires": {
+ "object-keys": "1.0.12"
+ }
+ },
+ "define-property": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/define-property/-/define-property-2.0.2.tgz",
+ "integrity": "sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==",
+ "dev": true,
+ "requires": {
+ "is-descriptor": "1.0.2",
+ "isobject": "3.0.1"
+ },
+ "dependencies": {
+ "is-accessor-descriptor": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
+ "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
+ "dev": true,
+ "requires": {
+ "kind-of": "6.0.2"
+ }
+ },
+ "is-data-descriptor": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
+ "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
+ "dev": true,
+ "requires": {
+ "kind-of": "6.0.2"
+ }
+ },
+ "is-descriptor": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
+ "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
+ "dev": true,
+ "requires": {
+ "is-accessor-descriptor": "1.0.0",
+ "is-data-descriptor": "1.0.0",
+ "kind-of": "6.0.2"
+ }
+ }
+ }
+ },
+ "del": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/del/-/del-3.0.0.tgz",
+ "integrity": "sha1-U+z2mf/LyzljdpGrE7rxYIGXZuU=",
+ "dev": true,
+ "requires": {
+ "globby": "6.1.0",
+ "is-path-cwd": "1.0.0",
+ "is-path-in-cwd": "1.0.1",
+ "p-map": "1.2.0",
+ "pify": "3.0.0",
+ "rimraf": "2.6.2"
+ },
+ "dependencies": {
+ "globby": {
+ "version": "6.1.0",
+ "resolved": "https://registry.npmjs.org/globby/-/globby-6.1.0.tgz",
+ "integrity": "sha1-9abXDoOV4hyFj7BInWTfAkJNUGw=",
+ "dev": true,
+ "requires": {
+ "array-union": "1.0.2",
+ "glob": "7.1.3",
+ "object-assign": "4.1.1",
+ "pify": "2.3.0",
+ "pinkie-promise": "2.0.1"
+ },
+ "dependencies": {
+ "pify": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+ "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=",
+ "dev": true
+ }
+ }
+ }
+ }
+ },
+ "delayed-stream": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz",
+ "integrity": "sha1-3zrhmayt+31ECqrgsp4icrJOxhk=",
+ "dev": true
+ },
+ "delegates": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/delegates/-/delegates-1.0.0.tgz",
+ "integrity": "sha1-hMbhWbgZBP3KWaDvRM2HDTElD5o=",
+ "dev": true
+ },
+ "depd": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz",
+ "integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=",
+ "dev": true
+ },
+ "des.js": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/des.js/-/des.js-1.0.0.tgz",
+ "integrity": "sha1-wHTS4qpqipoH29YfmhXCzYPsjsw=",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3",
+ "minimalistic-assert": "1.0.1"
+ }
+ },
+ "destroy": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz",
+ "integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=",
+ "dev": true
+ },
+ "detect-indent": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/detect-indent/-/detect-indent-4.0.0.tgz",
+ "integrity": "sha1-920GQ1LN9Docts5hnE7jqUdd4gg=",
+ "dev": true,
+ "requires": {
+ "repeating": "2.0.1"
+ }
+ },
+ "detect-node": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/detect-node/-/detect-node-2.0.4.tgz",
+ "integrity": "sha512-ZIzRpLJrOj7jjP2miAtgqIfmzbxa4ZOr5jJc601zklsfEx9oTzmmj2nVpIPRpNlRTIh8lc1kyViIY7BWSGNmKw==",
+ "dev": true
+ },
+ "di": {
+ "version": "0.0.1",
+ "resolved": "https://registry.npmjs.org/di/-/di-0.0.1.tgz",
+ "integrity": "sha1-gGZJMmzqp8qjMG112YXqJ0i6kTw=",
+ "dev": true
+ },
+ "diff": {
+ "version": "3.5.0",
+ "resolved": "https://registry.npmjs.org/diff/-/diff-3.5.0.tgz",
+ "integrity": "sha512-A46qtFgd+g7pDZinpnwiRJtxbC1hpgf0uzP3iG89scHk0AUC7A1TGxf5OiiOUv/JMZR8GOt8hL900hV0bOy5xA==",
+ "dev": true
+ },
+ "diffie-hellman": {
+ "version": "5.0.3",
+ "resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz",
+ "integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==",
+ "dev": true,
+ "requires": {
+ "bn.js": "4.11.8",
+ "miller-rabin": "4.0.1",
+ "randombytes": "2.0.6"
+ }
+ },
+ "dir-glob": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/dir-glob/-/dir-glob-2.0.0.tgz",
+ "integrity": "sha512-37qirFDz8cA5fimp9feo43fSuRo2gHwaIn6dXL8Ber1dGwUosDrGZeCCXq57WnIqE4aQ+u3eQZzsk1yOzhdwag==",
+ "dev": true,
+ "requires": {
+ "arrify": "1.0.1",
+ "path-type": "3.0.0"
+ }
+ },
+ "dns-equal": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/dns-equal/-/dns-equal-1.0.0.tgz",
+ "integrity": "sha1-s55/HabrCnW6nBcySzR1PEfgZU0=",
+ "dev": true
+ },
+ "dns-packet": {
+ "version": "1.3.1",
+ "resolved": "https://registry.npmjs.org/dns-packet/-/dns-packet-1.3.1.tgz",
+ "integrity": "sha512-0UxfQkMhYAUaZI+xrNZOz/as5KgDU0M/fQ9b6SpkyLbk3GEswDi6PADJVaYJradtRVsRIlF1zLyOodbcTCDzUg==",
+ "dev": true,
+ "requires": {
+ "ip": "1.1.5",
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "dns-txt": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/dns-txt/-/dns-txt-2.0.2.tgz",
+ "integrity": "sha1-uR2Ab10nGI5Ks+fRB9iBocxGQrY=",
+ "dev": true,
+ "requires": {
+ "buffer-indexof": "1.1.1"
+ }
+ },
+ "dom-converter": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/dom-converter/-/dom-converter-0.1.4.tgz",
+ "integrity": "sha1-pF71cnuJDJv/5tfIduexnLDhfzs=",
+ "dev": true,
+ "requires": {
+ "utila": "0.3.3"
+ },
+ "dependencies": {
+ "utila": {
+ "version": "0.3.3",
+ "resolved": "https://registry.npmjs.org/utila/-/utila-0.3.3.tgz",
+ "integrity": "sha1-1+jn1+MJEHCSsF+NloiCTWM6QiY=",
+ "dev": true
+ }
+ }
+ },
+ "dom-serialize": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/dom-serialize/-/dom-serialize-2.2.1.tgz",
+ "integrity": "sha1-ViromZ9Evl6jB29UGdzVnrQ6yVs=",
+ "dev": true,
+ "requires": {
+ "custom-event": "1.0.1",
+ "ent": "2.2.0",
+ "extend": "3.0.2",
+ "void-elements": "2.0.1"
+ }
+ },
+ "dom-serializer": {
+ "version": "0.1.0",
+ "resolved": "https://registry.npmjs.org/dom-serializer/-/dom-serializer-0.1.0.tgz",
+ "integrity": "sha1-BzxpdUbOB4DOI75KKOKT5AvDDII=",
+ "dev": true,
+ "requires": {
+ "domelementtype": "1.1.3",
+ "entities": "1.1.1"
+ },
+ "dependencies": {
+ "domelementtype": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/domelementtype/-/domelementtype-1.1.3.tgz",
+ "integrity": "sha1-vSh3PiZCiBrsUVRJJCmcXNgiGFs=",
+ "dev": true
+ }
+ }
+ },
+ "domain-browser": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-1.2.0.tgz",
+ "integrity": "sha512-jnjyiM6eRyZl2H+W8Q/zLMA481hzi0eszAaBUzIVnmYVDBbnLxVNnfu1HgEBvCbL+71FrxMl3E6lpKH7Ge3OXA==",
+ "dev": true
+ },
+ "domelementtype": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/domelementtype/-/domelementtype-1.3.0.tgz",
+ "integrity": "sha1-sXrtguirWeUt2cGbF1bg/BhyBMI=",
+ "dev": true
+ },
+ "domhandler": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/domhandler/-/domhandler-2.1.0.tgz",
+ "integrity": "sha1-0mRvXlf2w7qxHPbLBdPArPdBJZQ=",
+ "dev": true,
+ "requires": {
+ "domelementtype": "1.3.0"
+ }
+ },
+ "domutils": {
+ "version": "1.5.1",
+ "resolved": "https://registry.npmjs.org/domutils/-/domutils-1.5.1.tgz",
+ "integrity": "sha1-3NhIiib1Y9YQeeSMn3t+Mjc2gs8=",
+ "dev": true,
+ "requires": {
+ "dom-serializer": "0.1.0",
+ "domelementtype": "1.3.0"
+ }
+ },
+ "dot": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/dot/-/dot-1.1.2.tgz",
+ "integrity": "sha1-xzdwGfxOVQeYkosrmv62ar+h8vk=",
+ "dev": true
+ },
+ "dot-prop": {
+ "version": "4.2.0",
+ "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-4.2.0.tgz",
+ "integrity": "sha512-tUMXrxlExSW6U2EXiiKGSBVdYgtV8qlHL+C10TsW4PURY/ic+eaysnSkwB4kA/mBlCyy/IKDJ+Lc3wbWeaXtuQ==",
+ "dev": true,
+ "requires": {
+ "is-obj": "1.0.1"
+ }
+ },
+ "duplexer": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/duplexer/-/duplexer-0.1.1.tgz",
+ "integrity": "sha1-rOb/gIwc5mtX0ev5eXessCM0z8E=",
+ "dev": true
+ },
+ "duplexer3": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/duplexer3/-/duplexer3-0.1.4.tgz",
+ "integrity": "sha1-7gHdHKwO08vH/b6jfcCo8c4ALOI=",
+ "dev": true
+ },
+ "duplexify": {
+ "version": "3.6.0",
+ "resolved": "https://registry.npmjs.org/duplexify/-/duplexify-3.6.0.tgz",
+ "integrity": "sha512-fO3Di4tBKJpYTFHAxTU00BcfWMY9w24r/x21a6rZRbsD/ToUgGxsMbiGRmB7uVAXeGKXD9MwiLZa5E97EVgIRQ==",
+ "dev": true,
+ "requires": {
+ "end-of-stream": "1.4.1",
+ "inherits": "2.0.3",
+ "readable-stream": "2.3.6",
+ "stream-shift": "1.0.0"
+ }
+ },
+ "eachr": {
+ "version": "3.2.0",
+ "resolved": "https://registry.npmjs.org/eachr/-/eachr-3.2.0.tgz",
+ "integrity": "sha1-LDXkPqCGUW95l8+At6pk1VpKRIQ=",
+ "dev": true,
+ "requires": {
+ "editions": "1.3.4",
+ "typechecker": "4.5.0"
+ }
+ },
+ "ecc-jsbn": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/ecc-jsbn/-/ecc-jsbn-0.1.2.tgz",
+ "integrity": "sha1-OoOpBOVDUyh4dMVkt1SThoSamMk=",
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "jsbn": "0.1.1",
+ "safer-buffer": "2.1.2"
+ }
+ },
+ "editions": {
+ "version": "1.3.4",
+ "resolved": "https://registry.npmjs.org/editions/-/editions-1.3.4.tgz",
+ "integrity": "sha512-gzao+mxnYDzIysXKMQi/+M1mjy/rjestjg6OPoYTtI+3Izp23oiGZitsl9lPDPiTGXbcSIk1iJWhliSaglxnUg==",
+ "dev": true
+ },
+ "ee-first": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz",
+ "integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=",
+ "dev": true
+ },
+ "ejs": {
+ "version": "2.6.1",
+ "resolved": "https://registry.npmjs.org/ejs/-/ejs-2.6.1.tgz",
+ "integrity": "sha512-0xy4A/twfrRCnkhfk8ErDi5DqdAsAqeGxht4xkCUrsvhhbQNs7E+4jV0CN7+NKIY0aHE72+XvqtBIXzD31ZbXQ==",
+ "dev": true
+ },
+ "electron-to-chromium": {
+ "version": "1.3.63",
+ "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.3.63.tgz",
+ "integrity": "sha512-Ec35NNY040HKuSxMAzBMgz/uUI78amSWpBUD9x2gN7R7gkb/wgAcClngWklcLP0/lm/g0UUYHnC/tUIlZj8UvQ==",
+ "dev": true
+ },
+ "elliptic": {
+ "version": "6.4.1",
+ "resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.4.1.tgz",
+ "integrity": "sha512-BsXLz5sqX8OHcsh7CqBMztyXARmGQ3LWPtGjJi6DiJHq5C/qvi9P3OqgswKSDftbu8+IoI/QDTAm2fFnQ9SZSQ==",
+ "dev": true,
+ "requires": {
+ "bn.js": "4.11.8",
+ "brorand": "1.1.0",
+ "hash.js": "1.1.5",
+ "hmac-drbg": "1.0.1",
+ "inherits": "2.0.3",
+ "minimalistic-assert": "1.0.1",
+ "minimalistic-crypto-utils": "1.0.1"
+ }
+ },
+ "emojis-list": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-2.1.0.tgz",
+ "integrity": "sha1-TapNnbAPmBmIDHn6RXrlsJof04k=",
+ "dev": true
+ },
+ "encodeurl": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz",
+ "integrity": "sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k=",
+ "dev": true
+ },
+ "end-of-stream": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.1.tgz",
+ "integrity": "sha512-1MkrZNvWTKCaigbn+W15elq2BB/L22nqrSY5DKlo3X6+vclJm8Bb5djXJBmEX6fS3+zCh/F4VBK5Z2KxJt4s2Q==",
+ "dev": true,
+ "requires": {
+ "once": "1.4.0"
+ }
+ },
+ "engine.io": {
+ "version": "1.8.3",
+ "resolved": "https://registry.npmjs.org/engine.io/-/engine.io-1.8.3.tgz",
+ "integrity": "sha1-jef5eJXSDTm4X4ju7nd7K9QrE9Q=",
+ "dev": true,
+ "requires": {
+ "accepts": "1.3.3",
+ "base64id": "1.0.0",
+ "cookie": "0.3.1",
+ "debug": "2.3.3",
+ "engine.io-parser": "1.3.2",
+ "ws": "1.1.2"
+ },
+ "dependencies": {
+ "accepts": {
+ "version": "1.3.3",
+ "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.3.tgz",
+ "integrity": "sha1-w8p0NJOGSMPg2cHjKN1otiLChMo=",
+ "dev": true,
+ "requires": {
+ "mime-types": "2.1.20",
+ "negotiator": "0.6.1"
+ }
+ },
+ "debug": {
+ "version": "2.3.3",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.3.3.tgz",
+ "integrity": "sha1-QMRT5n5uE8kB3ewxeviYbNqe/4w=",
+ "dev": true,
+ "requires": {
+ "ms": "0.7.2"
+ }
+ },
+ "ms": {
+ "version": "0.7.2",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
+ "integrity": "sha1-riXPJRKziFodldfwN4aNhDESR2U=",
+ "dev": true
+ }
+ }
+ },
+ "engine.io-client": {
+ "version": "1.8.3",
+ "resolved": "https://registry.npmjs.org/engine.io-client/-/engine.io-client-1.8.3.tgz",
+ "integrity": "sha1-F5jtk0USRkU9TG9jXXogH+lA1as=",
+ "dev": true,
+ "requires": {
+ "component-emitter": "1.2.1",
+ "component-inherit": "0.0.3",
+ "debug": "2.3.3",
+ "engine.io-parser": "1.3.2",
+ "has-cors": "1.1.0",
+ "indexof": "0.0.1",
+ "parsejson": "0.0.3",
+ "parseqs": "0.0.5",
+ "parseuri": "0.0.5",
+ "ws": "1.1.2",
+ "xmlhttprequest-ssl": "1.5.3",
+ "yeast": "0.1.2"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "2.3.3",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.3.3.tgz",
+ "integrity": "sha1-QMRT5n5uE8kB3ewxeviYbNqe/4w=",
+ "dev": true,
+ "requires": {
+ "ms": "0.7.2"
+ }
+ },
+ "ms": {
+ "version": "0.7.2",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
+ "integrity": "sha1-riXPJRKziFodldfwN4aNhDESR2U=",
+ "dev": true
+ }
+ }
+ },
+ "engine.io-parser": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/engine.io-parser/-/engine.io-parser-1.3.2.tgz",
+ "integrity": "sha1-k3sHnwAH0Ik+xW1GyyILjLQ1Igo=",
+ "dev": true,
+ "requires": {
+ "after": "0.8.2",
+ "arraybuffer.slice": "0.0.6",
+ "base64-arraybuffer": "0.1.5",
+ "blob": "0.0.4",
+ "has-binary": "0.1.7",
+ "wtf-8": "1.0.0"
+ }
+ },
+ "enhanced-resolve": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.0.tgz",
+ "integrity": "sha512-F/7vkyTtyc/llOIn8oWclcB25KdRaiPBpZYDgJHgh/UHtpgT2p2eldQgtQnLtUvfMKPKxbRaQM/hHkvLHt1Vng==",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "memory-fs": "0.4.1",
+ "tapable": "1.0.0"
+ }
+ },
+ "ent": {
+ "version": "2.2.0",
+ "resolved": "https://registry.npmjs.org/ent/-/ent-2.2.0.tgz",
+ "integrity": "sha1-6WQhkyWiHQX0RGai9obtbOX13R0=",
+ "dev": true
+ },
+ "entities": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/entities/-/entities-1.1.1.tgz",
+ "integrity": "sha1-blwtClYhtdra7O+AuQ7ftc13cvA=",
+ "dev": true
+ },
+ "errlop": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/errlop/-/errlop-1.0.3.tgz",
+ "integrity": "sha512-5VTnt0yikY4LlQEfCXVSqfE6oLj1HVM4zVSvAKMnoYjL/zrb6nqiLowZS4XlG7xENfyj7lpYWvT+wfSCr6dtlA==",
+ "dev": true,
+ "requires": {
+ "editions": "1.3.4"
+ }
+ },
+ "errno": {
+ "version": "0.1.7",
+ "resolved": "https://registry.npmjs.org/errno/-/errno-0.1.7.tgz",
+ "integrity": "sha512-MfrRBDWzIWifgq6tJj60gkAwtLNb6sQPlcFrSOflcP1aFmmruKQ2wRnze/8V6kgyz7H3FF8Npzv78mZ7XLLflg==",
+ "dev": true,
+ "requires": {
+ "prr": "1.0.1"
+ }
+ },
+ "error-ex": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/error-ex/-/error-ex-1.3.2.tgz",
+ "integrity": "sha512-7dFHNmqeFSEt2ZBsCriorKnn3Z2pj+fd9kmI6QoWw4//DL+icEBfc0U7qJCisqrTsKTjw4fNFy2pW9OqStD84g==",
+ "dev": true,
+ "requires": {
+ "is-arrayish": "0.2.1"
+ }
+ },
+ "es-abstract": {
+ "version": "1.12.0",
+ "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.12.0.tgz",
+ "integrity": "sha512-C8Fx/0jFmV5IPoMOFPA9P9G5NtqW+4cOPit3MIuvR2t7Ag2K15EJTpxnHAYTzL+aYQJIESYeXZmDBfOBE1HcpA==",
+ "dev": true,
+ "requires": {
+ "es-to-primitive": "1.1.1",
+ "function-bind": "1.1.1",
+ "has": "1.0.3",
+ "is-callable": "1.1.4",
+ "is-regex": "1.0.4"
+ }
+ },
+ "es-to-primitive": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.1.1.tgz",
+ "integrity": "sha1-RTVSSKiJeQNLZ5Lhm7gfK3l13Q0=",
+ "dev": true,
+ "requires": {
+ "is-callable": "1.1.4",
+ "is-date-object": "1.0.1",
+ "is-symbol": "1.0.1"
+ }
+ },
+ "es6-promise": {
+ "version": "4.2.4",
+ "resolved": "https://registry.npmjs.org/es6-promise/-/es6-promise-4.2.4.tgz",
+ "integrity": "sha512-/NdNZVJg+uZgtm9eS3O6lrOLYmQag2DjdEXuPaHlZ6RuVqgqaVZfgYCepEIKsLqwdQArOPtC3XzRLqGGfT8KQQ==",
+ "dev": true
+ },
+ "es6-promisify": {
+ "version": "5.0.0",
+ "resolved": "https://registry.npmjs.org/es6-promisify/-/es6-promisify-5.0.0.tgz",
+ "integrity": "sha1-UQnWLz5W6pZ8S2NQWu8IKRyKUgM=",
+ "dev": true,
+ "requires": {
+ "es6-promise": "4.2.4"
+ }
+ },
+ "escape-html": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz",
+ "integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=",
+ "dev": true
+ },
+ "escape-string-regexp": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz",
+ "integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=",
+ "dev": true
+ },
+ "escodegen": {
+ "version": "1.8.1",
+ "resolved": "https://registry.npmjs.org/escodegen/-/escodegen-1.8.1.tgz",
+ "integrity": "sha1-WltTr0aTEQvrsIZ6o0MN07cKEBg=",
+ "dev": true,
+ "requires": {
+ "esprima": "2.7.3",
+ "estraverse": "1.9.3",
+ "esutils": "2.0.2",
+ "optionator": "0.8.2",
+ "source-map": "0.2.0"
+ },
+ "dependencies": {
+ "source-map": {
+ "version": "0.2.0",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.2.0.tgz",
+ "integrity": "sha1-2rc/vPwrqBm03gO9b26qSBZLP50=",
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "amdefine": "1.0.1"
+ }
+ }
+ }
+ },
+ "eslint-scope": {
+ "version": "3.7.3",
+ "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-3.7.3.tgz",
+ "integrity": "sha512-W+B0SvF4gamyCTmUc+uITPY0989iXVfKvhwtmJocTaYoc/3khEHmEmvfY/Gn9HA9VV75jrQECsHizkNw1b68FA==",
+ "dev": true,
+ "requires": {
+ "esrecurse": "4.2.1",
+ "estraverse": "4.2.0"
+ },
+ "dependencies": {
+ "estraverse": {
+ "version": "4.2.0",
+ "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-4.2.0.tgz",
+ "integrity": "sha1-De4/7TH81GlhjOc0IJn8GvoL2xM=",
+ "dev": true
+ }
+ }
+ },
+ "esprima": {
+ "version": "2.7.3",
+ "resolved": "https://registry.npmjs.org/esprima/-/esprima-2.7.3.tgz",
+ "integrity": "sha1-luO3DVd59q1JzQMmc9HDEnZ7pYE=",
+ "dev": true
+ },
+ "esrecurse": {
+ "version": "4.2.1",
+ "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.2.1.tgz",
+ "integrity": "sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==",
+ "dev": true,
+ "requires": {
+ "estraverse": "4.2.0"
+ },
+ "dependencies": {
+ "estraverse": {
+ "version": "4.2.0",
+ "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-4.2.0.tgz",
+ "integrity": "sha1-De4/7TH81GlhjOc0IJn8GvoL2xM=",
+ "dev": true
+ }
+ }
+ },
+ "estraverse": {
+ "version": "1.9.3",
+ "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-1.9.3.tgz",
+ "integrity": "sha1-r2fy3JIlgkFZUJJgkaQAXSnJu0Q=",
+ "dev": true
+ },
+ "estree-walker": {
+ "version": "0.5.2",
+ "resolved": "https://registry.npmjs.org/estree-walker/-/estree-walker-0.5.2.tgz",
+ "integrity": "sha512-XpCnW/AE10ws/kDAs37cngSkvgIR8aN3G0MS85m7dUpuK2EREo9VJ00uvw6Dg/hXEpfsE1I1TvJOJr+Z+TL+ig==",
+ "dev": true
+ },
+ "esutils": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.2.tgz",
+ "integrity": "sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=",
+ "dev": true
+ },
+ "etag": {
+ "version": "1.8.1",
+ "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz",
+ "integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=",
+ "dev": true
+ },
+ "event-stream": {
+ "version": "3.3.5",
+ "resolved": "https://registry.npmjs.org/event-stream/-/event-stream-3.3.5.tgz",
+ "integrity": "sha512-vyibDcu5JL20Me1fP734QBH/kenBGLZap2n0+XXM7mvuUPzJ20Ydqj1aKcIeMdri1p+PU+4yAKugjN8KCVst+g==",
+ "dev": true,
+ "requires": {
+ "duplexer": "0.1.1",
+ "from": "0.1.7",
+ "map-stream": "0.0.7",
+ "pause-stream": "0.0.11",
+ "split": "1.0.1",
+ "stream-combiner": "0.2.2",
+ "through": "2.3.8"
+ }
+ },
+ "eventemitter3": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/eventemitter3/-/eventemitter3-3.1.0.tgz",
+ "integrity": "sha512-ivIvhpq/Y0uSjcHDcOIccjmYjGLcP09MFGE7ysAwkAvkXfpZlC985pH2/ui64DKazbTW/4kN3yqozUxlXzI6cA==",
+ "dev": true
+ },
+ "events": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/events/-/events-1.1.1.tgz",
+ "integrity": "sha1-nr23Y1rQmccNzEwqH1AEKI6L2SQ=",
+ "dev": true
+ },
+ "eventsource": {
+ "version": "0.1.6",
+ "resolved": "https://registry.npmjs.org/eventsource/-/eventsource-0.1.6.tgz",
+ "integrity": "sha1-Cs7ehJ7X3RzMMsgRuxG5RNTykjI=",
+ "dev": true,
+ "requires": {
+ "original": "1.0.2"
+ }
+ },
+ "evp_bytestokey": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz",
+ "integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==",
+ "dev": true,
+ "requires": {
+ "md5.js": "1.3.4",
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "execa": {
+ "version": "0.10.0",
+ "resolved": "https://registry.npmjs.org/execa/-/execa-0.10.0.tgz",
+ "integrity": "sha512-7XOMnz8Ynx1gGo/3hyV9loYNPWM94jG3+3T3Y8tsfSstFmETmENCMU/A/zj8Lyaj1lkgEepKepvd6240tBRvlw==",
+ "dev": true,
+ "requires": {
+ "cross-spawn": "6.0.5",
+ "get-stream": "3.0.0",
+ "is-stream": "1.1.0",
+ "npm-run-path": "2.0.2",
+ "p-finally": "1.0.0",
+ "signal-exit": "3.0.2",
+ "strip-eof": "1.0.0"
+ },
+ "dependencies": {
+ "cross-spawn": {
+ "version": "6.0.5",
+ "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-6.0.5.tgz",
+ "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==",
+ "dev": true,
+ "requires": {
+ "nice-try": "1.0.5",
+ "path-key": "2.0.1",
+ "semver": "5.5.1",
+ "shebang-command": "1.2.0",
+ "which": "1.3.1"
+ }
+ }
+ }
+ },
+ "exit": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/exit/-/exit-0.1.2.tgz",
+ "integrity": "sha1-BjJjj42HfMghB9MKD/8aF8uhzQw=",
+ "dev": true
+ },
+ "expand-braces": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/expand-braces/-/expand-braces-0.1.2.tgz",
+ "integrity": "sha1-SIsdHSRRyz06axks/AMPRMWFX+o=",
+ "dev": true,
+ "requires": {
+ "array-slice": "0.2.3",
+ "array-unique": "0.2.1",
+ "braces": "0.1.5"
+ },
+ "dependencies": {
+ "array-unique": {
+ "version": "0.2.1",
+ "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.2.1.tgz",
+ "integrity": "sha1-odl8yvy8JiXMcPrc6zalDFiwGlM=",
+ "dev": true
+ },
+ "braces": {
+ "version": "0.1.5",
+ "resolved": "https://registry.npmjs.org/braces/-/braces-0.1.5.tgz",
+ "integrity": "sha1-wIVxEIUpHYt1/ddOqw+FlygHEeY=",
+ "dev": true,
+ "requires": {
+ "expand-range": "0.1.1"
+ }
+ },
+ "expand-range": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/expand-range/-/expand-range-0.1.1.tgz",
+ "integrity": "sha1-TLjtoJk8pW+k9B/ELzy7TMrf8EQ=",
+ "dev": true,
+ "requires": {
+ "is-number": "0.1.1",
+ "repeat-string": "0.2.2"
+ }
+ },
+ "is-number": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/is-number/-/is-number-0.1.1.tgz",
+ "integrity": "sha1-aaevEWlj1HIG7JvZtIoUIW8eOAY=",
+ "dev": true
+ },
+ "repeat-string": {
+ "version": "0.2.2",
+ "resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-0.2.2.tgz",
+ "integrity": "sha1-x6jTI2BoNiBZp+RlH8aITosftK4=",
+ "dev": true
+ }
+ }
+ },
+ "expand-brackets": {
+ "version": "2.1.4",
+ "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-2.1.4.tgz",
+ "integrity": "sha1-t3c14xXOMPa27/D4OwQVGiJEliI=",
+ "dev": true,
+ "requires": {
+ "debug": "2.6.9",
+ "define-property": "0.2.5",
+ "extend-shallow": "2.0.1",
+ "posix-character-classes": "0.1.1",
+ "regex-not": "1.0.2",
+ "snapdragon": "0.8.2",
+ "to-regex": "3.0.2"
+ },
+ "dependencies": {
+ "define-property": {
+ "version": "0.2.5",
+ "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
+ "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
+ "dev": true,
+ "requires": {
+ "is-descriptor": "0.1.6"
+ }
+ },
+ "extend-shallow": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+ "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+ "dev": true,
+ "requires": {
+ "is-extendable": "0.1.1"
+ }
+ }
+ }
+ },
+ "expand-range": {
+ "version": "1.8.2",
+ "resolved": "https://registry.npmjs.org/expand-range/-/expand-range-1.8.2.tgz",
+ "integrity": "sha1-opnv/TNf4nIeuujiV+x5ZE/IUzc=",
+ "dev": true,
+ "requires": {
+ "fill-range": "2.2.4"
+ },
+ "dependencies": {
+ "fill-range": {
+ "version": "2.2.4",
+ "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-2.2.4.tgz",
+ "integrity": "sha512-cnrcCbj01+j2gTG921VZPnHbjmdAf8oQV/iGeV2kZxGSyfYjjTyY79ErsK1WJWMpw6DaApEX72binqJE+/d+5Q==",
+ "dev": true,
+ "requires": {
+ "is-number": "2.1.0",
+ "isobject": "2.1.0",
+ "randomatic": "3.1.0",
+ "repeat-element": "1.1.3",
+ "repeat-string": "1.6.1"
+ }
+ },
+ "is-number": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/is-number/-/is-number-2.1.0.tgz",
+ "integrity": "sha1-Afy7s5NGOlSPL0ZszhbezknbkI8=",
+ "dev": true,
+ "requires": {
+ "kind-of": "3.2.2"
+ }
+ },
+ "isobject": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/isobject/-/isobject-2.1.0.tgz",
+ "integrity": "sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=",
+ "dev": true,
+ "requires": {
+ "isarray": "1.0.0"
+ }
+ },
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ }
+ }
+ },
+ "express": {
+ "version": "4.16.3",
+ "resolved": "http://registry.npmjs.org/express/-/express-4.16.3.tgz",
+ "integrity": "sha1-avilAjUNsyRuzEvs9rWjTSL37VM=",
+ "dev": true,
+ "requires": {
+ "accepts": "1.3.5",
+ "array-flatten": "1.1.1",
+ "body-parser": "1.18.2",
+ "content-disposition": "0.5.2",
+ "content-type": "1.0.4",
+ "cookie": "0.3.1",
+ "cookie-signature": "1.0.6",
+ "debug": "2.6.9",
+ "depd": "1.1.2",
+ "encodeurl": "1.0.2",
+ "escape-html": "1.0.3",
+ "etag": "1.8.1",
+ "finalhandler": "1.1.1",
+ "fresh": "0.5.2",
+ "merge-descriptors": "1.0.1",
+ "methods": "1.1.2",
+ "on-finished": "2.3.0",
+ "parseurl": "1.3.2",
+ "path-to-regexp": "0.1.7",
+ "proxy-addr": "2.0.4",
+ "qs": "6.5.1",
+ "range-parser": "1.2.0",
+ "safe-buffer": "5.1.1",
+ "send": "0.16.2",
+ "serve-static": "1.13.2",
+ "setprototypeof": "1.1.0",
+ "statuses": "1.4.0",
+ "type-is": "1.6.16",
+ "utils-merge": "1.0.1",
+ "vary": "1.1.2"
+ },
+ "dependencies": {
+ "array-flatten": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz",
+ "integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=",
+ "dev": true
+ },
+ "qs": {
+ "version": "6.5.1",
+ "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.1.tgz",
+ "integrity": "sha512-eRzhrN1WSINYCDCbrz796z37LOe3m5tmW7RQf6oBntukAG1nmovJvhnwHHRMAfeoItc1m2Hk02WER2aQ/iqs+A==",
+ "dev": true
+ },
+ "safe-buffer": {
+ "version": "5.1.1",
+ "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.1.tgz",
+ "integrity": "sha512-kKvNJn6Mm93gAczWVJg7wH+wGYWNrDHdWvpUmHyEsgCtIwwo3bqPtV4tR5tuPaUhTOo/kvhVwd8XwwOllGYkbg==",
+ "dev": true
+ }
+ }
+ },
+ "extend": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/extend/-/extend-3.0.2.tgz",
+ "integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==",
+ "dev": true
+ },
+ "extend-shallow": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-3.0.2.tgz",
+ "integrity": "sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=",
+ "dev": true,
+ "requires": {
+ "assign-symbols": "1.0.0",
+ "is-extendable": "1.0.1"
+ },
+ "dependencies": {
+ "is-extendable": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz",
+ "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==",
+ "dev": true,
+ "requires": {
+ "is-plain-object": "2.0.4"
+ }
+ }
+ }
+ },
+ "extendr": {
+ "version": "3.3.0",
+ "resolved": "https://registry.npmjs.org/extendr/-/extendr-3.3.0.tgz",
+ "integrity": "sha512-BmBSu+KOX2XOo3XMECiekGY8VAr3O4aGYgOaHQDNg2ez5rOYW+SDfNStao4VNzr+6N27Vw3A7HJKJMrHmAAXvQ==",
+ "dev": true,
+ "requires": {
+ "editions": "1.3.4",
+ "typechecker": "4.5.0"
+ }
+ },
+ "extglob": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/extglob/-/extglob-2.0.4.tgz",
+ "integrity": "sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==",
+ "dev": true,
+ "requires": {
+ "array-unique": "0.3.2",
+ "define-property": "1.0.0",
+ "expand-brackets": "2.1.4",
+ "extend-shallow": "2.0.1",
+ "fragment-cache": "0.2.1",
+ "regex-not": "1.0.2",
+ "snapdragon": "0.8.2",
+ "to-regex": "3.0.2"
+ },
+ "dependencies": {
+ "define-property": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
+ "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
+ "dev": true,
+ "requires": {
+ "is-descriptor": "1.0.2"
+ }
+ },
+ "extend-shallow": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+ "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+ "dev": true,
+ "requires": {
+ "is-extendable": "0.1.1"
+ }
+ },
+ "is-accessor-descriptor": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
+ "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
+ "dev": true,
+ "requires": {
+ "kind-of": "6.0.2"
+ }
+ },
+ "is-data-descriptor": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
+ "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
+ "dev": true,
+ "requires": {
+ "kind-of": "6.0.2"
+ }
+ },
+ "is-descriptor": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
+ "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
+ "dev": true,
+ "requires": {
+ "is-accessor-descriptor": "1.0.0",
+ "is-data-descriptor": "1.0.0",
+ "kind-of": "6.0.2"
+ }
+ }
+ }
+ },
+ "extract-opts": {
+ "version": "3.3.1",
+ "resolved": "https://registry.npmjs.org/extract-opts/-/extract-opts-3.3.1.tgz",
+ "integrity": "sha1-WrvtyYwNUgLjJ4cn+Rktfghsa+E=",
+ "dev": true,
+ "requires": {
+ "eachr": "3.2.0",
+ "editions": "1.3.4",
+ "typechecker": "4.5.0"
+ }
+ },
+ "extsprintf": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/extsprintf/-/extsprintf-1.3.0.tgz",
+ "integrity": "sha1-lpGEQOMEGnpBT4xS48V06zw+HgU=",
+ "dev": true
+ },
+ "fancy-log": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/fancy-log/-/fancy-log-1.3.2.tgz",
+ "integrity": "sha1-9BEl49hPLn2JpD0G2VjI94vha+E=",
+ "dev": true,
+ "requires": {
+ "ansi-gray": "0.1.1",
+ "color-support": "1.1.3",
+ "time-stamp": "1.1.0"
+ }
+ },
+ "fast-deep-equal": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-1.1.0.tgz",
+ "integrity": "sha1-wFNHeBfIa1HaqFPIHgWbcz0CNhQ=",
+ "dev": true
+ },
+ "fast-glob": {
+ "version": "2.2.2",
+ "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-2.2.2.tgz",
+ "integrity": "sha512-TR6zxCKftDQnUAPvkrCWdBgDq/gbqx8A3ApnBrR5rMvpp6+KMJI0Igw7fkWPgeVK0uhRXTXdvO3O+YP0CaUX2g==",
+ "dev": true,
+ "requires": {
+ "@mrmlnc/readdir-enhanced": "2.2.1",
+ "@nodelib/fs.stat": "1.1.2",
+ "glob-parent": "3.1.0",
+ "is-glob": "4.0.0",
+ "merge2": "1.2.2",
+ "micromatch": "3.1.10"
+ }
+ },
+ "fast-json-stable-stringify": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz",
+ "integrity": "sha1-1RQsDK7msRifh9OnYREGT4bIu/I=",
+ "dev": true
+ },
+ "fast-levenshtein": {
+ "version": "2.0.6",
+ "resolved": "https://registry.npmjs.org/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz",
+ "integrity": "sha1-PYpcZog6FqMMqGQ+hR8Zuqd5eRc=",
+ "dev": true
+ },
+ "fastparse": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/fastparse/-/fastparse-1.1.1.tgz",
+ "integrity": "sha1-0eJkOzipTXWDtHkGDmxK/8lAcfg=",
+ "dev": true
+ },
+ "faye-websocket": {
+ "version": "0.10.0",
+ "resolved": "https://registry.npmjs.org/faye-websocket/-/faye-websocket-0.10.0.tgz",
+ "integrity": "sha1-TkkvjQTftviQA1B/btvy1QHnxvQ=",
+ "dev": true,
+ "requires": {
+ "websocket-driver": "0.7.0"
+ }
+ },
+ "file-loader": {
+ "version": "1.1.11",
+ "resolved": "https://registry.npmjs.org/file-loader/-/file-loader-1.1.11.tgz",
+ "integrity": "sha512-TGR4HU7HUsGg6GCOPJnFk06RhWgEWFLAGWiT6rcD+GRC2keU3s9RGJ+b3Z6/U73jwwNb2gKLJ7YCrp+jvU4ALg==",
+ "dev": true,
+ "requires": {
+ "loader-utils": "1.1.0",
+ "schema-utils": "0.4.7"
+ }
+ },
+ "filename-regex": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/filename-regex/-/filename-regex-2.0.1.tgz",
+ "integrity": "sha1-wcS5vuPglyXdsQa3XB4wH+LxiyY=",
+ "dev": true
+ },
+ "fileset": {
+ "version": "2.0.3",
+ "resolved": "https://registry.npmjs.org/fileset/-/fileset-2.0.3.tgz",
+ "integrity": "sha1-jnVIqW08wjJ+5eZ0FocjozO7oqA=",
+ "dev": true,
+ "requires": {
+ "glob": "7.1.3",
+ "minimatch": "3.0.4"
+ }
+ },
+ "fill-range": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz",
+ "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=",
+ "dev": true,
+ "requires": {
+ "extend-shallow": "2.0.1",
+ "is-number": "3.0.0",
+ "repeat-string": "1.6.1",
+ "to-regex-range": "2.1.1"
+ },
+ "dependencies": {
+ "extend-shallow": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+ "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+ "dev": true,
+ "requires": {
+ "is-extendable": "0.1.1"
+ }
+ }
+ }
+ },
+ "finalhandler": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.1.tgz",
+ "integrity": "sha512-Y1GUDo39ez4aHAw7MysnUD5JzYX+WaIj8I57kO3aEPT1fFRL4sr7mjei97FgnwhAyyzRYmQZaTHb2+9uZ1dPtg==",
+ "dev": true,
+ "requires": {
+ "debug": "2.6.9",
+ "encodeurl": "1.0.2",
+ "escape-html": "1.0.3",
+ "on-finished": "2.3.0",
+ "parseurl": "1.3.2",
+ "statuses": "1.4.0",
+ "unpipe": "1.0.0"
+ }
+ },
+ "find-cache-dir": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-1.0.0.tgz",
+ "integrity": "sha1-kojj6ePMN0hxfTnq3hfPcfww7m8=",
+ "dev": true,
+ "requires": {
+ "commondir": "1.0.1",
+ "make-dir": "1.3.0",
+ "pkg-dir": "2.0.0"
+ }
+ },
+ "find-parent-dir": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/find-parent-dir/-/find-parent-dir-0.3.0.tgz",
+ "integrity": "sha1-M8RLQpqysvBkYpnF+fcY83b/jVQ=",
+ "dev": true
+ },
+ "find-up": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz",
+ "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=",
+ "dev": true,
+ "requires": {
+ "locate-path": "2.0.0"
+ }
+ },
+ "findit2": {
+ "version": "2.2.3",
+ "resolved": "https://registry.npmjs.org/findit2/-/findit2-2.2.3.tgz",
+ "integrity": "sha1-WKRmaX34piBc39vzlVNri9d3pfY=",
+ "dev": true
+ },
+ "flush-write-stream": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/flush-write-stream/-/flush-write-stream-1.0.3.tgz",
+ "integrity": "sha512-calZMC10u0FMUqoiunI2AiGIIUtUIvifNwkHhNupZH4cbNnW1Itkoh/Nf5HFYmDrwWPjrUxpkZT0KhuCq0jmGw==",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3",
+ "readable-stream": "2.3.6"
+ }
+ },
+ "follow-redirects": {
+ "version": "1.5.7",
+ "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.5.7.tgz",
+ "integrity": "sha512-NONJVIFiX7Z8k2WxfqBjtwqMifx7X42ORLFrOZ2LTKGj71G3C0kfdyTqGqr8fx5zSX6Foo/D95dgGWbPUiwnew==",
+ "dev": true,
+ "requires": {
+ "debug": "3.1.0"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+ "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ }
+ }
+ },
+ "for-in": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/for-in/-/for-in-1.0.2.tgz",
+ "integrity": "sha1-gQaNKVqBQuwKxybG4iAMMPttXoA=",
+ "dev": true
+ },
+ "for-own": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/for-own/-/for-own-1.0.0.tgz",
+ "integrity": "sha1-xjMy9BXO3EsE2/5wz4NklMU8tEs=",
+ "dev": true,
+ "requires": {
+ "for-in": "1.0.2"
+ }
+ },
+ "forever-agent": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/forever-agent/-/forever-agent-0.6.1.tgz",
+ "integrity": "sha1-+8cfDEGt6zf5bFd60e1C2P2sypE=",
+ "dev": true
+ },
+ "form-data": {
+ "version": "2.3.2",
+ "resolved": "https://registry.npmjs.org/form-data/-/form-data-2.3.2.tgz",
+ "integrity": "sha1-SXBJi+YEwgwAXU9cI67NIda0kJk=",
+ "dev": true,
+ "requires": {
+ "asynckit": "0.4.0",
+ "combined-stream": "1.0.6",
+ "mime-types": "2.1.20"
+ }
+ },
+ "forwarded": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.2.tgz",
+ "integrity": "sha1-mMI9qxF1ZXuMBXPozszZGw/xjIQ=",
+ "dev": true
+ },
+ "fragment-cache": {
+ "version": "0.2.1",
+ "resolved": "https://registry.npmjs.org/fragment-cache/-/fragment-cache-0.2.1.tgz",
+ "integrity": "sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=",
+ "dev": true,
+ "requires": {
+ "map-cache": "0.2.2"
+ }
+ },
+ "fresh": {
+ "version": "0.5.2",
+ "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz",
+ "integrity": "sha1-PYyt2Q2XZWn6g1qx+OSyOhBWBac=",
+ "dev": true
+ },
+ "from": {
+ "version": "0.1.7",
+ "resolved": "https://registry.npmjs.org/from/-/from-0.1.7.tgz",
+ "integrity": "sha1-g8YK/Fi5xWmXAH7Rp2izqzA6RP4=",
+ "dev": true
+ },
+ "from2": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/from2/-/from2-2.3.0.tgz",
+ "integrity": "sha1-i/tVAr3kpNNs/e6gB/zKIdfjgq8=",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3",
+ "readable-stream": "2.3.6"
+ }
+ },
+ "fs-access": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/fs-access/-/fs-access-1.0.1.tgz",
+ "integrity": "sha1-1qh/JiJxzv6+wwxVNAf7mV2od3o=",
+ "dev": true,
+ "requires": {
+ "null-check": "1.0.0"
+ }
+ },
+ "fs-extra": {
+ "version": "6.0.1",
+ "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-6.0.1.tgz",
+ "integrity": "sha512-GnyIkKhhzXZUWFCaJzvyDLEEgDkPfb4/TPvJCJVuS8MWZgoSsErf++QpiAlDnKFcqhRlm+tIOcencCjyJE6ZCA==",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "jsonfile": "4.0.0",
+ "universalify": "0.1.2"
+ }
+ },
+ "fs-write-stream-atomic": {
+ "version": "1.0.10",
+ "resolved": "https://registry.npmjs.org/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz",
+ "integrity": "sha1-tH31NJPvkR33VzHnCp3tAYnbQMk=",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "iferr": "0.1.5",
+ "imurmurhash": "0.1.4",
+ "readable-stream": "2.3.6"
+ }
+ },
+ "fs.realpath": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz",
+ "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=",
+ "dev": true
+ },
+ "fsevents": {
+ "version": "1.2.4",
+ "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.4.tgz",
+ "integrity": "sha512-z8H8/diyk76B7q5wg+Ud0+CqzcAF3mBBI/bA5ne5zrRUUIvNkJY//D3BqyH571KuAC4Nr7Rw7CjWX4r0y9DvNg==",
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "nan": "2.11.0",
+ "node-pre-gyp": "0.10.0"
+ },
+ "dependencies": {
+ "abbrev": {
+ "version": "1.1.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "ansi-regex": {
+ "version": "2.1.1",
+ "bundled": true,
+ "dev": true
+ },
+ "aproba": {
+ "version": "1.2.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "are-we-there-yet": {
+ "version": "1.1.4",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "delegates": "1.0.0",
+ "readable-stream": "2.3.6"
+ }
+ },
+ "balanced-match": {
+ "version": "1.0.0",
+ "bundled": true,
+ "dev": true
+ },
+ "brace-expansion": {
+ "version": "1.1.11",
+ "bundled": true,
+ "dev": true,
+ "requires": {
+ "balanced-match": "1.0.0",
+ "concat-map": "0.0.1"
+ }
+ },
+ "chownr": {
+ "version": "1.0.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "code-point-at": {
+ "version": "1.1.0",
+ "bundled": true,
+ "dev": true
+ },
+ "concat-map": {
+ "version": "0.0.1",
+ "bundled": true,
+ "dev": true
+ },
+ "console-control-strings": {
+ "version": "1.1.0",
+ "bundled": true,
+ "dev": true
+ },
+ "core-util-is": {
+ "version": "1.0.2",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "debug": {
+ "version": "2.6.9",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ },
+ "deep-extend": {
+ "version": "0.5.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "delegates": {
+ "version": "1.0.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "detect-libc": {
+ "version": "1.0.3",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "fs-minipass": {
+ "version": "1.2.5",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "minipass": "2.2.4"
+ }
+ },
+ "fs.realpath": {
+ "version": "1.0.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "gauge": {
+ "version": "2.7.4",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "aproba": "1.2.0",
+ "console-control-strings": "1.1.0",
+ "has-unicode": "2.0.1",
+ "object-assign": "4.1.1",
+ "signal-exit": "3.0.2",
+ "string-width": "1.0.2",
+ "strip-ansi": "3.0.1",
+ "wide-align": "1.1.2"
+ }
+ },
+ "glob": {
+ "version": "7.1.2",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "fs.realpath": "1.0.0",
+ "inflight": "1.0.6",
+ "inherits": "2.0.3",
+ "minimatch": "3.0.4",
+ "once": "1.4.0",
+ "path-is-absolute": "1.0.1"
+ }
+ },
+ "has-unicode": {
+ "version": "2.0.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "iconv-lite": {
+ "version": "0.4.21",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "safer-buffer": "2.1.2"
+ }
+ },
+ "ignore-walk": {
+ "version": "3.0.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "minimatch": "3.0.4"
+ }
+ },
+ "inflight": {
+ "version": "1.0.6",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "once": "1.4.0",
+ "wrappy": "1.0.2"
+ }
+ },
+ "inherits": {
+ "version": "2.0.3",
+ "bundled": true,
+ "dev": true
+ },
+ "ini": {
+ "version": "1.3.5",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "is-fullwidth-code-point": {
+ "version": "1.0.0",
+ "bundled": true,
+ "dev": true,
+ "requires": {
+ "number-is-nan": "1.0.1"
+ }
+ },
+ "isarray": {
+ "version": "1.0.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "minimatch": {
+ "version": "3.0.4",
+ "bundled": true,
+ "dev": true,
+ "requires": {
+ "brace-expansion": "1.1.11"
+ }
+ },
+ "minimist": {
+ "version": "0.0.8",
+ "bundled": true,
+ "dev": true
+ },
+ "minipass": {
+ "version": "2.2.4",
+ "bundled": true,
+ "dev": true,
+ "requires": {
+ "safe-buffer": "5.1.1",
+ "yallist": "3.0.2"
+ }
+ },
+ "minizlib": {
+ "version": "1.1.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "minipass": "2.2.4"
+ }
+ },
+ "mkdirp": {
+ "version": "0.5.1",
+ "bundled": true,
+ "dev": true,
+ "requires": {
+ "minimist": "0.0.8"
+ }
+ },
+ "ms": {
+ "version": "2.0.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "needle": {
+ "version": "2.2.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "debug": "2.6.9",
+ "iconv-lite": "0.4.21",
+ "sax": "1.2.4"
+ }
+ },
+ "node-pre-gyp": {
+ "version": "0.10.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "detect-libc": "1.0.3",
+ "mkdirp": "0.5.1",
+ "needle": "2.2.0",
+ "nopt": "4.0.1",
+ "npm-packlist": "1.1.10",
+ "npmlog": "4.1.2",
+ "rc": "1.2.7",
+ "rimraf": "2.6.2",
+ "semver": "5.5.0",
+ "tar": "4.4.1"
+ }
+ },
+ "nopt": {
+ "version": "4.0.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "abbrev": "1.1.1",
+ "osenv": "0.1.5"
+ }
+ },
+ "npm-bundled": {
+ "version": "1.0.3",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "npm-packlist": {
+ "version": "1.1.10",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "ignore-walk": "3.0.1",
+ "npm-bundled": "1.0.3"
+ }
+ },
+ "npmlog": {
+ "version": "4.1.2",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "are-we-there-yet": "1.1.4",
+ "console-control-strings": "1.1.0",
+ "gauge": "2.7.4",
+ "set-blocking": "2.0.0"
+ }
+ },
+ "number-is-nan": {
+ "version": "1.0.1",
+ "bundled": true,
+ "dev": true
+ },
+ "object-assign": {
+ "version": "4.1.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "once": {
+ "version": "1.4.0",
+ "bundled": true,
+ "dev": true,
+ "requires": {
+ "wrappy": "1.0.2"
+ }
+ },
+ "os-homedir": {
+ "version": "1.0.2",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "os-tmpdir": {
+ "version": "1.0.2",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "osenv": {
+ "version": "0.1.5",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "os-homedir": "1.0.2",
+ "os-tmpdir": "1.0.2"
+ }
+ },
+ "path-is-absolute": {
+ "version": "1.0.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "process-nextick-args": {
+ "version": "2.0.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "rc": {
+ "version": "1.2.7",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "deep-extend": "0.5.1",
+ "ini": "1.3.5",
+ "minimist": "1.2.0",
+ "strip-json-comments": "2.0.1"
+ },
+ "dependencies": {
+ "minimist": {
+ "version": "1.2.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ }
+ }
+ },
+ "readable-stream": {
+ "version": "2.3.6",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "core-util-is": "1.0.2",
+ "inherits": "2.0.3",
+ "isarray": "1.0.0",
+ "process-nextick-args": "2.0.0",
+ "safe-buffer": "5.1.1",
+ "string_decoder": "1.1.1",
+ "util-deprecate": "1.0.2"
+ }
+ },
+ "rimraf": {
+ "version": "2.6.2",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "glob": "7.1.2"
+ }
+ },
+ "safe-buffer": {
+ "version": "5.1.1",
+ "bundled": true,
+ "dev": true
+ },
+ "safer-buffer": {
+ "version": "2.1.2",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "sax": {
+ "version": "1.2.4",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "semver": {
+ "version": "5.5.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "set-blocking": {
+ "version": "2.0.0",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "signal-exit": {
+ "version": "3.0.2",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "string-width": {
+ "version": "1.0.2",
+ "bundled": true,
+ "dev": true,
+ "requires": {
+ "code-point-at": "1.1.0",
+ "is-fullwidth-code-point": "1.0.0",
+ "strip-ansi": "3.0.1"
+ }
+ },
+ "string_decoder": {
+ "version": "1.1.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "safe-buffer": "5.1.1"
+ }
+ },
+ "strip-ansi": {
+ "version": "3.0.1",
+ "bundled": true,
+ "dev": true,
+ "requires": {
+ "ansi-regex": "2.1.1"
+ }
+ },
+ "strip-json-comments": {
+ "version": "2.0.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "tar": {
+ "version": "4.4.1",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "chownr": "1.0.1",
+ "fs-minipass": "1.2.5",
+ "minipass": "2.2.4",
+ "minizlib": "1.1.0",
+ "mkdirp": "0.5.1",
+ "safe-buffer": "5.1.1",
+ "yallist": "3.0.2"
+ }
+ },
+ "util-deprecate": {
+ "version": "1.0.2",
+ "bundled": true,
+ "dev": true,
+ "optional": true
+ },
+ "wide-align": {
+ "version": "1.1.2",
+ "bundled": true,
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "string-width": "1.0.2"
+ }
+ },
+ "wrappy": {
+ "version": "1.0.2",
+ "bundled": true,
+ "dev": true
+ },
+ "yallist": {
+ "version": "3.0.2",
+ "bundled": true,
+ "dev": true
+ }
+ }
+ },
+ "fstream": {
+ "version": "1.0.11",
+ "resolved": "https://registry.npmjs.org/fstream/-/fstream-1.0.11.tgz",
+ "integrity": "sha1-XB+x8RdHcRTwYyoOtLcbPLD9MXE=",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "inherits": "2.0.3",
+ "mkdirp": "0.5.1",
+ "rimraf": "2.6.2"
+ }
+ },
+ "function-bind": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz",
+ "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==",
+ "dev": true
+ },
+ "gauge": {
+ "version": "2.7.4",
+ "resolved": "https://registry.npmjs.org/gauge/-/gauge-2.7.4.tgz",
+ "integrity": "sha1-LANAXHU4w51+s3sxcCLjJfsBi/c=",
+ "dev": true,
+ "requires": {
+ "aproba": "1.2.0",
+ "console-control-strings": "1.1.0",
+ "has-unicode": "2.0.1",
+ "object-assign": "4.1.1",
+ "signal-exit": "3.0.2",
+ "string-width": "1.0.2",
+ "strip-ansi": "3.0.1",
+ "wide-align": "1.1.3"
+ }
+ },
+ "gaze": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/gaze/-/gaze-1.1.3.tgz",
+ "integrity": "sha512-BRdNm8hbWzFzWHERTrejLqwHDfS4GibPoq5wjTPIoJHoBtKGPg3xAFfxmM+9ztbXelxcf2hwQcaz1PtmFeue8g==",
+ "dev": true,
+ "requires": {
+ "globule": "1.2.1"
+ }
+ },
+ "get-caller-file": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-1.0.3.tgz",
+ "integrity": "sha512-3t6rVToeoZfYSGd8YoLFR2DJkiQrIiUrGcjvFX2mDw3bn6k2OtwHN0TNCLbBO+w8qTvimhDkv+LSscbJY1vE6w==",
+ "dev": true
+ },
+ "get-stdin": {
+ "version": "4.0.1",
+ "resolved": "https://registry.npmjs.org/get-stdin/-/get-stdin-4.0.1.tgz",
+ "integrity": "sha1-uWjGsKBDhDJJAui/Gl3zJXmkUP4=",
+ "dev": true
+ },
+ "get-stream": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-3.0.0.tgz",
+ "integrity": "sha1-jpQ9E1jcN1VQVOy+LtsFqhdO3hQ=",
+ "dev": true
+ },
+ "get-value": {
+ "version": "2.0.6",
+ "resolved": "https://registry.npmjs.org/get-value/-/get-value-2.0.6.tgz",
+ "integrity": "sha1-3BXKHGcjh8p2vTesCjlbogQqLCg=",
+ "dev": true
+ },
+ "getpass": {
+ "version": "0.1.7",
+ "resolved": "https://registry.npmjs.org/getpass/-/getpass-0.1.7.tgz",
+ "integrity": "sha1-Xv+OPmhNVprkyysSgmBOi6YhSfo=",
+ "dev": true,
+ "requires": {
+ "assert-plus": "1.0.0"
+ }
+ },
+ "glob": {
+ "version": "7.1.3",
+ "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.3.tgz",
+ "integrity": "sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==",
+ "dev": true,
+ "requires": {
+ "fs.realpath": "1.0.0",
+ "inflight": "1.0.6",
+ "inherits": "2.0.3",
+ "minimatch": "3.0.4",
+ "once": "1.4.0",
+ "path-is-absolute": "1.0.1"
+ }
+ },
+ "glob-base": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/glob-base/-/glob-base-0.3.0.tgz",
+ "integrity": "sha1-27Fk9iIbHAscz4Kuoyi0l98Oo8Q=",
+ "dev": true,
+ "requires": {
+ "glob-parent": "2.0.0",
+ "is-glob": "2.0.1"
+ },
+ "dependencies": {
+ "glob-parent": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-2.0.0.tgz",
+ "integrity": "sha1-gTg9ctsFT8zPUzbaqQLxgvbtuyg=",
+ "dev": true,
+ "requires": {
+ "is-glob": "2.0.1"
+ }
+ },
+ "is-extglob": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-1.0.0.tgz",
+ "integrity": "sha1-rEaBd8SUNAWgkvyPKXYMb/xiBsA=",
+ "dev": true
+ },
+ "is-glob": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-2.0.1.tgz",
+ "integrity": "sha1-0Jb5JqPe1WAPP9/ZEZjLCIjC2GM=",
+ "dev": true,
+ "requires": {
+ "is-extglob": "1.0.0"
+ }
+ }
+ }
+ },
+ "glob-parent": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz",
+ "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=",
+ "dev": true,
+ "requires": {
+ "is-glob": "3.1.0",
+ "path-dirname": "1.0.2"
+ },
+ "dependencies": {
+ "is-glob": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz",
+ "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=",
+ "dev": true,
+ "requires": {
+ "is-extglob": "2.1.1"
+ }
+ }
+ }
+ },
+ "glob-to-regexp": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/glob-to-regexp/-/glob-to-regexp-0.3.0.tgz",
+ "integrity": "sha1-jFoUlNIGbFcMw7/kSWF1rMTVAqs=",
+ "dev": true
+ },
+ "global-dirs": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/global-dirs/-/global-dirs-0.1.1.tgz",
+ "integrity": "sha1-sxnA3UYH81PzvpzKTHL8FIxJ9EU=",
+ "dev": true,
+ "requires": {
+ "ini": "1.3.5"
+ }
+ },
+ "globals": {
+ "version": "9.18.0",
+ "resolved": "https://registry.npmjs.org/globals/-/globals-9.18.0.tgz",
+ "integrity": "sha512-S0nG3CLEQiY/ILxqtztTWH/3iRRdyBLw6KMDxnKMchrtbj2OFmehVh0WUCfW3DUrIgx/qFrJPICrq4Z4sTR9UQ==",
+ "dev": true
+ },
+ "globby": {
+ "version": "7.1.1",
+ "resolved": "https://registry.npmjs.org/globby/-/globby-7.1.1.tgz",
+ "integrity": "sha1-+yzP+UAfhgCUXfral0QMypcrhoA=",
+ "dev": true,
+ "requires": {
+ "array-union": "1.0.2",
+ "dir-glob": "2.0.0",
+ "glob": "7.1.3",
+ "ignore": "3.3.10",
+ "pify": "3.0.0",
+ "slash": "1.0.0"
+ }
+ },
+ "globule": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/globule/-/globule-1.2.1.tgz",
+ "integrity": "sha512-g7QtgWF4uYSL5/dn71WxubOrS7JVGCnFPEnoeChJmBnyR9Mw8nGoEwOgJL/RC2Te0WhbsEUCejfH8SZNJ+adYQ==",
+ "dev": true,
+ "requires": {
+ "glob": "7.1.3",
+ "lodash": "4.17.10",
+ "minimatch": "3.0.4"
+ }
+ },
+ "got": {
+ "version": "6.7.1",
+ "resolved": "http://registry.npmjs.org/got/-/got-6.7.1.tgz",
+ "integrity": "sha1-JAzQV4WpoY5WHcG0S0HHY+8ejbA=",
+ "dev": true,
+ "requires": {
+ "create-error-class": "3.0.2",
+ "duplexer3": "0.1.4",
+ "get-stream": "3.0.0",
+ "is-redirect": "1.0.0",
+ "is-retry-allowed": "1.1.0",
+ "is-stream": "1.1.0",
+ "lowercase-keys": "1.0.1",
+ "safe-buffer": "5.1.2",
+ "timed-out": "4.0.1",
+ "unzip-response": "2.0.1",
+ "url-parse-lax": "1.0.0"
+ }
+ },
+ "graceful-fs": {
+ "version": "4.1.11",
+ "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.1.11.tgz",
+ "integrity": "sha1-Dovf5NHduIVNZOBOp8AOKgJuVlg=",
+ "dev": true
+ },
+ "handle-thing": {
+ "version": "1.2.5",
+ "resolved": "https://registry.npmjs.org/handle-thing/-/handle-thing-1.2.5.tgz",
+ "integrity": "sha1-/Xqtcmvxpf0W38KbL3pmAdJxOcQ=",
+ "dev": true
+ },
+ "handlebars": {
+ "version": "4.0.12",
+ "resolved": "https://registry.npmjs.org/handlebars/-/handlebars-4.0.12.tgz",
+ "integrity": "sha512-RhmTekP+FZL+XNhwS1Wf+bTTZpdLougwt5pcgA1tuz6Jcx0fpH/7z0qd71RKnZHBCxIRBHfBOnio4gViPemNzA==",
+ "dev": true,
+ "requires": {
+ "async": "2.6.1",
+ "optimist": "0.6.1",
+ "source-map": "0.6.1",
+ "uglify-js": "3.4.9"
+ },
+ "dependencies": {
+ "async": {
+ "version": "2.6.1",
+ "resolved": "https://registry.npmjs.org/async/-/async-2.6.1.tgz",
+ "integrity": "sha512-fNEiL2+AZt6AlAw/29Cr0UDe4sRAHCpEHh54WMz+Bb7QfNcFw4h3loofyJpLeQs4Yx7yuqu/2dLgM5hKOs6HlQ==",
+ "dev": true,
+ "requires": {
+ "lodash": "4.17.10"
+ }
+ },
+ "source-map": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+ "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+ "dev": true
+ }
+ }
+ },
+ "har-schema": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/har-schema/-/har-schema-2.0.0.tgz",
+ "integrity": "sha1-qUwiJOvKwEeCoNkDVSHyRzW37JI=",
+ "dev": true
+ },
+ "har-validator": {
+ "version": "5.1.0",
+ "resolved": "https://registry.npmjs.org/har-validator/-/har-validator-5.1.0.tgz",
+ "integrity": "sha512-+qnmNjI4OfH2ipQ9VQOw23bBd/ibtfbVdK2fYbY4acTDqKTW/YDp9McimZdDbG8iV9fZizUqQMD5xvriB146TA==",
+ "dev": true,
+ "requires": {
+ "ajv": "5.5.2",
+ "har-schema": "2.0.0"
+ },
+ "dependencies": {
+ "ajv": {
+ "version": "5.5.2",
+ "resolved": "https://registry.npmjs.org/ajv/-/ajv-5.5.2.tgz",
+ "integrity": "sha1-c7Xuyj+rZT49P5Qis0GtQiBdyWU=",
+ "dev": true,
+ "requires": {
+ "co": "4.6.0",
+ "fast-deep-equal": "1.1.0",
+ "fast-json-stable-stringify": "2.0.0",
+ "json-schema-traverse": "0.3.1"
+ }
+ }
+ }
+ },
+ "has": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz",
+ "integrity": "sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==",
+ "dev": true,
+ "requires": {
+ "function-bind": "1.1.1"
+ }
+ },
+ "has-ansi": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/has-ansi/-/has-ansi-2.0.0.tgz",
+ "integrity": "sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=",
+ "dev": true,
+ "requires": {
+ "ansi-regex": "2.1.1"
+ }
+ },
+ "has-binary": {
+ "version": "0.1.7",
+ "resolved": "https://registry.npmjs.org/has-binary/-/has-binary-0.1.7.tgz",
+ "integrity": "sha1-aOYesWIQyVRaClzOBqhzkS/h5ow=",
+ "dev": true,
+ "requires": {
+ "isarray": "0.0.1"
+ },
+ "dependencies": {
+ "isarray": {
+ "version": "0.0.1",
+ "resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz",
+ "integrity": "sha1-ihis/Kmo9Bd+Cav8YDiTmwXR7t8=",
+ "dev": true
+ }
+ }
+ },
+ "has-cors": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/has-cors/-/has-cors-1.1.0.tgz",
+ "integrity": "sha1-XkdHk/fqmEPRu5nCPu9J/xJv/zk=",
+ "dev": true
+ },
+ "has-flag": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz",
+ "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=",
+ "dev": true
+ },
+ "has-unicode": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/has-unicode/-/has-unicode-2.0.1.tgz",
+ "integrity": "sha1-4Ob+aijPUROIVeCG0Wkedx3iqLk=",
+ "dev": true
+ },
+ "has-value": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz",
+ "integrity": "sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=",
+ "dev": true,
+ "requires": {
+ "get-value": "2.0.6",
+ "has-values": "1.0.0",
+ "isobject": "3.0.1"
+ }
+ },
+ "has-values": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/has-values/-/has-values-1.0.0.tgz",
+ "integrity": "sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=",
+ "dev": true,
+ "requires": {
+ "is-number": "3.0.0",
+ "kind-of": "4.0.0"
+ },
+ "dependencies": {
+ "kind-of": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz",
+ "integrity": "sha1-IIE989cSkosgc3hpGkUGb65y3Vc=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ }
+ }
+ },
+ "hash-base": {
+ "version": "3.0.4",
+ "resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.0.4.tgz",
+ "integrity": "sha1-X8hoaEfs1zSZQDMZprCj8/auSRg=",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3",
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "hash.js": {
+ "version": "1.1.5",
+ "resolved": "https://registry.npmjs.org/hash.js/-/hash.js-1.1.5.tgz",
+ "integrity": "sha512-eWI5HG9Np+eHV1KQhisXWwM+4EPPYe5dFX1UZZH7k/E3JzDEazVH+VGlZi6R94ZqImq+A3D1mCEtrFIfg/E7sA==",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3",
+ "minimalistic-assert": "1.0.1"
+ }
+ },
+ "he": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/he/-/he-1.1.1.tgz",
+ "integrity": "sha1-k0EP0hsAlzUVH4howvJx80J+I/0=",
+ "dev": true
+ },
+ "hmac-drbg": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/hmac-drbg/-/hmac-drbg-1.0.1.tgz",
+ "integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=",
+ "dev": true,
+ "requires": {
+ "hash.js": "1.1.5",
+ "minimalistic-assert": "1.0.1",
+ "minimalistic-crypto-utils": "1.0.1"
+ }
+ },
+ "hosted-git-info": {
+ "version": "2.7.1",
+ "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.7.1.tgz",
+ "integrity": "sha512-7T/BxH19zbcCTa8XkMlbK5lTo1WtgkFi3GvdWEyNuc4Vex7/9Dqbnpsf4JMydcfj9HCg4zUWFTL3Za6lapg5/w==",
+ "dev": true
+ },
+ "hpack.js": {
+ "version": "2.1.6",
+ "resolved": "https://registry.npmjs.org/hpack.js/-/hpack.js-2.1.6.tgz",
+ "integrity": "sha1-h3dMCUnlE/QuhFdbPEVoH63ioLI=",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3",
+ "obuf": "1.1.2",
+ "readable-stream": "2.3.6",
+ "wbuf": "1.7.3"
+ }
+ },
+ "html-entities": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-1.2.1.tgz",
+ "integrity": "sha1-DfKTUfByEWNRXfueVUPl9u7VFi8=",
+ "dev": true
+ },
+ "html-minifier": {
+ "version": "3.5.20",
+ "resolved": "https://registry.npmjs.org/html-minifier/-/html-minifier-3.5.20.tgz",
+ "integrity": "sha512-ZmgNLaTp54+HFKkONyLFEfs5dd/ZOtlquKaTnqIWFmx3Av5zG6ZPcV2d0o9XM2fXOTxxIf6eDcwzFFotke/5zA==",
+ "dev": true,
+ "requires": {
+ "camel-case": "3.0.0",
+ "clean-css": "4.2.1",
+ "commander": "2.17.1",
+ "he": "1.1.1",
+ "param-case": "2.1.1",
+ "relateurl": "0.2.7",
+ "uglify-js": "3.4.9"
+ }
+ },
+ "html-webpack-plugin": {
+ "version": "3.2.0",
+ "resolved": "http://registry.npmjs.org/html-webpack-plugin/-/html-webpack-plugin-3.2.0.tgz",
+ "integrity": "sha1-sBq71yOsqqeze2r0SS69oD2d03s=",
+ "dev": true,
+ "requires": {
+ "html-minifier": "3.5.20",
+ "loader-utils": "0.2.17",
+ "lodash": "4.17.10",
+ "pretty-error": "2.1.1",
+ "tapable": "1.0.0",
+ "toposort": "1.0.7",
+ "util.promisify": "1.0.0"
+ },
+ "dependencies": {
+ "loader-utils": {
+ "version": "0.2.17",
+ "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-0.2.17.tgz",
+ "integrity": "sha1-+G5jdNQyBabmxg6RlvF8Apm/s0g=",
+ "dev": true,
+ "requires": {
+ "big.js": "3.2.0",
+ "emojis-list": "2.1.0",
+ "json5": "0.5.1",
+ "object-assign": "4.1.1"
+ }
+ }
+ }
+ },
+ "htmlparser2": {
+ "version": "3.3.0",
+ "resolved": "https://registry.npmjs.org/htmlparser2/-/htmlparser2-3.3.0.tgz",
+ "integrity": "sha1-zHDQWln2VC5D8OaFyYLhTJJKnv4=",
+ "dev": true,
+ "requires": {
+ "domelementtype": "1.3.0",
+ "domhandler": "2.1.0",
+ "domutils": "1.1.6",
+ "readable-stream": "1.0.34"
+ },
+ "dependencies": {
+ "domutils": {
+ "version": "1.1.6",
+ "resolved": "https://registry.npmjs.org/domutils/-/domutils-1.1.6.tgz",
+ "integrity": "sha1-vdw94Jm5ou+sxRxiPyj0FuzFdIU=",
+ "dev": true,
+ "requires": {
+ "domelementtype": "1.3.0"
+ }
+ },
+ "isarray": {
+ "version": "0.0.1",
+ "resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz",
+ "integrity": "sha1-ihis/Kmo9Bd+Cav8YDiTmwXR7t8=",
+ "dev": true
+ },
+ "readable-stream": {
+ "version": "1.0.34",
+ "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-1.0.34.tgz",
+ "integrity": "sha1-Elgg40vIQtLyqq+v5MKRbuMsFXw=",
+ "dev": true,
+ "requires": {
+ "core-util-is": "1.0.2",
+ "inherits": "2.0.3",
+ "isarray": "0.0.1",
+ "string_decoder": "0.10.31"
+ }
+ },
+ "string_decoder": {
+ "version": "0.10.31",
+ "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz",
+ "integrity": "sha1-YuIDvEF2bGwoyfyEMB2rHFMQ+pQ=",
+ "dev": true
+ }
+ }
+ },
+ "http-auth": {
+ "version": "2.4.11",
+ "resolved": "https://registry.npmjs.org/http-auth/-/http-auth-2.4.11.tgz",
+ "integrity": "sha1-YfAkpuDnxIk0lEiVyHoTlVCcYZs=",
+ "dev": true,
+ "requires": {
+ "apache-crypt": "1.1.2",
+ "apache-md5": "1.0.6",
+ "node-uuid": "1.4.8"
+ }
+ },
+ "http-deceiver": {
+ "version": "1.2.7",
+ "resolved": "https://registry.npmjs.org/http-deceiver/-/http-deceiver-1.2.7.tgz",
+ "integrity": "sha1-+nFolEq5pRnTN8sL7HKE3D5yPYc=",
+ "dev": true
+ },
+ "http-errors": {
+ "version": "1.6.3",
+ "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.6.3.tgz",
+ "integrity": "sha1-i1VoC7S+KDoLW/TqLjhYC+HZMg0=",
+ "dev": true,
+ "requires": {
+ "depd": "1.1.2",
+ "inherits": "2.0.3",
+ "setprototypeof": "1.1.0",
+ "statuses": "1.4.0"
+ }
+ },
+ "http-parser-js": {
+ "version": "0.4.13",
+ "resolved": "https://registry.npmjs.org/http-parser-js/-/http-parser-js-0.4.13.tgz",
+ "integrity": "sha1-O9bW/ebjFyyTNMOzO2wZPYD+ETc=",
+ "dev": true
+ },
+ "http-proxy": {
+ "version": "1.17.0",
+ "resolved": "https://registry.npmjs.org/http-proxy/-/http-proxy-1.17.0.tgz",
+ "integrity": "sha512-Taqn+3nNvYRfJ3bGvKfBSRwy1v6eePlm3oc/aWVxZp57DQr5Eq3xhKJi7Z4hZpS8PC3H4qI+Yly5EmFacGuA/g==",
+ "dev": true,
+ "requires": {
+ "eventemitter3": "3.1.0",
+ "follow-redirects": "1.5.7",
+ "requires-port": "1.0.0"
+ }
+ },
+ "http-proxy-middleware": {
+ "version": "0.18.0",
+ "resolved": "http://registry.npmjs.org/http-proxy-middleware/-/http-proxy-middleware-0.18.0.tgz",
+ "integrity": "sha512-Fs25KVMPAIIcgjMZkVHJoKg9VcXcC1C8yb9JUgeDvVXY0S/zgVIhMb+qVswDIgtJe2DfckMSY2d6TuTEutlk6Q==",
+ "dev": true,
+ "requires": {
+ "http-proxy": "1.17.0",
+ "is-glob": "4.0.0",
+ "lodash": "4.17.10",
+ "micromatch": "3.1.10"
+ }
+ },
+ "http-signature": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/http-signature/-/http-signature-1.2.0.tgz",
+ "integrity": "sha1-muzZJRFHcvPZW2WmCruPfBj7rOE=",
+ "dev": true,
+ "requires": {
+ "assert-plus": "1.0.0",
+ "jsprim": "1.4.1",
+ "sshpk": "1.14.2"
+ }
+ },
+ "https-browserify": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/https-browserify/-/https-browserify-1.0.0.tgz",
+ "integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM=",
+ "dev": true
+ },
+ "https-proxy-agent": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-2.2.1.tgz",
+ "integrity": "sha512-HPCTS1LW51bcyMYbxUIOO4HEOlQ1/1qRaFWcyxvwaqUS9TY88aoEuHUY33kuAh1YhVVaDQhLZsnPd+XNARWZlQ==",
+ "dev": true,
+ "requires": {
+ "agent-base": "4.2.1",
+ "debug": "3.1.0"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+ "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ }
+ }
+ },
+ "i18next": {
+ "version": "11.7.0",
+ "resolved": "https://registry.npmjs.org/i18next/-/i18next-11.7.0.tgz",
+ "integrity": "sha512-k4nu76PQMUnN4W8OGFQHK3/FWwG8k/GwXdemzMmYUVLPnpBdF6VfWbpMOpTT3DOFmFw7D6Ndj46EH1EbNNtMjw==",
+ "dev": true
+ },
+ "iconv-lite": {
+ "version": "0.4.19",
+ "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.19.tgz",
+ "integrity": "sha512-oTZqweIP51xaGPI4uPa56/Pri/480R+mo7SeU+YETByQNhDG55ycFyNLIgta9vXhILrxXDmF7ZGhqZIcuN0gJQ=="
+ },
+ "ieee754": {
+ "version": "1.1.12",
+ "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.1.12.tgz",
+ "integrity": "sha512-GguP+DRY+pJ3soyIiGPTvdiVXjZ+DbXOxGpXn3eMvNW4x4irjqXm4wHKscC+TfxSJ0yw/S1F24tqdMNsMZTiLA==",
+ "dev": true
+ },
+ "iferr": {
+ "version": "0.1.5",
+ "resolved": "https://registry.npmjs.org/iferr/-/iferr-0.1.5.tgz",
+ "integrity": "sha1-xg7taebY/bazEEofy8ocGS3FtQE=",
+ "dev": true
+ },
+ "ignore": {
+ "version": "3.3.10",
+ "resolved": "https://registry.npmjs.org/ignore/-/ignore-3.3.10.tgz",
+ "integrity": "sha512-Pgs951kaMm5GXP7MOvxERINe3gsaVjUWFm+UZPSq9xYriQAksyhg0csnS0KXSNRD5NmNdapXEpjxG49+AKh/ug==",
+ "dev": true
+ },
+ "ignorefs": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/ignorefs/-/ignorefs-1.2.0.tgz",
+ "integrity": "sha1-2ln7hYl25KXkNwLM0fKC/byeV1Y=",
+ "dev": true,
+ "requires": {
+ "editions": "1.3.4",
+ "ignorepatterns": "1.1.0"
+ }
+ },
+ "ignorepatterns": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/ignorepatterns/-/ignorepatterns-1.1.0.tgz",
+ "integrity": "sha1-rI9DbyI5td+2bV8NOpBKh6xnzF4=",
+ "dev": true
+ },
+ "image-size": {
+ "version": "0.5.5",
+ "resolved": "https://registry.npmjs.org/image-size/-/image-size-0.5.5.tgz",
+ "integrity": "sha1-Cd/Uq50g4p6xw+gLiZA3jfnjy5w=",
+ "dev": true,
+ "optional": true
+ },
+ "immediate": {
+ "version": "3.0.6",
+ "resolved": "https://registry.npmjs.org/immediate/-/immediate-3.0.6.tgz",
+ "integrity": "sha1-nbHb0Pr43m++D13V5Wu2BigN5ps=",
+ "dev": true
+ },
+ "import-cwd": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/import-cwd/-/import-cwd-2.1.0.tgz",
+ "integrity": "sha1-qmzzbnInYShcs3HsZRn1PiQ1sKk=",
+ "dev": true,
+ "requires": {
+ "import-from": "2.1.0"
+ }
+ },
+ "import-from": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/import-from/-/import-from-2.1.0.tgz",
+ "integrity": "sha1-M1238qev/VOqpHHUuAId7ja387E=",
+ "dev": true,
+ "requires": {
+ "resolve-from": "3.0.0"
+ }
+ },
+ "import-lazy": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/import-lazy/-/import-lazy-2.1.0.tgz",
+ "integrity": "sha1-BWmOPUXIjo1+nZLLBYTnfwlvPkM=",
+ "dev": true
+ },
+ "import-local": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/import-local/-/import-local-1.0.0.tgz",
+ "integrity": "sha512-vAaZHieK9qjGo58agRBg+bhHX3hoTZU/Oa3GESWLz7t1U62fk63aHuDJJEteXoDeTCcPmUT+z38gkHPZkkmpmQ==",
+ "dev": true,
+ "requires": {
+ "pkg-dir": "2.0.0",
+ "resolve-cwd": "2.0.0"
+ }
+ },
+ "imurmurhash": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz",
+ "integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=",
+ "dev": true
+ },
+ "in-publish": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/in-publish/-/in-publish-2.0.0.tgz",
+ "integrity": "sha1-4g/146KvwmkDILbcVSaCqcf631E=",
+ "dev": true
+ },
+ "indent-string": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-2.1.0.tgz",
+ "integrity": "sha1-ji1INIdCEhtKghi3oTfppSBJ3IA=",
+ "dev": true,
+ "requires": {
+ "repeating": "2.0.1"
+ }
+ },
+ "indexof": {
+ "version": "0.0.1",
+ "resolved": "https://registry.npmjs.org/indexof/-/indexof-0.0.1.tgz",
+ "integrity": "sha1-gtwzbSMrkGIXnQWrMpOmYFn9Q10=",
+ "dev": true
+ },
+ "inflight": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz",
+ "integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=",
+ "dev": true,
+ "requires": {
+ "once": "1.4.0",
+ "wrappy": "1.0.2"
+ }
+ },
+ "inherits": {
+ "version": "2.0.3",
+ "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz",
+ "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=",
+ "dev": true
+ },
+ "ini": {
+ "version": "1.3.5",
+ "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz",
+ "integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==",
+ "dev": true
+ },
+ "injection-js": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/injection-js/-/injection-js-2.2.1.tgz",
+ "integrity": "sha512-zHI+E+dM0PXix5FFTO1Y4/UOyAzE7zG1l/QwAn4jchTThOoBq+UYRFK4AVG7lQgFL+go62SbrzSsjXy9DFEZUg==",
+ "dev": true
+ },
+ "inside": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/inside/-/inside-1.0.0.tgz",
+ "integrity": "sha1-20Xpk1c82z23C5gy6ChbrUZCR3A=",
+ "dev": true
+ },
+ "internal-ip": {
+ "version": "3.0.1",
+ "resolved": "https://registry.npmjs.org/internal-ip/-/internal-ip-3.0.1.tgz",
+ "integrity": "sha512-NXXgESC2nNVtU+pqmC9e6R8B1GpKxzsAQhffvh5AL79qKnodd+L7tnEQmTiUAVngqLalPbSqRA7XGIEL5nCd0Q==",
+ "dev": true,
+ "requires": {
+ "default-gateway": "2.7.2",
+ "ipaddr.js": "1.8.0"
+ }
+ },
+ "invariant": {
+ "version": "2.2.4",
+ "resolved": "https://registry.npmjs.org/invariant/-/invariant-2.2.4.tgz",
+ "integrity": "sha512-phJfQVBuaJM5raOpJjSfkiD6BpbCE4Ns//LaXl6wGYtUBY83nWS6Rf9tXm2e8VaK60JEjYldbPif/A2B1C2gNA==",
+ "dev": true,
+ "requires": {
+ "loose-envify": "1.4.0"
+ }
+ },
+ "invert-kv": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/invert-kv/-/invert-kv-1.0.0.tgz",
+ "integrity": "sha1-EEqOSqym09jNFXqO+L+rLXo//bY=",
+ "dev": true
+ },
+ "ip": {
+ "version": "1.1.5",
+ "resolved": "https://registry.npmjs.org/ip/-/ip-1.1.5.tgz",
+ "integrity": "sha1-vd7XARQpCCjAoDnnLvJfWq7ENUo=",
+ "dev": true
+ },
+ "ip-regex": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/ip-regex/-/ip-regex-2.1.0.tgz",
+ "integrity": "sha1-+ni/XS5pE8kRzp+BnuUUa7bYROk=",
+ "dev": true
+ },
+ "ipaddr.js": {
+ "version": "1.8.0",
+ "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.8.0.tgz",
+ "integrity": "sha1-6qM9bd16zo9/b+DJygRA5wZzix4=",
+ "dev": true
+ },
+ "is-absolute": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-absolute/-/is-absolute-1.0.0.tgz",
+ "integrity": "sha512-dOWoqflvcydARa360Gvv18DZ/gRuHKi2NU/wU5X1ZFzdYfH29nkiNZsF3mp4OJ3H4yo9Mx8A/uAGNzpzPN3yBA==",
+ "dev": true,
+ "requires": {
+ "is-relative": "1.0.0",
+ "is-windows": "1.0.2"
+ }
+ },
+ "is-accessor-descriptor": {
+ "version": "0.1.6",
+ "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz",
+ "integrity": "sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=",
+ "dev": true,
+ "requires": {
+ "kind-of": "3.2.2"
+ },
+ "dependencies": {
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ }
+ }
+ },
+ "is-arrayish": {
+ "version": "0.2.1",
+ "resolved": "https://registry.npmjs.org/is-arrayish/-/is-arrayish-0.2.1.tgz",
+ "integrity": "sha1-d8mYQFJ6qOyxqLppe4BkWnqSap0=",
+ "dev": true
+ },
+ "is-binary-path": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz",
+ "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=",
+ "dev": true,
+ "requires": {
+ "binary-extensions": "1.11.0"
+ }
+ },
+ "is-buffer": {
+ "version": "1.1.6",
+ "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz",
+ "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==",
+ "dev": true
+ },
+ "is-builtin-module": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-builtin-module/-/is-builtin-module-1.0.0.tgz",
+ "integrity": "sha1-VAVy0096wxGfj3bDDLwbHgN6/74=",
+ "dev": true,
+ "requires": {
+ "builtin-modules": "1.1.1"
+ }
+ },
+ "is-callable": {
+ "version": "1.1.4",
+ "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.1.4.tgz",
+ "integrity": "sha512-r5p9sxJjYnArLjObpjA4xu5EKI3CuKHkJXMhT7kwbpUyIFD1n5PMAsoPvWnvtZiNz7LjkYDRZhd7FlI0eMijEA==",
+ "dev": true
+ },
+ "is-ci": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/is-ci/-/is-ci-1.2.0.tgz",
+ "integrity": "sha512-plgvKjQtalH2P3Gytb7L61Lmz95g2DlpzFiQyRSFew8WoJKxtKRzrZMeyRN2supblm3Psc8OQGy7Xjb6XG11jw==",
+ "dev": true,
+ "requires": {
+ "ci-info": "1.4.0"
+ }
+ },
+ "is-data-descriptor": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz",
+ "integrity": "sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=",
+ "dev": true,
+ "requires": {
+ "kind-of": "3.2.2"
+ },
+ "dependencies": {
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ }
+ }
+ },
+ "is-date-object": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.1.tgz",
+ "integrity": "sha1-mqIOtq7rv/d/vTPnTKAbM1gdOhY=",
+ "dev": true
+ },
+ "is-descriptor": {
+ "version": "0.1.6",
+ "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz",
+ "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==",
+ "dev": true,
+ "requires": {
+ "is-accessor-descriptor": "0.1.6",
+ "is-data-descriptor": "0.1.4",
+ "kind-of": "5.1.0"
+ },
+ "dependencies": {
+ "kind-of": {
+ "version": "5.1.0",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz",
+ "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==",
+ "dev": true
+ }
+ }
+ },
+ "is-directory": {
+ "version": "0.3.1",
+ "resolved": "https://registry.npmjs.org/is-directory/-/is-directory-0.3.1.tgz",
+ "integrity": "sha1-YTObbyR1/Hcv2cnYP1yFddwVSuE=",
+ "dev": true
+ },
+ "is-dotfile": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/is-dotfile/-/is-dotfile-1.0.3.tgz",
+ "integrity": "sha1-pqLzL/0t+wT1yiXs0Pa4PPeYoeE=",
+ "dev": true
+ },
+ "is-equal-shallow": {
+ "version": "0.1.3",
+ "resolved": "https://registry.npmjs.org/is-equal-shallow/-/is-equal-shallow-0.1.3.tgz",
+ "integrity": "sha1-IjgJj8Ih3gvPpdnqxMRdY4qhxTQ=",
+ "dev": true,
+ "requires": {
+ "is-primitive": "2.0.0"
+ }
+ },
+ "is-extendable": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz",
+ "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=",
+ "dev": true
+ },
+ "is-extglob": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz",
+ "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=",
+ "dev": true
+ },
+ "is-finite": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-finite/-/is-finite-1.0.2.tgz",
+ "integrity": "sha1-zGZ3aVYCvlUO8R6LSqYwU0K20Ko=",
+ "dev": true,
+ "requires": {
+ "number-is-nan": "1.0.1"
+ }
+ },
+ "is-fullwidth-code-point": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz",
+ "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=",
+ "dev": true,
+ "requires": {
+ "number-is-nan": "1.0.1"
+ }
+ },
+ "is-glob": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.0.tgz",
+ "integrity": "sha1-lSHHaEXMJhCoUgPd8ICpWML/q8A=",
+ "dev": true,
+ "requires": {
+ "is-extglob": "2.1.1"
+ }
+ },
+ "is-installed-globally": {
+ "version": "0.1.0",
+ "resolved": "https://registry.npmjs.org/is-installed-globally/-/is-installed-globally-0.1.0.tgz",
+ "integrity": "sha1-Df2Y9akRFxbdU13aZJL2e/PSWoA=",
+ "dev": true,
+ "requires": {
+ "global-dirs": "0.1.1",
+ "is-path-inside": "1.0.1"
+ }
+ },
+ "is-module": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-module/-/is-module-1.0.0.tgz",
+ "integrity": "sha1-Mlj7afeMFNW4FdZkM2tM/7ZEFZE=",
+ "dev": true
+ },
+ "is-negated-glob": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-negated-glob/-/is-negated-glob-1.0.0.tgz",
+ "integrity": "sha1-aRC8pdqMleeEtXUbl2z1oQ/uNtI=",
+ "dev": true
+ },
+ "is-npm": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-npm/-/is-npm-1.0.0.tgz",
+ "integrity": "sha1-8vtjpl5JBbQGyGBydloaTceTufQ=",
+ "dev": true
+ },
+ "is-number": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz",
+ "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=",
+ "dev": true,
+ "requires": {
+ "kind-of": "3.2.2"
+ },
+ "dependencies": {
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ }
+ }
+ },
+ "is-obj": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/is-obj/-/is-obj-1.0.1.tgz",
+ "integrity": "sha1-PkcprB9f3gJc19g6iW2rn09n2w8=",
+ "dev": true
+ },
+ "is-path-cwd": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-path-cwd/-/is-path-cwd-1.0.0.tgz",
+ "integrity": "sha1-0iXsIxMuie3Tj9p2dHLmLmXxEG0=",
+ "dev": true
+ },
+ "is-path-in-cwd": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/is-path-in-cwd/-/is-path-in-cwd-1.0.1.tgz",
+ "integrity": "sha512-FjV1RTW48E7CWM7eE/J2NJvAEEVektecDBVBE5Hh3nM1Jd0kvhHtX68Pr3xsDf857xt3Y4AkwVULK1Vku62aaQ==",
+ "dev": true,
+ "requires": {
+ "is-path-inside": "1.0.1"
+ }
+ },
+ "is-path-inside": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-1.0.1.tgz",
+ "integrity": "sha1-jvW33lBDej/cprToZe96pVy0gDY=",
+ "dev": true,
+ "requires": {
+ "path-is-inside": "1.0.2"
+ }
+ },
+ "is-plain-object": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz",
+ "integrity": "sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==",
+ "dev": true,
+ "requires": {
+ "isobject": "3.0.1"
+ }
+ },
+ "is-posix-bracket": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/is-posix-bracket/-/is-posix-bracket-0.1.1.tgz",
+ "integrity": "sha1-MzTceXdDaOkvAW5vvAqI9c1ua8Q=",
+ "dev": true
+ },
+ "is-primitive": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/is-primitive/-/is-primitive-2.0.0.tgz",
+ "integrity": "sha1-IHurkWOEmcB7Kt8kCkGochADRXU=",
+ "dev": true
+ },
+ "is-redirect": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-redirect/-/is-redirect-1.0.0.tgz",
+ "integrity": "sha1-HQPd7VO9jbDzDCbk+V02/HyH3CQ=",
+ "dev": true
+ },
+ "is-regex": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.0.4.tgz",
+ "integrity": "sha1-VRdIm1RwkbCTDglWVM7SXul+lJE=",
+ "dev": true,
+ "requires": {
+ "has": "1.0.3"
+ }
+ },
+ "is-relative": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-relative/-/is-relative-1.0.0.tgz",
+ "integrity": "sha512-Kw/ReK0iqwKeu0MITLFuj0jbPAmEiOsIwyIXvvbfa6QfmN9pkD1M+8pdk7Rl/dTKbH34/XBFMbgD4iMJhLQbGA==",
+ "dev": true,
+ "requires": {
+ "is-unc-path": "1.0.0"
+ }
+ },
+ "is-retry-allowed": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/is-retry-allowed/-/is-retry-allowed-1.1.0.tgz",
+ "integrity": "sha1-EaBgVotnM5REAz0BJaYaINVk+zQ=",
+ "dev": true
+ },
+ "is-stream": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/is-stream/-/is-stream-1.1.0.tgz",
+ "integrity": "sha1-EtSj3U5o4Lec6428hBc66A2RykQ=",
+ "dev": true
+ },
+ "is-symbol": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.1.tgz",
+ "integrity": "sha1-PMWfAAJRlLarLjjbrmaJJWtmBXI=",
+ "dev": true
+ },
+ "is-typedarray": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-typedarray/-/is-typedarray-1.0.0.tgz",
+ "integrity": "sha1-5HnICFjfDBsR3dppQPlgEfzaSpo=",
+ "dev": true
+ },
+ "is-unc-path": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-unc-path/-/is-unc-path-1.0.0.tgz",
+ "integrity": "sha512-mrGpVd0fs7WWLfVsStvgF6iEJnbjDFZh9/emhRDcGWTduTfNHd9CHeUwH3gYIjdbwo4On6hunkztwOaAw0yllQ==",
+ "dev": true,
+ "requires": {
+ "unc-path-regex": "0.1.2"
+ }
+ },
+ "is-utf8": {
+ "version": "0.2.1",
+ "resolved": "https://registry.npmjs.org/is-utf8/-/is-utf8-0.2.1.tgz",
+ "integrity": "sha1-Sw2hRCEE0bM2NA6AeX6GXPOffXI=",
+ "dev": true
+ },
+ "is-windows": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-windows/-/is-windows-1.0.2.tgz",
+ "integrity": "sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==",
+ "dev": true
+ },
+ "is-wsl": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz",
+ "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=",
+ "dev": true
+ },
+ "isarray": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz",
+ "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=",
+ "dev": true
+ },
+ "isbinaryfile": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/isbinaryfile/-/isbinaryfile-3.0.3.tgz",
+ "integrity": "sha512-8cJBL5tTd2OS0dM4jz07wQd5g0dCCqIhUxPIGtZfa5L6hWlvV5MHTITy/DBAsF+Oe2LS1X3krBUhNwaGUWpWxw==",
+ "dev": true,
+ "requires": {
+ "buffer-alloc": "1.2.0"
+ }
+ },
+ "isexe": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz",
+ "integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA=",
+ "dev": true
+ },
+ "isobject": {
+ "version": "3.0.1",
+ "resolved": "https://registry.npmjs.org/isobject/-/isobject-3.0.1.tgz",
+ "integrity": "sha1-TkMekrEalzFjaqH5yNHMvP2reN8=",
+ "dev": true
+ },
+ "isstream": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/isstream/-/isstream-0.1.2.tgz",
+ "integrity": "sha1-R+Y/evVa+m+S4VAOaQ64uFKcCZo=",
+ "dev": true
+ },
+ "istanbul": {
+ "version": "0.4.5",
+ "resolved": "https://registry.npmjs.org/istanbul/-/istanbul-0.4.5.tgz",
+ "integrity": "sha1-ZcfXPUxNqE1POsMQuRj7C4Azczs=",
+ "dev": true,
+ "requires": {
+ "abbrev": "1.0.9",
+ "async": "1.5.2",
+ "escodegen": "1.8.1",
+ "esprima": "2.7.3",
+ "glob": "5.0.15",
+ "handlebars": "4.0.12",
+ "js-yaml": "3.12.0",
+ "mkdirp": "0.5.1",
+ "nopt": "3.0.6",
+ "once": "1.4.0",
+ "resolve": "1.1.7",
+ "supports-color": "3.2.3",
+ "which": "1.3.1",
+ "wordwrap": "1.0.0"
+ },
+ "dependencies": {
+ "glob": {
+ "version": "5.0.15",
+ "resolved": "https://registry.npmjs.org/glob/-/glob-5.0.15.tgz",
+ "integrity": "sha1-G8k2ueAvSmA/zCIuz3Yz0wuLk7E=",
+ "dev": true,
+ "requires": {
+ "inflight": "1.0.6",
+ "inherits": "2.0.3",
+ "minimatch": "3.0.4",
+ "once": "1.4.0",
+ "path-is-absolute": "1.0.1"
+ }
+ },
+ "has-flag": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-1.0.0.tgz",
+ "integrity": "sha1-nZ55MWXOAXoA8AQYxD+UKnsdEfo=",
+ "dev": true
+ },
+ "resolve": {
+ "version": "1.1.7",
+ "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.1.7.tgz",
+ "integrity": "sha1-IDEU2CrSxe2ejgQRs5ModeiJ6Xs=",
+ "dev": true
+ },
+ "supports-color": {
+ "version": "3.2.3",
+ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-3.2.3.tgz",
+ "integrity": "sha1-ZawFBLOVQXHYpklGsq48u4pfVPY=",
+ "dev": true,
+ "requires": {
+ "has-flag": "1.0.0"
+ }
+ }
+ }
+ },
+ "istanbul-api": {
+ "version": "1.3.7",
+ "resolved": "https://registry.npmjs.org/istanbul-api/-/istanbul-api-1.3.7.tgz",
+ "integrity": "sha512-4/ApBnMVeEPG3EkSzcw25wDe4N66wxwn+KKn6b47vyek8Xb3NBAcg4xfuQbS7BqcZuTX4wxfD5lVagdggR3gyA==",
+ "dev": true,
+ "requires": {
+ "async": "2.6.1",
+ "fileset": "2.0.3",
+ "istanbul-lib-coverage": "1.2.1",
+ "istanbul-lib-hook": "1.2.2",
+ "istanbul-lib-instrument": "1.10.2",
+ "istanbul-lib-report": "1.1.5",
+ "istanbul-lib-source-maps": "1.2.6",
+ "istanbul-reports": "1.5.1",
+ "js-yaml": "3.12.0",
+ "mkdirp": "0.5.1",
+ "once": "1.4.0"
+ },
+ "dependencies": {
+ "async": {
+ "version": "2.6.1",
+ "resolved": "https://registry.npmjs.org/async/-/async-2.6.1.tgz",
+ "integrity": "sha512-fNEiL2+AZt6AlAw/29Cr0UDe4sRAHCpEHh54WMz+Bb7QfNcFw4h3loofyJpLeQs4Yx7yuqu/2dLgM5hKOs6HlQ==",
+ "dev": true,
+ "requires": {
+ "lodash": "4.17.10"
+ }
+ }
+ }
+ },
+ "istanbul-instrumenter-loader": {
+ "version": "3.0.1",
+ "resolved": "https://registry.npmjs.org/istanbul-instrumenter-loader/-/istanbul-instrumenter-loader-3.0.1.tgz",
+ "integrity": "sha512-a5SPObZgS0jB/ixaKSMdn6n/gXSrK2S6q/UfRJBT3e6gQmVjwZROTODQsYW5ZNwOu78hG62Y3fWlebaVOL0C+w==",
+ "dev": true,
+ "requires": {
+ "convert-source-map": "1.6.0",
+ "istanbul-lib-instrument": "1.10.2",
+ "loader-utils": "1.1.0",
+ "schema-utils": "0.3.0"
+ },
+ "dependencies": {
+ "ajv": {
+ "version": "5.5.2",
+ "resolved": "https://registry.npmjs.org/ajv/-/ajv-5.5.2.tgz",
+ "integrity": "sha1-c7Xuyj+rZT49P5Qis0GtQiBdyWU=",
+ "dev": true,
+ "requires": {
+ "co": "4.6.0",
+ "fast-deep-equal": "1.1.0",
+ "fast-json-stable-stringify": "2.0.0",
+ "json-schema-traverse": "0.3.1"
+ }
+ },
+ "schema-utils": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-0.3.0.tgz",
+ "integrity": "sha1-9YdyIs4+kx7a4DnxfrNxbnE3+M8=",
+ "dev": true,
+ "requires": {
+ "ajv": "5.5.2"
+ }
+ }
+ }
+ },
+ "istanbul-lib-coverage": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/istanbul-lib-coverage/-/istanbul-lib-coverage-1.2.1.tgz",
+ "integrity": "sha512-PzITeunAgyGbtY1ibVIUiV679EFChHjoMNRibEIobvmrCRaIgwLxNucOSimtNWUhEib/oO7QY2imD75JVgCJWQ==",
+ "dev": true
+ },
+ "istanbul-lib-hook": {
+ "version": "1.2.2",
+ "resolved": "https://registry.npmjs.org/istanbul-lib-hook/-/istanbul-lib-hook-1.2.2.tgz",
+ "integrity": "sha512-/Jmq7Y1VeHnZEQ3TL10VHyb564mn6VrQXHchON9Jf/AEcmQ3ZIiyD1BVzNOKTZf/G3gE+kiGK6SmpF9y3qGPLw==",
+ "dev": true,
+ "requires": {
+ "append-transform": "0.4.0"
+ }
+ },
+ "istanbul-lib-instrument": {
+ "version": "1.10.2",
+ "resolved": "https://registry.npmjs.org/istanbul-lib-instrument/-/istanbul-lib-instrument-1.10.2.tgz",
+ "integrity": "sha512-aWHxfxDqvh/ZlxR8BBaEPVSWDPUkGD63VjGQn3jcw8jCp7sHEMKcrj4xfJn/ABzdMEHiQNyvDQhqm5o8+SQg7A==",
+ "dev": true,
+ "requires": {
+ "babel-generator": "6.26.1",
+ "babel-template": "6.26.0",
+ "babel-traverse": "6.26.0",
+ "babel-types": "6.26.0",
+ "babylon": "6.18.0",
+ "istanbul-lib-coverage": "1.2.1",
+ "semver": "5.5.1"
+ }
+ },
+ "istanbul-lib-report": {
+ "version": "1.1.5",
+ "resolved": "https://registry.npmjs.org/istanbul-lib-report/-/istanbul-lib-report-1.1.5.tgz",
+ "integrity": "sha512-UsYfRMoi6QO/doUshYNqcKJqVmFe9w51GZz8BS3WB0lYxAllQYklka2wP9+dGZeHYaWIdcXUx8JGdbqaoXRXzw==",
+ "dev": true,
+ "requires": {
+ "istanbul-lib-coverage": "1.2.1",
+ "mkdirp": "0.5.1",
+ "path-parse": "1.0.6",
+ "supports-color": "3.2.3"
+ },
+ "dependencies": {
+ "has-flag": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-1.0.0.tgz",
+ "integrity": "sha1-nZ55MWXOAXoA8AQYxD+UKnsdEfo=",
+ "dev": true
+ },
+ "supports-color": {
+ "version": "3.2.3",
+ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-3.2.3.tgz",
+ "integrity": "sha1-ZawFBLOVQXHYpklGsq48u4pfVPY=",
+ "dev": true,
+ "requires": {
+ "has-flag": "1.0.0"
+ }
+ }
+ }
+ },
+ "istanbul-lib-source-maps": {
+ "version": "1.2.6",
+ "resolved": "https://registry.npmjs.org/istanbul-lib-source-maps/-/istanbul-lib-source-maps-1.2.6.tgz",
+ "integrity": "sha512-TtbsY5GIHgbMsMiRw35YBHGpZ1DVFEO19vxxeiDMYaeOFOCzfnYVxvl6pOUIZR4dtPhAGpSMup8OyF8ubsaqEg==",
+ "dev": true,
+ "requires": {
+ "debug": "3.1.0",
+ "istanbul-lib-coverage": "1.2.1",
+ "mkdirp": "0.5.1",
+ "rimraf": "2.6.2",
+ "source-map": "0.5.7"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+ "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ }
+ }
+ },
+ "istanbul-reports": {
+ "version": "1.5.1",
+ "resolved": "https://registry.npmjs.org/istanbul-reports/-/istanbul-reports-1.5.1.tgz",
+ "integrity": "sha512-+cfoZ0UXzWjhAdzosCPP3AN8vvef8XDkWtTfgaN+7L3YTpNYITnCaEkceo5SEYy644VkHka/P1FvkWvrG/rrJw==",
+ "dev": true,
+ "requires": {
+ "handlebars": "4.0.12"
+ }
+ },
+ "jasmine": {
+ "version": "2.8.0",
+ "resolved": "https://registry.npmjs.org/jasmine/-/jasmine-2.8.0.tgz",
+ "integrity": "sha1-awicChFXax8W3xG4AUbZHU6Lij4=",
+ "dev": true,
+ "requires": {
+ "exit": "0.1.2",
+ "glob": "7.1.3",
+ "jasmine-core": "2.8.0"
+ },
+ "dependencies": {
+ "jasmine-core": {
+ "version": "2.8.0",
+ "resolved": "https://registry.npmjs.org/jasmine-core/-/jasmine-core-2.8.0.tgz",
+ "integrity": "sha1-vMl5rh+f0FcB5F5S5l06XWPxok4=",
+ "dev": true
+ }
+ }
+ },
+ "jasmine-core": {
+ "version": "2.99.1",
+ "resolved": "https://registry.npmjs.org/jasmine-core/-/jasmine-core-2.99.1.tgz",
+ "integrity": "sha1-5kAN8ea1bhMLYcS80JPap/boyhU=",
+ "dev": true
+ },
+ "jasmine-diff": {
+ "version": "0.1.3",
+ "resolved": "https://registry.npmjs.org/jasmine-diff/-/jasmine-diff-0.1.3.tgz",
+ "integrity": "sha1-k8zC3MQQKMXd1GBlWAdIOfLe6qg=",
+ "dev": true,
+ "requires": {
+ "diff": "3.5.0"
+ }
+ },
+ "jasmine-spec-reporter": {
+ "version": "4.2.1",
+ "resolved": "https://registry.npmjs.org/jasmine-spec-reporter/-/jasmine-spec-reporter-4.2.1.tgz",
+ "integrity": "sha512-FZBoZu7VE5nR7Nilzy+Np8KuVIOxF4oXDPDknehCYBDE080EnlPu0afdZNmpGDBRCUBv3mj5qgqCRmk6W/K8vg==",
+ "dev": true,
+ "requires": {
+ "colors": "1.1.2"
+ }
+ },
+ "jasminewd2": {
+ "version": "2.2.0",
+ "resolved": "https://registry.npmjs.org/jasminewd2/-/jasminewd2-2.2.0.tgz",
+ "integrity": "sha1-43zwsX8ZnM4jvqcbIDk5Uka07E4=",
+ "dev": true
+ },
+ "js-base64": {
+ "version": "2.4.9",
+ "resolved": "https://registry.npmjs.org/js-base64/-/js-base64-2.4.9.tgz",
+ "integrity": "sha512-xcinL3AuDJk7VSzsHgb9DvvIXayBbadtMZ4HFPx8rUszbW1MuNMlwYVC4zzCZ6e1sqZpnNS5ZFYOhXqA39T7LQ==",
+ "dev": true
+ },
+ "js-tokens": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-3.0.2.tgz",
+ "integrity": "sha1-mGbfOVECEw449/mWvOtlRDIJwls=",
+ "dev": true
+ },
+ "js-yaml": {
+ "version": "3.12.0",
+ "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-3.12.0.tgz",
+ "integrity": "sha512-PIt2cnwmPfL4hKNwqeiuz4bKfnzHTBv6HyVgjahA6mPLwPDzjDWrplJBMjHUFxku/N3FlmrbyPclad+I+4mJ3A==",
+ "dev": true,
+ "requires": {
+ "argparse": "1.0.10",
+ "esprima": "4.0.1"
+ },
+ "dependencies": {
+ "esprima": {
+ "version": "4.0.1",
+ "resolved": "https://registry.npmjs.org/esprima/-/esprima-4.0.1.tgz",
+ "integrity": "sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==",
+ "dev": true
+ }
+ }
+ },
+ "jsbn": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/jsbn/-/jsbn-0.1.1.tgz",
+ "integrity": "sha1-peZUwuWi3rXyAdls77yoDA7y9RM=",
+ "dev": true,
+ "optional": true
+ },
+ "jsesc": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-1.3.0.tgz",
+ "integrity": "sha1-RsP+yMGJKxKwgz25vHYiF226s0s=",
+ "dev": true
+ },
+ "json-parse-better-errors": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/json-parse-better-errors/-/json-parse-better-errors-1.0.2.tgz",
+ "integrity": "sha512-mrqyZKfX5EhL7hvqcV6WG1yYjnjeuYDzDhhcAAUrq8Po85NBQBJP+ZDUT75qZQ98IkUoBqdkExkukOU7Ts2wrw==",
+ "dev": true
+ },
+ "json-schema": {
+ "version": "0.2.3",
+ "resolved": "https://registry.npmjs.org/json-schema/-/json-schema-0.2.3.tgz",
+ "integrity": "sha1-tIDIkuWaLwWVTOcnvT8qTogvnhM=",
+ "dev": true
+ },
+ "json-schema-traverse": {
+ "version": "0.3.1",
+ "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.3.1.tgz",
+ "integrity": "sha1-NJptRMU6Ud6JtAgFxdXlm0F9M0A=",
+ "dev": true
+ },
+ "json-stringify-safe": {
+ "version": "5.0.1",
+ "resolved": "https://registry.npmjs.org/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz",
+ "integrity": "sha1-Epai1Y/UXxmg9s4B1lcB4sc1tus=",
+ "dev": true
+ },
+ "json3": {
+ "version": "3.3.2",
+ "resolved": "https://registry.npmjs.org/json3/-/json3-3.3.2.tgz",
+ "integrity": "sha1-PAQ0dD35Pi9cQq7nsZvLSDV19OE=",
+ "dev": true
+ },
+ "json5": {
+ "version": "0.5.1",
+ "resolved": "https://registry.npmjs.org/json5/-/json5-0.5.1.tgz",
+ "integrity": "sha1-Hq3nrMASA0rYTiOWdn6tn6VJWCE=",
+ "dev": true
+ },
+ "jsonfile": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/jsonfile/-/jsonfile-4.0.0.tgz",
+ "integrity": "sha1-h3Gq4HmbZAdrdmQPygWPnBDjPss=",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11"
+ }
+ },
+ "jsprim": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/jsprim/-/jsprim-1.4.1.tgz",
+ "integrity": "sha1-MT5mvB5cwG5Di8G3SZwuXFastqI=",
+ "dev": true,
+ "requires": {
+ "assert-plus": "1.0.0",
+ "extsprintf": "1.3.0",
+ "json-schema": "0.2.3",
+ "verror": "1.10.0"
+ }
+ },
+ "jszip": {
+ "version": "3.1.5",
+ "resolved": "https://registry.npmjs.org/jszip/-/jszip-3.1.5.tgz",
+ "integrity": "sha512-5W8NUaFRFRqTOL7ZDDrx5qWHJyBXy6velVudIzQUSoqAAYqzSh2Z7/m0Rf1QbmQJccegD0r+YZxBjzqoBiEeJQ==",
+ "dev": true,
+ "requires": {
+ "core-js": "2.3.0",
+ "es6-promise": "3.0.2",
+ "lie": "3.1.1",
+ "pako": "1.0.6",
+ "readable-stream": "2.0.6"
+ },
+ "dependencies": {
+ "core-js": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/core-js/-/core-js-2.3.0.tgz",
+ "integrity": "sha1-+rg/uwstjchfpjbEudNMdUIMbWU=",
+ "dev": true
+ },
+ "es6-promise": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/es6-promise/-/es6-promise-3.0.2.tgz",
+ "integrity": "sha1-AQ1YWEI6XxGJeWZfRkhqlcbuK7Y=",
+ "dev": true
+ },
+ "process-nextick-args": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-1.0.7.tgz",
+ "integrity": "sha1-FQ4gt1ZZCtP5EJPyWk8q2L/zC6M=",
+ "dev": true
+ },
+ "readable-stream": {
+ "version": "2.0.6",
+ "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.0.6.tgz",
+ "integrity": "sha1-j5A0HmilPMySh4jaz80Rs265t44=",
+ "dev": true,
+ "requires": {
+ "core-util-is": "1.0.2",
+ "inherits": "2.0.3",
+ "isarray": "1.0.0",
+ "process-nextick-args": "1.0.7",
+ "string_decoder": "0.10.31",
+ "util-deprecate": "1.0.2"
+ }
+ },
+ "string_decoder": {
+ "version": "0.10.31",
+ "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz",
+ "integrity": "sha1-YuIDvEF2bGwoyfyEMB2rHFMQ+pQ=",
+ "dev": true
+ }
+ }
+ },
+ "karma": {
+ "version": "1.7.1",
+ "resolved": "https://registry.npmjs.org/karma/-/karma-1.7.1.tgz",
+ "integrity": "sha512-k5pBjHDhmkdaUccnC7gE3mBzZjcxyxYsYVaqiL2G5AqlfLyBO5nw2VdNK+O16cveEPd/gIOWULH7gkiYYwVNHg==",
+ "dev": true,
+ "requires": {
+ "bluebird": "3.5.2",
+ "body-parser": "1.18.2",
+ "chokidar": "1.7.0",
+ "colors": "1.1.2",
+ "combine-lists": "1.0.1",
+ "connect": "3.6.6",
+ "core-js": "2.5.7",
+ "di": "0.0.1",
+ "dom-serialize": "2.2.1",
+ "expand-braces": "0.1.2",
+ "glob": "7.1.3",
+ "graceful-fs": "4.1.11",
+ "http-proxy": "1.17.0",
+ "isbinaryfile": "3.0.3",
+ "lodash": "3.10.1",
+ "log4js": "0.6.38",
+ "mime": "1.6.0",
+ "minimatch": "3.0.4",
+ "optimist": "0.6.1",
+ "qjobs": "1.2.0",
+ "range-parser": "1.2.0",
+ "rimraf": "2.6.2",
+ "safe-buffer": "5.1.2",
+ "socket.io": "1.7.3",
+ "source-map": "0.5.7",
+ "tmp": "0.0.31",
+ "useragent": "2.3.0"
+ },
+ "dependencies": {
+ "anymatch": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-1.3.2.tgz",
+ "integrity": "sha512-0XNayC8lTHQ2OI8aljNCN3sSx6hsr/1+rlcDAotXJR7C1oZZHCNsfpbKwMjRA3Uqb5tF1Rae2oloTr4xpq+WjA==",
+ "dev": true,
+ "requires": {
+ "micromatch": "2.3.11",
+ "normalize-path": "2.1.1"
+ }
+ },
+ "arr-diff": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-2.0.0.tgz",
+ "integrity": "sha1-jzuCf5Vai9ZpaX5KQlasPOrjVs8=",
+ "dev": true,
+ "requires": {
+ "arr-flatten": "1.1.0"
+ }
+ },
+ "array-unique": {
+ "version": "0.2.1",
+ "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.2.1.tgz",
+ "integrity": "sha1-odl8yvy8JiXMcPrc6zalDFiwGlM=",
+ "dev": true
+ },
+ "braces": {
+ "version": "1.8.5",
+ "resolved": "https://registry.npmjs.org/braces/-/braces-1.8.5.tgz",
+ "integrity": "sha1-uneWLhLf+WnWt2cR6RS3N4V79qc=",
+ "dev": true,
+ "requires": {
+ "expand-range": "1.8.2",
+ "preserve": "0.2.0",
+ "repeat-element": "1.1.3"
+ }
+ },
+ "chokidar": {
+ "version": "1.7.0",
+ "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-1.7.0.tgz",
+ "integrity": "sha1-eY5ol3gVHIB2tLNg5e3SjNortGg=",
+ "dev": true,
+ "requires": {
+ "anymatch": "1.3.2",
+ "async-each": "1.0.1",
+ "fsevents": "1.2.4",
+ "glob-parent": "2.0.0",
+ "inherits": "2.0.3",
+ "is-binary-path": "1.0.1",
+ "is-glob": "2.0.1",
+ "path-is-absolute": "1.0.1",
+ "readdirp": "2.1.0"
+ }
+ },
+ "expand-brackets": {
+ "version": "0.1.5",
+ "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-0.1.5.tgz",
+ "integrity": "sha1-3wcoTjQqgHzXM6xa9yQR5YHRF3s=",
+ "dev": true,
+ "requires": {
+ "is-posix-bracket": "0.1.1"
+ }
+ },
+ "extglob": {
+ "version": "0.3.2",
+ "resolved": "https://registry.npmjs.org/extglob/-/extglob-0.3.2.tgz",
+ "integrity": "sha1-Lhj/PS9JqydlzskCPwEdqo2DSaE=",
+ "dev": true,
+ "requires": {
+ "is-extglob": "1.0.0"
+ }
+ },
+ "glob-parent": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-2.0.0.tgz",
+ "integrity": "sha1-gTg9ctsFT8zPUzbaqQLxgvbtuyg=",
+ "dev": true,
+ "requires": {
+ "is-glob": "2.0.1"
+ }
+ },
+ "is-extglob": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-1.0.0.tgz",
+ "integrity": "sha1-rEaBd8SUNAWgkvyPKXYMb/xiBsA=",
+ "dev": true
+ },
+ "is-glob": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-2.0.1.tgz",
+ "integrity": "sha1-0Jb5JqPe1WAPP9/ZEZjLCIjC2GM=",
+ "dev": true,
+ "requires": {
+ "is-extglob": "1.0.0"
+ }
+ },
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ },
+ "lodash": {
+ "version": "3.10.1",
+ "resolved": "http://registry.npmjs.org/lodash/-/lodash-3.10.1.tgz",
+ "integrity": "sha1-W/Rejkm6QYnhfUgnid/RW9FAt7Y=",
+ "dev": true
+ },
+ "micromatch": {
+ "version": "2.3.11",
+ "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-2.3.11.tgz",
+ "integrity": "sha1-hmd8l9FyCzY0MdBNDRUpO9OMFWU=",
+ "dev": true,
+ "requires": {
+ "arr-diff": "2.0.0",
+ "array-unique": "0.2.1",
+ "braces": "1.8.5",
+ "expand-brackets": "0.1.5",
+ "extglob": "0.3.2",
+ "filename-regex": "2.0.1",
+ "is-extglob": "1.0.0",
+ "is-glob": "2.0.1",
+ "kind-of": "3.2.2",
+ "normalize-path": "2.1.1",
+ "object.omit": "2.0.1",
+ "parse-glob": "3.0.4",
+ "regex-cache": "0.4.4"
+ }
+ }
+ }
+ },
+ "karma-chrome-launcher": {
+ "version": "2.2.0",
+ "resolved": "https://registry.npmjs.org/karma-chrome-launcher/-/karma-chrome-launcher-2.2.0.tgz",
+ "integrity": "sha512-uf/ZVpAabDBPvdPdveyk1EPgbnloPvFFGgmRhYLTDH7gEB4nZdSBk8yTU47w1g/drLSx5uMOkjKk7IWKfWg/+w==",
+ "dev": true,
+ "requires": {
+ "fs-access": "1.0.1",
+ "which": "1.3.1"
+ }
+ },
+ "karma-coverage-istanbul-reporter": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/karma-coverage-istanbul-reporter/-/karma-coverage-istanbul-reporter-1.4.3.tgz",
+ "integrity": "sha1-O13/RmT6W41RlrmInj9hwforgNk=",
+ "dev": true,
+ "requires": {
+ "istanbul-api": "1.3.7",
+ "minimatch": "3.0.4"
+ }
+ },
+ "karma-firefox-launcher": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/karma-firefox-launcher/-/karma-firefox-launcher-1.1.0.tgz",
+ "integrity": "sha512-LbZ5/XlIXLeQ3cqnCbYLn+rOVhuMIK9aZwlP6eOLGzWdo1UVp7t6CN3DP4SafiRLjexKwHeKHDm0c38Mtd3VxA==",
+ "dev": true
+ },
+ "karma-jasmine": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/karma-jasmine/-/karma-jasmine-1.1.2.tgz",
+ "integrity": "sha1-OU8rJf+0pkS5rabyLUQ+L9CIhsM=",
+ "dev": true
+ },
+ "karma-jasmine-html-reporter": {
+ "version": "0.2.2",
+ "resolved": "https://registry.npmjs.org/karma-jasmine-html-reporter/-/karma-jasmine-html-reporter-0.2.2.tgz",
+ "integrity": "sha1-SKjl7xiAdhfuK14zwRlMNbQ5Ukw=",
+ "dev": true,
+ "requires": {
+ "karma-jasmine": "1.1.2"
+ }
+ },
+ "karma-source-map-support": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/karma-source-map-support/-/karma-source-map-support-1.3.0.tgz",
+ "integrity": "sha512-HcPqdAusNez/ywa+biN4EphGz62MmQyPggUsDfsHqa7tSe4jdsxgvTKuDfIazjL+IOxpVWyT7Pr4dhAV+sxX5Q==",
+ "dev": true,
+ "requires": {
+ "source-map-support": "0.5.9"
+ }
+ },
+ "killable": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/killable/-/killable-1.0.0.tgz",
+ "integrity": "sha1-2ouEvUfeU5WHj5XWTQLyRJ/gXms=",
+ "dev": true
+ },
+ "kind-of": {
+ "version": "6.0.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-6.0.2.tgz",
+ "integrity": "sha512-s5kLOcnH0XqDO+FvuaLX8DDjZ18CGFk7VygH40QoKPUQhW4e2rvM0rwUq0t8IQDOwYSeLK01U90OjzBTme2QqA==",
+ "dev": true
+ },
+ "latest-version": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/latest-version/-/latest-version-3.1.0.tgz",
+ "integrity": "sha1-ogU4P+oyKzO1rjsYq+4NwvNW7hU=",
+ "dev": true,
+ "requires": {
+ "package-json": "4.0.1"
+ }
+ },
+ "lazy-cache": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/lazy-cache/-/lazy-cache-1.0.4.tgz",
+ "integrity": "sha1-odePw6UEdMuAhF07O24dpJpEbo4=",
+ "dev": true,
+ "optional": true
+ },
+ "lcid": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/lcid/-/lcid-1.0.0.tgz",
+ "integrity": "sha1-MIrMr6C8SDo4Z7S28rlQYlHRuDU=",
+ "dev": true,
+ "requires": {
+ "invert-kv": "1.0.0"
+ }
+ },
+ "leb": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/leb/-/leb-0.3.0.tgz",
+ "integrity": "sha1-Mr7p+tFoMo1q6oUi2DP0GA7tHaM=",
+ "dev": true
+ },
+ "less": {
+ "version": "3.8.1",
+ "resolved": "https://registry.npmjs.org/less/-/less-3.8.1.tgz",
+ "integrity": "sha512-8HFGuWmL3FhQR0aH89escFNBQH/nEiYPP2ltDFdQw2chE28Yx2E3lhAIq9Y2saYwLSwa699s4dBVEfCY8Drf7Q==",
+ "dev": true,
+ "requires": {
+ "clone": "2.1.2",
+ "errno": "0.1.7",
+ "graceful-fs": "4.1.11",
+ "image-size": "0.5.5",
+ "mime": "1.6.0",
+ "mkdirp": "0.5.1",
+ "promise": "7.3.1",
+ "request": "2.88.0",
+ "source-map": "0.6.1"
+ },
+ "dependencies": {
+ "source-map": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+ "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+ "dev": true,
+ "optional": true
+ }
+ }
+ },
+ "less-loader": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/less-loader/-/less-loader-4.1.0.tgz",
+ "integrity": "sha512-KNTsgCE9tMOM70+ddxp9yyt9iHqgmSs0yTZc5XH5Wo+g80RWRIYNqE58QJKm/yMud5wZEvz50ugRDuzVIkyahg==",
+ "dev": true,
+ "requires": {
+ "clone": "2.1.2",
+ "loader-utils": "1.1.0",
+ "pify": "3.0.0"
+ }
+ },
+ "levn": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/levn/-/levn-0.3.0.tgz",
+ "integrity": "sha1-OwmSTt+fCDwEkP3UwLxEIeBHZO4=",
+ "dev": true,
+ "requires": {
+ "prelude-ls": "1.1.2",
+ "type-check": "0.3.2"
+ }
+ },
+ "license-webpack-plugin": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/license-webpack-plugin/-/license-webpack-plugin-1.4.0.tgz",
+ "integrity": "sha512-iwuNFMWbXS76WiQXJBTs8/7Tby4NQnY8AIkBMuJG5El79UT8zWrJQMfpW+KRXt4Y2Bs5uk+Myg/MO7ROSF8jzA==",
+ "dev": true,
+ "requires": {
+ "ejs": "2.6.1"
+ }
+ },
+ "lie": {
+ "version": "3.1.1",
+ "resolved": "https://registry.npmjs.org/lie/-/lie-3.1.1.tgz",
+ "integrity": "sha1-mkNrLMd0bKWd56QfpGmz77dr2H4=",
+ "dev": true,
+ "requires": {
+ "immediate": "3.0.6"
+ }
+ },
+ "live-server": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/live-server/-/live-server-1.1.0.tgz",
+ "integrity": "sha1-pp8ObKWB4DkapXlBlw4XwwjdSGk=",
+ "dev": true,
+ "requires": {
+ "colors": "1.3.2",
+ "connect": "3.4.1",
+ "cors": "2.8.4",
+ "event-stream": "3.3.5",
+ "faye-websocket": "0.11.1",
+ "http-auth": "2.4.11",
+ "morgan": "1.9.0",
+ "object-assign": "4.1.1",
+ "opn": "5.3.0",
+ "proxy-middleware": "0.15.0",
+ "send": "0.16.2",
+ "serve-index": "1.9.1",
+ "watchr": "2.6.0"
+ },
+ "dependencies": {
+ "colors": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/colors/-/colors-1.3.2.tgz",
+ "integrity": "sha512-rhP0JSBGYvpcNQj4s5AdShMeE5ahMop96cTeDl/v9qQQm2fYClE2QXZRi8wLzc+GmXSxdIqqbOIAhyObEXDbfQ==",
+ "dev": true
+ },
+ "connect": {
+ "version": "3.4.1",
+ "resolved": "https://registry.npmjs.org/connect/-/connect-3.4.1.tgz",
+ "integrity": "sha1-ohNh0/QJnvdhzabcSpc7seuwo00=",
+ "dev": true,
+ "requires": {
+ "debug": "2.2.0",
+ "finalhandler": "0.4.1",
+ "parseurl": "1.3.2",
+ "utils-merge": "1.0.0"
+ }
+ },
+ "debug": {
+ "version": "2.2.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz",
+ "integrity": "sha1-+HBX6ZWxofauaklgZkE3vFbwOdo=",
+ "dev": true,
+ "requires": {
+ "ms": "0.7.1"
+ }
+ },
+ "faye-websocket": {
+ "version": "0.11.1",
+ "resolved": "https://registry.npmjs.org/faye-websocket/-/faye-websocket-0.11.1.tgz",
+ "integrity": "sha1-8O/hjE9W5PQK/H4Gxxn9XuYYjzg=",
+ "dev": true,
+ "requires": {
+ "websocket-driver": "0.7.0"
+ }
+ },
+ "finalhandler": {
+ "version": "0.4.1",
+ "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-0.4.1.tgz",
+ "integrity": "sha1-haF8bFmpRxfSYtYSMNSw6+PUoU0=",
+ "dev": true,
+ "requires": {
+ "debug": "2.2.0",
+ "escape-html": "1.0.3",
+ "on-finished": "2.3.0",
+ "unpipe": "1.0.0"
+ }
+ },
+ "mime": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/mime/-/mime-1.4.1.tgz",
+ "integrity": "sha512-KI1+qOZu5DcW6wayYHSzR/tXKCDC5Om4s1z2QJjDULzLcmf3DvzS7oluY4HCTrc+9FiKmWUgeNLg7W3uIQvxtQ==",
+ "dev": true
+ },
+ "ms": {
+ "version": "0.7.1",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz",
+ "integrity": "sha1-nNE8A62/8ltl7/3nzoZO6VIBcJg=",
+ "dev": true
+ },
+ "object-assign": {
+ "version": "4.1.1",
+ "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
+ "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=",
+ "dev": true
+ },
+ "opn": {
+ "version": "5.3.0",
+ "resolved": "https://registry.npmjs.org/opn/-/opn-5.3.0.tgz",
+ "integrity": "sha512-bYJHo/LOmoTd+pfiYhfZDnf9zekVJrY+cnS2a5F2x+w5ppvTqObojTP7WiFG+kVZs9Inw+qQ/lw7TroWwhdd2g==",
+ "dev": true,
+ "requires": {
+ "is-wsl": "1.1.0"
+ }
+ },
+ "send": {
+ "version": "0.16.2",
+ "resolved": "https://registry.npmjs.org/send/-/send-0.16.2.tgz",
+ "integrity": "sha512-E64YFPUssFHEFBvpbbjr44NCLtI1AohxQ8ZSiJjQLskAdKuriYEP6VyGEsRDH8ScozGpkaX1BGvhanqCwkcEZw==",
+ "dev": true,
+ "requires": {
+ "debug": "2.6.9",
+ "depd": "1.1.2",
+ "destroy": "1.0.4",
+ "encodeurl": "1.0.2",
+ "escape-html": "1.0.3",
+ "etag": "1.8.1",
+ "fresh": "0.5.2",
+ "http-errors": "1.6.3",
+ "mime": "1.4.1",
+ "ms": "2.0.0",
+ "on-finished": "2.3.0",
+ "range-parser": "1.2.0",
+ "statuses": "1.4.0"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "2.6.9",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
+ "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ },
+ "ms": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
+ "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=",
+ "dev": true
+ }
+ }
+ },
+ "utils-merge": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.0.tgz",
+ "integrity": "sha1-ApT7kiu5N1FTVBxPcJYjHyh8ivg=",
+ "dev": true
+ }
+ }
+ },
+ "load-json-file": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-1.1.0.tgz",
+ "integrity": "sha1-lWkFcI1YtLq0wiYbBPWfMcmTdMA=",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "parse-json": "2.2.0",
+ "pify": "2.3.0",
+ "pinkie-promise": "2.0.1",
+ "strip-bom": "2.0.0"
+ },
+ "dependencies": {
+ "pify": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+ "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=",
+ "dev": true
+ }
+ }
+ },
+ "loader-runner": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/loader-runner/-/loader-runner-2.3.0.tgz",
+ "integrity": "sha1-9IKuqC1UPgeSFwDVpG7yb9rGuKI=",
+ "dev": true
+ },
+ "loader-utils": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.1.0.tgz",
+ "integrity": "sha1-yYrvSIvM7aL/teLeZG1qdUQp9c0=",
+ "dev": true,
+ "requires": {
+ "big.js": "3.2.0",
+ "emojis-list": "2.1.0",
+ "json5": "0.5.1"
+ }
+ },
+ "locate-path": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-2.0.0.tgz",
+ "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=",
+ "dev": true,
+ "requires": {
+ "p-locate": "2.0.0",
+ "path-exists": "3.0.0"
+ }
+ },
+ "lodash": {
+ "version": "4.17.10",
+ "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.10.tgz",
+ "integrity": "sha512-UejweD1pDoXu+AD825lWwp4ZGtSwgnpZxb3JDViD7StjQz+Nb/6l093lx4OQ0foGWNRoc19mWy7BzL+UAK2iVg==",
+ "dev": true
+ },
+ "lodash.assign": {
+ "version": "4.2.0",
+ "resolved": "https://registry.npmjs.org/lodash.assign/-/lodash.assign-4.2.0.tgz",
+ "integrity": "sha1-DZnzzNem0mHRm9rrkkUAXShYCOc=",
+ "dev": true
+ },
+ "lodash.clonedeep": {
+ "version": "4.5.0",
+ "resolved": "https://registry.npmjs.org/lodash.clonedeep/-/lodash.clonedeep-4.5.0.tgz",
+ "integrity": "sha1-4j8/nE+Pvd6HJSnBBxhXoIblzO8=",
+ "dev": true
+ },
+ "lodash.debounce": {
+ "version": "4.0.8",
+ "resolved": "https://registry.npmjs.org/lodash.debounce/-/lodash.debounce-4.0.8.tgz",
+ "integrity": "sha1-gteb/zCmfEAF/9XiUVMArZyk168=",
+ "dev": true
+ },
+ "lodash.mergewith": {
+ "version": "4.6.1",
+ "resolved": "https://registry.npmjs.org/lodash.mergewith/-/lodash.mergewith-4.6.1.tgz",
+ "integrity": "sha512-eWw5r+PYICtEBgrBE5hhlT6aAa75f411bgDz/ZL2KZqYV03USvucsxcHUIlGTDTECs1eunpI7HOV7U+WLDvNdQ==",
+ "dev": true
+ },
+ "lodash.tail": {
+ "version": "4.1.1",
+ "resolved": "https://registry.npmjs.org/lodash.tail/-/lodash.tail-4.1.1.tgz",
+ "integrity": "sha1-0jM6NtnncXyK0vfKyv7HwytERmQ=",
+ "dev": true
+ },
+ "log4js": {
+ "version": "0.6.38",
+ "resolved": "http://registry.npmjs.org/log4js/-/log4js-0.6.38.tgz",
+ "integrity": "sha1-LElBFmldb7JUgJQ9P8hy5mKlIv0=",
+ "dev": true,
+ "requires": {
+ "readable-stream": "1.0.34",
+ "semver": "4.3.6"
+ },
+ "dependencies": {
+ "isarray": {
+ "version": "0.0.1",
+ "resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz",
+ "integrity": "sha1-ihis/Kmo9Bd+Cav8YDiTmwXR7t8=",
+ "dev": true
+ },
+ "readable-stream": {
+ "version": "1.0.34",
+ "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-1.0.34.tgz",
+ "integrity": "sha1-Elgg40vIQtLyqq+v5MKRbuMsFXw=",
+ "dev": true,
+ "requires": {
+ "core-util-is": "1.0.2",
+ "inherits": "2.0.3",
+ "isarray": "0.0.1",
+ "string_decoder": "0.10.31"
+ }
+ },
+ "semver": {
+ "version": "4.3.6",
+ "resolved": "https://registry.npmjs.org/semver/-/semver-4.3.6.tgz",
+ "integrity": "sha1-MAvG4OhjdPe6YQaLWx7NV/xlMto=",
+ "dev": true
+ },
+ "string_decoder": {
+ "version": "0.10.31",
+ "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz",
+ "integrity": "sha1-YuIDvEF2bGwoyfyEMB2rHFMQ+pQ=",
+ "dev": true
+ }
+ }
+ },
+ "loglevel": {
+ "version": "1.6.1",
+ "resolved": "https://registry.npmjs.org/loglevel/-/loglevel-1.6.1.tgz",
+ "integrity": "sha1-4PyVEztu8nbNyIh82vJKpvFW+Po=",
+ "dev": true
+ },
+ "long": {
+ "version": "3.2.0",
+ "resolved": "https://registry.npmjs.org/long/-/long-3.2.0.tgz",
+ "integrity": "sha1-2CG3E4yhy1gcFymQ7xTbIAtcR0s=",
+ "dev": true
+ },
+ "longest": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/longest/-/longest-1.0.1.tgz",
+ "integrity": "sha1-MKCy2jj3N3DoKUoNIuZiXtd9AJc=",
+ "dev": true
+ },
+ "loose-envify": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz",
+ "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==",
+ "dev": true,
+ "requires": {
+ "js-tokens": "3.0.2"
+ }
+ },
+ "loud-rejection": {
+ "version": "1.6.0",
+ "resolved": "https://registry.npmjs.org/loud-rejection/-/loud-rejection-1.6.0.tgz",
+ "integrity": "sha1-W0b4AUft7leIcPCG0Eghz5mOVR8=",
+ "dev": true,
+ "requires": {
+ "currently-unhandled": "0.4.1",
+ "signal-exit": "3.0.2"
+ }
+ },
+ "lower-case": {
+ "version": "1.1.4",
+ "resolved": "https://registry.npmjs.org/lower-case/-/lower-case-1.1.4.tgz",
+ "integrity": "sha1-miyr0bno4K6ZOkv31YdcOcQujqw=",
+ "dev": true
+ },
+ "lowercase-keys": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/lowercase-keys/-/lowercase-keys-1.0.1.tgz",
+ "integrity": "sha512-G2Lj61tXDnVFFOi8VZds+SoQjtQC3dgokKdDG2mTm1tx4m50NUHBOZSBwQQHyy0V12A0JTG4icfZQH+xPyh8VA==",
+ "dev": true
+ },
+ "lru-cache": {
+ "version": "4.1.3",
+ "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-4.1.3.tgz",
+ "integrity": "sha512-fFEhvcgzuIoJVUF8fYr5KR0YqxD238zgObTps31YdADwPPAp82a4M8TrckkWyx7ekNlf9aBcVn81cFwwXngrJA==",
+ "dev": true,
+ "requires": {
+ "pseudomap": "1.0.2",
+ "yallist": "2.1.2"
+ }
+ },
+ "lunr": {
+ "version": "2.3.2",
+ "resolved": "https://registry.npmjs.org/lunr/-/lunr-2.3.2.tgz",
+ "integrity": "sha512-3wO9shK+cBcJ260ibDtw3JGY+xE0so0y90Dt5YY4e+VmhZO8z8l4cwdau09Fiud0nZHdSgNsIKFHUy3MbXm00A==",
+ "dev": true
+ },
+ "macos-release": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/macos-release/-/macos-release-1.1.0.tgz",
+ "integrity": "sha512-mmLbumEYMi5nXReB9js3WGsB8UE6cDBWyIO62Z4DNx6GbRhDxHNjA1MlzSpJ2S2KM1wyiPRA0d19uHWYYvMHjA==",
+ "dev": true
+ },
+ "magic-string": {
+ "version": "0.22.5",
+ "resolved": "https://registry.npmjs.org/magic-string/-/magic-string-0.22.5.tgz",
+ "integrity": "sha512-oreip9rJZkzvA8Qzk9HFs8fZGF/u7H/gtrE8EN6RjKJ9kh2HlC+yQ2QezifqTZfGyiuAV0dRv5a+y/8gBb1m9w==",
+ "dev": true,
+ "requires": {
+ "vlq": "0.2.3"
+ }
+ },
+ "make-dir": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-1.3.0.tgz",
+ "integrity": "sha512-2w31R7SJtieJJnQtGc7RVL2StM2vGYVfqUOvUDxH6bC6aJTxPxTF0GnIgCyu7tjockiUWAYQRbxa7vKn34s5sQ==",
+ "dev": true,
+ "requires": {
+ "pify": "3.0.0"
+ }
+ },
+ "make-error": {
+ "version": "1.3.5",
+ "resolved": "https://registry.npmjs.org/make-error/-/make-error-1.3.5.tgz",
+ "integrity": "sha512-c3sIjNUow0+8swNwVpqoH4YCShKNFkMaw6oH1mNS2haDZQqkeZFlHS3dhoeEbKKmJB4vXpJucU6oH75aDYeE9g==",
+ "dev": true
+ },
+ "map-cache": {
+ "version": "0.2.2",
+ "resolved": "https://registry.npmjs.org/map-cache/-/map-cache-0.2.2.tgz",
+ "integrity": "sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=",
+ "dev": true
+ },
+ "map-obj": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-1.0.1.tgz",
+ "integrity": "sha1-2TPOuSBdgr3PSIb2dCvcK03qFG0=",
+ "dev": true
+ },
+ "map-stream": {
+ "version": "0.0.7",
+ "resolved": "https://registry.npmjs.org/map-stream/-/map-stream-0.0.7.tgz",
+ "integrity": "sha1-ih8HiW2CsQkmvTdEokIACfiJdKg=",
+ "dev": true
+ },
+ "map-visit": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz",
+ "integrity": "sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=",
+ "dev": true,
+ "requires": {
+ "object-visit": "1.0.1"
+ }
+ },
+ "marked": {
+ "version": "0.4.0",
+ "resolved": "https://registry.npmjs.org/marked/-/marked-0.4.0.tgz",
+ "integrity": "sha512-tMsdNBgOsrUophCAFQl0XPe6Zqk/uy9gnue+jIIKhykO51hxyu6uNx7zBPy0+y/WKYVZZMspV9YeXLNdKk+iYw==",
+ "dev": true
+ },
+ "math-random": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/math-random/-/math-random-1.0.1.tgz",
+ "integrity": "sha1-izqsWIuKZuSXXjzepn97sylgH6w=",
+ "dev": true
+ },
+ "md5.js": {
+ "version": "1.3.4",
+ "resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.4.tgz",
+ "integrity": "sha1-6b296UogpawYsENA/Fdk1bCdkB0=",
+ "dev": true,
+ "requires": {
+ "hash-base": "3.0.4",
+ "inherits": "2.0.3"
+ }
+ },
+ "media-typer": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz",
+ "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=",
+ "dev": true
+ },
+ "mem": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/mem/-/mem-1.1.0.tgz",
+ "integrity": "sha1-Xt1StIXKHZAP5kiVUFOZoN+kX3Y=",
+ "dev": true,
+ "requires": {
+ "mimic-fn": "1.2.0"
+ }
+ },
+ "memory-fs": {
+ "version": "0.4.1",
+ "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz",
+ "integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=",
+ "dev": true,
+ "requires": {
+ "errno": "0.1.7",
+ "readable-stream": "2.3.6"
+ }
+ },
+ "meow": {
+ "version": "3.7.0",
+ "resolved": "https://registry.npmjs.org/meow/-/meow-3.7.0.tgz",
+ "integrity": "sha1-cstmi0JSKCkKu/qFaJJYcwioAfs=",
+ "dev": true,
+ "requires": {
+ "camelcase-keys": "2.1.0",
+ "decamelize": "1.2.0",
+ "loud-rejection": "1.6.0",
+ "map-obj": "1.0.1",
+ "minimist": "1.2.0",
+ "normalize-package-data": "2.4.0",
+ "object-assign": "4.1.1",
+ "read-pkg-up": "1.0.1",
+ "redent": "1.0.0",
+ "trim-newlines": "1.0.0"
+ },
+ "dependencies": {
+ "minimist": {
+ "version": "1.2.0",
+ "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+ "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+ "dev": true
+ }
+ }
+ },
+ "merge-descriptors": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz",
+ "integrity": "sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E=",
+ "dev": true
+ },
+ "merge2": {
+ "version": "1.2.2",
+ "resolved": "https://registry.npmjs.org/merge2/-/merge2-1.2.2.tgz",
+ "integrity": "sha512-bgM8twH86rWni21thii6WCMQMRMmwqqdW3sGWi9IipnVAszdLXRjwDwAnyrVXo6DuP3AjRMMttZKUB48QWIFGg==",
+ "dev": true
+ },
+ "methods": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz",
+ "integrity": "sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4=",
+ "dev": true
+ },
+ "micromatch": {
+ "version": "3.1.10",
+ "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz",
+ "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==",
+ "dev": true,
+ "requires": {
+ "arr-diff": "4.0.0",
+ "array-unique": "0.3.2",
+ "braces": "2.3.2",
+ "define-property": "2.0.2",
+ "extend-shallow": "3.0.2",
+ "extglob": "2.0.4",
+ "fragment-cache": "0.2.1",
+ "kind-of": "6.0.2",
+ "nanomatch": "1.2.13",
+ "object.pick": "1.3.0",
+ "regex-not": "1.0.2",
+ "snapdragon": "0.8.2",
+ "to-regex": "3.0.2"
+ }
+ },
+ "miller-rabin": {
+ "version": "4.0.1",
+ "resolved": "https://registry.npmjs.org/miller-rabin/-/miller-rabin-4.0.1.tgz",
+ "integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==",
+ "dev": true,
+ "requires": {
+ "bn.js": "4.11.8",
+ "brorand": "1.1.0"
+ }
+ },
+ "mime": {
+ "version": "1.6.0",
+ "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz",
+ "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==",
+ "dev": true
+ },
+ "mime-db": {
+ "version": "1.36.0",
+ "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.36.0.tgz",
+ "integrity": "sha512-L+xvyD9MkoYMXb1jAmzI/lWYAxAMCPvIBSWur0PZ5nOf5euahRLVqH//FKW9mWp2lkqUgYiXPgkzfMUFi4zVDw==",
+ "dev": true
+ },
+ "mime-types": {
+ "version": "2.1.20",
+ "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.20.tgz",
+ "integrity": "sha512-HrkrPaP9vGuWbLK1B1FfgAkbqNjIuy4eHlIYnFi7kamZyLLrGlo2mpcx0bBmNpKqBtYtAfGbodDddIgddSJC2A==",
+ "dev": true,
+ "requires": {
+ "mime-db": "1.36.0"
+ }
+ },
+ "mimic-fn": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/mimic-fn/-/mimic-fn-1.2.0.tgz",
+ "integrity": "sha512-jf84uxzwiuiIVKiOLpfYk7N46TSy8ubTonmneY9vrpHNAnp0QBt2BxWV9dO3/j+BoVAb+a5G6YDPW3M5HOdMWQ==",
+ "dev": true
+ },
+ "mini-css-extract-plugin": {
+ "version": "0.4.2",
+ "resolved": "https://registry.npmjs.org/mini-css-extract-plugin/-/mini-css-extract-plugin-0.4.2.tgz",
+ "integrity": "sha512-ots7URQH4wccfJq9Ssrzu2+qupbncAce4TmTzunI9CIwlQMp2XI+WNUw6xWF6MMAGAm1cbUVINrSjATaVMyKXg==",
+ "dev": true,
+ "requires": {
+ "loader-utils": "1.1.0",
+ "schema-utils": "1.0.0",
+ "webpack-sources": "1.2.0"
+ },
+ "dependencies": {
+ "schema-utils": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz",
+ "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==",
+ "dev": true,
+ "requires": {
+ "ajv": "6.4.0",
+ "ajv-errors": "1.0.0",
+ "ajv-keywords": "3.2.0"
+ }
+ }
+ }
+ },
+ "minimalistic-assert": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz",
+ "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A==",
+ "dev": true
+ },
+ "minimalistic-crypto-utils": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz",
+ "integrity": "sha1-9sAMHAsIIkblxNmd+4x8CDsrWCo=",
+ "dev": true
+ },
+ "minimatch": {
+ "version": "3.0.4",
+ "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz",
+ "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==",
+ "dev": true,
+ "requires": {
+ "brace-expansion": "1.1.11"
+ }
+ },
+ "minimist": {
+ "version": "0.0.8",
+ "resolved": "http://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz",
+ "integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=",
+ "dev": true
+ },
+ "mississippi": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/mississippi/-/mississippi-2.0.0.tgz",
+ "integrity": "sha512-zHo8v+otD1J10j/tC+VNoGK9keCuByhKovAvdn74dmxJl9+mWHnx6EMsDN4lgRoMI/eYo2nchAxniIbUPb5onw==",
+ "dev": true,
+ "requires": {
+ "concat-stream": "1.6.2",
+ "duplexify": "3.6.0",
+ "end-of-stream": "1.4.1",
+ "flush-write-stream": "1.0.3",
+ "from2": "2.3.0",
+ "parallel-transform": "1.1.0",
+ "pump": "2.0.1",
+ "pumpify": "1.5.1",
+ "stream-each": "1.2.3",
+ "through2": "2.0.3"
+ }
+ },
+ "mixin-deep": {
+ "version": "1.3.1",
+ "resolved": "https://registry.npmjs.org/mixin-deep/-/mixin-deep-1.3.1.tgz",
+ "integrity": "sha512-8ZItLHeEgaqEvd5lYBXfm4EZSFCX29Jb9K+lAHhDKzReKBQKj3R+7NOF6tjqYi9t4oI8VUfaWITJQm86wnXGNQ==",
+ "dev": true,
+ "requires": {
+ "for-in": "1.0.2",
+ "is-extendable": "1.0.1"
+ },
+ "dependencies": {
+ "is-extendable": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz",
+ "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==",
+ "dev": true,
+ "requires": {
+ "is-plain-object": "2.0.4"
+ }
+ }
+ }
+ },
+ "mixin-object": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/mixin-object/-/mixin-object-2.0.1.tgz",
+ "integrity": "sha1-T7lJRB2rGCVA8f4DW6YOGUel5X4=",
+ "dev": true,
+ "requires": {
+ "for-in": "0.1.8",
+ "is-extendable": "0.1.1"
+ },
+ "dependencies": {
+ "for-in": {
+ "version": "0.1.8",
+ "resolved": "https://registry.npmjs.org/for-in/-/for-in-0.1.8.tgz",
+ "integrity": "sha1-2Hc5COMSVhCZUrH9ubP6hn0ndeE=",
+ "dev": true
+ }
+ }
+ },
+ "mkdirp": {
+ "version": "0.5.1",
+ "resolved": "http://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz",
+ "integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=",
+ "dev": true,
+ "requires": {
+ "minimist": "0.0.8"
+ }
+ },
+ "morgan": {
+ "version": "1.9.0",
+ "resolved": "https://registry.npmjs.org/morgan/-/morgan-1.9.0.tgz",
+ "integrity": "sha1-0B+mxlhZt2/PMbPLU6OCGjEdgFE=",
+ "dev": true,
+ "requires": {
+ "basic-auth": "2.0.0",
+ "debug": "2.6.9",
+ "depd": "1.1.2",
+ "on-finished": "2.3.0",
+ "on-headers": "1.0.1"
+ }
+ },
+ "move-concurrently": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/move-concurrently/-/move-concurrently-1.0.1.tgz",
+ "integrity": "sha1-viwAX9oy4LKa8fBdfEszIUxwH5I=",
+ "dev": true,
+ "requires": {
+ "aproba": "1.2.0",
+ "copy-concurrently": "1.0.5",
+ "fs-write-stream-atomic": "1.0.10",
+ "mkdirp": "0.5.1",
+ "rimraf": "2.6.2",
+ "run-queue": "1.0.3"
+ }
+ },
+ "ms": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
+ "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=",
+ "dev": true
+ },
+ "multicast-dns": {
+ "version": "6.2.3",
+ "resolved": "https://registry.npmjs.org/multicast-dns/-/multicast-dns-6.2.3.tgz",
+ "integrity": "sha512-ji6J5enbMyGRHIAkAOu3WdV8nggqviKCEKtXcOqfphZZtQrmHKycfynJ2V7eVPUA4NhJ6V7Wf4TmGbTwKE9B6g==",
+ "dev": true,
+ "requires": {
+ "dns-packet": "1.3.1",
+ "thunky": "1.0.2"
+ }
+ },
+ "multicast-dns-service-types": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/multicast-dns-service-types/-/multicast-dns-service-types-1.1.0.tgz",
+ "integrity": "sha1-iZ8R2WhuXgXLkbNdXw5jt3PPyQE=",
+ "dev": true
+ },
+ "multimatch": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/multimatch/-/multimatch-2.1.0.tgz",
+ "integrity": "sha1-nHkGoi+0wCkZ4vX3UWG0zb1LKis=",
+ "dev": true,
+ "requires": {
+ "array-differ": "1.0.0",
+ "array-union": "1.0.2",
+ "arrify": "1.0.1",
+ "minimatch": "3.0.4"
+ }
+ },
+ "nan": {
+ "version": "2.11.0",
+ "resolved": "https://registry.npmjs.org/nan/-/nan-2.11.0.tgz",
+ "integrity": "sha512-F4miItu2rGnV2ySkXOQoA8FKz/SR2Q2sWP0sbTxNxz/tuokeC8WxOhPMcwi0qIyGtVn/rrSeLbvVkznqCdwYnw==",
+ "dev": true
+ },
+ "nanomatch": {
+ "version": "1.2.13",
+ "resolved": "https://registry.npmjs.org/nanomatch/-/nanomatch-1.2.13.tgz",
+ "integrity": "sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==",
+ "dev": true,
+ "requires": {
+ "arr-diff": "4.0.0",
+ "array-unique": "0.3.2",
+ "define-property": "2.0.2",
+ "extend-shallow": "3.0.2",
+ "fragment-cache": "0.2.1",
+ "is-windows": "1.0.2",
+ "kind-of": "6.0.2",
+ "object.pick": "1.3.0",
+ "regex-not": "1.0.2",
+ "snapdragon": "0.8.2",
+ "to-regex": "3.0.2"
+ }
+ },
+ "negotiator": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.1.tgz",
+ "integrity": "sha1-KzJxhOiZIQEXeyhWP7XnECrNDKk=",
+ "dev": true
+ },
+ "neo-async": {
+ "version": "2.5.2",
+ "resolved": "https://registry.npmjs.org/neo-async/-/neo-async-2.5.2.tgz",
+ "integrity": "sha512-vdqTKI9GBIYcAEbFAcpKPErKINfPF5zIuz3/niBfq8WUZjpT2tytLlFVrBgWdOtqI4uaA/Rb6No0hux39XXDuw==",
+ "dev": true
+ },
+ "ng-packagr": {
+ "version": "3.0.6",
+ "resolved": "https://registry.npmjs.org/ng-packagr/-/ng-packagr-3.0.6.tgz",
+ "integrity": "sha512-gVhJdrf0RNygxBLk6Qfby7l+y6pIjpVikyS95wuKPwzihvW14cz/KNKQOwNPbKCeVwPhVxflpH2atW5vxsq9cQ==",
+ "dev": true,
+ "requires": {
+ "@ngtools/json-schema": "1.1.0",
+ "autoprefixer": "8.6.5",
+ "browserslist": "3.2.8",
+ "chalk": "2.4.1",
+ "commander": "2.17.1",
+ "fs-extra": "6.0.1",
+ "glob": "7.1.3",
+ "injection-js": "2.2.1",
+ "less": "3.8.1",
+ "node-sass": "4.9.3",
+ "node-sass-tilde-importer": "1.0.2",
+ "postcss": "6.0.23",
+ "postcss-clean": "1.1.0",
+ "postcss-url": "7.3.2",
+ "read-pkg-up": "3.0.0",
+ "rimraf": "2.6.2",
+ "rollup": "0.59.4",
+ "rollup-plugin-commonjs": "9.1.6",
+ "rollup-plugin-node-resolve": "3.4.0",
+ "rollup-plugin-sourcemaps": "0.4.2",
+ "rxjs": "6.3.2",
+ "strip-bom": "3.0.0",
+ "stylus": "0.54.5",
+ "uglify-js": "3.4.9",
+ "update-notifier": "2.5.0"
+ },
+ "dependencies": {
+ "chalk": {
+ "version": "2.4.1",
+ "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.1.tgz",
+ "integrity": "sha512-ObN6h1v2fTJSmUXoS3nMQ92LbDK9be4TV+6G+omQlGJFdcUX5heKi1LZ1YnRMIgwTLEj3E24bT6tYni50rlCfQ==",
+ "dev": true,
+ "requires": {
+ "ansi-styles": "3.2.1",
+ "escape-string-regexp": "1.0.5",
+ "supports-color": "5.5.0"
+ }
+ },
+ "load-json-file": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-4.0.0.tgz",
+ "integrity": "sha1-L19Fq5HjMhYjT9U62rZo607AmTs=",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "parse-json": "4.0.0",
+ "pify": "3.0.0",
+ "strip-bom": "3.0.0"
+ }
+ },
+ "parse-json": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz",
+ "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=",
+ "dev": true,
+ "requires": {
+ "error-ex": "1.3.2",
+ "json-parse-better-errors": "1.0.2"
+ }
+ },
+ "read-pkg": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-3.0.0.tgz",
+ "integrity": "sha1-nLxoaXj+5l0WwA4rGcI3/Pbjg4k=",
+ "dev": true,
+ "requires": {
+ "load-json-file": "4.0.0",
+ "normalize-package-data": "2.4.0",
+ "path-type": "3.0.0"
+ }
+ },
+ "read-pkg-up": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-3.0.0.tgz",
+ "integrity": "sha1-PtSWaF26D4/hGNBpHcUfSh/5bwc=",
+ "dev": true,
+ "requires": {
+ "find-up": "2.1.0",
+ "read-pkg": "3.0.0"
+ }
+ },
+ "strip-bom": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz",
+ "integrity": "sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=",
+ "dev": true
+ }
+ }
+ },
+ "nice-try": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/nice-try/-/nice-try-1.0.5.tgz",
+ "integrity": "sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ==",
+ "dev": true
+ },
+ "no-case": {
+ "version": "2.3.2",
+ "resolved": "https://registry.npmjs.org/no-case/-/no-case-2.3.2.tgz",
+ "integrity": "sha512-rmTZ9kz+f3rCvK2TD1Ue/oZlns7OGoIWP4fc3llxxRXlOkHKoWPPWJOfFYpITabSow43QJbRIoHQXtt10VldyQ==",
+ "dev": true,
+ "requires": {
+ "lower-case": "1.1.4"
+ }
+ },
+ "node-forge": {
+ "version": "0.7.5",
+ "resolved": "https://registry.npmjs.org/node-forge/-/node-forge-0.7.5.tgz",
+ "integrity": "sha512-MmbQJ2MTESTjt3Gi/3yG1wGpIMhUfcIypUCGtTizFR9IiccFwxSpfp0vtIZlkFclEqERemxfnSdZEMR9VqqEFQ==",
+ "dev": true
+ },
+ "node-gyp": {
+ "version": "3.8.0",
+ "resolved": "https://registry.npmjs.org/node-gyp/-/node-gyp-3.8.0.tgz",
+ "integrity": "sha512-3g8lYefrRRzvGeSowdJKAKyks8oUpLEd/DyPV4eMhVlhJ0aNaZqIrNUIPuEWWTAoPqyFkfGrM67MC69baqn6vA==",
+ "dev": true,
+ "requires": {
+ "fstream": "1.0.11",
+ "glob": "7.1.3",
+ "graceful-fs": "4.1.11",
+ "mkdirp": "0.5.1",
+ "nopt": "3.0.6",
+ "npmlog": "4.1.2",
+ "osenv": "0.1.5",
+ "request": "2.88.0",
+ "rimraf": "2.6.2",
+ "semver": "5.3.0",
+ "tar": "2.2.1",
+ "which": "1.3.1"
+ },
+ "dependencies": {
+ "semver": {
+ "version": "5.3.0",
+ "resolved": "https://registry.npmjs.org/semver/-/semver-5.3.0.tgz",
+ "integrity": "sha1-myzl094C0XxgEq0yaqa00M9U+U8=",
+ "dev": true
+ }
+ }
+ },
+ "node-libs-browser": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/node-libs-browser/-/node-libs-browser-2.1.0.tgz",
+ "integrity": "sha512-5AzFzdoIMb89hBGMZglEegffzgRg+ZFoUmisQ8HI4j1KDdpx13J0taNp2y9xPbur6W61gepGDDotGBVQ7mfUCg==",
+ "dev": true,
+ "requires": {
+ "assert": "1.4.1",
+ "browserify-zlib": "0.2.0",
+ "buffer": "4.9.1",
+ "console-browserify": "1.1.0",
+ "constants-browserify": "1.0.0",
+ "crypto-browserify": "3.12.0",
+ "domain-browser": "1.2.0",
+ "events": "1.1.1",
+ "https-browserify": "1.0.0",
+ "os-browserify": "0.3.0",
+ "path-browserify": "0.0.0",
+ "process": "0.11.10",
+ "punycode": "1.4.1",
+ "querystring-es3": "0.2.1",
+ "readable-stream": "2.3.6",
+ "stream-browserify": "2.0.1",
+ "stream-http": "2.8.3",
+ "string_decoder": "1.1.1",
+ "timers-browserify": "2.0.10",
+ "tty-browserify": "0.0.0",
+ "url": "0.11.0",
+ "util": "0.10.4",
+ "vm-browserify": "0.0.4"
+ },
+ "dependencies": {
+ "punycode": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz",
+ "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=",
+ "dev": true
+ }
+ }
+ },
+ "node-sass": {
+ "version": "4.9.3",
+ "resolved": "https://registry.npmjs.org/node-sass/-/node-sass-4.9.3.tgz",
+ "integrity": "sha512-XzXyGjO+84wxyH7fV6IwBOTrEBe2f0a6SBze9QWWYR/cL74AcQUks2AsqcCZenl/Fp/JVbuEaLpgrLtocwBUww==",
+ "dev": true,
+ "requires": {
+ "async-foreach": "0.1.3",
+ "chalk": "1.1.3",
+ "cross-spawn": "3.0.1",
+ "gaze": "1.1.3",
+ "get-stdin": "4.0.1",
+ "glob": "7.1.3",
+ "in-publish": "2.0.0",
+ "lodash.assign": "4.2.0",
+ "lodash.clonedeep": "4.5.0",
+ "lodash.mergewith": "4.6.1",
+ "meow": "3.7.0",
+ "mkdirp": "0.5.1",
+ "nan": "2.11.0",
+ "node-gyp": "3.8.0",
+ "npmlog": "4.1.2",
+ "request": "2.87.0",
+ "sass-graph": "2.2.4",
+ "stdout-stream": "1.4.1",
+ "true-case-path": "1.0.3"
+ },
+ "dependencies": {
+ "ajv": {
+ "version": "5.5.2",
+ "resolved": "https://registry.npmjs.org/ajv/-/ajv-5.5.2.tgz",
+ "integrity": "sha1-c7Xuyj+rZT49P5Qis0GtQiBdyWU=",
+ "dev": true,
+ "requires": {
+ "co": "4.6.0",
+ "fast-deep-equal": "1.1.0",
+ "fast-json-stable-stringify": "2.0.0",
+ "json-schema-traverse": "0.3.1"
+ }
+ },
+ "ansi-styles": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz",
+ "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=",
+ "dev": true
+ },
+ "chalk": {
+ "version": "1.1.3",
+ "resolved": "http://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz",
+ "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=",
+ "dev": true,
+ "requires": {
+ "ansi-styles": "2.2.1",
+ "escape-string-regexp": "1.0.5",
+ "has-ansi": "2.0.0",
+ "strip-ansi": "3.0.1",
+ "supports-color": "2.0.0"
+ }
+ },
+ "har-validator": {
+ "version": "5.0.3",
+ "resolved": "https://registry.npmjs.org/har-validator/-/har-validator-5.0.3.tgz",
+ "integrity": "sha1-ukAsJmGU8VlW7xXg/PJCmT9qff0=",
+ "dev": true,
+ "requires": {
+ "ajv": "5.5.2",
+ "har-schema": "2.0.0"
+ }
+ },
+ "oauth-sign": {
+ "version": "0.8.2",
+ "resolved": "https://registry.npmjs.org/oauth-sign/-/oauth-sign-0.8.2.tgz",
+ "integrity": "sha1-Rqarfwrq2N6unsBWV4C31O/rnUM=",
+ "dev": true
+ },
+ "punycode": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz",
+ "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=",
+ "dev": true
+ },
+ "request": {
+ "version": "2.87.0",
+ "resolved": "https://registry.npmjs.org/request/-/request-2.87.0.tgz",
+ "integrity": "sha512-fcogkm7Az5bsS6Sl0sibkbhcKsnyon/jV1kF3ajGmF0c8HrttdKTPRT9hieOaQHA5HEq6r8OyWOo/o781C1tNw==",
+ "dev": true,
+ "requires": {
+ "aws-sign2": "0.7.0",
+ "aws4": "1.8.0",
+ "caseless": "0.12.0",
+ "combined-stream": "1.0.6",
+ "extend": "3.0.2",
+ "forever-agent": "0.6.1",
+ "form-data": "2.3.2",
+ "har-validator": "5.0.3",
+ "http-signature": "1.2.0",
+ "is-typedarray": "1.0.0",
+ "isstream": "0.1.2",
+ "json-stringify-safe": "5.0.1",
+ "mime-types": "2.1.20",
+ "oauth-sign": "0.8.2",
+ "performance-now": "2.1.0",
+ "qs": "6.5.2",
+ "safe-buffer": "5.1.2",
+ "tough-cookie": "2.3.4",
+ "tunnel-agent": "0.6.0",
+ "uuid": "3.3.2"
+ }
+ },
+ "supports-color": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz",
+ "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=",
+ "dev": true
+ },
+ "tough-cookie": {
+ "version": "2.3.4",
+ "resolved": "https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.3.4.tgz",
+ "integrity": "sha512-TZ6TTfI5NtZnuyy/Kecv+CnoROnyXn2DN97LontgQpCwsX2XyLYCC0ENhYkehSOwAp8rTQKc/NUIF7BkQ5rKLA==",
+ "dev": true,
+ "requires": {
+ "punycode": "1.4.1"
+ }
+ }
+ }
+ },
+ "node-sass-tilde-importer": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/node-sass-tilde-importer/-/node-sass-tilde-importer-1.0.2.tgz",
+ "integrity": "sha512-Swcmr38Y7uB78itQeBm3mThjxBy9/Ah/ykPIaURY/L6Nec9AyRoL/jJ7ECfMR+oZeCTVQNxVMu/aHU+TLRVbdg==",
+ "dev": true,
+ "requires": {
+ "find-parent-dir": "0.3.0"
+ }
+ },
+ "node-uuid": {
+ "version": "1.4.8",
+ "resolved": "https://registry.npmjs.org/node-uuid/-/node-uuid-1.4.8.tgz",
+ "integrity": "sha1-sEDrCSOWivq/jTL7HxfxFn/auQc=",
+ "dev": true
+ },
+ "nopt": {
+ "version": "3.0.6",
+ "resolved": "https://registry.npmjs.org/nopt/-/nopt-3.0.6.tgz",
+ "integrity": "sha1-xkZdvwirzU2zWTF/eaxopkayj/k=",
+ "dev": true,
+ "requires": {
+ "abbrev": "1.0.9"
+ }
+ },
+ "normalize-package-data": {
+ "version": "2.4.0",
+ "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.4.0.tgz",
+ "integrity": "sha512-9jjUFbTPfEy3R/ad/2oNbKtW9Hgovl5O1FvFWKkKblNXoN/Oou6+9+KKohPK13Yc3/TyunyWhJp6gvRNR/PPAw==",
+ "dev": true,
+ "requires": {
+ "hosted-git-info": "2.7.1",
+ "is-builtin-module": "1.0.0",
+ "semver": "5.5.1",
+ "validate-npm-package-license": "3.0.4"
+ }
+ },
+ "normalize-path": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz",
+ "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=",
+ "dev": true,
+ "requires": {
+ "remove-trailing-separator": "1.1.0"
+ }
+ },
+ "normalize-range": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/normalize-range/-/normalize-range-0.1.2.tgz",
+ "integrity": "sha1-LRDAa9/TEuqXd2laTShDlFa3WUI=",
+ "dev": true
+ },
+ "npm-package-arg": {
+ "version": "6.1.0",
+ "resolved": "https://registry.npmjs.org/npm-package-arg/-/npm-package-arg-6.1.0.tgz",
+ "integrity": "sha512-zYbhP2k9DbJhA0Z3HKUePUgdB1x7MfIfKssC+WLPFMKTBZKpZh5m13PgexJjCq6KW7j17r0jHWcCpxEqnnncSA==",
+ "dev": true,
+ "requires": {
+ "hosted-git-info": "2.7.1",
+ "osenv": "0.1.5",
+ "semver": "5.5.1",
+ "validate-npm-package-name": "3.0.0"
+ }
+ },
+ "npm-registry-client": {
+ "version": "8.6.0",
+ "resolved": "https://registry.npmjs.org/npm-registry-client/-/npm-registry-client-8.6.0.tgz",
+ "integrity": "sha512-Qs6P6nnopig+Y8gbzpeN/dkt+n7IyVd8f45NTMotGk6Qo7GfBmzwYx6jRLoOOgKiMnaQfYxsuyQlD8Mc3guBhg==",
+ "dev": true,
+ "requires": {
+ "concat-stream": "1.6.2",
+ "graceful-fs": "4.1.11",
+ "normalize-package-data": "2.4.0",
+ "npm-package-arg": "6.1.0",
+ "npmlog": "4.1.2",
+ "once": "1.4.0",
+ "request": "2.88.0",
+ "retry": "0.10.1",
+ "safe-buffer": "5.1.2",
+ "semver": "5.5.1",
+ "slide": "1.1.6",
+ "ssri": "5.3.0"
+ }
+ },
+ "npm-run-path": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz",
+ "integrity": "sha1-NakjLfo11wZ7TLLd8jV7GHFTbF8=",
+ "dev": true,
+ "requires": {
+ "path-key": "2.0.1"
+ }
+ },
+ "npmlog": {
+ "version": "4.1.2",
+ "resolved": "https://registry.npmjs.org/npmlog/-/npmlog-4.1.2.tgz",
+ "integrity": "sha512-2uUqazuKlTaSI/dC8AzicUck7+IrEaOnN/e0jd3Xtt1KcGpwx30v50mL7oPyr/h9bL3E4aZccVwpwP+5W9Vjkg==",
+ "dev": true,
+ "requires": {
+ "are-we-there-yet": "1.1.5",
+ "console-control-strings": "1.1.0",
+ "gauge": "2.7.4",
+ "set-blocking": "2.0.0"
+ }
+ },
+ "nth-check": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/nth-check/-/nth-check-1.0.1.tgz",
+ "integrity": "sha1-mSms32KPwsQQmN6rgqxYDPFJquQ=",
+ "dev": true,
+ "requires": {
+ "boolbase": "1.0.0"
+ }
+ },
+ "null-check": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/null-check/-/null-check-1.0.0.tgz",
+ "integrity": "sha1-l33/1xdgErnsMNKjnbXPcqBDnt0=",
+ "dev": true
+ },
+ "num2fraction": {
+ "version": "1.2.2",
+ "resolved": "https://registry.npmjs.org/num2fraction/-/num2fraction-1.2.2.tgz",
+ "integrity": "sha1-b2gragJ6Tp3fpFZM0lidHU5mnt4=",
+ "dev": true
+ },
+ "number-is-nan": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz",
+ "integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=",
+ "dev": true
+ },
+ "oauth-sign": {
+ "version": "0.9.0",
+ "resolved": "https://registry.npmjs.org/oauth-sign/-/oauth-sign-0.9.0.tgz",
+ "integrity": "sha512-fexhUFFPTGV8ybAtSIGbV6gOkSv8UtRbDBnAyLQw4QPKkgNlsH2ByPGtMUqdWkos6YCRmAqViwgZrJc/mRDzZQ==",
+ "dev": true
+ },
+ "object-assign": {
+ "version": "4.1.1",
+ "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
+ "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=",
+ "dev": true
+ },
+ "object-component": {
+ "version": "0.0.3",
+ "resolved": "https://registry.npmjs.org/object-component/-/object-component-0.0.3.tgz",
+ "integrity": "sha1-8MaapQ78lbhmwYb0AKM3acsvEpE=",
+ "dev": true
+ },
+ "object-copy": {
+ "version": "0.1.0",
+ "resolved": "https://registry.npmjs.org/object-copy/-/object-copy-0.1.0.tgz",
+ "integrity": "sha1-fn2Fi3gb18mRpBupde04EnVOmYw=",
+ "dev": true,
+ "requires": {
+ "copy-descriptor": "0.1.1",
+ "define-property": "0.2.5",
+ "kind-of": "3.2.2"
+ },
+ "dependencies": {
+ "define-property": {
+ "version": "0.2.5",
+ "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
+ "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
+ "dev": true,
+ "requires": {
+ "is-descriptor": "0.1.6"
+ }
+ },
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ }
+ }
+ },
+ "object-keys": {
+ "version": "1.0.12",
+ "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.0.12.tgz",
+ "integrity": "sha512-FTMyFUm2wBcGHnH2eXmz7tC6IwlqQZ6mVZ+6dm6vZ4IQIHjs6FdNsQBuKGPuUUUY6NfJw2PshC08Tn6LzLDOag==",
+ "dev": true
+ },
+ "object-visit": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/object-visit/-/object-visit-1.0.1.tgz",
+ "integrity": "sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=",
+ "dev": true,
+ "requires": {
+ "isobject": "3.0.1"
+ }
+ },
+ "object.getownpropertydescriptors": {
+ "version": "2.0.3",
+ "resolved": "https://registry.npmjs.org/object.getownpropertydescriptors/-/object.getownpropertydescriptors-2.0.3.tgz",
+ "integrity": "sha1-h1jIRvW0B62rDyNuCYbxSwUcqhY=",
+ "dev": true,
+ "requires": {
+ "define-properties": "1.1.3",
+ "es-abstract": "1.12.0"
+ }
+ },
+ "object.omit": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/object.omit/-/object.omit-2.0.1.tgz",
+ "integrity": "sha1-Gpx0SCnznbuFjHbKNXmuKlTr0fo=",
+ "dev": true,
+ "requires": {
+ "for-own": "0.1.5",
+ "is-extendable": "0.1.1"
+ },
+ "dependencies": {
+ "for-own": {
+ "version": "0.1.5",
+ "resolved": "https://registry.npmjs.org/for-own/-/for-own-0.1.5.tgz",
+ "integrity": "sha1-UmXGgaTylNq78XyVCbZ2OqhFEM4=",
+ "dev": true,
+ "requires": {
+ "for-in": "1.0.2"
+ }
+ }
+ }
+ },
+ "object.pick": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz",
+ "integrity": "sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=",
+ "dev": true,
+ "requires": {
+ "isobject": "3.0.1"
+ }
+ },
+ "obuf": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/obuf/-/obuf-1.1.2.tgz",
+ "integrity": "sha512-PX1wu0AmAdPqOL1mWhqmlOd8kOIZQwGZw6rh7uby9fTc5lhaOWFLX3I6R1hrF9k3zUY40e6igsLGkDXK92LJNg==",
+ "dev": true
+ },
+ "on-finished": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz",
+ "integrity": "sha1-IPEzZIGwg811M3mSoWlxqi2QaUc=",
+ "dev": true,
+ "requires": {
+ "ee-first": "1.1.1"
+ }
+ },
+ "on-headers": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/on-headers/-/on-headers-1.0.1.tgz",
+ "integrity": "sha1-ko9dD0cNSTQmUepnlLCFfBAGk/c=",
+ "dev": true
+ },
+ "once": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz",
+ "integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=",
+ "dev": true,
+ "requires": {
+ "wrappy": "1.0.2"
+ }
+ },
+ "opn": {
+ "version": "5.3.0",
+ "resolved": "https://registry.npmjs.org/opn/-/opn-5.3.0.tgz",
+ "integrity": "sha512-bYJHo/LOmoTd+pfiYhfZDnf9zekVJrY+cnS2a5F2x+w5ppvTqObojTP7WiFG+kVZs9Inw+qQ/lw7TroWwhdd2g==",
+ "dev": true,
+ "requires": {
+ "is-wsl": "1.1.0"
+ }
+ },
+ "optimist": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/optimist/-/optimist-0.6.1.tgz",
+ "integrity": "sha1-2j6nRob6IaGaERwybpDrFaAZZoY=",
+ "dev": true,
+ "requires": {
+ "minimist": "0.0.8",
+ "wordwrap": "0.0.3"
+ },
+ "dependencies": {
+ "wordwrap": {
+ "version": "0.0.3",
+ "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-0.0.3.tgz",
+ "integrity": "sha1-o9XabNXAvAAI03I0u68b7WMFkQc=",
+ "dev": true
+ }
+ }
+ },
+ "optionator": {
+ "version": "0.8.2",
+ "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.8.2.tgz",
+ "integrity": "sha1-NkxeQJ0/TWMB1sC0wFu6UBgK62Q=",
+ "dev": true,
+ "requires": {
+ "deep-is": "0.1.3",
+ "fast-levenshtein": "2.0.6",
+ "levn": "0.3.0",
+ "prelude-ls": "1.1.2",
+ "type-check": "0.3.2",
+ "wordwrap": "1.0.0"
+ }
+ },
+ "options": {
+ "version": "0.0.6",
+ "resolved": "https://registry.npmjs.org/options/-/options-0.0.6.tgz",
+ "integrity": "sha1-7CLTEoBrtT5zF3Pnza788cZDEo8=",
+ "dev": true
+ },
+ "original": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/original/-/original-1.0.2.tgz",
+ "integrity": "sha512-hyBVl6iqqUOJ8FqRe+l/gS8H+kKYjrEndd5Pm1MfBtsEKA038HkkdbAl/72EAXGyonD/PFsvmVG+EvcIpliMBg==",
+ "dev": true,
+ "requires": {
+ "url-parse": "1.4.3"
+ }
+ },
+ "os-browserify": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/os-browserify/-/os-browserify-0.3.0.tgz",
+ "integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc=",
+ "dev": true
+ },
+ "os-homedir": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz",
+ "integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=",
+ "dev": true
+ },
+ "os-locale": {
+ "version": "1.4.0",
+ "resolved": "http://registry.npmjs.org/os-locale/-/os-locale-1.4.0.tgz",
+ "integrity": "sha1-IPnxeuKe00XoveWDsT0gCYA8FNk=",
+ "dev": true,
+ "requires": {
+ "lcid": "1.0.0"
+ }
+ },
+ "os-name": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/os-name/-/os-name-2.0.1.tgz",
+ "integrity": "sha1-uaOGNhwXrjohc27wWZQFyajF3F4=",
+ "dev": true,
+ "requires": {
+ "macos-release": "1.1.0",
+ "win-release": "1.1.1"
+ }
+ },
+ "os-tmpdir": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz",
+ "integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=",
+ "dev": true
+ },
+ "osenv": {
+ "version": "0.1.5",
+ "resolved": "https://registry.npmjs.org/osenv/-/osenv-0.1.5.tgz",
+ "integrity": "sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==",
+ "dev": true,
+ "requires": {
+ "os-homedir": "1.0.2",
+ "os-tmpdir": "1.0.2"
+ }
+ },
+ "p-finally": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/p-finally/-/p-finally-1.0.0.tgz",
+ "integrity": "sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4=",
+ "dev": true
+ },
+ "p-limit": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz",
+ "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==",
+ "dev": true,
+ "requires": {
+ "p-try": "1.0.0"
+ }
+ },
+ "p-locate": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-2.0.0.tgz",
+ "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=",
+ "dev": true,
+ "requires": {
+ "p-limit": "1.3.0"
+ }
+ },
+ "p-map": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/p-map/-/p-map-1.2.0.tgz",
+ "integrity": "sha512-r6zKACMNhjPJMTl8KcFH4li//gkrXWfbD6feV8l6doRHlzljFWGJ2AP6iKaCJXyZmAUMOPtvbW7EXkbWO/pLEA==",
+ "dev": true
+ },
+ "p-try": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz",
+ "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=",
+ "dev": true
+ },
+ "package-json": {
+ "version": "4.0.1",
+ "resolved": "https://registry.npmjs.org/package-json/-/package-json-4.0.1.tgz",
+ "integrity": "sha1-iGmgQBJTZhxMTKPabCEh7VVfXu0=",
+ "dev": true,
+ "requires": {
+ "got": "6.7.1",
+ "registry-auth-token": "3.3.2",
+ "registry-url": "3.1.0",
+ "semver": "5.5.1"
+ }
+ },
+ "pako": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/pako/-/pako-1.0.6.tgz",
+ "integrity": "sha512-lQe48YPsMJAig+yngZ87Lus+NF+3mtu7DVOBu6b/gHO1YpKwIj5AWjZ/TOS7i46HD/UixzWb1zeWDZfGZ3iYcg==",
+ "dev": true
+ },
+ "parallel-transform": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/parallel-transform/-/parallel-transform-1.1.0.tgz",
+ "integrity": "sha1-1BDwZbBdojCB/NEPKIVMKb2jOwY=",
+ "dev": true,
+ "requires": {
+ "cyclist": "0.2.2",
+ "inherits": "2.0.3",
+ "readable-stream": "2.3.6"
+ }
+ },
+ "param-case": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/param-case/-/param-case-2.1.1.tgz",
+ "integrity": "sha1-35T9jPZTHs915r75oIWPvHK+Ikc=",
+ "dev": true,
+ "requires": {
+ "no-case": "2.3.2"
+ }
+ },
+ "parse-asn1": {
+ "version": "5.1.1",
+ "resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.1.tgz",
+ "integrity": "sha512-KPx7flKXg775zZpnp9SxJlz00gTd4BmJ2yJufSc44gMCRrRQ7NSzAcSJQfifuOLgW6bEi+ftrALtsgALeB2Adw==",
+ "dev": true,
+ "requires": {
+ "asn1.js": "4.10.1",
+ "browserify-aes": "1.2.0",
+ "create-hash": "1.2.0",
+ "evp_bytestokey": "1.0.3",
+ "pbkdf2": "3.0.16"
+ }
+ },
+ "parse-glob": {
+ "version": "3.0.4",
+ "resolved": "https://registry.npmjs.org/parse-glob/-/parse-glob-3.0.4.tgz",
+ "integrity": "sha1-ssN2z7EfNVE7rdFz7wu246OIORw=",
+ "dev": true,
+ "requires": {
+ "glob-base": "0.3.0",
+ "is-dotfile": "1.0.3",
+ "is-extglob": "1.0.0",
+ "is-glob": "2.0.1"
+ },
+ "dependencies": {
+ "is-extglob": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-1.0.0.tgz",
+ "integrity": "sha1-rEaBd8SUNAWgkvyPKXYMb/xiBsA=",
+ "dev": true
+ },
+ "is-glob": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-2.0.1.tgz",
+ "integrity": "sha1-0Jb5JqPe1WAPP9/ZEZjLCIjC2GM=",
+ "dev": true,
+ "requires": {
+ "is-extglob": "1.0.0"
+ }
+ }
+ }
+ },
+ "parse-json": {
+ "version": "2.2.0",
+ "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-2.2.0.tgz",
+ "integrity": "sha1-9ID0BDTvgHQfhGkJn43qGPVaTck=",
+ "dev": true,
+ "requires": {
+ "error-ex": "1.3.2"
+ }
+ },
+ "parse5": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/parse5/-/parse5-4.0.0.tgz",
+ "integrity": "sha512-VrZ7eOd3T1Fk4XWNXMgiGBK/z0MG48BWG2uQNU4I72fkQuKUTZpl+u9k+CxEG0twMVzSmXEEz12z5Fnw1jIQFA==",
+ "dev": true
+ },
+ "parsejson": {
+ "version": "0.0.3",
+ "resolved": "https://registry.npmjs.org/parsejson/-/parsejson-0.0.3.tgz",
+ "integrity": "sha1-q343WfIJ7OmUN5c/fQ8fZK4OZKs=",
+ "dev": true,
+ "requires": {
+ "better-assert": "1.0.2"
+ }
+ },
+ "parseqs": {
+ "version": "0.0.5",
+ "resolved": "https://registry.npmjs.org/parseqs/-/parseqs-0.0.5.tgz",
+ "integrity": "sha1-1SCKNzjkZ2bikbouoXNoSSGouJ0=",
+ "dev": true,
+ "requires": {
+ "better-assert": "1.0.2"
+ }
+ },
+ "parseuri": {
+ "version": "0.0.5",
+ "resolved": "https://registry.npmjs.org/parseuri/-/parseuri-0.0.5.tgz",
+ "integrity": "sha1-gCBKUNTbt3m/3G6+J3jZDkvOMgo=",
+ "dev": true,
+ "requires": {
+ "better-assert": "1.0.2"
+ }
+ },
+ "parseurl": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.2.tgz",
+ "integrity": "sha1-/CidTtiZMRlGDBViUyYs3I3mW/M=",
+ "dev": true
+ },
+ "pascalcase": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/pascalcase/-/pascalcase-0.1.1.tgz",
+ "integrity": "sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ=",
+ "dev": true
+ },
+ "path-browserify": {
+ "version": "0.0.0",
+ "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.0.tgz",
+ "integrity": "sha1-oLhwcpquIUAFt9UDLsLLuw+0RRo=",
+ "dev": true
+ },
+ "path-dirname": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/path-dirname/-/path-dirname-1.0.2.tgz",
+ "integrity": "sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA=",
+ "dev": true
+ },
+ "path-exists": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz",
+ "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=",
+ "dev": true
+ },
+ "path-is-absolute": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz",
+ "integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=",
+ "dev": true
+ },
+ "path-is-inside": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/path-is-inside/-/path-is-inside-1.0.2.tgz",
+ "integrity": "sha1-NlQX3t5EQw0cEa9hAn+s8HS9/FM=",
+ "dev": true
+ },
+ "path-key": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/path-key/-/path-key-2.0.1.tgz",
+ "integrity": "sha1-QRyttXTFoUDTpLGRDUDYDMn0C0A=",
+ "dev": true
+ },
+ "path-parse": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.6.tgz",
+ "integrity": "sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==",
+ "dev": true
+ },
+ "path-to-regexp": {
+ "version": "0.1.7",
+ "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz",
+ "integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=",
+ "dev": true
+ },
+ "path-type": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz",
+ "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==",
+ "dev": true,
+ "requires": {
+ "pify": "3.0.0"
+ }
+ },
+ "pause-stream": {
+ "version": "0.0.11",
+ "resolved": "https://registry.npmjs.org/pause-stream/-/pause-stream-0.0.11.tgz",
+ "integrity": "sha1-/lo0sMvOErWqaitAPuLnO2AvFEU=",
+ "dev": true,
+ "requires": {
+ "through": "2.3.8"
+ }
+ },
+ "pbkdf2": {
+ "version": "3.0.16",
+ "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.0.16.tgz",
+ "integrity": "sha512-y4CXP3thSxqf7c0qmOF+9UeOTrifiVTIM+u7NWlq+PRsHbr7r7dpCmvzrZxa96JJUNi0Y5w9VqG5ZNeCVMoDcA==",
+ "dev": true,
+ "requires": {
+ "create-hash": "1.2.0",
+ "create-hmac": "1.1.7",
+ "ripemd160": "2.0.2",
+ "safe-buffer": "5.1.2",
+ "sha.js": "2.4.11"
+ }
+ },
+ "performance-now": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/performance-now/-/performance-now-2.1.0.tgz",
+ "integrity": "sha1-Ywn04OX6kT7BxpMHrjZLSzd8nns=",
+ "dev": true
+ },
+ "pify": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz",
+ "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=",
+ "dev": true
+ },
+ "pinkie": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/pinkie/-/pinkie-2.0.4.tgz",
+ "integrity": "sha1-clVrgM+g1IqXToDnckjoDtT3+HA=",
+ "dev": true
+ },
+ "pinkie-promise": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/pinkie-promise/-/pinkie-promise-2.0.1.tgz",
+ "integrity": "sha1-ITXW36ejWMBprJsXh3YogihFD/o=",
+ "dev": true,
+ "requires": {
+ "pinkie": "2.0.4"
+ }
+ },
+ "pkg-dir": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-2.0.0.tgz",
+ "integrity": "sha1-9tXREJ4Z1j7fQo4L1X4Sd3YVM0s=",
+ "dev": true,
+ "requires": {
+ "find-up": "2.1.0"
+ }
+ },
+ "portfinder": {
+ "version": "1.0.17",
+ "resolved": "https://registry.npmjs.org/portfinder/-/portfinder-1.0.17.tgz",
+ "integrity": "sha512-syFcRIRzVI1BoEFOCaAiizwDolh1S1YXSodsVhncbhjzjZQulhczNRbqnUl9N31Q4dKGOXsNDqxC2BWBgSMqeQ==",
+ "dev": true,
+ "requires": {
+ "async": "1.5.2",
+ "debug": "2.6.9",
+ "mkdirp": "0.5.1"
+ }
+ },
+ "posix-character-classes": {
+ "version": "0.1.1",
+ "resolved": "https://registry.npmjs.org/posix-character-classes/-/posix-character-classes-0.1.1.tgz",
+ "integrity": "sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=",
+ "dev": true
+ },
+ "postcss": {
+ "version": "6.0.23",
+ "resolved": "https://registry.npmjs.org/postcss/-/postcss-6.0.23.tgz",
+ "integrity": "sha512-soOk1h6J3VMTZtVeVpv15/Hpdl2cBLX3CAw4TAbkpTJiNPk9YP/zWcD1ND+xEtvyuuvKzbxliTOIyvkSeSJ6ag==",
+ "dev": true,
+ "requires": {
+ "chalk": "2.4.1",
+ "source-map": "0.6.1",
+ "supports-color": "5.5.0"
+ },
+ "dependencies": {
+ "chalk": {
+ "version": "2.4.1",
+ "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.1.tgz",
+ "integrity": "sha512-ObN6h1v2fTJSmUXoS3nMQ92LbDK9be4TV+6G+omQlGJFdcUX5heKi1LZ1YnRMIgwTLEj3E24bT6tYni50rlCfQ==",
+ "dev": true,
+ "requires": {
+ "ansi-styles": "3.2.1",
+ "escape-string-regexp": "1.0.5",
+ "supports-color": "5.5.0"
+ }
+ },
+ "source-map": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+ "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+ "dev": true
+ }
+ }
+ },
+ "postcss-clean": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/postcss-clean/-/postcss-clean-1.1.0.tgz",
+ "integrity": "sha512-83g3GqMbCM5NL6MlbbPLJ/m2NrUepBF44MoDk4Gt04QGXeXKh9+ilQa0DzLnYnvqYHQCw83nckuEzBFr2muwbg==",
+ "dev": true,
+ "requires": {
+ "clean-css": "4.2.1",
+ "postcss": "6.0.23"
+ }
+ },
+ "postcss-import": {
+ "version": "11.1.0",
+ "resolved": "https://registry.npmjs.org/postcss-import/-/postcss-import-11.1.0.tgz",
+ "integrity": "sha512-5l327iI75POonjxkXgdRCUS+AlzAdBx4pOvMEhTKTCjb1p8IEeVR9yx3cPbmN7LIWJLbfnIXxAhoB4jpD0c/Cw==",
+ "dev": true,
+ "requires": {
+ "postcss": "6.0.23",
+ "postcss-value-parser": "3.3.0",
+ "read-cache": "1.0.0",
+ "resolve": "1.8.1"
+ }
+ },
+ "postcss-load-config": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/postcss-load-config/-/postcss-load-config-2.0.0.tgz",
+ "integrity": "sha512-V5JBLzw406BB8UIfsAWSK2KSwIJ5yoEIVFb4gVkXci0QdKgA24jLmHZ/ghe/GgX0lJ0/D1uUK1ejhzEY94MChQ==",
+ "dev": true,
+ "requires": {
+ "cosmiconfig": "4.0.0",
+ "import-cwd": "2.1.0"
+ }
+ },
+ "postcss-loader": {
+ "version": "2.1.6",
+ "resolved": "https://registry.npmjs.org/postcss-loader/-/postcss-loader-2.1.6.tgz",
+ "integrity": "sha512-hgiWSc13xVQAq25cVw80CH0l49ZKlAnU1hKPOdRrNj89bokRr/bZF2nT+hebPPF9c9xs8c3gw3Fr2nxtmXYnNg==",
+ "dev": true,
+ "requires": {
+ "loader-utils": "1.1.0",
+ "postcss": "6.0.23",
+ "postcss-load-config": "2.0.0",
+ "schema-utils": "0.4.7"
+ }
+ },
+ "postcss-url": {
+ "version": "7.3.2",
+ "resolved": "https://registry.npmjs.org/postcss-url/-/postcss-url-7.3.2.tgz",
+ "integrity": "sha512-QMV5mA+pCYZQcUEPQkmor9vcPQ2MT+Ipuu8qdi1gVxbNiIiErEGft+eny1ak19qALoBkccS5AHaCaCDzh7b9MA==",
+ "dev": true,
+ "requires": {
+ "mime": "1.6.0",
+ "minimatch": "3.0.4",
+ "mkdirp": "0.5.1",
+ "postcss": "6.0.23",
+ "xxhashjs": "0.2.2"
+ }
+ },
+ "postcss-value-parser": {
+ "version": "3.3.0",
+ "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.0.tgz",
+ "integrity": "sha1-h/OPnxj3dKSrTIojL1xc6IcqnRU=",
+ "dev": true
+ },
+ "prelude-ls": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/prelude-ls/-/prelude-ls-1.1.2.tgz",
+ "integrity": "sha1-IZMqVJ9eUv/ZqCf1cOBL5iqX2lQ=",
+ "dev": true
+ },
+ "prepend-http": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/prepend-http/-/prepend-http-1.0.4.tgz",
+ "integrity": "sha1-1PRWKwzjaW5BrFLQ4ALlemNdxtw=",
+ "dev": true
+ },
+ "preserve": {
+ "version": "0.2.0",
+ "resolved": "https://registry.npmjs.org/preserve/-/preserve-0.2.0.tgz",
+ "integrity": "sha1-gV7R9uvGWSb4ZbMQwHE7yzMVzks=",
+ "dev": true
+ },
+ "pretty-error": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/pretty-error/-/pretty-error-2.1.1.tgz",
+ "integrity": "sha1-X0+HyPkeWuPzuoerTPXgOxoX8aM=",
+ "dev": true,
+ "requires": {
+ "renderkid": "2.0.1",
+ "utila": "0.4.0"
+ }
+ },
+ "process": {
+ "version": "0.11.10",
+ "resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz",
+ "integrity": "sha1-czIwDoQBYb2j5podHZGn1LwW8YI=",
+ "dev": true
+ },
+ "process-nextick-args": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.0.tgz",
+ "integrity": "sha512-MtEC1TqN0EU5nephaJ4rAtThHtC86dNN9qCuEhtshvpVBkAW5ZO7BASN9REnF9eoXGcRub+pFuKEpOHE+HbEMw==",
+ "dev": true
+ },
+ "promise": {
+ "version": "7.3.1",
+ "resolved": "https://registry.npmjs.org/promise/-/promise-7.3.1.tgz",
+ "integrity": "sha512-nolQXZ/4L+bP/UGlkfaIujX9BKxGwmQ9OT4mOt5yvy8iK1h3wqTEJCijzGANTCCl9nWjY41juyAn2K3Q1hLLTg==",
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "asap": "2.0.6"
+ }
+ },
+ "promise-inflight": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/promise-inflight/-/promise-inflight-1.0.1.tgz",
+ "integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM=",
+ "dev": true
+ },
+ "protractor": {
+ "version": "5.3.2",
+ "resolved": "https://registry.npmjs.org/protractor/-/protractor-5.3.2.tgz",
+ "integrity": "sha512-pw4uwwiy5lHZjIguxNpkEwJJa7hVz+bJsvaTI+IbXlfn2qXwzbF8eghW/RmrZwE2sGx82I8etb8lVjQ+JrjejA==",
+ "dev": true,
+ "requires": {
+ "@types/node": "6.0.117",
+ "@types/q": "0.0.32",
+ "@types/selenium-webdriver": "2.53.43",
+ "blocking-proxy": "1.0.1",
+ "chalk": "1.1.3",
+ "glob": "7.1.3",
+ "jasmine": "2.8.0",
+ "jasminewd2": "2.2.0",
+ "optimist": "0.6.1",
+ "q": "1.4.1",
+ "saucelabs": "1.5.0",
+ "selenium-webdriver": "3.6.0",
+ "source-map-support": "0.4.18",
+ "webdriver-js-extender": "1.0.0",
+ "webdriver-manager": "12.1.0"
+ },
+ "dependencies": {
+ "@types/node": {
+ "version": "6.0.117",
+ "resolved": "https://registry.npmjs.org/@types/node/-/node-6.0.117.tgz",
+ "integrity": "sha512-sihk0SnN8PpiS5ihu5xJQ5ddnURNq4P+XPmW+nORlKkHy21CoZO/IVHK/Wq/l3G8fFW06Fkltgnqx229uPlnRg==",
+ "dev": true
+ },
+ "adm-zip": {
+ "version": "0.4.11",
+ "resolved": "https://registry.npmjs.org/adm-zip/-/adm-zip-0.4.11.tgz",
+ "integrity": "sha512-L8vcjDTCOIJk7wFvmlEUN7AsSb8T+2JrdP7KINBjzr24TJ5Mwj590sLu3BC7zNZowvJWa/JtPmD8eJCzdtDWjA==",
+ "dev": true
+ },
+ "ansi-styles": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz",
+ "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=",
+ "dev": true
+ },
+ "chalk": {
+ "version": "1.1.3",
+ "resolved": "http://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz",
+ "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=",
+ "dev": true,
+ "requires": {
+ "ansi-styles": "2.2.1",
+ "escape-string-regexp": "1.0.5",
+ "has-ansi": "2.0.0",
+ "strip-ansi": "3.0.1",
+ "supports-color": "2.0.0"
+ }
+ },
+ "del": {
+ "version": "2.2.2",
+ "resolved": "https://registry.npmjs.org/del/-/del-2.2.2.tgz",
+ "integrity": "sha1-wSyYHQZ4RshLyvhiz/kw2Qf/0ag=",
+ "dev": true,
+ "requires": {
+ "globby": "5.0.0",
+ "is-path-cwd": "1.0.0",
+ "is-path-in-cwd": "1.0.1",
+ "object-assign": "4.1.1",
+ "pify": "2.3.0",
+ "pinkie-promise": "2.0.1",
+ "rimraf": "2.6.2"
+ }
+ },
+ "globby": {
+ "version": "5.0.0",
+ "resolved": "https://registry.npmjs.org/globby/-/globby-5.0.0.tgz",
+ "integrity": "sha1-69hGZ8oNuzMLmbz8aOrCvFQ3Dg0=",
+ "dev": true,
+ "requires": {
+ "array-union": "1.0.2",
+ "arrify": "1.0.1",
+ "glob": "7.1.3",
+ "object-assign": "4.1.1",
+ "pify": "2.3.0",
+ "pinkie-promise": "2.0.1"
+ }
+ },
+ "minimist": {
+ "version": "1.2.0",
+ "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+ "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+ "dev": true
+ },
+ "pify": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+ "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=",
+ "dev": true
+ },
+ "source-map-support": {
+ "version": "0.4.18",
+ "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.4.18.tgz",
+ "integrity": "sha512-try0/JqxPLF9nOjvSta7tVondkP5dwgyLDjVoyMDlmjugT2lRZ1OfsrYTkCd2hkDnJTKRbO/Rl3orm8vlsUzbA==",
+ "dev": true,
+ "requires": {
+ "source-map": "0.5.7"
+ }
+ },
+ "supports-color": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz",
+ "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=",
+ "dev": true
+ },
+ "webdriver-manager": {
+ "version": "12.1.0",
+ "resolved": "https://registry.npmjs.org/webdriver-manager/-/webdriver-manager-12.1.0.tgz",
+ "integrity": "sha512-oEc5fmkpz6Yh6udhwir5m0eN5mgRPq9P/NU5YWuT3Up5slt6Zz+znhLU7q4+8rwCZz/Qq3Fgpr/4oao7NPCm2A==",
+ "dev": true,
+ "requires": {
+ "adm-zip": "0.4.11",
+ "chalk": "1.1.3",
+ "del": "2.2.2",
+ "glob": "7.1.3",
+ "ini": "1.3.5",
+ "minimist": "1.2.0",
+ "q": "1.4.1",
+ "request": "2.88.0",
+ "rimraf": "2.6.2",
+ "semver": "5.5.1",
+ "xml2js": "0.4.19"
+ }
+ }
+ }
+ },
+ "proxy-addr": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.4.tgz",
+ "integrity": "sha512-5erio2h9jp5CHGwcybmxmVqHmnCBZeewlfJ0pex+UW7Qny7OOZXTtH56TGNyBizkgiOwhJtMKrVzDTeKcySZwA==",
+ "dev": true,
+ "requires": {
+ "forwarded": "0.1.2",
+ "ipaddr.js": "1.8.0"
+ }
+ },
+ "proxy-middleware": {
+ "version": "0.15.0",
+ "resolved": "https://registry.npmjs.org/proxy-middleware/-/proxy-middleware-0.15.0.tgz",
+ "integrity": "sha1-o/3xvvtzD5UZZYcqwvYHTGFHelY=",
+ "dev": true
+ },
+ "prr": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/prr/-/prr-1.0.1.tgz",
+ "integrity": "sha1-0/wRS6BplaRexok/SEzrHXj19HY=",
+ "dev": true
+ },
+ "pseudomap": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/pseudomap/-/pseudomap-1.0.2.tgz",
+ "integrity": "sha1-8FKijacOYYkX7wqKw0wa5aaChrM=",
+ "dev": true
+ },
+ "psl": {
+ "version": "1.1.29",
+ "resolved": "https://registry.npmjs.org/psl/-/psl-1.1.29.tgz",
+ "integrity": "sha512-AeUmQ0oLN02flVHXWh9sSJF7mcdFq0ppid/JkErufc3hGIV/AMa8Fo9VgDo/cT2jFdOWoFvHp90qqBH54W+gjQ==",
+ "dev": true
+ },
+ "public-encrypt": {
+ "version": "4.0.2",
+ "resolved": "https://registry.npmjs.org/public-encrypt/-/public-encrypt-4.0.2.tgz",
+ "integrity": "sha512-4kJ5Esocg8X3h8YgJsKAuoesBgB7mqH3eowiDzMUPKiRDDE7E/BqqZD1hnTByIaAFiwAw246YEltSq7tdrOH0Q==",
+ "dev": true,
+ "requires": {
+ "bn.js": "4.11.8",
+ "browserify-rsa": "4.0.1",
+ "create-hash": "1.2.0",
+ "parse-asn1": "5.1.1",
+ "randombytes": "2.0.6"
+ }
+ },
+ "pump": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz",
+ "integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==",
+ "dev": true,
+ "requires": {
+ "end-of-stream": "1.4.1",
+ "once": "1.4.0"
+ }
+ },
+ "pumpify": {
+ "version": "1.5.1",
+ "resolved": "https://registry.npmjs.org/pumpify/-/pumpify-1.5.1.tgz",
+ "integrity": "sha512-oClZI37HvuUJJxSKKrC17bZ9Cu0ZYhEAGPsPUy9KlMUmv9dKX2o77RUmq7f3XjIxbwyGwYzbzQ1L2Ks8sIradQ==",
+ "dev": true,
+ "requires": {
+ "duplexify": "3.6.0",
+ "inherits": "2.0.3",
+ "pump": "2.0.1"
+ }
+ },
+ "punycode": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.1.1.tgz",
+ "integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==",
+ "dev": true
+ },
+ "q": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/q/-/q-1.4.1.tgz",
+ "integrity": "sha1-VXBbzZPF82c1MMLCy8DCs63cKG4=",
+ "dev": true
+ },
+ "qjobs": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/qjobs/-/qjobs-1.2.0.tgz",
+ "integrity": "sha512-8YOJEHtxpySA3fFDyCRxA+UUV+fA+rTWnuWvylOK/NCjhY+b4ocCtmu8TtsWb+mYeU+GCHf/S66KZF/AsteKHg==",
+ "dev": true
+ },
+ "qs": {
+ "version": "6.5.2",
+ "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.2.tgz",
+ "integrity": "sha512-N5ZAX4/LxJmF+7wN74pUD6qAh9/wnvdQcjq9TZjevvXzSUo7bfmw91saqMjzGS2xq91/odN2dW/WOl7qQHNDGA==",
+ "dev": true
+ },
+ "querystring": {
+ "version": "0.2.0",
+ "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.0.tgz",
+ "integrity": "sha1-sgmEkgO7Jd+CDadW50cAWHhSFiA=",
+ "dev": true
+ },
+ "querystring-es3": {
+ "version": "0.2.1",
+ "resolved": "https://registry.npmjs.org/querystring-es3/-/querystring-es3-0.2.1.tgz",
+ "integrity": "sha1-nsYfeQSYdXB9aUFFlv2Qek1xHnM=",
+ "dev": true
+ },
+ "querystringify": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/querystringify/-/querystringify-2.0.0.tgz",
+ "integrity": "sha512-eTPo5t/4bgaMNZxyjWx6N2a6AuE0mq51KWvpc7nU/MAqixcI6v6KrGUKES0HaomdnolQBBXU/++X6/QQ9KL4tw==",
+ "dev": true
+ },
+ "randomatic": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/randomatic/-/randomatic-3.1.0.tgz",
+ "integrity": "sha512-KnGPVE0lo2WoXxIZ7cPR8YBpiol4gsSuOwDSg410oHh80ZMp5EiypNqL2K4Z77vJn6lB5rap7IkAmcUlalcnBQ==",
+ "dev": true,
+ "requires": {
+ "is-number": "4.0.0",
+ "kind-of": "6.0.2",
+ "math-random": "1.0.1"
+ },
+ "dependencies": {
+ "is-number": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/is-number/-/is-number-4.0.0.tgz",
+ "integrity": "sha512-rSklcAIlf1OmFdyAqbnWTLVelsQ58uvZ66S/ZyawjWqIviTWCjg2PzVGw8WUA+nNuPTqb4wgA+NszrJ+08LlgQ==",
+ "dev": true
+ }
+ }
+ },
+ "randombytes": {
+ "version": "2.0.6",
+ "resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.0.6.tgz",
+ "integrity": "sha512-CIQ5OFxf4Jou6uOKe9t1AOgqpeU5fd70A8NPdHSGeYXqXsPe6peOwI0cUl88RWZ6sP1vPMV3avd/R6cZ5/sP1A==",
+ "dev": true,
+ "requires": {
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "randomfill": {
+ "version": "1.0.4",
+ "resolved": "https://registry.npmjs.org/randomfill/-/randomfill-1.0.4.tgz",
+ "integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==",
+ "dev": true,
+ "requires": {
+ "randombytes": "2.0.6",
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "range-parser": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.0.tgz",
+ "integrity": "sha1-9JvmtIeJTdxA3MlKMi9hEJLgDV4=",
+ "dev": true
+ },
+ "raw-body": {
+ "version": "2.3.2",
+ "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.3.2.tgz",
+ "integrity": "sha1-vNYMd9Prk83gBQKVw/N5OJvIj4k=",
+ "dev": true,
+ "requires": {
+ "bytes": "3.0.0",
+ "http-errors": "1.6.2",
+ "iconv-lite": "0.4.19",
+ "unpipe": "1.0.0"
+ },
+ "dependencies": {
+ "depd": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.1.tgz",
+ "integrity": "sha1-V4O04cRZ8G+lyif5kfPQbnoxA1k=",
+ "dev": true
+ },
+ "http-errors": {
+ "version": "1.6.2",
+ "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.6.2.tgz",
+ "integrity": "sha1-CgAsyFcHGSp+eUbO7cERVfYOxzY=",
+ "dev": true,
+ "requires": {
+ "depd": "1.1.1",
+ "inherits": "2.0.3",
+ "setprototypeof": "1.0.3",
+ "statuses": "1.4.0"
+ }
+ },
+ "setprototypeof": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.0.3.tgz",
+ "integrity": "sha1-ZlZ+NwQ+608E2RvWWMDL77VbjgQ=",
+ "dev": true
+ }
+ }
+ },
+ "raw-loader": {
+ "version": "0.5.1",
+ "resolved": "https://registry.npmjs.org/raw-loader/-/raw-loader-0.5.1.tgz",
+ "integrity": "sha1-DD0L6u2KAclm2Xh793goElKpeao=",
+ "dev": true
+ },
+ "rc": {
+ "version": "1.2.8",
+ "resolved": "https://registry.npmjs.org/rc/-/rc-1.2.8.tgz",
+ "integrity": "sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==",
+ "dev": true,
+ "requires": {
+ "deep-extend": "0.6.0",
+ "ini": "1.3.5",
+ "minimist": "1.2.0",
+ "strip-json-comments": "2.0.1"
+ },
+ "dependencies": {
+ "minimist": {
+ "version": "1.2.0",
+ "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+ "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+ "dev": true
+ }
+ }
+ },
+ "read-cache": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/read-cache/-/read-cache-1.0.0.tgz",
+ "integrity": "sha1-5mTvMRYRZsl1HNvo28+GtftY93Q=",
+ "dev": true,
+ "requires": {
+ "pify": "2.3.0"
+ },
+ "dependencies": {
+ "pify": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+ "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=",
+ "dev": true
+ }
+ }
+ },
+ "read-pkg": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-1.1.0.tgz",
+ "integrity": "sha1-9f+qXs0pyzHAR0vKfXVra7KePyg=",
+ "dev": true,
+ "requires": {
+ "load-json-file": "1.1.0",
+ "normalize-package-data": "2.4.0",
+ "path-type": "1.1.0"
+ },
+ "dependencies": {
+ "path-type": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/path-type/-/path-type-1.1.0.tgz",
+ "integrity": "sha1-WcRPfuSR2nBNpBXaWkBwuk+P5EE=",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "pify": "2.3.0",
+ "pinkie-promise": "2.0.1"
+ }
+ },
+ "pify": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+ "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=",
+ "dev": true
+ }
+ }
+ },
+ "read-pkg-up": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-1.0.1.tgz",
+ "integrity": "sha1-nWPBMnbAZZGNV/ACpX9AobZD+wI=",
+ "dev": true,
+ "requires": {
+ "find-up": "1.1.2",
+ "read-pkg": "1.1.0"
+ },
+ "dependencies": {
+ "find-up": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/find-up/-/find-up-1.1.2.tgz",
+ "integrity": "sha1-ay6YIrGizgpgq2TWEOzK1TyyTQ8=",
+ "dev": true,
+ "requires": {
+ "path-exists": "2.1.0",
+ "pinkie-promise": "2.0.1"
+ }
+ },
+ "path-exists": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-2.1.0.tgz",
+ "integrity": "sha1-D+tsZPD8UY2adU3V77YscCJ2H0s=",
+ "dev": true,
+ "requires": {
+ "pinkie-promise": "2.0.1"
+ }
+ }
+ }
+ },
+ "readable-stream": {
+ "version": "2.3.6",
+ "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz",
+ "integrity": "sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==",
+ "dev": true,
+ "requires": {
+ "core-util-is": "1.0.2",
+ "inherits": "2.0.3",
+ "isarray": "1.0.0",
+ "process-nextick-args": "2.0.0",
+ "safe-buffer": "5.1.2",
+ "string_decoder": "1.1.1",
+ "util-deprecate": "1.0.2"
+ }
+ },
+ "readdirp": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.1.0.tgz",
+ "integrity": "sha1-TtCtBg3zBzMAxIRANz9y0cxkLXg=",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "minimatch": "3.0.4",
+ "readable-stream": "2.3.6",
+ "set-immediate-shim": "1.0.1"
+ }
+ },
+ "redent": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/redent/-/redent-1.0.0.tgz",
+ "integrity": "sha1-z5Fqsf1fHxbfsggi3W7H9zDCr94=",
+ "dev": true,
+ "requires": {
+ "indent-string": "2.1.0",
+ "strip-indent": "1.0.1"
+ }
+ },
+ "reflect-metadata": {
+ "version": "0.1.12",
+ "resolved": "https://registry.npmjs.org/reflect-metadata/-/reflect-metadata-0.1.12.tgz",
+ "integrity": "sha512-n+IyV+nGz3+0q3/Yf1ra12KpCyi001bi4XFxSjbiWWjfqb52iTTtpGXmCCAOWWIAn9KEuFZKGqBERHmrtScZ3A==",
+ "dev": true
+ },
+ "regenerate": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/regenerate/-/regenerate-1.4.0.tgz",
+ "integrity": "sha512-1G6jJVDWrt0rK99kBjvEtziZNCICAuvIPkSiUFIQxVP06RCVpq3dmDo2oi6ABpYaDYaTRr67BEhL8r1wgEZZKg==",
+ "dev": true
+ },
+ "regenerator-runtime": {
+ "version": "0.11.1",
+ "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz",
+ "integrity": "sha512-MguG95oij0fC3QV3URf4V2SDYGJhJnJGqvIIgdECeODCT98wSWDAJ94SSuVpYQUoTcGUIL6L4yNB7j1DFFHSBg==",
+ "dev": true
+ },
+ "regex-cache": {
+ "version": "0.4.4",
+ "resolved": "https://registry.npmjs.org/regex-cache/-/regex-cache-0.4.4.tgz",
+ "integrity": "sha512-nVIZwtCjkC9YgvWkpM55B5rBhBYRZhAaJbgcFYXXsHnbZ9UZI9nnVWYZpBlCqv9ho2eZryPnWrZGsOdPwVWXWQ==",
+ "dev": true,
+ "requires": {
+ "is-equal-shallow": "0.1.3"
+ }
+ },
+ "regex-not": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz",
+ "integrity": "sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==",
+ "dev": true,
+ "requires": {
+ "extend-shallow": "3.0.2",
+ "safe-regex": "1.1.0"
+ }
+ },
+ "regexpu-core": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-1.0.0.tgz",
+ "integrity": "sha1-hqdj9Y7k18L2sQLkdkBQ3n7ZDGs=",
+ "dev": true,
+ "requires": {
+ "regenerate": "1.4.0",
+ "regjsgen": "0.2.0",
+ "regjsparser": "0.1.5"
+ }
+ },
+ "registry-auth-token": {
+ "version": "3.3.2",
+ "resolved": "https://registry.npmjs.org/registry-auth-token/-/registry-auth-token-3.3.2.tgz",
+ "integrity": "sha512-JL39c60XlzCVgNrO+qq68FoNb56w/m7JYvGR2jT5iR1xBrUA3Mfx5Twk5rqTThPmQKMWydGmq8oFtDlxfrmxnQ==",
+ "dev": true,
+ "requires": {
+ "rc": "1.2.8",
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "registry-url": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/registry-url/-/registry-url-3.1.0.tgz",
+ "integrity": "sha1-PU74cPc93h138M+aOBQyRE4XSUI=",
+ "dev": true,
+ "requires": {
+ "rc": "1.2.8"
+ }
+ },
+ "regjsgen": {
+ "version": "0.2.0",
+ "resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.2.0.tgz",
+ "integrity": "sha1-bAFq3qxVT3WCP+N6wFuS1aTtsfc=",
+ "dev": true
+ },
+ "regjsparser": {
+ "version": "0.1.5",
+ "resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.1.5.tgz",
+ "integrity": "sha1-fuj4Tcb6eS0/0K4ijSS9lJ6tIFw=",
+ "dev": true,
+ "requires": {
+ "jsesc": "0.5.0"
+ },
+ "dependencies": {
+ "jsesc": {
+ "version": "0.5.0",
+ "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz",
+ "integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=",
+ "dev": true
+ }
+ }
+ },
+ "relateurl": {
+ "version": "0.2.7",
+ "resolved": "https://registry.npmjs.org/relateurl/-/relateurl-0.2.7.tgz",
+ "integrity": "sha1-VNvzd+UUQKypCkzSdGANP/LYiKk=",
+ "dev": true
+ },
+ "remove-trailing-separator": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz",
+ "integrity": "sha1-wkvOKig62tW8P1jg1IJJuSN52O8=",
+ "dev": true
+ },
+ "renderkid": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/renderkid/-/renderkid-2.0.1.tgz",
+ "integrity": "sha1-iYyr/Ivt5Le5ETWj/9Mj5YwNsxk=",
+ "dev": true,
+ "requires": {
+ "css-select": "1.2.0",
+ "dom-converter": "0.1.4",
+ "htmlparser2": "3.3.0",
+ "strip-ansi": "3.0.1",
+ "utila": "0.3.3"
+ },
+ "dependencies": {
+ "utila": {
+ "version": "0.3.3",
+ "resolved": "https://registry.npmjs.org/utila/-/utila-0.3.3.tgz",
+ "integrity": "sha1-1+jn1+MJEHCSsF+NloiCTWM6QiY=",
+ "dev": true
+ }
+ }
+ },
+ "repeat-element": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/repeat-element/-/repeat-element-1.1.3.tgz",
+ "integrity": "sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g==",
+ "dev": true
+ },
+ "repeat-string": {
+ "version": "1.6.1",
+ "resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-1.6.1.tgz",
+ "integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc=",
+ "dev": true
+ },
+ "repeating": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/repeating/-/repeating-2.0.1.tgz",
+ "integrity": "sha1-UhTFOpJtNVJwdSf7q0FdvAjQbdo=",
+ "dev": true,
+ "requires": {
+ "is-finite": "1.0.2"
+ }
+ },
+ "request": {
+ "version": "2.88.0",
+ "resolved": "https://registry.npmjs.org/request/-/request-2.88.0.tgz",
+ "integrity": "sha512-NAqBSrijGLZdM0WZNsInLJpkJokL72XYjUpnB0iwsRgxh7dB6COrHnTBNwN0E+lHDAJzu7kLAkDeY08z2/A0hg==",
+ "dev": true,
+ "requires": {
+ "aws-sign2": "0.7.0",
+ "aws4": "1.8.0",
+ "caseless": "0.12.0",
+ "combined-stream": "1.0.6",
+ "extend": "3.0.2",
+ "forever-agent": "0.6.1",
+ "form-data": "2.3.2",
+ "har-validator": "5.1.0",
+ "http-signature": "1.2.0",
+ "is-typedarray": "1.0.0",
+ "isstream": "0.1.2",
+ "json-stringify-safe": "5.0.1",
+ "mime-types": "2.1.20",
+ "oauth-sign": "0.9.0",
+ "performance-now": "2.1.0",
+ "qs": "6.5.2",
+ "safe-buffer": "5.1.2",
+ "tough-cookie": "2.4.3",
+ "tunnel-agent": "0.6.0",
+ "uuid": "3.3.2"
+ }
+ },
+ "require-directory": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz",
+ "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=",
+ "dev": true
+ },
+ "require-from-string": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/require-from-string/-/require-from-string-2.0.2.tgz",
+ "integrity": "sha512-Xf0nWe6RseziFMu+Ap9biiUbmplq6S9/p+7w7YXP/JBHhrUDDUhwa+vANyubuqfZWTveU//DYVGsDG7RKL/vEw==",
+ "dev": true
+ },
+ "require-main-filename": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-1.0.1.tgz",
+ "integrity": "sha1-l/cXtp1IeE9fUmpsWqj/3aBVpNE=",
+ "dev": true
+ },
+ "requires-port": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/requires-port/-/requires-port-1.0.0.tgz",
+ "integrity": "sha1-kl0mAdOaxIXgkc8NpcbmlNw9yv8=",
+ "dev": true
+ },
+ "resolve": {
+ "version": "1.8.1",
+ "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.8.1.tgz",
+ "integrity": "sha512-AicPrAC7Qu1JxPCZ9ZgCZlY35QgFnNqc+0LtbRNxnVw4TXvjQ72wnuL9JQcEBgXkI9JM8MsT9kaQoHcpCRJOYA==",
+ "dev": true,
+ "requires": {
+ "path-parse": "1.0.6"
+ }
+ },
+ "resolve-cwd": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz",
+ "integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=",
+ "dev": true,
+ "requires": {
+ "resolve-from": "3.0.0"
+ }
+ },
+ "resolve-from": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz",
+ "integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=",
+ "dev": true
+ },
+ "resolve-url": {
+ "version": "0.2.1",
+ "resolved": "https://registry.npmjs.org/resolve-url/-/resolve-url-0.2.1.tgz",
+ "integrity": "sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo=",
+ "dev": true
+ },
+ "ret": {
+ "version": "0.1.15",
+ "resolved": "https://registry.npmjs.org/ret/-/ret-0.1.15.tgz",
+ "integrity": "sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg==",
+ "dev": true
+ },
+ "retry": {
+ "version": "0.10.1",
+ "resolved": "https://registry.npmjs.org/retry/-/retry-0.10.1.tgz",
+ "integrity": "sha1-52OI0heZLCUnUCQdPTlW/tmNj/Q=",
+ "dev": true
+ },
+ "right-align": {
+ "version": "0.1.3",
+ "resolved": "https://registry.npmjs.org/right-align/-/right-align-0.1.3.tgz",
+ "integrity": "sha1-YTObci/mo1FWiSENJOFMlhSGE+8=",
+ "dev": true,
+ "optional": true,
+ "requires": {
+ "align-text": "0.1.4"
+ }
+ },
+ "rimraf": {
+ "version": "2.6.2",
+ "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.6.2.tgz",
+ "integrity": "sha512-lreewLK/BlghmxtfH36YYVg1i8IAce4TI7oao75I1g245+6BctqTVQiBP3YUJ9C6DQOXJmkYR9X9fCLtCOJc5w==",
+ "dev": true,
+ "requires": {
+ "glob": "7.1.3"
+ }
+ },
+ "ripemd160": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/ripemd160/-/ripemd160-2.0.2.tgz",
+ "integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==",
+ "dev": true,
+ "requires": {
+ "hash-base": "3.0.4",
+ "inherits": "2.0.3"
+ }
+ },
+ "rollup": {
+ "version": "0.59.4",
+ "resolved": "https://registry.npmjs.org/rollup/-/rollup-0.59.4.tgz",
+ "integrity": "sha512-ISiMqq/aJa+57QxX2MRcvLESHdJ7wSavmr6U1euMr+6UgFe6KM+3QANrYy8LQofwhTC1I7BcAdlLnDiaODs1BA==",
+ "dev": true,
+ "requires": {
+ "@types/estree": "0.0.39",
+ "@types/node": "8.9.5"
+ }
+ },
+ "rollup-plugin-commonjs": {
+ "version": "9.1.6",
+ "resolved": "https://registry.npmjs.org/rollup-plugin-commonjs/-/rollup-plugin-commonjs-9.1.6.tgz",
+ "integrity": "sha512-J7GOJm9uzEeLqkVxYSgjyoieh34hATWpa9G2M1ilGzWOLYGfQx5IDQ9ewG8QUj/Z2dzgV+d0/AyloAzElkABAA==",
+ "dev": true,
+ "requires": {
+ "estree-walker": "0.5.2",
+ "magic-string": "0.22.5",
+ "resolve": "1.8.1",
+ "rollup-pluginutils": "2.3.1"
+ }
+ },
+ "rollup-plugin-node-resolve": {
+ "version": "3.4.0",
+ "resolved": "https://registry.npmjs.org/rollup-plugin-node-resolve/-/rollup-plugin-node-resolve-3.4.0.tgz",
+ "integrity": "sha512-PJcd85dxfSBWih84ozRtBkB731OjXk0KnzN0oGp7WOWcarAFkVa71cV5hTJg2qpVsV2U8EUwrzHP3tvy9vS3qg==",
+ "dev": true,
+ "requires": {
+ "builtin-modules": "2.0.0",
+ "is-module": "1.0.0",
+ "resolve": "1.8.1"
+ },
+ "dependencies": {
+ "builtin-modules": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/builtin-modules/-/builtin-modules-2.0.0.tgz",
+ "integrity": "sha512-3U5kUA5VPsRUA3nofm/BXX7GVHKfxz0hOBAPxXrIvHzlDRkQVqEn6yi8QJegxl4LzOHLdvb7XF5dVawa/VVYBg==",
+ "dev": true
+ }
+ }
+ },
+ "rollup-plugin-sourcemaps": {
+ "version": "0.4.2",
+ "resolved": "https://registry.npmjs.org/rollup-plugin-sourcemaps/-/rollup-plugin-sourcemaps-0.4.2.tgz",
+ "integrity": "sha1-YhJaqUCHqt97g+9N+vYptHMTXoc=",
+ "dev": true,
+ "requires": {
+ "rollup-pluginutils": "2.3.1",
+ "source-map-resolve": "0.5.2"
+ }
+ },
+ "rollup-pluginutils": {
+ "version": "2.3.1",
+ "resolved": "https://registry.npmjs.org/rollup-pluginutils/-/rollup-pluginutils-2.3.1.tgz",
+ "integrity": "sha512-JZS8aJMHEHhqmY2QVPMXwKP6lsD1ShkrcGYjhAIvqKKdXQyPHw/9NF0tl3On/xOJ4ACkxfeG7AF+chfCN1NpBg==",
+ "dev": true,
+ "requires": {
+ "estree-walker": "0.5.2",
+ "micromatch": "2.3.11"
+ },
+ "dependencies": {
+ "arr-diff": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-2.0.0.tgz",
+ "integrity": "sha1-jzuCf5Vai9ZpaX5KQlasPOrjVs8=",
+ "dev": true,
+ "requires": {
+ "arr-flatten": "1.1.0"
+ }
+ },
+ "array-unique": {
+ "version": "0.2.1",
+ "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.2.1.tgz",
+ "integrity": "sha1-odl8yvy8JiXMcPrc6zalDFiwGlM=",
+ "dev": true
+ },
+ "braces": {
+ "version": "1.8.5",
+ "resolved": "https://registry.npmjs.org/braces/-/braces-1.8.5.tgz",
+ "integrity": "sha1-uneWLhLf+WnWt2cR6RS3N4V79qc=",
+ "dev": true,
+ "requires": {
+ "expand-range": "1.8.2",
+ "preserve": "0.2.0",
+ "repeat-element": "1.1.3"
+ }
+ },
+ "expand-brackets": {
+ "version": "0.1.5",
+ "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-0.1.5.tgz",
+ "integrity": "sha1-3wcoTjQqgHzXM6xa9yQR5YHRF3s=",
+ "dev": true,
+ "requires": {
+ "is-posix-bracket": "0.1.1"
+ }
+ },
+ "extglob": {
+ "version": "0.3.2",
+ "resolved": "https://registry.npmjs.org/extglob/-/extglob-0.3.2.tgz",
+ "integrity": "sha1-Lhj/PS9JqydlzskCPwEdqo2DSaE=",
+ "dev": true,
+ "requires": {
+ "is-extglob": "1.0.0"
+ }
+ },
+ "is-extglob": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-1.0.0.tgz",
+ "integrity": "sha1-rEaBd8SUNAWgkvyPKXYMb/xiBsA=",
+ "dev": true
+ },
+ "is-glob": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-2.0.1.tgz",
+ "integrity": "sha1-0Jb5JqPe1WAPP9/ZEZjLCIjC2GM=",
+ "dev": true,
+ "requires": {
+ "is-extglob": "1.0.0"
+ }
+ },
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ },
+ "micromatch": {
+ "version": "2.3.11",
+ "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-2.3.11.tgz",
+ "integrity": "sha1-hmd8l9FyCzY0MdBNDRUpO9OMFWU=",
+ "dev": true,
+ "requires": {
+ "arr-diff": "2.0.0",
+ "array-unique": "0.2.1",
+ "braces": "1.8.5",
+ "expand-brackets": "0.1.5",
+ "extglob": "0.3.2",
+ "filename-regex": "2.0.1",
+ "is-extglob": "1.0.0",
+ "is-glob": "2.0.1",
+ "kind-of": "3.2.2",
+ "normalize-path": "2.1.1",
+ "object.omit": "2.0.1",
+ "parse-glob": "3.0.4",
+ "regex-cache": "0.4.4"
+ }
+ }
+ }
+ },
+ "run-queue": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/run-queue/-/run-queue-1.0.3.tgz",
+ "integrity": "sha1-6Eg5bwV9Ij8kOGkkYY4laUFh7Ec=",
+ "dev": true,
+ "requires": {
+ "aproba": "1.2.0"
+ }
+ },
+ "rw": {
+ "version": "1.3.3",
+ "resolved": "https://registry.npmjs.org/rw/-/rw-1.3.3.tgz",
+ "integrity": "sha1-P4Yt+pGrdmsUiF700BEkv9oHT7Q="
+ },
+ "rxjs": {
+ "version": "6.3.2",
+ "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.3.2.tgz",
+ "integrity": "sha512-hV7criqbR0pe7EeL3O66UYVg92IR0XsA97+9y+BWTePK9SKmEI5Qd3Zj6uPnGkNzXsBywBQWTvujPl+1Kn9Zjw==",
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "safe-buffer": {
+ "version": "5.1.2",
+ "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz",
+ "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==",
+ "dev": true
+ },
+ "safe-regex": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/safe-regex/-/safe-regex-1.1.0.tgz",
+ "integrity": "sha1-QKNmnzsHfR6UPURinhV91IAjvy4=",
+ "dev": true,
+ "requires": {
+ "ret": "0.1.15"
+ }
+ },
+ "safefs": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/safefs/-/safefs-4.1.0.tgz",
+ "integrity": "sha1-+CrrS9165R9lPrIPZyizBYyNZEU=",
+ "dev": true,
+ "requires": {
+ "editions": "1.3.4",
+ "graceful-fs": "4.1.11"
+ }
+ },
+ "safer-buffer": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz",
+ "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==",
+ "dev": true
+ },
+ "sass-graph": {
+ "version": "2.2.4",
+ "resolved": "https://registry.npmjs.org/sass-graph/-/sass-graph-2.2.4.tgz",
+ "integrity": "sha1-E/vWPNHK8JCLn9k0dq1DpR0eC0k=",
+ "dev": true,
+ "requires": {
+ "glob": "7.1.3",
+ "lodash": "4.17.10",
+ "scss-tokenizer": "0.2.3",
+ "yargs": "7.1.0"
+ }
+ },
+ "sass-loader": {
+ "version": "7.1.0",
+ "resolved": "https://registry.npmjs.org/sass-loader/-/sass-loader-7.1.0.tgz",
+ "integrity": "sha512-+G+BKGglmZM2GUSfT9TLuEp6tzehHPjAMoRRItOojWIqIGPloVCMhNIQuG639eJ+y033PaGTSjLaTHts8Kw79w==",
+ "dev": true,
+ "requires": {
+ "clone-deep": "2.0.2",
+ "loader-utils": "1.1.0",
+ "lodash.tail": "4.1.1",
+ "neo-async": "2.5.2",
+ "pify": "3.0.0",
+ "semver": "5.5.1"
+ }
+ },
+ "saucelabs": {
+ "version": "1.5.0",
+ "resolved": "https://registry.npmjs.org/saucelabs/-/saucelabs-1.5.0.tgz",
+ "integrity": "sha512-jlX3FGdWvYf4Q3LFfFWS1QvPg3IGCGWxIc8QBFdPTbpTJnt/v17FHXYVAn7C8sHf1yUXo2c7yIM0isDryfYtHQ==",
+ "dev": true,
+ "requires": {
+ "https-proxy-agent": "2.2.1"
+ }
+ },
+ "sax": {
+ "version": "0.5.8",
+ "resolved": "http://registry.npmjs.org/sax/-/sax-0.5.8.tgz",
+ "integrity": "sha1-1HLbIo6zMcJQaw6MFVJK25OdEsE=",
+ "dev": true
+ },
+ "scandirectory": {
+ "version": "2.5.0",
+ "resolved": "https://registry.npmjs.org/scandirectory/-/scandirectory-2.5.0.tgz",
+ "integrity": "sha1-bOA/VKCQtmjjy+2/IO354xBZPnI=",
+ "dev": true,
+ "requires": {
+ "ignorefs": "1.2.0",
+ "safefs": "3.2.2",
+ "taskgroup": "4.3.1"
+ },
+ "dependencies": {
+ "safefs": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/safefs/-/safefs-3.2.2.tgz",
+ "integrity": "sha1-gXDBRE1wOOCMrqBaN0+uL6NJ4Vw=",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11"
+ }
+ },
+ "taskgroup": {
+ "version": "4.3.1",
+ "resolved": "https://registry.npmjs.org/taskgroup/-/taskgroup-4.3.1.tgz",
+ "integrity": "sha1-feGT/r12gnPEV3MElwJNUSwnkVo=",
+ "dev": true,
+ "requires": {
+ "ambi": "2.5.0",
+ "csextends": "1.2.0"
+ }
+ }
+ }
+ },
+ "schema-utils": {
+ "version": "0.4.7",
+ "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-0.4.7.tgz",
+ "integrity": "sha512-v/iwU6wvwGK8HbU9yi3/nhGzP0yGSuhQMzL6ySiec1FSrZZDkhm4noOSWzrNFo/jEc+SJY6jRTwuwbSXJPDUnQ==",
+ "dev": true,
+ "requires": {
+ "ajv": "6.4.0",
+ "ajv-keywords": "3.2.0"
+ }
+ },
+ "scss-tokenizer": {
+ "version": "0.2.3",
+ "resolved": "https://registry.npmjs.org/scss-tokenizer/-/scss-tokenizer-0.2.3.tgz",
+ "integrity": "sha1-jrBtualyMzOCTT9VMGQRSYR85dE=",
+ "dev": true,
+ "requires": {
+ "js-base64": "2.4.9",
+ "source-map": "0.4.4"
+ },
+ "dependencies": {
+ "source-map": {
+ "version": "0.4.4",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.4.4.tgz",
+ "integrity": "sha1-66T12pwNyZneaAMti092FzZSA2s=",
+ "dev": true,
+ "requires": {
+ "amdefine": "1.0.1"
+ }
+ }
+ }
+ },
+ "select-hose": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/select-hose/-/select-hose-2.0.0.tgz",
+ "integrity": "sha1-Yl2GWPhlr0Psliv8N2o3NZpJlMo=",
+ "dev": true
+ },
+ "selenium-webdriver": {
+ "version": "3.6.0",
+ "resolved": "https://registry.npmjs.org/selenium-webdriver/-/selenium-webdriver-3.6.0.tgz",
+ "integrity": "sha512-WH7Aldse+2P5bbFBO4Gle/nuQOdVwpHMTL6raL3uuBj/vPG07k6uzt3aiahu352ONBr5xXh0hDlM3LhtXPOC4Q==",
+ "dev": true,
+ "requires": {
+ "jszip": "3.1.5",
+ "rimraf": "2.6.2",
+ "tmp": "0.0.30",
+ "xml2js": "0.4.19"
+ },
+ "dependencies": {
+ "tmp": {
+ "version": "0.0.30",
+ "resolved": "https://registry.npmjs.org/tmp/-/tmp-0.0.30.tgz",
+ "integrity": "sha1-ckGdSovn1s51FI/YsyTlk6cRwu0=",
+ "dev": true,
+ "requires": {
+ "os-tmpdir": "1.0.2"
+ }
+ }
+ }
+ },
+ "selfsigned": {
+ "version": "1.10.3",
+ "resolved": "https://registry.npmjs.org/selfsigned/-/selfsigned-1.10.3.tgz",
+ "integrity": "sha512-vmZenZ+8Al3NLHkWnhBQ0x6BkML1eCP2xEi3JE+f3D9wW9fipD9NNJHYtE9XJM4TsPaHGZJIamrSI6MTg1dU2Q==",
+ "dev": true,
+ "requires": {
+ "node-forge": "0.7.5"
+ }
+ },
+ "semver": {
+ "version": "5.5.1",
+ "resolved": "https://registry.npmjs.org/semver/-/semver-5.5.1.tgz",
+ "integrity": "sha512-PqpAxfrEhlSUWge8dwIp4tZnQ25DIOthpiaHNIthsjEFQD6EvqUKUDM7L8O2rShkFccYo1VjJR0coWfNkCubRw==",
+ "dev": true
+ },
+ "semver-diff": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/semver-diff/-/semver-diff-2.1.0.tgz",
+ "integrity": "sha1-S7uEN8jTfksM8aaP1ybsbWRdbTY=",
+ "dev": true,
+ "requires": {
+ "semver": "5.5.1"
+ }
+ },
+ "semver-dsl": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/semver-dsl/-/semver-dsl-1.0.1.tgz",
+ "integrity": "sha1-02eN5VVeimH2Ke7QJTZq5fJzQKA=",
+ "dev": true,
+ "requires": {
+ "semver": "5.5.1"
+ }
+ },
+ "semver-intersect": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/semver-intersect/-/semver-intersect-1.4.0.tgz",
+ "integrity": "sha512-d8fvGg5ycKAq0+I6nfWeCx6ffaWJCsBYU0H2Rq56+/zFePYfT8mXkB3tWBSjR5BerkHNZ5eTPIk1/LBYas35xQ==",
+ "dev": true,
+ "requires": {
+ "semver": "5.5.1"
+ }
+ },
+ "send": {
+ "version": "0.16.2",
+ "resolved": "https://registry.npmjs.org/send/-/send-0.16.2.tgz",
+ "integrity": "sha512-E64YFPUssFHEFBvpbbjr44NCLtI1AohxQ8ZSiJjQLskAdKuriYEP6VyGEsRDH8ScozGpkaX1BGvhanqCwkcEZw==",
+ "dev": true,
+ "requires": {
+ "debug": "2.6.9",
+ "depd": "1.1.2",
+ "destroy": "1.0.4",
+ "encodeurl": "1.0.2",
+ "escape-html": "1.0.3",
+ "etag": "1.8.1",
+ "fresh": "0.5.2",
+ "http-errors": "1.6.3",
+ "mime": "1.4.1",
+ "ms": "2.0.0",
+ "on-finished": "2.3.0",
+ "range-parser": "1.2.0",
+ "statuses": "1.4.0"
+ },
+ "dependencies": {
+ "mime": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/mime/-/mime-1.4.1.tgz",
+ "integrity": "sha512-KI1+qOZu5DcW6wayYHSzR/tXKCDC5Om4s1z2QJjDULzLcmf3DvzS7oluY4HCTrc+9FiKmWUgeNLg7W3uIQvxtQ==",
+ "dev": true
+ }
+ }
+ },
+ "serialize-javascript": {
+ "version": "1.5.0",
+ "resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-1.5.0.tgz",
+ "integrity": "sha512-Ga8c8NjAAp46Br4+0oZ2WxJCwIzwP60Gq1YPgU+39PiTVxyed/iKE/zyZI6+UlVYH5Q4PaQdHhcegIFPZTUfoQ==",
+ "dev": true
+ },
+ "serve-index": {
+ "version": "1.9.1",
+ "resolved": "https://registry.npmjs.org/serve-index/-/serve-index-1.9.1.tgz",
+ "integrity": "sha1-03aNabHn2C5c4FD/9bRTvqEqkjk=",
+ "dev": true,
+ "requires": {
+ "accepts": "1.3.5",
+ "batch": "0.6.1",
+ "debug": "2.6.9",
+ "escape-html": "1.0.3",
+ "http-errors": "1.6.3",
+ "mime-types": "2.1.20",
+ "parseurl": "1.3.2"
+ }
+ },
+ "serve-static": {
+ "version": "1.13.2",
+ "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.13.2.tgz",
+ "integrity": "sha512-p/tdJrO4U387R9oMjb1oj7qSMaMfmOyd4j9hOFoxZe2baQszgHcSWjuya/CiT5kgZZKRudHNOA0pYXOl8rQ5nw==",
+ "dev": true,
+ "requires": {
+ "encodeurl": "1.0.2",
+ "escape-html": "1.0.3",
+ "parseurl": "1.3.2",
+ "send": "0.16.2"
+ }
+ },
+ "set-blocking": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz",
+ "integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=",
+ "dev": true
+ },
+ "set-immediate-shim": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/set-immediate-shim/-/set-immediate-shim-1.0.1.tgz",
+ "integrity": "sha1-SysbJ+uAip+NzEgaWOXlb1mfP2E=",
+ "dev": true
+ },
+ "set-value": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/set-value/-/set-value-2.0.0.tgz",
+ "integrity": "sha512-hw0yxk9GT/Hr5yJEYnHNKYXkIA8mVJgd9ditYZCe16ZczcaELYYcfvaXesNACk2O8O0nTiPQcQhGUQj8JLzeeg==",
+ "dev": true,
+ "requires": {
+ "extend-shallow": "2.0.1",
+ "is-extendable": "0.1.1",
+ "is-plain-object": "2.0.4",
+ "split-string": "3.1.0"
+ },
+ "dependencies": {
+ "extend-shallow": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+ "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+ "dev": true,
+ "requires": {
+ "is-extendable": "0.1.1"
+ }
+ }
+ }
+ },
+ "setimmediate": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/setimmediate/-/setimmediate-1.0.5.tgz",
+ "integrity": "sha1-KQy7Iy4waULX1+qbg3Mqt4VvgoU=",
+ "dev": true
+ },
+ "setprototypeof": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.1.0.tgz",
+ "integrity": "sha512-BvE/TwpZX4FXExxOxZyRGQQv651MSwmWKZGqvmPcRIjDqWub67kTKuIMx43cZZrS/cBBzwBcNDWoFxt2XEFIpQ==",
+ "dev": true
+ },
+ "sha.js": {
+ "version": "2.4.11",
+ "resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz",
+ "integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3",
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "shallow-clone": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/shallow-clone/-/shallow-clone-1.0.0.tgz",
+ "integrity": "sha512-oeXreoKR/SyNJtRJMAKPDSvd28OqEwG4eR/xc856cRGBII7gX9lvAqDxusPm0846z/w/hWYjI1NpKwJ00NHzRA==",
+ "dev": true,
+ "requires": {
+ "is-extendable": "0.1.1",
+ "kind-of": "5.1.0",
+ "mixin-object": "2.0.1"
+ },
+ "dependencies": {
+ "kind-of": {
+ "version": "5.1.0",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz",
+ "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==",
+ "dev": true
+ }
+ }
+ },
+ "shebang-command": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-1.2.0.tgz",
+ "integrity": "sha1-RKrGW2lbAzmJaMOfNj/uXer98eo=",
+ "dev": true,
+ "requires": {
+ "shebang-regex": "1.0.0"
+ }
+ },
+ "shebang-regex": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-1.0.0.tgz",
+ "integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=",
+ "dev": true
+ },
+ "signal-exit": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz",
+ "integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=",
+ "dev": true
+ },
+ "silent-error": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/silent-error/-/silent-error-1.1.0.tgz",
+ "integrity": "sha1-IglwbxyFCp8dENDYQJGLRvJuG8k=",
+ "dev": true,
+ "requires": {
+ "debug": "2.6.9"
+ }
+ },
+ "slash": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/slash/-/slash-1.0.0.tgz",
+ "integrity": "sha1-xB8vbDn8FtHNF61LXYlhFK5HDVU=",
+ "dev": true
+ },
+ "slide": {
+ "version": "1.1.6",
+ "resolved": "https://registry.npmjs.org/slide/-/slide-1.1.6.tgz",
+ "integrity": "sha1-VusCfWW00tzmyy4tMsTUr8nh1wc=",
+ "dev": true
+ },
+ "snapdragon": {
+ "version": "0.8.2",
+ "resolved": "https://registry.npmjs.org/snapdragon/-/snapdragon-0.8.2.tgz",
+ "integrity": "sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==",
+ "dev": true,
+ "requires": {
+ "base": "0.11.2",
+ "debug": "2.6.9",
+ "define-property": "0.2.5",
+ "extend-shallow": "2.0.1",
+ "map-cache": "0.2.2",
+ "source-map": "0.5.7",
+ "source-map-resolve": "0.5.2",
+ "use": "3.1.1"
+ },
+ "dependencies": {
+ "define-property": {
+ "version": "0.2.5",
+ "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
+ "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
+ "dev": true,
+ "requires": {
+ "is-descriptor": "0.1.6"
+ }
+ },
+ "extend-shallow": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+ "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+ "dev": true,
+ "requires": {
+ "is-extendable": "0.1.1"
+ }
+ }
+ }
+ },
+ "snapdragon-node": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/snapdragon-node/-/snapdragon-node-2.1.1.tgz",
+ "integrity": "sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==",
+ "dev": true,
+ "requires": {
+ "define-property": "1.0.0",
+ "isobject": "3.0.1",
+ "snapdragon-util": "3.0.1"
+ },
+ "dependencies": {
+ "define-property": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
+ "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
+ "dev": true,
+ "requires": {
+ "is-descriptor": "1.0.2"
+ }
+ },
+ "is-accessor-descriptor": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
+ "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
+ "dev": true,
+ "requires": {
+ "kind-of": "6.0.2"
+ }
+ },
+ "is-data-descriptor": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
+ "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
+ "dev": true,
+ "requires": {
+ "kind-of": "6.0.2"
+ }
+ },
+ "is-descriptor": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
+ "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
+ "dev": true,
+ "requires": {
+ "is-accessor-descriptor": "1.0.0",
+ "is-data-descriptor": "1.0.0",
+ "kind-of": "6.0.2"
+ }
+ }
+ }
+ },
+ "snapdragon-util": {
+ "version": "3.0.1",
+ "resolved": "https://registry.npmjs.org/snapdragon-util/-/snapdragon-util-3.0.1.tgz",
+ "integrity": "sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==",
+ "dev": true,
+ "requires": {
+ "kind-of": "3.2.2"
+ },
+ "dependencies": {
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ }
+ }
+ },
+ "socket.io": {
+ "version": "1.7.3",
+ "resolved": "https://registry.npmjs.org/socket.io/-/socket.io-1.7.3.tgz",
+ "integrity": "sha1-uK+cq6AJSeVo42nxMn6pvp6iRhs=",
+ "dev": true,
+ "requires": {
+ "debug": "2.3.3",
+ "engine.io": "1.8.3",
+ "has-binary": "0.1.7",
+ "object-assign": "4.1.0",
+ "socket.io-adapter": "0.5.0",
+ "socket.io-client": "1.7.3",
+ "socket.io-parser": "2.3.1"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "2.3.3",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.3.3.tgz",
+ "integrity": "sha1-QMRT5n5uE8kB3ewxeviYbNqe/4w=",
+ "dev": true,
+ "requires": {
+ "ms": "0.7.2"
+ }
+ },
+ "ms": {
+ "version": "0.7.2",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
+ "integrity": "sha1-riXPJRKziFodldfwN4aNhDESR2U=",
+ "dev": true
+ },
+ "object-assign": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.0.tgz",
+ "integrity": "sha1-ejs9DpgGPUP0wD8uiubNUahog6A=",
+ "dev": true
+ }
+ }
+ },
+ "socket.io-adapter": {
+ "version": "0.5.0",
+ "resolved": "https://registry.npmjs.org/socket.io-adapter/-/socket.io-adapter-0.5.0.tgz",
+ "integrity": "sha1-y21LuL7IHhB4uZZ3+c7QBGBmu4s=",
+ "dev": true,
+ "requires": {
+ "debug": "2.3.3",
+ "socket.io-parser": "2.3.1"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "2.3.3",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.3.3.tgz",
+ "integrity": "sha1-QMRT5n5uE8kB3ewxeviYbNqe/4w=",
+ "dev": true,
+ "requires": {
+ "ms": "0.7.2"
+ }
+ },
+ "ms": {
+ "version": "0.7.2",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
+ "integrity": "sha1-riXPJRKziFodldfwN4aNhDESR2U=",
+ "dev": true
+ }
+ }
+ },
+ "socket.io-client": {
+ "version": "1.7.3",
+ "resolved": "https://registry.npmjs.org/socket.io-client/-/socket.io-client-1.7.3.tgz",
+ "integrity": "sha1-sw6GqhDV7zVGYBwJzeR2Xjgdo3c=",
+ "dev": true,
+ "requires": {
+ "backo2": "1.0.2",
+ "component-bind": "1.0.0",
+ "component-emitter": "1.2.1",
+ "debug": "2.3.3",
+ "engine.io-client": "1.8.3",
+ "has-binary": "0.1.7",
+ "indexof": "0.0.1",
+ "object-component": "0.0.3",
+ "parseuri": "0.0.5",
+ "socket.io-parser": "2.3.1",
+ "to-array": "0.1.4"
+ },
+ "dependencies": {
+ "debug": {
+ "version": "2.3.3",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.3.3.tgz",
+ "integrity": "sha1-QMRT5n5uE8kB3ewxeviYbNqe/4w=",
+ "dev": true,
+ "requires": {
+ "ms": "0.7.2"
+ }
+ },
+ "ms": {
+ "version": "0.7.2",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
+ "integrity": "sha1-riXPJRKziFodldfwN4aNhDESR2U=",
+ "dev": true
+ }
+ }
+ },
+ "socket.io-parser": {
+ "version": "2.3.1",
+ "resolved": "https://registry.npmjs.org/socket.io-parser/-/socket.io-parser-2.3.1.tgz",
+ "integrity": "sha1-3VMgJRA85Clpcya+/WQAX8/ltKA=",
+ "dev": true,
+ "requires": {
+ "component-emitter": "1.1.2",
+ "debug": "2.2.0",
+ "isarray": "0.0.1",
+ "json3": "3.3.2"
+ },
+ "dependencies": {
+ "component-emitter": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.1.2.tgz",
+ "integrity": "sha1-KWWU8nU9qmOZbSrwjRWpURbJrsM=",
+ "dev": true
+ },
+ "debug": {
+ "version": "2.2.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz",
+ "integrity": "sha1-+HBX6ZWxofauaklgZkE3vFbwOdo=",
+ "dev": true,
+ "requires": {
+ "ms": "0.7.1"
+ }
+ },
+ "isarray": {
+ "version": "0.0.1",
+ "resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz",
+ "integrity": "sha1-ihis/Kmo9Bd+Cav8YDiTmwXR7t8=",
+ "dev": true
+ },
+ "ms": {
+ "version": "0.7.1",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz",
+ "integrity": "sha1-nNE8A62/8ltl7/3nzoZO6VIBcJg=",
+ "dev": true
+ }
+ }
+ },
+ "sockjs": {
+ "version": "0.3.19",
+ "resolved": "https://registry.npmjs.org/sockjs/-/sockjs-0.3.19.tgz",
+ "integrity": "sha512-V48klKZl8T6MzatbLlzzRNhMepEys9Y4oGFpypBFFn1gLI/QQ9HtLLyWJNbPlwGLelOVOEijUbTTJeLLI59jLw==",
+ "dev": true,
+ "requires": {
+ "faye-websocket": "0.10.0",
+ "uuid": "3.3.2"
+ }
+ },
+ "sockjs-client": {
+ "version": "1.1.5",
+ "resolved": "https://registry.npmjs.org/sockjs-client/-/sockjs-client-1.1.5.tgz",
+ "integrity": "sha1-G7fA9yIsQPQq3xT0RCy9Eml3GoM=",
+ "dev": true,
+ "requires": {
+ "debug": "2.6.9",
+ "eventsource": "0.1.6",
+ "faye-websocket": "0.11.1",
+ "inherits": "2.0.3",
+ "json3": "3.3.2",
+ "url-parse": "1.4.3"
+ },
+ "dependencies": {
+ "faye-websocket": {
+ "version": "0.11.1",
+ "resolved": "https://registry.npmjs.org/faye-websocket/-/faye-websocket-0.11.1.tgz",
+ "integrity": "sha1-8O/hjE9W5PQK/H4Gxxn9XuYYjzg=",
+ "dev": true,
+ "requires": {
+ "websocket-driver": "0.7.0"
+ }
+ }
+ }
+ },
+ "source-list-map": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/source-list-map/-/source-list-map-2.0.0.tgz",
+ "integrity": "sha512-I2UmuJSRr/T8jisiROLU3A3ltr+swpniSmNPI4Ml3ZCX6tVnDsuZzK7F2hl5jTqbZBWCEKlj5HRQiPExXLgE8A==",
+ "dev": true
+ },
+ "source-map": {
+ "version": "0.5.7",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz",
+ "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=",
+ "dev": true
+ },
+ "source-map-resolve": {
+ "version": "0.5.2",
+ "resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.2.tgz",
+ "integrity": "sha512-MjqsvNwyz1s0k81Goz/9vRBe9SZdB09Bdw+/zYyO+3CuPk6fouTaxscHkgtE8jKvf01kVfl8riHzERQ/kefaSA==",
+ "dev": true,
+ "requires": {
+ "atob": "2.1.2",
+ "decode-uri-component": "0.2.0",
+ "resolve-url": "0.2.1",
+ "source-map-url": "0.4.0",
+ "urix": "0.1.0"
+ }
+ },
+ "source-map-support": {
+ "version": "0.5.9",
+ "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.9.tgz",
+ "integrity": "sha512-gR6Rw4MvUlYy83vP0vxoVNzM6t8MUXqNuRsuBmBHQDu1Fh6X015FrLdgoDKcNdkwGubozq0P4N0Q37UyFVr1EA==",
+ "dev": true,
+ "requires": {
+ "buffer-from": "1.1.1",
+ "source-map": "0.6.1"
+ },
+ "dependencies": {
+ "source-map": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+ "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+ "dev": true
+ }
+ }
+ },
+ "source-map-url": {
+ "version": "0.4.0",
+ "resolved": "https://registry.npmjs.org/source-map-url/-/source-map-url-0.4.0.tgz",
+ "integrity": "sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=",
+ "dev": true
+ },
+ "spdx-correct": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/spdx-correct/-/spdx-correct-3.0.0.tgz",
+ "integrity": "sha512-N19o9z5cEyc8yQQPukRCZ9EUmb4HUpnrmaL/fxS2pBo2jbfcFRVuFZ/oFC+vZz0MNNk0h80iMn5/S6qGZOL5+g==",
+ "dev": true,
+ "requires": {
+ "spdx-expression-parse": "3.0.0",
+ "spdx-license-ids": "3.0.0"
+ }
+ },
+ "spdx-exceptions": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/spdx-exceptions/-/spdx-exceptions-2.1.0.tgz",
+ "integrity": "sha512-4K1NsmrlCU1JJgUrtgEeTVyfx8VaYea9J9LvARxhbHtVtohPs/gFGG5yy49beySjlIMhhXZ4QqujIZEfS4l6Cg==",
+ "dev": true
+ },
+ "spdx-expression-parse": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/spdx-expression-parse/-/spdx-expression-parse-3.0.0.tgz",
+ "integrity": "sha512-Yg6D3XpRD4kkOmTpdgbUiEJFKghJH03fiC1OPll5h/0sO6neh2jqRDVHOQ4o/LMea0tgCkbMgea5ip/e+MkWyg==",
+ "dev": true,
+ "requires": {
+ "spdx-exceptions": "2.1.0",
+ "spdx-license-ids": "3.0.0"
+ }
+ },
+ "spdx-license-ids": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/spdx-license-ids/-/spdx-license-ids-3.0.0.tgz",
+ "integrity": "sha512-2+EPwgbnmOIl8HjGBXXMd9NAu02vLjOO1nWw4kmeRDFyHn+M/ETfHxQUK0oXg8ctgVnl9t3rosNVsZ1jG61nDA==",
+ "dev": true
+ },
+ "spdy": {
+ "version": "3.4.7",
+ "resolved": "https://registry.npmjs.org/spdy/-/spdy-3.4.7.tgz",
+ "integrity": "sha1-Qv9B7OXMD5mjpsKKq7c/XDsDrLw=",
+ "dev": true,
+ "requires": {
+ "debug": "2.6.9",
+ "handle-thing": "1.2.5",
+ "http-deceiver": "1.2.7",
+ "safe-buffer": "5.1.2",
+ "select-hose": "2.0.0",
+ "spdy-transport": "2.1.0"
+ }
+ },
+ "spdy-transport": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/spdy-transport/-/spdy-transport-2.1.0.tgz",
+ "integrity": "sha512-bpUeGpZcmZ692rrTiqf9/2EUakI6/kXX1Rpe0ib/DyOzbiexVfXkw6GnvI9hVGvIwVaUhkaBojjCZwLNRGQg1g==",
+ "dev": true,
+ "requires": {
+ "debug": "2.6.9",
+ "detect-node": "2.0.4",
+ "hpack.js": "2.1.6",
+ "obuf": "1.1.2",
+ "readable-stream": "2.3.6",
+ "safe-buffer": "5.1.2",
+ "wbuf": "1.7.3"
+ }
+ },
+ "split": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/split/-/split-1.0.1.tgz",
+ "integrity": "sha512-mTyOoPbrivtXnwnIxZRFYRrPNtEFKlpB2fvjSnCQUiAA6qAZzqwna5envK4uk6OIeP17CsdF3rSBGYVBsU0Tkg==",
+ "dev": true,
+ "requires": {
+ "through": "2.3.8"
+ }
+ },
+ "split-string": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/split-string/-/split-string-3.1.0.tgz",
+ "integrity": "sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==",
+ "dev": true,
+ "requires": {
+ "extend-shallow": "3.0.2"
+ }
+ },
+ "sprintf-js": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/sprintf-js/-/sprintf-js-1.0.3.tgz",
+ "integrity": "sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=",
+ "dev": true
+ },
+ "sshpk": {
+ "version": "1.14.2",
+ "resolved": "https://registry.npmjs.org/sshpk/-/sshpk-1.14.2.tgz",
+ "integrity": "sha1-xvxhZIo9nE52T9P8306hBeSSupg=",
+ "dev": true,
+ "requires": {
+ "asn1": "0.2.4",
+ "assert-plus": "1.0.0",
+ "bcrypt-pbkdf": "1.0.2",
+ "dashdash": "1.14.1",
+ "ecc-jsbn": "0.1.2",
+ "getpass": "0.1.7",
+ "jsbn": "0.1.1",
+ "safer-buffer": "2.1.2",
+ "tweetnacl": "0.14.5"
+ }
+ },
+ "ssri": {
+ "version": "5.3.0",
+ "resolved": "https://registry.npmjs.org/ssri/-/ssri-5.3.0.tgz",
+ "integrity": "sha512-XRSIPqLij52MtgoQavH/x/dU1qVKtWUAAZeOHsR9c2Ddi4XerFy3mc1alf+dLJKl9EUIm/Ht+EowFkTUOA6GAQ==",
+ "dev": true,
+ "requires": {
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "static-extend": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/static-extend/-/static-extend-0.1.2.tgz",
+ "integrity": "sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=",
+ "dev": true,
+ "requires": {
+ "define-property": "0.2.5",
+ "object-copy": "0.1.0"
+ },
+ "dependencies": {
+ "define-property": {
+ "version": "0.2.5",
+ "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
+ "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
+ "dev": true,
+ "requires": {
+ "is-descriptor": "0.1.6"
+ }
+ }
+ }
+ },
+ "stats-webpack-plugin": {
+ "version": "0.6.2",
+ "resolved": "https://registry.npmjs.org/stats-webpack-plugin/-/stats-webpack-plugin-0.6.2.tgz",
+ "integrity": "sha1-LFlJtTHgf4eojm6k3PrFOqjHWis=",
+ "dev": true,
+ "requires": {
+ "lodash": "4.17.10"
+ }
+ },
+ "statuses": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.4.0.tgz",
+ "integrity": "sha512-zhSCtt8v2NDrRlPQpCNtw/heZLtfUDqxBM1udqikb/Hbk52LK4nQSwr10u77iopCW5LsyHpuXS0GnEc48mLeew==",
+ "dev": true
+ },
+ "stdout-stream": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/stdout-stream/-/stdout-stream-1.4.1.tgz",
+ "integrity": "sha512-j4emi03KXqJWcIeF8eIXkjMFN1Cmb8gUlDYGeBALLPo5qdyTfA9bOtl8m33lRoC+vFMkP3gl0WsDr6+gzxbbTA==",
+ "dev": true,
+ "requires": {
+ "readable-stream": "2.3.6"
+ }
+ },
+ "stream-browserify": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-2.0.1.tgz",
+ "integrity": "sha1-ZiZu5fm9uZQKTkUUyvtDu3Hlyds=",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3",
+ "readable-stream": "2.3.6"
+ }
+ },
+ "stream-combiner": {
+ "version": "0.2.2",
+ "resolved": "https://registry.npmjs.org/stream-combiner/-/stream-combiner-0.2.2.tgz",
+ "integrity": "sha1-rsjLrBd7Vrb0+kec7YwZEs7lKFg=",
+ "dev": true,
+ "requires": {
+ "duplexer": "0.1.1",
+ "through": "2.3.8"
+ }
+ },
+ "stream-each": {
+ "version": "1.2.3",
+ "resolved": "https://registry.npmjs.org/stream-each/-/stream-each-1.2.3.tgz",
+ "integrity": "sha512-vlMC2f8I2u/bZGqkdfLQW/13Zihpej/7PmSiMQsbYddxuTsJp8vRe2x2FvVExZg7FaOds43ROAuFJwPR4MTZLw==",
+ "dev": true,
+ "requires": {
+ "end-of-stream": "1.4.1",
+ "stream-shift": "1.0.0"
+ }
+ },
+ "stream-http": {
+ "version": "2.8.3",
+ "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz",
+ "integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==",
+ "dev": true,
+ "requires": {
+ "builtin-status-codes": "3.0.0",
+ "inherits": "2.0.3",
+ "readable-stream": "2.3.6",
+ "to-arraybuffer": "1.0.1",
+ "xtend": "4.0.1"
+ }
+ },
+ "stream-shift": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/stream-shift/-/stream-shift-1.0.0.tgz",
+ "integrity": "sha1-1cdSgl5TZ+eG944Y5EXqIjoVWVI=",
+ "dev": true
+ },
+ "string-width": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz",
+ "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=",
+ "dev": true,
+ "requires": {
+ "code-point-at": "1.1.0",
+ "is-fullwidth-code-point": "1.0.0",
+ "strip-ansi": "3.0.1"
+ }
+ },
+ "string_decoder": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz",
+ "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==",
+ "dev": true,
+ "requires": {
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "strip-ansi": {
+ "version": "3.0.1",
+ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz",
+ "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=",
+ "dev": true,
+ "requires": {
+ "ansi-regex": "2.1.1"
+ }
+ },
+ "strip-bom": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-2.0.0.tgz",
+ "integrity": "sha1-YhmoVhZSBJHzV4i9vxRHqZx+aw4=",
+ "dev": true,
+ "requires": {
+ "is-utf8": "0.2.1"
+ }
+ },
+ "strip-eof": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz",
+ "integrity": "sha1-u0P/VZim6wXYm1n80SnJgzE2Br8=",
+ "dev": true
+ },
+ "strip-indent": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-1.0.1.tgz",
+ "integrity": "sha1-DHlipq3vp7vUrDZkYKY4VSrhoKI=",
+ "dev": true,
+ "requires": {
+ "get-stdin": "4.0.1"
+ }
+ },
+ "strip-json-comments": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-2.0.1.tgz",
+ "integrity": "sha1-PFMZQukIwml8DsNEhYwobHygpgo=",
+ "dev": true
+ },
+ "style-loader": {
+ "version": "0.21.0",
+ "resolved": "https://registry.npmjs.org/style-loader/-/style-loader-0.21.0.tgz",
+ "integrity": "sha512-T+UNsAcl3Yg+BsPKs1vd22Fr8sVT+CJMtzqc6LEw9bbJZb43lm9GoeIfUcDEefBSWC0BhYbcdupV1GtI4DGzxg==",
+ "dev": true,
+ "requires": {
+ "loader-utils": "1.1.0",
+ "schema-utils": "0.4.7"
+ }
+ },
+ "stylus": {
+ "version": "0.54.5",
+ "resolved": "https://registry.npmjs.org/stylus/-/stylus-0.54.5.tgz",
+ "integrity": "sha1-QrlWCTHKcJDOhRWnmLqeaqPW3Hk=",
+ "dev": true,
+ "requires": {
+ "css-parse": "1.7.0",
+ "debug": "2.6.9",
+ "glob": "7.0.6",
+ "mkdirp": "0.5.1",
+ "sax": "0.5.8",
+ "source-map": "0.1.43"
+ },
+ "dependencies": {
+ "glob": {
+ "version": "7.0.6",
+ "resolved": "https://registry.npmjs.org/glob/-/glob-7.0.6.tgz",
+ "integrity": "sha1-IRuvr0nlJbjNkyYNFKsTYVKz9Xo=",
+ "dev": true,
+ "requires": {
+ "fs.realpath": "1.0.0",
+ "inflight": "1.0.6",
+ "inherits": "2.0.3",
+ "minimatch": "3.0.4",
+ "once": "1.4.0",
+ "path-is-absolute": "1.0.1"
+ }
+ },
+ "source-map": {
+ "version": "0.1.43",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.1.43.tgz",
+ "integrity": "sha1-wkvBRspRfBRx9drL4lcbK3+eM0Y=",
+ "dev": true,
+ "requires": {
+ "amdefine": "1.0.1"
+ }
+ }
+ }
+ },
+ "stylus-loader": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/stylus-loader/-/stylus-loader-3.0.2.tgz",
+ "integrity": "sha512-+VomPdZ6a0razP+zinir61yZgpw2NfljeSsdUF5kJuEzlo3khXhY19Fn6l8QQz1GRJGtMCo8nG5C04ePyV7SUA==",
+ "dev": true,
+ "requires": {
+ "loader-utils": "1.1.0",
+ "lodash.clonedeep": "4.5.0",
+ "when": "3.6.4"
+ }
+ },
+ "supports-color": {
+ "version": "5.5.0",
+ "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
+ "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
+ "dev": true,
+ "requires": {
+ "has-flag": "3.0.0"
+ }
+ },
+ "symbol-observable": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/symbol-observable/-/symbol-observable-1.2.0.tgz",
+ "integrity": "sha512-e900nM8RRtGhlV36KGEU9k65K3mPb1WV70OdjfxlG2EAuM1noi/E/BaW/uMhL7bPEssK8QV57vN3esixjUvcXQ==",
+ "dev": true
+ },
+ "tapable": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/tapable/-/tapable-1.0.0.tgz",
+ "integrity": "sha512-dQRhbNQkRnaqauC7WqSJ21EEksgT0fYZX2lqXzGkpo8JNig9zGZTYoMGvyI2nWmXlE2VSVXVDu7wLVGu/mQEsg==",
+ "dev": true
+ },
+ "tar": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/tar/-/tar-2.2.1.tgz",
+ "integrity": "sha1-jk0qJWwOIYXGsYrWlK7JaLg8sdE=",
+ "dev": true,
+ "requires": {
+ "block-stream": "0.0.9",
+ "fstream": "1.0.11",
+ "inherits": "2.0.3"
+ }
+ },
+ "taskgroup": {
+ "version": "5.3.0",
+ "resolved": "https://registry.npmjs.org/taskgroup/-/taskgroup-5.3.0.tgz",
+ "integrity": "sha512-++j3Yi3XZGYgAvmGzRtNa+BnDvkPbdroyMffCY+Gj9A4iH2IJ1S7/g6LewGVXQkVw/KOzlfE1TimARYXvOEsgQ==",
+ "dev": true,
+ "requires": {
+ "ambi": "3.1.1",
+ "eachr": "3.2.0",
+ "editions": "1.3.4",
+ "extendr": "3.3.0",
+ "unbounded": "1.1.0"
+ },
+ "dependencies": {
+ "ambi": {
+ "version": "3.1.1",
+ "resolved": "https://registry.npmjs.org/ambi/-/ambi-3.1.1.tgz",
+ "integrity": "sha512-aObUKDykDPXOvovML+jDLJMw1cRS3/VhYb7vI3GmtQB7hmWeILWDzMYwC/9pljYL5gK3ZMb2QzUA9qQn5VAx7A==",
+ "dev": true,
+ "requires": {
+ "editions": "2.0.2",
+ "typechecker": "4.5.0"
+ },
+ "dependencies": {
+ "editions": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/editions/-/editions-2.0.2.tgz",
+ "integrity": "sha512-0B8aSTWUu9+JW99zHoeogavCi+lkE5l35FK0OKe0pCobixJYoeof3ZujtqYzSsU2MskhRadY5V9oWUuyG4aJ3A==",
+ "dev": true,
+ "requires": {
+ "errlop": "1.0.3",
+ "semver": "5.5.1"
+ }
+ }
+ }
+ }
+ }
+ },
+ "term-size": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/term-size/-/term-size-1.2.0.tgz",
+ "integrity": "sha1-RYuDiH8oj8Vtb/+/rSYuJmOO+mk=",
+ "dev": true,
+ "requires": {
+ "execa": "0.7.0"
+ },
+ "dependencies": {
+ "cross-spawn": {
+ "version": "5.1.0",
+ "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-5.1.0.tgz",
+ "integrity": "sha1-6L0O/uWPz/b4+UUQoKVUu/ojVEk=",
+ "dev": true,
+ "requires": {
+ "lru-cache": "4.1.3",
+ "shebang-command": "1.2.0",
+ "which": "1.3.1"
+ }
+ },
+ "execa": {
+ "version": "0.7.0",
+ "resolved": "https://registry.npmjs.org/execa/-/execa-0.7.0.tgz",
+ "integrity": "sha1-lEvs00zEHuMqY6n68nrVpl/Fl3c=",
+ "dev": true,
+ "requires": {
+ "cross-spawn": "5.1.0",
+ "get-stream": "3.0.0",
+ "is-stream": "1.1.0",
+ "npm-run-path": "2.0.2",
+ "p-finally": "1.0.0",
+ "signal-exit": "3.0.2",
+ "strip-eof": "1.0.0"
+ }
+ }
+ }
+ },
+ "through": {
+ "version": "2.3.8",
+ "resolved": "https://registry.npmjs.org/through/-/through-2.3.8.tgz",
+ "integrity": "sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=",
+ "dev": true
+ },
+ "through2": {
+ "version": "2.0.3",
+ "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.3.tgz",
+ "integrity": "sha1-AARWmzfHx0ujnEPzzteNGtlBQL4=",
+ "dev": true,
+ "requires": {
+ "readable-stream": "2.3.6",
+ "xtend": "4.0.1"
+ }
+ },
+ "thunky": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/thunky/-/thunky-1.0.2.tgz",
+ "integrity": "sha1-qGLgGOP7HqLsP85dVWBc9X8kc3E=",
+ "dev": true
+ },
+ "time-stamp": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/time-stamp/-/time-stamp-1.1.0.tgz",
+ "integrity": "sha1-dkpaEa9QVhkhsTPztE5hhofg9cM=",
+ "dev": true
+ },
+ "timed-out": {
+ "version": "4.0.1",
+ "resolved": "https://registry.npmjs.org/timed-out/-/timed-out-4.0.1.tgz",
+ "integrity": "sha1-8y6srFoXW+ol1/q1Zas+2HQe9W8=",
+ "dev": true
+ },
+ "timers-browserify": {
+ "version": "2.0.10",
+ "resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.10.tgz",
+ "integrity": "sha512-YvC1SV1XdOUaL6gx5CoGroT3Gu49pK9+TZ38ErPldOWW4j49GI1HKs9DV+KGq/w6y+LZ72W1c8cKz2vzY+qpzg==",
+ "dev": true,
+ "requires": {
+ "setimmediate": "1.0.5"
+ }
+ },
+ "tmp": {
+ "version": "0.0.31",
+ "resolved": "https://registry.npmjs.org/tmp/-/tmp-0.0.31.tgz",
+ "integrity": "sha1-jzirlDjhcxXl29izZX6L+yd65Kc=",
+ "dev": true,
+ "requires": {
+ "os-tmpdir": "1.0.2"
+ }
+ },
+ "to-array": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/to-array/-/to-array-0.1.4.tgz",
+ "integrity": "sha1-F+bBH3PdTz10zaek/zI46a2b+JA=",
+ "dev": true
+ },
+ "to-arraybuffer": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz",
+ "integrity": "sha1-fSKbH8xjfkZsoIEYCDanqr/4P0M=",
+ "dev": true
+ },
+ "to-fast-properties": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.3.tgz",
+ "integrity": "sha1-uDVx+k2MJbguIxsG46MFXeTKGkc=",
+ "dev": true
+ },
+ "to-object-path": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/to-object-path/-/to-object-path-0.3.0.tgz",
+ "integrity": "sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=",
+ "dev": true,
+ "requires": {
+ "kind-of": "3.2.2"
+ },
+ "dependencies": {
+ "kind-of": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+ "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+ "dev": true,
+ "requires": {
+ "is-buffer": "1.1.6"
+ }
+ }
+ }
+ },
+ "to-regex": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/to-regex/-/to-regex-3.0.2.tgz",
+ "integrity": "sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==",
+ "dev": true,
+ "requires": {
+ "define-property": "2.0.2",
+ "extend-shallow": "3.0.2",
+ "regex-not": "1.0.2",
+ "safe-regex": "1.1.0"
+ }
+ },
+ "to-regex-range": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz",
+ "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=",
+ "dev": true,
+ "requires": {
+ "is-number": "3.0.0",
+ "repeat-string": "1.6.1"
+ }
+ },
+ "toposort": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/toposort/-/toposort-1.0.7.tgz",
+ "integrity": "sha1-LmhELZ9k7HILjMieZEOsbKqVACk=",
+ "dev": true
+ },
+ "tough-cookie": {
+ "version": "2.4.3",
+ "resolved": "https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.4.3.tgz",
+ "integrity": "sha512-Q5srk/4vDM54WJsJio3XNn6K2sCG+CQ8G5Wz6bZhRZoAe/+TxjWB/GlFAnYEbkYVlON9FMk/fE3h2RLpPXo4lQ==",
+ "dev": true,
+ "requires": {
+ "psl": "1.1.29",
+ "punycode": "1.4.1"
+ },
+ "dependencies": {
+ "punycode": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz",
+ "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=",
+ "dev": true
+ }
+ }
+ },
+ "traverse": {
+ "version": "0.6.6",
+ "resolved": "https://registry.npmjs.org/traverse/-/traverse-0.6.6.tgz",
+ "integrity": "sha1-y99WD9e5r2MlAv7UD5GMFX6pcTc=",
+ "dev": true
+ },
+ "tree-kill": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/tree-kill/-/tree-kill-1.2.0.tgz",
+ "integrity": "sha512-DlX6dR0lOIRDFxI0mjL9IYg6OTncLm/Zt+JiBhE5OlFcAR8yc9S7FFXU9so0oda47frdM/JFsk7UjNt9vscKcg==",
+ "dev": true
+ },
+ "trim-newlines": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-1.0.0.tgz",
+ "integrity": "sha1-WIeWa7WCpFA6QetST301ARgVphM=",
+ "dev": true
+ },
+ "trim-right": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/trim-right/-/trim-right-1.0.1.tgz",
+ "integrity": "sha1-yy4SAwZ+DI3h9hQJS5/kVwTqYAM=",
+ "dev": true
+ },
+ "true-case-path": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/true-case-path/-/true-case-path-1.0.3.tgz",
+ "integrity": "sha512-m6s2OdQe5wgpFMC+pAJ+q9djG82O2jcHPOI6RNg1yy9rCYR+WD6Nbpl32fDpfC56nirdRy+opFa/Vk7HYhqaew==",
+ "dev": true,
+ "requires": {
+ "glob": "7.1.3"
+ }
+ },
+ "ts-node": {
+ "version": "5.0.1",
+ "resolved": "https://registry.npmjs.org/ts-node/-/ts-node-5.0.1.tgz",
+ "integrity": "sha512-XK7QmDcNHVmZkVtkiwNDWiERRHPyU8nBqZB1+iv2UhOG0q3RQ9HsZ2CMqISlFbxjrYFGfG2mX7bW4dAyxBVzUw==",
+ "dev": true,
+ "requires": {
+ "arrify": "1.0.1",
+ "chalk": "2.4.1",
+ "diff": "3.5.0",
+ "make-error": "1.3.5",
+ "minimist": "1.2.0",
+ "mkdirp": "0.5.1",
+ "source-map-support": "0.5.9",
+ "yn": "2.0.0"
+ },
+ "dependencies": {
+ "chalk": {
+ "version": "2.4.1",
+ "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.1.tgz",
+ "integrity": "sha512-ObN6h1v2fTJSmUXoS3nMQ92LbDK9be4TV+6G+omQlGJFdcUX5heKi1LZ1YnRMIgwTLEj3E24bT6tYni50rlCfQ==",
+ "dev": true,
+ "requires": {
+ "ansi-styles": "3.2.1",
+ "escape-string-regexp": "1.0.5",
+ "supports-color": "5.5.0"
+ }
+ },
+ "minimist": {
+ "version": "1.2.0",
+ "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+ "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+ "dev": true
+ }
+ }
+ },
+ "ts-simple-ast": {
+ "version": "12.4.0",
+ "resolved": "https://registry.npmjs.org/ts-simple-ast/-/ts-simple-ast-12.4.0.tgz",
+ "integrity": "sha512-7GJFZlyTZY7uMAEhX62ZLxdwOpGDJzc/nwpi1nRPZ7N2ICcqqrMjDtRnki15IUBv2ZjIGu6KBqk/pUqJFODFsg==",
+ "dev": true,
+ "requires": {
+ "@dsherret/to-absolute-glob": "2.0.2",
+ "code-block-writer": "7.2.1",
+ "fs-extra": "6.0.1",
+ "glob-parent": "3.1.0",
+ "globby": "8.0.1",
+ "is-negated-glob": "1.0.0",
+ "multimatch": "2.1.0",
+ "object-assign": "4.1.1",
+ "tslib": "1.9.3",
+ "typescript": "2.9.1"
+ },
+ "dependencies": {
+ "globby": {
+ "version": "8.0.1",
+ "resolved": "https://registry.npmjs.org/globby/-/globby-8.0.1.tgz",
+ "integrity": "sha512-oMrYrJERnKBLXNLVTqhm3vPEdJ/b2ZE28xN4YARiix1NOIOBPEpOUnm844K1iu/BkphCaf2WNFwMszv8Soi1pw==",
+ "dev": true,
+ "requires": {
+ "array-union": "1.0.2",
+ "dir-glob": "2.0.0",
+ "fast-glob": "2.2.2",
+ "glob": "7.1.3",
+ "ignore": "3.3.10",
+ "pify": "3.0.0",
+ "slash": "1.0.0"
+ }
+ },
+ "typescript": {
+ "version": "2.9.1",
+ "resolved": "https://registry.npmjs.org/typescript/-/typescript-2.9.1.tgz",
+ "integrity": "sha512-h6pM2f/GDchCFlldnriOhs1QHuwbnmj6/v7499eMHqPeW4V2G0elua2eIc2nu8v2NdHV0Gm+tzX83Hr6nUFjQA==",
+ "dev": true
+ }
+ }
+ },
+ "tsickle": {
+ "version": "0.32.1",
+ "resolved": "https://registry.npmjs.org/tsickle/-/tsickle-0.32.1.tgz",
+ "integrity": "sha512-JW9j+W0SaMSZGejIFZBk0AiPfnhljK3oLx5SaqxrJhjlvzFyPml5zqG1/PuScUj6yTe1muEqwk5CnDK0cOZmKw==",
+ "dev": true,
+ "requires": {
+ "jasmine-diff": "0.1.3",
+ "minimist": "1.2.0",
+ "mkdirp": "0.5.1",
+ "source-map": "0.6.1",
+ "source-map-support": "0.5.9"
+ },
+ "dependencies": {
+ "minimist": {
+ "version": "1.2.0",
+ "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+ "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+ "dev": true
+ },
+ "source-map": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+ "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+ "dev": true
+ }
+ }
+ },
+ "tslib": {
+ "version": "1.9.3",
+ "resolved": "https://registry.npmjs.org/tslib/-/tslib-1.9.3.tgz",
+ "integrity": "sha512-4krF8scpejhaOgqzBEcGM7yDIEfi0/8+8zDRZhNZZ2kjmHJ4hv3zCbQWxoJGz1iw5U0Jl0nma13xzHXcncMavQ=="
+ },
+ "tslint": {
+ "version": "5.9.1",
+ "resolved": "https://registry.npmjs.org/tslint/-/tslint-5.9.1.tgz",
+ "integrity": "sha1-ElX4ej/1frCw4fDmEKi0dIBGya4=",
+ "dev": true,
+ "requires": {
+ "babel-code-frame": "6.26.0",
+ "builtin-modules": "1.1.1",
+ "chalk": "2.4.1",
+ "commander": "2.17.1",
+ "diff": "3.5.0",
+ "glob": "7.1.3",
+ "js-yaml": "3.12.0",
+ "minimatch": "3.0.4",
+ "resolve": "1.8.1",
+ "semver": "5.5.1",
+ "tslib": "1.9.3",
+ "tsutils": "2.29.0"
+ },
+ "dependencies": {
+ "chalk": {
+ "version": "2.4.1",
+ "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.1.tgz",
+ "integrity": "sha512-ObN6h1v2fTJSmUXoS3nMQ92LbDK9be4TV+6G+omQlGJFdcUX5heKi1LZ1YnRMIgwTLEj3E24bT6tYni50rlCfQ==",
+ "dev": true,
+ "requires": {
+ "ansi-styles": "3.2.1",
+ "escape-string-regexp": "1.0.5",
+ "supports-color": "5.5.0"
+ }
+ }
+ }
+ },
+ "tsutils": {
+ "version": "2.29.0",
+ "resolved": "https://registry.npmjs.org/tsutils/-/tsutils-2.29.0.tgz",
+ "integrity": "sha512-g5JVHCIJwzfISaXpXE1qvNalca5Jwob6FjI4AoPlqMusJ6ftFE7IkkFoMhVLRgK+4Kx3gkzb8UZK5t5yTTvEmA==",
+ "dev": true,
+ "requires": {
+ "tslib": "1.9.3"
+ }
+ },
+ "tty-browserify": {
+ "version": "0.0.0",
+ "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz",
+ "integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY=",
+ "dev": true
+ },
+ "tunnel-agent": {
+ "version": "0.6.0",
+ "resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.6.0.tgz",
+ "integrity": "sha1-J6XeoGs2sEoKmWZ3SykIaPD8QP0=",
+ "dev": true,
+ "requires": {
+ "safe-buffer": "5.1.2"
+ }
+ },
+ "tweetnacl": {
+ "version": "0.14.5",
+ "resolved": "https://registry.npmjs.org/tweetnacl/-/tweetnacl-0.14.5.tgz",
+ "integrity": "sha1-WuaBd/GS1EViadEIr6k/+HQ/T2Q=",
+ "dev": true,
+ "optional": true
+ },
+ "type-check": {
+ "version": "0.3.2",
+ "resolved": "https://registry.npmjs.org/type-check/-/type-check-0.3.2.tgz",
+ "integrity": "sha1-WITKtRLPHTVeP7eE8wgEsrUg23I=",
+ "dev": true,
+ "requires": {
+ "prelude-ls": "1.1.2"
+ }
+ },
+ "type-is": {
+ "version": "1.6.16",
+ "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.16.tgz",
+ "integrity": "sha512-HRkVv/5qY2G6I8iab9cI7v1bOIdhm94dVjQCPFElW9W+3GeDOSHmy2EBYe4VTApuzolPcmgFTN3ftVJRKR2J9Q==",
+ "dev": true,
+ "requires": {
+ "media-typer": "0.3.0",
+ "mime-types": "2.1.20"
+ }
+ },
+ "typechecker": {
+ "version": "4.5.0",
+ "resolved": "https://registry.npmjs.org/typechecker/-/typechecker-4.5.0.tgz",
+ "integrity": "sha512-bqPE/ck3bVIaXP7gMKTKSHrypT32lpYTpiqzPYeYzdSQnmaGvaGhy7TnN/M/+5R+2rs/kKcp9ZLPRp/Q9Yj+4w==",
+ "dev": true,
+ "requires": {
+ "editions": "1.3.4"
+ }
+ },
+ "typedarray": {
+ "version": "0.0.6",
+ "resolved": "https://registry.npmjs.org/typedarray/-/typedarray-0.0.6.tgz",
+ "integrity": "sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c=",
+ "dev": true
+ },
+ "typescript": {
+ "version": "2.7.2",
+ "resolved": "http://registry.npmjs.org/typescript/-/typescript-2.7.2.tgz",
+ "integrity": "sha512-p5TCYZDAO0m4G344hD+wx/LATebLWZNkkh2asWUFqSsD2OrDNhbAHuSjobrmsUmdzjJjEeZVU9g1h3O6vpstnw==",
+ "dev": true
+ },
+ "uglify-js": {
+ "version": "3.4.9",
+ "resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-3.4.9.tgz",
+ "integrity": "sha512-8CJsbKOtEbnJsTyv6LE6m6ZKniqMiFWmm9sRbopbkGs3gMPPfd3Fh8iIA4Ykv5MgaTbqHr4BaoGLJLZNhsrW1Q==",
+ "dev": true,
+ "requires": {
+ "commander": "2.17.1",
+ "source-map": "0.6.1"
+ },
+ "dependencies": {
+ "source-map": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+ "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+ "dev": true
+ }
+ }
+ },
+ "uglify-to-browserify": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/uglify-to-browserify/-/uglify-to-browserify-1.0.2.tgz",
+ "integrity": "sha1-bgkk1r2mta/jSeOabWMoUKD4grc=",
+ "dev": true,
+ "optional": true
+ },
+ "uglifyjs-webpack-plugin": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/uglifyjs-webpack-plugin/-/uglifyjs-webpack-plugin-1.3.0.tgz",
+ "integrity": "sha512-ovHIch0AMlxjD/97j9AYovZxG5wnHOPkL7T1GKochBADp/Zwc44pEWNqpKl1Loupp1WhFg7SlYmHZRUfdAacgw==",
+ "dev": true,
+ "requires": {
+ "cacache": "10.0.4",
+ "find-cache-dir": "1.0.0",
+ "schema-utils": "0.4.7",
+ "serialize-javascript": "1.5.0",
+ "source-map": "0.6.1",
+ "uglify-es": "3.3.9",
+ "webpack-sources": "1.2.0",
+ "worker-farm": "1.6.0"
+ },
+ "dependencies": {
+ "commander": {
+ "version": "2.13.0",
+ "resolved": "https://registry.npmjs.org/commander/-/commander-2.13.0.tgz",
+ "integrity": "sha512-MVuS359B+YzaWqjCL/c+22gfryv+mCBPHAv3zyVI2GN8EY6IRP8VwtasXn8jyyhvvq84R4ImN1OKRtcbIasjYA==",
+ "dev": true
+ },
+ "source-map": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+ "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+ "dev": true
+ },
+ "uglify-es": {
+ "version": "3.3.9",
+ "resolved": "https://registry.npmjs.org/uglify-es/-/uglify-es-3.3.9.tgz",
+ "integrity": "sha512-r+MU0rfv4L/0eeW3xZrd16t4NZfK8Ld4SWVglYBb7ez5uXFWHuVRs6xCTrf1yirs9a4j4Y27nn7SRfO6v67XsQ==",
+ "dev": true,
+ "requires": {
+ "commander": "2.13.0",
+ "source-map": "0.6.1"
+ }
+ }
+ }
+ },
+ "ultron": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/ultron/-/ultron-1.0.2.tgz",
+ "integrity": "sha1-rOEWq1V80Zc4ak6I9GhTeMiy5Po=",
+ "dev": true
+ },
+ "unbounded": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/unbounded/-/unbounded-1.1.0.tgz",
+ "integrity": "sha512-kmPrjST7m53WbxoMqk6QUFvWOp/ZGssCA0Zls63pbt+7cZqST4i0YIVLNX97ZlsMv/ml+0CPBVN15sVdSi/yZA==",
+ "dev": true,
+ "requires": {
+ "editions": "1.3.4"
+ }
+ },
+ "unc-path-regex": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/unc-path-regex/-/unc-path-regex-0.1.2.tgz",
+ "integrity": "sha1-5z3T17DXxe2G+6xrCufYxqadUPo=",
+ "dev": true
+ },
+ "union-value": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/union-value/-/union-value-1.0.0.tgz",
+ "integrity": "sha1-XHHDTLW61dzr4+oM0IIHulqhrqQ=",
+ "dev": true,
+ "requires": {
+ "arr-union": "3.1.0",
+ "get-value": "2.0.6",
+ "is-extendable": "0.1.1",
+ "set-value": "0.4.3"
+ },
+ "dependencies": {
+ "extend-shallow": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+ "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+ "dev": true,
+ "requires": {
+ "is-extendable": "0.1.1"
+ }
+ },
+ "set-value": {
+ "version": "0.4.3",
+ "resolved": "https://registry.npmjs.org/set-value/-/set-value-0.4.3.tgz",
+ "integrity": "sha1-fbCPnT0i3H945Trzw79GZuzfzPE=",
+ "dev": true,
+ "requires": {
+ "extend-shallow": "2.0.1",
+ "is-extendable": "0.1.1",
+ "is-plain-object": "2.0.4",
+ "to-object-path": "0.3.0"
+ }
+ }
+ }
+ },
+ "unique-filename": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/unique-filename/-/unique-filename-1.1.0.tgz",
+ "integrity": "sha1-0F8v5AMlYIcfMOk8vnNe6iAVFPM=",
+ "dev": true,
+ "requires": {
+ "unique-slug": "2.0.0"
+ }
+ },
+ "unique-slug": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/unique-slug/-/unique-slug-2.0.0.tgz",
+ "integrity": "sha1-22Z258fMBimHj/GWCXx4hVrp9Ks=",
+ "dev": true,
+ "requires": {
+ "imurmurhash": "0.1.4"
+ }
+ },
+ "unique-string": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/unique-string/-/unique-string-1.0.0.tgz",
+ "integrity": "sha1-nhBXzKhRq7kzmPizOuGHuZyuwRo=",
+ "dev": true,
+ "requires": {
+ "crypto-random-string": "1.0.0"
+ }
+ },
+ "universalify": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/universalify/-/universalify-0.1.2.tgz",
+ "integrity": "sha512-rBJeI5CXAlmy1pV+617WB9J63U6XcazHHF2f2dbJix4XzpUF0RS3Zbj0FGIOCAva5P/d/GBOYaACQ1w+0azUkg==",
+ "dev": true
+ },
+ "unix-crypt-td-js": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/unix-crypt-td-js/-/unix-crypt-td-js-1.0.0.tgz",
+ "integrity": "sha1-HAgkFQSBvHoB1J6Y8exmjYJBLzs=",
+ "dev": true
+ },
+ "unpipe": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz",
+ "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=",
+ "dev": true
+ },
+ "unset-value": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/unset-value/-/unset-value-1.0.0.tgz",
+ "integrity": "sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=",
+ "dev": true,
+ "requires": {
+ "has-value": "0.3.1",
+ "isobject": "3.0.1"
+ },
+ "dependencies": {
+ "has-value": {
+ "version": "0.3.1",
+ "resolved": "https://registry.npmjs.org/has-value/-/has-value-0.3.1.tgz",
+ "integrity": "sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=",
+ "dev": true,
+ "requires": {
+ "get-value": "2.0.6",
+ "has-values": "0.1.4",
+ "isobject": "2.1.0"
+ },
+ "dependencies": {
+ "isobject": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/isobject/-/isobject-2.1.0.tgz",
+ "integrity": "sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=",
+ "dev": true,
+ "requires": {
+ "isarray": "1.0.0"
+ }
+ }
+ }
+ },
+ "has-values": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/has-values/-/has-values-0.1.4.tgz",
+ "integrity": "sha1-bWHeldkd/Km5oCCJrThL/49it3E=",
+ "dev": true
+ }
+ }
+ },
+ "unzip-response": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/unzip-response/-/unzip-response-2.0.1.tgz",
+ "integrity": "sha1-0vD3N9FrBhXnKmk17QQhRXLVb5c=",
+ "dev": true
+ },
+ "upath": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/upath/-/upath-1.1.0.tgz",
+ "integrity": "sha512-bzpH/oBhoS/QI/YtbkqCg6VEiPYjSZtrHQM6/QnJS6OL9pKUFLqb3aFh4Scvwm45+7iAgiMkLhSbaZxUqmrprw==",
+ "dev": true
+ },
+ "update-notifier": {
+ "version": "2.5.0",
+ "resolved": "https://registry.npmjs.org/update-notifier/-/update-notifier-2.5.0.tgz",
+ "integrity": "sha512-gwMdhgJHGuj/+wHJJs9e6PcCszpxR1b236igrOkUofGhqJuG+amlIKwApH1IW1WWl7ovZxsX49lMBWLxSdm5Dw==",
+ "dev": true,
+ "requires": {
+ "boxen": "1.3.0",
+ "chalk": "2.2.2",
+ "configstore": "3.1.2",
+ "import-lazy": "2.1.0",
+ "is-ci": "1.2.0",
+ "is-installed-globally": "0.1.0",
+ "is-npm": "1.0.0",
+ "latest-version": "3.1.0",
+ "semver-diff": "2.1.0",
+ "xdg-basedir": "3.0.0"
+ }
+ },
+ "upper-case": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/upper-case/-/upper-case-1.1.3.tgz",
+ "integrity": "sha1-9rRQHC7EzdJrp4vnIilh3ndiFZg=",
+ "dev": true
+ },
+ "uri-js": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-3.0.2.tgz",
+ "integrity": "sha1-+QuFhQf4HepNz7s8TD2/orVX+qo=",
+ "dev": true,
+ "requires": {
+ "punycode": "2.1.1"
+ }
+ },
+ "urix": {
+ "version": "0.1.0",
+ "resolved": "https://registry.npmjs.org/urix/-/urix-0.1.0.tgz",
+ "integrity": "sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI=",
+ "dev": true
+ },
+ "url": {
+ "version": "0.11.0",
+ "resolved": "https://registry.npmjs.org/url/-/url-0.11.0.tgz",
+ "integrity": "sha1-ODjpfPxgUh63PFJajlW/3Z4uKPE=",
+ "dev": true,
+ "requires": {
+ "punycode": "1.3.2",
+ "querystring": "0.2.0"
+ },
+ "dependencies": {
+ "punycode": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.3.2.tgz",
+ "integrity": "sha1-llOgNvt8HuQjQvIyXM7v6jkmxI0=",
+ "dev": true
+ }
+ }
+ },
+ "url-join": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/url-join/-/url-join-4.0.0.tgz",
+ "integrity": "sha1-TTNA6AfTdzvamZH4MFrNzCpmXSo=",
+ "dev": true
+ },
+ "url-loader": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/url-loader/-/url-loader-1.1.1.tgz",
+ "integrity": "sha512-vugEeXjyYFBCUOpX+ZuaunbK3QXMKaQ3zUnRfIpRBlGkY7QizCnzyyn2ASfcxsvyU3ef+CJppVywnl3Kgf13Gg==",
+ "dev": true,
+ "requires": {
+ "loader-utils": "1.1.0",
+ "mime": "2.3.1",
+ "schema-utils": "1.0.0"
+ },
+ "dependencies": {
+ "mime": {
+ "version": "2.3.1",
+ "resolved": "https://registry.npmjs.org/mime/-/mime-2.3.1.tgz",
+ "integrity": "sha512-OEUllcVoydBHGN1z84yfQDimn58pZNNNXgZlHXSboxMlFvgI6MXSWpWKpFRra7H1HxpVhHTkrghfRW49k6yjeg==",
+ "dev": true
+ },
+ "schema-utils": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz",
+ "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==",
+ "dev": true,
+ "requires": {
+ "ajv": "6.4.0",
+ "ajv-errors": "1.0.0",
+ "ajv-keywords": "3.2.0"
+ }
+ }
+ }
+ },
+ "url-parse": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/url-parse/-/url-parse-1.4.3.tgz",
+ "integrity": "sha512-rh+KuAW36YKo0vClhQzLLveoj8FwPJNu65xLb7Mrt+eZht0IPT0IXgSv8gcMegZ6NvjJUALf6Mf25POlMwD1Fw==",
+ "dev": true,
+ "requires": {
+ "querystringify": "2.0.0",
+ "requires-port": "1.0.0"
+ }
+ },
+ "url-parse-lax": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/url-parse-lax/-/url-parse-lax-1.0.0.tgz",
+ "integrity": "sha1-evjzA2Rem9eaJy56FKxovAYJ2nM=",
+ "dev": true,
+ "requires": {
+ "prepend-http": "1.0.4"
+ }
+ },
+ "use": {
+ "version": "3.1.1",
+ "resolved": "https://registry.npmjs.org/use/-/use-3.1.1.tgz",
+ "integrity": "sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ==",
+ "dev": true
+ },
+ "useragent": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/useragent/-/useragent-2.3.0.tgz",
+ "integrity": "sha512-4AoH4pxuSvHCjqLO04sU6U/uE65BYza8l/KKBS0b0hnUPWi+cQ2BpeTEwejCSx9SPV5/U03nniDTrWx5NrmKdw==",
+ "dev": true,
+ "requires": {
+ "lru-cache": "4.1.3",
+ "tmp": "0.0.31"
+ }
+ },
+ "util": {
+ "version": "0.10.4",
+ "resolved": "https://registry.npmjs.org/util/-/util-0.10.4.tgz",
+ "integrity": "sha512-0Pm9hTQ3se5ll1XihRic3FDIku70C+iHUdT/W926rSgHV5QgXsYbKZN8MSC3tJtSkhuROzvsQjAaFENRXr+19A==",
+ "dev": true,
+ "requires": {
+ "inherits": "2.0.3"
+ }
+ },
+ "util-deprecate": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
+ "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=",
+ "dev": true
+ },
+ "util.promisify": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/util.promisify/-/util.promisify-1.0.0.tgz",
+ "integrity": "sha512-i+6qA2MPhvoKLuxnJNpXAGhg7HphQOSUq2LKMZD0m15EiskXUkMvKdF4Uui0WYeCUGea+o2cw/ZuwehtfsrNkA==",
+ "dev": true,
+ "requires": {
+ "define-properties": "1.1.3",
+ "object.getownpropertydescriptors": "2.0.3"
+ }
+ },
+ "utila": {
+ "version": "0.4.0",
+ "resolved": "https://registry.npmjs.org/utila/-/utila-0.4.0.tgz",
+ "integrity": "sha1-ihagXURWV6Oupe7MWxKk+lN5dyw=",
+ "dev": true
+ },
+ "utils-merge": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz",
+ "integrity": "sha1-n5VxD1CiZ5R7LMwSR0HBAoQn5xM=",
+ "dev": true
+ },
+ "uuid": {
+ "version": "3.3.2",
+ "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.3.2.tgz",
+ "integrity": "sha512-yXJmeNaw3DnnKAOKJE51sL/ZaYfWJRl1pK9dr19YFCu0ObS231AB1/LbqTKRAQ5kw8A90rA6fr4riOUpTZvQZA==",
+ "dev": true
+ },
+ "validate-npm-package-license": {
+ "version": "3.0.4",
+ "resolved": "https://registry.npmjs.org/validate-npm-package-license/-/validate-npm-package-license-3.0.4.tgz",
+ "integrity": "sha512-DpKm2Ui/xN7/HQKCtpZxoRWBhZ9Z0kqtygG8XCgNQ8ZlDnxuQmWhj566j8fN4Cu3/JmbhsDo7fcAJq4s9h27Ew==",
+ "dev": true,
+ "requires": {
+ "spdx-correct": "3.0.0",
+ "spdx-expression-parse": "3.0.0"
+ }
+ },
+ "validate-npm-package-name": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/validate-npm-package-name/-/validate-npm-package-name-3.0.0.tgz",
+ "integrity": "sha1-X6kS2B630MdK/BQN5zF/DKffQ34=",
+ "dev": true,
+ "requires": {
+ "builtins": "1.0.3"
+ }
+ },
+ "vary": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz",
+ "integrity": "sha1-IpnwLG3tMNSllhsLn3RSShj2NPw=",
+ "dev": true
+ },
+ "verror": {
+ "version": "1.10.0",
+ "resolved": "https://registry.npmjs.org/verror/-/verror-1.10.0.tgz",
+ "integrity": "sha1-OhBcoXBTr1XW4nDB+CiGguGNpAA=",
+ "dev": true,
+ "requires": {
+ "assert-plus": "1.0.0",
+ "core-util-is": "1.0.2",
+ "extsprintf": "1.3.0"
+ }
+ },
+ "viz.js": {
+ "version": "1.8.2",
+ "resolved": "https://registry.npmjs.org/viz.js/-/viz.js-1.8.2.tgz",
+ "integrity": "sha512-W+1+N/hdzLpQZEcvz79n2IgUE9pfx6JLdHh3Kh8RGvLL8P1LdJVQmi2OsDcLdY4QVID4OUy+FPelyerX0nJxIQ==",
+ "dev": true
+ },
+ "vlq": {
+ "version": "0.2.3",
+ "resolved": "https://registry.npmjs.org/vlq/-/vlq-0.2.3.tgz",
+ "integrity": "sha512-DRibZL6DsNhIgYQ+wNdWDL2SL3bKPlVrRiBqV5yuMm++op8W4kGFtaQfCs4KEJn0wBZcHVHJ3eoywX8983k1ow==",
+ "dev": true
+ },
+ "vm-browserify": {
+ "version": "0.0.4",
+ "resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-0.0.4.tgz",
+ "integrity": "sha1-XX6kW7755Kb/ZflUOOCofDV9WnM=",
+ "dev": true,
+ "requires": {
+ "indexof": "0.0.1"
+ }
+ },
+ "void-elements": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/void-elements/-/void-elements-2.0.1.tgz",
+ "integrity": "sha1-wGavtYK7HLQSjWDqkjkulNXp2+w=",
+ "dev": true
+ },
+ "watchpack": {
+ "version": "1.6.0",
+ "resolved": "https://registry.npmjs.org/watchpack/-/watchpack-1.6.0.tgz",
+ "integrity": "sha512-i6dHe3EyLjMmDlU1/bGQpEw25XSjkJULPuAVKCbNRefQVq48yXKUpwg538F7AZTf9kyr57zj++pQFltUa5H7yA==",
+ "dev": true,
+ "requires": {
+ "chokidar": "2.0.4",
+ "graceful-fs": "4.1.11",
+ "neo-async": "2.5.2"
+ }
+ },
+ "watchr": {
+ "version": "2.6.0",
+ "resolved": "https://registry.npmjs.org/watchr/-/watchr-2.6.0.tgz",
+ "integrity": "sha1-51xCOxC+eSZ6DD73bi6hBP4CZ6U=",
+ "dev": true,
+ "requires": {
+ "eachr": "3.2.0",
+ "extendr": "3.3.0",
+ "extract-opts": "3.3.1",
+ "ignorefs": "1.2.0",
+ "safefs": "4.1.0",
+ "scandirectory": "2.5.0",
+ "taskgroup": "5.3.0",
+ "typechecker": "4.5.0"
+ }
+ },
+ "wbuf": {
+ "version": "1.7.3",
+ "resolved": "https://registry.npmjs.org/wbuf/-/wbuf-1.7.3.tgz",
+ "integrity": "sha512-O84QOnr0icsbFGLS0O3bI5FswxzRr8/gHwWkDlQFskhSPryQXvrTMxjxGP4+iWYoauLoBvfDpkrOauZ+0iZpDA==",
+ "dev": true,
+ "requires": {
+ "minimalistic-assert": "1.0.1"
+ }
+ },
+ "webassemblyjs": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/webassemblyjs/-/webassemblyjs-1.4.3.tgz",
+ "integrity": "sha512-4lOV1Lv6olz0PJkDGQEp82HempAn147e6BXijWDzz9g7/2nSebVP9GVg62Fz5ZAs55mxq13GA0XLyvY8XkyDjg==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/ast": "1.4.3",
+ "@webassemblyjs/validation": "1.4.3",
+ "@webassemblyjs/wasm-parser": "1.4.3",
+ "@webassemblyjs/wast-parser": "1.4.3",
+ "long": "3.2.0"
+ }
+ },
+ "webdriver-js-extender": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/webdriver-js-extender/-/webdriver-js-extender-1.0.0.tgz",
+ "integrity": "sha1-gcUzqeM9W/tZe05j4s2yW1R3dRU=",
+ "dev": true,
+ "requires": {
+ "@types/selenium-webdriver": "2.53.43",
+ "selenium-webdriver": "2.53.3"
+ },
+ "dependencies": {
+ "sax": {
+ "version": "0.6.1",
+ "resolved": "http://registry.npmjs.org/sax/-/sax-0.6.1.tgz",
+ "integrity": "sha1-VjsZx8HeiS4Jv8Ty/DDjwn8JUrk=",
+ "dev": true
+ },
+ "selenium-webdriver": {
+ "version": "2.53.3",
+ "resolved": "https://registry.npmjs.org/selenium-webdriver/-/selenium-webdriver-2.53.3.tgz",
+ "integrity": "sha1-0p/1qVff8aG0ncRXdW5OS/vc4IU=",
+ "dev": true,
+ "requires": {
+ "adm-zip": "0.4.4",
+ "rimraf": "2.6.2",
+ "tmp": "0.0.24",
+ "ws": "1.1.2",
+ "xml2js": "0.4.4"
+ }
+ },
+ "tmp": {
+ "version": "0.0.24",
+ "resolved": "https://registry.npmjs.org/tmp/-/tmp-0.0.24.tgz",
+ "integrity": "sha1-1qXhmNFKmDXMby18PZ4wJCjIzxI=",
+ "dev": true
+ },
+ "xml2js": {
+ "version": "0.4.4",
+ "resolved": "https://registry.npmjs.org/xml2js/-/xml2js-0.4.4.tgz",
+ "integrity": "sha1-MREBAAMAiuGSQOuhdJe1fHKcVV0=",
+ "dev": true,
+ "requires": {
+ "sax": "0.6.1",
+ "xmlbuilder": "9.0.7"
+ }
+ }
+ }
+ },
+ "webpack": {
+ "version": "4.8.3",
+ "resolved": "https://registry.npmjs.org/webpack/-/webpack-4.8.3.tgz",
+ "integrity": "sha512-/hfAjBISycdK597lxONjKEFX7dSIU1PsYwC3XlXUXoykWBlv9QV5HnO+ql3HvrrgfBJ7WXdnjO9iGPR2aAc5sw==",
+ "dev": true,
+ "requires": {
+ "@webassemblyjs/ast": "1.4.3",
+ "@webassemblyjs/wasm-edit": "1.4.3",
+ "@webassemblyjs/wasm-parser": "1.4.3",
+ "acorn": "5.7.2",
+ "acorn-dynamic-import": "3.0.0",
+ "ajv": "6.4.0",
+ "ajv-keywords": "3.2.0",
+ "chrome-trace-event": "0.1.3",
+ "enhanced-resolve": "4.1.0",
+ "eslint-scope": "3.7.3",
+ "loader-runner": "2.3.0",
+ "loader-utils": "1.1.0",
+ "memory-fs": "0.4.1",
+ "micromatch": "3.1.10",
+ "mkdirp": "0.5.1",
+ "neo-async": "2.5.2",
+ "node-libs-browser": "2.1.0",
+ "schema-utils": "0.4.7",
+ "tapable": "1.0.0",
+ "uglifyjs-webpack-plugin": "1.3.0",
+ "watchpack": "1.6.0",
+ "webpack-sources": "1.2.0"
+ }
+ },
+ "webpack-core": {
+ "version": "0.6.9",
+ "resolved": "https://registry.npmjs.org/webpack-core/-/webpack-core-0.6.9.tgz",
+ "integrity": "sha1-/FcViMhVjad76e+23r3Fo7FyvcI=",
+ "dev": true,
+ "requires": {
+ "source-list-map": "0.1.8",
+ "source-map": "0.4.4"
+ },
+ "dependencies": {
+ "source-list-map": {
+ "version": "0.1.8",
+ "resolved": "https://registry.npmjs.org/source-list-map/-/source-list-map-0.1.8.tgz",
+ "integrity": "sha1-xVCyq1Qn9rPyH1r+rYjE9Vh7IQY=",
+ "dev": true
+ },
+ "source-map": {
+ "version": "0.4.4",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.4.4.tgz",
+ "integrity": "sha1-66T12pwNyZneaAMti092FzZSA2s=",
+ "dev": true,
+ "requires": {
+ "amdefine": "1.0.1"
+ }
+ }
+ }
+ },
+ "webpack-dev-middleware": {
+ "version": "3.2.0",
+ "resolved": "https://registry.npmjs.org/webpack-dev-middleware/-/webpack-dev-middleware-3.2.0.tgz",
+ "integrity": "sha512-YJLMF/96TpKXaEQwaLEo+Z4NDK8aV133ROF6xp9pe3gQoS7sxfpXh4Rv9eC+8vCvWfmDjRQaMSlRPbO+9G6jgA==",
+ "dev": true,
+ "requires": {
+ "loud-rejection": "1.6.0",
+ "memory-fs": "0.4.1",
+ "mime": "2.3.1",
+ "path-is-absolute": "1.0.1",
+ "range-parser": "1.2.0",
+ "url-join": "4.0.0",
+ "webpack-log": "2.0.0"
+ },
+ "dependencies": {
+ "mime": {
+ "version": "2.3.1",
+ "resolved": "https://registry.npmjs.org/mime/-/mime-2.3.1.tgz",
+ "integrity": "sha512-OEUllcVoydBHGN1z84yfQDimn58pZNNNXgZlHXSboxMlFvgI6MXSWpWKpFRra7H1HxpVhHTkrghfRW49k6yjeg==",
+ "dev": true
+ }
+ }
+ },
+ "webpack-dev-server": {
+ "version": "3.1.7",
+ "resolved": "https://registry.npmjs.org/webpack-dev-server/-/webpack-dev-server-3.1.7.tgz",
+ "integrity": "sha512-KagFrNHf3QKndS61cXqzkQ4gpdXo0d1LZTTplAJzNK1Ev2ZyJiu+BzerW/2dixYYfpnGzp0AcvCXpmYXIOkFOA==",
+ "dev": true,
+ "requires": {
+ "ansi-html": "0.0.7",
+ "bonjour": "3.5.0",
+ "chokidar": "2.0.4",
+ "compression": "1.7.3",
+ "connect-history-api-fallback": "1.5.0",
+ "debug": "3.1.0",
+ "del": "3.0.0",
+ "express": "4.16.3",
+ "html-entities": "1.2.1",
+ "http-proxy-middleware": "0.18.0",
+ "import-local": "1.0.0",
+ "internal-ip": "3.0.1",
+ "ip": "1.1.5",
+ "killable": "1.0.0",
+ "loglevel": "1.6.1",
+ "opn": "5.3.0",
+ "portfinder": "1.0.17",
+ "schema-utils": "1.0.0",
+ "selfsigned": "1.10.3",
+ "serve-index": "1.9.1",
+ "sockjs": "0.3.19",
+ "sockjs-client": "1.1.5",
+ "spdy": "3.4.7",
+ "strip-ansi": "3.0.1",
+ "supports-color": "5.5.0",
+ "webpack-dev-middleware": "3.2.0",
+ "webpack-log": "2.0.0",
+ "yargs": "12.0.1"
+ },
+ "dependencies": {
+ "ansi-regex": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz",
+ "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=",
+ "dev": true
+ },
+ "camelcase": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz",
+ "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=",
+ "dev": true
+ },
+ "cliui": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/cliui/-/cliui-4.1.0.tgz",
+ "integrity": "sha512-4FG+RSG9DL7uEwRUZXZn3SS34DiDPfzP0VOiEwtUWlE+AR2EIg+hSyvrIgUUfhdgR/UkAeW2QHgeP+hWrXs7jQ==",
+ "dev": true,
+ "requires": {
+ "string-width": "2.1.1",
+ "strip-ansi": "4.0.0",
+ "wrap-ansi": "2.1.0"
+ },
+ "dependencies": {
+ "strip-ansi": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz",
+ "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=",
+ "dev": true,
+ "requires": {
+ "ansi-regex": "3.0.0"
+ }
+ }
+ }
+ },
+ "cross-spawn": {
+ "version": "5.1.0",
+ "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-5.1.0.tgz",
+ "integrity": "sha1-6L0O/uWPz/b4+UUQoKVUu/ojVEk=",
+ "dev": true,
+ "requires": {
+ "lru-cache": "4.1.3",
+ "shebang-command": "1.2.0",
+ "which": "1.3.1"
+ }
+ },
+ "debug": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+ "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+ "dev": true,
+ "requires": {
+ "ms": "2.0.0"
+ }
+ },
+ "decamelize": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-2.0.0.tgz",
+ "integrity": "sha512-Ikpp5scV3MSYxY39ymh45ZLEecsTdv/Xj2CaQfI8RLMuwi7XvjX9H/fhraiSuU+C5w5NTDu4ZU72xNiZnurBPg==",
+ "dev": true,
+ "requires": {
+ "xregexp": "4.0.0"
+ }
+ },
+ "execa": {
+ "version": "0.7.0",
+ "resolved": "https://registry.npmjs.org/execa/-/execa-0.7.0.tgz",
+ "integrity": "sha1-lEvs00zEHuMqY6n68nrVpl/Fl3c=",
+ "dev": true,
+ "requires": {
+ "cross-spawn": "5.1.0",
+ "get-stream": "3.0.0",
+ "is-stream": "1.1.0",
+ "npm-run-path": "2.0.2",
+ "p-finally": "1.0.0",
+ "signal-exit": "3.0.2",
+ "strip-eof": "1.0.0"
+ }
+ },
+ "find-up": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz",
+ "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==",
+ "dev": true,
+ "requires": {
+ "locate-path": "3.0.0"
+ }
+ },
+ "is-fullwidth-code-point": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz",
+ "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=",
+ "dev": true
+ },
+ "locate-path": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz",
+ "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==",
+ "dev": true,
+ "requires": {
+ "p-locate": "3.0.0",
+ "path-exists": "3.0.0"
+ }
+ },
+ "os-locale": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/os-locale/-/os-locale-2.1.0.tgz",
+ "integrity": "sha512-3sslG3zJbEYcaC4YVAvDorjGxc7tv6KVATnLPZONiljsUncvihe9BQoVCEs0RZ1kmf4Hk9OBqlZfJZWI4GanKA==",
+ "dev": true,
+ "requires": {
+ "execa": "0.7.0",
+ "lcid": "1.0.0",
+ "mem": "1.1.0"
+ }
+ },
+ "p-limit": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.0.0.tgz",
+ "integrity": "sha512-fl5s52lI5ahKCernzzIyAP0QAZbGIovtVHGwpcu1Jr/EpzLVDI2myISHwGqK7m8uQFugVWSrbxH7XnhGtvEc+A==",
+ "dev": true,
+ "requires": {
+ "p-try": "2.0.0"
+ }
+ },
+ "p-locate": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz",
+ "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==",
+ "dev": true,
+ "requires": {
+ "p-limit": "2.0.0"
+ }
+ },
+ "p-try": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.0.0.tgz",
+ "integrity": "sha512-hMp0onDKIajHfIkdRk3P4CdCmErkYAxxDtP3Wx/4nZ3aGlau2VKh3mZpcuFkH27WQkL/3WBCPOktzA9ZOAnMQQ==",
+ "dev": true
+ },
+ "schema-utils": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz",
+ "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==",
+ "dev": true,
+ "requires": {
+ "ajv": "6.4.0",
+ "ajv-errors": "1.0.0",
+ "ajv-keywords": "3.2.0"
+ }
+ },
+ "string-width": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz",
+ "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==",
+ "dev": true,
+ "requires": {
+ "is-fullwidth-code-point": "2.0.0",
+ "strip-ansi": "4.0.0"
+ },
+ "dependencies": {
+ "strip-ansi": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz",
+ "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=",
+ "dev": true,
+ "requires": {
+ "ansi-regex": "3.0.0"
+ }
+ }
+ }
+ },
+ "which-module": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz",
+ "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=",
+ "dev": true
+ },
+ "yargs": {
+ "version": "12.0.1",
+ "resolved": "https://registry.npmjs.org/yargs/-/yargs-12.0.1.tgz",
+ "integrity": "sha512-B0vRAp1hRX4jgIOWFtjfNjd9OA9RWYZ6tqGA9/I/IrTMsxmKvtWy+ersM+jzpQqbC3YfLzeABPdeTgcJ9eu1qQ==",
+ "dev": true,
+ "requires": {
+ "cliui": "4.1.0",
+ "decamelize": "2.0.0",
+ "find-up": "3.0.0",
+ "get-caller-file": "1.0.3",
+ "os-locale": "2.1.0",
+ "require-directory": "2.1.1",
+ "require-main-filename": "1.0.1",
+ "set-blocking": "2.0.0",
+ "string-width": "2.1.1",
+ "which-module": "2.0.0",
+ "y18n": "4.0.0",
+ "yargs-parser": "10.1.0"
+ }
+ },
+ "yargs-parser": {
+ "version": "10.1.0",
+ "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-10.1.0.tgz",
+ "integrity": "sha512-VCIyR1wJoEBZUqk5PA+oOBF6ypbwh5aNB3I50guxAL/quggdfs4TtNHQrSazFA3fYZ+tEqfs0zIGlv0c/rgjbQ==",
+ "dev": true,
+ "requires": {
+ "camelcase": "4.1.0"
+ }
+ }
+ }
+ },
+ "webpack-log": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/webpack-log/-/webpack-log-2.0.0.tgz",
+ "integrity": "sha512-cX8G2vR/85UYG59FgkoMamwHUIkSSlV3bBMRsbxVXVUk2j6NleCKjQ/WE9eYg9WY4w25O9w8wKP4rzNZFmUcUg==",
+ "dev": true,
+ "requires": {
+ "ansi-colors": "3.0.5",
+ "uuid": "3.3.2"
+ }
+ },
+ "webpack-merge": {
+ "version": "4.1.4",
+ "resolved": "https://registry.npmjs.org/webpack-merge/-/webpack-merge-4.1.4.tgz",
+ "integrity": "sha512-TmSe1HZKeOPey3oy1Ov2iS3guIZjWvMT2BBJDzzT5jScHTjVC3mpjJofgueEzaEd6ibhxRDD6MIblDr8tzh8iQ==",
+ "dev": true,
+ "requires": {
+ "lodash": "4.17.10"
+ }
+ },
+ "webpack-sources": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/webpack-sources/-/webpack-sources-1.2.0.tgz",
+ "integrity": "sha512-9BZwxR85dNsjWz3blyxdOhTgtnQvv3OEs5xofI0wPYTwu5kaWxS08UuD1oI7WLBLpRO+ylf0ofnXLXWmGb2WMw==",
+ "dev": true,
+ "requires": {
+ "source-list-map": "2.0.0",
+ "source-map": "0.6.1"
+ },
+ "dependencies": {
+ "source-map": {
+ "version": "0.6.1",
+ "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+ "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+ "dev": true
+ }
+ }
+ },
+ "webpack-subresource-integrity": {
+ "version": "1.1.0-rc.4",
+ "resolved": "https://registry.npmjs.org/webpack-subresource-integrity/-/webpack-subresource-integrity-1.1.0-rc.4.tgz",
+ "integrity": "sha1-xcTj1pD50vZKlVDgeodn+Xlqpdg=",
+ "dev": true,
+ "requires": {
+ "webpack-core": "0.6.9"
+ }
+ },
+ "websocket-driver": {
+ "version": "0.7.0",
+ "resolved": "https://registry.npmjs.org/websocket-driver/-/websocket-driver-0.7.0.tgz",
+ "integrity": "sha1-DK+dLXVdk67gSdS90NP+LMoqJOs=",
+ "dev": true,
+ "requires": {
+ "http-parser-js": "0.4.13",
+ "websocket-extensions": "0.1.3"
+ }
+ },
+ "websocket-extensions": {
+ "version": "0.1.3",
+ "resolved": "https://registry.npmjs.org/websocket-extensions/-/websocket-extensions-0.1.3.tgz",
+ "integrity": "sha512-nqHUnMXmBzT0w570r2JpJxfiSD1IzoI+HGVdd3aZ0yNi3ngvQ4jv1dtHt5VGxfI2yj5yqImPhOK4vmIh2xMbGg==",
+ "dev": true
+ },
+ "when": {
+ "version": "3.6.4",
+ "resolved": "https://registry.npmjs.org/when/-/when-3.6.4.tgz",
+ "integrity": "sha1-RztRfsFZ4rhQBUl6E5g/CVQS404=",
+ "dev": true
+ },
+ "which": {
+ "version": "1.3.1",
+ "resolved": "https://registry.npmjs.org/which/-/which-1.3.1.tgz",
+ "integrity": "sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==",
+ "dev": true,
+ "requires": {
+ "isexe": "2.0.0"
+ }
+ },
+ "which-module": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/which-module/-/which-module-1.0.0.tgz",
+ "integrity": "sha1-u6Y8qGGUiZT/MHc2CJ47lgJsKk8=",
+ "dev": true
+ },
+ "wide-align": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.3.tgz",
+ "integrity": "sha512-QGkOQc8XL6Bt5PwnsExKBPuMKBxnGxWWW3fU55Xt4feHozMUhdUMaBCk290qpm/wG5u/RSKzwdAC4i51YigihA==",
+ "dev": true,
+ "requires": {
+ "string-width": "1.0.2"
+ }
+ },
+ "widest-line": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/widest-line/-/widest-line-2.0.0.tgz",
+ "integrity": "sha1-AUKk6KJD+IgsAjOqDgKBqnYVInM=",
+ "dev": true,
+ "requires": {
+ "string-width": "2.1.1"
+ },
+ "dependencies": {
+ "ansi-regex": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz",
+ "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=",
+ "dev": true
+ },
+ "is-fullwidth-code-point": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz",
+ "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=",
+ "dev": true
+ },
+ "string-width": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz",
+ "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==",
+ "dev": true,
+ "requires": {
+ "is-fullwidth-code-point": "2.0.0",
+ "strip-ansi": "4.0.0"
+ }
+ },
+ "strip-ansi": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz",
+ "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=",
+ "dev": true,
+ "requires": {
+ "ansi-regex": "3.0.0"
+ }
+ }
+ }
+ },
+ "win-release": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/win-release/-/win-release-1.1.1.tgz",
+ "integrity": "sha1-X6VeAr58qTTt/BJmVjLoSbcuUgk=",
+ "dev": true,
+ "requires": {
+ "semver": "5.5.1"
+ }
+ },
+ "window-size": {
+ "version": "0.1.0",
+ "resolved": "https://registry.npmjs.org/window-size/-/window-size-0.1.0.tgz",
+ "integrity": "sha1-VDjNLqk7IC76Ohn+iIeu58lPnJ0=",
+ "dev": true,
+ "optional": true
+ },
+ "wordwrap": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-1.0.0.tgz",
+ "integrity": "sha1-J1hIEIkUVqQXHI0CJkQa3pDLyus=",
+ "dev": true
+ },
+ "worker-farm": {
+ "version": "1.6.0",
+ "resolved": "https://registry.npmjs.org/worker-farm/-/worker-farm-1.6.0.tgz",
+ "integrity": "sha512-6w+3tHbM87WnSWnENBUvA2pxJPLhQUg5LKwUQHq3r+XPhIM+Gh2R5ycbwPCyuGbNg+lPgdcnQUhuC02kJCvffQ==",
+ "dev": true,
+ "requires": {
+ "errno": "0.1.7"
+ }
+ },
+ "wrap-ansi": {
+ "version": "2.1.0",
+ "resolved": "http://registry.npmjs.org/wrap-ansi/-/wrap-ansi-2.1.0.tgz",
+ "integrity": "sha1-2Pw9KE3QV5T+hJc8rs3Rz4JP3YU=",
+ "dev": true,
+ "requires": {
+ "string-width": "1.0.2",
+ "strip-ansi": "3.0.1"
+ }
+ },
+ "wrappy": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz",
+ "integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=",
+ "dev": true
+ },
+ "write-file-atomic": {
+ "version": "2.3.0",
+ "resolved": "https://registry.npmjs.org/write-file-atomic/-/write-file-atomic-2.3.0.tgz",
+ "integrity": "sha512-xuPeK4OdjWqtfi59ylvVL0Yn35SF3zgcAcv7rBPFHVaEapaDr4GdGgm3j7ckTwH9wHL7fGmgfAnb0+THrHb8tA==",
+ "dev": true,
+ "requires": {
+ "graceful-fs": "4.1.11",
+ "imurmurhash": "0.1.4",
+ "signal-exit": "3.0.2"
+ }
+ },
+ "ws": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/ws/-/ws-1.1.2.tgz",
+ "integrity": "sha1-iiRPoFJAHgjJiGz0SoUYnh/UBn8=",
+ "dev": true,
+ "requires": {
+ "options": "0.0.6",
+ "ultron": "1.0.2"
+ }
+ },
+ "wtf-8": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/wtf-8/-/wtf-8-1.0.0.tgz",
+ "integrity": "sha1-OS2LotDxw00e4tYw8V0O+2jhBIo=",
+ "dev": true
+ },
+ "xdg-basedir": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/xdg-basedir/-/xdg-basedir-3.0.0.tgz",
+ "integrity": "sha1-SWsswQnsqNus/i3HK2A8F8WHCtQ=",
+ "dev": true
+ },
+ "xml2js": {
+ "version": "0.4.19",
+ "resolved": "https://registry.npmjs.org/xml2js/-/xml2js-0.4.19.tgz",
+ "integrity": "sha512-esZnJZJOiJR9wWKMyuvSE1y6Dq5LCuJanqhxslH2bxM6duahNZ+HMpCLhBQGZkbX6xRf8x1Y2eJlgt2q3qo49Q==",
+ "dev": true,
+ "requires": {
+ "sax": "1.2.4",
+ "xmlbuilder": "9.0.7"
+ },
+ "dependencies": {
+ "sax": {
+ "version": "1.2.4",
+ "resolved": "https://registry.npmjs.org/sax/-/sax-1.2.4.tgz",
+ "integrity": "sha512-NqVDv9TpANUjFm0N8uM5GxL36UgKi9/atZw+x7YFnQ8ckwFGKrl4xX4yWtrey3UJm5nP1kUbnYgLopqWNSRhWw==",
+ "dev": true
+ }
+ }
+ },
+ "xmlbuilder": {
+ "version": "9.0.7",
+ "resolved": "https://registry.npmjs.org/xmlbuilder/-/xmlbuilder-9.0.7.tgz",
+ "integrity": "sha1-Ey7mPS7FVlxVfiD0wi35rKaGsQ0=",
+ "dev": true
+ },
+ "xmlhttprequest-ssl": {
+ "version": "1.5.3",
+ "resolved": "https://registry.npmjs.org/xmlhttprequest-ssl/-/xmlhttprequest-ssl-1.5.3.tgz",
+ "integrity": "sha1-GFqIjATspGw+QHDZn3tJ3jUomS0=",
+ "dev": true
+ },
+ "xregexp": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/xregexp/-/xregexp-4.0.0.tgz",
+ "integrity": "sha512-PHyM+sQouu7xspQQwELlGwwd05mXUFqwFYfqPO0cC7x4fxyHnnuetmQr6CjJiafIDoH4MogHb9dOoJzR/Y4rFg==",
+ "dev": true
+ },
+ "xtend": {
+ "version": "4.0.1",
+ "resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.1.tgz",
+ "integrity": "sha1-pcbVMr5lbiPbgg77lDofBJmNY68=",
+ "dev": true
+ },
+ "xxhashjs": {
+ "version": "0.2.2",
+ "resolved": "https://registry.npmjs.org/xxhashjs/-/xxhashjs-0.2.2.tgz",
+ "integrity": "sha512-AkTuIuVTET12tpsVIQo+ZU6f/qDmKuRUcjaqR+OIvm+aCBsZ95i7UVY5WJ9TMsSaZ0DA2WxoZ4acu0sPH+OKAw==",
+ "dev": true,
+ "requires": {
+ "cuint": "0.2.2"
+ }
+ },
+ "y18n": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz",
+ "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==",
+ "dev": true
+ },
+ "yallist": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/yallist/-/yallist-2.1.2.tgz",
+ "integrity": "sha1-HBH5IY8HYImkfdUS+TxmmaaoHVI=",
+ "dev": true
+ },
+ "yargs": {
+ "version": "7.1.0",
+ "resolved": "https://registry.npmjs.org/yargs/-/yargs-7.1.0.tgz",
+ "integrity": "sha1-a6MY6xaWFyf10oT46gA+jWFU0Mg=",
+ "dev": true,
+ "requires": {
+ "camelcase": "3.0.0",
+ "cliui": "3.2.0",
+ "decamelize": "1.2.0",
+ "get-caller-file": "1.0.3",
+ "os-locale": "1.4.0",
+ "read-pkg-up": "1.0.1",
+ "require-directory": "2.1.1",
+ "require-main-filename": "1.0.1",
+ "set-blocking": "2.0.0",
+ "string-width": "1.0.2",
+ "which-module": "1.0.0",
+ "y18n": "3.2.1",
+ "yargs-parser": "5.0.0"
+ },
+ "dependencies": {
+ "camelcase": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-3.0.0.tgz",
+ "integrity": "sha1-MvxLn82vhF/N9+c7uXysImHwqwo=",
+ "dev": true
+ },
+ "y18n": {
+ "version": "3.2.1",
+ "resolved": "https://registry.npmjs.org/y18n/-/y18n-3.2.1.tgz",
+ "integrity": "sha1-bRX7qITAhnnA136I53WegR4H+kE=",
+ "dev": true
+ }
+ }
+ },
+ "yargs-parser": {
+ "version": "5.0.0",
+ "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-5.0.0.tgz",
+ "integrity": "sha1-J17PDX/+Bcd+ZOfIbkzZS/DhIoo=",
+ "dev": true,
+ "requires": {
+ "camelcase": "3.0.0"
+ },
+ "dependencies": {
+ "camelcase": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-3.0.0.tgz",
+ "integrity": "sha1-MvxLn82vhF/N9+c7uXysImHwqwo=",
+ "dev": true
+ }
+ }
+ },
+ "yeast": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/yeast/-/yeast-0.1.2.tgz",
+ "integrity": "sha1-AI4G2AlDIMNy28L47XagymyKxBk=",
+ "dev": true
+ },
+ "yn": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/yn/-/yn-2.0.0.tgz",
+ "integrity": "sha1-5a2ryKz0CPY4X8dklWhMiOavaJo=",
+ "dev": true
+ },
+ "zone.js": {
+ "version": "0.8.26",
+ "resolved": "https://registry.npmjs.org/zone.js/-/zone.js-0.8.26.tgz",
+ "integrity": "sha512-W9Nj+UmBJG251wkCacIkETgra4QgBo/vgoEkb4a2uoLzpQG7qF9nzwoLXWU5xj3Fg2mxGvEDh47mg24vXccYjA=="
+ }
+ }
+}
diff --git a/web/gui2-fw-lib/package.json b/web/gui2-fw-lib/package.json
new file mode 100644
index 0000000..88595cc
--- /dev/null
+++ b/web/gui2-fw-lib/package.json
@@ -0,0 +1,54 @@
+{
+ "name": "gui2-fw-lib-app",
+ "version": "2.0.0",
+ "license": "MIT",
+ "scripts": {
+ "ng": "ng",
+ "start": "ng serve",
+ "build": "ng build",
+ "test": "ng test",
+ "lint": "ng lint",
+ "e2e": "ng e2e"
+ },
+ "private": true,
+ "dependencies": {
+ "@angular/animations": "^6.0.0",
+ "@angular/common": "^6.0.0",
+ "@angular/compiler": "^6.0.0",
+ "@angular/core": "^6.0.0",
+ "@angular/forms": "^6.0.0",
+ "@angular/http": "^6.0.0",
+ "@angular/platform-browser": "^6.0.0",
+ "@angular/platform-browser-dynamic": "^6.0.0",
+ "@angular/router": "^6.0.0",
+ "core-js": "^2.5.4",
+ "d3": "^5.2.0",
+ "rxjs": "^6.0.0",
+ "zone.js": "^0.8.26"
+ },
+ "devDependencies": {
+ "@angular-devkit/build-angular": "~0.6.0",
+ "@angular-devkit/build-ng-packagr": "~0.6.0",
+ "ng-packagr": "^3.0.0-rc.2",
+ "@angular/cli": "~6.0.0",
+ "@angular/compiler-cli": "^6.0.0",
+ "@angular/language-service": "^6.0.0",
+ "@compodoc/compodoc": "^1.1.3",
+ "@types/jasmine": "~2.8.6",
+ "@types/jasminewd2": "~2.0.3",
+ "@types/node": "~8.9.4",
+ "codelyzer": "^4.2.1",
+ "jasmine-core": "~2.99.1",
+ "jasmine-spec-reporter": "~4.2.1",
+ "karma": "~1.7.1",
+ "karma-chrome-launcher": "~2.2.0",
+ "karma-coverage-istanbul-reporter": "~1.4.2",
+ "karma-firefox-launcher": "^1.1.0",
+ "karma-jasmine": "~1.1.1",
+ "karma-jasmine-html-reporter": "^0.2.2",
+ "protractor": "~5.3.0",
+ "ts-node": "~5.0.1",
+ "tslint": "~5.9.1",
+ "typescript": "~2.7.2"
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/karma.conf.js b/web/gui2-fw-lib/projects/gui2-fw-lib/karma.conf.js
new file mode 100644
index 0000000..a7aca9d
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/karma.conf.js
@@ -0,0 +1,48 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// Karma configuration file, see link for more information
+// https://karma-runner.github.io/1.0/config/configuration-file.html
+
+module.exports = function (config) {
+ config.set({
+ basePath: '',
+ frameworks: ['jasmine', '@angular-devkit/build-angular'],
+ plugins: [
+ require('karma-jasmine'),
+ require('karma-chrome-launcher'),
+ require('karma-firefox-launcher'),
+ require('karma-jasmine-html-reporter'),
+ require('karma-coverage-istanbul-reporter'),
+ require('@angular-devkit/build-angular/plugins/karma')
+ ],
+ client: {
+ clearContext: false // leave Jasmine Spec Runner output visible in browser
+ },
+ coverageIstanbulReporter: {
+ dir: require('path').join(__dirname, '../../coverage'),
+ reports: ['html', 'lcovonly'],
+ fixWebpackSourcePaths: true
+ },
+ reporters: ['progress', 'kjhtml'],
+ port: 9876,
+ colors: true,
+ logLevel: config.LOG_INFO,
+ autoWatch: true,
+ browsers: ['Chrome', 'Firefox'],
+ singleRun: false
+ });
+};
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.json b/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.json
new file mode 100644
index 0000000..c43fcfb
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.json
@@ -0,0 +1,8 @@
+{
+ "$schema": "../../node_modules/ng-packagr/ng-package.schema.json",
+ "dest": "../../dist/gui2-fw-lib",
+ "deleteDestPath": false,
+ "lib": {
+ "entryFile": "src/public_api.ts"
+ }
+}
\ No newline at end of file
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.prod.json b/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.prod.json
new file mode 100644
index 0000000..e41eef4
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.prod.json
@@ -0,0 +1,7 @@
+{
+ "$schema": "../../node_modules/ng-packagr/ng-package.schema.json",
+ "dest": "../../dist/gui2-fw-lib",
+ "lib": {
+ "entryFile": "src/public_api.ts"
+ }
+}
\ No newline at end of file
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/package.json b/web/gui2-fw-lib/projects/gui2-fw-lib/package.json
new file mode 100644
index 0000000..a130774
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/package.json
@@ -0,0 +1,8 @@
+{
+ "name": "gui2-fw-lib",
+ "version": "0.14.0",
+ "peerDependencies": {
+ "@angular/common": "^6.0.0-rc.0 || ^6.0.0",
+ "@angular/core": "^6.0.0-rc.0 || ^6.0.0"
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.prod.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.prod.ts
new file mode 100644
index 0000000..ba55732
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.prod.ts
@@ -0,0 +1,18 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+export const environment = {
+ production: true
+};
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.ts
new file mode 100644
index 0000000..bca9ca2
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.ts
@@ -0,0 +1,24 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+// The file contents for the current environment will overwrite these during build.
+// The build system defaults to the dev environment which uses `environment.ts`, but if you do
+// `ng build --env=prod` then `environment.prod.ts` will be used instead.
+// The list of which env maps to which file can be found in `.angular-cli.json`.
+
+export const environment = {
+ production: false,
+ isDebugMode: true
+};
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/consolelogger.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/consolelogger.service.ts
new file mode 100644
index 0000000..a682fb3
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/consolelogger.service.ts
@@ -0,0 +1,61 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { environment } from '../environments/environment';
+import { Logger } from './log.service';
+
+export let isDebugMode: boolean = !environment.production;
+
+const noop = (): any => undefined;
+
+/**
+ * ONOS GUI -- LogService
+ * Inspired by https://robferguson.org/blog/2017/09/09/a-simple-logging-service-for-angular-4/
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class ConsoleLoggerService implements Logger {
+
+ get debug() {
+ if (isDebugMode) {
+ return console.debug.bind(console);
+ } else {
+ return noop;
+ }
+ }
+
+ get info() {
+ if (isDebugMode) {
+ return console.info.bind(console);
+ } else {
+ return noop;
+ }
+ }
+
+ get warn() {
+ return console.warn.bind(console);
+ }
+
+ get error() {
+ return console.error.bind(console);
+ }
+
+ invokeConsoleMethod(type: string, args?: any): void {
+ const logFn: Function = (console)[type] || console.log || noop;
+ logFn.apply(console, [args]);
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/detectbrowser.directive.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/detectbrowser.directive.ts
new file mode 100644
index 0000000..a2ec16d
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/detectbrowser.directive.ts
@@ -0,0 +1,65 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Inject } from '@angular/core';
+import { Directive } from '@angular/core';
+import { FnService } from './util/fn.service';
+import { LogService } from './log.service';
+import { OnosService } from './onos.service';
+
+/**
+ * ONOS GUI -- Detect Browser Directive
+ */
+@Directive({
+ selector: '[onosDetectBrowser]'
+})
+export class DetectBrowserDirective {
+ constructor(
+ private fs: FnService,
+ private log: LogService,
+ private onos: OnosService,
+
+ // TODO: Change the any type to Window when https://github.com/angular/angular/issues/15640 is fixed.
+ @Inject('Window') private w: any
+ ) {
+ const body: HTMLBodyElement = document.getElementsByTagName('body')[0];
+// let body = d3.select('body');
+ let browser = '';
+ if (fs.isChrome()) {
+ browser = 'chrome';
+ } else if (fs.isChromeHeadless()) {
+ browser = 'chromeheadless';
+ } else if (fs.isSafari()) {
+ browser = 'safari';
+ } else if (fs.isFirefox()) {
+ browser = 'firefox';
+ } else {
+ this.log.warn('Unknown browser. ',
+ 'Vendor:', this.w.navigator.vendor,
+ 'Agent:', this.w.navigator.userAgent);
+ return;
+ }
+ body.classList.add(browser);
+// body.classed(browser, true);
+ this.onos.browser = browser;
+
+ if (fs.isMobile()) {
+ body.classList.add('mobile');
+ this.onos.mobile = true;
+ }
+
+// this.log.debug('Detected browser is', fs.cap(browser));
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/gui2-fw-lib.module.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/gui2-fw-lib.module.ts
new file mode 100644
index 0000000..6004bce
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/gui2-fw-lib.module.ts
@@ -0,0 +1,52 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { NgModule } from '@angular/core';
+import { CommonModule } from '@angular/common';
+import { DetectBrowserDirective } from './detectbrowser.directive';
+import { IconComponent } from './svg/icon/icon.component';
+import { VeilComponent } from './layer/veil/veil.component';
+import { FlashComponent } from './layer/flash/flash.component';
+import { ConfirmComponent } from './layer/confirm/confirm.component';
+import { MastComponent } from './mast/mast/mast.component';
+import { TableFilterPipe } from './widget/tablefilter.pipe';
+import { TableResizeDirective } from './widget/tableresize.directive';
+
+@NgModule({
+ imports: [
+ CommonModule
+ ],
+ declarations: [
+ DetectBrowserDirective,
+ TableResizeDirective,
+ IconComponent,
+ VeilComponent,
+ FlashComponent,
+ ConfirmComponent,
+ MastComponent,
+ TableFilterPipe
+ ],
+ exports: [
+ DetectBrowserDirective,
+ TableResizeDirective,
+ IconComponent,
+ VeilComponent,
+ FlashComponent,
+ ConfirmComponent,
+ MastComponent,
+ TableFilterPipe
+ ]
+})
+export class Gui2FwLibModule { }
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.css
new file mode 100644
index 0000000..b097534
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.css
@@ -0,0 +1,39 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Confirm Component (layout) -- CSS file
+ */
+#app-dialog {
+ top: 140px;
+ padding: 12px;
+}
+
+#app-dialog h3 {
+ display: inline-block;
+ font-weight: bold;
+ font-size: 18pt;
+}
+
+#app-dialog p {
+ font-size: 12pt;
+}
+
+#app-dialog p.strong {
+ font-weight: bold;
+ padding: 8px;
+ text-align: center;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.html b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.html
new file mode 100644
index 0000000..a8e2489
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.html
@@ -0,0 +1,22 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~ http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+<div id="app-dialog" class="floatpanel dialog" [@confirmDlgState]="message!==''">
+ <h3> {{ lionFn('dlg_confirm_action') }} </h3>
+ <p>{{ message }}</p>
+ <p *ngIf="warning" class="warning strong">{{ warning }}</p>
+ <div tabindex="10" class="dialog-button" (click)="choice(true)">OK</div>
+ <div tabindex="11" class="dialog-button" (click)="choice(false)">Cancel</div>
+</div>
\ No newline at end of file
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.spec.ts
new file mode 100644
index 0000000..f4e76e0
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.spec.ts
@@ -0,0 +1,86 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { async, ComponentFixture, TestBed } from '@angular/core/testing';
+import { BrowserAnimationsModule } from '@angular/platform-browser/animations';
+import { DebugElement } from '@angular/core';
+import { By } from '@angular/platform-browser';
+import { LionService } from '../../util/lion.service';
+
+import { ConsoleLoggerService } from '../../consolelogger.service';
+import { LogService } from '../../log.service';
+import { ConfirmComponent } from './confirm.component';
+
+/**
+ * ONOS GUI -- Layer -- Confirm Component - Unit Tests
+ */
+describe('ConfirmComponent', () => {
+ let log: LogService;
+ let component: ConfirmComponent;
+ let fixture: ComponentFixture<ConfirmComponent>;
+ const bundleObj = {
+ 'core.view.App': {
+ test: 'test1'
+ }
+ };
+ const mockLion = (key) => {
+ return bundleObj[key] || '%' + key + '%';
+ };
+
+ beforeEach(async(() => {
+ log = new ConsoleLoggerService();
+ TestBed.configureTestingModule({
+ imports: [ BrowserAnimationsModule ],
+ declarations: [ ConfirmComponent ],
+ providers: [
+ { provide: LogService, useValue: log },
+ {
+ provide: LionService, useFactory: (() => {
+ return {
+ bundle: ((bundleId) => mockLion),
+ ubercache: new Array(),
+ loadCbs: new Map<string, () => void>([])
+ };
+ })
+ },
+ ]
+ });
+ }));
+
+ beforeEach(() => {
+ fixture = TestBed.createComponent(ConfirmComponent);
+ component = fixture.debugElement.componentInstance;
+ fixture.detectChanges();
+ });
+
+ it('should create', () => {
+ expect(component).toBeTruthy();
+ });
+
+ it('should have a h3 inside a div#app-dialog', () => {
+ const appDe: DebugElement = fixture.debugElement;
+ const divDe = appDe.query(By.css('div#app-dialog h3'));
+ const div: HTMLElement = divDe.nativeElement;
+ expect(div.textContent).toEqual(' %dlg_confirm_action% ');
+ });
+
+ it('should have a div.dialog-button inside a div#app-dialog', () => {
+ const appDe: DebugElement = fixture.debugElement;
+ const divDe = appDe.query(By.css('div#app-dialog div.dialog-button'));
+ const div: HTMLElement = divDe.nativeElement;
+ // It selects the first one
+ expect(div.textContent).toEqual('OK');
+ });
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.ts
new file mode 100644
index 0000000..fca6419
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.ts
@@ -0,0 +1,87 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Component, Input, Output, EventEmitter } from '@angular/core';
+import { trigger, state, style, animate, transition } from '@angular/animations';
+import { LogService } from '../../log.service';
+import { LionService } from '../../util/lion.service';
+
+/**
+ * ONOS GUI -- Layer -- Confirm Component
+ *
+ * Replaces Flash Service in old GUI.
+ * Provides a mechanism to present a confirm dialog to the screen
+ *
+ * To use add an element to the template like
+ * <onos-confirm message="Performing something dangerous. Would you like to proceed"></onos-flash>
+ *
+ * An event is raised with either OK or Cancel
+ */
+@Component({
+ selector: 'onos-confirm',
+ templateUrl: './confirm.component.html',
+ styleUrls: [
+ './confirm.component.css',
+ './confirm.theme.css',
+ '../dialog.css',
+ '../dialog.theme.css',
+ '../../widget/panel.css',
+ '../../widget/panel-theme.css'
+ ],
+ animations: [
+ trigger('confirmDlgState', [
+ state('true', style({
+ transform: 'translateX(-100%)',
+ opacity: '100'
+ })),
+ state('false', style({
+ transform: 'translateX(0%)',
+ opacity: '0'
+ })),
+ transition('0 => 1', animate('100ms ease-in')),
+ transition('1 => 0', animate('100ms ease-out'))
+ ])
+ ]
+})
+export class ConfirmComponent {
+
+ lionFn; // Function
+
+ @Input() message: string;
+ @Input() warning: string;
+ @Output() chosen: EventEmitter<boolean> = new EventEmitter();
+
+ constructor(
+ private log: LogService,
+ private lion: LionService,
+ ) {
+ this.log.debug('ConfirmComponent constructed');
+ this.doLion();
+ }
+
+ /**
+ * When OK or Cancel is pressed, send an event to parent with choice
+ */
+ choice(chosen: boolean): void {
+ this.chosen.emit(chosen);
+ }
+
+ /**
+ * Read the LION bundle for App to get confirm dialouge header
+ */
+ doLion() {
+ this.lionFn = this.lion.bundle('core.view.App');
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.theme.css
new file mode 100644
index 0000000..db97648
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.theme.css
@@ -0,0 +1,33 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Confirm Component (theme) -- CSS file
+ */
+/* temporarily removed .light */
+#app-dialog p.strong {
+ color: white;
+ background-color: #ce5b58;
+}
+
+#app-dialog.floatpanel.dialog {
+ background-color: #ffffff;
+}
+
+#app-dialog p.strong {
+ color: white;
+ background-color: #ce5b58;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.css
new file mode 100644
index 0000000..6792a3d
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.css
@@ -0,0 +1,36 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Dialog Service (layout) -- CSS file
+ */
+
+.dialog h2 {
+ margin: 0;
+ word-wrap: break-word;
+ display: inline-block;
+ width: 210px;
+ vertical-align: middle;
+}
+
+.dialog .dialog-button {
+ display: inline-block;
+ cursor: pointer;
+ height: 20px;
+ padding: 6px 8px 2px 8px;
+ margin: 4px;
+ float: right;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.theme.css
new file mode 100644
index 0000000..24cd5fa
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.theme.css
@@ -0,0 +1,33 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Dialog Service (theme) -- CSS file
+ */
+
+/* temporarily removed .light */
+.dialog .dialog-button {
+ background-color: #518ecc;
+ color: white;
+}
+
+
+/* ========== DARK Theme ========== */
+
+.dark .dialog .dialog-button {
+ background-color: #345e85;
+ color: #cccccd;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.css
new file mode 100644
index 0000000..66b8f3b
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.css
@@ -0,0 +1,68 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Flash Component (layout) -- CSS file
+ */
+
+#flash {
+ position: fixed;
+ top: 50%;
+ left: 50%;
+ transform: translate(-50%, -50%);
+ z-index: 1400;
+}
+
+#flash.warning div#flashBox {
+ border: 2px solid #222222;
+ border-radius: 10px;
+ background: #FFFFFF;
+ padding: 10px;
+}
+
+#flash div#flashBox {
+ background: #CCCCCC;
+ border-radius: 10px;
+ padding: 1px;
+}
+
+#flash div#flashBox div.dialog-button {
+ transform :translateY(-32px);
+}
+
+#flash.warning p#flashText {
+ stroke: #FF0000;
+ color: #FF0000;
+ text-anchor: middle;
+ alignment-baseline: middle;
+ text-align: center;
+ font-size: 16pt;
+ border-radius: 10px;
+ background: #FFFFFF;
+ padding: 10px;
+}
+
+#flash p#flashText {
+ stroke: none;
+ color: #222222;
+ text-anchor: middle;
+ alignment-baseline: middle;
+ text-align: center;
+ font-size: 16pt;
+ border-radius: 10px;
+ background: #CCCCCC;
+ padding: 5px;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.html b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.html
new file mode 100644
index 0000000..46b6de9
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.html
@@ -0,0 +1,21 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~ http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+<div id="flash" class="dialog" [ngClass]="warning?'warning':''" [@flashState]="visible">
+ <div id="flashBox" *ngIf="visible">
+ <p id="flashText">{{ message }}</p>
+ <div class="dialog-button" *ngIf="dwell>1200" (click)="closeNow()">Dismiss</div>
+ </div>
+</div>
\ No newline at end of file
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.spec.ts
new file mode 100644
index 0000000..661e223
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.spec.ts
@@ -0,0 +1,60 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { async, ComponentFixture, TestBed } from '@angular/core/testing';
+import { BrowserAnimationsModule } from '@angular/platform-browser/animations';
+import { DebugElement } from '@angular/core';
+import { By } from '@angular/platform-browser';
+
+import { ConsoleLoggerService } from '../../consolelogger.service';
+import { LogService } from '../../log.service';
+import { FlashComponent } from './flash.component';
+
+/**
+ * ONOS GUI -- Layer -- Flash Component - Unit Tests
+ */
+describe('FlashComponent', () => {
+ let log: LogService;
+ let component: FlashComponent;
+ let fixture: ComponentFixture<FlashComponent>;
+
+ beforeEach(async(() => {
+ log = new ConsoleLoggerService();
+ TestBed.configureTestingModule({
+ imports: [ BrowserAnimationsModule ],
+ declarations: [ FlashComponent ],
+ providers: [
+ { provide: LogService, useValue: log },
+ ]
+ });
+ }));
+
+ beforeEach(() => {
+ fixture = TestBed.createComponent(FlashComponent);
+ component = fixture.debugElement.componentInstance;
+ fixture.detectChanges();
+ });
+
+ it('should create', () => {
+ expect(component).toBeTruthy();
+ });
+
+// it('should have a div#flash', () => {
+// component.enabled = true;
+// const appDe: DebugElement = fixture.debugElement;
+// const divDe = appDe.query(By.css('div#flash'));
+// expect(divDe).toBeTruthy();
+// });
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.ts
new file mode 100644
index 0000000..7dd721d
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.ts
@@ -0,0 +1,91 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Component, Input, Output, OnChanges, SimpleChange, EventEmitter } from '@angular/core';
+import { LogService } from '../../log.service';
+import { trigger, state, style, animate, transition } from '@angular/animations';
+
+/**
+ * ONOS GUI -- Layer -- Flash Component
+ *
+ * Replaces Flash Service in old GUI.
+ * Provides a mechanism to flash short informational messages to the screen
+ * to alert the user of something, e.g. "Hosts visible" or "Hosts hidden".
+ *
+ * It can be used in a warning mode, where text will appear in red
+ * The dwell time (milliseconds) can be controlled or the default is 1200ms
+ *
+ * To use add an element to the template like
+ * <onos-flash message="Hosts visible" dwell="2000" warning="true"></onos-flash>
+ * This whole element can be disabled until needed with an ngIf, but if this is done
+ * the animated fade-in and fade-out will not happen
+ * There is also a (closed) event that tells you when the message is closed, or
+ * fades-out
+ */
+@Component({
+ selector: 'onos-flash',
+ templateUrl: './flash.component.html',
+ styleUrls: [
+ './flash.component.css',
+ '../dialog.css',
+ '../dialog.theme.css',
+ ],
+ animations: [
+ trigger('flashState', [
+ state('false', style({
+// transform: 'translateY(-400%)',
+ opacity: '0.0',
+ })),
+ state('true', style({
+// transform: 'translateY(0%)',
+ opacity: '1.0',
+ })),
+ transition('0 => 1', animate('200ms ease-in')),
+ transition('1 => 0', animate('200ms ease-out'))
+ ])
+ ]
+})
+export class FlashComponent implements OnChanges {
+ @Input() message: string;
+ @Input() dwell: number = 1200; // milliseconds
+ @Input() warning: boolean = false;
+ @Output() closed: EventEmitter<boolean> = new EventEmitter();
+
+ public visible: boolean = false;
+
+ /**
+ * Flash a message up for 1200ms then disappear again.
+ * See animation parameter for the ease in and ease out params
+ */
+ ngOnChanges(changes: {[propertyName: string]: SimpleChange}) {
+ if (changes['message'] && this.message && this.message !== '') {
+ this.visible = true;
+
+ setTimeout(() => {
+ this.visible = false;
+ this.closed.emit(false);
+ }, this.dwell);
+ }
+ }
+
+ /**
+ * The message will flash up for 'dwell' milliseconds
+ * If dwell is > 2000ms, then there will be a button that allows it to be dismissed now
+ */
+ closeNow() {
+ this.visible = false;
+ this.closed.emit(false);
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.css
new file mode 100644
index 0000000..4ba98a9
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.css
@@ -0,0 +1,27 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Loading Service -- CSS file
+ */
+
+#loading-anim {
+ position: fixed;
+ top: 50%;
+ left: 50%;
+ -webkit-transform: translate(-50%, -50%);
+ transform: translate(-50%, -50%);
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.ts
new file mode 100644
index 0000000..f7f54fa
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.ts
@@ -0,0 +1,137 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+import { ThemeService } from '../util/theme.service';
+import { WebSocketService } from '../remote/websocket.service';
+import * as d3 from 'd3';
+
+const id = 'loading-anim';
+const dir = 'data/img/loading/';
+const pfx = '/load-';
+const nImgs = 16;
+const speed = 100;
+const waitDelay = 500;
+
+
+/**
+ * ONOS GUI -- Layer -- Loading Service
+ *
+ * Provides a mechanism to start/stop the loading animation, center screen.
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class LoadingService {
+ images: any[] = [];
+ idx = 0;
+ img: any;
+ theme: string;
+ task: any;
+ wait: number;
+
+ constructor(
+ private fs: FnService,
+ private log: LogService,
+ private ts: ThemeService,
+ private wss: WebSocketService
+ ) {
+ this.preloadImages();
+ this.log.debug('LoadingService constructed');
+ }
+
+ dbg(...args) {
+ this.fs.debug(this.constructor.name, args);
+ }
+
+ preloadImages() {
+ let idx: number;
+
+ this.dbg('preload images start...');
+ for (idx = 1; idx <= nImgs ; idx++) {
+ this.addImg('light', idx);
+ this.addImg('dark', idx);
+ }
+ this.dbg('preload images DONE!', this.images);
+ }
+
+ addImg(theme: string, idx: number) {
+ const img = new Image();
+ img.src = this.fname(idx, theme);
+ this.images.push(img);
+ }
+
+ fname(i: number, theme: string) {
+ const z = i > 9 ? '' : '0';
+ return dir + theme + pfx + z + i + '.png';
+ }
+
+ nextFrame() {
+ this.idx = this.idx === 16 ? 1 : this.idx + 1;
+ this.img.attr('src', this.fname(this.idx, this.theme));
+ }
+
+ // start displaying 'loading...' animation (idempotent)
+ startAnim() {
+ this.dbg('start ANIMATION');
+ this.theme = this.ts.getTheme();
+ let div = d3.select('#' + id);
+ if (div.empty()) {
+ div = d3.select('body')
+ .append('div')
+ .attr('id', id);
+ this.img = div
+ .append('img')
+ .attr('src', this.fname(1, this.theme));
+ this.idx = 1;
+ this.task = setInterval(() => this.nextFrame(), speed);
+ }
+ }
+
+ // stop displaying 'loading...' animation (idempotent)
+ stopAnim() {
+ this.dbg('*stop* ANIMATION');
+ if (this.task) {
+ clearInterval(this.task);
+ this.task = null;
+ }
+ d3.select('#' + id).remove();
+ }
+
+ // schedule function to start animation in the future
+ start() {
+ this.dbg('start (schedule)');
+ this.wait = setTimeout(this.startAnim(), waitDelay);
+ }
+
+ // cancel future start, if any; stop the animation
+ stop() {
+ if (this.wait) {
+ this.dbg('start CANCELED');
+ clearTimeout(this.wait);
+ this.wait = null;
+ }
+ this.stopAnim();
+ }
+
+ // return true if start() has been called but not stop()
+ waiting(): boolean {
+ return !!this.wait;
+ }
+
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/panel.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/panel.service.ts
new file mode 100644
index 0000000..151bd0e
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/panel.service.ts
@@ -0,0 +1,222 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import {Injectable} from '@angular/core';
+import {FnService} from '../util/fn.service';
+import {LogService} from '../log.service';
+import {ThemeService} from '../util/theme.service';
+import {WebSocketService} from '../remote/websocket.service';
+import * as d3 from 'd3';
+
+let fs;
+
+const defaultSettings = {
+ edge: 'right',
+ width: 200,
+ margin: 20,
+ hideMargin: 20,
+ xtnTime: 750,
+ fade: true,
+};
+
+let panels,
+ panelLayer;
+
+function init() {
+ panelLayer = d3.select('div#floatpanels');
+ panelLayer.text('');
+ panels = {};
+}
+
+// helpers for panel
+function noop() {
+}
+
+function margin(p: any) {
+ return p.settings.margin;
+}
+
+function hideMargin(p: any) {
+ return p.settings.hideMargin;
+}
+
+function noPx(p: any, what: any) {
+ return Number(p.el.style(what).replace(/px$/, ''));
+}
+
+function widthVal(p: any) {
+ return noPx(p, 'width');
+}
+
+function heightVal(p: any) {
+ return noPx(p, 'height');
+}
+
+function pxShow(p: any) {
+ return margin(p) + 'px';
+}
+
+function pxHide(p: any) {
+ return (-hideMargin(p) - widthVal(p) - (noPx(p, 'padding') * 2)) + 'px';
+}
+
+function makePanel(id: any, settings: any) {
+ const p = {
+ id: id,
+ settings: settings,
+ on: false,
+ el: null,
+ },
+ api = {
+ show: showPanel,
+ hide: hidePanel,
+ toggle: togglePanel,
+ empty: emptyPanel,
+ append: appendPanel,
+ width: panelWidth,
+ height: panelHeight,
+ bbox: panelBBox,
+ isVisible: panelIsVisible,
+ classed: classed,
+ el: panelEl,
+ };
+
+ p.el = panelLayer.append('div')
+ .attr('id', id)
+ .attr('class', 'floatpanel')
+ .style('opacity', 0);
+
+ // has to be called after el is set
+ p.el.style(p.settings.edge, pxHide(p));
+ panelWidth(p.settings.width);
+ if (p.settings.height) {
+ panelHeight(p.settings.height);
+ }
+
+ panels[id] = p;
+
+ function showPanel(cb: any) {
+ const endCb = fs.isF(cb) || noop;
+ p.on = true;
+ p.el.transition().duration(p.settings.xtnTime)
+ .style(p.settings.edge, pxShow(p))
+ .style('opacity', 1);
+ }
+
+ function hidePanel(cb: any) {
+ const endCb = fs.isF(cb) || noop,
+ endOpacity = p.settings.fade ? 0 : 1;
+ p.on = false;
+ p.el.transition().duration(p.settings.xtnTime)
+ .style(p.settings.edge, pxHide(p))
+ .style('opacity', endOpacity);
+ }
+
+ function togglePanel(cb: any) {
+ if (p.on) {
+ hidePanel(cb);
+ } else {
+ showPanel(cb);
+ }
+ return p.on;
+ }
+
+ function emptyPanel() {
+ return p.el.text('');
+ }
+
+ function appendPanel(what: any) {
+ return p.el.append(what);
+ }
+
+ function panelWidth(w: any) {
+ if (w === undefined) {
+ return widthVal(p);
+ }
+ p.el.style('width', w + 'px');
+ }
+
+ function panelHeight(h: any) {
+ if (h === undefined) {
+ return heightVal(p);
+ }
+ p.el.style('height', h + 'px');
+ }
+
+ function panelBBox() {
+ return p.el.node().getBoundingClientRect();
+ }
+
+ function panelIsVisible() {
+ return p.on;
+ }
+
+ function classed(cls: any, bool: any) {
+ return p.el.classed(cls, bool);
+ }
+
+ function panelEl() {
+ return p.el;
+ }
+
+ return api;
+}
+
+function removePanel(id: any) {
+ panelLayer.select('#' + id).remove();
+ delete panels[id];
+}
+
+@Injectable({
+ providedIn: 'root',
+})
+export class PanelService {
+ constructor(private funcs: FnService,
+ private log: LogService,
+ private ts: ThemeService,
+ private wss: WebSocketService) {
+ fs = this.funcs;
+ init();
+ }
+
+ createPanel(id: any, opts: any) {
+ const settings = Object.assign({}, defaultSettings, opts);
+ if (!id) {
+ this.log.warn('createPanel: no ID given');
+ return null;
+ }
+ if (panels[id]) {
+ this.log.warn('Panel with ID "' + id + '" already exists');
+ return null;
+ }
+ if (fs.debugOn('widget')) {
+ this.log.debug('creating panel:', id, settings);
+ }
+ return makePanel(id, settings);
+ }
+
+ destroyPanel(id: any) {
+ if (panels[id]) {
+ if (fs.debugOn('widget')) {
+ this.log.debug('destroying panel:', id);
+ }
+ removePanel(id);
+ } else {
+ if (fs.debugOn('widget')) {
+ this.log.debug('no panel to destroy:', id);
+ }
+ }
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.css
new file mode 100644
index 0000000..b688ae7
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.css
@@ -0,0 +1,35 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Veil Service (layout) -- CSS file
+ */
+
+#veil {
+ z-index: 5000;
+ display: block;
+ position: absolute;
+ top: 0;
+ left: 0;
+ padding: 60px;
+}
+
+#veil p {
+ display: block;
+ text-align: left;
+ font-size: 14pt;
+ font-style: italic;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.html b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.html
new file mode 100644
index 0000000..69410c5
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.html
@@ -0,0 +1,25 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~ http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+
+<div id="veil" *ngIf="enabled">
+ <p *ngFor="let msg of messages">{{ msg }}</p>
+ <svg [attr.width]="fs.windowSize().width" [attr.height]="fs.windowSize().height">
+ <use [attr.width]="birdDim" [attr.height]="birdDim" class="glyph"
+ style="opacity: 0.2;"
+ xlink:href = "#bird" [attr.transform]="trans"/>
+
+ </svg>
+</div>
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.spec.ts
new file mode 100644
index 0000000..72123dd
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.spec.ts
@@ -0,0 +1,72 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Layer -- Veil Service - Unit Tests
+ */
+import { async, ComponentFixture, TestBed } from '@angular/core/testing';
+import { ActivatedRoute, Params } from '@angular/router';
+
+import { VeilComponent } from './veil.component';
+import { ConsoleLoggerService } from '../../consolelogger.service';
+import { FnService } from '../../util/fn.service';
+import { LogService } from '../../log.service';
+import { GlyphService } from '../../svg/glyph.service';
+import { of } from 'rxjs';
+
+class MockActivatedRoute extends ActivatedRoute {
+ constructor(params: Params) {
+ super();
+ this.queryParams = of(params);
+ }
+}
+
+class MockGlyphService {}
+
+describe('VeilComponent', () => {
+ let fs: FnService;
+ let ar: MockActivatedRoute;
+ let windowMock: Window;
+ let logServiceSpy: jasmine.SpyObj<LogService>;
+
+ beforeEach(async(() => {
+ const logSpy = jasmine.createSpyObj('LogService', ['info', 'debug', 'warn', 'error']);
+ ar = new MockActivatedRoute({});
+ windowMock = <any>{
+ location: <any> {
+ hostname: 'foo'
+ }
+ };
+ fs = new FnService(ar, logSpy, windowMock);
+
+ TestBed.configureTestingModule({
+ declarations: [ VeilComponent ],
+ providers: [
+ { provide: FnService, useValue: fs },
+ { provide: LogService, useValue: logSpy },
+ { provide: GlyphService, useClass: MockGlyphService },
+ { provide: 'Window', useValue: windowMock },
+ ]
+ });
+ logServiceSpy = TestBed.get(LogService);
+ }));
+
+ it('should create', () => {
+ const fixture = TestBed.createComponent(VeilComponent);
+ const component = fixture.componentInstance;
+ expect(component).toBeTruthy();
+ });
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.theme.css
new file mode 100644
index 0000000..2939b9f
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.theme.css
@@ -0,0 +1,34 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Veil Service (theme) -- CSS file
+ */
+
+.light, #veil {
+ background-color: rgba(0,0,0,0.75);
+}
+.dark, #veil {
+ background-color: rgba(64,64,64,0.75);
+}
+
+#veil p {
+ color: #ddd;
+}
+
+#veil svg .glyph {
+ fill: #222;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.ts
new file mode 100644
index 0000000..b93d950
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.ts
@@ -0,0 +1,84 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Component, OnInit } from '@angular/core';
+import { FnService } from '../../util/fn.service';
+import { GlyphService } from '../../svg/glyph.service';
+import { LogService } from '../../log.service';
+import { SvgUtilService } from '../../svg/svgutil.service';
+import { WebSocketService } from '../../remote/websocket.service';
+
+const BIRD = 'bird';
+
+/**
+ * ONOS GUI -- Layer -- Veil Component
+ *
+ * Provides a mechanism to display an overlaying div with information.
+ * Used mainly for web socket connection interruption.
+ *
+ * It can be added to an component's template as follows:
+ * <onos-veil #veil></onos-veil>
+ * <p (click)="veil.show(['t1','t2','t3'])">Test Veil</p>
+ */
+@Component({
+ selector: 'onos-veil',
+ templateUrl: './veil.component.html',
+ styleUrls: ['./veil.component.css', './veil.component.theme.css']
+})
+export class VeilComponent implements OnInit {
+ ww: number;
+ wh: number;
+ birdSvg: string;
+ birdDim: number;
+ enabled: boolean = false;
+ trans: string;
+ messages: string[] = [];
+ veilStyle: string;
+
+ constructor(
+ public fs: FnService,
+ private gs: GlyphService,
+ private log: LogService,
+ private sus: SvgUtilService,
+ private wss: WebSocketService
+ ) {
+ const wSize = this.fs.windowSize();
+ this.ww = wSize.width;
+ this.wh = wSize.height;
+ const shrink = this.wh * 0.3;
+ this.birdDim = this.wh - shrink;
+ const birdCenter = (this.ww - this.birdDim) / 2;
+ this.trans = this.sus.translate([birdCenter, shrink / 2]);
+
+ this.log.debug('VeilComponent with ' + BIRD + ' constructed');
+ }
+
+ ngOnInit() {
+ }
+
+ // msg should be an array of strings
+ show(msgs: string[]): void {
+ this.messages = msgs;
+ this.enabled = true;
+// this.ks.enableKeys(false);
+ }
+
+ hide(): void {
+ this.veilStyle = 'display: none';
+// this.ks.enableKeys(true);
+ }
+
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/log.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/log.service.ts
new file mode 100644
index 0000000..2835371
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/log.service.ts
@@ -0,0 +1,39 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+
+export abstract class Logger {
+ debug: any;
+ info: any;
+ warn: any;
+ error: any;
+}
+
+/**
+ * ONOS GUI -- LogService
+ * Inspired by https://robferguson.org/blog/2017/09/09/a-simple-logging-service-for-angular-4/
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class LogService extends Logger {
+ debug: any;
+ info: any;
+ warn: any;
+ error: any;
+
+ invokeConsoleMethod(type: string, args?: any): void {}
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast.service.ts
new file mode 100644
index 0000000..b279aec
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast.service.ts
@@ -0,0 +1,43 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+
+const PADMOBILE = 16;
+
+/**
+ * ONOS GUI -- Masthead Service
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class MastService {
+
+ public mastHeight = 48;
+
+ constructor(
+ private fs: FnService,
+ private log: LogService
+ ) {
+ if (this.fs.isMobile()) {
+ this.mastHeight += PADMOBILE;
+ }
+
+ this.log.debug('MastService constructed');
+ }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.css
new file mode 100644
index 0000000..5b2d464
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.css
@@ -0,0 +1,132 @@
+/*
+ * Copyright 2014-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Masthead (layout) -- CSS file
+ */
+#mast-top-block {
+ display: block;
+ z-index: -1;
+ height: 48px;
+ width: 100%;
+}
+
+#mast {
+ position: absolute;
+ width: 100%;
+ top: 0px;
+ height: 48px;
+ padding: 0;
+ z-index: 10000;
+}
+
+#mast a:hover {
+ text-decoration: none;
+}
+
+html[data-platform='iPad'] #mast {
+ padding-top: 16px;
+}
+
+#mast .nav-menu-button {
+ display: inline-block;
+ vertical-align: middle;
+ text-align: center;
+ line-height: 48px;
+ padding: 0 12px;
+ cursor: pointer; cursor: hand;
+ /* Needed to removed 3px space at the bottom of img tags */
+ font-size: 0;
+}
+
+#mast .nav-menu-button img {
+ width: 25px;
+ vertical-align: middle;
+}
+
+#mast .logo {
+ height: 47px;
+ width: 511px;
+ vertical-align: bottom;
+}
+
+#mast-right {
+ display: inline-block;
+ float: right;
+ position: relative;
+ top: 0;
+ padding-right: 15px;
+ line-height: 48px;
+}
+
+/*
+ MAST HEAD DROPDOWN MENU
+*/
+
+#mast-right div.ctrl-btns {
+ float: right;
+}
+
+#mast-right div.icon {
+ box-sizing: border-box;
+ position: relative;
+ height: 48px;
+ width: 48px;
+ padding: 9px;
+}
+
+#mast .dropdown-parent {
+ position: relative;
+ float: right;
+}
+
+#mast .dropdown-parent i.dropdown-icon {
+ display: inline-block;
+ height: 7px;
+ width: 9px;
+ margin-left: 10px;
+ background: url('/data/img/dropdown-icon.png') no-repeat;
+}
+
+#mast .dropdown {
+ position: absolute;
+ top: 40px;
+ right: -8px;
+ display: none;
+ min-width: 100px;
+ line-height: 16px;
+ font-size: 12pt;
+ z-index: 1000;
+}
+
+#mast .dropdown a {
+ text-decoration: none;
+ font-size: 12px;
+ display: block;
+ padding: 8px 16px 6px 12px;
+}
+
+#mast .dropdown-parent:hover .dropdown {
+ display: block;
+}
+
+#mast .dropdown-parent:hover i.dropdown-icon {
+ background-position-x: -14px
+}
+
+html[data-platform='iPad'] #mast .dropdown {
+ top: 57px;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.html b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.html
new file mode 100644
index 0000000..72242ba
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.html
@@ -0,0 +1,43 @@
+<!--
+~ Copyright 2014-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~ http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+<div id="mast-top-block"></div>
+<!-- The mast-top-block is an inline display element that pushes any
+ subsequent elements down the page. It has a height of 48px
+ The mast block overlays the mast-top-block. It is is positioned
+ absolutely so that the nav component can slide in behind it when
+ not shown -->
+<div id="mast" align="left">
+ <span class="nav-menu-button clickable" (click)="ns.toggleNav()">
+ <img src="data/img/nav-menu-mojo.png"/>
+ </span>
+ <img class="logo" src="data/img/masthead-logo-mojo.png">
+ <div id="mast-right">
+ <nav>
+ <div class="dropdown-parent">
+ <a class="clickable user-menu__name">{{ username }} <i class="dropdown-icon"></i></a>
+ <div class="dropdown">
+ <a href="rs/logout"> {{ lionFn('logout') }} </a>
+ </div>
+ </div>
+ <div class="ctrl-btns">
+ <div class="active clickable icon" (click)="directTo()">
+ <onos-icon iconId="query" iconSize="32" toolTip="{{ lionFn('tt_help') }}"></onos-icon>
+ </div>
+ </div>
+ </nav>
+
+ </div>
+</div>
\ No newline at end of file
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.spec.ts
new file mode 100644
index 0000000..de42b62
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.spec.ts
@@ -0,0 +1,131 @@
+/*
+ * Copyright 2015-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { async, ComponentFixture, TestBed } from '@angular/core/testing';
+import { DebugElement } from '@angular/core';
+import { By } from '@angular/platform-browser';
+
+import { LogService } from '../../log.service';
+import { ConsoleLoggerService } from '../../consolelogger.service';
+import { MastComponent } from './mast.component';
+import { IconComponent } from '../../svg/icon/icon.component';
+import { LionService } from '../../util/lion.service';
+import { IconService } from '../../svg/icon.service';
+import { NavService } from '../../nav/nav.service';
+import { WebSocketService } from '../../remote/websocket.service';
+
+class MockNavService {}
+
+class MockIconService {
+ loadIconDef() {}
+}
+
+class MockWebSocketService {
+ createWebSocket() {}
+ isConnected() { return false; }
+ unbindHandlers() {}
+ bindHandlers() {}
+}
+
+/**
+ * ONOS GUI -- Masthead Controller - Unit Tests
+ */
+describe('MastComponent', () => {
+ let log: LogService;
+ let windowMock: Window;
+ let component: MastComponent;
+ let fixture: ComponentFixture<MastComponent>;
+ const bundleObj = {
+ 'core.view.App': {
+ test: 'test1',
+ tt_help: 'Help!'
+ }
+ };
+ const mockLion = (key) => {
+ return bundleObj[key] || '%' + key + '%';
+ };
+
+ beforeEach(async(() => {
+ log = new ConsoleLoggerService();
+ windowMock = <any>{
+ location: <any> {
+ hostname: 'foo',
+ pathname: 'apps',
+ host: 'foo',
+ port: '80',
+ protocol: 'http',
+ search: { debug: 'true'},
+ href: 'ws://foo:123/onos/ui/websock/path',
+ absUrl: 'ws://foo:123/onos/ui/websock/path'
+ }
+ };
+
+ TestBed.configureTestingModule({
+ declarations: [ MastComponent, IconComponent ],
+ providers: [
+ { provide: LogService, useValue: log },
+ { provide: NavService, useClass: MockNavService },
+ { provide: LionService, useFactory: (() => {
+ return {
+ bundle: ((bundleId) => mockLion),
+ ubercache: new Array(),
+ loadCbs: new Map<string, () => void>([])
+ };
+ })
+ },
+ { provide: IconService, useClass: MockIconService },
+ { provide: WebSocketService, useClass: MockWebSocketService },
+ { provide: 'Window', useValue: windowMock }
+ ]
+ })
+ .compileComponents();
+ }));
+
+ beforeEach(() => {
+ fixture = TestBed.createComponent(MastComponent);
+ component = fixture.debugElement.componentInstance;
+ fixture.detectChanges();
+ });
+
+ it('should create', () => {
+ expect(component).toBeTruthy();
+ });
+
+ it('should have a div#mast-top-block', () => {
+ const appDe: DebugElement = fixture.debugElement;
+ const divDe = appDe.query(By.css('div#mast-top-block'));
+ expect(divDe).toBeTruthy();
+ });
+
+ it('should have a span.nav-menu-button inside a div#mast', () => {
+ const appDe: DebugElement = fixture.debugElement;
+ const divDe = appDe.query(By.css('div#mast span.nav-menu-button'));
+ expect(divDe).toBeTruthy();
+ });
+
+ it('should have a div.dropdown-parent inside a div#mast-right inside a div#mast', () => {
+ const appDe: DebugElement = fixture.debugElement;
+ const divDe = appDe.query(By.css('div#mast div#mast-right div.dropdown-parent'));
+ const div: HTMLElement = divDe.nativeElement;
+ expect(div.textContent).toEqual(' %logout% ');
+ });
+
+ it('should have an onos-icon inside a div#mast-right inside a div#mast', () => {
+ const appDe: DebugElement = fixture.debugElement;
+ const divDe = appDe.query(By.css('div#mast div#mast-right div.ctrl-btns div.active onos-icon'));
+ expect(divDe).toBeTruthy();
+ });
+
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.ts
new file mode 100644
index 0000000..e6a927c
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.ts
@@ -0,0 +1,92 @@
+/*
+ * Copyright 2014-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Component, Input, OnInit, OnDestroy, Inject } from '@angular/core';
+import { LionService } from '../../util/lion.service';
+import { LogService } from '../../log.service';
+import { NavService } from '../../nav/nav.service';
+
+/**
+ * ONOS GUI -- Masthead Component
+ */
+@Component({
+ selector: 'onos-mast',
+ templateUrl: './mast.component.html',
+ styleUrls: ['./mast.component.css', './mast.theme.css']
+})
+export class MastComponent implements OnInit, OnDestroy {
+ @Input() username: string;
+
+ lionFn; // Function
+ viewMap = new Map<string, string>([]); // A map of app names
+
+ constructor(
+ private lion: LionService,
+ private log: LogService,
+ public ns: NavService,
+ @Inject('Window') private window: any,
+ ) {
+ this.viewMap.set('apps', 'https://wiki.onosproject.org/display/ONOS/GUI+Application+View');
+ this.viewMap.set('device', 'https://wiki.onosproject.org/display/ONOS/GUI+Device+View');
+ this.viewMap.set('', 'https://wiki.onosproject.org/display/ONOS/The+ONOS+Web+GUI');
+ }
+
+ ngOnInit() {
+ if (this.lion.ubercache.length === 0) {
+ this.lionFn = this.dummyLion;
+ this.lion.loadCbs.set('mast', () => this.doLion());
+ this.log.debug('LION not available when MastComponent initialized');
+ } else {
+ this.doLion();
+ }
+ this.log.debug('MastComponent initialized');
+ }
+
+ /**
+ * Nav component should never be closed, but in case it does, it's
+ * safer to tidy up after itself
+ */
+ ngOnDestroy() {
+ this.lion.loadCbs.delete('mast');
+ }
+
+ /**
+ * Read the LION bundle for App and set up the lionFn
+ */
+ doLion() {
+ this.lionFn = this.lion.bundle('core.fw.Mast');
+ if (this.username === undefined) {
+ this.username = this.lionFn('unknown_user');
+ }
+ }
+
+ /**
+ * A dummy implementation of the lionFn until the response is received and the LION
+ * bundle is received from the WebSocket
+ */
+ dummyLion(key: string): string {
+ return '%' + key + '%';
+ }
+
+ directTo() {
+ const curId = this.window.location.pathname.replace('/', '');
+ let helpUrl: string = this.viewMap.get(curId);
+ if (helpUrl === undefined) {
+ helpUrl = this.viewMap.get('');
+ this.log.warn('No help file linked for view:', curId);
+ }
+ this.window.open(helpUrl);
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.theme.css
new file mode 100644
index 0000000..6b92beb
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.theme.css
@@ -0,0 +1,51 @@
+/*
+ * Copyright 2016-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Masthead (theme) -- CSS file
+ */
+
+#mast {
+ background-color: #231f20;
+}
+
+#mast .nav-menu-button:hover {
+ background-color: #888;
+}
+
+#mast-right a {
+ color: #009fdb;
+}
+
+#mast nav {
+ color: #009fdb;
+}
+
+/* Theme styles for drop down menu */
+
+#mast .dropdown {
+ background-color: #231f20;
+ border: 1px solid #dddddd;
+}
+
+#mast .dropdown a {
+ color: #009fdb;
+ border-bottom: solid #444 1px;
+}
+
+#mast .dropdown a:hover {
+ color: #fff;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/nav/nav.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/nav/nav.service.ts
new file mode 100644
index 0000000..22f0549
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/nav/nav.service.ts
@@ -0,0 +1,52 @@
+/*
+ * Copyright 2015-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+
+/**
+ * ONOS GUI -- Navigation Service
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class NavService {
+ public showNav = false;
+
+ constructor(
+ private _fn_: FnService,
+ private log: LogService
+ ) {
+ this.log.debug('NavService constructed');
+ }
+
+ hideNav() {
+ this.showNav = !this.showNav;
+ if (!this.showNav) {
+ this.log.debug('Hiding Nav menu');
+ }
+ }
+
+ toggleNav() {
+ this.showNav = !this.showNav;
+ if (this.showNav) {
+ this.log.debug('Showing Nav menu');
+ } else {
+ this.log.debug('Hiding Nav menu');
+ }
+ }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/onos.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/onos.service.ts
new file mode 100644
index 0000000..17a30ff
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/onos.service.ts
@@ -0,0 +1,44 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { LogService } from './log.service';
+
+/**
+ * A structure of View elements for the OnosService
+ */
+export interface View {
+ id: string;
+ path: string;
+}
+
+/**
+ * ONOS GUI -- OnosService - a placeholder for the global onos variable
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class OnosService {
+ // Global variable
+ public browser: string;
+ public mobile: boolean;
+ public viewMap: View[];
+
+ constructor (
+ private log: LogService
+ ) {
+// this.log.debug('OnosService constructed');
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.spec.ts
new file mode 100644
index 0000000..2c31610
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.spec.ts
@@ -0,0 +1,123 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { TestBed, inject } from '@angular/core/testing';
+
+import { LogService } from '../log.service';
+import { ConsoleLoggerService } from '../consolelogger.service';
+import { UrlFnService } from './urlfn.service';
+import { FnService } from '../util/fn.service';
+import { ActivatedRoute, Params } from '@angular/router';
+import { of } from 'rxjs';
+
+class MockActivatedRoute extends ActivatedRoute {
+ constructor(params: Params) {
+ super();
+ this.queryParams = of(params);
+ }
+}
+
+/**
+ * ONOS GUI -- Remote -- General Functions - Unit Tests
+ */
+describe('UrlFnService', () => {
+ let log: LogService;
+ let ufs: UrlFnService;
+ let fs: FnService;
+ let ar: MockActivatedRoute;
+ let windowMock: Window;
+
+ beforeEach(() => {
+ log = new ConsoleLoggerService();
+ ar = new MockActivatedRoute({'debug': 'TestService'});
+ windowMock = <any>{
+ location: <any> {
+ hostname: '',
+ host: '',
+ port: '',
+ protocol: '',
+ search: { debug: 'true'},
+ href: ''
+ }
+ };
+
+ fs = new FnService(ar, log, windowMock);
+
+ TestBed.configureTestingModule({
+ providers: [UrlFnService,
+ { provide: LogService, useValue: log },
+ { provide: 'Window', useFactory: (() => windowMock ) },
+ ]
+ });
+
+ ufs = TestBed.get(UrlFnService);
+ });
+
+ function setLoc(prot: string, h: string, p: string, ctx: string = '') {
+ windowMock.location.host = h;
+ windowMock.location.hostname = h;
+ windowMock.location.port = p;
+ windowMock.location.protocol = prot;
+ windowMock.location.href = prot + '://' + h + ':' + p +
+ ctx + '/onos/ui/';
+ }
+
+ it('should define UrlFnService', () => {
+ expect(ufs).toBeDefined();
+ });
+
+ it('should define api functions', () => {
+ expect(fs.areFunctions(ufs, [
+ 'rsUrl', 'wsUrl', 'urlBase', 'httpPrefix',
+ 'wsPrefix', 'matchSecure'
+ ])).toBeTruthy();
+ });
+
+ it('should return the correct (http) RS url', () => {
+ setLoc('http', 'foo', '123');
+ expect(ufs.rsUrl('path')).toEqual('http://foo:123/onos/ui/rs/path');
+ });
+
+ it('should return the correct (https) RS url', () => {
+ setLoc('https', 'foo', '123');
+ expect(ufs.rsUrl('path')).toEqual('https://foo:123/onos/ui/rs/path');
+ });
+
+ it('should return the correct (ws) WS url', () => {
+ setLoc('http', 'foo', '123');
+ expect(ufs.wsUrl('path')).toEqual('ws://foo:123/onos/ui/websock/path');
+ });
+
+ it('should return the correct (wss) WS url', () => {
+ setLoc('https', 'foo', '123');
+ expect(ufs.wsUrl('path')).toEqual('wss://foo:123/onos/ui/websock/path');
+ });
+
+ it('should allow us to define an alternate WS port', () => {
+ setLoc('http', 'foo', '123');
+ expect(ufs.wsUrl('xyyzy', '456')).toEqual('ws://foo:456/onos/ui/websock/xyyzy');
+ });
+
+ it('should allow us to define an alternate host', () => {
+ setLoc('http', 'foo', '123');
+ expect(ufs.wsUrl('core', '456', 'bar')).toEqual('ws://bar:456/onos/ui/websock/core');
+ });
+
+ it('should allow us to inject an app context', () => {
+ setLoc('http', 'foo', '123', '/my/app');
+ expect(ufs.wsUrl('path')).toEqual('ws://foo:123/my/app/onos/ui/websock/path');
+ });
+
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.ts
new file mode 100644
index 0000000..a7576c0
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.ts
@@ -0,0 +1,78 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable, Inject } from '@angular/core';
+import { LogService } from '../log.service';
+
+const UICONTEXT = '/onos/ui/';
+const RSSUFFIX = UICONTEXT + 'rs/';
+const WSSUFFIX = UICONTEXT + 'websock/';
+
+/**
+ * ONOS GUI -- Remote -- General Purpose URL Functions
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class UrlFnService {
+ constructor(
+ private log: LogService,
+ @Inject('Window') private w: any
+ ) {
+ this.log.debug('UrlFnService constructed');
+ }
+
+ matchSecure(protocol: string): string {
+ const p: string = this.w.location.protocol;
+ const secure: boolean = (p === 'https' || p === 'wss');
+ return secure ? protocol + 's' : protocol;
+ }
+
+ /* A little bit of funky here. It is possible that ONOS sits
+ * behind a proxy and has an app prefix, e.g.
+ * http://host:port/my/app/onos/ui...
+ * This bit of regex grabs everything after the host:port and
+ * before the UICONTEXT (/onos/ui/) and uses that as an app
+ * prefix by inserting it back into the WS URL.
+ * If no prefix, then no insert.
+ */
+ urlBase(protocol: string, port: string = '', host: string = ''): string {
+ const match = this.w.location.href.match('.*//[^/]+/(.+)' + UICONTEXT);
+ const appPrefix = match ? '/' + match[1] : '';
+
+ return this.matchSecure(protocol) +
+ '://' +
+ (host === '' ? this.w.location.hostname : host) +
+ ':' +
+ (port === '' ? this.w.location.port : port) +
+ appPrefix;
+ }
+
+ httpPrefix(suffix: string): string {
+ return this.urlBase('http') + suffix;
+ }
+
+ wsPrefix(suffix: string, wsport: string, host: string): string {
+ return this.urlBase('ws', wsport, host) + suffix;
+ }
+
+ rsUrl(path: string): string {
+ return this.httpPrefix(RSSUFFIX) + path;
+ }
+
+ wsUrl(path: string, wsport?: string, host?: string): string {
+ return this.wsPrefix(WSSUFFIX, wsport, host) + path;
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.spec.ts
new file mode 100644
index 0000000..7695e13
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.spec.ts
@@ -0,0 +1,278 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { TestBed, inject } from '@angular/core/testing';
+
+import { LogService } from '../log.service';
+import { WebSocketService, WsOptions, Callback, EventType } from './websocket.service';
+import { FnService } from '../util/fn.service';
+import { GlyphService } from '../svg/glyph.service';
+import { ActivatedRoute, Params } from '@angular/router';
+import { UrlFnService } from './urlfn.service';
+import { WSock } from './wsock.service';
+import { of } from 'rxjs';
+
+class MockActivatedRoute extends ActivatedRoute {
+ constructor(params: Params) {
+ super();
+ this.queryParams = of(params);
+ }
+}
+
+class MockGlyphService {}
+
+/**
+ * ONOS GUI -- Remote -- Web Socket Service - Unit Tests
+ */
+describe('WebSocketService', () => {
+ let wss: WebSocketService;
+ let fs: FnService;
+ let ar: MockActivatedRoute;
+ let windowMock: Window;
+ let logServiceSpy: jasmine.SpyObj<LogService>;
+
+ const noop = () => ({});
+ const send = jasmine.createSpy('send')
+ .and.callFake((ev) => ev);
+ const mockWebSocket = {
+ send: send,
+ onmessage: (msgEvent) => ({}),
+ onopen: () => ({}),
+ onclose: () => ({}),
+ };
+
+ beforeEach(() => {
+ const logSpy = jasmine.createSpyObj('LogService', ['info', 'debug', 'warn', 'error']);
+ ar = new MockActivatedRoute({'debug': 'txrx'});
+
+ windowMock = <any>{
+ location: <any> {
+ hostname: 'foo',
+ host: 'foo',
+ port: '80',
+ protocol: 'http',
+ search: { debug: 'true'},
+ href: 'ws://foo:123/onos/ui/websock/path',
+ absUrl: 'ws://foo:123/onos/ui/websock/path'
+ }
+ };
+ fs = new FnService(ar, logSpy, windowMock);
+
+ TestBed.configureTestingModule({
+ providers: [WebSocketService,
+ { provide: FnService, useValue: fs },
+ { provide: LogService, useValue: logSpy },
+ { provide: GlyphService, useClass: MockGlyphService },
+ { provide: UrlFnService, useValue: new UrlFnService(logSpy, windowMock) },
+ { provide: 'Window', useFactory: (() => windowMock ) },
+ { provide: WSock, useFactory: (() => {
+ return {
+ newWebSocket: (() => mockWebSocket)
+ };
+ })
+ }
+ ]
+ });
+
+ wss = TestBed.get(WebSocketService);
+ logServiceSpy = TestBed.get(LogService);
+ });
+
+ it('should define WebSocketService', () => {
+ expect(wss).toBeDefined();
+ });
+
+ it('should define api functions', () => {
+ expect(fs.areFunctions(wss, ['bootstrap', 'error',
+ 'handleOpen', 'handleMessage', 'handleClose',
+ 'findGuiSuccessor', 'informListeners', 'send',
+ 'noHandlersWarn', 'resetState',
+ 'createWebSocket', 'bindHandlers', 'unbindHandlers',
+ 'addOpenListener', 'removeOpenListener', 'sendEvent',
+ 'setVeilDelegate', 'setLoadingDelegate', 'isConnected',
+ 'closeWebSocket', 'isHandling'
+ ])).toBeTruthy();
+ });
+
+ it('should use the appropriate URL, createWebsocket', () => {
+ const url = wss.createWebSocket();
+ expect(url).toEqual('ws://foo:80/onos/ui/websock/core');
+ });
+
+ it('should use the appropriate URL with modified port, createWebsocket',
+ () => {
+ const url = wss.createWebSocket(<WsOptions>{ wsport: 1243 });
+ expect(url).toEqual('ws://foo:1243/onos/ui/websock/core');
+ });
+
+ it('should verify websocket event handlers, createWebsocket', () => {
+ wss.createWebSocket({ wsport: 1234 });
+ expect(fs.isF(mockWebSocket.onopen)).toBeTruthy();
+ expect(fs.isF(mockWebSocket.onmessage)).toBeTruthy();
+ expect(fs.isF(mockWebSocket.onclose)).toBeTruthy();
+ });
+
+ it('should invoke listener callbacks when websocket is up, handleOpen',
+ () => {
+ let num = 0;
+ function incrementNum(host: string, url: string) {
+ expect(host).toEqual('foo');
+ num++;
+ }
+ wss.addOpenListener(incrementNum);
+ wss.createWebSocket({ wsport: 1234 });
+
+ mockWebSocket.onopen();
+ expect(num).toBe(1);
+ });
+
+ it('should send pending events, handleOpen', () => {
+ const fakeEvent = {
+ event: 'mockEv',
+ payload: { mock: 'thing' }
+ };
+ wss.sendEvent(fakeEvent.event, fakeEvent.payload);
+ // on opening the socket, a single authentication event should have
+ // been sent already...
+ expect(mockWebSocket.send.calls.count()).toEqual(1);
+
+ wss.createWebSocket({ wsport: 1234 });
+ mockWebSocket.onopen();
+ expect(mockWebSocket.send).toHaveBeenCalledWith(JSON.stringify(fakeEvent));
+ });
+
+ it('should handle an incoming bad JSON message, handleMessage', () => {
+ const badMsg = {
+ data: 'bad message'
+ };
+ wss.createWebSocket({ wsport: 1234 });
+ expect(mockWebSocket.onmessage(badMsg)).toBeNull();
+ expect(logServiceSpy.error).toHaveBeenCalled();
+ });
+
+ it('should verify message was handled, handleMessage', () => {
+ let num = 0;
+ function fakeHandler(data1: Object) { num++; }
+ const data = JSON.stringify(<EventType>{
+ event: 'mockEvResp',
+ payload: {}
+ });
+ const event = {
+ data: data
+ };
+
+ wss.createWebSocket({ wsport: 1234 });
+ wss.bindHandlers(new Map<string, (data) => void>([
+ ['mockEvResp', (data2) => fakeHandler(data2)]
+ ]));
+ expect(mockWebSocket.onmessage(event)).toBe(undefined);
+ expect(num).toBe(1);
+ });
+
+ it('should warn if there is an unhandled event, handleMessage', () => {
+ const data = { foo: 'bar', bar: 'baz'};
+ const dataString = JSON.stringify(data);
+ const badEv = {
+ data: dataString
+ };
+ wss.createWebSocket({ wsport: 1234 });
+ mockWebSocket.onmessage(badEv);
+ expect(logServiceSpy.warn).toHaveBeenCalledWith('Unhandled event:', data);
+ });
+
+ it('should not warn if valid input, bindHandlers', () => {
+ expect(wss.bindHandlers(new Map<string, (data) => void>([
+ ['test', noop ],
+ ['bar', noop ]
+ ]))).toBe(undefined);
+
+ expect(logServiceSpy.warn).not.toHaveBeenCalled();
+ });
+
+ it('should warn if no arguments, bindHandlers', () => {
+ expect(wss.bindHandlers(
+ new Map<string, (data) => void>([])
+ )).toBeNull();
+ expect(logServiceSpy.warn).toHaveBeenCalledWith(
+ 'WSS.bindHandlers(): no event handlers'
+ );
+ });
+
+ it('should warn if duplicate handlers were given, bindHandlers',
+ () => {
+ wss.bindHandlers(
+ new Map<string, (data) => void>([
+ ['noop', noop ]
+ ])
+ );
+ expect(wss.bindHandlers(
+ new Map<string, (data) => void>([
+ ['noop', noop ]
+ ])
+ )).toBe(undefined);
+ expect(logServiceSpy.warn).toHaveBeenCalledWith('duplicate bindings ignored:',
+ ['noop']);
+ });
+
+ it('should warn if no arguments, unbindHandlers', () => {
+ expect(wss.unbindHandlers([])).toBeNull();
+ expect(logServiceSpy.warn).toHaveBeenCalledWith(
+ 'WSS.unbindHandlers(): no event handlers'
+ );
+ });
+ // Note: cannot test unbindHandlers' forEach due to it using closure variable
+
+ it('should not warn if valid argument, addOpenListener', () => {
+ let o = wss.addOpenListener(noop);
+ expect(o.id === 1);
+ expect(o.cb === noop);
+ expect(logServiceSpy.warn).not.toHaveBeenCalled();
+ o = wss.addOpenListener(noop);
+ expect(o.id === 2);
+ expect(o.cb === noop);
+ expect(logServiceSpy.warn).not.toHaveBeenCalled();
+ });
+
+ it('should log error if callback not a function, addOpenListener',
+ () => {
+ const o = wss.addOpenListener(null);
+ expect(o.id === 1);
+ expect(o.cb === null);
+ expect(o.error === 'No callback defined');
+ expect(logServiceSpy.error).toHaveBeenCalledWith(
+ 'WSS.addOpenListener(): callback not a function'
+ );
+ });
+
+ it('should not warn if valid listener object, removeOpenListener', () => {
+ expect(wss.removeOpenListener(<Callback>{
+ id: 1,
+ error: 'error',
+ cb: noop
+ })).toBe(undefined);
+ expect(logServiceSpy.warn).not.toHaveBeenCalled();
+ });
+
+ it('should warn if listener is invalid, removeOpenListener', () => {
+ expect(wss.removeOpenListener(<Callback>{})).toBeNull();
+ expect(logServiceSpy.warn).toHaveBeenCalledWith(
+ 'WSS.removeOpenListener(): invalid listener', {}
+ );
+ });
+
+ // Note: handleClose is not currently tested due to all work it does relies
+ // on closure variables that cannot be mocked
+
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.ts
new file mode 100644
index 0000000..c4d5227
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.ts
@@ -0,0 +1,465 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable, Inject } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { GlyphService } from '../svg/glyph.service';
+import { LogService } from '../log.service';
+import { UrlFnService } from './urlfn.service';
+import { VeilComponent } from '../layer/veil/veil.component';
+import { WSock } from './wsock.service';
+
+/**
+ * Event Type structure for the WebSocketService
+ */
+export interface EventType {
+ event: string;
+ payload: Object;
+}
+
+export interface Callback {
+ id: number;
+ error: string;
+ cb(host: string, url: string): void;
+}
+
+interface ClusterNode {
+ id: string;
+ ip: string;
+ m_uiAttached: boolean;
+}
+
+interface Bootstrap {
+ user: string;
+ clusterNodes: ClusterNode[];
+ glyphs: any[]; // TODO: narrow this down to a known type
+}
+
+interface ErrorData {
+ message: string;
+}
+
+export interface WsOptions {
+ wsport: number;
+}
+
+/**
+ * ONOS GUI -- Remote -- Web Socket Service
+ *
+ * To see debug messages add ?debug=txrx to the URL
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class WebSocketService {
+ // internal state
+ private webSockOpts: WsOptions; // web socket options
+ private ws: WebSocket = null; // web socket reference
+ private wsUp: boolean = false; // web socket is good to go
+
+ // A map of event handler bindings - names and functions (that accept data and return void)
+ private handlers = new Map<string, (data: any) => void>([]);
+ private pendingEvents: EventType[] = []; // events TX'd while socket not up
+ private host: string; // web socket host
+ private url; // web socket URL
+ private clusterNodes: ClusterNode[] = []; // ONOS instances data for failover
+ private clusterIndex = -1; // the instance to which we are connected
+ private glyphs = [];
+ private connectRetries: number = 0; // limit our attempts at reconnecting
+
+ // A map of registered Callbacks for websocket open()
+ private openListeners = new Map<number, Callback>([]);
+ private nextListenerId: number = 1; // internal ID for open listeners
+ private loggedInUser = null; // name of logged-in user
+ private lcd: any; // The loading component delegate
+ private vcd: any; // The veil component delegate
+
+ /**
+ * built-in handler for the 'boostrap' event
+ */
+ private bootstrap(data: Bootstrap) {
+ this.loggedInUser = data.user;
+
+ this.clusterNodes = data.clusterNodes;
+ this.clusterNodes.forEach((d, i) => {
+ if (d.m_uiAttached) {
+ this.clusterIndex = i;
+ this.log.info('Connected to cluster node ' + d.ip);
+ // TODO: add connect info to masthead somewhere
+ }
+ });
+ this.glyphs = data.glyphs;
+ const glyphsMap = new Map<string, string>([]);
+ this.glyphs.forEach((d, i) => {
+ glyphsMap.set('_' + d.id, d.viewbox);
+ glyphsMap.set(d.id, d.path);
+ this.gs.registerGlyphs(glyphsMap);
+ });
+ }
+
+ private error(data: ErrorData) {
+ const m: string = data.message || 'error from server';
+ this.log.error(m, data);
+
+ // Unrecoverable error - throw up the veil...
+ if (this.vcd) {
+ this.vcd.show([
+ 'Oops!',
+ 'Server reports error...',
+ m,
+ ]);
+ }
+ }
+
+ constructor(
+ private fs: FnService,
+ private gs: GlyphService,
+ private log: LogService,
+ private ufs: UrlFnService,
+ private wsock: WSock,
+ @Inject('Window') private window: any
+ ) {
+ this.log.debug(window.location.hostname);
+
+ // Bind the boot strap event by default
+ this.bindHandlers(new Map<string, (data) => void>([
+ ['bootstrap', (data) => this.bootstrap(data)],
+ ['error', (data) => this.error(data)]
+ ]));
+
+ this.log.debug('WebSocketService constructed');
+ }
+
+
+ // ==========================
+ // === Web socket callbacks
+
+ /**
+ * Called when WebSocket has just opened
+ *
+ * Lift the Veil if it is displayed
+ * If there are any events pending, send them
+ * Mark the WSS as up and inform any listeners for this open event
+ */
+ handleOpen(): void {
+ this.log.info('Web socket open - ', this.url);
+ // Hide the veil
+ if (this.vcd) {
+ this.vcd.hide();
+ }
+
+ if (this.fs.debugOn('txrx')) {
+ this.log.debug('Sending ' + this.pendingEvents.length + ' pending event(s)...');
+ }
+ this.pendingEvents.forEach((ev) => {
+ this.send(ev);
+ });
+ this.pendingEvents = [];
+
+ this.connectRetries = 0;
+ this.wsUp = true;
+ this.informListeners(this.host, this.url);
+ }
+
+ /**
+ * Function called when WebSocket send a message
+ */
+ handleMessage(msgEvent: MessageEvent): void {
+ let ev: EventType;
+ let h;
+ try {
+ ev = JSON.parse(msgEvent.data);
+ } catch (e) {
+ this.log.error('Message.data is not valid JSON', msgEvent.data, e);
+ return null;
+ }
+ if (this.fs.debugOn('txrx')) {
+ this.log.debug(' << *Rx* ', ev.event, ev.payload);
+ }
+ h = this.handlers.get(ev.event);
+ if (h) {
+ try {
+ h(ev.payload);
+ } catch (e) {
+ this.log.error('Problem handling event:', ev, e);
+ return null;
+ }
+ } else {
+ this.log.warn('Unhandled event:', ev);
+ }
+ }
+
+ /**
+ * Called by the WebSocket if it is closed from the server end
+ *
+ * If the loading component is shown, call stop() on it
+ * Try to find another node in the cluster to connect to
+ * If this is not possible then show the Veil Component
+ */
+ handleClose(): void {
+ this.log.warn('Web socket closed');
+ if (this.lcd) {
+ this.lcd.stop();
+ }
+ this.wsUp = false;
+ let gsucc;
+
+ if (gsucc = this.findGuiSuccessor()) {
+ this.url = this.createWebSocket(this.webSockOpts, gsucc);
+ } else {
+ // If no controllers left to contact, show the Veil...
+ if (this.vcd) {
+ this.vcd.show([
+ 'Oops!', // TODO: Localize this
+ 'Web-socket connection to server closed...',
+ 'Try refreshing the page.',
+ ]);
+ }
+ }
+ }
+
+ // ==============================
+ // === Private Helper Functions
+
+ /**
+ * Find the next node in the ONOS cluster.
+ *
+ * This is used if the WebSocket connection closes because a
+ * node in the cluster ges down - fail over should be automatic
+ */
+ findGuiSuccessor(): string {
+ const ncn = this.clusterNodes.length;
+ let ip: string;
+ let node;
+
+ while (this.connectRetries < ncn && !ip) {
+ this.connectRetries++;
+ this.clusterIndex = (this.clusterIndex + 1) % ncn;
+ node = this.clusterNodes[this.clusterIndex];
+ ip = node && node.ip;
+ }
+
+ return ip;
+ }
+
+ /**
+ * When the WebSocket is opened, inform any listeners that registered
+ * for that event
+ */
+ informListeners(host: string, url: string): void {
+ for (const [key, cb] of this.openListeners.entries()) {
+ cb.cb(host, url);
+ }
+ }
+
+ send(ev: EventType): void {
+ if (this.fs.debugOn('txrx')) {
+ this.log.debug(' *Tx* >> ', ev.event, ev.payload);
+ }
+ this.ws.send(JSON.stringify(ev));
+ }
+
+ /**
+ * Check if there are no WSS event handlers left
+ */
+ noHandlersWarn(handlers: Map<string, Object>, caller: string): boolean {
+ if (!handlers || handlers.size === 0) {
+ this.log.warn('WSS.' + caller + '(): no event handlers');
+ return true;
+ }
+ return false;
+ }
+
+ /* ===================
+ * === API Functions
+ */
+
+ /**
+ * Required for unit tests to set to known state
+ */
+ resetState(): void {
+ this.webSockOpts = undefined;
+ this.ws = null;
+ this.wsUp = false;
+ this.host = undefined;
+ this.url = undefined;
+ this.pendingEvents = [];
+ this.handlers.clear();
+ this.clusterNodes = [];
+ this.clusterIndex = -1;
+ this.glyphs = [];
+ this.connectRetries = 0;
+ this.openListeners.clear();
+ this.nextListenerId = 1;
+
+ }
+
+ /*
+ * Currently supported opts:
+ * wsport: web socket port (other than default 8181)
+ * host: if defined, is the host address to use
+ */
+ createWebSocket(opts?: WsOptions, host?: string) {
+ this.webSockOpts = opts; // preserved for future calls
+ this.host = host === undefined ? this.window.location.host : host;
+ this.url = this.ufs.wsUrl('core', opts === undefined ? '' : opts['wsport'].toString(), host);
+
+ this.log.debug('Attempting to open websocket to: ' + this.url);
+ this.ws = this.wsock.newWebSocket(this.url);
+ if (this.ws) {
+ // fat arrow => syntax means that the 'this' context passed will
+ // be of WebSocketService, not the WebSocket
+ this.ws.onopen = (() => this.handleOpen());
+ this.ws.onmessage = ((msgEvent) => this.handleMessage(msgEvent));
+ this.ws.onclose = (() => this.handleClose());
+ const authToken = this.window['onosAuth'];
+ this.log.debug('Auth Token for opening WebSocket', authToken);
+ this.sendEvent('authentication', { token: authToken });
+ }
+ // Note: Wsock logs an error if the new WebSocket call fails
+ return this.url;
+ }
+
+ /**
+ * Tell the WebSocket to close - this should call the handleClose() method
+ */
+ closeWebSocket() {
+ this.ws.close();
+ }
+
+
+ /**
+ * Binds the message handlers to their message type (event type) as
+ * specified in the given map. Note that keys are the event IDs; values
+ * are either:
+ * * the event handler function, or
+ * * an API object which has an event handler for the key
+ */
+ bindHandlers(handlerMap: Map<string, (data) => void>): void {
+ const dups: string[] = [];
+
+ if (this.noHandlersWarn(handlerMap, 'bindHandlers')) {
+ return null;
+ }
+ for (const [eventId, api] of handlerMap) {
+ this.log.debug('Adding handler for ', eventId);
+ const fn = this.fs.isF(api) || this.fs.isF(api[eventId]);
+ if (!fn) {
+ this.log.warn(eventId + ' handler not a function');
+ return;
+ }
+
+ if (this.handlers.get(eventId)) {
+ dups.push(eventId);
+ } else {
+ this.handlers.set(eventId, fn);
+ }
+ }
+ if (dups.length) {
+ this.log.warn('duplicate bindings ignored:', dups);
+ }
+ }
+
+ /**
+ * Unbinds the specified message handlers.
+ * Expected that the same map will be used, but we only care about keys
+ */
+ unbindHandlers(handlerIds: string[]): void {
+ if ( handlerIds.length === 0 ) {
+ this.log.warn('WSS.unbindHandlers(): no event handlers');
+ return null;
+ }
+ for (const eventId of handlerIds) {
+ this.handlers.delete(eventId);
+ }
+ }
+
+ isHandling(handlerId: string): boolean {
+ return this.handlers.get(handlerId) !== undefined;
+ }
+
+ /**
+ * Add a listener function for listening for WebSocket opening.
+ * The function must give a host and url and return void
+ */
+ addOpenListener(callback: (host: string, url: string) => void ): Callback {
+ const id: number = this.nextListenerId++;
+ const cb = this.fs.isF(callback);
+ const o: Callback = <Callback>{ id: id, cb: cb };
+
+ if (cb) {
+ this.openListeners.set(id, o);
+ } else {
+ this.log.error('WSS.addOpenListener(): callback not a function');
+ o.error = 'No callback defined';
+ }
+ return o;
+ }
+
+ /**
+ * Remove a listener of WebSocket opening
+ */
+ removeOpenListener(lsnr: Callback): void {
+ const id = this.fs.isO(lsnr) && lsnr.id;
+ let o;
+
+ if (!id) {
+ this.log.warn('WSS.removeOpenListener(): invalid listener', lsnr);
+ return null;
+ }
+ o = this.openListeners[id];
+
+ if (o) {
+ this.openListeners.delete(id);
+ }
+ }
+
+ /**
+ * Formulates an event message and sends it via the web-socket.
+ * If the websocket is not up yet, we store it in a pending list.
+ */
+ sendEvent(evType: string, payload: Object ): void {
+ const ev = <EventType> {
+ event: evType,
+ payload: payload
+ };
+
+ if (this.wsUp) {
+ this.send(ev);
+ } else {
+ this.pendingEvents.push(ev);
+ }
+ }
+
+ /**
+ * Binds the veil service as a delegate.
+ */
+ setVeilDelegate(vd: VeilComponent): void {
+ this.vcd = vd;
+ }
+
+ /**
+ * Binds the loading service as a delegate
+ */
+ setLoadingDelegate(ld: any): void {
+ // TODO - Investigate changing Loading Service to LoadingComponent
+ this.log.debug('Loading delegate set', ld);
+ this.lcd = ld;
+ }
+
+ isConnected(): boolean {
+ return this.wsUp;
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/wsock.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/wsock.service.ts
new file mode 100644
index 0000000..40e0b2a
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/wsock.service.ts
@@ -0,0 +1,46 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { LogService } from '../log.service';
+
+/**
+ * ONOS GUI -- Remote -- Web Socket Wrapper Service
+ *
+ * This service provided specifically so that it can be mocked in unit tests.
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class WSock {
+
+ constructor(
+ private log: LogService,
+ ) {
+ this.log.debug('WSockService constructed');
+ }
+
+
+ newWebSocket(url) {
+ let ws = null;
+ try {
+ ws = new WebSocket(url);
+ } catch (e) {
+ this.log.error('Unable to create web socket:', e);
+ }
+ return ws;
+ }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyph.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyph.service.ts
new file mode 100644
index 0000000..56d62ab
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyph.service.ts
@@ -0,0 +1,208 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+import * as gds from './glyphdata.service';
+import * as d3 from 'd3';
+import { SvgUtilService } from './svgutil.service';
+
+// constants
+const msgGS = 'GlyphService.';
+const rg = 'registerGlyphs(): ';
+const rgs = 'registerGlyphSet(): ';
+
+/**
+ * ONOS GUI -- SVG -- Glyph Service
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class GlyphService {
+ // internal state
+ glyphs = d3.map();
+ api: Object;
+
+ constructor(
+ private fs: FnService,
+ // private gd: GlyphDataService,
+ private log: LogService,
+ private sus: SvgUtilService
+ ) {
+ this.clear();
+ this.init();
+ this.api = {
+ registerGlyphs: this.registerGlyphs,
+ registerGlyphSet: this.registerGlyphSet,
+ ids: this.ids,
+ glyph: this.glyph,
+ glyphDefined: this.glyphDefined,
+ loadDefs: this.loadDefs,
+ addGlyph: this.addGlyph,
+ };
+ this.log.debug('GlyphService constructed');
+ }
+
+ warn(msg: string): void {
+ this.log.warn(msgGS + msg);
+ }
+
+ addToMap(key, value, vbox, overwrite: boolean, dups) {
+ if (!overwrite && this.glyphs.get(key)) {
+ dups.push(key);
+ } else {
+ this.glyphs.set(key, { id: key, vb: vbox, d: value });
+ }
+ }
+
+ reportDups(dups: string[], which: string): boolean {
+ const ok: boolean = (dups.length === 0);
+ const msg = 'ID collision: ';
+
+ if (!ok) {
+ dups.forEach((id) => {
+ this.warn(which + msg + '"' + id + '"');
+ });
+ }
+ return ok;
+ }
+
+ reportMissVb(missing: string[], which: string): boolean {
+ const ok: boolean = (missing.length === 0);
+ const msg = 'Missing viewbox property: ';
+
+ if (!ok) {
+ missing.forEach((vbk) => {
+ this.warn(which + msg + '"' + vbk + '"');
+ });
+ }
+ return ok;
+ }
+
+ clear() {
+ // start with a fresh map
+ this.glyphs = d3.map();
+ }
+
+ init() {
+ this.log.info('Registering glyphs');
+ this.registerGlyphs(gds.logos);
+ this.registerGlyphSet(gds.glyphDataSet);
+ this.registerGlyphSet(gds.badgeDataSet);
+ this.registerGlyphs(gds.spriteData);
+ this.registerGlyphSet(gds.mojoDataSet);
+ this.registerGlyphs(gds.extraGlyphs);
+ }
+
+ registerGlyphs(data: Map<string, string>, overwrite: boolean = false): boolean {
+ const dups: string[] = [];
+ const missvb: string[] = [];
+ for (const [key, value] of data.entries()) {
+ const vbk = '_' + key;
+ const vb = data.get(vbk);
+
+ if (key[0] !== '_') {
+ if (!vb) {
+ missvb.push(vbk);
+ continue;
+ }
+ this.addToMap(key, value, vb, overwrite, dups);
+ }
+ }
+ return this.reportDups(dups, rg) && this.reportMissVb(missvb, rg);
+ }
+
+ registerGlyphSet(data: Map<string, string>, overwrite: boolean = false): boolean {
+ const dups: string[] = [];
+ const vb: string = data.get('_viewbox');
+
+ if (!vb) {
+ this.warn(rgs + 'no "_viewbox" property found');
+ return false;
+ }
+
+ for (const [key, value] of data.entries()) {
+ // angular.forEach(data, function (value, key) {
+ if (key[0] !== '_') {
+ this.addToMap(key, value, vb, overwrite, dups);
+ }
+ }
+ return this.reportDups(dups, rgs);
+ }
+
+ ids() {
+ return this.glyphs.keys();
+ }
+
+ glyph(id) {
+ return this.glyphs.get(id);
+ }
+
+ glyphDefined(id) {
+ return this.glyphs.has(id);
+ }
+
+
+ /**
+ * Load definitions of a glyph
+ *
+ * Note: defs should be a D3 selection of a single <defs> element
+ */
+ loadDefs(defs, glyphIds: string[], noClear: boolean) {
+ const list = this.fs.isA(glyphIds) || this.ids();
+
+ if (!noClear) {
+ // remove all existing content
+ defs.html(null);
+ }
+
+ // load up the requested glyphs
+ list.forEach((id) => {
+ const g = this.glyph(id);
+ if (g) {
+ if (noClear) {
+ // quick exit if symbol is already present
+ // TODO: check if this should be a continue or break instead
+ if (defs.select('symbol#' + g.id).size() > 0) {
+ return;
+ }
+ }
+ defs.append('symbol')
+ .attr('id', g.id)
+ .attr('viewBox', g.vb)
+ .append('path')
+ .attr('d', g.d);
+ }
+ });
+ }
+
+ addGlyph(elem: any, glyphId: string, size: number, overlay: any, trans: any) {
+ const sz = size || 40,
+ ovr = !!overlay,
+ xns = this.fs.isA(trans),
+ atr = {
+ width: sz,
+ height: sz,
+ 'class': 'glyph',
+ 'xlink:href': '#' + glyphId,
+ };
+
+ if (xns) {
+ atr.class = this.sus.translate(trans);
+ }
+ return elem.append('use').attr(atr).classed('overlay', ovr);
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyphdata.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyphdata.service.ts
new file mode 100644
index 0000000..2ff3e85
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyphdata.service.ts
@@ -0,0 +1,1326 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { LogService } from '../log.service';
+
+
+// --- ONOS logo glyph ------------------------------------
+
+export const logos = new Map<string, string>([
+ [ '_bird', '352 224 113 112'],
+ [ 'bird', 'M427.7,300.4 c-6.9,0.6-13.1,5-19.2,7.1c-18.1,6.2-33.9,' +
+ '9.1-56.5,4.7c24.6,17.2,36.6,13,63.7,0.1c-0.5,0.6-0.7,1.3-1.3,' +
+ '1.9c1.4-0.4,2.4-1.7,3.4-2.2c-0.4,0.7-0.9,1.5-1.4,1.9c2.2-0.6,' +
+ '3.7-2.3,5.9-3.9c-2.4,2.1-4.2,5-6,8c-1.5,2.5-3.1,4.8-5.1,6.9c-1,' +
+ '1-1.9,1.9-2.9,2.9c-1.4,1.3-2.9,2.5-5.1,2.9c1.7,0.1,3.6-0.3,6.5' +
+ '-1.9c-1.6,2.4-7.1,6.2-9.9,7.2c10.5-2.6,19.2-15.9,25.7-18c18.3' +
+ '-5.9,13.8-3.4,27-14.2c1.6-1.3,3-1,5.1-0.8c1.1,0.1,2.1,0.3,3.2,' +
+ '0.5c0.8,0.2,1.4,0.4,2.2,0.8l1.8,0.9c-1.9-4.5-2.3-4.1-5.9-6c-2.3' +
+ '-1.3-3.3-3.8-6.2-4.9c-7.1-2.6-11.9,11.7-11.7-5c0.1-8,4.2-14.4,' +
+ '6.4-22c1.1-3.8,2.3-7.6,2.4-11.5c0.1-2.3,0-4.7-0.4-7c-2-11.2-8.4' +
+ '-21.5-19.7-24.8c-1-0.3-1.1-0.3-0.9,0c9.6,17.1,7.2,38.3,3.1,54.2' +
+ 'C429.9,285.5,426.7,293.2,427.7,300.4z'],
+ [ '_cord', '0 0 110 110'],
+ [ 'cord', 'M92.5,62.3l-33,33,2.5,2.5c4.1,4.1,7.4,3.6,11.2-.1L95.9,75' +
+ 'l-4.5-4.5,4.7-4.7-3.6-3.6Z' +
+ 'm2.6,7L98.4,66l3.3,3.3-3.3,3.3-3.3-3.3Z' +
+ 'M94.5,60l4.9-4.9,4.9,4.9-4.9,4.9Z' +
+ 'M36.2,36.1L18.6,53.8c-7.8,7.8-5.8,17.4-2.4,22l-2.2-2.2' +
+ 'c-10.6-10.6-11.2-20,0-31.2L28.2,28.1L31.3,25l8,8-3.1,3.1Z' +
+ 'M55.5,55.4l3.6-3.6L66.9,44l-8-8l-2.5,2.5-5.2,5.2l-3.6,3.6' +
+ 'L33.2,61.6C22,72.7,22.5,82.2,33.2,92.8L35.4,95' +
+ 'c-3.4-4.5-5.4-14.1,2.4-22L55.5,55.4Z' +
+ 'M50.7,21.7l-8-8L35,21.2l8,8,7.6-7.6Z' +
+ 'M62.8,9.6L55.4,17l-8-8,7.4-7.4,8,8Z' +
+ 'm0.7,18.3-7.6,7.6-8-8,7.6-7.6,8,8Z' +
+ 'm26.1-6.6-8.1,8.1-8-8,8.1-8.1,8,8Z' +
+ 'M79.3,31.5l-7.4,7.4-8-8,7.4-7.4,8,8Z' +
+ 'M45.7,45.6L54.3,37l-8-8-8.6,8.6L23.4,51.8' +
+ 'C12.2,63,12.8,72.4,23.4,83l2.2,2.2c-3.4-4.5-5.4-14.1,2.4-22Z' +
+ 'M34.9,80.7l20.6,20.5c2,2,4.6,4.1,7.9,3.2-2.9,2.9-8.9,1.7-11.9-1.3' +
+ 'L35.1,86.8,35,86.6H34.9l-0.8-.8' +
+ 'a15,15,0,0,1,.1-1.9,14.7,14.7,0,0,1,.7-3.2Z' +
+ 'm-0.6,7.4a21.3,21.3,0,0,0,5.9,11.7l5.7,5.7' +
+ 'c3,3,9,4.1,11.9,1.3-3.3.9-5.9-1.2-7.9-3.2L34.3,88.1Z' +
+ 'm3.5-12.4a16.6,16.6,0,0,0-2.3,3.6L57,100.8' +
+ 'c3,3,9,4.1,11.9,1.3-3.3.9-5.9-1.2-7.9-3.2Z'],
+]);
+
+
+// --- Core glyphs ------------------------------------
+
+// NOTE: when adding glyphs, please also update GlyphConstants class.
+const tableFrame = 'M6.3,5.3h8.5v14.2h-8.5z' +
+ 'M95.3,5.3h8.5v14.2h-8.5z' +
+ 'M18.5,5.3h15.6v14.2h-15.6z' +
+ 'M37.9,5.3h15.6v14.2h-15.6z' +
+ 'M57,5.3h15.6v14.2h-15.6z' +
+ 'M76.1,5.3h15.6v14.2h-15.6z' +
+ 'M6.3,23.9h97.5v80.75h-97.5z';
+
+const rSquare = 'M10,20a10,10,0,0,1,10-10h70a10,10,0,0,1,10,10v70a10,10,' +
+ '0,0,1-10,10h-70a10,10,0,0,1-10-10z';
+
+const octagon = 'M10,35l25-25h40l25,25v40l-25,25h-40l-25-25z';
+
+const circle = 'M10,55A45,45,0,0,1,100,55A45,45,0,0,1,10,55';
+
+const arrowsLR = 'M58,26l12,0,0-8,18,13-18,13,0-8-12,0z' +
+ 'M58,60l12,0,0-8,18,13-18,13,0-8-12,0z' +
+ 'M52,40l-12,0,0-8-18,13,18,13,0-8,12,0z' +
+ 'M52,74l-12,0,0-8-18,13,18,13,0-8,12,0z';
+
+const arrowsInHOutV = 'M20,50l12,0,0-8,18,13-18,13,0-8-12,0z' +
+ 'M90,50l-12,0,0-8-18,13,18,13,0-8,12,0z' +
+ 'M50,47l0-12-8,0,13-18,13,18-8,0,0,12z' +
+ 'M50,63l0,12-8,0,13,18,13-18-8,0,0-12z';
+
+const laser = 'M47.2,68.4L31.1,84.5,25.6,79,41.7,62.9Z' +
+ 'M76.3,30.6A3.4,3.4,0,0,0,72.9,34a3.3,3.3,0,0,0,.3,1.3L44.7,63.7' +
+ 'l1.7,1.7L74.8,37a3.2,3.2,0,0,0,1.5.4A3.4,3.4,0,1,0,76.3,30.6Z' +
+ 'm0.9-2.9V23.8a0.8,0.8,0,0,0-.8-0.8H76.1a0.8,0.8,0,0,0-.8.8v3.9' +
+ 'a0.8,0.8,0,0,0,.8.8h0.3A0.8,0.8,0,0,0,77.2,27.7Z' +
+ 'm3.5,3.2,3.6-3.6a0.9,0.9,0,0,0,0-1.2H84.3a0.9,0.9,0,0,0-1.2,0' +
+ 'l-3.6,3.6a0.9,0.9,0,0,0,0,1.2h0.1A0.9,0.9,0,0,0,80.7,30.9Z' +
+ 'm1.8,4h3.9a0.8,0.8,0,0,0,.8-0.8V33.7a0.8,0.8,0,0,0-.8-0.8H82.6' +
+ 'a0.8,0.8,0,0,0-.8.8V34A0.8,0.8,0,0,0,82.6,34.8Z' +
+ 'm-16.3.1h3.9a0.8,0.8,0,0,0,.8-0.8V33.8a0.8,0.8,0,0,0-.8-0.8' +
+ 'H66.2a0.8,0.8,0,0,0-.8.8v0.3A0.8,0.8,0,0,0,66.2,34.9Z' +
+ 'm6.8-5.2-3.8-3.8a0.9,0.9,0,0,0-1.3,0a0.9,0.9,0,0,0,0,1.3' +
+ 'L71.8,31A0.9,0.9,0,0,0,73,31A0.9,0.9,0,0,0,73.1,29.7Z' +
+ 'M84.8,40.9L80.9,37a0.9,0.9,0,0,0-1.3,0a0.9,0.9,0,0,0,0,1.3' +
+ 'l3.9,3.9a0.9,0.9,0,0,0,1.3,0A0.9,0.9,0,0,0,84.8,40.9Z' +
+ 'm-7.6,3.2V40.2a0.8,0.8,0,0,0-.8-0.8H76.2a0.8,0.8,0,0,0-.8.8' +
+ 'v3.9a0.8,0.8,0,0,0,.8.8h0.3A0.8,0.8,0,0,0,77.3,44.1Z';
+
+const fiberStar = 'M89,60V57H70.6a15,15,0,0,1-3.2,7.6l13,12.9L82.8,75v7.5' +
+ 'H75.2l2.2-2.2-12.8-13A14.9,14.9,0,0,1,57,70.6V89h3.1l-5.3,5.4' +
+ 'L49.4,89H53V70.6a13.2,13.2,0,0,1-8-3.2l-13.1,13,2.3,2.3H26.5' +
+ 'V75.1l2.3,2.3,13-12.8A15,15,0,0,1,38.7,57H21v3l-5.4-5.4L21,49.3' +
+ 'V53H38.7a13.1,13.1,0,0,1,3.2-8l-13-13.1-2.2,2.1V26.4h7.5l-2.4,2.4' +
+ 'L45,41.8a13.2,13.2,0,0,1,8-3.2V21H49.4l5.4-5.4L60.1,21H57V38.6' +
+ 'a14.9,14.9,0,0,1,7.6,3.2l12.9-13-2.4-2.3h7.5v7.6l-2.3-2.3L67.4,45' +
+ 'a13.1,13.1,0,0,1,3.2,8H89V49.3l5.4,5.3Z';
+
+export const glyphDataSet = new Map<string, string>([
+ ['_viewbox', '0 0 110 110'],
+
+ ['uiAttached', 'M91.9,16.7H18.1A5.3,5.3,0,0,0,12.8,22V68' +
+ 'a5.3,5.3,0,0,0,5.3,5.3H91.9A5.3,5.3,0,0,0,97.2,68V22' +
+ 'A5.3,5.3,0,0,0,91.9,16.7ZM91.6,65.2H18.4V22.3H91.6V65.2Z' +
+ 'M71.5,87.5h3.8v5.9h-40.6v-5.9h3.8v-1.7h5.4v-9.7h22.3v9.7h5.3v1.7z'],
+
+ // Small dot
+ ['unknown', 'M35,40a5,5,0,0,1,5-5h30a5,5,0,0,1,5,5v30a5,5,0,0,1-5,5' +
+ 'h-30a5,5,0,0,1-5-5z'],
+
+ // Question mark for unknown device types
+ ['query', 'M51.4,69.9c0-0.9,0-1.6,0-2.1c0-2.7,0.4-5.1,1.2-7.1' +
+ 'c0.6-1.5,1.5-3,2.8-4.5c0.9-1.1,2.6-2.7,5.1-4.8c2.4-2.1,4-3.8,' +
+ '4.8-5.1 c0.7-1.3,1.1-2.6,1.1-4.1c0-2.7-1.1-5.1-3.2-7.1c-2.1-2' +
+ '-4.8-3.1-7.9-3.1c-3,0-5.5,0.9-7.5,2.8c-2,1.9-3.3,4.8-4,8.7l-7.2' +
+ '-0.8 c0.7-5.3,2.6-9.3,5.8-12.1c3.2-2.8,7.5-4.2,12.8-4.2c5.6,0,' +
+ '10.1,1.5,13.4,4.5c3.3,3,5,6.7,5,10.9c0,2.5-0.6,4.8-1.8,6.8 ' +
+ 's-3.5,4.6-6.9,7.6c-2.3,2-3.8,3.5-4.5,4.4c-0.7,1-1.2,2-1.6,3.3' +
+ 'c-0.3,1.2-0.5,3.2-0.6,6H51.4z M51,83.8v-7.9h8v7.9H51z'],
+
+
+ // --- ONOS cluster node ---
+ ['node', 'M15,100a5,5,0,0,1-5-5v-65a5,5,0,0,1,5-5h80a5,5,0,0,1,5,5' +
+ 'v65a5,5,0,0,1-5,5zM14,22.5l11-11a10,3,0,0,1,10-2h40a10,3,0,0,1,' +
+ '10,2l11,11zM16,35a5,5,0,0,1,10,0a5,5,0,0,1-10,0z'],
+
+
+ // --- DEVICES ---
+ // See Device.DeviceType enum for the following...
+
+ // NOTE: 'other' should map to 'unknown' (.) above
+
+ // deprecated glyphs -- using Mojo Designs below -- m_*
+ ['switch', rSquare + arrowsLR],
+
+ ['router', circle + arrowsInHOutV],
+
+ ['roadm', octagon + arrowsLR],
+
+ ['otn', rSquare + laser],
+
+ ['roadm_otn', octagon + laser],
+
+ ['fiber_switch', rSquare + fiberStar],
+
+ ['microwave', 'M85,71.2c-8.9,10.5-29.6,8.7-45.3-3.5C23.9,55.4,19.8,' +
+ '37,28.6,26.5C29.9,38.6,71.5,69.9,85,71.2z M92.7,76.2M16.2,15 ' +
+ 'M69.5,100.7v-4c0-1.4-1.2-2.2-2.6-2.2H19.3c-1.4,0-2.8,0.7-2.8,2.2' +
+ 'v3.9c0,0.7,0.8,1,1.5,1h50.3C69,101.5,69.5,101.3,69.5,100.7z ' +
+ 'M77.3,7.5l0,3.7c9,0.1,16.3,7.1,16.2,15.7l3.9,0C97.5,16.3,88.5,' +
+ '7.6,77.3,7.5z M77.6,14.7l0,2.5c5.3,0,9.7,4.2,9.6,9.3l2.6,0C89.9' +
+ ',20,84.4,14.7,77.6,14.7z M82.3,22.2c-1.3-1.2-2.9-1.9-4.7-1.9' +
+ 'l0,1.2c1.4,0,2.8,0.6,3.8,1.5c1,1,1.6,2.3,1.6,3.7l1.3,0C84.3,25.1,' +
+ '83.6,23.4,82.3,22.2z M38.9,69.5l-5.1,23h16.5l-2.5-17.2C44.1,73.3,' +
+ '38.9,69.5,38.9,69.5zM58.1,54.1c13.7,10.1,26.5,16.8,29.2,13.7' +
+ 'c2.7-3.1-5.6-13-19.3-24.4 M62.9,34.2 M62,37.9C47.7,27.3,33.7,20,' +
+ '31,23.1c-2.7,3.2,7,14.2,20.6,26 M73.9,25.7c-2.9,0.1-5.2,2.3-5.1,' +
+ '4.8c0,0.7,0.2,1.4,0.6,2l0,0L53.8,49.7l3.3,2.5L72.7,35l-0.4-0.3' +
+ 'c0.6,0.2,1.3,0.3,1.9,0.3c2.9-0.1,5.2-2.3,5.1-4.9C79.3,27.6,76.8,' +
+ '25.6,73.9,25.7z'],
+
+ // NOTE: 'unrecognized' should map to 'query' (?) above
+
+
+ // --- HOSTS ---
+
+ // default glyph for a host
+ ['endstation', 'M10,15a5,5,0,0,1,5-5h65a5,5,0,0,1,5,5v80a5,5,0,0,1' +
+ '-5,5h-65a5,5,0,0,1-5-5zM87.5,14l11,11a3,10,0,0,1,2,10v40a3,10,' +
+ '0,0,1,-2,10l-11,11zM17,19a2,2,0,0,1,2-2h56a2,2,0,0,1,2,2v26a2,' +
+ '2,0,0,1-2,2h-56a2,2,0,0,1-2-2zM20,20h54v10h-54zM20,33h54v10h' +
+ '-54zM42,70a5,5,0,0,1,10,0a5,5,0,0,1-10,0z'],
+
+ ['bgpSpeaker', 'M10,40a45,35,0,0,1,90,0Q100,77,55,100Q10,77,10,40z' +
+ 'M50,29l12,0,0-8,18,13-18,13,0-8-12,0zM60,57l-12,0,0-8-18,13,' +
+ '18,13,0-8,12,0z'],
+
+
+ // --- Miscellaneous glyphs ---------------------------------
+
+ ['chain', 'M60.4,77.6c-4.9,5.2-9.6,11.3-15.3,16.3c-8.6,7.5-20.4,6.8' +
+ '-28-0.8c-7.7-7.7-8.4-19.6-0.8-28.4c6.5-7.4,13.5-14.4,20.9-20.9' +
+ 'c7.5-6.7,19.2-6.7,26.5-0.8c3.5,2.8,4.4,6.1,2.2,8.7c-2.7,3.1' +
+ '-5.5,2.5-8.5,0.3c-4.7-3.4-9.7-3.2-14,0.9C37.1,58.7,31,64.8,' +
+ '25.2,71c-4.2,4.4-4.2,10.6-0.6,14.3c3.7,3.7,9.7,3.7,14.3-0.4' +
+ 'c2.9-2.5,5.3-5.5,8.3-8c1-0.9,3-1.1,4.4-0.9C54.8,76.3,57.9,77.1,' +
+ '60.4,77.6zM49.2,32.2c5-5.2,9.7-10.9,15.2-15.7c12.8-11,31.2' +
+ '-4.9,34.3,11.2C100,34.2,98.3,40.2,94,45c-6.7,7.4-13.7,14.6' +
+ '-21.2,21.2C65.1,73,53.2,72.7,46,66.5c-3.2-2.8-3.9-5.8-1.6-8.4' +
+ 'c2.6-2.9,5.3-2.4,8.2-0.3c5.2,3.7,10,3.3,14.7-1.1c5.8-5.6,11.6' +
+ '-11.3,17.2-17.2c4.6-4.8,4.9-11.1,0.9-15c-3.9-3.9-10.1-3.4-15,' +
+ '1.2c-3.1,2.9-5.7,7.4-9.3,8.5C57.6,35.3,53,33,49.2,32.2z'],
+
+ ['crown', 'M99.5,21.6c0,3-2.3,5.4-5.1,5.4c-0.3,0-0.7,0-1-0.1c-1.8,' +
+ '4-4.8,10-7.2,17.3c-3.4,10.6-0.9,26.2,2.7,27.3C90.4,72,91.3,' +
+ '75,88,75H22.7c-3.3,0-2.4-3-0.9-3.5c3.6-1.1,6.1-16.7,2.7-27.3' +
+ 'c-2.4-7.4-5.4-13.5-7.2-17.5c-0.5,0.2-1,0.3-1.6,0.3c-2.8,0' +
+ '-5.1-2.4-5.1-5.4c0-3,2.3-5.4,5.1-5.4c2.8,0,5.1,2.4,5.1,5.4c0,' +
+ '1-0.2,1.9-0.7,2.7c0.7,0.8,1.4,1.6,2.4,2.6c8.8,8.9,11.9,12.7,' +
+ '18.1,11.7c6.5-1,11-8.2,13.3-14.1c-2-0.8-3.3-2.7-3.3-5.1c0-3,' +
+ '2.3-5.4,5.1-5.4c2.8,0,5.1,2.4,5.1,5.4c0,2.5-1.6,4.5-3.7,5.2' +
+ 'c2.3,5.9,6.8,13,13.2,14c6.2,1,9.3-2.7,18.1-11.7c0.7-0.7,1.4' +
+ '-1.5,2-2.1c-0.6-0.9-1-2-1-3.1c0-3,2.3-5.4,5.1-5.4C97.2,16.2,' +
+ '99.5,18.6,99.5,21.6zM92,87.9c0,2.2-1.7,4.1-3.8,4.1H22.4c' +
+ '-2.1,0-4.4-1.9-4.4-4.1v-3.3c0-2.2,2.3-4.5,4.4-4.5h65.8c2.1,' +
+ '0,3.8,2.3,3.8,4.5V87.9z'],
+
+ ['lock', 'M79.4,48.6h-2.7c0.2-5.7-0.2-20.4-7.9-28.8c-3.6-3.9-8.3' +
+ '-5.9-13.7-5.9c-5.4,0-10.2,2-13.8,5.9c-7.8,8.4-8.3,23.2-8.1,28.8' +
+ 'h-2.7c-4.4,0-8,2.6-8,5.9v35.7c0,3.3,3.6,5.9,8,5.9h48.9c4.4,0,' +
+ '8-2.6,8-5.9V54.5C87.5,51.3,83.9,48.6,79.4,48.6z M48.1,26.1c1.9' +
+ '-2,4.1-2.9,7-2.9c2.9,0,5.1,0.9,6.9,2.9c5,5.4,5.6,17.1,5.4,22.6' +
+ 'h-25C42.3,43.1,43.1,31.5,48.1,26.1z'],
+
+ ['topo', 'M97.2,76.3H86.6l-7.7-21.9H82c1,0,1.9-0.8,1.9-1.9V35.7c' +
+ '0-1-0.8-1.9-1.9-1.9H65.2c-1,0-1.9,0.8-1.9,1.9v2.6L33.4,26.1v-11' +
+ 'c0-1-0.8-1.9-1.9-1.9H14.7c-1,0-1.9,0.8-1.9,1.9v16.8c0,1,0.8,' +
+ '1.9,1.9,1.9h16.8c1,0,1.9-0.8,1.9-1.9v-2.6l29.9,12.2v9L30.5,76.9' +
+ 'c-0.3-0.3-0.8-0.5-1.3-0.5H12.4c-1,0-1.9,0.8-1.9,1.9V95c0,1,0.8,' +
+ '1.9,1.9,1.9h16.8c1,0,1.9-0.8,1.9-1.9v-6.9h47.4V95c0,1,0.8,1.9,' +
+ '1.9,1.9h16.8c1,0,1.9-0.8,1.9-1.9V78.2C99.1,77.2,98.2,76.3,97.2,' +
+ '76.3z M31.1,85.1v-4.9l32.8-26.4c0.3,0.3,0.8,0.5,1.3,0.5h10.5l' +
+ '7.7,21.9h-3c-1,0-1.9,0.8-1.9,1.9v6.9H31.1z'],
+
+ ['refresh',
+ 'M99.7,53.8l-10,13.3L85,73.5,78,64,70.4,53.7h9' +
+ 'A28.5,28.5,0,1,0,68.3,77.6l10.6,6.9A40.7,40.7,0,1,1,91.6,53.8h8.2Z'],
+
+ ['garbage', 'M55.1,31.1c9.4,0,18.7.1,28.1-.1,3.2-.1,4.2,1,3.7,4.1' +
+ 'q-4.1,28.6-8,57.3c-0.3,2.3-1.3,3.4-3.5,3.4h-41' +
+ 'c-2.2,0-2.9-1.2-3.2-3.2Q27,63.5,22.7,34.4c-0.4-2.8.6-3.4,3.1-3.4' +
+ 'H55.1Z' +
+ 'M44.3,81.9c0.4-1.1-2.5-27.4-3.8-40.5a3.2,3.2,0,0,0-3.7-3.2' +
+ 'c-2.5.1-2.5,1.9-2.4,3.7,0.5,4.9,1,9.8,1.5,14.7,0.8,8.1,1.6,16.2,' +
+ '2.4,24.2,0.2,2.2,1.1,4.1,3.6,3.4A3.6,3.6,0,0,0,44.3,81.9Z' +
+ 'm21.2,0a2.8,2.8,0,0,0,2.2,2.3' +
+ 'c2.3,0.8,3.7-.7,4-3.1,1.3-12.9,2.6-25.7,3.8-38.6,0.2-2,.3-4.1-2.6-4.4' +
+ 's-3.3,1.7-3.5,3.7C68.1,54.8,65.5,81.1,65.5,81.9Z' +
+ 'M57.9,61.3q0-9.8,0-19.6c0-2.2-.8-3.6-3.2-3.5s-2.6,1.7-2.6,3.6' +
+ 'q0,19.4,0,38.8c0,1.9,0,3.8,2.8,3.9s3-1.8,3-3.9Q57.9,70.9,57.9,61.3Z' +
+ 'M19,24.7c0.3-2,.5-5.7,1.5-8a5.1,5.1,0,0,1,3.6-2.3' +
+ 'c5.5-.5,17.3-0.8,17.3-0.8l4.3-3.3H62.9l5.6,3.5S84.5,14.6,87,15' +
+ 's2.5,0.7,3.2,1.9,0.9,7.4.9,7.4Z'],
+
+ ['cog', 'M100.2,46.4L87.1,44.8l-2.1-5L93.1,29a2.3,2.3,0,0,0-.2-3' +
+ 'l-8.7-8.8a2.4,2.4,0,0,0-3.1-.2l-11,7.9L66,23.1,63.1,9.5' +
+ 'A2.1,2.1,0,0,0,60.8,8H49.3A2.1,2.1,0,0,0,47,9.5L44.2,22.7l-5,2.2' +
+ 'L28.8,16.8a2.3,2.3,0,0,0-3.1.2l-9.2,9.2a2.4,2.4,0,0,0-.2,3.2' +
+ 'l8.1,10.4-1.7,4.1L9.8,46.4A2.3,2.3,0,0,0,8,48.7V61.9' +
+ 'a2.3,2.3,0,0,0,2,2.4L22.6,66l1.7,5.2-7.7,10a2.4,2.4,0,0,0,.2,3.2' +
+ 'l9.1,9a2.4,2.4,0,0,0,3.3.1l9-8.2,4.8,2.2,2.6,12.7' +
+ 'a2.3,2.3,0,0,0,2.4,1.9l13.9-.2a2.5,2.5,0,0,0,2.3-2.4' +
+ 'l0.7-11.4,5.5-2.3,9.8,8.1a2.4,2.4,0,0,0,3.2-.1L93,83.9' +
+ 'a2.4,2.4,0,0,0,.1-3.3L84.7,71,87,66l13.2-2.5a2.3,2.3,0,0,0,1.9-2.3' +
+ 'l0.2-12.5A2.4,2.4,0,0,0,100.2,46.4ZM54.4,73' +
+ 'A18.2,18.2,0,1,1,72.6,54.8,18.2,18.2,0,0,1,54.4,73Z'],
+
+ ['delta', 'M55,19.2L13.7,90.8h82.7L55,19.2z ' +
+ 'M55,31.2l30.9,53.5H24.1L55,31.2z'],
+
+ ['nonzero', 'M76.7,25.1l7.8-13.5l-7.6-0.3l-5.7,9.9' +
+ 'c-4.8-2.9-10.4-4.5-16.2-4.5c-19.1,0-34.7,17.2-34.7,38.4' +
+ 'c0,12.5,5.4,23.6,13.7,30.6l-7.6,13.2l7.6,0.1l5.5-9.6' +
+ 'c4.7,2.6,9.9,4,15.5,4c19.1,0,34.7-17.2,34.7-38.4' +
+ 'C89.7,42.9,84.6,32.1,76.7,25.1z M27.9,55C27.9,38.4,40,25,55,25' +
+ 'c4.4,0,8.5,1.2,12.2,3.2l-29,50.3C31.9,73,27.9,64.5,27.9,55z' +
+ 'M55,85c-4.1,0-7.9-1-11.4-2.8l29-50.1c5.8,5.5,9.5,13.7,9.5,22.8' +
+ 'C82.1,71.6,70,85,55,85z'],
+
+ ['download', 'M90.3,94.5H19.7V79.2H90.3V94.5Z' +
+ 'm-49.1-79V44H26.2L55,72.3,83.8,44H68.9V15.5H41.1Z'],
+
+ ['upload', 'M90.3,79.4H19.7V94.6H90.3V79.4Z' +
+ 'M41.1,71.8V43.5H26.2L55,15.4,83.8,43.5H68.9V71.8H41.1Z'],
+
+ // --- Navigation glyphs ------------------------------------
+
+ ['flowTable', tableFrame +
+ 'M86,63.2c0,3.3-2.7,6-6,6c-2.8,0-5.1-1.9-5.8-' +
+ '4.5H63.3v5.1c0,0.9-0.7,1.5-1.5,1.5h-5.2v10.6c2.6,0.7,4.5,3,4.5,' +
+ '5.8c0,3.3-2.7,6-6,6c-3.3,0-6-2.7-6-6c0-2.8,1.9-5.1,4.4-5.8V71.3' +
+ 'H48c-0.9,0-1.5-0.7-1.5-1.5v-5.1H36c-0.7,2.6-3,4.4-5.8,4.4c-3.3,' +
+ '0-6-2.7-6-6s2.7-6,6-6c2.8,0,5.2,1.9,5.8,4.5h10.5V56c0-0.9,0.7-' +
+ '1.5,1.5-1.5h5.5V43.8c-2.6-0.7-4.5-3-4.5-5.8c0-3.3,2.7-6,6-6s6,' +
+ '2.7,6,6c0,2.8-1.9,5.1-4.5,5.8v10.6h5.2c0.9,0,1.5,0.7,1.5,1.5v' +
+ '5.6h10.8c0.7-2.6,3-4.5,5.8-4.5C83.3,57.1,86,59.8,86,63.2z ' +
+ 'M55.1,42.3c2.3,0,4.3-1.9,4.3-4.3c0-2.3-1.9-4.3-4.3-4.3' +
+ 's-4.3,1.9-4.3,4.3C50.8,40.4,52.7,42.3,55.1,42.3z ' +
+ 'M34.4,63.1c0-2.3-1.9-4.3-4.3-4.3s-4.3,1.9-4.3,4.3' +
+ 's1.9,4.3,4.3,4.3S34.4,65.5,34.4,63.1z ' +
+ 'M55.1,83.5c-2.3,0-4.3,1.9-4.3,4.3s1.9,4.3,4.3,4.3' +
+ 's4.3-1.9,4.3-4.3S57.5,83.5,55.1,83.5z' +
+ 'M84.2,63.2c0-2.3-1.9-4.3-4.3-4.3s-4.3,' +
+ '1.9-4.3,4.3s1.9,4.3,4.3,4.3S84.2,65.5,84.2,63.2z'],
+
+ ['portTable', tableFrame +
+ 'M85.5,37.7c0-0.7-0.4-1.3-0.9-1.3H26.2c-0.5,0-' +
+ '0.9,0.6-0.9,1.3v34.6c0,0.7,0.4,1.3,0.9,1.3h11v9.6c0,1.1,0.5,2,' +
+ '1.2,2h9.1c0,0.2,0,0.3,0,0.5v3c0,1.1,0.5,2,1.2,2h13.5c0.6,0,1.2-' +
+ '0.9,1.2-2v-3c0-0.2,0-0.3,0-0.5h9.1c0.6,0,1.2-0.9,1.2-2v-9.6h11' +
+ 'c0.5,0,0.9-0.6,0.9-1.3V37.7z M30.2,40h-1v8h1V40zM75.2,40h-2.1v8' +
+ 'h2.1V40z M67.7,40h-2.1v8h2.1V40z M60.2,40h-2.1v8h2.1V40z M52.7,' +
+ '40h-2.1v8h2.1V40z M45.2,40h-2.1v8h2.1V40zM37.7,40h-2.1v8h2.1V40' +
+ 'z M81.6,40h-1v8h1V40z'],
+
+ ['groupTable', tableFrame +
+ 'M45.7,52.7c0.2-5.6,2.6-10.7,6.2-14.4c-2.6-1.5-5.7-2.5-8.9-2.5' +
+ 'c-9.8,0-17.7,7.9-17.7,17.7c0,6.3,3.3,11.9,8.3,15' +
+ 'C34.8,61.5,39.4,55.6,45.7,52.7z ' +
+ 'M51.9,68.8c-3.1-3.1-5.2-7.2-6-11.7c-4.7,2.8-7.9,7.6-8.6,13.2' +
+ 'c1.8,0.6,3.6,0.9,5.6,0.9C46.2,71.2,49.3,70.3,51.9,68.8z ' +
+ 'M55.2,71.5c-3.5,2.4-7.7,3.7-12.2,3.7c-1.9,0-3.8-0.3-5.6-0.7' +
+ 'C38.5,83.2,45.9,90,54.9,90c9,0,16.4-6.7,17.5-15.4' +
+ 'c-1.6,0.4-3.4,0.6-5.1,0.6C62.8,75.2,58.6,73.8,55.2,71.5z ' +
+ 'M54.9,50.6c1.9,0,3.8,0.3,5.6,0.7c-0.5-4.1-2.5-7.9-5.4-10.6' +
+ 'c-2.9,2.7-4.8,6.4-5.3,10.5C51.5,50.8,53.2,50.6,54.9,50.6z ' +
+ 'M49.7,55.4c0.5,4.3,2.4,8.1,5.4,10.9c2.9-2.8,4.9-6.6,5.4-10.8' +
+ 'c-1.8-0.6-3.6-0.9-5.6-0.9C53.1,54.6,51.4,54.9,49.7,55.4z ' +
+ 'M89,53.5c0-12-9.7-21.7-21.7-21.7c-4.5,0-8.7,1.4-12.2,3.7' +
+ 'c-3.5-2.4-7.7-3.7-12.2-3.7c-12,0-21.7,9.7-21.7,21.7' +
+ 'c0,8.5,4.9,15.9,12,19.4C33.6,84.6,43.2,94,54.9,94' +
+ 'c11.7,0,21.2-9.3,21.7-20.9C84,69.7,89,62.2,89,53.5z ' +
+ 'M64.3,57.3c-0.8,4.4-2.9,8.4-5.9,11.5c2.6,1.5,5.7,2.5,8.9,2.5' +
+ 'c1.8,0,3.6-0.3,5.2-0.8C72,64.9,68.8,60.1,64.3,57.3z ' +
+ 'M67.3,35.8c-3.3,0-6.3,0.9-8.9,2.5c3.7,3.8,6.1,8.9,6.2,14.6' +
+ 'c6.1,3.1,10.6,8.9,11.7,15.8C81.5,65.6,85,60,85,53.5' +
+ 'C85,43.8,77.1,35.8,67.3,35.8z'],
+
+ ['meterTable', tableFrame +
+ 'M96.3,79.2c0-19.1-22.1-34.6-41.3-34.6S13.7,60.1,13.7,79.2' +
+ 'H39.4c0-7.2,8.4-13.1,15.7-13.1S70.6,72,70.6,79.2H96.3z' +
+ 'M48,65.6L36.8,53c0-.5-1.5.5-1.4,0.7l5.3,16.6z'],
+
+ ['pipeconfTable', tableFrame +
+ 'M10,66h13v3h-13z' +
+ 'M23,62.5L28,67.5L23,72.5z' +
+ 'M30,55h12.5v25h-12.5z' +
+ 'M45,66h13v3h-13z' +
+ 'M58,62.5L63,67.5L58,72.5z' +
+ 'M65,55h12.5v25h-12.5z' +
+ 'M79,66h15v3h-15z' +
+ 'M94,62.5L99,67.5L94,72.5z'],
+
+ // --- Topology toolbar specific glyphs ----------------------
+
+ ['summary', 'M95.8,9.2H14.2c-2.8,0-5,2.2-5,5v81.5c0,2.8,2.2,5,5,' +
+ '5h81.5c2.8,0,5-2.2,5-5V14.2C100.8,11.5,98.5,9.2,95.8,9.2z ' +
+ 'M16.7,22.2c0-1.1,0.9-2,2-2h20.1c1.1,0,2,0.9,2,2v20.1c0,1.1-0.9,' +
+ '2-2,2H18.7c-1.1,0-2-0.9-2-2V22.2z M93,87c0,1.1-0.9,2-2,2H18.9' +
+ 'c-1.1,0-2-0.9-2-2v-7c0-1.1,0.9-2,2-2H91c1.1,0,2,0.9,2,2V87z ' +
+ 'M93,65c0,1.1-0.9,2-2,2H18.9c-1.1,0-2-0.9-2-2v-7c0-1.1,0.9-2,' +
+ '2-2H91c1.1,0,2,0.9,2,2V65z'],
+
+ ['details', 'M95.8,9.2H14.2c-2.8,0-5,2.2-5,5v81.5c0,2.8,2.2,5,5,' +
+ '5h81.5c2.8,0,5-2.2,5-5V14.2C100.8,11.5,98.5,9.2,95.8,9.2z M16.9,' +
+ '22.2c0-1.1,0.9-2,2-2H91c1.1,0,2,0.9,2,2v7c0,1.1-0.9,2-2,2H18.9c' +
+ '-1.1,0-2-0.9-2-2V22.2z M93,87.8c0,1.1-0.9,2-2,2H18.9c-1.1,' +
+ '0-2-0.9-2-2v-7c0-1.1,0.9-2,2-2H91c1.1,0,2,0.9,2,2V87.8z M93,68.2' +
+ 'c0,1.1-0.9,2-2,2H18.9c-1.1,0-2-0.9-2-2v-7c0-1.1,0.9-2,2-2H91' +
+ 'c1.1,0,2,0.9,2,2V68.2z M93,48.8c0,1.1-0.9,2-2,2H19c-1.1,0-2-' +
+ '0.9-2-2v-7c0-1.1,0.9-2,2-2H91c1.1,0,2,0.9,2,2V48.8z'],
+
+ ['ports', 'M98,9.2H79.6c-1.1,0-2.1,0.9-2.1,2.1v17.6l-5.4,5.4c-1.7' +
+ '-1.1-3.8-1.8-6-1.8c-6,0-10.9,4.9-10.9,10.9c0,2.2,0.7,4.3,1.8,6' +
+ 'l-7.5,7.5c-1.8-1.2-3.9-1.9-6.2-1.9c-6,0-10.9,4.9-10.9,10.9c0,' +
+ '2.3,0.7,4.4,1.9,6.2l-6.2,6.2H11.3c-1.1,0-2.1,0.9-2.1,2.1v18.4' +
+ 'c0,1.1,0.9,2.1,2.1,2.1h18.4c1.1,0,2.1-0.9,2.1-2.1v-16l7-6.9' +
+ 'c1.4,0.7,3,1.1,4.7,1.1c6,0,10.9-4.9,10.9-10.9c0-1.7-0.4-3.3-' +
+ '1.1-4.7l8-8c1.5,0.7,3.1,1.1,4.8,1.1c6,0,10.9-4.9,10.9-10.9c0' +
+ '-1.7-0.4-3.4-1.1-4.8l6.9-6.9H98c1.1,0,2.1-0.9,2.1-2.1V11.3' +
+ 'C100.1,10.2,99.2,9.2,98,9.2z M43.4,72c-3.3,0-6-2.7-6-6s2.7-6,' +
+ '6-6s6,2.7,6,6S46.7,72,43.4,72z M66.1,49.5c-3.3,0-6-2.7-6-6' +
+ 'c0-3.3,2.7-6,6-6s6,2.7,6,6C72.2,46.8,69.5,49.5,66.1,49.5z'],
+
+ ['map', 'M95.8,9.2H14.2c-2.8,0-5,2.2-5,5v66c0.3-1.4,0.7-2.8,' +
+ '1.1-4.1l1.6,0.5c-0.9,2.4-1.6,4.8-2.2,7.3l-0.5-0.1v12c0,2.8,2.2,' +
+ '5,5,5h81.5c2.8,0,5-2.2,5-5V14.2C100.8,11.5,98.5,9.2,95.8,9.2z ' +
+ 'M16.5,67.5c-0.4,0.5-0.7,1-1,1.5c-0.3,0.5-0.6,1-0.9,1.6l-1.9-0.9' +
+ 'c0.3-0.6,0.6-1.2,0.9-1.8c0.3-0.6,0.6-1.2,1-1.7c0.7-1.1,1.5-2.2,' +
+ '2.5-3.2l1.8,1.8C18,65.6,17.2,66.5,16.5,67.5z M29.7,64.1' +
+ 'c-0.4-0.4-0.8-0.8-1.2-1.1c-0.1-0.1-0.2-0.1-0.2-0.1c0,0-0.1,' +
+ '0-0.1-0.1l-0.1,0l0,0l-0.1,0c-0.3-0.1-0.5-0.2-0.8-0.2c-0.5-0.1' +
+ '-1.1-0.2-1.6-0.3c-0.6,0-1.1,0-1.6,0l-0.4-2.8c0.7-0.1,1.5-0.2,2.2' +
+ '-0.1c0.7,0,1.4,0.1,2.2,0.3c0.4,0.1,0.7,0.2,1,0.3l0.1,0l0,0l0.1,' +
+ '0l0.1,0c0.1,0,0.1,0,0.3,0.1c0.3,0.1,0.5,0.2,0.7,0.4c0.7,0.5,' +
+ '1.2,0.9,1.7,1.4L29.7,64.1z M39.4,74.7c-1.8-1.8-3.6-3.8-5.3-5.7' +
+ 'l2.6-2.4c0.9,0.9,1.8,1.8,2.7,2.7c0.9,0.9,1.8,1.7,2.7,2.6L39.4,' +
+ '74.7z M50.8,84.2c-1.1-0.7-2.2-1.5-3.3-2.3c-0.5-0.4-1.1-0.8-1.6' +
+ '-1.2c-0.5-0.4-1-0.8-1.5-1.2l2.7-3.4c0.5,0.4,1,0.8,1.5,1.1c0.5,' +
+ '0.3,1,0.7,1.5,1c1,0.7,2.1,1.3,3.1,1.9L50.8,84.2z M61.3,' +
+ '88.7c-0.7-0.1-1.4-0.3-2.1-0.5c-0.7-0.2-1.4-0.5-2-0.7l1.8' +
+ '-4.8c0.6,0.2,1.1,0.4,1.6,0.5c0.5,0.2,1.1,0.3,1.6,0.4c1,0.2,2.1,' +
+ '0.2,3,0.1l0.7,5.1C64.3,89.1,62.7,88.9,61.3,88.7z M75.1,80.4c' +
+ '-0.2,0.7-0.5,1.4-0.9,2c-0.2,0.3-0.3,0.7-0.5,1l-0.3,0.5l-0.3,' +
+ '0.4l-3.9-2.8l0.3-0.4l0.2-0.3c0.1-0.2,0.3-0.4,0.4-0.7c0.3-0.5,' +
+ '0.5-0.9,0.7-1.5c0.4-1,0.8-2.1,1.1-3.3l4.2,0.9C75.9,77.7,75.6,' +
+ '79,75.1,80.4z M73,69.2l0.2-1.9l0.1-1.9c0.1-1.2,0.1-2.5,0.1-' +
+ '3.8l2.5-0.2c0.2,1.3,0.4,2.6,0.5,3.9l0.1,2l0.1,2L73,69.2z ' +
+ 'M73,51l0.5-0.1c0.4,1.3,0.8,2.6,1.1,3.9L73.2,55C73.1,53.7,73.1,' +
+ '52.3,73,51z M91.9,20.4c-0.7,1.4-3.6,3.6-4.2,3.9c-1.5,0.8-5,' +
+ '2.8-10.1,7.7c3,2.9,5.8,5.4,7.3,6.4c2.6,1.8,3.4,4.3,3.6,6.1c0.1,' +
+ '1.1-0.1,2.5-0.4,3c-0.5,0.9-1.6,2-3,1.4c-2-0.8-11.5-9.6-13-11c' +
+ '-3.5,3.9-7.4,8.9-11.7,15.1c0,0-3.1,3.4-5.2,0.9C52.9,51.5,61,' +
+ '39.3,61,39.3s2.2-3.1,5.6-7c-2.9-3-5.9-6.3-6.6-7.3c0,0-3.7-5-1.3' +
+ '-6.6c3.2-2.1,6.3,0.8,6.3,0.8s3.1,3.3,7,7.2c4.7-4.7,10.1-9.2,' +
+ '14.7-10c0,0,3.3-1,5.2,1.7C92.5,18.8,92.4,19.6,91.9,20.4z'],
+
+ ['cycleLabels', 'M72.5,33.9c0,0.6-0.2,1-0.5,1H40c-0.3,0-0.5-0.4' +
+ '-0.5-1V20.7c0-0.6,0.2-1,0.5-1h32c0.3,0,0.5,0.4,0.5,1V33.9z ' +
+ 'M41.2,61.8c0-0.6-0.2-1-0.5-1h-32c-0.3,0-0.5,0.4-0.5,1V75c0,0.6,' +
+ '0.2,1,0.5,1h32c0.3,0,0.5-0.4,0.5-1V61.8z M101.8,61.8c0-0.6-0.2' +
+ '-1-0.5-1h-32c-0.3,0-0.5,0.4-0.5,1V75c0,0.6,0.2,1,0.5,1h32c0.3,' +
+ '0,0.5-0.4,0.5-1V61.8z M17.2,52.9c0-0.1-0.3-7.1,4.6-13.6l-2.4-1.8' +
+ 'c-5.4,7.3-5.2,15.2-5.1,15.5L17.2,52.9z M12.7,36.8l7.4,2.5l1.5,' +
+ '7.6L29.5,31L12.7,36.8z M94.2,42.3c-2.1-8.9-8.3-13.7-8.6-13.9l' +
+ '-1.8,2.4c0.1,0,5.6,4.3,7.5,12.2L94.2,42.3z M99,37.8l-6.6,4.1l' +
+ '-6.8-3.7l7.1,16.2L99,37.8z M69,90.2l-1.2-2.8c-0.1,0-6.6,2.8' +
+ '-14.3,0.6l-0.8,2.9c2.5,0.7,4.9,1,7,1C65,91.8,68.7,90.2,69,90.2z ' +
+ 'M54.3,97.3L54,89.5l6.6-4.1l-17.6-1.7L54.3,97.3z'],
+
+ ['oblique', 'M80.9,30.2h4.3l15-16.9H24.8l-15,16.9h19v48.5h-4l-15,' +
+ '16.9h75.3l15-16.9H80.9V30.2z M78.6,78.7H56.1V30.2h22.5V78.7z' +
+ 'M79.7,17.4c2.4,0,4.3,1.9,4.3,4.3c0,2.4-1.9,4.3-4.3,4.3s-4.3' +
+ '-1.9-4.3-4.3C75.4,19.3,77.4,17.4,79.7,17.4z M55,17.4c2.4,0,' +
+ '4.3,1.9,4.3,4.3c0,2.4-1.9,4.3-4.3,4.3s-4.3-1.9-4.3-4.3C50.7,' +
+ '19.3,52.6,17.4,55,17.4z M26.1,21.7c0-2.4,1.9-4.3,4.3-4.3c2.4,' +
+ '0,4.3,1.9,4.3,4.3c0,2.4-1.9,4.3-4.3,4.3C28,26,26.1,24.1,26.1,' +
+ '21.7z M31.1,30.2h22.6v48.5H31.1V30.2z M30.3,91.4c-2.4,0-4.3' +
+ '-1.9-4.3-4.3c0-2.4,1.9-4.3,4.3-4.3c2.4,0,4.3,1.9,4.3,4.3C34.6,' +
+ '89.5,32.7,91.4,30.3,91.4z M54.9,91.4c-2.4,0-4.3-1.9-4.3-4.3c0' +
+ '-2.4,1.9-4.3,4.3-4.3c2.4,0,4.3,1.9,4.3,4.3C59.2,89.5,57.3,' +
+ '91.4,54.9,91.4z M84,87.1c0,2.4-1.9,4.3-4.3,4.3c-2.4,0-4.3-1.9' +
+ '-4.3-4.3c0-2.4,1.9-4.3,4.3-4.3C82.1,82.8,84,84.7,84,87.1z'],
+
+ ['filters', 'M24.8,13.3L9.8,40.5h75.3l15.0-27.2H24.8z M72.8,32.1l-' +
+ '9.7-8.9l-19.3,8.9l-6.0-7.4L24.1,30.9l-1.2-2.7l15.7-7.1l6.0,7.4' +
+ 'l19.0-8.8l9.7,8.8l11.5-5.6l1.3,2.7L72.8,32.1zM24.3,68.3L9.3,' +
+ '95.5h75.3l15.0-27.2H24.3z M84.3,85.9L70.7,79.8l-6.0,7.4l-19.3' +
+ '-8.9l-9.7,8.9l-13.3-6.5l1.3-2.7l11.5,5.6l9.7-8.8l19.0,8.8l6.0' +
+ '-7.4l15.7,7.1L84.3,85.9z M15.3,57h-6v-4h6V57zM88.1,57H76.0v-4h' +
+ '12.1V57z M69.9,57H57.8v-4h12.1V57z M51.7,57H39.6v-4H51.7V57z ' +
+ 'M33.5,57H21.4v-4h12.1V57zM100.2,57h-6v-4h6V57z'],
+
+ ['resetZoom', 'M86,79.8L61.7,54.3c1.8-2.9,2.8-6.3,2.9-10c0.3-11.2' +
+ '-8.6-20.5-19.8-20.8C33.7,23.2,24.3,32,24.1,43.2c-0.3,11.2,8.6,' +
+ '20.5,19.8,20.8c4,0.1,8.9-0.8,11.9-3.6l23.7,25c1.5,1.6,4,2.3,' +
+ '5.3,1l1.6-1.6C87.7,83.7,87.5,81.4,86,79.8z M31.4,43.4c0.2-7.1,' +
+ '6.1-12.8,13.2-12.6C51.8,31,57.5,37,57.3,44.1c-0.2,7.1-6.1,12.8' +
+ '-13.2,12.6C36.9,56.5,31.3,50.6,31.4,43.4zM22.6,104H6V86.4c0' +
+ '-1.7,1.4-3.1,3.1-3.1s3.1,1.4,3.1,3.1v11.4h10.4c1.7,0,3.1,1.4,' +
+ '3.1,3.1S24.3,104,22.6,104z M25.7,9.1c0,1.7-1.4,3.1-3.1,3.1' +
+ 'H12.2v11.4c0,1.7-1.4,3.1-3.1,3.1S6,25.3,6,23.6V6h16.6C24.3,6,' +
+ '25.7,7.4,25.7,9.1z M84.3,100.9c0-1.7,1.4-3.1,3.1-3.1h10.4V86.4' +
+ 'c0-1.7,1.4-3.1,3.1-3.1s3.1,1.4,3.1,3.1V104H87.4C85.7,104,84.3,' +
+ '102.6,84.3,100.9z M87.4,6H104v17.6c0,1.7-1.4,3.1-3.1,3.1s-3.1' +
+ '-1.4-3.1-3.1V12.2H87.4c-1.7,0-3.1-1.4-3.1-3.1S85.7,6,87.4,6z'],
+
+ ['relatedIntents', 'M99.9,43.7v22.6c0,1.9-1.5,3.4-3.4,3.4H73.9c' +
+ '-1.9,0-3.4-1.5-3.4-3.4V43.7c0-1.9,1.5-3.4,3.4-3.4h22.6C98.4,' +
+ '40.3,99.9,41.8,99.9,43.7z M48.4,46.3l6.2,6.7h-4.6L38.5,38v9.7' +
+ 'l4.7,5.3H10.1V57h33.2l-4.8,5.3v9.5L49.8,57h5.1v0l-6.5,7v11.5' +
+ 'L64.1,55L48.4,34.4V46.3z'],
+
+ ['nextIntent', 'M88.1,55.7L34.6,13.1c0,0-1.6-0.5-2.1-0.2c-1.9,1.2' +
+ '-6.5,13.8-3.1,17.2c7,6.9,30.6,24.5,32.4,25.9c-1.8,1.4-25.4,19' +
+ '-32.4,25.9c-3.4,3.4,1.2,16,3.1,17.2c0.6,0.4,2.1-0.2,2.1-0.2' +
+ 's53.1-42.4,53.5-42.7C88.5,56,88.1,55.7,88.1,55.7z'],
+
+ ['prevIntent', 'M22.5,55.6L76,12.9c0,0,1.6-0.5,2.2-0.2c1.9,1.2,' +
+ '6.5,13.8,3.1,17.2c-7,6.9-30.6,24.5-32.4,25.9c1.8,1.4,25.4,19,' +
+ '32.4,25.9c3.4,3.4-1.2,16-3.1,17.2c-0.6,0.4-2.2-0.2-2.2-0.2' +
+ 'S22.9,56.3,22.5,56C22.2,55.8,22.5,55.6,22.5,55.6z'],
+
+ ['intentTraffic', 'M14.7,71.5h-6v-33h6V71.5z M88.5,38.5H76.9v33' +
+ 'h11.7V38.5z M70.1,38.5H58.4v33h11.7V38.5z M51.6,38.5H39.9v33' +
+ 'h11.7V38.5z M33.1,38.5H21.5v33h11.7V38.5z M101.3,38.5h-6v33h6' +
+ 'V38.5z'],
+
+ ['allTraffic', 'M15.7,64.5h-7v-19h7V64.5z M78.6,45.5H62.9v19h15.7' +
+ 'V45.5z M47.1,45.5H31.4v19h15.7V45.5z M101.3,45.5h-7v19h7V45.5z' +
+ 'M14.7,14.1h-6v19h6V14.1z M88.5,14.1H76.9v19h11.7V14.1z M70.1,' +
+ '14.1H58.4v19h11.7V14.1z M51.6,14.1H39.9v19h11.7V14.1z M33.1,14.1' +
+ 'H21.5v19h11.7V14.1z M101.3,14.1h-6v19h6V14.1z M14.7,76.9h-6v19' +
+ 'h6V76.9z M88.5,76.9H76.9v19h11.7V76.9z M70.1,76.9H58.4v19h11.7' +
+ 'V76.9z M51.6,76.9H39.9v19h11.7V76.9z M33.1,76.9H21.5v19h11.7' +
+ 'V76.9z M101.3,76.9h-6v19h6V76.9z'],
+
+ ['flows', 'M93.8,46.1c-4.3,0-8,3-9,7H67.9v-8.8c0-1.3-1.1-2.4-2.4' +
+ '-2.4h-8.1V25.3c4-1,7-4.7,7-9.1c0-5.2-4.2-9.4-9.4-9.4c-5.2,0' +
+ '-9.4,4.2-9.4,9.4c0,4.3,3,8,7,9v16.5H44c-1.3,0-2.4,1.1-2.4,2.4' +
+ 'v8.8H25.3c-1-4.1-4.7-7.1-9.1-7.1c-5.2,0-9.4,4.2-9.4,9.4s4.2,' +
+ '9.4,9.4,9.4c4.3,0,8-2.9,9-6.9h16.4v7.9c0,1.3,1.1,2.4,2.4,2.4' +
+ 'h8.6v16.6c-4,1.1-6.9,4.7-6.9,9c0,5.2,4.2,9.4,9.4,9.4c5.2,0,' +
+ '9.4-4.2,9.4-9.4c0-4.4-3-8-7.1-9.1V68.2h8.1c1.3,0,2.4-1.1,2.4' +
+ '-2.4v-7.9h16.8c1.1,4,4.7,7,9,7c5.2,0,9.4-4.2,9.4-9.4S99,46.1,' +
+ '93.8,46.1z M48.7,16.3c0-3.5,2.9-6.4,6.4-6.4c3.5,0,6.4,2.9,6.4,' +
+ '6.4s-2.9,6.4-6.4,6.4C51.5,22.6,48.7,19.8,48.7,16.3zM16.2,61.7c' +
+ '-3.5,0-6.4-2.9-6.4-6.4c0-3.5,2.9-6.4,6.4-6.4s6.4,2.9,6.4,6.4' +
+ 'C22.6,58.9,19.7,61.7,16.2,61.7z M61.4,93.7c0,3.5-2.9,6.4-6.4,' +
+ '6.4c-3.5,0-6.4-2.9-6.4-6.4c0-3.5,2.9-6.4,6.4-6.4C58.6,87.4,' +
+ '61.4,90.2,61.4,93.7z M93.8,61.8c-3.5,0-6.4-2.9-6.4-6.4c0-3.5,' +
+ '2.9-6.4,6.4-6.4s6.4,2.9,6.4,6.4C100.1,58.9,97.3,61.8,93.8,61.8z'],
+
+ ['eqMaster', 'M100.1,46.9l-10.8-25h0.2c0.5,0,0.8-0.5,0.8-1.1v-3.2' +
+ 'c0-0.6-0.4-1.1-0.8-1.1H59.2v-5.1c0-0.5-0.8-1-1.7-1h-5.1c-0.9,0' +
+ '-1.7,0.4-1.7,1v5.1l-30.2,0c-0.5,0-0.8,0.5-0.8,1.1v3.2c0,0.6,' +
+ '0.4,1.1,0.8,1.1h0.1l-10.8,25C9,47.3,8.4,48,8.4,48.8v1.6l0,0h0' +
+ 'v6.4c0,1.3,1.4,2.3,3.2,2.3h21.7c1.8,0,3.2-1,3.2-2.3v-8c0-0.9' +
+ '-0.7-1.6-1.7-2L22.9,21.9h27.9v59.6l-29,15.9c0,1.2,1.8,2.2,4.1,' +
+ '2.2h58.3c2.3,0,4.1-1,4.1-2.2l-29-15.9V21.9h27.8L75.2,46.8c-1,' +
+ '0.4-1.7,1.1-1.7,2v8c0,1.3,1.4,2.3,3.2,2.3h21.7c1.8,0,3.2-1,3.2' +
+ '-2.3v-8C101.6,48,101,47.3,100.1,46.9z M22,23.7l10.8,22.8H12.1' +
+ 'L22,23.7z M97.9,46.5H77.2L88,23.7L97.9,46.5z'],
+
+ ['xClose', 'M20,8l35,35,35-35,12,12-35,35,35,35-12,12-35-35-35,35' +
+ '-12-12,35-35-35-35,12-12Z'],
+]);
+
+export const badgeDataSet = new Map<string, string>([
+ ['_viewbox', '0 0 10 10'],
+
+ ['checkMark', 'M8.6,3.4L4.4,7.7L1.4,4.7L2.5,3.6L4.4,5.5L7.5,2.3L8.6,3.4Z'],
+
+ ['xMark', 'M7.8,6.7L6.7,7.8,5,6.1,3.3,7.8,2.2,6.7,3.9,5,2.2,3.3,3.3,' +
+ '2.2,5,3.9,6.7,2.2,7.8,3.3,6.1,5Z'],
+
+ ['triangleUp', 'M0.5,6.2c0,0,3.8-3.8,4.2-4.2C5,1.7,5.3,2,5.3,2l4.3,' +
+ '4.3c0,0,0.4,0.4-0.1,0.4c-1.7,0-8.2,0-8.8,0C0,6.6,0.5,6.2,0.5,6.2z'],
+
+ ['triangleDown', 'M9.5,4.2c0,0-3.8,3.8-4.2,4.2c-0.3,0.3-0.5,0-0.5,' +
+ '0L0.5,4.2c0,0-0.4-0.4,0.1-0.4c1.7,0,8.2,0,8.8,0C10,3.8,9.5,4.2,' +
+ '9.5,4.2z'],
+
+ ['plus', 'M4,2h2v2h2v2h-2v2h-2v-2h-2v-2h2z'],
+
+ ['minus', 'M2,4h6v2h-6z'],
+
+ ['play', 'M3,1.5l3.5,3.5l-3.5,3.5z'],
+
+ ['stop', 'M2.5,2.5h5v5h-5z'],
+]);
+
+export const spriteData = new Map<string, string>([
+ ['_cloud', '0 0 110 110'],
+ ['cloud', 'M37.6,79.5c-6.9,8.7-20.4,8.6-22.2-2.7' +
+ 'M16.3,41.2c-0.8-13.9,19.4-19.2,23.5-7.8' +
+ 'M38.9,30.9c5.1-9.4,15.1-8.5,16.9-1.3' +
+ 'M54.4,32.9c4-12.9,14.8-9.6,18.6-3.8' +
+ 'M95.8,58.5c10-4.1,11.7-17.8-0.9-19.8' +
+ 'M18.1,76.4C5.6,80.3,3.8,66,13.8,61.5' +
+ 'M16.2,62.4C2.1,58.4,3.5,36,16.8,36.6' +
+ 'M93.6,74.7c10.2-2,10.7-14,5.8-18.3' +
+ 'M71.1,79.3c11.2,7.6,24.6,6.4,22.1-11.7' +
+ 'M36.4,76.8c3.4,13.3,35.4,11.6,36.1-1.4' +
+ 'M70.4,31c11.8-10.4,26.2-5.2,24.7,10.1'],
+]);
+
+
+ // --- Mojo Re-Design ---------------------------------------
+const m_octagon = 'M33.5,91.9a1.8,1.8,0,0,1-1.3-.5L8.7,68a1.8,1.8,0,0,' +
+ '1-.5-1.3V33.5a1.8,1.8,0,0,1,.5-1.3L32,8.7a1.8,1.8,0,0,1,1.3-.5' +
+ 'H66.5a1.8,1.8,0,0,1,1.3.5L91.3,32a1.8,1.8,0,0,1,.5,1.3V66.5' +
+ 'a1.8,1.8,0,0,1-.5,1.3L68,91.3a1.8,1.8,0,0,1-1.3.5H33.5Z' +
+ 'm-21.7-26L34.3,88.2H65.9L88.2,65.7V34.1L65.7,11.8H34.1' +
+ 'L11.8,34.3V65.9Z';
+
+const m_switch_arrows = 'M60,42.1l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V33.8' +
+ 'a1.8,1.8,0,0,1,3.7,0v3.3l13-7.1L61.9,23v3.3' +
+ 'A1.8,1.8,0,0,1,60,28.2h-7v3.7h1.7a1.8,1.8,0,0,1,0,3.7H51.2' +
+ 'a1.8,1.8,0,0,1-1.8-1.8V26.4a1.8,1.8,0,0,1,1.8-1.8h7V20' +
+ 'a1.8,1.8,0,0,1,2.7-1.6l18.7,10a1.8,1.8,0,0,1,0,3.2L60.9,41.8Z' +
+ 'M60,69.2l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V60.9a1.8,1.8,0,0,1,3.7,0' +
+ 'v3.3l13-7.1-13-6.9v3.3A1.8,1.8,0,0,1,60,55.3h-7V59h1.7' +
+ 'a1.8,1.8,0,0,1,0,3.7H51.2a1.8,1.8,0,0,1-1.8-1.8V53.5' +
+ 'a1.8,1.8,0,0,1,1.8-1.8h7V47.1a1.8,1.8,0,0,1,2.7-1.6l18.7,10' +
+ 'a1.8,1.8,0,0,1,0,3.2L60.9,69ZM40,54.8l-0.9-.2L20.4,44.2' +
+ 'a1.8,1.8,0,0,1,0-3.2L39.1,31a1.8,1.8,0,0,1,2.7,1.6v4.5h7' +
+ 'A1.8,1.8,0,0,1,50.6,39v7.4a1.8,1.8,0,0,1-1.8,1.8H45.2' +
+ 'a1.8,1.8,0,0,1,0-3.7h1.7V40.9H40A1.8,1.8,0,0,1,38.1,39' +
+ 'V35.7l-13,6.9,13,7.1V46.4a1.8,1.8,0,0,1,3.7,0v6.5' +
+ 'a1.8,1.8,0,0,1-.9,1.6ZM40,81.9l-0.9-.2L20.4,71.4' +
+ 'a1.8,1.8,0,0,1,0-3.2l18.7-10a1.8,1.8,0,0,1,2.7,1.6v4.5h7' +
+ 'a1.8,1.8,0,0,1,1.8,1.8v7.4a1.8,1.8,0,0,1-1.8,1.8H45.2' +
+ 'a1.8,1.8,0,0,1,0-3.7h1.7V68H40a1.8,1.8,0,0,1-1.8-1.8V62.9' +
+ 'l-13,6.9,13,7.1V73.6a1.8,1.8,0,0,1,3.7,0V80a1.8,1.8,0,0,1-.9,1.6Z';
+
+const m_diamond = 'M50,87a16.1,16.1,0,0,1-11.5-4.7L17.7,61.5a16.3,16.3,0,0,' +
+ '1,0-22.9L38.5,17.7a16.3,16.3,0,0,1,22.9,0L82.3,38.5' +
+ 'a16.3,16.3,0,0,1,0,22.9L61.5,82.3A16.1,16.1,0,0,1,50,87Z' +
+ 'm0-70.3a12.4,12.4,0,0,0-8.9,3.7L20.3,41.1a12.6,12.6,0,0,0,0,' +
+ '17.7L41.1,79.7a12.6,12.6,0,0,0,17.7,0L79.7,58.9a12.6,12.6,0,0,' +
+ '0,0-17.7L58.9,20.3A12.4,12.4,0,0,0,50,16.7Z';
+
+const m_trafficArrows = 'M41,66.7l-0.9-.2-16.8-9a1.8,1.8,0,0,1,0-3.2' +
+ 'L40.1,45a1.8,1.8,0,0,1,2.7,1.6v5.8a1.8,1.8,0,0,1-3.7,0V49.7' +
+ 'L28,55.8l11.1,5.9V59.1A1.8,1.8,0,0,1,41,57.2H47v-3H45.7' +
+ 'a1.8,1.8,0,0,1,0-3.7h3.2a1.8,1.8,0,0,1,1.8,1.8v6.7' +
+ 'a1.8,1.8,0,0,1-1.8,1.8H42.8v3.9a1.8,1.8,0,0,1-.9,1.6ZM59,55.3' +
+ 'l-1-.3a1.8,1.8,0,0,1-.9-1.6V49.5H51.1a1.8,1.8,0,0,1-1.8-1.8' +
+ 'V41a1.8,1.8,0,0,1,1.8-1.8h3.2a1.8,1.8,0,0,1,0,3.7H53v3H59' +
+ 'a1.8,1.8,0,0,1,1.8,1.8v2.7L72,44.4,60.9,38.3V41' +
+ 'a1.8,1.8,0,0,1-3.7,0V35.2a1.8,1.8,0,0,1,2.7-1.6l16.8,9.3' +
+ 'a1.8,1.8,0,0,1,0,3.2L59.9,55Z';
+
+const m_otn_base = 'M63.1,79.8a7.5,7.5,0,0,1-5.3-12.8,7.7,7.7,0,0,1,10.7,0' +
+ 'A7.5,7.5,0,0,1,63.1,79.8Zm0-11.3A3.8,3.8,0,0,0,60.4,75h0' +
+ 'a3.9,3.9,0,0,0,5.4,0A3.8,3.8,0,0,0,63.1,68.4Z' +
+ 'M63.1,35.2A7.5,7.5,0,1,1,68.5,33h0A7.5,7.5,0,0,1,63.1,35.2Z' +
+ 'm4-3.5h0Zm-4-7.8A3.8,3.8,0,1,0,65.8,25,3.8,3.8,0,0,0,63.1,23.9Z' +
+ 'M73.3,57.3a7.5,7.5,0,1,1,7.5-7.5A7.5,7.5,0,0,1,73.3,57.3Z' +
+ 'm0-11.3a3.8,3.8,0,1,0,3.8,3.8A3.8,3.8,0,0,0,73.3,46Z' +
+ 'M61.9,48.7H51.5V41.9l5-5a1.9,1.9,0,0,0-2.6-2.6l-4.2,4.2L38,48.7' +
+ 'H34.1A7.3,7.3,0,0,0,32,45a7.6,7.6,0,0,0-10.7,0,7.5,7.5,0,0,0,0,' +
+ '10.6,7.6,7.6,0,0,0,10.7,0,7.4,7.4,0,0,0,1.9-3.2h5.2' +
+ 'l11.4,9.9,3.4,3.4a1.8,1.8,0,0,0,2.6,0,1.8,1.8,0,0,0,0-2.6l-5-5' +
+ 'V52.4H61.9A1.9,1.9,0,0,0,61.9,48.7ZM29.4,53a3.8,3.8,0,0,1-6.5-2.7' +
+ 'A3.9,3.9,0,0,1,24,47.6a3.9,3.9,0,0,1,5.4,0A3.8,3.8,0,0,1,29.4,53Z';
+
+export const mojoDataSet = new Map<string, string>([
+ ['_viewbox', '0 0 100 100'],
+
+ ['m_cloud', 'M62,48.8H61.5a1.8,1.8,0,0,1-1.3-2.3,11,11,0,0,' +
+ '0-21.1-6.1,1.8,1.8,0,1,1-3.5-1,14.7,14.7,0,0,1,28.2,8.1' +
+ 'A1.8,1.8,0,0,1,62,48.8ZM70.6,71.2H28.3' +
+ 'A14.7,14.7,0,1,1,38.4,45.2,1.8,1.8,0,1,1,36,48' +
+ 'a11,11,0,1,0-7.5,19.4H71.8A11,11,0,0,0,71,45.5' +
+ 'a10.9,10.9,0,0,0-3.2.5,1.8,1.8,0,1,1-1.1-3.5,14.7,14.7,0,0,1,19,14' +
+ 'A14.8,14.8,0,0,1,72.2,71.1H70.6Z'],
+
+ ['m_map', 'M50,17.6A32.4,32.4,0,1,0,82.4,50,32.4,32.4,0,0,0,50,17.6Z' +
+ 'm0,61.1A28.7,28.7,0,1,1,78.7,50,28.7,28.7,0,0,1,50,78.7Z' +
+ 'M75.9,48.8a1.8,1.8,0,0,1-1.8,1.8H65' +
+ 'a38.3,38.3,0,0,1-8.4,22.9,1.8,1.8,0,0,1-1.4.7,1.8,1.8,0,0,' +
+ '1-1.2-.4,1.8,1.8,0,0,1-.3-2.6,34.6,34.6,0,0,0,7.5-20.5H39.2' +
+ 'a34.5,34.5,0,0,0,7.6,20.7,1.8,1.8,0,0,1-1.4,3,1.8,1.8,0,0,' +
+ '1-1.4-.7,38.2,38.2,0,0,1-8.5-23H26.2a1.8,1.8,0,1,1,0-3.7' +
+ 'h9.4a38.1,38.1,0,0,1,8.4-21.6,1.8,1.8,0,0,1,2.9,2.3,34.4,34.4,0,0,' +
+ '0-7.6,19.3h22a34.3,34.3,0,0,0-8-19.7,1.8,1.8,0,1,1,2.8-2.4,38,38,' +
+ '0,0,1,8.8,22.1h9.1A1.8,1.8,0,0,1,75.9,48.8Z'],
+
+ ['m_selectMap', 'M51.36,8.74A32.45,32.45,0,0,0,19,41.15' +
+ 'a32.12,32.12,0,0,0,9.22,22.62L17,72.07a1.84,1.84,0,0,0,1,3.32' +
+ 'L35.52,76h0l10,14.42a1.84,1.84,0,0,0,1.52.79,2.05,2.05,0,0,' +
+ '0,.49-0.06,1.84,1.84,0,0,0,1.35-1.66l2.68-39.19' +
+ 'a1.73,1.73,0,0,0-.06-0.6,0.85,0.85,0,0,0-.09-0.24,1.7,1.7,0,0,' +
+ '0-.81-0.9l-0.18-.1a1.69,1.69,0,0,0-.94-0.16H49.33l-0.16,0' +
+ 'a1,1,0,0,0-.31.12,1.52,1.52,0,0,0-.33.18L42.73,53' +
+ 'a34.6,34.6,0,0,1-2.22-11.21H62.68a34.55,34.55,0,0,1-7.55,20.54' +
+ 'A1.85,1.85,0,1,0,58,64.63a38.26,38.26,0,0,0,8.37-22.86h9.08' +
+ 'a1.85,1.85,0,0,0,0-3.7H66.3a38.06,38.06,0,0,0-8.83-22.14,' +
+ '1.85,1.85,0,1,0-2.82,2.38,34.37,34.37,0,0,1,8,19.76h-22' +
+ 'a34.38,34.38,0,0,1,7.58-19.3,1.85,1.85,0,1,0-2.87-2.33,' +
+ '38.11,38.11,0,0,0-8.41,21.63H27.53a1.85,1.85,0,0,0,0,3.7' +
+ 'h9.28a38.43,38.43,0,0,0,2.85,13.48l-8.5,6.31a28.71,28.71,0,1,' +
+ '1,23.21,8.16,1.85,1.85,0,0,0,.19,3.68h0.19A32.41,32.41,0,0,' +
+ '0,51.36,8.74Zm-4,49.75L45.57,84l-6.85-9.87,2.64-4.92,0.56-1,2.8-5' +
+ 'C45.61,61.58,46.49,60,47.31,58.49ZM44,56.63' +
+ 'c-0.81,1.5-1.69,3.11-2.56,4.73l-3.3,6.11-0.19.35' +
+ 'C37,69.4,36.19,70.93,35.4,72.34l-12-.44Z'],
+
+ ['thatsNoMoon', 'M50,83.4A33.2,33.2,0,1,1,83.2,50.2,33.2,33.2,0,0,' +
+ '1,50,83.4ZM79.3,50.1A29.3,29.3,0,1,0,50.1,79.4,29.3,29.3,0,0,0,' +
+ '79.3,50.1ZM65.4,46.9h9.1A1.9,1.9,0,0,1,76.4,48a1.9,1.9,0,0,' +
+ '1-.3,2.1,2.1,2.1,0,0,1-1.8.7H65.4c-0.1.6-.1,1.2-0.2,1.8' +
+ 'A38.5,38.5,0,0,1,57,73.9a2.1,2.1,0,0,1-2.2.9,2,2,0,0,' +
+ '1-1.4-1.6,2.3,2.3,0,0,1,.6-1.7,33.6,33.6,0,0,0,4.9-8.5,34.6,34.6,' +
+ '0,0,0,2.5-11c0-.3,0-0.7,0-1.1H38.9c0.2,1.3.3,2.6,0.5,3.9' +
+ 'a34.2,34.2,0,0,0,7.3,17,2,2,0,1,1-3,2.4A37.1,37.1,0,0,1,39.1,67' +
+ 'a40.8,40.8,0,0,1-4-15.5V50.8H25.8a2,2,0,0,1-2.2-1.9,1.9,1.9,0,0,' +
+ '1,2.1-2H35l0.3-1.8-0.8-.2a7.5,7.5,0,0,1-5.5-8.5,12.4,12.4,0,0,' +
+ '1,10-10.3,15.5,15.5,0,0,1,3.4,0,0.6,0.6,0,0,0,.7-0.3l0.8-1.1' +
+ 'a1.9,1.9,0,0,1,2.5-.4,1.8,1.8,0,0,1,.7,2.4,13.6,13.6,0,0,' +
+ '1-.8,1.4,7.7,7.7,0,0,1,2.1,6.3A11,11,0,0,1,46,40.2a12.6,12.6,0,0,' +
+ '1-6.3,4.5,0.5,0.5,0,0,0-.5.6c0,0.5-.1,1-0.1,1.6H61.5l-0.7-4' +
+ 'A33.6,33.6,0,0,0,53.5,27c-0.8-1-.9-1.7-0.4-2.5a1.7,1.7,0,0,' +
+ '1,2.4-.7,3.6,3.6,0,0,1,1.1.9,37,37,0,0,1,8,17.1' +
+ 'c0.3,1.5.4,3,.7,4.4v0.7Zm-28.8-4A10.1,10.1,0,0,0,46,34.1' +
+ 'a5.3,5.3,0,0,0-6-5.8A10.2,10.2,0,0,0,31.3,36' +
+ 'C30.4,39.9,32.8,42.9,36.6,42.9ZM34.9,35.1a4,4,0,0,' +
+ '1,2.7-3.2,2.7,2.7,0,0,1,3.8,2.6,4.4,4.4,0,0,1-2.5,4' +
+ 'C36.8,39.5,34.7,38,34.9,35.1Zm2,0.7c0,0.7.3,1,.9,0.9' +
+ 'a2.3,2.3,0,0,0,1.5-2.3,0.7,0.7,0,0,0-1.1-.6' +
+ 'A2.2,2.2,0,0,0,36.9,35.8Z'],
+
+ ['m_ports', 'M83.2,20L80,16.8a4.8,4.8,0,0,0-6.8,0l-1.4,1.4' +
+ 'a4.8,4.8,0,0,0-1.4,3.4l-4.5,5.9a3.8,3.8,0,0,0,.4,5l1.2,1.2' +
+ 'a3.8,3.8,0,0,0,5,.4l5.4-3.9,0.5-.6h0a4.8,4.8,0,0,0,3.4-1.4' +
+ 'l1.4-1.4A4.8,4.8,0,0,0,83.2,20ZM70.3,31.1H70.1l-1.2-1.2' +
+ 'a0.2,0.2,0,0,1,0-.2l3.3-4.4,2.6,2.6Zm10.3-6.9-1.4,1.4' +
+ 'a1.1,1.1,0,0,1-1.6,0l-3.2-3.2a1.1,1.1,0,0,1,0-1.6l1.4-1.4' +
+ 'a1.1,1.1,0,0,1,1.6,0l3.2,3.2A1.1,1.1,0,0,1,80.6,24.2Z' +
+ 'M33.7,67.5l-1.2-1.2a3.8,3.8,0,0,0-5-.4l-5.9,4.5' +
+ 'a4.8,4.8,0,0,0-3.4,1.4l-1.4,1.4a4.8,4.8,0,0,0,0,6.8L20,83.2' +
+ 'a4.8,4.8,0,0,0,6.8,0l1.4-1.4a4.8,4.8,0,0,0,1.4-3.5l4.5-5.9' +
+ 'A3.8,3.8,0,0,0,33.7,67.5ZM25.6,79.3l-1.4,1.4' +
+ 'a1.2,1.2,0,0,1-1.6,0l-3.2-3.2a1.1,1.1,0,0,1,0-1.6l1.4-1.4' +
+ 'a1.1,1.1,0,0,1,.8-0.3,1.1,1.1,0,0,1,.8.3l3.2,3.2' +
+ 'A1.1,1.1,0,0,1,25.6,79.3Zm5.6-9-3.3,4.4-2.5-2.5,4.3-3.3h0.2' +
+ 'l1.2,1.2A0.2,0.2,0,0,1,31.1,70.3ZM65.4,61.9a6.2,6.2,0,0,1-8.8,0' +
+ 'L37.2,42.5A2.5,2.5,0,1,0,33.7,46l7,7a6.2,6.2,0,0,1,.4,8.3h0' +
+ 'l-0.2.2-0.2.2-3.6,3.6a1.8,1.8,0,0,1-2.6-2.6l3.6-3.6h0.1' +
+ 'a2.5,2.5,0,0,0-.1-3.4l-7-7a6.2,6.2,0,0,1,8.8-8.8L59.3,59.3' +
+ 'a2.5,2.5,0,0,0,3.5-3.5l-6.2-6.2a6.2,6.2,0,0,1,0-8.8l6.1-6.1' +
+ 'a1.8,1.8,0,0,1,2.6,2.6l-6.1,6.1a2.5,2.5,0,0,0,0,3.5l6.2,6.2' +
+ 'A6.2,6.2,0,0,1,65.4,61.9Z'],
+
+ ['m_switch', m_switch_arrows],
+
+ ['m_roadm', m_switch_arrows + m_octagon],
+
+ ['m_router', 'M29.3,60.9l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V55.2H21.4' +
+ 'a1.8,1.8,0,0,1-1.8-1.8V46.7a1.8,1.8,0,0,1,1.8-1.8h3.2' +
+ 'a1.8,1.8,0,0,1,0,3.7H23.2v3h6.1a1.8,1.8,0,0,1,1.8,1.8V56' +
+ 'l11.1-5.9L31.1,44v2.7a1.8,1.8,0,0,1-3.7,0V40.8' +
+ 'a1.8,1.8,0,0,1,2.7-1.6L47,48.5a1.8,1.8,0,0,1,0,3.2l-16.8,9Z' +
+ 'M70.6,60.9l-0.9-.2L52.9,51.4a1.8,1.8,0,0,1,0-3.2l16.8-9' +
+ 'a1.8,1.8,0,0,1,2.7,1.6v3.9h6.1a1.8,1.8,0,0,1,1.8,1.8v6.7' +
+ 'a1.8,1.8,0,0,1-1.8,1.8H75.4a1.8,1.8,0,0,1,0-3.7h1.3v-3H70.6' +
+ 'a1.8,1.8,0,0,1-1.8-1.8V43.9L57.7,49.8l11.1,6.1V53.2' +
+ 'a1.8,1.8,0,0,1,3.7,0v5.8a1.8,1.8,0,0,1-.9,1.6Z' +
+ 'M49.8,82.5h0a1.8,1.8,0,0,1-1.6-1l-9-16.8A1.8,1.8,0,0,1,40.8,62' +
+ 'h3.9V55.9a1.8,1.8,0,0,1,1.8-1.8h6.7a1.8,1.8,0,0,1,1.8,1.8v3.2' +
+ 'a1.8,1.8,0,0,1-3.7,0V57.8h-3v6.1a1.8,1.8,0,0,1-1.8,1.8H43.9' +
+ 'l5.9,11.1,6.1-11.1H53.2a1.8,1.8,0,0,1,0-3.7h5.8' +
+ 'a1.8,1.8,0,0,1,1.6,2.7L51.4,81.5A1.8,1.8,0,0,1,49.8,82.5Z' +
+ 'M53.3,45.8H46.7A1.8,1.8,0,0,1,44.8,44V40.8a1.8,1.8,0,0,1,3.7,0' +
+ 'v1.3h3V36a1.8,1.8,0,0,1,1.8-1.8H56L50.1,23.1,44,34.2h2.7' +
+ 'a1.8,1.8,0,0,1,0,3.7H40.8a1.8,1.8,0,0,1-1.6-2.7l9.2-16.8' +
+ 'a1.8,1.8,0,0,1,1.6-1h0a1.8,1.8,0,0,1,1.6,1l9,16.8' +
+ 'a1.8,1.8,0,0,1-1.6,2.7H55.2V44A1.8,1.8,0,0,1,53.3,45.8Z' +
+ 'M50,91.2A41.3,41.3,0,1,1,91.2,50,41.3,41.3,0,0,1,50,91.2Z' +
+ 'm0-78.9A37.6,37.6,0,1,0,87.6,50,37.6,37.6,0,0,0,50,12.4Z'],
+
+ ['m_uiAttached', 'M73.6,61.3H26.4a4.9,4.9,0,0,1-4.9-4.9V27.7' +
+ 'a4.9,4.9,0,0,1,4.9-4.9H73.6a4.9,4.9,0,0,1,4.9,4.9V56.5' +
+ 'A4.9,4.9,0,0,1,73.6,61.3ZM26.4,26.5a1.2,1.2,0,0,0-1.2,1.2' +
+ 'V56.5a1.2,1.2,0,0,0,1.2,1.2H73.6a1.2,1.2,0,0,0,1.2-1.2V27.7' +
+ 'a1.2,1.2,0,0,0-1.2-1.2H26.4ZM63.5,75.3a1.8,1.8,0,0,1-1.8,1.8' +
+ 'H38.4a1.8,1.8,0,0,1,0-3.7h9.8V65.7a1.8,1.8,0,0,1,3.7,0v7.8' +
+ 'h9.8A1.8,1.8,0,0,1,63.5,75.3Z'],
+
+ ['m_office', 'M31.7,28.6h-6a1.8,1.8,0,1,1,0-3.7h6A1.8,1.8,0,0,' +
+ '1,31.7,28.6ZM45,28.6h-6a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,1,' +
+ '1,45,28.6ZM31.7,38.3h-6a1.8,1.8,0,1,1,0-3.7h6A1.8,1.8,0,0,' +
+ '1,31.7,38.3ZM45,38.3h-6a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,1,' +
+ '1,45,38.3ZM31.7,48.1h-6a1.8,1.8,0,1,1,0-3.7h6A1.8,1.8,0,0,' +
+ '1,31.7,48.1ZM45,48.1h-6a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,1,' +
+ '1,45,48.1ZM63.7,51.1h-6a1.8,1.8,0,1,1,0-3.7h6A1.8,1.8,0,0,' +
+ '1,63.7,51.1ZM77,51.1H71a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,0,' +
+ '1,77,51.1ZM63.7,60.9h-6a1.8,1.8,0,1,1,0-3.7h6A1.8,1.8,0,0,' +
+ '1,63.7,60.9ZM77,60.9H71a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,0,' +
+ '1,77,60.9ZM45,57.9h-6a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,1,1,' +
+ '45,57.9ZM45,67.6h-6a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,1,1,45,67.6Z' +
+ 'M82.3,37.9H52.6V18a1.8,1.8,0,0,0-1.8-1.8H19.2A1.8,1.8,0,0,' +
+ '0,17.3,18V50.1a1.8,1.8,0,0,0,3.7,0V19.8H48.9V80.2H27.2V75.4' +
+ 'c4-1.2,6.5-3.3,7.3-6.3,2-7.2-6.8-16.2-7.8-17.2a1.9,1.9,0,0,' +
+ '0-2.6,0c-1,1-9.9,10-7.9,17.2,0.8,3,3.3,5.1,7.3,6.3v4.7H21V77.9' +
+ 'a1.8,1.8,0,0,0-3.7,0V82a1.8,1.8,0,0,0,1.9,1.8H82.3A1.8,1.8,0,0,' +
+ '0,84.1,82V39.7A1.8,1.8,0,0,0,82.3,37.9ZM25.4,62.5a1.9,1.9,0,0,' +
+ '0-1.9,1.8v7.2c-2.1-.8-3.4-1.9-3.8-3.4-1-3.7,3-9.2,5.6-12.2,2.6,' +
+ '3,6.6,8.5,5.6,12.2-0.4,1.5-1.7,2.6-3.8,3.4V64.4A1.8,1.8,0,0,' +
+ '0,25.4,62.5ZM71.5,80.2H63.3V70h8.2V80.2Zm8.9,0H75.2V68.1' +
+ 'a1.8,1.8,0,0,0-1.8-1.8H61.5a1.8,1.8,0,0,0-1.8,1.8V80.2H52.6' +
+ 'V41.6H80.4V80.2Z'],
+
+ ['m_home', 'M79.2,52.2a1.7,1.7,0,0,1-2.3,0l-5.8-5.8V77a1.7,1.7,0,0,' +
+ '1-1.7,1.7H30.6A1.7,1.7,0,0,1,28.9,77V52.1a1.7,1.7,0,1,1,3.3,0' +
+ 'V75.3H67.8V43.8a1.7,1.7,0,0,1,.1-0.7L50.1,25.4l-26.9,27' +
+ 'a1.7,1.7,0,0,1-1.2.5A1.7,1.7,0,0,1,20.8,50L48.9,21.8' +
+ 'a1.7,1.7,0,0,1,2.4,0l28,28A1.7,1.7,0,0,1,79.2,52.2ZM57.1,61.6' +
+ 'H42.9a1.7,1.7,0,0,1-1.7-1.7V45.6A1.7,1.7,0,0,1,42.9,44H57.1' +
+ 'a1.7,1.7,0,0,1,1.7,1.7V59.9A1.7,1.7,0,0,1,57.1,61.6ZM44.5,58.2' +
+ 'H55.5V47.3H44.5V58.2Z'],
+
+ ['m_summary', 'M73.9,79.9H26.1A4.9,4.9,0,0,1,21.2,75V25' +
+ 'a4.9,4.9,0,0,1,4.9-4.9H73.9A4.9,4.9,0,0,1,78.8,25V75' +
+ 'A4.9,4.9,0,0,1,73.9,79.9Zm-47.8-56A1.2,1.2,0,0,0,24.9,25V75' +
+ 'a1.2,1.2,0,0,0,1.2,1.2H73.9A1.2,1.2,0,0,0,75.1,75V25' +
+ 'a1.2,1.2,0,0,0-1.2-1.2H26.1ZM42.4,46.7h-8a4.9,4.9,0,0,1-4.9-4.9' +
+ 'v-8A4.9,4.9,0,0,1,34.4,29h8a4.9,4.9,0,0,1,4.9,4.9v8' +
+ 'A4.9,4.9,0,0,1,42.4,46.7Zm-8-14.1a1.2,1.2,0,0,0-1.2,1.2v8' +
+ 'A1.2,1.2,0,0,0,34.4,43h8a1.2,1.2,0,0,0,1.2-1.2v-8' +
+ 'a1.2,1.2,0,0,0-1.2-1.2h-8ZM68.7,57.3H31.3a1.8,1.8,0,0,1,0-3.7' +
+ 'H68.7A1.8,1.8,0,0,1,68.7,57.3ZM68.7,66.5H31.3a1.8,1.8,0,0,1,0-3.7' +
+ 'H68.7A1.8,1.8,0,0,1,68.7,66.5Z'],
+
+ ['m_details', 'M68.7,33.2H31.3a1.8,1.8,0,0,1,0-3.7H68.7' +
+ 'A1.8,1.8,0,1,1,68.7,33.2ZM73.9,17.5H26.1a4.9,4.9,0,0,0-4.9,4.9' +
+ 'V72.4a4.9,4.9,0,0,0,4.9,4.9h8.2l-4.1,6.6a1.9,1.9,0,0,0,.6,2.5' +
+ 'l1,0.3a1.8,1.8,0,0,0,1.6-.9L46.1,64.9a15.1,15.1,0,0,' +
+ '0,4,.5,15.6,15.6,0,0,0,3.7-.4A15.9,15.9,0,0,0,57,63.9H68.7' +
+ 'a1.8,1.8,0,0,0,0-3.7H61.9a16.6,16.6,0,0,0,1.6-2.2,15.5,15.5,0,0,' +
+ '0,2.2-9.4h2.9a1.8,1.8,0,0,0,0-3.7H65a15.7,15.7,0,0,0-29.8,0' +
+ 'H31.3a1.8,1.8,0,1,0,0,3.7h3.2a15.7,15.7,0,0,0,.4,4.9,15.5,15.5,' +
+ '0,0,0,3.5,6.7H31.3a1.8,1.8,0,1,0,0,3.7H42.4l-6,9.8H26.1' +
+ 'a1.2,1.2,0,0,1-1.2-1.2V22.4a1.2,1.2,0,0,1,1.2-1.2H73.9' +
+ 'a1.2,1.2,0,0,1,1.2,1.2V72.4a1.2,1.2,0,0,1-1.2,1.2H44.5' +
+ 'a1.8,1.8,0,0,0,0,3.7H73.9a4.9,4.9,0,0,0,4.9-4.9V22.4' +
+ 'A4.9,4.9,0,0,0,73.9,17.5ZM38.5,52.6A12,12,0,0,1,50.2,37.8,12,12,' +
+ '0,0,1,61.8,47a10.7,10.7,0,0,1,.3,1.6,12,12,0,0,1-5.9,11.6,12,12,' +
+ '0,0,1-12,0L43.9,60A12,12,0,0,1,38.5,52.6Z'],
+
+ ['m_oblique', 'M82.1,30.5a1.8,1.8,0,0,0-1.7-1.1H30.2' +
+ 'a1.8,1.8,0,0,0-1.4.7L18.2,42.8a1.8,1.8,0,0,0,1.4,3H40.9V62.2' +
+ 'a1.8,1.8,0,1,0,3.7,0V45.8H55.4V62.2a1.9,1.9,0,1,0,3.7,0V45.8' +
+ 'H69.8a1.9,1.9,0,0,0,1.4-.7L81.8,32.5A1.8,1.8,0,0,0,82.1,30.5Z' +
+ 'M69,42.2H23.5l7.5-9H76.5ZM69.8,70.5H19.6a1.8,1.8,0,0,1-1.4-3' +
+ 'L28.7,54.8a1.8,1.8,0,0,1,1.4-.7h7a1.8,1.8,0,0,1,0,3.7H31l-7.5,9' +
+ 'H69l7.5-9H62.4a1.8,1.8,0,0,1,0-3.7H80.4a1.8,1.8,0,0,1,1.4,3' +
+ 'L71.3,69.9A1.8,1.8,0,0,1,69.8,70.5ZM52.3,57.8H47.6' +
+ 'a1.8,1.8,0,0,1,0-3.7h4.8A1.8,1.8,0,0,1,52.3,57.8Z'],
+
+ ['m_filters', 'M69.9,45.8H19.5a1.9,1.9,0,0,1-1.4-3L28.7,30' +
+ 'a1.8,1.8,0,0,1,1.4-.7H80.5a1.8,1.8,0,0,1,1.4,3L71.3,45.1' +
+ 'A1.8,1.8,0,0,1,69.9,45.8ZM23.5,42.1H69l7.5-9H31ZM69.9,58.2' +
+ 'H19.5a1.8,1.8,0,0,1-1.4-3l6.1-7.3a1.8,1.8,0,0,1,2.8,2.4l-3.6,4.3' +
+ 'H69l7.6-9.1a1.8,1.8,0,0,1,.5-3.6h3.4a1.8,1.8,0,0,1,1.4,3' +
+ 'L71.3,57.5A1.8,1.8,0,0,1,69.9,58.2ZM69.9,70.7H19.5' +
+ 'a1.9,1.9,0,0,1-1.4-3l5.6-6.7a1.8,1.8,0,0,1,2.8,2.4L23.5,67H69' +
+ 'l7.5-9H76.3a1.8,1.8,0,0,1,0-3.7h4.1a1.9,1.9,0,0,1,1.4,3L71.3,70' +
+ 'A1.8,1.8,0,0,1,69.9,70.7Z'],
+
+ ['m_cycleLabels', 'M78.5,74.7a34.2,34.2,0,0,1-47.7,6.8l-0.3-.3' +
+ 'L30.4,81V80.8a1.8,1.8,0,0,1,.8-2.5l0.7-.3-5.2-3.4v6.2l0.7-.3' +
+ 'a1.8,1.8,0,1,1,1.7,3.3l-3.4,1.8-0.9.2-1-.3a1.9,1.9,0,0,1-.9-1.6' +
+ 'V71.1a1.8,1.8,0,0,1,2.8-1.5l10.7,7a1.9,1.9,0,0,1,.8,1.6,1.9,1.9,' +
+ '0,0,1-1,1.5l-0.7.4a30.5,30.5,0,0,0,40.1-7.7A1.8,1.8,0,0,' +
+ '1,78.5,74.7ZM30.8,25.7L29.5,38.4a1.8,1.8,0,0,1-1.1,1.5l-0.8.2' +
+ 'a1.9,1.9,0,0,1-1.1-.3l-1.7-1.2a30.1,30.1,0,0,0-2.7,6,1.9,1.9,0,0,' +
+ '1-1.8,1.3H19.9a1.8,1.8,0,0,1-1.2-2.3A33.9,33.9,0,0,1,22.8,35' +
+ 'a1.8,1.8,0,0,1,1.6-.8,1.9,1.9,0,0,1,1.2.3L26.2,35l0.7-6.2-5.5,2.8' +
+ 'L21.9,32a1.8,1.8,0,1,1-2.1,3l-3.1-2.2a1.8,1.8,0,0,1,.2-3.2' +
+ 'l11.3-5.8A1.8,1.8,0,0,1,30.8,25.7ZM85.2,30.8L84.7,43.4' +
+ 'a1.8,1.8,0,0,1-1,1.6l-0.8.2a1.8,1.8,0,0,1-1.1-.4L71.4,37.4' +
+ 'a1.8,1.8,0,0,1,.3-3.2l1.9-.9a30.5,30.5,0,0,0-3.9-5.3,1.8,1.8,0,0,' +
+ '1,2.7-2.5,34.3,34.3,0,0,1,5.3,7.7,2,2,0,0,1-.9,2.6' +
+ 'l-0.7.3,5.1,3.6,0.3-6.2-0.7.3a1.8,1.8,0,0,1-1.6-3.3L82.6,29' +
+ 'a1.8,1.8,0,0,1,1.8.1A1.9,1.9,0,0,1,85.2,30.8ZM62.4,32.2H40.2' +
+ 'a4.9,4.9,0,0,1-4.9-4.9V16.6a4.9,4.9,0,0,1,4.9-4.9H62.4' +
+ 'a4.9,4.9,0,0,1,4.9,4.9V27.3A4.9,4.9,0,0,1,62.4,32.2ZM40.2,15.4' +
+ 'A1.2,1.2,0,0,0,39,16.6V27.3a1.2,1.2,0,0,0,1.2,1.2H62.4' +
+ 'a1.2,1.2,0,0,0,1.2-1.2V16.6a1.2,1.2,0,0,0-1.2-1.2H40.2Z' +
+ 'M88.4,68.1H66.2a4.9,4.9,0,0,1-4.9-4.9V52.6a4.9,4.9,0,0,1,4.9-4.9' +
+ 'H88.4a4.9,4.9,0,0,1,4.9,4.9V63.2A4.9,4.9,0,0,1,88.4,68.1Z' +
+ 'M66.2,51.4A1.2,1.2,0,0,0,65,52.6V63.2a1.2,1.2,0,0,0,1.2,1.2H88.4' +
+ 'a1.2,1.2,0,0,0,1.2-1.2V52.6a1.2,1.2,0,0,0-1.2-1.2H66.2Z' +
+ 'M33.8,68.1H11.6a4.9,4.9,0,0,1-4.9-4.9V52.6a4.9,4.9,0,0,1,4.9-4.9' +
+ 'H33.8a4.9,4.9,0,0,1,4.9,4.9V63.2A4.9,4.9,0,0,1,33.8,68.1Z' +
+ 'M11.6,51.4a1.2,1.2,0,0,0-1.2,1.2V63.2a1.2,1.2,0,0,0,1.2,1.2' +
+ 'H33.8A1.2,1.2,0,0,0,35,63.2V52.6a1.2,1.2,0,0,0-1.2-1.2H11.6Z'],
+
+ ['m_prev', 'M59.8,72l-0.9-.2L21.8,51.3a1.8,1.8,0,0,1,0-3.2L58.9,28.2' +
+ 'a1.8,1.8,0,0,1,2.7,1.6V40.7H77.3a1.8,1.8,0,0,1,1.8,1.8V57.3' +
+ 'a1.8,1.8,0,0,1-1.8,1.8h-7a1.8,1.8,0,1,1,0-3.7h5.2v-11H59.8' +
+ 'A1.8,1.8,0,0,1,58,42.6V33L26.6,49.7,58,67V57.3' +
+ 'a1.8,1.8,0,0,1,3.7,0V70.1a1.8,1.8,0,0,1-.9,1.6Z'],
+
+ ['m_next', 'M40.2,72l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V57.3' +
+ 'a1.8,1.8,0,0,1,3.7,0V67L73.5,49.7,42,32.9v9.6' +
+ 'a1.8,1.8,0,0,1-1.8,1.8H24.5v11h5.2a1.8,1.8,0,1,1,0,3.7h-7' +
+ 'a1.8,1.8,0,0,1-1.8-1.8V42.6a1.8,1.8,0,0,1,1.8-1.8H38.3V29.9' +
+ 'a1.8,1.8,0,0,1,2.7-1.6L78.2,48.1a1.8,1.8,0,0,1,0,3.2L41.1,71.8Z'],
+
+ ['m_flows', 'M50.1,26.2a7.4,7.4,0,1,1,7.4-7.4A7.4,7.4,0,0,1,50.1,26.2Z' +
+ 'm0-11.2a3.8,3.8,0,1,0,3.8,3.8A3.8,3.8,0,0,0,50.1,15Z' +
+ 'M50.1,88.6a7.4,7.4,0,1,1,7.4-7.4A7.4,7.4,0,0,1,50.1,88.6Z' +
+ 'm0-11.2a3.8,3.8,0,1,0,3.8,3.8A3.8,3.8,0,0,0,50.1,77.4Z' +
+ 'M72,50.1a1.8,1.8,0,0,1-1.8,1.8H58.1V55a3,3,0,0,1-3,3H51.9V70.2' +
+ 'a1.8,1.8,0,0,1-3.6,0V58.1h-3a3,3,0,0,1-3-3V51.9H29.8' +
+ 'a1.8,1.8,0,1,1,0-3.6H42.3v-3a3,3,0,0,1,3-3h3a1.7,1.7,0,0,1,0-.3' +
+ 'V29.8a1.8,1.8,0,0,1,3.6,0V41.9a1.7,1.7,0,0,1,0,.3h3.2' +
+ 'a3,3,0,0,1,3,3v3H70.2A1.8,1.8,0,0,1,72,50.1ZM18.8,57.5' +
+ 'a7.4,7.4,0,1,1,7.4-7.4A7.4,7.4,0,0,1,18.8,57.5Zm0-11.2' +
+ 'a3.8,3.8,0,1,0,3.8,3.8A3.8,3.8,0,0,0,18.8,46.3ZM81.2,57.5' +
+ 'a7.4,7.4,0,1,1,7.4-7.4A7.4,7.4,0,0,1,81.2,57.5Zm0-11.2' +
+ 'A3.8,3.8,0,1,0,85,50.1,3.8,3.8,0,0,0,81.2,46.3Z'],
+
+ ['m_allTraffic', m_diamond + m_trafficArrows],
+
+ ['m_xMark', 'M76.8,73.7a2.2,2.2,0,0,1-3.1,3.1L50,53.1,26.3,76.7' +
+ 'a2.2,2.2,0,1,1-3.1-3.1L46.9,50,23.2,26.3a2.2,2.2,0,0,1,3.1-3.1' +
+ 'L50,46.9,73.7,23.2a2.2,2.2,0,1,1,3.1,3.1L53.1,50Z'],
+
+ ['m_resetZoom', 'M73.9,76.8H64.2a1.8,1.8,0,1,1,0-3.7h9.7' +
+ 'a1.2,1.2,0,0,0,1.2-1.2V62.6a1.8,1.8,0,0,1,3.7,0v9.3' +
+ 'A4.9,4.9,0,0,1,73.9,76.8ZM77,33.3a1.8,1.8,0,0,1-1.8-1.8V22' +
+ 'a1.2,1.2,0,0,0-1.2-1.2H64.2a1.8,1.8,0,1,1,0-3.7h9.7' +
+ 'A4.9,4.9,0,0,1,78.8,22v9.5A1.8,1.8,0,0,1,77,33.3ZM23,33.6' +
+ 'a1.8,1.8,0,0,1-1.8-1.8V22a4.9,4.9,0,0,1,4.9-4.9h9.8' +
+ 'a1.8,1.8,0,0,1,0,3.7H26.1A1.2,1.2,0,0,0,24.9,22v9.7' +
+ 'A1.8,1.8,0,0,1,23,33.6ZM65.3,42.3A15.7,15.7,0,1,0,42.6,59.8' +
+ 'L34.4,73.1H26.1a1.2,1.2,0,0,1-1.2-1.2V62.1a1.9,1.9,0,0,0-3.7,0' +
+ 'v9.8a4.9,4.9,0,0,0,4.9,4.9h6.1l-2,3.3' +
+ 'a1.8,1.8,0,0,0,.6,2.5,1.8,1.8,0,0,0,1,.3,1.8,1.8,0,0,0,1.6-.9' +
+ 'L46,61.2a15.7,15.7,0,0,0,7.7.1A15.7,15.7,0,0,0,65.3,42.3Z' +
+ 'm-5,9.9A12,12,0,1,1,50.1,34a12,12,0,0,1,11.7,9.2' +
+ 'A11.9,11.9,0,0,1,60.3,52.3Z'],
+
+ ['m_eqMaster', 'M63,79.9H37.4a1.8,1.8,0,0,1-1.2-3.2L48.8,65.1' +
+ 'a1.8,1.8,0,0,1,2.5,0L64.2,76.7A1.8,1.8,0,0,1,63,79.9Z' +
+ 'M42.1,76.2H58.2l-8.1-7.3ZM19.7,65.8a1.8,1.8,0,0,1-.3-3.7' +
+ 'l61-11.3a1.8,1.8,0,1,1,.7,3.6L20,65.8H19.7ZM34.2,53.5' +
+ 'A16.7,16.7,0,1,1,50.9,36.8,16.7,16.7,0,0,1,34.2,53.5Zm0-29.7' +
+ 'a13,13,0,1,0,13,13A13,13,0,0,0,34.2,23.8ZM70.7,45.7' +
+ 'a8.6,8.6,0,1,1,8.6-8.6A8.6,8.6,0,0,1,70.7,45.7Zm0-13.6' +
+ 'a4.9,4.9,0,1,0,4.9,4.9A4.9,4.9,0,0,0,70.7,32.2Z'],
+
+ ['m_unknown', 'M63.2,20.6H36.8A16.2,16.2,0,0,0,20.6,36.8V63.2' +
+ 'A16.2,16.2,0,0,0,36.8,79.4H63.2A16.2,16.2,0,0,0,79.4,63.2V36.8' +
+ 'A16.2,16.2,0,0,0,63.2,20.6ZM75.7,63.2A12.5,12.5,0,0,1,63.2,75.7' +
+ 'H36.8A12.5,12.5,0,0,1,24.3,63.2V36.8A12.5,12.5,0,0,1,36.8,24.3' +
+ 'H63.2A12.5,12.5,0,0,1,75.7,36.8V63.2ZM67.3,64.7' +
+ 'a1.8,1.8,0,0,1-2.6,2.6L50,52.6,35.3,67.3a1.8,1.8,0,0,1-2.6-2.6' +
+ 'L47.4,50,32.7,35.3a1.8,1.8,0,0,1,2.6-2.6L50,47.4,64.7,32.7' +
+ 'a1.8,1.8,0,0,1,2.6,2.6L52.6,50Z'],
+
+ ['m_controller', 'M73.9,20.1H26.1A4.9,4.9,0,0,0,21.2,25V75' +
+ 'a4.9,4.9,0,0,0,4.9,4.9H73.9A4.9,4.9,0,0,0,78.8,75V25' +
+ 'A4.9,4.9,0,0,0,73.9,20.1ZM75.1,75a1.2,1.2,0,0,1-1.2,1.2H26.1' +
+ 'A1.2,1.2,0,0,1,24.9,75V25a1.2,1.2,0,0,1,1.2-1.2H73.9' +
+ 'A1.2,1.2,0,0,1,75.1,25V75ZM70.5,63a1.8,1.8,0,0,1-1.9,1.8H38.3' +
+ 'v2.4a1.8,1.8,0,0,1-3.7,0V64.9H31.3a1.8,1.8,0,1,1,0-3.7h3.3V58.3' +
+ 'a1.8,1.8,0,0,1,3.7,0v2.9H68.7A1.9,1.9,0,0,1,70.5,63ZM70.5,36.6' +
+ 'a1.9,1.9,0,0,1-1.9,1.9H44.5v2.3a1.8,1.8,0,0,1-3.7,0V38.5H31.3' +
+ 'a1.8,1.8,0,1,1,0-3.7h9.5v-3a1.8,1.8,0,0,1,3.7,0v3H68.7' +
+ 'A1.8,1.8,0,0,1,70.5,36.6ZM70.5,49.8a1.9,1.9,0,0,1-1.9,1.8H60.9' +
+ 'v2.1a1.8,1.8,0,1,1-3.7,0V51.7H31.3a1.8,1.8,0,1,1,0-3.7H57.2' +
+ 'V44.8a1.8,1.8,0,1,1,3.7,0V48h7.8A1.9,1.9,0,0,1,70.5,49.8Z'],
+
+ ['m_virtual', 'M56.6,53.5l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V45.8' +
+ 'a1.8,1.8,0,1,1,3.7,0v2.7l11.1-6.1L58.4,36.5v2.7' +
+ 'A1.8,1.8,0,0,1,56.6,41H50.5v3h1.3a1.8,1.8,0,0,1,0,3.7H48.6' +
+ 'a1.8,1.8,0,0,1-1.8-1.8V39.2a1.8,1.8,0,0,1,1.8-1.8h6.1V33.4' +
+ 'a1.8,1.8,0,0,1,2.7-1.6l16.8,9a1.8,1.8,0,0,1,0,3.2L57.5,53.3Z' +
+ 'M56.6,77.9l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V70.2a1.8,1.8,0,1,1,3.7,0' +
+ 'v2.7l11.1-6.1L58.4,60.9v2.7a1.8,1.8,0,0,1-1.8,1.8H50.5v3h1.3' +
+ 'a1.8,1.8,0,0,1,0,3.7H48.6a1.8,1.8,0,0,1-1.8-1.8V63.6' +
+ 'a1.8,1.8,0,0,1,1.8-1.8h6.1V57.8a1.8,1.8,0,0,1,2.7-1.6l16.8,9' +
+ 'a1.8,1.8,0,0,1,0,3.2L57.5,77.7ZM38.5,64.9l-0.9-.2L20.8,55.4' +
+ 'a1.8,1.8,0,0,1,0-3.2l16.8-9a1.8,1.8,0,0,1,2.7,1.6v3.9h6.1' +
+ 'a1.8,1.8,0,0,1,1.8,1.8v6.7a1.8,1.8,0,0,1-1.8,1.8H43.2' +
+ 'a1.8,1.8,0,1,1,0-3.7h1.3v-3H38.5a1.8,1.8,0,0,1-1.8-1.8V47.9' +
+ 'L25.6,53.8l11.1,6.1V57.2a1.8,1.8,0,0,1,3.7,0v5.8' +
+ 'a1.8,1.8,0,0,1-.9,1.6ZM38.5,89.3l-0.9-.2L20.8,79.8' +
+ 'a1.8,1.8,0,0,1,0-3.2l16.8-9a1.8,1.8,0,0,1,2.7,1.6v3.9h6.1' +
+ 'A1.8,1.8,0,0,1,48.3,75v6.7a1.8,1.8,0,0,1-1.8,1.8H43.2' +
+ 'a1.8,1.8,0,1,1,0-3.7h1.3v-3H38.5A1.8,1.8,0,0,1,36.6,75V72.3' +
+ 'L25.6,78.2l11.1,6.1V81.6a1.8,1.8,0,1,1,3.7,0v5.8' +
+ 'a1.8,1.8,0,0,1-.9,1.6ZM60.8,29.1H60.3A1.8,1.8,0,0,1,59,26.8' +
+ 'a9.7,9.7,0,0,0-18.7-5.4,1.8,1.8,0,1,1-3.5-1,13.4,13.4,0,0,' +
+ '1,25.8,7.4A1.8,1.8,0,0,1,60.8,29.1ZM77.4,45.7a1.8,1.8,0,0,' +
+ '1-1.3-3.1,9.7,9.7,0,0,0-9.9-16A1.8,1.8,0,1,1,65,23.1,13.4,13.4,' +
+ '0,0,1,78.7,45.1,1.8,1.8,0,0,1,77.4,45.7ZM22.7,45.8a1.8,1.8,0,0,' +
+ '1-1.3-.6A13.4,13.4,0,0,1,39.6,25.6a1.8,1.8,0,1,1-2.4,2.8' +
+ 'A9.7,9.7,0,0,0,24,42.6,1.8,1.8,0,0,1,22.7,45.8Z'],
+
+
+ ['m_other', 'M78.9,64.9H21.1A4.9,4.9,0,0,1,16.2,60V24.3a4.9,4.9,0,0,' +
+ '1,4.9-4.9H78.9a4.9,4.9,0,0,1,4.9,4.9V60A4.9,4.9,0,0,1,78.9,64.9Z' +
+ 'M21.1,23.1a1.2,1.2,0,0,0-1.2,1.2V60a1.2,1.2,0,0,0,1.2,1.2H78.9' +
+ 'A1.2,1.2,0,0,0,80.1,60V24.3a1.2,1.2,0,0,0-1.2-1.2H21.1Z' +
+ 'M65.8,78.8a1.9,1.9,0,0,1-1.8,1.8H36.1a1.9,1.9,0,1,1,0-3.7H48.2' +
+ 'V70.4a1.8,1.8,0,1,1,3.7,0v6.5H63.9A1.9,1.9,0,0,1,65.8,78.8Z' +
+ 'M47.2,49.3V48.1c-0.3-2.3.5-4.9,2.7-7.5s3-4,3-5.9-1.4-3.7-4.1-3.7' +
+ 'a7.7,7.7,0,0,0-4.4,1.3l-1-2.7A11.3,11.3,0,0,1,49.5,28' +
+ 'c5,0,7.2,3.1,7.2,6.3s-1.6,5-3.7,7.5-2.6,4.1-2.5,6.3v1.1H47.2Z' +
+ 'm-1,6a2.5,2.5,0,0,1,2.6-2.7A2.7,2.7,0,1,1,46.3,55.3Z'],
+
+ ['m_endstation', 'M75,49.5H25a1.8,1.8,0,0,1-1.8-1.8V27.1' +
+ 'A1.8,1.8,0,0,1,25,25.3H75a1.8,1.8,0,0,1,1.8,1.8V47.7' +
+ 'A1.8,1.8,0,0,1,75,49.5ZM26.9,45.8H73.1V28.9H26.9V45.8Z' +
+ 'M35.5,43.2H30.7a1.8,1.8,0,1,1,0-3.7h4.8A1.8,1.8,0,1,1,35.5,43.2Z' +
+ 'M72.1,72.9a1.8,1.8,0,0,1-1.8,1.8H29.7a1.8,1.8,0,1,1,0-3.7' +
+ 'H48.2V53.5a1.8,1.8,0,1,1,3.7,0V71.1H70.3A1.9,1.9,0,0,1,72.1,72.9Z'],
+
+ ['m_bgpSpeaker', 'M59.2,49.6l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V43.3' +
+ 'a1.8,1.8,0,1,1,3.7,0v1.3l7-3.9L61,37v1.3a1.8,1.8,0,0,1-1.8,1.8' +
+ 'H47.5a1.8,1.8,0,1,1,0-3.7h9.8V33.9A1.8,1.8,0,0,1,60,32.3' +
+ 'l12.8,6.8a1.8,1.8,0,0,1,0,3.2l-12.8,7Z' +
+ 'M40,58.8l-0.9-.2-12.8-7a1.8,1.8,0,0,1,0-3.2l12.8-6.8' +
+ 'a1.8,1.8,0,0,1,2.7,1.6v2.5h9.8a1.8,1.8,0,0,1,0,3.7H40' +
+ 'a1.8,1.8,0,0,1-1.8-1.8V46.2l-7,3.8,7,3.9V52.5' +
+ 'a1.8,1.8,0,0,1,3.7,0v4.4a1.8,1.8,0,0,1-.9,1.6Z' +
+ 'M83.6,45.8c0,13.8-15.1,25-33.6,25a43.8,43.8,0,0,1-6.1-.4' +
+ 'c-2.5,2.7-7.2,6.1-15.6,8.7H27.8a1.8,1.8,0,0,1-1.2-3.2' +
+ 's5.4-5,5.8-10.2a1.8,1.8,0,0,1,2-1.7A1.8,1.8,0,0,1,36,66' +
+ 'a16.2,16.2,0,0,1-2.5,7.2,24.4,24.4,0,0,0,8.3-5.9L42,67l0.2-.2' +
+ 'h0l0.6-.2h0.6a41.4,41.4,0,0,0,6.5.5c16.5,0,29.9-9.5,29.9-21.3' +
+ 'S66.5,24.5,50,24.5,20.1,34.1,20.1,45.8c0,5.4,2.9,10.6,8.2,14.6' +
+ 'a1.8,1.8,0,0,1-2.2,2.9' +
+ 'c-6.2-4.7-9.7-10.9-9.7-17.5,0-13.8,15.1-25,33.6-25' +
+ 'S83.6,32,83.6,45.8Z'],
+
+ ['m_otn', m_otn_base],
+
+ ['m_roadm_otn', m_otn_base + m_octagon],
+
+ ['m_fiberSwitch', 'M47.5,37.2a1.8,1.8,0,0,1-1.8-1.8V25.6H43.4' +
+ 'a1.8,1.8,0,0,1-1.6-2.7l6.4-12a1.8,1.8,0,0,1,1.6-1h0' +
+ 'a1.8,1.8,0,0,1,1.6,1l6.6,12a1.8,1.8,0,0,1-1.6,2.7H53.2' +
+ 'a1.8,1.8,0,0,1,0-3.7h0.1l-3.5-6.3L46.5,22h1a1.8,1.8,0,0,1,1.8,1.8' +
+ 'V35.3A1.8,1.8,0,0,1,47.5,37.2Z' +
+ 'M75.9,46.9H75.8a1.8,1.8,0,0,1-1.5-1l-1.8-3.4' +
+ 'a1.8,1.8,0,1,1,3.2-1.7l0.4,0.8,4.2-6-7.1-.3,0.5,0.9' +
+ 'a1.8,1.8,0,0,1-.8,2.5l-10.4,5a1.8,1.8,0,0,1-1.6-3.3l8.7-4.2-1-2' +
+ 'a1.8,1.8,0,0,1,.1-1.8,1.8,1.8,0,0,1,1.6-.8l13.6,0.5' +
+ 'A1.8,1.8,0,0,1,85.3,35L77.4,46.1A1.8,1.8,0,0,1,75.9,46.9Z' +
+ 'M81.2,72.5H81.1l-13.6-.8A1.8,1.8,0,0,1,66,69l1.7-3.1' +
+ 'a1.8,1.8,0,1,1,3.2,1.8l-0.3.5,7.3,0.4-3.5-6.2-0.5.9' +
+ 'a1.8,1.8,0,0,1-2.5.6l-9.8-6.1a1.8,1.8,0,0,1,1.9-3.1' +
+ 'l8.2,5.1,1.2-1.9a1.9,1.9,0,0,1,1.6-.9,1.8,1.8,0,0,1,1.6.9' +
+ 'l6.8,11.8A1.8,1.8,0,0,1,81.2,72.5Z' +
+ 'M48.8,89.7a1.8,1.8,0,0,1-1.6-1l-6.6-12a1.8,1.8,0,0,1,1.6-2.7h3.3' +
+ 'a1.8,1.8,0,0,1,0,3.7H45.3L48.7,84l3.4-6.3h-1' +
+ 'a1.8,1.8,0,0,1-1.8-1.8V64.4a1.8,1.8,0,0,1,1.8-1.8h0' +
+ 'a1.8,1.8,0,0,1,1.8,1.8v9.7h2.3a1.8,1.8,0,0,1,1.6,2.7l-6.4,12' +
+ 'a1.8,1.8,0,0,1-1.6,1h0Z' +
+ 'M16.9,71.3a1.8,1.8,0,0,1-1.6-2.7l6.7-12' +
+ 'a1.8,1.8,0,0,1,1.6-.9,1.9,1.9,0,0,1,1.6.9l1.7,2.8' +
+ 'a1.8,1.8,0,1,1-3.1,1.9H23.7l-3.5,6.3,7.1-.5L26.8,66' +
+ 'a1.8,1.8,0,0,1,.6-2.5l9.8-6.1a1.8,1.8,0,0,1,1.9,3.1l-8.2,5.1' +
+ 'L32,67.6a1.8,1.8,0,0,1-1.4,2.8l-13.5.9H16.9Z' +
+ 'M35.8,46.9L35,46.7l-8.7-4.3-1,2a1.8,1.8,0,0,1-3.1.3l-8-11' +
+ 'a1.8,1.8,0,0,1,1.4-2.9l13.6-.7' +
+ 'a1.8,1.8,0,0,1,1.6.8,1.8,1.8,0,0,1,.1,1.8l-1.6,3' +
+ 'a1.8,1.8,0,1,1-3.3-1.7h0.1l-7.1.4,4.2,5.8,0.5-.9' +
+ 'a1.8,1.8,0,0,1,2.5-.8l10.4,5.1A1.8,1.8,0,0,1,35.8,46.9Z' +
+ 'M60.5,49.9a11.3,11.3,0,1,1-3.3-8A11.2,11.2,0,0,1,60.5,49.9Z'],
+
+ ['m_microwave', 'M63.5,38.9a2.8,2.8,0,0,0-2.1,1H49.6V15.1' +
+ 'a1.8,1.8,0,0,0-.5-1.3,1.8,1.8,0,0,0-1.3-.5h0' +
+ 'a28.4,28.4,0,0,0-15.7,52V82.5H22.8a1.8,1.8,0,0,0,0,3.7H45' +
+ 'a1.8,1.8,0,1,0,0-3.7H35.8V67.4a28.4,28.4,0,0,0,12,2.8h0' +
+ 'a1.9,1.9,0,0,0,1.8-1.8V43.6H61.3a2.8,2.8,0,0,0,2.1,1' +
+ 'A2.8,2.8,0,1,0,63.5,38.9ZM46,66.4a24.8,24.8,0,0,1,0-49.4V66.4Z' +
+ 'M41.7,64H41.2a24.3,24.3,0,0,1-12.9-9.7L28,53.9' +
+ 'a1.8,1.8,0,0,1,3.1-2l0.2,0.3a20.3,20.3,0,0,0,10.9,8.2' +
+ 'A1.8,1.8,0,0,1,41.7,64Z' +
+ 'M66.4,53.1a1.8,1.8,0,0,1-.5-3.6A8.1,8.1,0,0,0,66,34' +
+ 'a1.8,1.8,0,0,1,1.1-3.5A11.8,11.8,0,0,1,67,53H66.4Z' +
+ 'M66.5,58.2a1.8,1.8,0,0,1-.4-3.6,13.1,13.1,0,0,0,0-25.7,' +
+ '1.8,1.8,0,1,1,.7-3.6,16.8,16.8,0,0,1,0,32.9H66.5Z'],
+
+ ['m_relatedIntents', 'M34.5,73.1A7.5,7.5,0,1,1,42,65.6,7.5,7.5,' +
+ '0,0,1,34.5,73.1Zm0-11.3a3.8,3.8,0,1,0,3.8,3.8' +
+ 'A3.8,3.8,0,0,0,34.5,61.8Z' +
+ 'M56.7,34.3a1.8,1.8,0,0,1-1.8,1.9H42.6v3.1a3.1,3.1,0,0,1-3,3' +
+ 'H36.4V54.5a1.9,1.9,0,0,1-3.7,0V42.3h-3a3.1,3.1,0,0,1-3-3' +
+ 'V29.5a3,3,0,0,1,3-3h9.8a3,3,0,0,1,3,3v3H54.8' +
+ 'A1.8,1.8,0,0,1,56.7,34.3Z' +
+ 'M66,41.8a7.5,7.5,0,1,1,7.5-7.5A7.5,7.5,0,0,1,66,41.8Z' +
+ 'm0-11.3a3.8,3.8,0,1,0,3.8,3.8A3.8,3.8,0,0,0,66,30.5Z'],
+
+ ['m_intentTraffic', 'M28.9,77.6H28.5a1.8,1.8,0,0,1-1.4-2.2L39,23.3' +
+ 'a1.8,1.8,0,0,1,3.6.8l-12,52.1A1.8,1.8,0,0,1,28.9,77.6Z' +
+ 'M71.1,77.6a1.8,1.8,0,0,1-1.8-1.4l-12-52.1a1.8,1.8,0,0,1,3.6-.8' +
+ 'l12,52.1a1.8,1.8,0,0,1-1.4,2.2H71.1Z' +
+ 'M49.9,26.2A1.8,1.8,0,0,1,48,24.4V23.7a1.8,1.8,0,0,1,3.7,0' +
+ 'v0.7A1.8,1.8,0,0,1,49.9,26.2Z' +
+ 'M49.9,43.6A1.8,1.8,0,0,1,48,41.8V40.2a1.8,1.8,0,0,1,3.7,0' +
+ 'v1.6A1.8,1.8,0,0,1,49.9,43.6Zm0-8.7A1.8,1.8,0,0,1,48,33.1' +
+ 'V31.5a1.8,1.8,0,0,1,3.7,0v1.6A1.8,1.8,0,0,1,49.9,34.9Z' +
+ 'M49.9,69.8A1.8,1.8,0,0,1,48,67.9V66.3a1.8,1.8,0,0,1,3.7,0' +
+ 'v1.6A1.8,1.8,0,0,1,49.9,69.8Zm0-8.7A1.8,1.8,0,0,1,48,59.2' +
+ 'V57.6a1.8,1.8,0,0,1,3.7,0v1.6A1.8,1.8,0,0,1,49.9,61.1Zm0-8.7' +
+ 'A1.8,1.8,0,0,1,48,50.5V48.9a1.8,1.8,0,0,1,3.7,0v1.6' +
+ 'A1.8,1.8,0,0,1,49.9,52.3Z' +
+ 'M49.9,77.6A1.8,1.8,0,0,1,48,75.7V75a1.8,1.8,0,0,1,3.7,0v0.7' +
+ 'A1.8,1.8,0,0,1,49.9,77.6Z'],
+
+ ['m_firewall', 'M75.3,88.8H65.6a4.9,4.9,0,0,1-4.9-4.9V79.1' +
+ 'a4.9,4.9,0,0,1,4.9-4.9h9.7a4.9,4.9,0,0,1,4.9,4.9v4.8' +
+ 'A4.9,4.9,0,0,1,75.3,88.8ZM65.6,77.9a1.2,1.2,0,0,0-1.2,1.2v4.8' +
+ 'a1.2,1.2,0,0,0,1.2,1.2h9.7a1.2,1.2,0,0,0,1.2-1.2V79.1' +
+ 'a1.2,1.2,0,0,0-1.2-1.2H65.6Z' +
+ 'M53.9,88.8H24.7a4.9,4.9,0,0,1-4.9-4.9V79.1a4.9,4.9,0,0,1,4.9-4.9' +
+ 'H53.9a4.9,4.9,0,0,1,4.9,4.9v4.8A4.9,4.9,0,0,1,53.9,88.8Z' +
+ 'M24.7,77.9a1.2,1.2,0,0,0-1.2,1.2v4.8a1.2,1.2,0,0,0,1.2,1.2' +
+ 'H53.9a1.2,1.2,0,0,0,1.2-1.2V79.1a1.2,1.2,0,0,0-1.2-1.2H24.7Z' +
+ 'M34.4,72.1H24.7a4.9,4.9,0,0,1-4.9-4.9V62.4a4.9,4.9,0,0,1,4.9-4.9' +
+ 'h9.7a4.9,4.9,0,0,1,4.9,4.9v4.8A4.9,4.9,0,0,1,34.4,72.1Z' +
+ 'M24.7,61.2a1.2,1.2,0,0,0-1.2,1.2v4.8a1.2,1.2,0,0,0,1.2,1.2h9.7' +
+ 'a1.2,1.2,0,0,0,1.2-1.2V62.4a1.2,1.2,0,0,0-1.2-1.2H24.7Z' +
+ 'M75.3,72.1H46.1a4.9,4.9,0,0,1-4.9-4.9V62.4a4.9,4.9,0,0,1,4.9-4.9' +
+ 'H75.3a4.9,4.9,0,0,1,4.9,4.9v4.8A4.9,4.9,0,0,1,75.3,72.1Z' +
+ 'M46.1,61.2a1.2,1.2,0,0,0-1.2,1.2v4.8a1.2,1.2,0,0,0,1.2,1.2H75.3' +
+ 'a1.2,1.2,0,0,0,1.2-1.2V62.4a1.2,1.2,0,0,0-1.2-1.2H46.1Z' +
+ 'M67.7,40.7c-0.2-4.8-3.6-8.8-6.3-12s-3-3.6-3.3-4.8' +
+ 'a13.1,13.1,0,0,1,1-9.7,2.2,2.2,0,0,0,.3-1.1,1.9,1.9,0,0,' +
+ '0-.8-1.5,1.8,1.8,0,0,0-1.7-.2c-0.3.1-8.1,3-10.4,14.7-1.4-2.3' +
+ '-3.4-4.6-5.9-5.4a1.8,1.8,0,0,0-2,.6,1.9,1.9,0,0,0-.2,2.1,6.8,6.8,' +
+ '0,0,1-.6,7.1c-1.4,1.8-5.9,8.3-4.1,14.9,1.2,4.1,4.6,7.3,10.2,9.4' +
+ 'h1.6l0.2-.2h0.1l0.2-.3,0.2-.3h0V53.2a1.6,1.6,0,0,0,0-.4,1.7,1.7,' +
+ '0,0,0,0-.3h0V52.2h0V51.8L46,51.6H45.9c-0.3-.4-2.4-3-2.1-5.9' +
+ 'a5,5,0,0,1,.7-2.1c1,2,2.7,4.4,5.5,4.6a5.1,5.1,0,0,0,3.9-1.3' +
+ 'A8.2,8.2,0,0,0,56,43.5a7.3,7.3,0,0,1,.3,2.6,7.6,7.6,0,0,' +
+ '1-3.1,5.3,1.8,1.8,0,0,0,1.2,3.3h0c0.3,0,6.3-.1,10.1-4.3' +
+ 'C66.9,47.9,67.9,44.6,67.7,40.7Zm-5.8,7.1a9,9,0,0,1-2.7,2,9.9,9.9,' +
+ '0,0,0,.9-3.5c0.3-5.1-3.4-9.2-3.5-9.4a1.8,1.8,0,0,0-3.2,1.2' +
+ 'c0,1.4-.5,4.8-1.8,5.9a1.4,1.4,0,0,1-1.2.4c-1.7-.1-2.9-3.3-3.3-4.8' +
+ 'a1.8,1.8,0,0,0-1.2-1.4,1.8,1.8,0,0,0-1.8.3,9.7,9.7,0,0,' +
+ '0-4,6.8,9.4,9.4,0,0,0,.3,3.1,8.4,8.4,0,0,1-3.1-4.4' +
+ 'c-1.4-5,2.6-10.5,3.5-11.7A10,10,0,0,0,42.8,27,27.2,27.2,0,0,' +
+ '1,46,33.7a1.8,1.8,0,0,0,3.6-.6,33.2,33.2,0,0,1,.4-5.4,19.3,19.3,' +
+ '0,0,1,4-9.7,19.1,19.1,0,0,0,.5,6.7c0.5,2.1,2.2,4,4.1,6.3' +
+ 's5.3,6.2,5.5,9.8A9.1,9.1,0,0,1,61.9,47.8Z'],
+
+ ['m_balancer', 'M33.4,56.6H26.7a3.1,3.1,0,0,1-3-3V46.9a3.1,3.1,0,0,1,3-3' +
+ 'h6.7a3.1,3.1,0,0,1,3,3v6.7A3.1,3.1,0,0,1,33.4,56.6Z' +
+ 'M73.3,36.5H66.6a3.1,3.1,0,0,1-3-3V26.7a3.1,3.1,0,0,1,3-3' +
+ 'h6.7a3.1,3.1,0,0,1,3,3v6.7A3.1,3.1,0,0,1,73.3,36.5Z' +
+ 'M73.3,56.1H66.6a3.1,3.1,0,0,1-3-3V46.4a3.1,3.1,0,0,1,3-3' +
+ 'h6.7a3.1,3.1,0,0,1,3,3v6.7A3.1,3.1,0,0,1,73.3,56.1Z' +
+ 'M73.3,76.3H66.6a3.1,3.1,0,0,1-3-3V66.6a3.1,3.1,0,0,1,3-3' +
+ 'h6.7a3.1,3.1,0,0,1,3,3v6.7A3.1,3.1,0,0,1,73.3,76.3Z' +
+ 'M62.7,70.4a1.9,1.9,0,0,1-1.8,1.5H60.5a15.2,15.2,0,0,1-10.9-9.1' +
+ 'c-3.9-8.6-4.7-9.8-10.8-10.4a1.8,1.8,0,0,1-1.6-1.7,0.3,0.3,0,0,1,0-.1' +
+ 'h0V50.1h0a1.8,1.8,0,0,1,1.7-2c6.2-.5,7-1.7,10.9-10.4' +
+ 'a15.2,15.2,0,0,1,10.7-9.1,1.8,1.8,0,1,1,.8,3.6,11.5,11.5,0,0,0-8.2,7' +
+ 'c-2,4.4-3.4,7.3-5.3,9.2H60.8a1.8,1.8,0,1,1,0,3.7h-13' +
+ 'c1.8,1.9,3.2,4.8,5.2,9.1a11.5,11.5,0,0,0,8.3,7' +
+ 'A1.9,1.9,0,0,1,62.7,70.4Z'],
+
+ ['m_ips', 'M79.4,26.8a0.9,0.9,0,0,0-.1-0.3V26.1l-0.3-.4-0.2-.2' +
+ 'H78.6c-1.3-1-11-8-28.3-8H49.7c-18.7,0-28.1,7.8-28.5,8.1' +
+ 'a2,2,0,0,0-.7,1.3c-1.1,22.8,6.7,36.8,13.4,44.4S48.3,82.4,49.1,82.7' +
+ 'h1.6c0.3-.1,7.9-3.1,15.3-11.4S80.5,49.7,79.4,26.8ZM50,79' +
+ 'c-3.9-1.7-27.3-13.4-25.8-51.1,2.3-1.6,10.7-6.8,25.5-6.8h0.5' +
+ 'c14.4,0,23.2,5.2,25.5,6.8C77.2,65.6,53.9,77.3,50,79Z' +
+ 'M41.7,41.9a1.8,1.8,0,0,1-1.8-1.9V37.3a9.8,9.8,0,0,1,9.8-9.8h0.6' +
+ 'a9.8,9.8,0,0,1,9.8,9.8v2.6a1.8,1.8,0,1,1-3.7,0V37.3' +
+ 'a6.1,6.1,0,0,0-6.1-6.1H49.6a6.1,6.1,0,0,0-6.1,6.1v2.8' +
+ 'A1.8,1.8,0,0,1,41.7,41.9Z' +
+ 'M58.6,63.1H41.3a3.7,3.7,0,0,1-3.6-3.7V47.3a3.7,3.7,0,0,1,3.6-3.7' +
+ 'H58.6a3.8,3.8,0,0,1,3.6,3.7V59.4A3.7,3.7,0,0,1,58.6,63.1Z'],
+
+ ['m_ids', 'M69.7,41.5c-2.9,3.6-9.1,5-18.6,4.2a18.4,18.4,0,0,0-8.9,1.4' +
+ 'H41.5a1.8,1.8,0,0,1-.7-3.5A22.2,22.2,0,0,1,51.5,42' +
+ 'c7.4,0.6,12.5-.2,14.8-2.3L63.2,22.6c-5,2.9-12.5,2.4-15.9,1.9' +
+ 'a18.7,18.7,0,0,0-12.7,3.4H34.3l9.5,52.4a1.9,1.9,0,0,1-1.5,2.1' +
+ 'H42a1.8,1.8,0,0,1-1.8-1.5L29.9,24.3a1.8,1.8,0,1,1,3.6-.6v0.4' +
+ 'a22.3,22.3,0,0,1,14.1-3.2C55,21.8,60.9,20.7,63,18' +
+ 'a1.8,1.8,0,0,1,1.9-.6,1.8,1.8,0,0,1,1.4,1.5L70.1,40' +
+ 'A1.9,1.9,0,0,1,69.7,41.5Z'],
+
+ ['m_olt', 'M83,47.6H64.5a1.8,1.8,0,0,0-1.9,1.9V74.3' +
+ 'a1.8,1.8,0,0,0,1.9,1.8H83a1.8,1.8,0,0,0,1.8-1.8V49.5' +
+ 'A1.8,1.8,0,0,0,83,47.6ZM81.1,72.5H77.7v-5a1.4,1.4,0,0,0-1.4-1.4' +
+ 'H72.1a1.4,1.4,0,0,0-1.4,1.4v5H66.3V51.3H81.1V72.5Z' +
+ 'M70.9,56.9H69.5a1.8,1.8,0,0,1,0-3.7h1.3A1.8,1.8,0,1,1,70.9,56.9Z' +
+ 'M77.5,56.9H76.1a1.8,1.8,0,0,1,0-3.7h1.3A1.8,1.8,0,1,1,77.5,56.9Z' +
+ 'M70.9,62.5H69.5a1.8,1.8,0,0,1,0-3.7h1.3A1.8,1.8,0,1,1,70.9,62.5Z' +
+ 'M77.5,62.5H76.1a1.8,1.8,0,0,1,0-3.7h1.3A1.8,1.8,0,1,1,77.5,62.5Z' +
+ 'M40.9,56.2H36.1a1.8,1.8,0,1,1,0-3.7h4.8A1.8,1.8,0,0,1,40.9,56.2Z' +
+ 'M82.2,25.7V43.9a1.8,1.8,0,0,1-3.7,0V27.5H32.3V59.8H58.4' +
+ 'a1.8,1.8,0,0,1,0,3.7h-28a1.9,1.9,0,0,1-1.8-1.9V45.5H17' +
+ 'a1.8,1.8,0,0,1,0-3.7H28.6V25.7a1.8,1.8,0,0,1,1.8-1.8h50' +
+ 'A1.8,1.8,0,0,1,82.2,25.7Z'],
+
+ ['m_onu', 'M39.8,58.7H35a1.8,1.8,0,1,1,0-3.7h4.9' +
+ 'A1.8,1.8,0,1,1,39.8,58.7Z' +
+ 'M81.4,28.3V46.5a1.9,1.9,0,0,1-3.7,0V30.2H31.2V62.4H57.4' +
+ 'a1.8,1.8,0,1,1,0,3.7H29.3a1.8,1.8,0,0,1-1.8-1.9V48.1H15.9' +
+ 'a1.8,1.8,0,1,1,0-3.7H27.5V28.3a1.8,1.8,0,0,1,1.8-1.8H79.5' +
+ 'A1.8,1.8,0,0,1,81.4,28.3Z' +
+ 'M85.8,60.3L75.1,49.6a1.8,1.8,0,0,0-2.6,0L61.6,60.3' +
+ 'a1.8,1.8,0,0,0,0,2.6,1.8,1.8,0,0,0,2.6,0l0.2-.2v8.8' +
+ 'a1.8,1.8,0,0,0,1.8,1.8H81.2a1.8,1.8,0,0,0,1.8-1.8V62.7l0.2,0.2' +
+ 'A1.8,1.8,0,0,0,85.8,60.3Zm-6.5,9.4H68.1V59.1l5.6-5.6L79.4,59V69.7Z'],
+
+ ['m_swap', 'M62.2,54.7l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V47.1' +
+ 'a1.8,1.8,0,1,1,3.7,0v2.6l10.8-6L64,38v2.6a1.8,1.8,0,0,1-1.8,1.8' +
+ 'H47.1a1.8,1.8,0,0,1,0-3.7H60.3V34.9a1.8,1.8,0,0,1,2.7-1.6' +
+ 'l16.5,8.8a1.8,1.8,0,0,1,0,3.2L63.1,54.5Z' +
+ 'M37.4,66.6l-0.9-.2L20,57.2a1.8,1.8,0,0,1,0-3.2l16.5-8.8' +
+ 'a1.8,1.8,0,0,1,2.7,1.6v3.8H52.5a1.8,1.8,0,0,1,0,3.7H37.4' +
+ 'a1.8,1.8,0,0,1-1.8-1.8V49.9L24.8,55.7l10.8,6V59' +
+ 'a1.8,1.8,0,1,1,3.7,0v5.7a1.8,1.8,0,0,1-.9,1.6Z'],
+
+ ['m_shortestGeoPath', 'M49.7,17.5A32.3,32.3,0,1,0,81.9,49.8,32.3,32.3,0,' +
+ '0,0,49.7,17.5Zm0,60.9A28.6,28.6,0,1,1,78.2,49.8,28.6,28.6,0,0,1,' +
+ '49.7,78.4Z M60.9,49a1.5,1.5,0,0,1-.1-0.4,0.8,0.8,0,0,1,0-.3' +
+ 'C60.9,48.5,60.9,48.8,60.9,49Z' +
+ 'M75.4,48.6a1.8,1.8,0,0,1-1.8,1.8h-9' +
+ 'a38.2,38.2,0,0,1-8.3,22.8,1.8,1.8,0,0,1-1.4.7,1.8,1.8,0,0,' +
+ '1-1.1-.4,1.8,1.8,0,0,1-.3-2.6,34.6,34.6,0,0,0,7.5-21.6V49' +
+ 'c0-.3,0-0.5,0-0.7a0.1,0.1,0,0,1,0-.1,33.2,33.2,0,0,0-.7-6.1H60' +
+ 'a5.1,5.1,0,0,1-3.1-9.1A33,33,0,0,0,52.9,27' +
+ 'a1.8,1.8,0,1,1,2.8-2.4,36.2,36.2,0,0,1,4.7,7.2,5.1,5.1,0,0,' +
+ '1,3.1,8.7,38.3,38.3,0,0,1,.9,6.2h9.1A1.8,1.8,0,0,1,75.4,48.6Z' +
+ 'M46.5,71a1.8,1.8,0,0,1-1.4,3,1.8,1.8,0,0,1-1.4-.7,36.3,36.3,' +
+ '0,0,1-4.3-6.7H39a5.1,5.1,0,0,1-2.9-9.3,40.3,40.3,0,0,1-.8-6.9H26' +
+ 'a1.8,1.8,0,0,1,0-3.7h9.3a38,38,0,0,1,8.3-21.5,1.8,1.8,0,1,1,2.8,' +
+ '2.3,34.5,34.5,0,0,0-7.6,21.8,36,36,0,0,0,.7,7.2,5.1,5.1,0,0,' +
+ '1,4.5,5.1,5,5,0,0,1-1.4,3.5A33.4,33.4,0,0,0,46.5,71Z' +
+ 'M44.9,56.9a1.8,1.8,0,0,1-1.1-.4,1.8,1.8,0,0,1-.3-2.6l0.6-.8' +
+ 'A1.8,1.8,0,1,1,47,55.3l-0.6.8A1.8,1.8,0,0,1,44.9,56.9Zm3.9-5' +
+ 'a1.8,1.8,0,0,1-1.1-.4,1.8,1.8,0,0,1-.3-2.6l0.6-.8' +
+ 'a1.8,1.8,0,1,1,2.9,2.3l-0.6.8A1.8,1.8,0,0,1,48.8,51.9Zm3.9-5' +
+ 'a1.8,1.8,0,0,1-1.1-.4,1.8,1.8,0,0,1-.3-2.6l0.6-.8' +
+ 'a1.8,1.8,0,1,1,2.9,2.3l-0.6.8A1.8,1.8,0,0,1,52.7,46.9Z'],
+
+ ['m_source', 'M71,63.8l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V57.1' +
+ 'a1.8,1.8,0,0,1,3.7,0v1.7l8.2-4.5-8.2-4.4v1.7A1.8,1.8,0,0,1,71,53.4' +
+ 'H58.2a1.8,1.8,0,0,1,0-3.7H69.2V46.8a1.8,1.8,0,0,1,2.7-1.6l14,7.5' +
+ 'a1.8,1.8,0,0,1,0,3.2l-14,7.7Z' +
+ 'M32.7,77.7a3.6,3.6,0,0,1-3.1-1.8L16.1,52.1l-0.9-1.6' +
+ 'a19.3,19.3,0,0,1-2.1-8.7,19.6,19.6,0,0,1,6.1-14.2' +
+ 'A19.5,19.5,0,0,1,52.1,40.5h0a19.5,19.5,0,0,1-2,9.9l-1,1.8' +
+ 'L35.8,75.9A3.6,3.6,0,0,1,32.7,77.7Zm0-51.7' +
+ 'A15.8,15.8,0,0,0,18.5,48.8l0.8,1.4L32.7,73.9,46,50.3l0.8-1.4' +
+ 'a15.9,15.9,0,0,0,1.6-8.1h0A15.8,15.8,0,0,0,33.6,26h-1Z' +
+ 'm0,21.1A8.2,8.2,0,1,1,40.8,39,8.2,8.2,0,0,1,32.7,47.1Z' +
+ 'm0-12.6A4.5,4.5,0,1,0,37.1,39,4.5,4.5,0,0,0,32.7,34.5Z'],
+
+ ['m_destination', 'M30.3,63.8l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V57.1' +
+ 'a1.8,1.8,0,0,1,3.7,0v1.7l8.2-4.5-8.2-4.4v1.7a1.8,1.8,0,0,1-1.8,1.8' +
+ 'H17.5a1.8,1.8,0,1,1,0-3.7H28.4V46.8a1.8,1.8,0,0,1,2.7-1.6l14,7.5' +
+ 'a1.8,1.8,0,0,1,0,3.2l-14,7.7Z' +
+ 'M64.9,77.7a3.6,3.6,0,0,1-3.1-1.8L48.3,52.1l-0.9-1.6' +
+ 'a19.3,19.3,0,0,1-2-8.6,19.6,19.6,0,0,1,6.1-14.2' +
+ 'A19.5,19.5,0,0,1,84.3,40.5a19.5,19.5,0,0,1-1.9,9.8v0.2l-0.9,1.7' +
+ 'L68,75.9A3.6,3.6,0,0,1,64.9,77.7ZM50.7,48.8l0.8,1.4' +
+ 'L64.9,73.9,78.2,50.3,79,48.8h0a15.8,15.8,0,0,0,1.6-8' +
+ 'a15.8,15.8,0,1,0-29.9,8h0Zm14.1-1.7' +
+ 'A8.2,8.2,0,1,1,73,39,8.2,8.2,0,0,1,64.9,47.1Z' +
+ 'm0-12.6A4.5,4.5,0,1,0,69.3,39,4.5,4.5,0,0,0,64.9,34.5Z'],
+
+ ['m_topo', 'M31.3,73H21.5a3.1,3.1,0,0,1-3-3V60.1a3.1,3.1,0,0,1,3-3' +
+ 'h9.8a3.2,3.2,0,0,1,3,3V70A3.1,3.1,0,0,1,31.3,73Z' +
+ 'M78.5,46.7H68.7a3.1,3.1,0,0,1-3-3V33.8a3.1,3.1,0,0,1,3-3h9.8' +
+ 'a3.1,3.1,0,0,1,3,3v9.8A3.1,3.1,0,0,1,78.5,46.7Z' +
+ 'M40.8,42.9H31a3.1,3.1,0,0,1-3-3V30a3.1,3.1,0,0,1,3-3' +
+ 'h9.9a2.9,2.9,0,0,1,2.9,3v9.8A3.1,3.1,0,0,1,40.8,42.9Z' +
+ 'M37.4,66.1a1.8,1.8,0,0,1-1.2-3.3L61.1,42a1.8,1.8,0,1,1,2.4,2.8' +
+ 'L38.6,65.7A1.8,1.8,0,0,1,37.4,66.1Z' +
+ 'M27.4,55.5a1.8,1.8,0,0,1-1.5-3l5.8-7.7a1.8,1.8,0,1,1,2.9,2.2' +
+ 'l-5.8,7.7A1.8,1.8,0,0,1,27.4,55.5Z' +
+ 'M62.5,39.7H62.2L46.6,36.5a1.8,1.8,0,1,1,.7-3.6L62.9,36' +
+ 'A1.8,1.8,0,0,1,62.5,39.7Z'],
+
+ ['m_shortestPath', 'M28.2,31.2H19.5a3,3,0,0,1-3-3V19.5a3,3,0,0,1,3-3' +
+ 'h8.6c1.8,0.4,3,1.4,3,3v8.6A3,3,0,0,1,28.2,31.2Z' +
+ 'M80.2,83.2H71.6a3,3,0,0,1-3-3V71.5a3,3,0,0,1,3-3h8.6' +
+ 'c1.7,0.4,3,1.4,3,3v8.6A3,3,0,0,1,80.2,83.2Z' +
+ 'M67.6,67.4a1.8,1.8,0,0,1-1.3.5,1.9,1.9,0,0,1-1.3-.5L54.7,57.1' +
+ 'H45.6a3,3,0,0,1-3-3V45.5a2.1,2.1,0,0,1,.1-0.5L32.3,34.7' +
+ 'a1.8,1.8,0,0,1,0-2.6,1.9,1.9,0,0,1,2.6,0L45.3,42.5h8.9' +
+ 'a3,3,0,0,1,3,3v8.6a0.9,0.9,0,0,1,0,.2L67.6,64.8' +
+ 'A1.8,1.8,0,0,1,67.6,67.4Z'],
+
+ ['m_disjointPaths', 'M67.7,59.8h9.4a2.9,2.9,0,0,1,3,3v9.4' +
+ 'a3.1,3.1,0,0,1-3,3H67.7a3.1,3.1,0,0,1-3-3V62.9' +
+ 'A3.1,3.1,0,0,1,67.7,59.8Z' +
+ 'M22.9,59.8h9.4a2.9,2.9,0,0,1,3,3v9.4a3.1,3.1,0,0,1-3,3H22.9' +
+ 'a3.1,3.1,0,0,1-3-3V62.9A3.1,3.1,0,0,1,22.9,59.8Z' +
+ 'M45.3,24.7h9.4a2.9,2.9,0,0,1,3,3v9.4a3.1,3.1,0,0,1-3,3H45.3' +
+ 'a3.1,3.1,0,0,1-3-3V27.7A3.1,3.1,0,0,1,45.3,24.7Z' +
+ 'M65.9,58.5a1.8,1.8,0,0,1-1.5-.8L55.3,44.3a1.8,1.8,0,0,1,3.1-2.1' +
+ 'l9.1,13.4A1.8,1.8,0,0,1,65.9,58.5Z' +
+ 'M61.1,68.8H39.1a1.8,1.8,0,1,1,0-3.7H61.1A1.8,1.8,0,0,1,61.1,68.8Z' +
+ 'M35.5,59.9l-1-.3a1.8,1.8,0,0,1-.6-2.5l8.8-14.3' +
+ 'a1.8,1.8,0,0,1,3.1,1.9L37.1,59A1.8,1.8,0,0,1,35.5,59.9Z'],
+
+ ['m_region', 'M49.8,70.9a3.4,3.4,0,0,1-3-1.8L34.3,47l-0.8-1.5' +
+ 'a18.2,18.2,0,0,1-1.9-8.2,18.4,18.4,0,0,1,5.8-13.3' +
+ 'A18.3,18.3,0,0,1,68.1,36.1h0a18.4,18.4,0,0,1-1.9,9.3' +
+ 'L65.3,47,52.8,69.2A3.4,3.4,0,0,1,49.8,70.9Zm0-48.3' +
+ 'A14.6,14.6,0,0,0,36.7,43.8l0.7,1.3L49.8,67,62.2,45.2l0.8-1.3' +
+ 'a14.7,14.7,0,0,0,1.5-7.5h0A14.8,14.8,0,0,0,50.7,22.7H49.8Z' +
+ 'm0,19.7a7.7,7.7,0,1,1,7.7-7.7A7.7,7.7,0,0,1,49.8,42.4Zm0-11.8' +
+ 'a4.1,4.1,0,1,0,4.1,4.1A4.1,4.1,0,0,0,49.8,30.6Z' +
+ 'M81.7,80.8H17.9a1.8,1.8,0,0,1-1.6-2.7l9.2-16.8' +
+ 'a1.8,1.8,0,0,1,1.6-1h9.5a1.8,1.8,0,1,1,0,3.7H28.2L21,77.1H78.6' +
+ 'L71.4,64H61.9a1.8,1.8,0,1,1,0-3.7H72.5a1.8,1.8,0,0,1,1.6,1' +
+ 'l9.2,16.8A1.8,1.8,0,0,1,81.7,80.8Z'],
+]);
+
+export const extraGlyphs = new Map<string, string>([
+ ['_yang', '0 0 400 400'],
+ ['yang', 'M323.3,199.2a33.2,33.2,0,1,1-66.4,0' +
+ 'c0-18.4,14.9-34.1,33.2-33.3S323.3,180.8,323.3,199.2Z' +
+ 'M286.5,289.9c-78.2-.3-86.6-72.2-86.9-89.1s-14.6-91.8-88.3-88.3' +
+ 'c-7.5.3-34.6,1.2-56.9,20.1-25.8,21.8-29,53.9-30.5,68.2-0.2,' +
+ '2.2-.4,4.4-0.5,6.5h0a175.5,175.5,0,0,0,171,172.9H199' +
+ 'a175.5,175.5,0,0,0,58.6-10l3.9-1.4,3.9-1.5,3.9-1.7h0' +
+ 'l3.9-1.7,2.8-1.3,2.7-1.4a175.6,175.6,0,0,0,95.9-155.1' +
+ 'C372.4,226.7,358,290.1,286.5,289.9ZM110.1,237.7' +
+ 'A33.6,33.6,0,1,1,143.7,204,33.6,33.6,0,0,1,110.1,237.7Z'],
+]);
+
+
+/**
+ * ONOS GUI -- SVG -- Glyph Data Service
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class GlyphDataService {
+
+ constructor(
+ private log: LogService
+ ) {
+ this.log.debug('GlyphDataService constructed');
+ }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon.service.ts
new file mode 100644
index 0000000..6ced162
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon.service.ts
@@ -0,0 +1,245 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { GlyphService } from './glyph.service';
+import { LogService } from '../log.service';
+import { SvgUtilService } from './svgutil.service';
+import * as d3 from 'd3';
+
+const vboxSize = 50;
+const cornerSize = vboxSize / 10;
+const viewBox = '0 0 ' + vboxSize + ' ' + vboxSize;
+
+export const glyphMapping = new Map<string, string>([
+ // Maps icon ID to the glyph ID it uses.
+ // NOTE: icon ID maps to a CSS class for styling that icon
+ ['active', 'checkMark'],
+ ['inactive', 'xMark'],
+
+ ['plus', 'plus'],
+ ['minus', 'minus'],
+ ['play', 'play'],
+ ['stop', 'stop'],
+
+ ['upload', 'upload'],
+ ['download', 'download'],
+ ['delta', 'delta'],
+ ['nonzero', 'nonzero'],
+ ['close', 'xClose'],
+
+ ['m_ports', 'm_ports'],
+
+ ['topo', 'topo'],
+
+ ['refresh', 'refresh'],
+ ['query', 'query'],
+ ['garbage', 'garbage'],
+
+
+ ['upArrow', 'triangleUp'],
+ ['downArrow', 'triangleDown'],
+
+ ['appInactive', 'unknown'],
+
+ ['node', 'node'],
+ ['devIcon_SWITCH', 'switch'],
+ ['devIcon_ROADM', 'roadm'],
+ ['devIcon_OTN', 'otn'],
+
+ ['portIcon_DEFAULT', 'm_ports'],
+
+ ['meter', 'meterTable'], // TODO: m_meter icon?
+
+ ['deviceTable', 'switch'],
+ ['flowTable', 'flowTable'],
+ ['portTable', 'portTable'],
+ ['groupTable', 'groupTable'],
+ ['meterTable', 'meterTable'],
+ ['pipeconfTable', 'pipeconfTable'],
+
+ ['hostIcon_endstation', 'endstation'],
+ ['hostIcon_router', 'router'],
+ ['hostIcon_bgpSpeaker', 'bgpSpeaker'],
+
+ // navigation menu icons...
+ ['nav_apps', 'bird'],
+ ['nav_settings', 'cog'],
+ ['nav_cluster', 'node'],
+ ['nav_processors', 'allTraffic'],
+ ['nav_partitions', 'unknown'],
+
+ ['nav_topo', 'topo'],
+ ['nav_topo2', 'm_cloud'],
+ ['nav_devs', 'switch'],
+ ['nav_links', 'ports'],
+ ['nav_hosts', 'endstation'],
+ ['nav_intents', 'relatedIntents'],
+ ['nav_tunnels', 'ports'], // TODO: use tunnel glyph, when available
+ ['nav_yang', 'yang'],
+]);
+
+/**
+ * ONOS GUI -- SVG -- Icon Service
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class IconService {
+
+ constructor(
+ private gs: GlyphService,
+ private log: LogService,
+ private sus: SvgUtilService
+ ) {
+
+ this.log.debug('IconService constructed');
+ }
+
+ ensureIconLibDefs() {
+ const body = d3.select('body');
+ let svg = body.select('svg#IconLibDefs');
+ if (svg.empty()) {
+ svg = body.append('svg').attr('id', 'IconLibDefs');
+ svg.append('defs');
+ }
+ return svg.select('defs');
+ }
+
+ /**
+ * Load an icon
+ *
+ * @param div A D3 selection of the '<div>' element into which icon should load
+ * @param glyphId Identifies the glyph to use
+ * @param size The dimension of icon in pixels. Defaults to 20.
+ * @param installGlyph If truthy, will cause the glyph to be added to
+ * well-known defs element. Defaults to false.
+ * @param svgClass The CSS class used to identify the SVG layer.
+ * Defaults to 'embeddedIcon'.
+ */
+ loadIcon(div, glyphId: string = 'unknown', size: number = 20, installGlyph: boolean = true, svgClass: string = 'embeddedIcon') {
+ const dim = size || 20;
+ const svgCls = svgClass || 'embeddedIcon';
+ const gid = glyphId || 'unknown';
+ let g;
+ let svgIcon: any;
+
+ if (installGlyph) {
+ this.gs.loadDefs(this.ensureIconLibDefs(), [gid], true);
+ }
+ this.log.warn('loadEmbeddedIcon. install done');
+
+ svgIcon = div
+ .append('svg')
+ .attr('class', svgCls)
+ .attr('width', dim)
+ .attr('height', dim)
+ .attr('viewBox', viewBox);
+
+ g = svgIcon.append('g')
+ .attr('class', 'icon');
+
+ g.append('rect')
+ .attr('width', vboxSize)
+ .attr('height', vboxSize)
+ .attr('rx', cornerSize);
+
+ g.append('use')
+ .attr('width', vboxSize)
+ .attr('height', vboxSize)
+ .attr('class', 'glyph')
+ .attr('xlink:href', '#' + gid);
+ }
+
+ /**
+ * Load an icon by class.
+ * @param div A D3 selection of the <DIV> element into which icon should load
+ * @param iconCls The CSS class used to identify the icon
+ * @param size The dimension of icon in pixels. Defaults to 20.
+ * @param installGlyph If truthy, will cause the glyph to be added to
+ * well-known defs element. Defaults to false.
+ * @param svgClass The CSS class used to identify the SVG layer.
+ * Defaults to 'embeddedIcon'.
+ */
+ loadIconByClass(div, iconCls: string, size: number, installGlyph: boolean, svgClass= 'embeddedIcon') {
+ this.loadIcon(div, glyphMapping.get(iconCls), size, installGlyph, svgClass);
+ div.select('svg g').classed(iconCls, true);
+ }
+
+ /**
+ * Load an embedded icon.
+ */
+ loadEmbeddedIcon(div, iconCls: string, size: number) {
+ this.loadIconByClass(div, iconCls, size, true);
+ }
+
+ /**
+ * Load an icon only to the svg defs collection
+ *
+ * Note: This is added for use with IconComponent, where the icon's
+ * svg element is defined in the component template (and not built
+ * inline using d3 manipulation
+ *
+ * @param iconCls The icon class as a string
+ */
+ loadIconDef(iconCls: string): void {
+ this.gs.loadDefs(this.ensureIconLibDefs(), [glyphMapping.get(iconCls)], true);
+ this.log.debug('icon definition', iconCls, 'added to defs');
+ }
+
+
+ /**
+ * Add a device icon
+ *
+ * Adds a device glyph to the specified element.
+ * Returns the D3 selection of the glyph (use) element.
+ */
+ addDeviceIcon(elem, glyphId, iconDim) {
+ const gid = this.gs.glyphDefined(glyphId) ? glyphId : 'query';
+ return elem.append('use').attr({
+ 'xlink:href': '#' + gid,
+ width: iconDim,
+ height: iconDim,
+ });
+ }
+
+ addHostIcon(elem, radius, glyphId) {
+ const dim = radius * 1.5;
+ const xlate = -dim / 2;
+ const g = elem.append('g')
+ .attr('class', 'svgIcon hostIcon');
+
+ g.append('circle').attr('r', radius);
+
+ g.append('use').attr({
+ 'xlink:href': '#' + glyphId,
+ width: dim,
+ height: dim,
+ transform: this.sus.translate([xlate], xlate),
+ });
+ return g;
+ }
+
+ registerIconMapping(iconId, glyphId) {
+ if (glyphMapping[iconId]) {
+ this.log.warn('Icon with id', iconId, 'already mapped. Ignoring.');
+ } else {
+ // map icon-->glyph
+ glyphMapping[iconId] = glyphId;
+ // make sure definition is installed
+ this.gs.loadDefs(this.ensureIconLibDefs(), [glyphId], true);
+ }
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph-theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph-theme.css
new file mode 100644
index 0000000..12cdf30
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph-theme.css
@@ -0,0 +1,33 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Glyph Service (theme) -- CSS file
+ */
+
+.light svg .glyph,
+.dark svg .glyph.overlay {
+ fill: blue;
+}
+
+/*
+* NOTE: Keeping the theme black while we
+* wait for the mockup theme designs to be made
+*/
+.dark svg .glyph,
+.light svg .glyph.overlay {
+ fill: blue;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph.css
new file mode 100644
index 0000000..0743ff2
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph.css
@@ -0,0 +1,24 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Glyph Service (layout) -- CSS file
+ */
+
+svg .glyph {
+ stroke: none;
+ fill-rule: evenodd;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.css
new file mode 100644
index 0000000..8350a75
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.css
@@ -0,0 +1,87 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Icon Service (layout) -- CSS file
+ */
+
+svg#IconLibDefs {
+ display: none;
+}
+
+svg .svgIcon {
+ fill-rule: evenodd;
+}
+
+svg.embeddedIcon g.icon {
+ fill: none;
+}
+
+.ctrl-btns div svg.embeddedIcon g.icon use {
+ fill: #e0dfd6;
+}
+
+.ctrl-btns div.active svg.embeddedIcon g.icon use {
+ fill: #939598;
+}
+.ctrl-btns div.active:hover svg.embeddedIcon g.icon use {
+ fill: #ce5b58;
+}
+
+.ctrl-btns div.current-view svg.embeddedIcon g.icon rect {
+ fill: #518ecc;
+}
+.ctrl-btns div.current-view svg.embeddedIcon g.icon use {
+ fill: white;
+}
+
+svg.embeddedIcon .icon.active .glyph {
+ fill: #04bf34;
+}
+
+svg.embeddedIcon .icon.inactive .glyph {
+ fill: #c0242b;
+}
+
+svg.embeddedIcon .icon.active-rect .glyph {
+ fill:#939598;
+}
+
+svg.embeddedIcon .icon.active-sort .glyph {
+ fill:#333333;
+}
+
+svg.embeddedIcon g.icon.active-rect:hover use {
+ fill: #ce5b58;
+}
+
+svg.embeddedIcon g.icon.active-type .glyph {
+ fill: #3c3a3a;
+}
+
+svg.embeddedIcon g.icon.active-close:hover use {
+ fill: #ce5b58;
+}
+
+svg.embeddedIcon g.icon.active-close .glyph {
+ fill: #333333;
+}
+
+svg.embeddedIcon g.icon.details-icon .glyph {
+ fill: #0071bd;;
+}
+
+
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.html b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.html
new file mode 100644
index 0000000..a301c3c
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.html
@@ -0,0 +1,28 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~ http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+<div class="tooltip">
+<svg class="embeddedIcon" [attr.width]="iconSize" [attr.height]="iconSize" viewBox="0 0 50 50" (mouseover)="toolTipDisp = toolTip" (mouseout)="toolTipDisp = undefined">
+ <g class="icon" [ngClass]="classes">
+ <rect width="50" height="50" rx="5"></rect>
+ <use width="50" height="50" class="glyph" [attr.href]="iconTag()"></use>
+ </g>
+</svg>
+<!-- I'm fixing class as light as view encapsulation changes how the hirerarchy of css is handled -->
+
+<!-- <p id="tooltip" class="light" *ngIf="toolTip" [ngStyle]="{ 'display': toolTipDisp ? 'inline-block':'none'}">{{ toolTipDisp }}</p> -->
+
+ <span class="tooltiptext" [ngStyle]="{ 'display': toolTipDisp ? 'inline-block':'none'}">{{toolTipDisp}}</span>
+</div>
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.ts
new file mode 100644
index 0000000..5267aef
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.ts
@@ -0,0 +1,79 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Component, OnInit, OnChanges, Input } from '@angular/core';
+import { IconService, glyphMapping } from '../icon.service';
+import { LogService } from '../../log.service';
+
+/**
+ * Icon Component
+ *
+ * Note: This is an alternative to the Icon Directive from ONOS 1.0.0
+ * It has been implemented as a Component because it was inadvertently adding
+ * in a template through d3 DOM manipulations - it's better to make it a Comp
+ * and build a template the Angular 6 way
+ *
+ * Remember: The CSS files applied here only apply to this component
+ */
+@Component({
+ selector: 'onos-icon',
+ templateUrl: './icon.component.html',
+ styleUrls: [
+ './icon.component.css', './icon.theme.css',
+ './glyph.css', './glyph-theme.css',
+ './tooltip.css', './tooltip-theme.css'
+ ]
+})
+export class IconComponent implements OnInit, OnChanges {
+ @Input() iconId: string;
+ @Input() iconSize: number = 20;
+ @Input() toolTip: string = undefined;
+ @Input() classes: string = undefined;
+
+ // The displayed tooltip - undefined until mouse hovers over, then equals toolTip
+ toolTipDisp: string = undefined;
+
+ constructor(
+ private is: IconService,
+ private log: LogService
+ ) {
+ // Note: iconId is not available until initialization
+ this.log.debug('IconComponent constructed');
+ }
+
+ /**
+ * Icons are loaded in to the DOM under iconDefs
+ * TODO: Change this to use more standard Angular 6 mechanism
+ */
+ ngOnInit() {
+ this.is.loadIconDef(this.iconId);
+ }
+
+ /**
+ * This is needed in case the iconId changes while icon component
+ * is displayed on screen.
+ */
+ ngOnChanges() {
+ this.is.loadIconDef(this.iconId);
+ }
+
+ /**
+ * Get the corresponding iconTag from the glyphMapping in the iconService
+ * @returns The iconTag corresponding to the iconId of this instance
+ */
+ iconTag(): string {
+ return '#' + glyphMapping.get(this.iconId);
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.theme.css
new file mode 100644
index 0000000..f267b10
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.theme.css
@@ -0,0 +1,108 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Icon Service (theme) -- CSS file
+ */
+
+div.close-btn svg.embeddedIcon g.icon .glyph {
+ fill: #333333;
+}
+
+/* Sortable table headers */
+div.tableColSort svg.embeddedIcon .icon .glyph {
+ fill: #353333;
+}
+
+/* --- Control Buttons --- */
+
+/* INACTIVE */
+svg.embeddedIcon g.icon use {
+ fill: #e0dfd6;
+}
+/* note: no change for inactive buttons when hovered */
+
+
+/* ACTIVE */
+.ctrl-btns div.active svg.embeddedIcon g.icon use {
+ fill: #939598;
+}
+
+svg.embeddedIcon g.icon.active:hover use {
+ fill: #ce5b58;
+}
+
+/* CURRENT-VIEW */
+svg.embeddedIcon g.icon.current-view rect {
+ fill: #518ecc;
+}
+svg.embeddedIcon g.icon.current-view use {
+ fill: white;
+}
+
+/* REFRESH */
+svg.embeddedIcon g.icon.refresh use {
+ fill: #cdeff2;
+}
+svg.embeddedIcon g.icon.refresh:hover use {
+ fill: #ce5b58;
+}
+svg.embeddedIcon g.icon.refresh.active use {
+ fill: #009fdb;
+}
+svg.embeddedIcon g.icon.refresh.active:hover use {
+ fill: #ce5b58;
+}
+
+
+/* ========== DARK Theme ========== */
+
+ div.close-btn svg.embeddedIcon g.icon .glyph {
+ fill: #8d8d8d;
+}
+
+ div.tableColSort svg.embeddedIcon .icon .glyph {
+ fill: #888888;
+}
+
+ /*svg.embeddedIcon .icon.active .glyph {
+ fill: #04bf34;
+}
+ svg.embeddedIcon .icon.inactive .glyph {
+ fill: #c0242b;
+}*/
+
+ table svg.embeddedIcon .icon .glyph {
+ fill: #9999aa;
+}
+
+/*
+svg.embeddedIcon g.icon .glyph {
+ fill: #007dc4;
+}
+
+svg.embeddedIcon:hover g.icon .glyph {
+ fill: #20b2ff;
+}
+*/
+
+svg.embeddedIcon g.icon.devIcon_SWITCH .glyph {
+ fill: #0071bd;;
+}
+
+svg.embeddedIcon g.icon.hostIcon_endstation .glyph {
+ fill: #0071bd;;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip-theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip-theme.css
new file mode 100644
index 0000000..bcdcd55
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip-theme.css
@@ -0,0 +1,30 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Tooltip Service (theme) -- CSS file
+ */
+.light#tooltip {
+ background-color: #dbeffc;
+ color: #3c3a3a;
+ border-color: #c7c7c0;
+}
+
+.dark#tooltip {
+ background-color: #3a3a60;
+ border-color: #6c6a6a;
+ color: #c7c7c0;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip.css
new file mode 100644
index 0000000..eda38d9
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip.css
@@ -0,0 +1,61 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Tooltip Service (layout) -- CSS file
+ */
+
+#tooltip {
+ text-align: center;
+ font-size: 80%;
+ border: 1px solid;
+ padding: 5px;
+ position: absolute;
+ z-index: 5000;
+ display: inline-block;
+ pointer-events: none;
+ top: 40px;
+ right: auto;
+ /* width: 240px; */
+}
+
+.tooltip {
+ position: relative;
+ display: inline-block;
+}
+
+.tooltip .tooltiptext {
+ display: inline-block;
+ visibility: hidden;
+ background-color: #dbeffc;
+ color: #3c3a3a;
+ border-color: #c7c7c0;
+ text-align: center;
+ border-radius: 6px;
+ font-size: 80%;
+ padding: 5px;
+
+ /* Position the tooltip */
+ position: absolute;
+ z-index: 5000;
+ top: 42px;
+ right: 10%;
+ white-space: nowrap;
+}
+
+.tooltip:hover .tooltiptext {
+ visibility: visible;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/svgutil.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/svgutil.service.ts
new file mode 100644
index 0000000..13327fe
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/svgutil.service.ts
@@ -0,0 +1,43 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+
+/**
+ * ONOS GUI -- SVG -- Util Service
+ *
+ * The SVG Util Service provides a miscellany of utility functions.
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class SvgUtilService {
+
+ constructor(
+ private fs: FnService,
+ private log: LogService
+ ) {
+ this.log.debug('SvgUtilService constructed');
+ }
+
+ translate(x: number[], y?: any): string {
+ if (this.fs.isA(x) && x.length === 2 && !y) {
+ return 'translate(' + x[0] + ',' + x[1] + ')';
+ }
+ return 'translate(' + x + ',' + y + ')';
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.spec.ts
new file mode 100644
index 0000000..5b86d56
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.spec.ts
@@ -0,0 +1,492 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { TestBed, inject } from '@angular/core/testing';
+
+import { LogService } from '../log.service';
+import { ConsoleLoggerService } from '../consolelogger.service';
+import { FnService } from './fn.service';
+import { ActivatedRoute, Params } from '@angular/router';
+import { of } from 'rxjs';
+import * as d3 from 'd3';
+
+class MockActivatedRoute extends ActivatedRoute {
+ constructor(params: Params) {
+ super();
+ this.queryParams = of(params);
+ }
+}
+
+/**
+ * ONOS GUI -- Util -- General Purpose Functions - Unit Tests
+ */
+describe('FnService', () => {
+ let ar: ActivatedRoute;
+ let fs: FnService;
+ let mockWindow: Window;
+ let logServiceSpy: jasmine.SpyObj<LogService>;
+
+ const someFunction = () => {};
+ const someArray = [1, 2, 3];
+ const someObject = { foo: 'bar'};
+ const someNumber = 42;
+ const someString = 'xyyzy';
+ const someDate = new Date();
+ const stringArray = ['foo', 'bar'];
+
+ beforeEach(() => {
+ const logSpy = jasmine.createSpyObj('LogService', ['debug', 'warn']);
+ ar = new MockActivatedRoute({'debug': 'TestService'});
+ mockWindow = <any>{
+ innerWidth: 400,
+ innerHeight: 200,
+ navigator: {
+ userAgent: 'defaultUA'
+ }
+ };
+
+
+ TestBed.configureTestingModule({
+ providers: [FnService,
+ { provide: LogService, useValue: logSpy },
+ { provide: ActivatedRoute, useValue: ar },
+ { provide: 'Window', useFactory: (() => mockWindow ) }
+ ]
+ });
+
+ fs = TestBed.get(FnService);
+ logServiceSpy = TestBed.get(LogService);
+ });
+
+ it('should be created', () => {
+ expect(fs).toBeTruthy();
+ });
+
+ // === Tests for isF()
+ it('isF(): null for undefined', () => {
+ expect(fs.isF(undefined)).toBeNull();
+ });
+
+ it('isF(): null for null', () => {
+ expect(fs.isF(null)).toBeNull();
+ });
+ it('isF(): the reference for function', () => {
+ expect(fs.isF(someFunction)).toBe(someFunction);
+ });
+ it('isF(): null for string', () => {
+ expect(fs.isF(someString)).toBeNull();
+ });
+ it('isF(): null for number', () => {
+ expect(fs.isF(someNumber)).toBeNull();
+ });
+ it('isF(): null for Date', () => {
+ expect(fs.isF(someDate)).toBeNull();
+ });
+ it('isF(): null for array', () => {
+ expect(fs.isF(someArray)).toBeNull();
+ });
+ it('isF(): null for object', () => {
+ expect(fs.isF(someObject)).toBeNull();
+ });
+
+ // === Tests for isA()
+ it('isA(): null for undefined', () => {
+ expect(fs.isA(undefined)).toBeNull();
+ });
+ it('isA(): null for null', () => {
+ expect(fs.isA(null)).toBeNull();
+ });
+ it('isA(): null for function', () => {
+ expect(fs.isA(someFunction)).toBeNull();
+ });
+ it('isA(): null for string', () => {
+ expect(fs.isA(someString)).toBeNull();
+ });
+ it('isA(): null for number', () => {
+ expect(fs.isA(someNumber)).toBeNull();
+ });
+ it('isA(): null for Date', () => {
+ expect(fs.isA(someDate)).toBeNull();
+ });
+ it('isA(): the reference for array', () => {
+ expect(fs.isA(someArray)).toBe(someArray);
+ });
+ it('isA(): null for object', () => {
+ expect(fs.isA(someObject)).toBeNull();
+ });
+
+ // === Tests for isS()
+ it('isS(): null for undefined', () => {
+ expect(fs.isS(undefined)).toBeNull();
+ });
+ it('isS(): null for null', () => {
+ expect(fs.isS(null)).toBeNull();
+ });
+ it('isS(): null for function', () => {
+ expect(fs.isS(someFunction)).toBeNull();
+ });
+ it('isS(): the reference for string', () => {
+ expect(fs.isS(someString)).toBe(someString);
+ });
+ it('isS(): null for number', () => {
+ expect(fs.isS(someNumber)).toBeNull();
+ });
+ it('isS(): null for Date', () => {
+ expect(fs.isS(someDate)).toBeNull();
+ });
+ it('isS(): null for array', () => {
+ expect(fs.isS(someArray)).toBeNull();
+ });
+ it('isS(): null for object', () => {
+ expect(fs.isS(someObject)).toBeNull();
+ });
+
+ // === Tests for isO()
+ it('isO(): null for undefined', () => {
+ expect(fs.isO(undefined)).toBeNull();
+ });
+ it('isO(): null for null', () => {
+ expect(fs.isO(null)).toBeNull();
+ });
+ it('isO(): null for function', () => {
+ expect(fs.isO(someFunction)).toBeNull();
+ });
+ it('isO(): null for string', () => {
+ expect(fs.isO(someString)).toBeNull();
+ });
+ it('isO(): null for number', () => {
+ expect(fs.isO(someNumber)).toBeNull();
+ });
+ it('isO(): null for Date', () => {
+ expect(fs.isO(someDate)).toBeNull();
+ });
+ it('isO(): null for array', () => {
+ expect(fs.isO(someArray)).toBeNull();
+ });
+ it('isO(): the reference for object', () => {
+ expect(fs.isO(someObject)).toBe(someObject);
+ });
+
+
+ // === Tests for contains()
+ it('contains(): false for non-array', () => {
+ expect(fs.contains(null, 1)).toBeFalsy();
+ });
+ it('contains(): true for contained item', () => {
+ expect(fs.contains(someArray, 1)).toBeTruthy();
+ expect(fs.contains(stringArray, 'bar')).toBeTruthy();
+ });
+ it('contains(): false for non-contained item', () => {
+ expect(fs.contains(someArray, 109)).toBeFalsy();
+ expect(fs.contains(stringArray, 'zonko')).toBeFalsy();
+ });
+
+ // === Tests for areFunctions()
+ it('areFunctions(): true for empty-array', () => {
+ expect(fs.areFunctions({}, [])).toBeTruthy();
+ });
+ it('areFunctions(): true for some api', () => {
+ expect(fs.areFunctions({
+ a: () => {},
+ b: () => {}
+ }, ['b', 'a'])).toBeTruthy();
+ });
+ it('areFunctions(): false for some other api', () => {
+ expect(fs.areFunctions({
+ a: () => {},
+ b: 'not-a-function'
+ }, ['b', 'a'])).toBeFalsy();
+ });
+ it('areFunctions(): extraneous stuff NOT ignored', () => {
+ expect(fs.areFunctions({
+ a: () => {},
+ b: () => {},
+ c: 1,
+ d: 'foo'
+ }, ['a', 'b'])).toBeFalsy();
+ });
+ it('areFunctions(): extraneous stuff ignored (alternate fn)', () => {
+ expect(fs.areFunctionsNonStrict({
+ a: () => {},
+ b: () => {},
+ c: 1,
+ d: 'foo'
+ }, ['a', 'b'])).toBeTruthy();
+ });
+
+ // == use the now-tested areFunctions() on our own api:
+ it('should define api functions', () => {
+ expect(fs.areFunctions(fs, [
+ 'isF', 'isA', 'isS', 'isO', 'contains',
+ 'areFunctions', 'areFunctionsNonStrict', 'windowSize',
+ 'isMobile', 'isChrome', 'isChromeHeadless', 'isSafari',
+ 'isFirefox', 'parseDebugFlags',
+ 'debugOn', 'debug', 'find', 'inArray', 'removeFromArray',
+ 'isEmptyObject', 'cap', 'noPx', 'noPxStyle', 'endsWith',
+ 'inEvilList', 'analyze', 'sanitize', 'sameObjProps', 'containsObj'
+// 'find', 'inArray', 'removeFromArray', 'isEmptyObject', 'sameObjProps', 'containsObj', 'cap',
+// 'eecode', 'noPx', 'noPxStyle', 'endsWith', 'addToTrie', 'removeFromTrie', 'trieLookup',
+// 'classNames', 'extend', 'sanitize'
+ ])).toBeTruthy();
+ });
+
+
+ // === Tests for windowSize()
+ it('windowSize(): adjust height', () => {
+ const dim = fs.windowSize(50);
+ expect(dim.width).toEqual(400);
+ expect(dim.height).toEqual(150);
+ });
+
+ it('windowSize(): adjust width', () => {
+ const dim = fs.windowSize(0, 50);
+ expect(dim.width).toEqual(350);
+ expect(dim.height).toEqual(200);
+ });
+
+ it('windowSize(): adjust width and height', () => {
+ const dim = fs.windowSize(101, 201);
+ expect(dim.width).toEqual(199);
+ expect(dim.height).toEqual(99);
+ });
+
+ // === Tests for isMobile()
+ const uaMap = {
+ chrome: 'Mozilla/5.0 (Macintosh; Intel Mac OS X 10_10_2) ' +
+ 'AppleWebKit/537.36 (KHTML, like Gecko) ' +
+ 'Chrome/41.0.2272.89 Safari/537.36',
+
+ iPad: 'Mozilla/5.0 (iPad; CPU OS 7_0 like Mac OS X) ' +
+ 'AppleWebKit/537.51.1 (KHTML, like Gecko) Version/7.0 ' +
+ 'Mobile/11A465 Safari/9537.53',
+
+ iPhone: 'Mozilla/5.0 (iPhone; CPU iPhone OS 7_0 like Mac OS X) ' +
+ 'AppleWebKit/537.51.1 (KHTML, like Gecko) Version/7.0 ' +
+ 'Mobile/11A465 Safari/9537.53'
+ };
+
+ function setUa(key) {
+ const str = uaMap[key];
+ expect(str).toBeTruthy();
+ (<any>mockWindow.navigator).userAgent = str;
+ }
+
+ it('isMobile(): should be false for Chrome on Mac OS X', () => {
+ setUa('chrome');
+ expect(fs.isMobile()).toBe(false);
+ });
+ it('isMobile(): should be true for Safari on iPad', () => {
+ setUa('iPad');
+ expect(fs.isMobile()).toBe(true);
+ });
+ it('isMobile(): should be true for Safari on iPhone', () => {
+ setUa('iPhone');
+ expect(fs.isMobile()).toBe(true);
+ });
+
+ // === Tests for find()
+ const dataset = [
+ { id: 'foo', name: 'Furby'},
+ { id: 'bar', name: 'Barbi'},
+ { id: 'baz', name: 'Basil'},
+ { id: 'goo', name: 'Gabby'},
+ { id: 'zoo', name: 'Zevvv'}
+ ];
+
+ it('should not find ooo', () => {
+ expect(fs.find('ooo', dataset)).toEqual(-1);
+ });
+ it('should find foo', () => {
+ expect(fs.find('foo', dataset)).toEqual(0);
+ });
+ it('should find zoo', () => {
+ expect(fs.find('zoo', dataset)).toEqual(4);
+ });
+
+ it('should not find Simon', () => {
+ expect(fs.find('Simon', dataset, 'name')).toEqual(-1);
+ });
+ it('should find Furby', () => {
+ expect(fs.find('Furby', dataset, 'name')).toEqual(0);
+ });
+ it('should find Zevvv', () => {
+ expect(fs.find('Zevvv', dataset, 'name')).toEqual(4);
+ });
+
+
+ // === Tests for inArray()
+ const objRef = { x: 1, y: 2 };
+ const array = [1, 3.14, 'hey', objRef, 'there', true];
+ const array2 = ['b', 'a', 'd', 'a', 's', 's'];
+
+ it('should not find HOO', () => {
+ expect(fs.inArray('HOO', array)).toEqual(-1);
+ });
+ it('should find 1', () => {
+ expect(fs.inArray(1, array)).toEqual(0);
+ });
+ it('should find pi', () => {
+ expect(fs.inArray(3.14, array)).toEqual(1);
+ });
+ it('should find hey', () => {
+ expect(fs.inArray('hey', array)).toEqual(2);
+ });
+ it('should find the object', () => {
+ expect(fs.inArray(objRef, array)).toEqual(3);
+ });
+ it('should find there', () => {
+ expect(fs.inArray('there', array)).toEqual(4);
+ });
+ it('should find true', () => {
+ expect(fs.inArray(true, array)).toEqual(5);
+ });
+
+ it('should find the first occurrence A', () => {
+ expect(fs.inArray('a', array2)).toEqual(1);
+ });
+ it('should find the first occurrence S', () => {
+ expect(fs.inArray('s', array2)).toEqual(4);
+ });
+ it('should not find X', () => {
+ expect(fs.inArray('x', array2)).toEqual(-1);
+ });
+
+ // === Tests for removeFromArray()
+ it('should keep the array the same, for non-match', () => {
+ const array1 = [1, 2, 3];
+ expect(fs.removeFromArray(4, array1)).toBe(false);
+ expect(array1).toEqual([1, 2, 3]);
+ });
+ it('should remove a value', () => {
+ const array1a = [1, 2, 3];
+ expect(fs.removeFromArray(2, array1a)).toBe(true);
+ expect(array1a).toEqual([1, 3]);
+ });
+ it('should remove the first occurrence', () => {
+ const array1b = ['x', 'y', 'z', 'z', 'y'];
+ expect(fs.removeFromArray('y', array1b)).toBe(true);
+ expect(array1b).toEqual(['x', 'z', 'z', 'y']);
+ expect(fs.removeFromArray('x', array1b)).toBe(true);
+ expect(array1b).toEqual(['z', 'z', 'y']);
+ });
+
+ // === Tests for isEmptyObject()
+ it('should return true if an object is empty', () => {
+ expect(fs.isEmptyObject({})).toBe(true);
+ });
+ it('should return false if an object is not empty', () => {
+ expect(fs.isEmptyObject({foo: 'bar'})).toBe(false);
+ });
+
+ // === Tests for cap()
+ it('should ignore non-alpha', () => {
+ expect(fs.cap('123')).toEqual('123');
+ });
+ it('should capitalize first char', () => {
+ expect(fs.cap('Foo')).toEqual('Foo');
+ expect(fs.cap('foo')).toEqual('Foo');
+ expect(fs.cap('foo bar')).toEqual('Foo bar');
+ expect(fs.cap('FOO BAR')).toEqual('Foo bar');
+ expect(fs.cap('foo Bar')).toEqual('Foo bar');
+ });
+
+ // === Tests for noPx()
+ it('should return the value without px suffix', () => {
+ expect(fs.noPx('10px')).toBe(10);
+ expect(fs.noPx('500px')).toBe(500);
+ expect(fs.noPx('-80px')).toBe(-80);
+ });
+
+ // === Tests for noPxStyle()
+ it('should give a style\'s property without px suffix', () => {
+ const d3Elem = d3.select('body')
+ .append('div')
+ .attr('id', 'fooElem')
+ .style('width', '500px')
+ .style('height', '200px')
+ .style('font-size', '12px');
+ expect(fs.noPxStyle(d3Elem, 'width')).toBe(500);
+ expect(fs.noPxStyle(d3Elem, 'height')).toBe(200);
+ expect(fs.noPxStyle(d3Elem, 'font-size')).toBe(12);
+ d3.select('#fooElem').remove();
+ });
+
+ // === Tests for endsWith()
+ it('should return true if string ends with foo', () => {
+ expect(fs.endsWith('barfoo', 'foo')).toBe(true);
+ });
+
+ it('should return false if string doesnt end with foo', () => {
+ expect(fs.endsWith('barfood', 'foo')).toBe(false);
+ });
+
+ // === Tests for sanitize()
+ it('should return foo', () => {
+ expect(fs.sanitize('foo')).toEqual('foo');
+ });
+ it('should retain < b > tags', () => {
+ const str = 'foo <b>bar</b> baz';
+ expect(fs.sanitize(str)).toEqual(str);
+ });
+ it('should retain < i > tags', () => {
+ const str = 'foo <i>bar</i> baz';
+ expect(fs.sanitize(str)).toEqual(str);
+ });
+ it('should retain < p > tags', () => {
+ const str = 'foo <p>bar</p> baz';
+ expect(fs.sanitize(str)).toEqual(str);
+ });
+ it('should retain < em > tags', () => {
+ const str = 'foo <em>bar</em> baz';
+ expect(fs.sanitize(str)).toEqual(str);
+ });
+ it('should retain < strong > tags', () => {
+ const str = 'foo <strong>bar</strong> baz';
+ expect(fs.sanitize(str)).toEqual(str);
+ });
+
+ it('should reject < a > tags', () => {
+ expect(fs.sanitize('test <a href="hah">something</a> this'))
+ .toEqual('test something this');
+ });
+
+ it('should log a warning for < script > tags', () => {
+ expect(fs.sanitize('<script>alert("foo");</script>'))
+ .toEqual('');
+ expect(logServiceSpy.warn).toHaveBeenCalledWith(
+ 'Unsanitary HTML input -- <script> detected!'
+ );
+ });
+ it('should log a warning for < style > tags', () => {
+ expect(fs.sanitize('<style> h1 {color:red;} </style>'))
+ .toEqual('');
+ expect(logServiceSpy.warn).toHaveBeenCalledWith(
+ 'Unsanitary HTML input -- <style> detected!'
+ );
+ });
+
+ it('should log a warning for < iframe > tags', () => {
+ expect(fs.sanitize('Foo<iframe><body><h1>fake</h1></body></iframe>Bar'))
+ .toEqual('FooBar');
+ expect(logServiceSpy.warn).toHaveBeenCalledWith(
+ 'Unsanitary HTML input -- <iframe> detected!'
+ );
+ });
+
+ it('should completely strip < script >, remove < a >, retain < i >', () => {
+ expect(fs.sanitize('Hey <i>this</i> is <script>alert("foo");</script> <a href="meh">cool</a>'))
+ .toEqual('Hey <i>this</i> is cool');
+ });
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.ts
new file mode 100644
index 0000000..506ce74
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.ts
@@ -0,0 +1,564 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable, Inject } from '@angular/core';
+import { ActivatedRoute, Router} from '@angular/router';
+import { LogService } from '../log.service';
+
+// Angular>=2 workaround for missing definition
+declare const InstallTrigger: any;
+
+const matcher = /<\/?([a-zA-Z0-9]+)*(.*?)\/?>/igm;
+const whitelist: string[] = ['b', 'i', 'p', 'em', 'strong', 'br'];
+const evillist: string[] = ['script', 'style', 'iframe'];
+
+/**
+ * Used with the Window size function;
+ **/
+export interface WindowSize {
+ width: number;
+ height: number;
+}
+
+/**
+ * For the sanitize() and analyze() functions
+ */
+export interface Match {
+ full: string;
+ name: string;
+}
+
+// TODO Move all this trie stuff to its own class
+// Angular>=2 Tightened up on types to avoid compiler errors
+interface TrieC {
+ p: any;
+ s: string[];
+}
+// trie operation
+function _trieOp(op: string, trie, word: string, data) {
+ const p = trie;
+ const w: string = word.toUpperCase();
+ const s: Array<string> = w.split('');
+ let c: TrieC = { p: p, s: s };
+ let t = [];
+ let x = 0;
+ const f1 = op === '+' ? add : probe;
+ const f2 = op === '+' ? insert : remove;
+
+ function add(cAdded): TrieC {
+ const q = cAdded.s.shift();
+ let np = cAdded.p[q];
+
+ if (!np) {
+ cAdded.p[q] = {};
+ np = cAdded.p[q];
+ x = 1;
+ }
+ return { p: np, s: cAdded.s };
+ }
+
+ function probe(cProbed): TrieC {
+ const q = cProbed.s.shift();
+ const k: number = Object.keys(cProbed.p).length;
+ const np = cProbed.p[q];
+
+ t.push({ q: q, k: k, p: cProbed.p });
+ if (!np) {
+ t = [];
+ return { p: [], s: [] };
+ }
+ return { p: np, s: cProbed.s };
+ }
+
+ function insert() {
+ c.p._data = data;
+ return x ? 'added' : 'updated';
+ }
+
+ function remove() {
+ if (t.length) {
+ t = t.reverse();
+ while (t.length) {
+ const d = t.shift();
+ delete d.p[d.q];
+ if (d.k > 1) {
+ t = [];
+ }
+ }
+ return 'removed';
+ }
+ return 'absent';
+ }
+
+ while (c.s.length) {
+ c = f1(c);
+ }
+ return f2();
+}
+
+// add word to trie (word will be converted to uppercase)
+// data associated with the word
+// returns 'added' or 'updated'
+function addToTrie(trie, word, data) {
+ return _trieOp('+', trie, word, data);
+}
+
+// remove word from trie (word will be converted to uppercase)
+// returns 'removed' or 'absent'
+// Angular>=2 added in quotes for data. error TS2554: Expected 4 arguments, but got 3.
+function removeFromTrie(trie, word) {
+ return _trieOp('-', trie, word, '');
+}
+
+// lookup word (converted to uppercase) in trie
+// returns:
+// undefined if the word is not in the trie
+// -1 for a partial match (word is a prefix to an existing word)
+// data for the word for an exact match
+function trieLookup(trie, word) {
+ const s = word.toUpperCase().split('');
+ let p = trie;
+ let n;
+
+ while (s.length) {
+ n = s.shift();
+ p = p[n];
+ if (!p) {
+ return undefined;
+ }
+ }
+ if (p._data) {
+ return p._data;
+ }
+ return -1;
+}
+
+
+/**
+ * ONOS GUI -- Util -- General Purpose Functions
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class FnService {
+ // internal state
+ private debugFlags = new Map<string, boolean>([
+// [ "LoadingService", true ]
+ ]);
+
+ constructor(
+ private route: ActivatedRoute,
+ private log: LogService,
+ // TODO: Change the any type to Window when https://github.com/angular/angular/issues/15640 is fixed.
+ @Inject('Window') private w: any
+ ) {
+ this.route.queryParams.subscribe(params => {
+ const debugparam: string = params['debug'];
+// log.debug('Param:', debugparam);
+ this.parseDebugFlags(debugparam);
+ });
+// this.log.debug('FnService constructed');
+ }
+
+ /**
+ * Test if an argument is a function
+ *
+ * Note: the need for this would go away if all functions
+ * were strongly typed
+ */
+ isF(f: any): any {
+ return typeof f === 'function' ? f : null;
+ }
+
+ /**
+ * Test if an argument is an array
+ *
+ * Note: the need for this would go away if all arrays
+ * were strongly typed
+ */
+ isA(a: any): any {
+ // NOTE: Array.isArray() is part of EMCAScript 5.1
+ return Array.isArray(a) ? a : null;
+ }
+
+ /**
+ * Test if an argument is a string
+ *
+ * Note: the need for this would go away if all strings
+ * were strongly typed
+ */
+ isS(s: any): string {
+ return typeof s === 'string' ? s : null;
+ }
+
+ /**
+ * Test if an argument is an object
+ *
+ * Note: the need for this would go away if all objects
+ * were strongly typed
+ */
+ isO(o: any): Object {
+ return (o && typeof o === 'object' && o.constructor === Object) ? o : null;
+ }
+
+ /**
+ * Test that an array contains an object
+ */
+ contains(a: any[], x: any): boolean {
+ return this.isA(a) && a.indexOf(x) > -1;
+ }
+
+ /**
+ * Returns width and height of window inner dimensions.
+ * offH, offW : offset width/height are subtracted, if present
+ */
+ windowSize(offH: number = 0, offW: number = 0): WindowSize {
+ return {
+ height: this.w.innerHeight - offH,
+ width: this.w.innerWidth - offW
+ };
+ }
+
+ /**
+ * Returns true if all names in the array are defined as functions
+ * on the given api object; false otherwise.
+ * Also returns false if there are properties on the api that are NOT
+ * listed in the array of names.
+ *
+ * This gets extra complicated when the api Object is an
+ * Angular service - while the functions can be retrieved
+ * by an indexed get, the ownProperties does not show the
+ * functions of the class. We have to dive in to the prototypes
+ * properties to get these - and even then we have to filter
+ * out the constructor and any member variables
+ */
+ areFunctions(api: Object, fnNames: string[]): boolean {
+ const fnLookup: Map<string, boolean> = new Map();
+ let extraFound: boolean = false;
+
+ if (!this.isA(fnNames)) {
+ return false;
+ }
+
+ const n: number = fnNames.length;
+ let i: number;
+ let name: string;
+
+ for (i = 0; i < n; i++) {
+ name = fnNames[i];
+ if (!this.isF(api[name])) {
+ return false;
+ }
+ fnLookup.set(name, true);
+ }
+
+ // check for properties on the API that are not listed in the array,
+ const keys = Object.getOwnPropertyNames(api);
+ if (keys.length === 0) {
+ return true;
+ }
+ // If the api is a class it will have a name,
+ // else it will just be called 'Object'
+ const apiObjectName: string = api.constructor.name;
+ if (apiObjectName === 'Object') {
+ Object.keys(api).forEach((key) => {
+ if (!fnLookup.get(key)) {
+ extraFound = true;
+ }
+ });
+ } else { // It is a class, so its functions will be in the child (prototype)
+ const pObj: Object = Object.getPrototypeOf(api);
+ for ( const key in Object.getOwnPropertyDescriptors(pObj) ) {
+ if (key === 'constructor') { // Filter out constructor
+ continue;
+ }
+ const value = Object.getOwnPropertyDescriptor(pObj, key);
+ // Only compare functions. Look for any not given in the map
+ if (this.isF(value.value) && !fnLookup.get(key)) {
+ extraFound = true;
+ }
+ }
+ }
+ return !extraFound;
+ }
+
+ /**
+ * Returns true if all names in the array are defined as functions
+ * on the given api object; false otherwise. This is a non-strict version
+ * that does not care about other properties on the api.
+ */
+ areFunctionsNonStrict(api, fnNames): boolean {
+ if (!this.isA(fnNames)) {
+ return false;
+ }
+ const n = fnNames.length;
+ let i;
+ let name;
+
+ for (i = 0; i < n; i++) {
+ name = fnNames[i];
+ if (!this.isF(api[name])) {
+ return false;
+ }
+ }
+ return true;
+ }
+
+ /**
+ * Returns true if current browser determined to be a mobile device
+ */
+ isMobile() {
+ const ua = this.w.navigator.userAgent;
+ const patt = /iPhone|iPod|iPad|Silk|Android|BlackBerry|Opera Mini|IEMobile/;
+ return patt.test(ua);
+ }
+
+ /**
+ * Returns true if the current browser determined to be Chrome
+ */
+ isChrome() {
+ const isChromium = (this.w as any).chrome;
+ const vendorName = this.w.navigator.vendor;
+
+ const isOpera = this.w.navigator.userAgent.indexOf('OPR') > -1;
+ return (isChromium !== null &&
+ isChromium !== undefined &&
+ vendorName === 'Google Inc.' &&
+ isOpera === false);
+ }
+
+ isChromeHeadless() {
+ const vendorName = this.w.navigator.vendor;
+ const headlessChrome = this.w.navigator.userAgent.indexOf('HeadlessChrome') > -1;
+
+ return (vendorName === 'Google Inc.' && headlessChrome === true);
+ }
+
+ /**
+ * Returns true if the current browser determined to be Safari
+ */
+ isSafari() {
+ return (this.w.navigator.userAgent.indexOf('Safari') !== -1 &&
+ this.w.navigator.userAgent.indexOf('Chrome') === -1);
+ }
+
+ /**
+ * Returns true if the current browser determined to be Firefox
+ */
+ isFirefox() {
+ return typeof InstallTrigger !== 'undefined';
+ }
+
+ /**
+ * search through an array of objects, looking for the one with the
+ * tagged property matching the given key. tag defaults to 'id'.
+ * returns the index of the matching object, or -1 for no match.
+ */
+ find(key: string, array: Object[], tag: string = 'id'): number {
+ let idx: number;
+ const n: number = array.length;
+
+ for (idx = 0 ; idx < n; idx++) {
+ const d: Object = array[idx];
+ if (d[tag] === key) {
+ return idx;
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * search through array to find (the first occurrence of) item,
+ * returning its index if found; otherwise returning -1.
+ */
+ inArray(item: any, array: any[]): number {
+ if (this.isA(array)) {
+ for (let i = 0; i < array.length; i++) {
+ if (array[i] === item) {
+ return i;
+ }
+ }
+ }
+ return -1;
+ }
+
+ /**
+ * remove (the first occurrence of) the specified item from the given
+ * array, if any. Return true if the removal was made; false otherwise.
+ */
+ removeFromArray(item: any, array: any[]): boolean {
+ const i: number = this.inArray(item, array);
+ if (i >= 0) {
+ array.splice(i, 1);
+ return true;
+ }
+ return false;
+ }
+
+ /**
+ * return true if the object is empty, return false otherwise
+ */
+ isEmptyObject(obj: Object): boolean {
+ for (const key in obj) {
+ if (true) { return false; }
+ }
+ return true;
+ }
+
+ /**
+ * returns true if the two objects have all the same properties
+ */
+ sameObjProps(obj1: Object, obj2: Object): boolean {
+ for (const key in obj1) {
+ if (obj1.hasOwnProperty(key)) {
+ if (!(obj1[key] === obj2[key])) {
+ return false;
+ }
+ }
+ }
+ return true;
+ }
+
+ /**
+ * returns true if the array contains the object
+ * does NOT use strict object reference equality,
+ * instead checks each property individually for equality
+ */
+ containsObj(arr: any[], obj: Object): boolean {
+ const len = arr.length;
+ for (let i = 0; i < len; i++) {
+ if (this.sameObjProps(arr[i], obj)) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ /**
+ * Return the given string with the first character capitalized.
+ */
+ cap(s: string): string {
+ return s ? s[0].toUpperCase() + s.slice(1).toLowerCase() : s;
+ }
+
+ /**
+ * return the parameter without a px suffix
+ */
+ noPx(num: string): number {
+ return Number(num.replace(/px$/, ''));
+ }
+
+ /**
+ * return an element's given style property without px suffix
+ */
+ noPxStyle(elem: any, prop: string): number {
+ return Number(elem.style(prop).replace(/px$/, ''));
+ }
+
+ /**
+ * Return true if a str ends with suffix
+ */
+ endsWith(str: string, suffix: string) {
+ return str.indexOf(suffix, str.length - suffix.length) !== -1;
+ }
+
+ /**
+ * output debug message to console, if debug tag set...
+ * e.g. fs.debug('mytag', arg1, arg2, ...)
+ */
+ debug(tag, ...args) {
+ if (this.debugFlags.get(tag)) {
+// this.log.debug(tag, args.join());
+ }
+ }
+
+ private parseDebugFlags(dbgstr: string): void {
+ const bits = dbgstr ? dbgstr.split(',') : [];
+ bits.forEach((key) => {
+ this.debugFlags.set(key, true);
+ });
+// this.log.debug('Debug flags:', dbgstr);
+ }
+
+ /**
+ * Return true if the given debug flag was specified in the query params
+ */
+ debugOn(tag: string): boolean {
+ return this.debugFlags.get(tag);
+ }
+
+
+
+ // -----------------------------------------------------------------
+ // The next section deals with sanitizing external strings destined
+ // to be loaded via a .html() function call.
+ //
+ // See definition of matcher, evillist and whitelist at the top of this file
+
+ /*
+ * Returns true if the tag is in the evil list, (and is not an end-tag)
+ */
+ inEvilList(tag: any): boolean {
+ return (evillist.indexOf(tag.name) !== -1 && tag.full.indexOf('/') === -1);
+ }
+
+ /*
+ * Returns an array of Matches of matcher in html
+ */
+ analyze(html: string): Match[] {
+ const matches: Match[] = [];
+ let match;
+
+ // extract all tags
+ while ((match = matcher.exec(html)) !== null) {
+ matches.push({
+ full: match[0],
+ name: match[1],
+ // NOTE: ignoring attributes {match[2].split(' ')} for now
+ });
+ }
+
+ return matches;
+ }
+
+ /*
+ * Returns a cleaned version of html
+ */
+ sanitize(html: string): string {
+ const matches: Match[] = this.analyze(html);
+
+ // completely obliterate evil tags and their contents...
+ evillist.forEach((tag) => {
+ const re = new RegExp('<' + tag + '(.*?)>(.*?[\r\n])*?(.*?)(.*?[\r\n])*?<\/' + tag + '>', 'gim');
+ html = html.replace(re, '');
+ });
+
+ // filter out all but white-listed tags and end-tags
+ matches.forEach((tag) => {
+ if (whitelist.indexOf(tag.name) === -1) {
+ html = html.replace(tag.full, '');
+ if (this.inEvilList(tag)) {
+ this.log.warn('Unsanitary HTML input -- ' +
+ tag.full + ' detected!');
+ }
+ }
+ });
+
+ // TODO: consider encoding HTML entities, e.g. '&' -> '&'
+
+ return html;
+ }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/lion.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/lion.service.ts
new file mode 100644
index 0000000..b8cde73
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/lion.service.ts
@@ -0,0 +1,90 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *
+ */
+import { Injectable } from '@angular/core';
+import { LogService } from '../log.service';
+import { WebSocketService } from '../remote/websocket.service';
+
+/**
+ * A definition of Lion data
+ */
+export interface Lion {
+ locale: any;
+ lion: any;
+}
+
+/**
+ * ONOS GUI -- Lion -- Localization Utilities
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class LionService {
+
+ ubercache: any[] = [];
+ loadCbs = new Map<string, () => void>([]); // A map of functions
+
+ /**
+ * Handler for uberlion event from WSS
+ */
+ uberlion(data: Lion) {
+ this.ubercache = data.lion;
+
+ this.log.info('LION service: Locale... [' + data.locale + ']');
+ this.log.info('LION service: Bundles installed...');
+
+ for (const p in this.ubercache) {
+ if (this.ubercache[p]) {
+ this.log.info(' :=> ', p);
+ }
+ }
+ // If any component had registered a callback, call it now
+ // that LION is loaded
+ for (const cbname of this.loadCbs.keys()) {
+ this.log.debug('Updating', cbname, 'with LION');
+ this.loadCbs.get(cbname)();
+ }
+
+ this.log.debug('LION service: uber-lion bundle received:', data);
+ }
+
+ constructor(
+ private log: LogService,
+ private wss: WebSocketService
+ ) {
+ this.wss.bindHandlers(new Map<string, (data) => void>([
+ ['uberlion', (data) => this.uberlion(data) ]
+ ]));
+ this.log.debug('LionService constructed');
+ }
+
+ /**
+ * Returns a lion bundle (function) for the given bundle ID (string)
+ * returns a function that takes a string and returns a string
+ */
+ bundle(bundleId: string): (string) => string {
+ let bundleObj = this.ubercache[bundleId];
+
+ if (!bundleObj) {
+ this.log.warn('No lion bundle registered:', bundleId);
+ bundleObj = {};
+ }
+
+ return (key) => {
+ return bundleObj[key] || '%' + key + '%';
+ };
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/prefs.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/prefs.service.ts
new file mode 100644
index 0000000..8145921
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/prefs.service.ts
@@ -0,0 +1,117 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from './fn.service';
+import { LogService } from '../log.service';
+import { WebSocketService } from '../remote/websocket.service';
+
+/**
+ * ONOS GUI -- Util -- User Preference Service
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class PrefsService {
+ protected Prefs;
+ protected handlers: string[] = [];
+ cache: any;
+ listeners: any;
+ constructor(
+ protected fs: FnService,
+ protected log: LogService,
+ protected wss: WebSocketService
+ ) {
+ this.cache = {};
+ this.wss.bindHandlers(new Map<string, (data) => void>([
+ [this.Prefs, (data) => this.updatePrefs(data)]
+ ]));
+ this.handlers.push(this.Prefs);
+
+ this.log.debug('PrefsService constructed');
+ }
+
+ setPrefs(name: string, obj: any) {
+ // keep a cached copy of the object and send an update to server
+ this.cache[name] = obj;
+ this.wss.sendEvent('updatePrefReq', { key: name, value: obj });
+ }
+ updatePrefs(data: any) {
+ this.cache = data;
+ this.listeners.forEach(function (lsnr) { lsnr(); });
+ }
+
+ asNumbers(obj: any, keys?: any, not?: any) {
+ if (!obj) {
+ return null;
+ }
+
+ const skip = {};
+ if (not) {
+ keys.forEach(k => {
+ skip[k] = 1;
+ }
+ );
+ }
+
+ if (!keys || not) {
+ // do them all
+ Array.from(obj).forEach((v, k) => {
+ if (!not || !skip[k]) {
+ obj[k] = Number(obj[k]);
+ }
+ });
+ } else {
+ // do the explicitly named keys
+ keys.forEach(k => {
+ obj[k] = Number(obj[k]);
+ });
+ }
+ return obj;
+ }
+
+ getPrefs(name: string, defaults: any, qparams?: string) {
+ const obj = Object.assign({}, defaults || {}, this.cache[name] || {});
+
+ // if query params are specified, they override...
+ if (this.fs.isO(qparams)) {
+ obj.forEach(k => {
+ if (qparams.hasOwnProperty(k)) {
+ obj[k] = qparams[k];
+ }
+ });
+ }
+ return obj;
+ }
+
+ // merge preferences:
+ // The assumption here is that obj is a sparse object, and that the
+ // defined keys should overwrite the corresponding values, but any
+ // existing keys that are NOT explicitly defined here should be left
+ // alone (not deleted).
+ mergePrefs(name: string, obj: any) {
+ const merged = this.cache[name] || {};
+ this.setPrefs(name, Object.assign(merged, obj));
+ }
+
+ addListener(listener: any) {
+ this.listeners.push(listener);
+ }
+
+ removeListener(listener: any) {
+ this.listeners = this.listeners.filter(function (obj) { return obj === listener; });
+ }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/theme.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/theme.service.ts
new file mode 100644
index 0000000..993d9f3
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/theme.service.ts
@@ -0,0 +1,44 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { LogService } from '../log.service';
+
+
+/**
+ * ONOS GUI -- Util -- Theme Service
+ */
+@Injectable({
+ providedIn: 'root',
+})
+export class ThemeService {
+ themes: string[] = ['light', 'dark'];
+ thidx = 0;
+
+ constructor(
+ private log: LogService
+ ) {
+ this.log.debug('ThemeService constructed');
+ }
+
+ getTheme(): string {
+ return this.themes[this.thidx];
+ }
+
+ themeStr(): string {
+ return this.themes.join(' ');
+ }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/detailspanel.base.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/detailspanel.base.ts
new file mode 100644
index 0000000..11dc8c9
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/detailspanel.base.ts
@@ -0,0 +1,114 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { FnService } from '../util/fn.service';
+import { LoadingService } from '../layer/loading.service';
+import { LogService } from '../log.service';
+import { WebSocketService } from '../remote/websocket.service';
+
+import { PanelBaseImpl } from './panel.base';
+import { Output, EventEmitter, Input } from '@angular/core';
+
+/**
+ * A generic model of the data returned from the *DetailsResponse
+ */
+export interface DetailsResponse {
+ details: any;
+}
+
+/**
+ * Extends the PanelBase abstract class specifically for showing details
+ *
+ * This makes another call through WSS to the server for specific
+ * details to fill the panel with
+ *
+ * This replaces the detailspanel service in the old gui
+ */
+export abstract class DetailsPanelBaseImpl extends PanelBaseImpl {
+
+ @Input() id: string;
+ @Output() closeEvent = new EventEmitter<string>();
+
+ private root: string;
+ private req: string;
+ private resp: string;
+ private handlers: string[] = [];
+ public detailsData: any = {};
+ public closed: boolean = false;
+
+ constructor(
+ protected fs: FnService,
+ protected ls: LoadingService,
+ protected log: LogService,
+ protected wss: WebSocketService,
+ protected tag: string,
+ ) {
+ super(fs, ls, log, wss, {});
+ this.root = tag + 's';
+ this.req = tag + 'DetailsRequest';
+ this.resp = tag + 'DetailsResponse';
+ }
+
+ /**
+ * When the details panel is created set up a listener on
+ * Web Socket for details responses
+ */
+ init() {
+ this.wss.bindHandlers(new Map<string, (data) => void>([
+ [this.resp, (data) => this.detailsPanelResponseCb(data)]
+ ]));
+ this.handlers.push(this.resp);
+ }
+
+ /**
+ * When the details panel is destroyed this should be called to
+ * de-register from the WebSocket
+ */
+ destroy() {
+ this.wss.unbindHandlers(this.handlers);
+ }
+
+ /**
+ * A callback that executes when the details data that was requested
+ * on WebSocketService arrives.
+ */
+ detailsPanelResponseCb(data: DetailsResponse) {
+ this.detailsData = data['details'];
+ }
+
+ /**
+ * Details Panel Data Request - should be called whenever row id changes
+ */
+ requestDetailsPanelData(query: any) {
+ this.closed = false;
+ // Do not send if the Web Socket hasn't opened
+ if (this.wss.isConnected()) {
+ if (this.fs.debugOn('panel')) {
+ this.log.debug('Details panel data REQUEST:', this.req, query);
+ }
+ this.wss.sendEvent(this.req, query);
+ }
+ }
+
+ /**
+ * this should be called when the details panel close button is clicked
+ */
+ close(): void {
+ this.closed = true;
+ this.id = null;
+ this.closeEvent.emit(this.id);
+ }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel-theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel-theme.css
new file mode 100644
index 0000000..2291136
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel-theme.css
@@ -0,0 +1,66 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Panel Service (theme) -- CSS file
+ */
+
+.light .floatpanel {
+ background-color: white;
+ color: #3c3a3a;
+ border: 1px solid #c7c7c0;
+}
+
+.light .floatpanel hr {
+ border: 1px solid #c7c7c0;
+}
+
+.light .floatpanel .bottom tr:nth-child(odd) {
+ background-color: #f4f4f4;
+}
+
+.light .floatpanel .bottom tr:nth-child(even) {
+ background-color: #fbfbfb;
+}
+
+
+/* ========== DARK Theme ========== */
+
+.dark .floatpanel {
+ background-color: #282528;
+ color: #888c8c;
+ border: 1px solid #364144;
+}
+
+.dark .floatpanel th {
+ background-color: #242424;
+}
+
+.dark .floatpanel h2 {
+ color: #dddddd;
+}
+
+.dark .floatpanel hr {
+ border: 1px solid #30303a;
+}
+
+.dark .floatpanel .bottom tr:nth-child(odd) {
+ background-color: #333333;
+}
+
+.dark .floatpanel .bottom tr:nth-child(even) {
+ background-color: #3a3a3a;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.base.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.base.ts
new file mode 100644
index 0000000..90cdfd5
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.base.ts
@@ -0,0 +1,167 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { FnService } from '../util/fn.service';
+import { LoadingService } from '../layer/loading.service';
+import { LogService } from '../log.service';
+import { WebSocketService } from '../remote/websocket.service';
+
+
+const noop = (): any => undefined;
+
+/**
+ ********* Static functions *********
+ */
+function margin(p) {
+ return p.settings.margin;
+}
+
+function hideMargin(p) {
+ return p.settings.hideMargin;
+}
+
+function noPx(p, what) {
+ return Number(p.el.style(what).replace(/px$/, ''));
+}
+
+function widthVal(p) {
+ return noPx(p, 'width');
+}
+
+function heightVal(p) {
+ return noPx(p, 'height');
+}
+
+function pxShow(p) {
+ return margin(p) + 'px';
+}
+
+function pxHide(p) {
+ return (-hideMargin(p) - widthVal(p) - (noPx(p, 'padding') * 2)) + 'px';
+}
+
+
+/**
+ * Base model of panel view - implemented by Panel components
+ */
+export interface PanelBase {
+ showPanel(cb: any): void;
+ hidePanel(cb: any): void;
+ togglePanel(cb: any): void;
+ emptyPanel(): void;
+ appendPanel(what: any): void;
+ panelWidth(w: number): number;
+ panelHeight(h: number): number;
+ panelBBox(): string;
+ panelIsVisible(): boolean;
+ classed(cls: any, bool: boolean): boolean;
+ panelEl(): any;
+}
+
+/**
+ * ONOS GUI -- Widget -- Panel Base class
+ *
+ * Replacing the panel service in the old implementation
+ */
+export abstract class PanelBaseImpl implements PanelBase {
+
+ protected on: boolean;
+ protected el: any;
+
+ constructor(
+ protected fs: FnService,
+ protected ls: LoadingService,
+ protected log: LogService,
+ protected wss: WebSocketService,
+ protected settings: any
+ ) {
+// this.log.debug('Panel base class constructed');
+ }
+
+ showPanel(cb) {
+ const endCb = this.fs.isF(cb) || noop;
+ this.on = true;
+ this.el.transition().duration(this.settings.xtnTime)
+ .each('end', endCb)
+ .style(this.settings.edge, pxShow(this))
+ .style('opacity', 1);
+ }
+
+ hidePanel(cb) {
+ const endCb = this.fs.isF(cb) || noop;
+ const endOpacity = this.settings.fade ? 0 : 1;
+ this.on = false;
+ this.el.transition().duration(this.settings.xtnTime)
+ .each('end', endCb)
+ .style(this.settings.edge, pxHide(this))
+ .style('opacity', endOpacity);
+ }
+
+ togglePanel(cb): boolean {
+ if (this.on) {
+ this.hidePanel(cb);
+ } else {
+ this.showPanel(cb);
+ }
+ return this.on;
+ }
+
+ emptyPanel(): string {
+ return this.el.text('');
+ }
+
+ appendPanel(what) {
+ return this.el.append(what);
+ }
+
+ panelWidth(w: number): number {
+ if (w === undefined) {
+ return widthVal(this);
+ }
+ this.el.style('width', w + 'px');
+ }
+
+ panelHeight(h: number): number {
+ if (h === undefined) {
+ return heightVal(this);
+ }
+ this.el.style('height', h + 'px');
+ }
+
+ panelBBox(): string {
+ return this.el.node().getBoundingClientRect();
+ }
+
+ panelIsVisible(): boolean {
+ return this.on;
+ }
+
+ classed(cls, bool): boolean {
+ return this.el.classed(cls, bool);
+ }
+
+ panelEl() {
+ return this.el;
+ }
+
+
+ /**
+ * A dummy implementation of the lionFn until the response is received and the LION
+ * bundle is received from the WebSocket
+ */
+ dummyLion(key: string): string {
+ return '%' + key + '%';
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.css
new file mode 100644
index 0000000..77fa9f4
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.css
@@ -0,0 +1,61 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Panel Service (layout) -- CSS file
+ */
+
+.floatpanel {
+ position: absolute;
+ z-index: 100;
+ display: block;
+ top: 160px;
+ width: 544px;
+ right: -550px;
+ opacity: 100;
+
+ padding: 2px;
+ font-size: 10pt;
+}
+
+/* The following 4 are copied here from Theme until we sort out the
+ * theme service
+ */
+.floatpanel {
+ background-color: white;
+ color: #3c3a3a;
+ border: 1px solid #c7c7c0;
+}
+
+.floatpanel hr {
+ border: 1px solid #c7c7c0;
+}
+
+.floatpanel .bottom tr:nth-child(odd) {
+ background-color: #f4f4f4;
+}
+
+.floatpanel .bottom tr:nth-child(even) {
+ background-color: #fbfbfb;
+}
+
+.floatpanel.dialog {
+ top: 180px;
+}
+
+html[data-platform='iPad'] .floatpanel {
+ top: 80px;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.base.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.base.ts
new file mode 100644
index 0000000..591aa77
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.base.ts
@@ -0,0 +1,298 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { FnService } from '../util/fn.service';
+import { LoadingService } from '../layer/loading.service';
+import { LogService } from '../log.service';
+import { WebSocketService } from '../remote/websocket.service';
+import { Observable, of } from 'rxjs';
+
+const REFRESH_INTERVAL = 2000;
+const SEARCH_REGEX = '\\W';
+
+/**
+ * Model of table annotations within this table base class
+ */
+export interface TableAnnots {
+ noRowsMsg: string;
+}
+
+/**
+ * A model of data returned from Web Socket in a TableResponse
+ *
+ * There is an interface extending from this one in the parent component
+ */
+export interface TableResponse {
+ annots: any;
+ // There will be other parts to the response depending on table type
+ // Expect one called tag+'s' e.g. devices or apps
+}
+
+/**
+ * A criteria for filtering the tableData
+ */
+export interface TableFilter {
+ queryStr: string;
+ queryBy: string;
+ sortBy: string;
+}
+
+/**
+ * Enumerated values for the sort dir
+ */
+export enum SortDir {
+ asc = 'asc', desc = 'desc'
+}
+
+/**
+ * A structure to format sort params for table
+ * This is sent to WebSocket as part of table request
+ */
+export interface SortParams {
+ firstCol: string;
+ firstDir: SortDir;
+ secondCol: string;
+ secondDir: SortDir;
+}
+
+export interface PayloadParams {
+ devId: string;
+}
+
+
+/**
+ * ONOS GUI -- Widget -- Table Base class
+ */
+export abstract class TableBaseImpl {
+ // attributes from the interface
+ protected annots: TableAnnots;
+ protected changedData: string[] = [];
+ protected payloadParams: PayloadParams;
+ protected sortParams: SortParams;
+ protected selectCallback; // Function
+ protected parentSelCb = null;
+ protected responseCallback; // Function
+ selId: string = undefined;
+ tableData: any[] = [];
+ tableDataFilter: TableFilter;
+ toggleRefresh; // Function
+ autoRefresh: boolean = true;
+ autoRefreshTip: string = 'Toggle auto refresh'; // TODO: get LION string
+
+ private root: string;
+ private req: string;
+ private resp: string;
+ private refreshPromise: any = null;
+ private handlers: string[] = [];
+
+ constructor(
+ protected fs: FnService,
+ protected ls: LoadingService,
+ protected log: LogService,
+ protected wss: WebSocketService,
+ protected tag: string,
+ protected idKey: string = 'id',
+ protected selCb = () => ({}) // Function
+ ) {
+ this.root = tag + 's';
+ this.req = tag + 'DataRequest';
+ this.resp = tag + 'DataResponse';
+
+ this.selectCallback = this.rowSelectionCb;
+ this.toggleRefresh = () => {
+ this.autoRefresh = !this.autoRefresh;
+ this.autoRefresh ? this.startRefresh() : this.stopRefresh();
+ };
+
+ // Mapped to the search and searchBy inputs in template
+ // Changes are handled through TableFilterPipe
+ this.tableDataFilter = <TableFilter>{
+ queryStr: '',
+ queryBy: '$',
+ };
+ }
+
+ init() {
+ this.wss.bindHandlers(new Map<string, (data) => void>([
+ [this.resp, (data) => this.tableDataResponseCb(data)]
+ ]));
+ this.handlers.push(this.resp);
+
+ this.annots = <TableAnnots>{
+ noRowsMsg: ''
+ };
+
+ // Now send the WebSocket request and make it repeat every 2 seconds
+ this.requestTableData();
+ this.startRefresh();
+ this.log.debug('TableBase initialized. Calling ', this.req,
+ 'every', REFRESH_INTERVAL, 'ms');
+ }
+
+ destroy() {
+ this.wss.unbindHandlers(this.handlers);
+ this.stopRefresh();
+ this.ls.stop();
+ }
+
+ /**
+ * A callback that executes when the table data that was requested
+ * on WebSocketService arrives.
+ *
+ * Happens every 2 seconds
+ */
+ tableDataResponseCb(data: TableResponse) {
+ this.ls.stop();
+
+ const newTableData: any[] = Array.from(data[this.root]);
+ this.annots.noRowsMsg = data.annots.no_rows_msg;
+
+ // If the parents onResp() function is set then call it
+ if (this.responseCallback) {
+ this.responseCallback(data);
+ }
+ this.changedData = [];
+
+ // checks if data changed for row flashing
+ if (JSON.stringify(newTableData) !== JSON.stringify(this.tableData)) {
+ this.log.debug('table data has changed');
+ const oldTableData: any[] = this.tableData;
+ this.tableData = [...newTableData]; // ES6 spread syntax
+ // only flash the row if the data already exists
+ if (oldTableData.length > 0) {
+ for (const idx in newTableData) {
+ if (!this.fs.containsObj(oldTableData, newTableData[idx])) {
+ this.changedData.push(newTableData[idx][this.idKey]);
+ }
+ }
+ }
+ }
+ }
+
+ /**
+ * Table Data Request
+ * Pass in sort parameters and the set will be returned sorted
+ * In the old GUI there was also a query parameter, but this was not
+ * implemented on the server end
+ */
+ requestTableData() {
+ const p = Object.assign({}, this.sortParams, this.payloadParams);
+
+ // Allow it to sit in pending events
+ if (this.wss.isConnected()) {
+ if (this.fs.debugOn('table')) {
+ this.log.debug('Table data REQUEST:', this.req, p);
+ }
+ this.wss.sendEvent(this.req, p);
+ this.ls.start();
+ }
+ }
+
+ /**
+ * Row Selected
+ */
+ rowSelectionCb(event: any, selRow: any): void {
+ const selId: string = selRow[this.idKey];
+ this.selId = (this.selId === selId) ? undefined : selId;
+ this.log.debug('Row', selId, 'selected');
+ if (this.parentSelCb) {
+ this.parentSelCb(event, selRow);
+ }
+ }
+
+ /**
+ * autoRefresh functions
+ */
+ startRefresh() {
+ this.refreshPromise =
+ setInterval(() => {
+ if (!this.ls.waiting()) {
+ if (this.fs.debugOn('table')) {
+ this.log.debug('Refreshing ' + this.root + ' page');
+ }
+ this.requestTableData();
+ }
+ }, REFRESH_INTERVAL);
+ }
+
+ stopRefresh() {
+ if (this.refreshPromise) {
+ clearInterval(this.refreshPromise);
+ this.refreshPromise = null;
+ }
+ }
+
+ isChanged(id: string): boolean {
+ return (this.fs.inArray(id, this.changedData) === -1) ? false : true;
+ }
+
+ /**
+ * A dummy implementation of the lionFn until the response is received and the LION
+ * bundle is received from the WebSocket
+ */
+ dummyLion(key: string): string {
+ return '%' + key + '%';
+ }
+
+ /**
+ * Change the sort order of the data returned
+ *
+ * sortParams are passed to the server by WebSocket and the data is
+ * returned sorted
+ *
+ * This is usually assigned to the (click) event on a column, and the column
+ * name passed in e.g. (click)="onSort('origin')
+ * If the column that is passed in is already the firstCol, then reverse its direction
+ * If a new column is passed in, then make the existing col the 2nd sort order
+ */
+ onSort(colName: string) {
+ if (this.sortParams.firstCol === colName) {
+ if (this.sortParams.firstDir === SortDir.desc) {
+ this.sortParams.firstDir = SortDir.asc;
+ return;
+ } else {
+ this.sortParams.firstDir = SortDir.desc;
+ return;
+ }
+ } else {
+ this.sortParams.secondCol = this.sortParams.firstCol;
+ this.sortParams.secondDir = this.sortParams.firstDir;
+ this.sortParams.firstCol = colName;
+ this.sortParams.firstDir = SortDir.desc;
+ }
+ this.log.debug('Sort params', this.sortParams);
+ this.requestTableData();
+ }
+
+ sortIcon(column: string): string {
+ if (this.sortParams.firstCol === column) {
+ if (this.sortParams.firstDir === SortDir.asc) {
+ return 'upArrow';
+ } else {
+ return 'downArrow';
+ }
+ } else {
+ return '';
+ }
+ }
+
+ /**
+ * De-selects the row
+ */
+ deselectRow(event) {
+ this.log.debug('Details panel close event');
+ this.selId = event;
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.css
new file mode 100644
index 0000000..6b78988
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.css
@@ -0,0 +1,109 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/* ------ for summary-list tables (layout) ------ */
+
+div.summary-list {
+ margin: 0 20px 16px 10px;
+ font-size: 10pt;
+ border-spacing: 0;
+}
+
+div.summary-list table {
+ border-collapse: collapse;
+ table-layout: fixed;
+ empty-cells: show;
+ margin: 0;
+}
+
+div.summary-list div.table-body {
+ overflow-y: scroll;
+}
+
+div.summary-list div.table-body::-webkit-scrollbar {
+ display: none;
+}
+
+div.summary-list div.table-body tr.no-data td {
+ text-align: center;
+ font-style: italic;
+}
+
+
+/* highlighting */
+div.summary-list tr {
+ transition: background-color 500ms;
+}
+
+div.summary-list td {
+ padding: 4px;
+ text-align: left;
+ word-wrap: break-word;
+ font-size: 10pt;
+}
+
+div.summary-list td.table-icon {
+ width: 42px;
+ padding-top: 4px;
+ padding-bottom: 0px;
+ padding-left: 4px;
+ text-align: center;
+}
+
+div.summary-list .table-header th {
+ font-weight: bold;
+ font-variant: small-caps;
+ text-transform: uppercase;
+ font-size: 10pt;
+ padding-top: 8px;
+ padding-bottom: 8px;
+ letter-spacing: 0.02em;
+ cursor: pointer;
+}
+
+/* rows are selectable */
+div.summary-list .table-body td {
+ cursor: pointer;
+}
+
+/* Tabular view controls */
+
+div.tabular-header .search {
+ margin: 0 0 10px 10px;
+}
+
+
+div.tabular-header div.ctrl-btns {
+ display: inline-block;
+ float: right;
+ height: 44px;
+ margin-top: 24px;
+ margin-right: 20px;
+ position: absolute;
+ right: 0px;
+}
+
+div.tabular-header div.ctrl-btns div {
+ display: inline-block;
+ cursor: pointer;
+}
+
+div.tabular-header div.ctrl-btns div.separator {
+ width: 0;
+ height: 40px;
+ padding: 0;
+ border-right: 1px solid #c7c7c0;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.theme.css
new file mode 100644
index 0000000..cc7e7e6
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.theme.css
@@ -0,0 +1,152 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/* ------ for summary-list tables (theme) ------ */
+
+.light div.summary-list, .table-header th {
+ background-color: #e5e5e6;
+ color: #3c3a3a;
+}
+
+.light div.summary-list, td {
+ color: #3c3a3a;
+}
+
+.light div.summary-list, tr:nth-child(even) {
+ background-color: #f4f4f4;
+}
+.light div.summary-list, tr:nth-child(odd) {
+ background-color: #fbfbfb;
+}
+
+.light div.summary-list, tr.selected {
+ background-color: #dbeffc !important;
+}
+
+
+.light div.summary-list, tr.data-change {
+ background-color: #FDFFDC;
+}
+
+/* --- Control Buttons --- */
+
+/* INACTIVE */
+.light .ctrl-btns div svg.embeddedIcon g.icon use {
+ fill: #e0dfd6;
+}
+/* note: no change for inactive buttons when hovered */
+
+
+/* ACTIVE */
+.light .ctrl-btns div.active svg.embeddedIcon g.icon use {
+ fill: #939598;
+}
+.light .ctrl-btns div.active:hover svg.embeddedIcon g.icon use {
+ fill: #ce5b58;
+}
+
+/* CURRENT-VIEW */
+.light .ctrl-btns div.current-view svg.embeddedIcon g.icon rect {
+ fill: #518ecc;
+}
+.light .ctrl-btns div.current-view svg.embeddedIcon g.icon use {
+ fill: white;
+}
+
+/* REFRESH */
+.light .ctrl-btns div.refresh svg.embeddedIcon g.icon use {
+ fill: #cdeff2;
+}
+.light .ctrl-btns div.refresh:hover svg.embeddedIcon g.icon use {
+ fill: #ce5b58;
+}
+.light .ctrl-btns div.refresh.active svg.embeddedIcon g.icon use {
+ fill: #009fdb;
+}
+.light .ctrl-btns div.refresh.active:hover svg.embeddedIcon g.icon use {
+ fill: #ce5b58;
+}
+
+
+/* ========== DARK Theme ========== */
+
+.dark div.summary-list .table-header td {
+ background-color: #222222;
+ color: #cccccc;
+}
+
+.dark div.summary-list td {
+ /* note: don't put background-color here */
+ color: #cccccc;
+}
+.dark div.summary-list tr.no-data td {
+ background-color: #333333;
+}
+
+.dark div.summary-list tr:nth-child(even) {
+ background-color: #333333;
+}
+.dark div.summary-list tr:nth-child(odd) {
+ background-color: #3a3a3a;
+}
+
+.dark div.summary-list tr.selected {
+ background-color: #304860 !important;
+}
+
+
+.dark div.summary-list tr.data-change {
+ background-color: #423708;
+}
+
+/* --- Control Buttons --- */
+
+/* INACTIVE */
+.dark .ctrl-btns div svg.embeddedIcon g.icon use {
+ fill: #444444;
+}
+/* note: no change for inactive buttons when hovered */
+
+
+/* ACTIVE */
+.dark .ctrl-btns div.active svg.embeddedIcon g.icon use {
+ fill: #939598;
+}
+.dark .ctrl-btns div.active:hover svg.embeddedIcon g.icon use {
+ fill: #ce5b58;
+}
+
+/* CURRENT-VIEW */
+.dark .ctrl-btns div.current-view svg.embeddedIcon g.icon rect {
+ fill: #518ecc;
+}
+.dark .ctrl-btns div.current-view svg.embeddedIcon g.icon use {
+ fill: #dddddd;
+}
+
+/* REFRESH */
+.dark .ctrl-btns div.refresh svg.embeddedIcon g.icon use {
+ fill: #364144;
+}
+.dark .ctrl-btns div.refresh:hover svg.embeddedIcon g.icon use {
+ fill: #ce5b58;
+}
+.dark .ctrl-btns div.refresh.active svg.embeddedIcon g.icon use {
+ fill: #0074a6;
+}
+.dark .ctrl-btns div.refresh.active:hover svg.embeddedIcon g.icon use {
+ fill: #ce5b58;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.spec.ts
new file mode 100644
index 0000000..8832feb
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.spec.ts
@@ -0,0 +1,104 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the 'License');
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an 'AS IS' BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { TableFilterPipe } from './tablefilter.pipe';
+import { TableFilter } from './table.base';
+
+describe('TableFilterPipe', () => {
+
+ const pipe = new TableFilterPipe();
+ const items: any[] = new Array();
+ // Array item 0
+ items.push({
+ id: 'abc',
+ title: 'def',
+ origin: 'ghi'
+ });
+ // Array item 1
+ items.push({
+ id: 'pqr',
+ title: 'stu',
+ origin: 'vwx'
+ });
+ // Array item 2
+ items.push({
+ id: 'dog',
+ title: 'mouse',
+ origin: 'cat'
+ });
+
+
+ it('create an instance', () => {
+ expect(pipe).toBeTruthy();
+ });
+
+ it('expect it to handle empty search', () => {
+ const filteredItems: any[] =
+ pipe.transform(items, <TableFilter>{queryStr: '', queryBy: 'title'});
+ expect(filteredItems).toEqual(items);
+ });
+
+ it('expect it to handle empty items', () => {
+ const filteredItems: any[] =
+ pipe.transform(new Array(), <TableFilter>{queryStr: 'de', queryBy: 'title'});
+ expect(filteredItems).toEqual(new Array());
+ });
+
+
+ it('expect it to match 0 by title', () => {
+ const filteredItems: any[] =
+ pipe.transform(items, <TableFilter>{queryStr: 'de', queryBy: 'title'});
+ expect(filteredItems).toEqual(items.slice(0, 1));
+ });
+
+ it('expect it to match 1 by title', () => {
+ const filteredItems: any[] =
+ pipe.transform(items, <TableFilter>{queryStr: 'st', queryBy: 'title'});
+ expect(filteredItems).toEqual(items.slice(1, 2));
+ });
+
+ it('expect it to match 1 by uppercase title', () => {
+ const filteredItems: any[] =
+ pipe.transform(items, <TableFilter>{queryStr: 'sT', queryBy: 'title'});
+ expect(filteredItems).toEqual(items.slice(1, 2));
+ });
+
+ it('expect it to not match by title', () => {
+ const filteredItems: any[] =
+ pipe.transform(items, <TableFilter>{queryStr: 'pq', queryBy: 'title'});
+ expect(filteredItems.length).toEqual(0);
+ });
+
+ it('expect it to match 1 by all fields', () => {
+ const filteredItems: any[] =
+ pipe.transform(items, <TableFilter>{queryStr: 'pq', queryBy: '$'});
+ expect(filteredItems).toEqual(items.slice(1, 2));
+ });
+
+ it('expect it to not match by all fields', () => {
+ const filteredItems: any[] =
+ pipe.transform(items, <TableFilter>{queryStr: 'yz', queryBy: '$'});
+ expect(filteredItems.length).toEqual(0);
+ });
+
+ /**
+ * Check that items one and two contain a 't' - title=stu and origin=cat
+ */
+ it('expect it to match 1,2 by all fields', () => {
+ const filteredItems: any[] =
+ pipe.transform(items, <TableFilter>{queryStr: 't', queryBy: '$'});
+ expect(filteredItems).toEqual(items.slice(1));
+ });
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.ts
new file mode 100644
index 0000000..5ef048c
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.ts
@@ -0,0 +1,58 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the 'License');
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an 'AS IS' BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Pipe, PipeTransform } from '@angular/core';
+import { TableFilter } from './table.base';
+
+/**
+ * Only return the tabledata that matches filtering with some queries
+ *
+ * Note: the pipe is marked pure here as we need to filter on the
+ * content of the filter object (it's not a primitive type)
+ */
+@Pipe({
+ name: 'filter',
+ pure: false
+})
+export class TableFilterPipe implements PipeTransform {
+
+ /**
+ * From an array of table items just return those that match the filter
+ */
+ transform(items: any[], tableDataFilter: TableFilter): any[] {
+ if (!items) {
+ return [];
+ }
+ if (!tableDataFilter.queryStr) {
+ return items;
+ }
+
+ const queryStr = tableDataFilter.queryStr.toLowerCase();
+
+ return items.filter( it => {
+ if (tableDataFilter.queryBy === '$') {
+ const t1 = Object.values(it);
+ const t2 = Object.values(it).filter(value => {
+ return (<string>value).toLowerCase().includes(queryStr);
+ });
+ return Object.values(it).filter(value => {
+ return (<string>value).toLowerCase().includes(queryStr);
+ }).length > 0;
+ } else {
+ return it[tableDataFilter.queryBy].toLowerCase().includes(queryStr);
+ }
+ });
+ }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tableresize.directive.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tableresize.directive.ts
new file mode 100644
index 0000000..150d3a7
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tableresize.directive.ts
@@ -0,0 +1,83 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { AfterContentChecked, Directive, ElementRef, Inject } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+import { MastService } from '../mast/mast.service';
+import { HostListener } from '@angular/core';
+import * as d3 from 'd3';
+
+/**
+ * ONOS GUI -- Widget -- Table Resize Directive
+ */
+@Directive({
+ selector: '[onosTableResize]',
+})
+export class TableResizeDirective implements AfterContentChecked {
+
+ pdg = 22;
+ tables: any;
+
+ constructor(protected fs: FnService,
+ protected log: LogService,
+ protected mast: MastService,
+ protected el: ElementRef,
+ @Inject('Window') private w: any) {
+
+ log.info('TableResizeDirective constructed');
+ }
+
+ ngAfterContentChecked() {
+ this.tables = {
+ thead: d3.select('div.table-header').select('table'),
+ tbody: d3.select('div.table-body').select('table')
+ };
+ this.windowSize(this.tables);
+ }
+
+ windowSize(tables: any) {
+ const wsz = this.fs.windowSize(0, 30);
+ this.adjustTable(tables, wsz.width, wsz.height);
+ }
+
+ @HostListener('window:resize', ['event'])
+ onResize(event: any) {
+ this.windowSize(this.tables);
+ return {
+ h: this.w.innerHeight,
+ w: this.w.innerWidth
+ };
+ }
+
+ adjustTable(tables: any, width: number, height: number) {
+ this._width(tables.thead, width + 'px');
+ this._width(tables.tbody, width + 'px');
+
+ this.setHeight(tables.thead, d3.select('div.table-body'), height);
+ }
+
+ _width(elem, width) {
+ elem.style('width', width);
+ }
+
+ setHeight(thead: any, body: any, height: number) {
+ const h = height - (this.mast.mastHeight +
+ this.fs.noPxStyle(d3.select('.tabular-header'), 'height') +
+ this.fs.noPxStyle(thead, 'height') + this.pdg);
+ body.style('height', h + 'px');
+ }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/public_api.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/public_api.ts
new file mode 100644
index 0000000..51cf201
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/public_api.ts
@@ -0,0 +1,57 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ * Public API Surface of gui2-fw-lib
+ */
+
+export * from './lib/gui2-fw-lib.module';
+
+export * from './lib/util/fn.service';
+export * from './lib/log.service';
+export * from './lib/consolelogger.service';
+export * from './lib/svg/icon.service';
+
+export * from './lib/nav/nav.service';
+export * from './lib/mast/mast.service';
+export * from './lib/remote/wsock.service';
+export * from './lib/remote/urlfn.service';
+export * from './lib/remote/websocket.service';
+export * from './lib/onos.service';
+export * from './lib/layer/loading.service';
+export * from './lib/layer/panel.service';
+export * from './lib/svg/svgutil.service';
+export * from './lib/svg/glyphdata.service';
+export * from './lib/svg/glyph.service';
+export * from './lib/util/prefs.service';
+export * from './lib/util/fn.service';
+export * from './lib/util/lion.service';
+export * from './lib/util/theme.service';
+
+export * from './lib/mast/mast/mast.component';
+export * from './lib/layer/veil/veil.component';
+export * from './lib/layer/flash/flash.component';
+export * from './lib/layer/confirm/confirm.component';
+export * from './lib/svg/icon/icon.component';
+
+export * from './lib/widget/tableresize.directive';
+export * from './lib/detectbrowser.directive';
+
+export * from './lib/widget/tablefilter.pipe';
+
+export * from './lib/widget/detailspanel.base';
+export * from './lib/widget/panel.base';
+export * from './lib/widget/table.base';
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/test.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/test.ts
new file mode 100644
index 0000000..af048c5e
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/test.ts
@@ -0,0 +1,38 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// This file is required by karma.conf.js and loads recursively all the .spec and framework files
+
+import 'core-js/es7/reflect';
+import 'zone.js/dist/zone';
+import 'zone.js/dist/zone-testing';
+import { getTestBed } from '@angular/core/testing';
+import {
+ BrowserDynamicTestingModule,
+ platformBrowserDynamicTesting
+} from '@angular/platform-browser-dynamic/testing';
+
+declare const require: any;
+
+// First, initialize the Angular testing environment.
+getTestBed().initTestEnvironment(
+ BrowserDynamicTestingModule,
+ platformBrowserDynamicTesting()
+);
+// Then we find all the tests.
+const context = require.context('./', true, /\.spec\.ts$/);
+// And load the modules.
+context.keys().map(context);
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.lib.json b/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.lib.json
new file mode 100644
index 0000000..704bf8e
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.lib.json
@@ -0,0 +1,33 @@
+{
+ "extends": "../../tsconfig.json",
+ "compilerOptions": {
+ "outDir": "../../out-tsc/lib",
+ "target": "es2015",
+ "module": "es2015",
+ "moduleResolution": "node",
+ "declaration": true,
+ "sourceMap": true,
+ "inlineSources": true,
+ "emitDecoratorMetadata": true,
+ "experimentalDecorators": true,
+ "importHelpers": true,
+ "types": [],
+ "lib": [
+ "dom",
+ "es2017"
+ ]
+ },
+ "angularCompilerOptions": {
+ "annotateForClosureCompiler": true,
+ "skipTemplateCodegen": true,
+ "strictMetadataEmit": true,
+ "fullTemplateTypeCheck": true,
+ "strictInjectionParameters": true,
+ "flatModuleId": "AUTOGENERATED",
+ "flatModuleOutFile": "AUTOGENERATED"
+ },
+ "exclude": [
+ "src/test.ts",
+ "**/*.spec.ts"
+ ]
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.spec.json b/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.spec.json
new file mode 100644
index 0000000..16da33d
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.spec.json
@@ -0,0 +1,17 @@
+{
+ "extends": "../../tsconfig.json",
+ "compilerOptions": {
+ "outDir": "../../out-tsc/spec",
+ "types": [
+ "jasmine",
+ "node"
+ ]
+ },
+ "files": [
+ "src/test.ts"
+ ],
+ "include": [
+ "**/*.spec.ts",
+ "**/*.d.ts"
+ ]
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/tslint.json b/web/gui2-fw-lib/projects/gui2-fw-lib/tslint.json
new file mode 100644
index 0000000..3daf6d4
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/tslint.json
@@ -0,0 +1,17 @@
+{
+ "extends": "../../tslint.json",
+ "rules": {
+ "directive-selector": [
+ true,
+ "attribute",
+ "onos",
+ "camelCase"
+ ],
+ "component-selector": [
+ true,
+ "element",
+ "onos",
+ "kebab-case"
+ ]
+ }
+}
diff --git a/web/gui2-fw-lib/src/app/app.component.css b/web/gui2-fw-lib/src/app/app.component.css
new file mode 100644
index 0000000..85b86e1
--- /dev/null
+++ b/web/gui2-fw-lib/src/app/app.component.css
@@ -0,0 +1,19 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#tooltip {
+ visibility: visible;
+}
diff --git a/web/gui2-fw-lib/src/app/app.component.html b/web/gui2-fw-lib/src/app/app.component.html
new file mode 100644
index 0000000..26f2562
--- /dev/null
+++ b/web/gui2-fw-lib/src/app/app.component.html
@@ -0,0 +1,46 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~ http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+
+<div style="text-align:center">
+ <onos-icon iconId="nav_apps" iconSize="200" toolTip="Test app"></onos-icon>
+ <h1>
+ Welcome to {{ title }}!
+ </h1>
+</div>
+<h2>Test App - Do not use or extend</h2>
+<p>This app is just a wrapper around the GUI 2 Framework Library and is
+ necessary only to provide a base for that library.
+It has a use in validating that the library can be loaded.
+
+The library is linked in here by the addition of the paths statement in
+ tsconfig.json. This is fine for accessing a local library, but for another
+ project it should be added in through package.json, using the 'file' locator.
+ Then run "npm install" in that target project and the tar will be expanded in
+ to it's node_modules folder.
+
+A good article on the creation and use of libraries in Angular 6 is given in<br />
+ <a href="https://blog.angularindepth.com/creating-a-library-in-angular-6-87799552e7e5">The Angular Library Series - Creating a Library with the Angular CLI</a><br />
+ and <br />
+ <a href="https://blog.angularindepth.com/creating-a-library-in-angular-6-part-2-6e2bc1e14121">The Angular Library Series - Building and Packaging</a><br />
+
+This "app" component is not built by Bazel - it's only the library that is built
+ by bazel which in turn calls "ng build --prod gui2-fw-lib" and then "npm pack"
+ resulting in a tar file that can be used as an NPM package anywhere.
+<br />
+Note: Please remember that in Angular 6 rebuilding of libraries is not automatic.
+ If you change anything in the library, you will have to build it again before
+ it is picked up in this app.
+</p>
diff --git a/web/gui2-fw-lib/src/app/app.component.ts b/web/gui2-fw-lib/src/app/app.component.ts
new file mode 100644
index 0000000..b6a7c8b
--- /dev/null
+++ b/web/gui2-fw-lib/src/app/app.component.ts
@@ -0,0 +1,33 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { Component } from '@angular/core';
+import { FnService } from 'gui2-fw-lib';
+
+@Component({
+ selector: 'app-root',
+ templateUrl: './app.component.html',
+ styleUrls: ['./app.component.css']
+})
+export class AppComponent {
+ title = 'Test app for GUI Framework Library';
+
+ constructor(
+ protected fs: FnService
+ ) {
+ this.title = this.fs.cap(this.title);
+ }
+}
diff --git a/web/gui2-fw-lib/src/app/app.module.ts b/web/gui2-fw-lib/src/app/app.module.ts
new file mode 100644
index 0000000..dc92383
--- /dev/null
+++ b/web/gui2-fw-lib/src/app/app.module.ts
@@ -0,0 +1,42 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { BrowserModule } from '@angular/platform-browser';
+import { NgModule } from '@angular/core';
+import { RouterModule, Routes } from '@angular/router';
+import { AppComponent } from './app.component';
+import { Gui2FwLibModule, ConsoleLoggerService, LogService } from 'gui2-fw-lib';
+
+const appRoutes: Routes = [
+ { path: '**', component: AppComponent }
+]
+
+@NgModule({
+ declarations: [
+ AppComponent
+ ],
+ imports: [
+ RouterModule.forRoot(appRoutes),
+ BrowserModule,
+ Gui2FwLibModule
+ ],
+ providers: [
+ { provide: 'Window', useValue: window },
+ { provide: LogService, useClass: ConsoleLoggerService },
+ ],
+ bootstrap: [AppComponent]
+})
+export class AppModule { }
diff --git a/web/gui2-fw-lib/src/assets/.gitkeep b/web/gui2-fw-lib/src/assets/.gitkeep
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/web/gui2-fw-lib/src/assets/.gitkeep
diff --git a/web/gui2-fw-lib/src/browserslist b/web/gui2-fw-lib/src/browserslist
new file mode 100644
index 0000000..8e09ab4
--- /dev/null
+++ b/web/gui2-fw-lib/src/browserslist
@@ -0,0 +1,9 @@
+# This file is currently used by autoprefixer to adjust CSS to support the below specified browsers
+# For additional information regarding the format and rule options, please see:
+# https://github.com/browserslist/browserslist#queries
+# For IE 9-11 support, please uncomment the last line of the file and adjust as needed
+> 0.5%
+last 2 versions
+Firefox ESR
+not dead
+# IE 9-11
\ No newline at end of file
diff --git a/web/gui2-fw-lib/src/environments/environment.prod.ts b/web/gui2-fw-lib/src/environments/environment.prod.ts
new file mode 100644
index 0000000..63a2bac
--- /dev/null
+++ b/web/gui2-fw-lib/src/environments/environment.prod.ts
@@ -0,0 +1,19 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+export const environment = {
+ production: true
+};
diff --git a/web/gui2-fw-lib/src/environments/environment.ts b/web/gui2-fw-lib/src/environments/environment.ts
new file mode 100644
index 0000000..5bb7d11
--- /dev/null
+++ b/web/gui2-fw-lib/src/environments/environment.ts
@@ -0,0 +1,31 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// This file can be replaced during build by using the `fileReplacements` array.
+// `ng build ---prod` replaces `environment.ts` with `environment.prod.ts`.
+// The list of file replacements can be found in `angular.json`.
+
+export const environment = {
+ production: false
+};
+
+/*
+ * In development mode, to ignore zone related error stack frames such as
+ * `zone.run`, `zoneDelegate.invokeTask` for easier debugging, you can
+ * import the following file, but please comment it out in production mode
+ * because it will have performance impact when throw error
+ */
+// import 'zone.js/dist/zone-error'; // Included with Angular CLI.
diff --git a/web/gui2-fw-lib/src/favicon.ico b/web/gui2-fw-lib/src/favicon.ico
new file mode 100644
index 0000000..8081c7c
--- /dev/null
+++ b/web/gui2-fw-lib/src/favicon.ico
Binary files differ
diff --git a/web/gui2-fw-lib/src/index.html b/web/gui2-fw-lib/src/index.html
new file mode 100644
index 0000000..a087a77
--- /dev/null
+++ b/web/gui2-fw-lib/src/index.html
@@ -0,0 +1,31 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~ http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+
+<!doctype html>
+<html lang="en">
+<head>
+ <meta charset="utf-8">
+ <title>Gui2FwLibApp</title>
+ <base href="/">
+
+ <meta name="viewport" content="width=device-width, initial-scale=1">
+ <link rel="icon" type="image/x-icon" href="favicon.ico">
+</head>
+<body>
+ <!-- See app/app.component.html for an explanation of this <app-root> component -->
+ <app-root></app-root>
+</body>
+</html>
diff --git a/web/gui2-fw-lib/src/karma.conf.js b/web/gui2-fw-lib/src/karma.conf.js
new file mode 100644
index 0000000..88edff0
--- /dev/null
+++ b/web/gui2-fw-lib/src/karma.conf.js
@@ -0,0 +1,47 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// Karma configuration file, see link for more information
+// https://karma-runner.github.io/1.0/config/configuration-file.html
+
+module.exports = function (config) {
+ config.set({
+ basePath: '',
+ frameworks: ['jasmine', '@angular-devkit/build-angular'],
+ plugins: [
+ require('karma-jasmine'),
+ require('karma-chrome-launcher'),
+ require('karma-jasmine-html-reporter'),
+ require('karma-coverage-istanbul-reporter'),
+ require('@angular-devkit/build-angular/plugins/karma')
+ ],
+ client: {
+ clearContext: false // leave Jasmine Spec Runner output visible in browser
+ },
+ coverageIstanbulReporter: {
+ dir: require('path').join(__dirname, '../coverage'),
+ reports: ['html', 'lcovonly'],
+ fixWebpackSourcePaths: true
+ },
+ reporters: ['progress', 'kjhtml'],
+ port: 9876,
+ colors: true,
+ logLevel: config.LOG_INFO,
+ autoWatch: true,
+ browsers: ['Chrome'],
+ singleRun: false
+ });
+};
diff --git a/web/gui2-fw-lib/src/main.ts b/web/gui2-fw-lib/src/main.ts
new file mode 100644
index 0000000..d7800c7
--- /dev/null
+++ b/web/gui2-fw-lib/src/main.ts
@@ -0,0 +1,28 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { enableProdMode } from '@angular/core';
+import { platformBrowserDynamic } from '@angular/platform-browser-dynamic';
+
+import { AppModule } from './app/app.module';
+import { environment } from './environments/environment';
+
+if (environment.production) {
+ enableProdMode();
+}
+
+platformBrowserDynamic().bootstrapModule(AppModule)
+ .catch(err => console.log(err));
diff --git a/web/gui2-fw-lib/src/polyfills.ts b/web/gui2-fw-lib/src/polyfills.ts
new file mode 100644
index 0000000..85bbb3a
--- /dev/null
+++ b/web/gui2-fw-lib/src/polyfills.ts
@@ -0,0 +1,96 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/**
+ * This file includes polyfills needed by Angular and is loaded before the app.
+ * You can add your own extra polyfills to this file.
+ *
+ * This file is divided into 2 sections:
+ * 1. Browser polyfills. These are applied before loading ZoneJS and are sorted by browsers.
+ * 2. Application imports. Files imported after ZoneJS that should be loaded before your main
+ * file.
+ *
+ * The current setup is for so-called "evergreen" browsers; the last versions of browsers that
+ * automatically update themselves. This includes Safari >= 10, Chrome >= 55 (including Opera),
+ * Edge >= 13 on the desktop, and iOS 10 and Chrome on mobile.
+ *
+ * Learn more in https://angular.io/docs/ts/latest/guide/browser-support.html
+ */
+
+/***************************************************************************************************
+ * BROWSER POLYFILLS
+ */
+
+/** IE9, IE10 and IE11 requires all of the following polyfills. **/
+// import 'core-js/es6/symbol';
+// import 'core-js/es6/object';
+// import 'core-js/es6/function';
+// import 'core-js/es6/parse-int';
+// import 'core-js/es6/parse-float';
+// import 'core-js/es6/number';
+// import 'core-js/es6/math';
+// import 'core-js/es6/string';
+// import 'core-js/es6/date';
+// import 'core-js/es6/array';
+// import 'core-js/es6/regexp';
+// import 'core-js/es6/map';
+// import 'core-js/es6/weak-map';
+// import 'core-js/es6/set';
+
+/** IE10 and IE11 requires the following for NgClass support on SVG elements */
+// import 'classlist.js'; // Run `npm install --save classlist.js`.
+
+/** IE10 and IE11 requires the following for the Reflect API. */
+// import 'core-js/es6/reflect';
+
+
+/** Evergreen browsers require these. **/
+// Used for reflect-metadata in JIT. If you use AOT (and only Angular decorators), you can remove.
+import 'core-js/es7/reflect';
+
+
+/**
+ * Web Animations `@angular/platform-browser/animations`
+ * Only required if AnimationBuilder is used within the application and using IE/Edge or Safari.
+ * Standard animation support in Angular DOES NOT require any polyfills (as of Angular 6.0).
+ **/
+// import 'web-animations-js'; // Run `npm install --save web-animations-js`.
+
+/**
+ * By default, zone.js will patch all possible macroTask and DomEvents
+ * user can disable parts of macroTask/DomEvents patch by setting following flags
+ */
+
+ // (window as any).__Zone_disable_requestAnimationFrame = true; // disable patch requestAnimationFrame
+ // (window as any).__Zone_disable_on_property = true; // disable patch onProperty such as onclick
+ // (window as any).__zone_symbol__BLACK_LISTED_EVENTS = ['scroll', 'mousemove']; // disable patch specified eventNames
+
+ /*
+ * in IE/Edge developer tools, the addEventListener will also be wrapped by zone.js
+ * with the following flag, it will bypass `zone.js` patch for IE/Edge
+ */
+// (window as any).__Zone_enable_cross_context_check = true;
+
+/***************************************************************************************************
+ * Zone JS is required by default for Angular itself.
+ */
+import 'zone.js/dist/zone'; // Included with Angular CLI.
+
+
+
+/***************************************************************************************************
+ * APPLICATION IMPORTS
+ */
diff --git a/web/gui2-fw-lib/src/styles.css b/web/gui2-fw-lib/src/styles.css
new file mode 100644
index 0000000..90d4ee0
--- /dev/null
+++ b/web/gui2-fw-lib/src/styles.css
@@ -0,0 +1 @@
+/* You can add global styles to this file, and also import other style files */
diff --git a/web/gui2-fw-lib/src/test.ts b/web/gui2-fw-lib/src/test.ts
new file mode 100644
index 0000000..38acf1e
--- /dev/null
+++ b/web/gui2-fw-lib/src/test.ts
@@ -0,0 +1,36 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// This file is required by karma.conf.js and loads recursively all the .spec and framework files
+
+import 'zone.js/dist/zone-testing';
+import { getTestBed } from '@angular/core/testing';
+import {
+ BrowserDynamicTestingModule,
+ platformBrowserDynamicTesting
+} from '@angular/platform-browser-dynamic/testing';
+
+declare const require: any;
+
+// First, initialize the Angular testing environment.
+getTestBed().initTestEnvironment(
+ BrowserDynamicTestingModule,
+ platformBrowserDynamicTesting()
+);
+// Then we find all the tests.
+const context = require.context('./', true, /\.spec\.ts$/);
+// And load the modules.
+context.keys().map(context);
diff --git a/web/gui2-fw-lib/src/tsconfig.app.json b/web/gui2-fw-lib/src/tsconfig.app.json
new file mode 100644
index 0000000..722c370
--- /dev/null
+++ b/web/gui2-fw-lib/src/tsconfig.app.json
@@ -0,0 +1,12 @@
+{
+ "extends": "../tsconfig.json",
+ "compilerOptions": {
+ "outDir": "../out-tsc/app",
+ "module": "es2015",
+ "types": []
+ },
+ "exclude": [
+ "src/test.ts",
+ "**/*.spec.ts"
+ ]
+}
diff --git a/web/gui2-fw-lib/src/tsconfig.spec.json b/web/gui2-fw-lib/src/tsconfig.spec.json
new file mode 100644
index 0000000..8f7cede
--- /dev/null
+++ b/web/gui2-fw-lib/src/tsconfig.spec.json
@@ -0,0 +1,19 @@
+{
+ "extends": "../tsconfig.json",
+ "compilerOptions": {
+ "outDir": "../out-tsc/spec",
+ "module": "commonjs",
+ "types": [
+ "jasmine",
+ "node"
+ ]
+ },
+ "files": [
+ "test.ts",
+ "polyfills.ts"
+ ],
+ "include": [
+ "**/*.spec.ts",
+ "**/*.d.ts"
+ ]
+}
diff --git a/web/gui2-fw-lib/src/tslint.json b/web/gui2-fw-lib/src/tslint.json
new file mode 100644
index 0000000..52e2c1a
--- /dev/null
+++ b/web/gui2-fw-lib/src/tslint.json
@@ -0,0 +1,17 @@
+{
+ "extends": "../tslint.json",
+ "rules": {
+ "directive-selector": [
+ true,
+ "attribute",
+ "app",
+ "camelCase"
+ ],
+ "component-selector": [
+ true,
+ "element",
+ "app",
+ "kebab-case"
+ ]
+ }
+}
diff --git a/web/gui2-fw-lib/tsconfig.json b/web/gui2-fw-lib/tsconfig.json
new file mode 100644
index 0000000..c8de447
--- /dev/null
+++ b/web/gui2-fw-lib/tsconfig.json
@@ -0,0 +1,28 @@
+{
+ "compileOnSave": false,
+ "compilerOptions": {
+ "baseUrl": "./",
+ "outDir": "./dist/out-tsc",
+ "sourceMap": true,
+ "declaration": false,
+ "moduleResolution": "node",
+ "emitDecoratorMetadata": true,
+ "experimentalDecorators": true,
+ "target": "es6",
+ "typeRoots": [
+ "node_modules/@types"
+ ],
+ "lib": [
+ "es2017",
+ "dom"
+ ],
+ "paths": {
+ "gui2-fw-lib": [
+ "dist/gui2-fw-lib"
+ ],
+ "gui2-fw-lib/*": [
+ "dist/gui2-fw-lib/*"
+ ]
+ }
+ }
+}
diff --git a/web/gui2-fw-lib/tslint.json b/web/gui2-fw-lib/tslint.json
new file mode 100644
index 0000000..494ac63
--- /dev/null
+++ b/web/gui2-fw-lib/tslint.json
@@ -0,0 +1,142 @@
+{
+ "rulesDirectory": [
+ "node_modules/codelyzer"
+ ],
+ "rules": {
+ "arrow-return-shorthand": true,
+ "callable-types": true,
+ "class-name": true,
+ "comment-format": [
+ true,
+ "check-space"
+ ],
+ "curly": true,
+ "deprecation": {
+ "severity": "warn"
+ },
+ "eofline": true,
+ "forin": true,
+ "import-blacklist": [
+ true,
+ "rxjs/Rx"
+ ],
+ "import-spacing": true,
+ "indent": [
+ true,
+ "spaces"
+ ],
+ "interface-over-type-literal": true,
+ "label-position": true,
+ "max-line-length": [
+ true,
+ 140
+ ],
+ "member-access": false,
+ "member-ordering": [
+ true,
+ {
+ "order": [
+ "static-field",
+ "instance-field",
+ "static-method",
+ "instance-method"
+ ]
+ }
+ ],
+ "no-arg": true,
+ "no-bitwise": true,
+ "no-console": [
+ true,
+ "debug",
+ "info",
+ "time",
+ "timeEnd",
+ "trace"
+ ],
+ "no-construct": true,
+ "no-debugger": true,
+ "no-duplicate-super": true,
+ "no-empty": false,
+ "no-empty-interface": true,
+ "no-eval": true,
+ "no-inferrable-types": [
+ false,
+ "ignore-params"
+ ],
+ "no-misused-new": true,
+ "no-non-null-assertion": true,
+ "no-shadowed-variable": true,
+ "no-string-literal": false,
+ "no-string-throw": true,
+ "no-switch-case-fall-through": true,
+ "no-trailing-whitespace": true,
+ "no-unnecessary-initializer": true,
+ "no-unused-expression": true,
+ "no-use-before-declare": true,
+ "no-var-keyword": true,
+ "object-literal-sort-keys": false,
+ "one-line": [
+ true,
+ "check-open-brace",
+ "check-catch",
+ "check-else",
+ "check-whitespace"
+ ],
+ "prefer-const": true,
+ "quotemark": [
+ true,
+ "single"
+ ],
+ "radix": true,
+ "semicolon": [
+ true,
+ "always"
+ ],
+ "triple-equals": [
+ true,
+ "allow-null-check"
+ ],
+ "typedef-whitespace": [
+ true,
+ {
+ "call-signature": "nospace",
+ "index-signature": "nospace",
+ "parameter": "nospace",
+ "property-declaration": "nospace",
+ "variable-declaration": "nospace"
+ }
+ ],
+ "unified-signatures": true,
+ "variable-name": false,
+ "whitespace": [
+ true,
+ "check-branch",
+ "check-decl",
+ "check-operator",
+ "check-separator",
+ "check-type"
+ ],
+ "directive-selector": [
+ true,
+ "attribute",
+ "onos",
+ "camelCase"
+ ],
+ "component-selector": [
+ true,
+ "element",
+ "onos",
+ "kebab-case"
+ ],
+ "no-output-on-prefix": true,
+ "use-input-property-decorator": true,
+ "use-output-property-decorator": true,
+ "use-host-property-decorator": true,
+ "no-input-rename": true,
+ "no-output-rename": true,
+ "use-life-cycle-interface": true,
+ "use-pipe-transform-interface": true,
+ "component-class-suffix": true,
+ "directive-class-suffix": true
+ }
+}