diff --git a/web/gui2-fw-lib/.editorconfig b/web/gui2-fw-lib/.editorconfig
new file mode 100644
index 0000000..9b73521
--- /dev/null
+++ b/web/gui2-fw-lib/.editorconfig
@@ -0,0 +1,13 @@
+# Editor configuration, see http://editorconfig.org
+root = true
+
+[*]
+charset = utf-8
+indent_style = space
+indent_size = 4
+insert_final_newline = true
+trim_trailing_whitespace = true
+
+[*.md]
+max_line_length = off
+trim_trailing_whitespace = false
diff --git a/web/gui2-fw-lib/.gitignore b/web/gui2-fw-lib/.gitignore
new file mode 100644
index 0000000..ee5c9d8
--- /dev/null
+++ b/web/gui2-fw-lib/.gitignore
@@ -0,0 +1,39 @@
+# See http://help.github.com/ignore-files/ for more about ignoring files.
+
+# compiled output
+/dist
+/tmp
+/out-tsc
+
+# dependencies
+/node_modules
+
+# IDEs and editors
+/.idea
+.project
+.classpath
+.c9/
+*.launch
+.settings/
+*.sublime-workspace
+
+# IDE - VSCode
+.vscode/*
+!.vscode/settings.json
+!.vscode/tasks.json
+!.vscode/launch.json
+!.vscode/extensions.json
+
+# misc
+/.sass-cache
+/connect.lock
+/coverage
+/libpeerconnection.log
+npm-debug.log
+yarn-error.log
+testem.log
+/typings
+
+# System Files
+.DS_Store
+Thumbs.db
diff --git a/web/gui2-fw-lib/BUILD b/web/gui2-fw-lib/BUILD
new file mode 100644
index 0000000..e21f1d3
--- /dev/null
+++ b/web/gui2-fw-lib/BUILD
@@ -0,0 +1,326 @@
+"""
+ Copyright 2018-present Open Networking Foundation
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+     http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+"""
+
+"""
+    Rules to build the ONOS GUI 2 FW Lib
+
+    The GUI2 Angular 6 elements are built here with Angular CLI 'ng'
+    Some work is being done in the Bazel community to integrate Bazel and
+    Angular 6, (Angular Buildtools Convergence -
+    https://docs.google.com/document/d/1OlyiUnoTirUj4gecGxJeZBcjHcFr36RvLsvpBl2mxA8/preview)
+    but it is in the very early stages (Aug'18) and not yet fit
+    for production and at present it works as a replacement for Angular CLI
+    (which is not desirable).
+
+    There are plans to extend Bazel it to work with Angular CLI, and if works
+    well this Bazel file may be rearchiteced in future.
+
+    Bazel and npm are incompatibe in how they deal with files. npm likes to
+    follow links to get back to the original canonical path names, and bazel
+    uses links extensively when populating the sandbox. To get around these
+    problems, the rules that follow use filegroups to specify the files as
+    dependencies and then use a genrule to convert the files into a tar ball.
+    Once the tar ball is unrolled into the sandbox, the links are broken, but
+    the build is still hermetic since those files are referred to as dependencies in the genrule.
+"""
+
+COMPILE_DEPS = CORE_DEPS + JACKSON + KRYO + [
+    "@javax_ws_rs_api//jar",
+    "@servlet_api//jar",
+    "@jetty_websocket//jar",
+    "@jetty_util//jar",
+    "@jersey_media_multipart//jar",
+    "@jersey_server//jar",
+    "//utils/rest:onlab-rest",
+    "//core/store/serializers:onos-core-serializers",
+]
+
+TEST_DEPS = TEST + [
+    "//core/api:onos-api-tests",
+    "//drivers/default:onos-drivers-default",
+]
+
+"""
+    Files that get put at the top level of the tar ball
+"""
+
+filegroup(
+    name = "_root_level_files",
+    srcs =
+        [
+            ":angular.json",
+            ":package.json",
+            ":package-lock.json",
+            ":tsconfig.json",
+            ":tslint.json",
+        ],
+)
+
+filegroup(
+    name = "_e2e_test_files",
+    srcs = [
+        ":e2e/protractor.conf.js",
+        ":e2e/src/app.e2e-spec.ts",
+        ":e2e/src/app.po.ts",
+        ":e2e/tsconfig.e2e.json",
+    ],
+)
+
+"""
+    Make a group file of all the webapp files.
+"""
+
+filegroup(
+    name = "_gui2_fw_lib_src",
+    srcs = glob(
+        [
+            "projects/gui2-fw-lib/**",
+        ],
+        exclude = [
+            "projects/gui2-fw-lib/**/*.spec.*",  # Don't track tests here
+            "projects/gui2-fw-lib/karma.conf.js",
+            "projects/gui2-fw-lib/src/test.ts",
+        ],
+    ),
+)
+
+"""
+    Make a group of all the webapp qpp files.
+"""
+
+filegroup(
+    name = "_gui2_app_files",
+    srcs = glob(
+        [
+            "src/**/*",
+        ],
+    ),
+)
+
+"""
+    Make a jar file of all the webapp test (*.spec.ts) files.
+"""
+
+genrule(
+    name = "_gui2_fw_lib_tests",
+    srcs = glob(
+        [
+            "projects/gui2-fw-lib/karma.conf.js",
+            "projects/gui2-fw-lib/src/test.ts",
+            "projects/gui2-fw-lib/tsconfig.spec.json",
+            "projects/gui2-fw-lib/**/*.spec.ts",
+        ],
+        exclude = [
+            "projects/gui2-fw-lib/ng-package.json",
+            "projects/gui2-fw-lib/ng-package.prod.json",
+            "projects/gui2-fw-lib/package.json",
+            "projects/gui2-fw-lib/tsconfig.lib.json",
+            "projects/gui2-fw-lib/tslint.json",
+            "projects/gui2-fw-lib/src/public_api.ts",
+        ],
+    ),
+    outs = ["gui2_fw_lib_tests.jar"],
+    cmd = "cd web/gui2-fw-lib &&" +
+          " jar Mcf ../../$@ .",
+)
+
+"""
+    Make a jar file of all the CSS files we want to reuse in the target.
+"""
+
+genrule(
+    name = "gui2_fw_lib_ext_css",
+    srcs = glob(
+        [
+            "projects/gui2-fw-lib/src/lib/widget/panel.css",
+            "projects/gui2-fw-lib/src/lib/widget/panel-theme.css",
+            "projects/gui2-fw-lib/src/lib/widget/table.css",
+            "projects/gui2-fw-lib/src/lib/widget/table.theme.css",
+            "projects/gui2-fw-lib/src/lib/widget/table.theme.css",
+            "projects/gui2-fw-lib/src/lib/layer/loading.service.css",
+        ],
+    ),
+    outs = ["gui2_fw_lib_css.jar"],
+    cmd = " ROOT=`pwd` &&" +
+          " cd web/gui2-fw-lib/projects/gui2-fw-lib/src/lib &&" +
+          " jar Mcf $$ROOT/$@ .",
+    visibility = ["//visibility:public"],
+)
+
+"""
+    Install npm packages listed in package.json in web/gui2
+    See bazel-genfiles/web/gui2/onos-gui2-npm-install.log for details of the 'npm install'
+"""
+
+genrule(
+    name = "onos-gui2-fw-npm-install",
+    srcs = [
+        "@nodejs//:bin/npm",
+        "@nodejs//:bin/node",
+        "@nodejs//:bin/node.js",
+        "@nodejs//:bin/nodejs/bin/node",
+        "@nodejs//:bin/nodejs/bin/npm",
+        ":_root_level_files",
+    ],
+    outs = [
+        "onos-gui2-npm-install.jar",
+        "onos-gui2-npm-install.log",
+    ],
+    cmd = " ROOT=`pwd` &&" +
+          " export HOME=. &&" +
+          " export XDG_CONFIG_HOME=$(@D)/config &&" +  # npm config cache to the sandbox
+          " export BABEL_DISABLE_CACHE=1 &&" +  # turn off babel cache
+          ' if [[ ! -z $${HTTP_PROXY-} ]]; then NPM_ARGS="--proxy $$HTTP_PROXY --without-ssl --insecure"; else NPM_ARGS=""; fi &&' +
+          " NPM=$(location @nodejs//:bin/npm) &&" +
+          " export PATH=$$ROOT/$$(dirname $${NPM}):$$PATH &&" +
+          " npm -v > $$ROOT/$(location onos-gui2-npm-install.log) 2>&1 &&" +
+          " cd web/gui2-fw-lib && " +
+          " npm $$NPM_ARGS install --no-cache >> $$ROOT/$(location onos-gui2-npm-install.log) 2>&1 &&" +
+          " jar Mcf $$ROOT/$(location onos-gui2-npm-install.jar) node_modules &&" +
+          " touch $$ROOT/$(location onos-gui2-npm-install.log)",  # to get the log always as the 2nd file
+    message = "NodeJS npm install",
+    visibility = ["//visibility:public"],
+)
+
+"""
+    Run ng build to create outputs in production mode
+    See bazel-genfiles/web/gui2/onos-gui2-ng-build-prod.log for details of the Angular CLI output
+"""
+
+genrule(
+    name = "onos-gui2-fw-ng-build",
+    srcs = [
+        "@nodejs//:bin/npm",
+        "@nodejs//:bin/node",
+        "@nodejs//:bin/node.js",
+        "@nodejs//:bin/nodejs/bin/node",
+        "@nodejs//:bin/nodejs/bin/npm",
+        ":onos-gui2-fw-npm-install",
+        ":_root_level_files",
+        ":_gui2_fw_lib_src",
+    ],
+    outs = [
+        "gui2-fw-ng-build-prod.log",
+        "gui2-fw-lib-ver.tgz",
+    ],
+    cmd = "ROOT=`pwd` &&" +
+          " export HOME=. &&" +
+          " export XDG_CONFIG_HOME=$(@D)/config &&" +
+          " NODE=$(location @nodejs//:bin/node) &&" +
+          " INSTALL_FILES=($(locations :onos-gui2-fw-npm-install)) &&" +  # An array of filenames - sorted by time created
+          " cd web/gui2-fw-lib &&" +
+          " jar xf $$ROOT/$${INSTALL_FILES[0]} &&" +
+          " chmod +x $$ROOT/web/gui2-fw-lib/node_modules/@angular/cli/bin/ng &&" +
+          " export PATH=$$ROOT/$$(dirname $${NODE}):$$ROOT/web/gui2-fw-lib/node_modules/@angular/cli/bin:$$PATH &&" +
+          " node -v > ../../$(location gui2-fw-ng-build-prod.log) &&" +
+          " npm -v >> ../../$(location gui2-fw-ng-build-prod.log) &&" +
+          " ng -v >> ../../$(location gui2-fw-ng-build-prod.log);" +
+          " ng build --prod gui2-fw-lib >> $$ROOT/$(location gui2-fw-ng-build-prod.log) 2>&1 ||" +
+          " if [ $$? -eq 0 ]; then echo 'Successfully built GUI FW library';" +
+          " else " +
+          "   echo 'Error running \'ng build gui2-fw-lib\' on \'//web/gui2-fw-lib:onos-gui2-fw-ng-build\'. \\\n" +
+          "   See bazel-genfiles/web/gui2-fw-lib/gui2-fw-ng-build-prod.log for more details' >&2;" +
+          "   exit 1;" +
+          " fi;" +
+          " cd dist/gui2-fw-lib &&" +
+          " npm pack &&" +
+          " mv gui2-fw-lib-*.tgz $$ROOT/$(location gui2-fw-lib-ver.tgz) &&" +
+          " touch $$ROOT/$(location gui2-fw-ng-build-prod.log)",  # to get the log always as the 2nd file
+    message = "GUI FW Lib build",
+    visibility = ["//visibility:public"],
+)
+
+"""
+    Run 'ng test' to run Angular test and 'ng lint' for checkstyle
+    See bazel-genfiles/web/gui2/onos-gui2-fw-ng-lint.log or
+    bazel-genfiles/web/gui2/onos-gui2-fw-ng-test.log for details of the Angular CLI output
+"""
+
+genrule(
+    name = "_onos-gui2-fw-ng-test",
+    srcs = [
+        "@nodejs//:bin/npm",
+        "@nodejs//:bin/node",
+        "@nodejs//:bin/node.js",
+        "@nodejs//:bin/nodejs/bin/node",
+        "@nodejs//:bin/nodejs/bin/npm",
+        ":onos-gui2-fw-npm-install",
+        ":_root_level_files",
+        ":_gui2_fw_lib_src",
+        ":_gui2_fw_lib_tests",
+        ":_e2e_test_files",
+    ],
+    outs = [
+        "onos-gui2-fw-ng-ver.log",
+        "onos-gui2-fw-ng-lint.log",
+        "onos-gui2-fw-ng-test.log",
+    ],
+    cmd = " ROOT=`pwd` &&" +
+          " export HOME=. &&" +
+          " export XDG_CONFIG_HOME=$(@D)/config &&" +
+          " NODE=$(location @nodejs//:bin/node) &&" +
+          " INSTALL_FILES=($(locations :onos-gui2-fw-npm-install)) &&" +  # An array of filenames - sorted by time created
+          " mkdir -p web/gui2-fw-lib &&" +
+          " cd web/gui2-fw-lib &&" +
+          " jar xf ../../$(location :_gui2_fw_lib_tests) &&" +
+          " jar xf $$ROOT/$${INSTALL_FILES[0]} &&" +
+          " chmod +x $$ROOT/web/gui2-fw-lib/node_modules/@angular/cli/bin/ng &&" +
+          " export PATH=$$ROOT/$$(dirname $${NODE}):$$ROOT/web/gui2-fw-lib/node_modules/@angular/cli/bin:$$PATH &&" +
+          " node -v > ../../$(location onos-gui2-fw-ng-ver.log) &&" +
+          " npm -v >> ../../$(location onos-gui2-fw-ng-ver.log) &&" +
+          " ng -v >> ../../$(location onos-gui2-fw-ng-ver.log) &&" +
+          " ng lint gui2-fw-lib > ../../$(location onos-gui2-fw-ng-lint.log);" +
+          " if [ -f /usr/bin/chromium-browser ]; then " +  # Add to this for Mac and Chrome
+          "   export CHROME_BIN=/usr/bin/chromium-browser; " +
+          " elif [ -f /opt/google/chrome/chrome ]; then " +
+          "   export CHROME_BIN=/opt/google/chrome/chrome; " +
+          " else " +
+          "   MSG='Warning: Step _onos-gui2-fw-ng-test skipped because \\n" +
+          "   no binary for ChromeHeadless browser was found at /usr/bin/chromium-browser. \\n" +
+          "   Install Google Chrome or Chromium Browser to allow this step to run.';" +
+          "   echo -e $$MSG >&2;" +
+          "   echo -e $$MSG > ../../$(location onos-gui2-fw-ng-test.log);" +
+          "   exit 0;" +
+          " fi;" +
+          " ng test --preserve-symlinks --code-coverage --browsers=ChromeHeadless" +
+          "     --watch=false gui2-fw-lib > ../../$(location onos-gui2-fw-ng-test.log) 2>&1 ||" +
+          " if [ $$? -eq 0 ]; then echo 'Successfully ran tests';" +
+          " else " +
+          "   echo 'Error running \'ng test\' on \'//web/gui2-fw-lib:onos-gui2-fw-ng-test\'. \\\n" +
+          "     See bazel-genfiles/web/gui2-fw-lib/onos-gui2-fw-ng-test.log for more details' >&2;" +
+          #"   tail -n 100 ../../$(location onos-gui2-fw-ng-test.log) >&2;" +
+          "   exit 1;" +
+          " fi;",
+    message = "GUI FW lib lint and test",
+)
+
+"""
+    Wrap the genrule for testing in a test
+"""
+
+sh_test(
+    name = "onos-gui2-ng-tests",
+    size = "small",
+    srcs = [
+        ":ng-test.sh",
+    ],
+    data = [
+        ":_onos-gui2-fw-ng-test",
+    ],
+    deps = [
+        "@bazel_tools//tools/bash/runfiles",
+    ],
+)
diff --git a/web/gui2-fw-lib/README.md b/web/gui2-fw-lib/README.md
new file mode 100644
index 0000000..e7e6944
--- /dev/null
+++ b/web/gui2-fw-lib/README.md
@@ -0,0 +1,55 @@
+# Gui2FwLibApp
+
+This project separates out the Framework part of the ONOS GUI2 project in to a separate Angular library
+
+It is separate to the main ONOS GUI2 project which is in ~/onos/web/gui2
+
+The reason this has been separated out in to a separate library is to allow
+external applications e.g. YangGUI to use it, without bringing along the
+whole of GUI 2
+
+This project was generated with [Angular CLI](https://github.com/angular/angular-cli) version 6.0.0.
+
+A couple of good articles on the creation and use of __libraries__ in Angular 6 is given in
+
+[The Angular Library Series - Creating a Library with the Angular CLI](https://blog.angularindepth.com/creating-a-library-in-angular-6-87799552e7e5)
+
+and
+
+[The Angular Library Series - Building and Packaging](https://blog.angularindepth.com/creating-a-library-in-angular-6-part-2-6e2bc1e14121)
+
+The Bazel build of this library handles the building and packaging of the library
+so that other projects and libraries can use it.
+
+## Development server
+
+To build the library project using Angular CLI run 'ng build --prod gui2-fw-lib'
+inside the ~/onos/web/gui2-fw-lib folder
+
+To make the library in to an NPM package use 'npm pack' inside the project/gui2-fw-lib folder
+
+To build the app that surrounds the library run 'ng build'. This app is not
+part of the ONOS GUI and is there as a placeholder for testing the library
+
+Run `ng serve` for a dev server. Navigate to `http://localhost:4200/`.
+The app will automatically reload if you change any of the source files.
+
+## Code scaffolding
+
+Run `ng generate component component-name --project=gui2-fw-lib` to generate a new component. You can also use `ng generate directive|pipe|service|class|guard|interface|enum|module`.
+
+## Build
+
+Run `ng build` to build the project. The build artifacts will be stored in the `dist/` directory. Use the `--prod` flag for a production build.
+
+## Running unit tests
+
+Run `ng test` to execute the unit tests via [Karma](https://karma-runner.github.io).
+
+## Running end-to-end tests
+
+Run `ng e2e` to execute the end-to-end tests via [Protractor](http://www.protractortest.org/).
+
+## Further help
+
+To get more help on the Angular CLI use `ng help` or go check out the [Angular CLI README](https://github.com/angular/angular-cli/blob/master/README.md).
diff --git a/web/gui2-fw-lib/angular.json b/web/gui2-fw-lib/angular.json
new file mode 100644
index 0000000..739ee9f
--- /dev/null
+++ b/web/gui2-fw-lib/angular.json
@@ -0,0 +1,162 @@
+{
+  "$schema": "./node_modules/@angular/cli/lib/config/schema.json",
+  "version": 1,
+  "newProjectRoot": "projects",
+  "projects": {
+    "gui2-fw-lib-app": {
+      "root": "",
+      "sourceRoot": "src",
+      "projectType": "application",
+      "prefix": "app",
+      "schematics": {},
+      "architect": {
+        "build": {
+          "builder": "@angular-devkit/build-angular:browser",
+          "options": {
+            "outputPath": "dist/gui2-fw-lib-app",
+            "index": "src/index.html",
+            "main": "src/main.ts",
+            "polyfills": "src/polyfills.ts",
+            "tsConfig": "src/tsconfig.app.json",
+            "assets": [
+              "src/favicon.ico",
+              "src/assets"
+            ],
+            "styles": [
+              "src/styles.css"
+            ],
+            "scripts": []
+          },
+          "configurations": {
+            "production": {
+              "fileReplacements": [
+                {
+                  "replace": "src/environments/environment.ts",
+                  "with": "src/environments/environment.prod.ts"
+                }
+              ],
+              "optimization": true,
+              "outputHashing": "all",
+              "sourceMap": false,
+              "extractCss": true,
+              "namedChunks": false,
+              "aot": true,
+              "extractLicenses": true,
+              "vendorChunk": false,
+              "buildOptimizer": true
+            }
+          }
+        },
+        "serve": {
+          "builder": "@angular-devkit/build-angular:dev-server",
+          "options": {
+            "browserTarget": "gui2-fw-lib-app:build"
+          },
+          "configurations": {
+            "production": {
+              "browserTarget": "gui2-fw-lib-app:build:production"
+            }
+          }
+        },
+        "extract-i18n": {
+          "builder": "@angular-devkit/build-angular:extract-i18n",
+          "options": {
+            "browserTarget": "gui2-fw-lib-app:build"
+          }
+        },
+        "test": {
+          "builder": "@angular-devkit/build-angular:karma",
+          "options": {
+            "main": "src/test.ts",
+            "polyfills": "src/polyfills.ts",
+            "tsConfig": "src/tsconfig.spec.json",
+            "karmaConfig": "src/karma.conf.js",
+            "styles": [
+              "styles.css"
+            ],
+            "scripts": [],
+            "assets": [
+              "src/favicon.ico",
+              "src/assets"
+            ]
+          }
+        },
+        "lint": {
+          "builder": "@angular-devkit/build-angular:tslint",
+          "options": {
+            "tsConfig": [
+              "src/tsconfig.app.json",
+              "src/tsconfig.spec.json"
+            ],
+            "exclude": [
+              "**/node_modules/**"
+            ]
+          }
+        }
+      }
+    },
+    "gui2-fw-lib-app-e2e": {
+      "root": "e2e/",
+      "projectType": "application",
+      "architect": {
+        "e2e": {
+          "builder": "@angular-devkit/build-angular:protractor",
+          "options": {
+            "protractorConfig": "e2e/protractor.conf.js",
+            "devServerTarget": "gui2-fw-lib-app:serve"
+          }
+        },
+        "lint": {
+          "builder": "@angular-devkit/build-angular:tslint",
+          "options": {
+            "tsConfig": "e2e/tsconfig.e2e.json",
+            "exclude": [
+              "**/node_modules/**"
+            ]
+          }
+        }
+      }
+    },
+    "gui2-fw-lib": {
+      "root": "projects/gui2-fw-lib",
+      "sourceRoot": "projects/gui2-fw-lib/src",
+      "projectType": "library",
+      "prefix": "onos",
+      "architect": {
+        "build": {
+          "builder": "@angular-devkit/build-ng-packagr:build",
+          "options": {
+            "tsConfig": "projects/gui2-fw-lib/tsconfig.lib.json",
+            "project": "projects/gui2-fw-lib/ng-package.json"
+          },
+          "configurations": {
+            "production": {
+              "project": "projects/gui2-fw-lib/ng-package.prod.json"
+            }
+          }
+        },
+        "test": {
+          "builder": "@angular-devkit/build-angular:karma",
+          "options": {
+            "main": "projects/gui2-fw-lib/src/test.ts",
+            "tsConfig": "projects/gui2-fw-lib/tsconfig.spec.json",
+            "karmaConfig": "projects/gui2-fw-lib/karma.conf.js"
+          }
+        },
+        "lint": {
+          "builder": "@angular-devkit/build-angular:tslint",
+          "options": {
+            "tsConfig": [
+              "projects/gui2-fw-lib/tsconfig.lib.json",
+              "projects/gui2-fw-lib/tsconfig.spec.json"
+            ],
+            "exclude": [
+              "**/node_modules/**"
+            ]
+          }
+        }
+      }
+    }
+  },
+  "defaultProject": "gui2-fw-lib-app"
+}
\ No newline at end of file
diff --git a/web/gui2-fw-lib/e2e/protractor.conf.js b/web/gui2-fw-lib/e2e/protractor.conf.js
new file mode 100644
index 0000000..86776a3
--- /dev/null
+++ b/web/gui2-fw-lib/e2e/protractor.conf.js
@@ -0,0 +1,28 @@
+// Protractor configuration file, see link for more information
+// https://github.com/angular/protractor/blob/master/lib/config.ts
+
+const { SpecReporter } = require('jasmine-spec-reporter');
+
+exports.config = {
+  allScriptsTimeout: 11000,
+  specs: [
+    './src/**/*.e2e-spec.ts'
+  ],
+  capabilities: {
+    'browserName': 'chrome'
+  },
+  directConnect: true,
+  baseUrl: 'http://localhost:4200/',
+  framework: 'jasmine',
+  jasmineNodeOpts: {
+    showColors: true,
+    defaultTimeoutInterval: 30000,
+    print: function() {}
+  },
+  onPrepare() {
+    require('ts-node').register({
+      project: require('path').join(__dirname, './tsconfig.e2e.json')
+    });
+    jasmine.getEnv().addReporter(new SpecReporter({ spec: { displayStacktrace: true } }));
+  }
+};
\ No newline at end of file
diff --git a/web/gui2-fw-lib/e2e/src/app.e2e-spec.ts b/web/gui2-fw-lib/e2e/src/app.e2e-spec.ts
new file mode 100644
index 0000000..e42d1f9
--- /dev/null
+++ b/web/gui2-fw-lib/e2e/src/app.e2e-spec.ts
@@ -0,0 +1,14 @@
+import { AppPage } from './app.po';
+
+describe('workspace-project App', () => {
+  let page: AppPage;
+
+  beforeEach(() => {
+    page = new AppPage();
+  });
+
+  it('should display welcome message', () => {
+    page.navigateTo();
+    expect(page.getParagraphText()).toEqual('Welcome to app!');
+  });
+});
diff --git a/web/gui2-fw-lib/e2e/src/app.po.ts b/web/gui2-fw-lib/e2e/src/app.po.ts
new file mode 100644
index 0000000..82ea75b
--- /dev/null
+++ b/web/gui2-fw-lib/e2e/src/app.po.ts
@@ -0,0 +1,11 @@
+import { browser, by, element } from 'protractor';
+
+export class AppPage {
+  navigateTo() {
+    return browser.get('/');
+  }
+
+  getParagraphText() {
+    return element(by.css('app-root h1')).getText();
+  }
+}
diff --git a/web/gui2-fw-lib/e2e/tsconfig.e2e.json b/web/gui2-fw-lib/e2e/tsconfig.e2e.json
new file mode 100644
index 0000000..a6dd622
--- /dev/null
+++ b/web/gui2-fw-lib/e2e/tsconfig.e2e.json
@@ -0,0 +1,13 @@
+{
+  "extends": "../tsconfig.json",
+  "compilerOptions": {
+    "outDir": "../out-tsc/app",
+    "module": "commonjs",
+    "target": "es5",
+    "types": [
+      "jasmine",
+      "jasminewd2",
+      "node"
+    ]
+  }
+}
\ No newline at end of file
diff --git a/web/gui2-fw-lib/ng-test.sh b/web/gui2-fw-lib/ng-test.sh
new file mode 100755
index 0000000..ba8a3dd
--- /dev/null
+++ b/web/gui2-fw-lib/ng-test.sh
@@ -0,0 +1,29 @@
+#!/bin/bash
+set -euo pipefail
+# --- begin runfiles.bash initialization ---
+if [[ ! -d "${RUNFILES_DIR:-/dev/null}" && ! -f "${RUNFILES_MANIFEST_FILE:-/dev/null}" ]]; then
+    if [[ -f "$0.runfiles_manifest" ]]; then
+      export RUNFILES_MANIFEST_FILE="$0.runfiles_manifest"
+    elif [[ -f "$0.runfiles/MANIFEST" ]]; then
+      export RUNFILES_MANIFEST_FILE="$0.runfiles/MANIFEST"
+    elif [[ -f "$0.runfiles/bazel_tools/tools/bash/runfiles/runfiles.bash" ]]; then
+      export RUNFILES_DIR="$0.runfiles"
+    fi
+fi
+
+if [[ -f "${RUNFILES_DIR:-/dev/null}/bazel_tools/tools/bash/runfiles/runfiles.bash" ]]; then
+  source "${RUNFILES_DIR}/bazel_tools/tools/bash/runfiles/runfiles.bash"
+elif [[ -f "${RUNFILES_MANIFEST_FILE:-/dev/null}" ]]; then
+  source "$(grep -m1 "^bazel_tools/tools/bash/runfiles/runfiles.bash " \
+            "$RUNFILES_MANIFEST_FILE" | cut -d ' ' -f 2-)"
+else
+  echo >&2 "ERROR: cannot find @bazel_tools//tools/bash/runfiles:runfiles.bash"
+  exit 1
+fi
+
+# --- end runfiles.bash initialization ---
+echo "Test results for Angular CLI commands run in _onos-gui2-fw-ng-test outputs at:"
+ls $(rlocation org_onosproject_onos/web/gui2-fw-lib/onos-gui2-fw-ng-ver.log)
+ls $(rlocation org_onosproject_onos/web/gui2-fw-lib/onos-gui2-fw-ng-lint.log)
+ls $(rlocation org_onosproject_onos/web/gui2-fw-lib/onos-gui2-fw-ng-test.log)
+
diff --git a/web/gui2-fw-lib/package-lock.json b/web/gui2-fw-lib/package-lock.json
new file mode 100644
index 0000000..165e482
--- /dev/null
+++ b/web/gui2-fw-lib/package-lock.json
@@ -0,0 +1,12538 @@
+{
+  "name": "gui2-fw-lib-app",
+  "version": "2.0.0",
+  "lockfileVersion": 1,
+  "requires": true,
+  "dependencies": {
+    "@angular-devkit/architect": {
+      "version": "0.6.8",
+      "resolved": "https://registry.npmjs.org/@angular-devkit/architect/-/architect-0.6.8.tgz",
+      "integrity": "sha512-ZKTm/zC61iY9IBHOEAKoMSzZpvhkmv+1O/HHzpHEuR551jCzu6vSyCmMY9Z7GBcccscCV+hjeSMwgFrFRcqlkw==",
+      "dev": true,
+      "requires": {
+        "@angular-devkit/core": "0.6.8",
+        "rxjs": "6.3.2"
+      }
+    },
+    "@angular-devkit/build-angular": {
+      "version": "0.6.8",
+      "resolved": "https://registry.npmjs.org/@angular-devkit/build-angular/-/build-angular-0.6.8.tgz",
+      "integrity": "sha512-VGqYAk8jpISraz2UHfsDre270NOUmV0CTSZw2p9sm5g/XIr5m+IHetFZz3gpoAr9+If2aFTs8Rt3sGdCRzwBqA==",
+      "dev": true,
+      "requires": {
+        "@angular-devkit/architect": "0.6.8",
+        "@angular-devkit/build-optimizer": "0.6.8",
+        "@angular-devkit/core": "0.6.8",
+        "@ngtools/webpack": "6.0.8",
+        "ajv": "6.4.0",
+        "autoprefixer": "8.6.5",
+        "cache-loader": "1.2.2",
+        "chalk": "2.2.2",
+        "circular-dependency-plugin": "5.0.2",
+        "clean-css": "4.2.1",
+        "copy-webpack-plugin": "4.5.2",
+        "file-loader": "1.1.11",
+        "glob": "7.1.3",
+        "html-webpack-plugin": "3.2.0",
+        "istanbul": "0.4.5",
+        "istanbul-instrumenter-loader": "3.0.1",
+        "karma-source-map-support": "1.3.0",
+        "less": "3.8.1",
+        "less-loader": "4.1.0",
+        "license-webpack-plugin": "1.4.0",
+        "lodash": "4.17.10",
+        "memory-fs": "0.4.1",
+        "mini-css-extract-plugin": "0.4.2",
+        "minimatch": "3.0.4",
+        "node-sass": "4.9.3",
+        "opn": "5.3.0",
+        "parse5": "4.0.0",
+        "portfinder": "1.0.17",
+        "postcss": "6.0.23",
+        "postcss-import": "11.1.0",
+        "postcss-loader": "2.1.6",
+        "postcss-url": "7.3.2",
+        "raw-loader": "0.5.1",
+        "resolve": "1.8.1",
+        "rxjs": "6.3.2",
+        "sass-loader": "7.1.0",
+        "silent-error": "1.1.0",
+        "source-map-support": "0.5.9",
+        "stats-webpack-plugin": "0.6.2",
+        "style-loader": "0.21.0",
+        "stylus": "0.54.5",
+        "stylus-loader": "3.0.2",
+        "tree-kill": "1.2.0",
+        "uglifyjs-webpack-plugin": "1.3.0",
+        "url-loader": "1.1.1",
+        "webpack": "4.8.3",
+        "webpack-dev-middleware": "3.2.0",
+        "webpack-dev-server": "3.1.7",
+        "webpack-merge": "4.1.4",
+        "webpack-sources": "1.2.0",
+        "webpack-subresource-integrity": "1.1.0-rc.4"
+      }
+    },
+    "@angular-devkit/build-ng-packagr": {
+      "version": "0.6.8",
+      "resolved": "https://registry.npmjs.org/@angular-devkit/build-ng-packagr/-/build-ng-packagr-0.6.8.tgz",
+      "integrity": "sha512-xcv3BwfB4PkL34PwXt2F+UpkxDajGRoPBGVj7FCD+Js4OY3S2G94BcdnDdOcwZzV+vjf5ZUxRC0IJ80YLJFSRQ==",
+      "dev": true,
+      "requires": {
+        "@angular-devkit/architect": "0.6.8",
+        "@angular-devkit/core": "0.6.8",
+        "resolve": "1.8.1",
+        "rxjs": "6.3.2"
+      }
+    },
+    "@angular-devkit/build-optimizer": {
+      "version": "0.6.8",
+      "resolved": "https://registry.npmjs.org/@angular-devkit/build-optimizer/-/build-optimizer-0.6.8.tgz",
+      "integrity": "sha512-of5syQbv3uNPp4AQkfRecfnp8AE8kvffbfYi+FFPZ6OGr7e59T1fGwk6+Zgb2qQFQg8HO2tzWI/uygtLIqmbmw==",
+      "dev": true,
+      "requires": {
+        "loader-utils": "1.1.0",
+        "source-map": "0.5.7",
+        "typescript": "2.9.2",
+        "webpack-sources": "1.2.0"
+      },
+      "dependencies": {
+        "typescript": {
+          "version": "2.9.2",
+          "resolved": "https://registry.npmjs.org/typescript/-/typescript-2.9.2.tgz",
+          "integrity": "sha512-Gr4p6nFNaoufRIY4NMdpQRNmgxVIGMs4Fcu/ujdYk3nAZqk7supzBE9idmvfZIlH/Cuj//dvi+019qEue9lV0w==",
+          "dev": true
+        }
+      }
+    },
+    "@angular-devkit/core": {
+      "version": "0.6.8",
+      "resolved": "https://registry.npmjs.org/@angular-devkit/core/-/core-0.6.8.tgz",
+      "integrity": "sha512-rkIa1OSVWTt4g9leLSK/PsqOj3HZbDKHbZjqlslyfVa3AyCeiumFoOgViOVXlYgPX3HHDbE5uH24nyUWSD8uww==",
+      "dev": true,
+      "requires": {
+        "ajv": "6.4.0",
+        "chokidar": "2.0.4",
+        "rxjs": "6.3.2",
+        "source-map": "0.5.7"
+      }
+    },
+    "@angular-devkit/schematics": {
+      "version": "0.6.8",
+      "resolved": "https://registry.npmjs.org/@angular-devkit/schematics/-/schematics-0.6.8.tgz",
+      "integrity": "sha512-R4YqAUdo62wtrhX/5HSRGSKXNTWqfQb66ZE6m8jj6GEJNFKdNXMdxOchxr07LCiKTxfh1w6G3nGzxIsu/+D4KA==",
+      "dev": true,
+      "requires": {
+        "@angular-devkit/core": "0.6.8",
+        "rxjs": "6.3.2"
+      }
+    },
+    "@angular/animations": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/animations/-/animations-6.1.7.tgz",
+      "integrity": "sha512-bjX3VEVEh5scGDDmxEKPzYI8DWUbqOFA34aYDY2cHPnDkLM0I7pEtO44qb72FSbWwXn77sYlby/dx2gtRayOOA==",
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "@angular/cli": {
+      "version": "6.0.8",
+      "resolved": "https://registry.npmjs.org/@angular/cli/-/cli-6.0.8.tgz",
+      "integrity": "sha512-DhH1Zq5Yonthw6zh6W07fhf+9XrAZbD1fcQ0MrmbxlieCfLlTAdBqyK2LavFCKwSZkUMLF6UHM3+jiNRVZSSIg==",
+      "dev": true,
+      "requires": {
+        "@angular-devkit/architect": "0.6.8",
+        "@angular-devkit/core": "0.6.8",
+        "@angular-devkit/schematics": "0.6.8",
+        "@schematics/angular": "0.6.8",
+        "@schematics/update": "0.6.8",
+        "opn": "5.3.0",
+        "resolve": "1.8.1",
+        "rxjs": "6.3.2",
+        "semver": "5.5.1",
+        "silent-error": "1.1.0",
+        "symbol-observable": "1.2.0",
+        "yargs-parser": "10.1.0"
+      },
+      "dependencies": {
+        "camelcase": {
+          "version": "4.1.0",
+          "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz",
+          "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=",
+          "dev": true
+        },
+        "yargs-parser": {
+          "version": "10.1.0",
+          "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-10.1.0.tgz",
+          "integrity": "sha512-VCIyR1wJoEBZUqk5PA+oOBF6ypbwh5aNB3I50guxAL/quggdfs4TtNHQrSazFA3fYZ+tEqfs0zIGlv0c/rgjbQ==",
+          "dev": true,
+          "requires": {
+            "camelcase": "4.1.0"
+          }
+        }
+      }
+    },
+    "@angular/common": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/common/-/common-6.1.7.tgz",
+      "integrity": "sha512-zFK2xM0hqR2ZWIfUsn+06jg+0K5PolzTxPjfUtVQDCZo+JHHKTVHEwtfORUaMTMfH9EqKrvfB3t6fCwK0523ag==",
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "@angular/compiler": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/compiler/-/compiler-6.1.7.tgz",
+      "integrity": "sha512-JKuK/fzKNCF+mNPmPmGQjr0uHVpfxmrOqXBriJMklCtdsKeQW94BLUoNjn8h1H10rFbUqYuD5v9AAKdH77FgnA==",
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "@angular/compiler-cli": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/compiler-cli/-/compiler-cli-6.1.7.tgz",
+      "integrity": "sha512-HzrwmtvrgKwUowfkPTsb6AOqdoQajY3Uso3i0jNc9/bXvpeikH0vj0YIKuQzAJDemluHsowHk/ImEsVGGr2w9g==",
+      "dev": true,
+      "requires": {
+        "chokidar": "1.7.0",
+        "minimist": "1.2.0",
+        "reflect-metadata": "0.1.12",
+        "tsickle": "0.32.1"
+      },
+      "dependencies": {
+        "anymatch": {
+          "version": "1.3.2",
+          "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-1.3.2.tgz",
+          "integrity": "sha512-0XNayC8lTHQ2OI8aljNCN3sSx6hsr/1+rlcDAotXJR7C1oZZHCNsfpbKwMjRA3Uqb5tF1Rae2oloTr4xpq+WjA==",
+          "dev": true,
+          "requires": {
+            "micromatch": "2.3.11",
+            "normalize-path": "2.1.1"
+          }
+        },
+        "arr-diff": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-2.0.0.tgz",
+          "integrity": "sha1-jzuCf5Vai9ZpaX5KQlasPOrjVs8=",
+          "dev": true,
+          "requires": {
+            "arr-flatten": "1.1.0"
+          }
+        },
+        "array-unique": {
+          "version": "0.2.1",
+          "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.2.1.tgz",
+          "integrity": "sha1-odl8yvy8JiXMcPrc6zalDFiwGlM=",
+          "dev": true
+        },
+        "braces": {
+          "version": "1.8.5",
+          "resolved": "https://registry.npmjs.org/braces/-/braces-1.8.5.tgz",
+          "integrity": "sha1-uneWLhLf+WnWt2cR6RS3N4V79qc=",
+          "dev": true,
+          "requires": {
+            "expand-range": "1.8.2",
+            "preserve": "0.2.0",
+            "repeat-element": "1.1.3"
+          }
+        },
+        "chokidar": {
+          "version": "1.7.0",
+          "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-1.7.0.tgz",
+          "integrity": "sha1-eY5ol3gVHIB2tLNg5e3SjNortGg=",
+          "dev": true,
+          "requires": {
+            "anymatch": "1.3.2",
+            "async-each": "1.0.1",
+            "fsevents": "1.2.4",
+            "glob-parent": "2.0.0",
+            "inherits": "2.0.3",
+            "is-binary-path": "1.0.1",
+            "is-glob": "2.0.1",
+            "path-is-absolute": "1.0.1",
+            "readdirp": "2.1.0"
+          }
+        },
+        "expand-brackets": {
+          "version": "0.1.5",
+          "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-0.1.5.tgz",
+          "integrity": "sha1-3wcoTjQqgHzXM6xa9yQR5YHRF3s=",
+          "dev": true,
+          "requires": {
+            "is-posix-bracket": "0.1.1"
+          }
+        },
+        "extglob": {
+          "version": "0.3.2",
+          "resolved": "https://registry.npmjs.org/extglob/-/extglob-0.3.2.tgz",
+          "integrity": "sha1-Lhj/PS9JqydlzskCPwEdqo2DSaE=",
+          "dev": true,
+          "requires": {
+            "is-extglob": "1.0.0"
+          }
+        },
+        "glob-parent": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-2.0.0.tgz",
+          "integrity": "sha1-gTg9ctsFT8zPUzbaqQLxgvbtuyg=",
+          "dev": true,
+          "requires": {
+            "is-glob": "2.0.1"
+          }
+        },
+        "is-extglob": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-1.0.0.tgz",
+          "integrity": "sha1-rEaBd8SUNAWgkvyPKXYMb/xiBsA=",
+          "dev": true
+        },
+        "is-glob": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-2.0.1.tgz",
+          "integrity": "sha1-0Jb5JqPe1WAPP9/ZEZjLCIjC2GM=",
+          "dev": true,
+          "requires": {
+            "is-extglob": "1.0.0"
+          }
+        },
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        },
+        "micromatch": {
+          "version": "2.3.11",
+          "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-2.3.11.tgz",
+          "integrity": "sha1-hmd8l9FyCzY0MdBNDRUpO9OMFWU=",
+          "dev": true,
+          "requires": {
+            "arr-diff": "2.0.0",
+            "array-unique": "0.2.1",
+            "braces": "1.8.5",
+            "expand-brackets": "0.1.5",
+            "extglob": "0.3.2",
+            "filename-regex": "2.0.1",
+            "is-extglob": "1.0.0",
+            "is-glob": "2.0.1",
+            "kind-of": "3.2.2",
+            "normalize-path": "2.1.1",
+            "object.omit": "2.0.1",
+            "parse-glob": "3.0.4",
+            "regex-cache": "0.4.4"
+          }
+        },
+        "minimist": {
+          "version": "1.2.0",
+          "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+          "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+          "dev": true
+        }
+      }
+    },
+    "@angular/core": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/core/-/core-6.1.7.tgz",
+      "integrity": "sha512-3MtS8EQy+saNcImDWghphOr/h3l5CpFnZW6aaHiL8T5CpTBNdB86uEmAwtiNQkJ0UeO+cztF1zNCzhm9R93/3w==",
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "@angular/forms": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/forms/-/forms-6.1.7.tgz",
+      "integrity": "sha512-McCElnn6Abr+HAjwxa1ldvIMs101TT0NGq8EHXLyF9QcKG24dU7425+MdLuW0OrtgBql2+RjlqnSiKuxDQHxJA==",
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "@angular/http": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/http/-/http-6.1.7.tgz",
+      "integrity": "sha512-N0wXHpEL/CsNM4l44Z+dU51Y994mBEHjt9yb0SeKf02mdrsTJK+cEvfZ0JkVDjGddqdWHvWFn3zSmkR79qLrSQ==",
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "@angular/language-service": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/language-service/-/language-service-6.1.7.tgz",
+      "integrity": "sha512-L6upXuyO42Z5XhtvbDoDuQEmXEOdSYeGOBmXSxb3ywb/0eh8kHk1Xft+8aaKKtazYjol0t+M+DlZgehqvk4vEA==",
+      "dev": true
+    },
+    "@angular/platform-browser": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/platform-browser/-/platform-browser-6.1.7.tgz",
+      "integrity": "sha512-YOYg944aefCWElJhnma8X+3wJDb6nHf6aBAVN+YPg0bUplEFacR4y6PeM9QR8vjh5Y0kbGG9ZPGDT/WwP2t4sQ==",
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "@angular/platform-browser-dynamic": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/platform-browser-dynamic/-/platform-browser-dynamic-6.1.7.tgz",
+      "integrity": "sha512-sSF7n4SpwPiP1fMwocu/RUegpp/45jHK/+r9biXUXUBD12zO5QMcLHU393sjoNi7e6+meuXEH0pnWa66dTznjw==",
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "@angular/router": {
+      "version": "6.1.7",
+      "resolved": "https://registry.npmjs.org/@angular/router/-/router-6.1.7.tgz",
+      "integrity": "sha512-YaOTq2icKAd9FDls2qo2Qp8FrmLGke3eA+bZ3FvOhFydxyUAvlU96N9Y9Gb05tXTtBaQNzAInov2bbp2YMFEFA==",
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "@compodoc/compodoc": {
+      "version": "1.1.5",
+      "resolved": "https://registry.npmjs.org/@compodoc/compodoc/-/compodoc-1.1.5.tgz",
+      "integrity": "sha512-PwUa42qCYEIrbXX25oUVkWck+IhACXBRSScPSV0Fr6+Nd3d6BcxUx8hllzZRVMBVv2a85fojSF7Sk6BfLqraRg==",
+      "dev": true,
+      "requires": {
+        "@compodoc/ngd-transformer": "2.0.0",
+        "chalk": "2.4.1",
+        "cheerio": "1.0.0-rc.2",
+        "chokidar": "2.0.4",
+        "colors": "1.3.2",
+        "commander": "2.17.1",
+        "cosmiconfig": "5.0.6",
+        "fancy-log": "1.3.2",
+        "findit2": "2.2.3",
+        "fs-extra": "7.0.0",
+        "glob": "7.1.3",
+        "handlebars": "4.0.10",
+        "html-entities": "1.2.1",
+        "i18next": "11.7.0",
+        "inside": "1.0.0",
+        "json5": "2.0.1",
+        "live-server": "1.1.0",
+        "lodash": "4.17.10",
+        "lunr": "2.3.2",
+        "marked": "0.4.0",
+        "os-name": "2.0.1",
+        "traverse": "0.6.6",
+        "ts-simple-ast": "12.4.0",
+        "uuid": "3.3.2"
+      },
+      "dependencies": {
+        "camelcase": {
+          "version": "1.2.1",
+          "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-1.2.1.tgz",
+          "integrity": "sha1-m7UwTS4LVmmLLHWLCKPqqdqlijk=",
+          "dev": true,
+          "optional": true
+        },
+        "chalk": {
+          "version": "2.4.1",
+          "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.1.tgz",
+          "integrity": "sha512-ObN6h1v2fTJSmUXoS3nMQ92LbDK9be4TV+6G+omQlGJFdcUX5heKi1LZ1YnRMIgwTLEj3E24bT6tYni50rlCfQ==",
+          "dev": true,
+          "requires": {
+            "ansi-styles": "3.2.1",
+            "escape-string-regexp": "1.0.5",
+            "supports-color": "5.5.0"
+          }
+        },
+        "cliui": {
+          "version": "2.1.0",
+          "resolved": "https://registry.npmjs.org/cliui/-/cliui-2.1.0.tgz",
+          "integrity": "sha1-S0dXYP+AJkx2LDoXGQMukcf+oNE=",
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "center-align": "0.1.3",
+            "right-align": "0.1.3",
+            "wordwrap": "0.0.2"
+          }
+        },
+        "colors": {
+          "version": "1.3.2",
+          "resolved": "https://registry.npmjs.org/colors/-/colors-1.3.2.tgz",
+          "integrity": "sha512-rhP0JSBGYvpcNQj4s5AdShMeE5ahMop96cTeDl/v9qQQm2fYClE2QXZRi8wLzc+GmXSxdIqqbOIAhyObEXDbfQ==",
+          "dev": true
+        },
+        "cosmiconfig": {
+          "version": "5.0.6",
+          "resolved": "https://registry.npmjs.org/cosmiconfig/-/cosmiconfig-5.0.6.tgz",
+          "integrity": "sha512-6DWfizHriCrFWURP1/qyhsiFvYdlJzbCzmtFWh744+KyWsJo5+kPzUZZaMRSSItoYc0pxFX7gEO7ZC1/gN/7AQ==",
+          "dev": true,
+          "requires": {
+            "is-directory": "0.3.1",
+            "js-yaml": "3.12.0",
+            "parse-json": "4.0.0"
+          }
+        },
+        "fs-extra": {
+          "version": "7.0.0",
+          "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-7.0.0.tgz",
+          "integrity": "sha512-EglNDLRpmaTWiD/qraZn6HREAEAHJcJOmxNEYwq6xeMKnVMAy3GUcFB+wXt2C6k4CNvB/mP1y/U3dzvKKj5OtQ==",
+          "dev": true,
+          "requires": {
+            "graceful-fs": "4.1.11",
+            "jsonfile": "4.0.0",
+            "universalify": "0.1.2"
+          }
+        },
+        "handlebars": {
+          "version": "4.0.10",
+          "resolved": "https://registry.npmjs.org/handlebars/-/handlebars-4.0.10.tgz",
+          "integrity": "sha1-PTDHGLCaPZbyPqTMH0A8TTup/08=",
+          "dev": true,
+          "requires": {
+            "async": "1.5.2",
+            "optimist": "0.6.1",
+            "source-map": "0.4.4",
+            "uglify-js": "2.8.29"
+          }
+        },
+        "json5": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/json5/-/json5-2.0.1.tgz",
+          "integrity": "sha512-t6N/86QDIRYvOL259jR5c5TbtMnekl2Ib314mGeMh37zAwjgbWHieqijPH7pWaogmJq1F2I4Sphg19U1s+ZnXQ==",
+          "dev": true,
+          "requires": {
+            "minimist": "1.2.0"
+          }
+        },
+        "minimist": {
+          "version": "1.2.0",
+          "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+          "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+          "dev": true
+        },
+        "parse-json": {
+          "version": "4.0.0",
+          "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz",
+          "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=",
+          "dev": true,
+          "requires": {
+            "error-ex": "1.3.2",
+            "json-parse-better-errors": "1.0.2"
+          }
+        },
+        "source-map": {
+          "version": "0.4.4",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.4.4.tgz",
+          "integrity": "sha1-66T12pwNyZneaAMti092FzZSA2s=",
+          "dev": true,
+          "requires": {
+            "amdefine": "1.0.1"
+          }
+        },
+        "uglify-js": {
+          "version": "2.8.29",
+          "resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-2.8.29.tgz",
+          "integrity": "sha1-KcVzMUgFe7Th913zW3qcty5qWd0=",
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "source-map": "0.5.7",
+            "uglify-to-browserify": "1.0.2",
+            "yargs": "3.10.0"
+          },
+          "dependencies": {
+            "source-map": {
+              "version": "0.5.7",
+              "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz",
+              "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=",
+              "dev": true,
+              "optional": true
+            }
+          }
+        },
+        "wordwrap": {
+          "version": "0.0.2",
+          "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-0.0.2.tgz",
+          "integrity": "sha1-t5Zpu0LstAn4PVg8rVLKF+qhZD8=",
+          "dev": true,
+          "optional": true
+        },
+        "yargs": {
+          "version": "3.10.0",
+          "resolved": "http://registry.npmjs.org/yargs/-/yargs-3.10.0.tgz",
+          "integrity": "sha1-9+572FfdfB0tOMDnTvvWgdFDH9E=",
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "camelcase": "1.2.1",
+            "cliui": "2.1.0",
+            "decamelize": "1.2.0",
+            "window-size": "0.1.0"
+          }
+        }
+      }
+    },
+    "@compodoc/ngd-core": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/@compodoc/ngd-core/-/ngd-core-2.0.0.tgz",
+      "integrity": "sha512-6HpYvXRZBdIYFojWxW5EVNkhYPmblytCve62CNoYBSWfy++vTGH7Ypg2Bhjg2CsqeV8JOVxrPO7JM9M3MgWKEA==",
+      "dev": true,
+      "requires": {
+        "ansi-colors": "1.1.0",
+        "fancy-log": "1.3.2",
+        "typescript": "2.7.2"
+      },
+      "dependencies": {
+        "ansi-colors": {
+          "version": "1.1.0",
+          "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-1.1.0.tgz",
+          "integrity": "sha512-SFKX67auSNoVR38N3L+nvsPjOE0bybKTYbkf5tRvushrAPQ9V75huw0ZxBkKVeRU9kqH3d6HA4xTckbwZ4ixmA==",
+          "dev": true,
+          "requires": {
+            "ansi-wrap": "0.1.0"
+          }
+        }
+      }
+    },
+    "@compodoc/ngd-transformer": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/@compodoc/ngd-transformer/-/ngd-transformer-2.0.0.tgz",
+      "integrity": "sha512-9J0KkmuuuvDHxH0oREgrgbqdEFqcltQXIBofeYdIyMKzI3A+pN1Ji4zfi7x1ql0Ax7qQKemp8XWP+cCpP0qY+w==",
+      "dev": true,
+      "requires": {
+        "@compodoc/ngd-core": "2.0.0",
+        "dot": "1.1.2",
+        "fs-extra": "4.0.3",
+        "viz.js": "1.8.2"
+      },
+      "dependencies": {
+        "fs-extra": {
+          "version": "4.0.3",
+          "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-4.0.3.tgz",
+          "integrity": "sha512-q6rbdDd1o2mAnQreO7YADIxf/Whx4AHBiRf6d+/cVT8h44ss+lHgxf1FemcqDnQt9X3ct4McHr+JMGlYSsK7Cg==",
+          "dev": true,
+          "requires": {
+            "graceful-fs": "4.1.11",
+            "jsonfile": "4.0.0",
+            "universalify": "0.1.2"
+          }
+        }
+      }
+    },
+    "@dsherret/to-absolute-glob": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/@dsherret/to-absolute-glob/-/to-absolute-glob-2.0.2.tgz",
+      "integrity": "sha1-H2R13IvZdM6gei2vOGSzF7HdMyw=",
+      "dev": true,
+      "requires": {
+        "is-absolute": "1.0.0",
+        "is-negated-glob": "1.0.0"
+      }
+    },
+    "@mrmlnc/readdir-enhanced": {
+      "version": "2.2.1",
+      "resolved": "https://registry.npmjs.org/@mrmlnc/readdir-enhanced/-/readdir-enhanced-2.2.1.tgz",
+      "integrity": "sha512-bPHp6Ji8b41szTOcaP63VlnbbO5Ny6dwAATtY6JTjh5N2OLrb5Qk/Th5cRkRQhkWCt+EJsYrNB0MiL+Gpn6e3g==",
+      "dev": true,
+      "requires": {
+        "call-me-maybe": "1.0.1",
+        "glob-to-regexp": "0.3.0"
+      }
+    },
+    "@ngtools/json-schema": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/@ngtools/json-schema/-/json-schema-1.1.0.tgz",
+      "integrity": "sha1-w6DFRNYjkqzCgTpCyKDcb1j4aSI=",
+      "dev": true
+    },
+    "@ngtools/webpack": {
+      "version": "6.0.8",
+      "resolved": "https://registry.npmjs.org/@ngtools/webpack/-/webpack-6.0.8.tgz",
+      "integrity": "sha512-jorGpTd82ILbyUwg4JQekovHFaYwSMlZan4f7x+sd3+2WgyL3Z1+ZbVSGKvXZWKS/mAVx7eLkRikzJkuC4FgHw==",
+      "dev": true,
+      "requires": {
+        "@angular-devkit/core": "0.6.8",
+        "tree-kill": "1.2.0",
+        "webpack-sources": "1.2.0"
+      }
+    },
+    "@nodelib/fs.stat": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-1.1.2.tgz",
+      "integrity": "sha512-yprFYuno9FtNsSHVlSWd+nRlmGoAbqbeCwOryP6sC/zoCjhpArcRMYp19EvpSUSizJAlsXEwJv+wcWS9XaXdMw==",
+      "dev": true
+    },
+    "@schematics/angular": {
+      "version": "0.6.8",
+      "resolved": "https://registry.npmjs.org/@schematics/angular/-/angular-0.6.8.tgz",
+      "integrity": "sha512-9kRphqTYG5Df/I8fvnT1zMsw0YNDPO9tl18tQZXj4am4raT7l9UCr+WkwJdlBoA5pwG6baWE9sL0iGWV/bzF/g==",
+      "dev": true,
+      "requires": {
+        "@angular-devkit/core": "0.6.8",
+        "@angular-devkit/schematics": "0.6.8",
+        "typescript": "2.7.2"
+      }
+    },
+    "@schematics/update": {
+      "version": "0.6.8",
+      "resolved": "https://registry.npmjs.org/@schematics/update/-/update-0.6.8.tgz",
+      "integrity": "sha512-1Uq7LYnwL2wBwGVCgNz76QAR13ghAk+2vDDHOi+VX5+usHManxydrpoMGeX66OBPd+y5D3D2MFb+8mYHE7mygg==",
+      "dev": true,
+      "requires": {
+        "@angular-devkit/core": "0.6.8",
+        "@angular-devkit/schematics": "0.6.8",
+        "npm-registry-client": "8.6.0",
+        "rxjs": "6.3.2",
+        "semver": "5.5.1",
+        "semver-intersect": "1.4.0"
+      }
+    },
+    "@types/estree": {
+      "version": "0.0.39",
+      "resolved": "https://registry.npmjs.org/@types/estree/-/estree-0.0.39.tgz",
+      "integrity": "sha512-EYNwp3bU+98cpU4lAWYYL7Zz+2gryWH1qbdDTidVd6hkiR6weksdbMadyXKXNPEkQFhXM+hVO9ZygomHXp+AIw==",
+      "dev": true
+    },
+    "@types/jasmine": {
+      "version": "2.8.8",
+      "resolved": "https://registry.npmjs.org/@types/jasmine/-/jasmine-2.8.8.tgz",
+      "integrity": "sha512-OJSUxLaxXsjjhob2DBzqzgrkLmukM3+JMpRp0r0E4HTdT1nwDCWhaswjYxazPij6uOdzHCJfNbDjmQ1/rnNbCg==",
+      "dev": true
+    },
+    "@types/jasminewd2": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/@types/jasminewd2/-/jasminewd2-2.0.3.tgz",
+      "integrity": "sha512-hYDVmQZT5VA2kigd4H4bv7vl/OhlympwREUemqBdOqtrYTo5Ytm12a5W5/nGgGYdanGVxj0x/VhZ7J3hOg/YKg==",
+      "dev": true,
+      "requires": {
+        "@types/jasmine": "2.8.8"
+      }
+    },
+    "@types/node": {
+      "version": "8.9.5",
+      "resolved": "http://registry.npmjs.org/@types/node/-/node-8.9.5.tgz",
+      "integrity": "sha512-jRHfWsvyMtXdbhnz5CVHxaBgnV6duZnPlQuRSo/dm/GnmikNcmZhxIES4E9OZjUmQ8C+HCl4KJux+cXN/ErGDQ==",
+      "dev": true
+    },
+    "@types/q": {
+      "version": "0.0.32",
+      "resolved": "https://registry.npmjs.org/@types/q/-/q-0.0.32.tgz",
+      "integrity": "sha1-vShOV8hPEyXacCur/IKlMoGQwMU=",
+      "dev": true
+    },
+    "@types/selenium-webdriver": {
+      "version": "2.53.43",
+      "resolved": "https://registry.npmjs.org/@types/selenium-webdriver/-/selenium-webdriver-2.53.43.tgz",
+      "integrity": "sha512-UBYHWph6P3tutkbXpW6XYg9ZPbTKjw/YC2hGG1/GEvWwTbvezBUv3h+mmUFw79T3RFPnmedpiXdOBbXX+4l0jg==",
+      "dev": true
+    },
+    "@webassemblyjs/ast": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/ast/-/ast-1.4.3.tgz",
+      "integrity": "sha512-S6npYhPcTHDYe9nlsKa9CyWByFi8Vj8HovcAgtmMAQZUOczOZbQ8CnwMYKYC5HEZzxEE+oY0jfQk4cVlI3J59Q==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/helper-wasm-bytecode": "1.4.3",
+        "@webassemblyjs/wast-parser": "1.4.3",
+        "debug": "3.1.0",
+        "webassemblyjs": "1.4.3"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "3.1.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+          "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+          "dev": true,
+          "requires": {
+            "ms": "2.0.0"
+          }
+        }
+      }
+    },
+    "@webassemblyjs/floating-point-hex-parser": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/floating-point-hex-parser/-/floating-point-hex-parser-1.4.3.tgz",
+      "integrity": "sha512-3zTkSFswwZOPNHnzkP9ONq4bjJSeKVMcuahGXubrlLmZP8fmTIJ58dW7h/zOVWiFSuG2em3/HH3BlCN7wyu9Rw==",
+      "dev": true
+    },
+    "@webassemblyjs/helper-buffer": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-buffer/-/helper-buffer-1.4.3.tgz",
+      "integrity": "sha512-e8+KZHh+RV8MUvoSRtuT1sFXskFnWG9vbDy47Oa166xX+l0dD5sERJ21g5/tcH8Yo95e9IN3u7Jc3NbhnUcSkw==",
+      "dev": true,
+      "requires": {
+        "debug": "3.1.0"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "3.1.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+          "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+          "dev": true,
+          "requires": {
+            "ms": "2.0.0"
+          }
+        }
+      }
+    },
+    "@webassemblyjs/helper-code-frame": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-code-frame/-/helper-code-frame-1.4.3.tgz",
+      "integrity": "sha512-9FgHEtNsZQYaKrGCtsjswBil48Qp1agrzRcPzCbQloCoaTbOXLJ9IRmqT+uEZbenpULLRNFugz3I4uw18hJM8w==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/wast-printer": "1.4.3"
+      }
+    },
+    "@webassemblyjs/helper-fsm": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-fsm/-/helper-fsm-1.4.3.tgz",
+      "integrity": "sha512-JINY76U+702IRf7ePukOt037RwmtH59JHvcdWbTTyHi18ixmQ+uOuNhcdCcQHTquDAH35/QgFlp3Y9KqtyJsCQ==",
+      "dev": true
+    },
+    "@webassemblyjs/helper-wasm-bytecode": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-bytecode/-/helper-wasm-bytecode-1.4.3.tgz",
+      "integrity": "sha512-I7bS+HaO0K07Io89qhJv+z1QipTpuramGwUSDkwEaficbSvCcL92CUZEtgykfNtk5wb0CoLQwWlmXTwGbNZUeQ==",
+      "dev": true
+    },
+    "@webassemblyjs/helper-wasm-section": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/helper-wasm-section/-/helper-wasm-section-1.4.3.tgz",
+      "integrity": "sha512-p0yeeO/h2r30PyjnJX9xXSR6EDcvJd/jC6xa/Pxg4lpfcNi7JUswOpqDToZQ55HMMVhXDih/yqkaywHWGLxqyQ==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/ast": "1.4.3",
+        "@webassemblyjs/helper-buffer": "1.4.3",
+        "@webassemblyjs/helper-wasm-bytecode": "1.4.3",
+        "@webassemblyjs/wasm-gen": "1.4.3",
+        "debug": "3.1.0"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "3.1.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+          "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+          "dev": true,
+          "requires": {
+            "ms": "2.0.0"
+          }
+        }
+      }
+    },
+    "@webassemblyjs/leb128": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/leb128/-/leb128-1.4.3.tgz",
+      "integrity": "sha512-4u0LJLSPzuRDWHwdqsrThYn+WqMFVqbI2ltNrHvZZkzFPO8XOZ0HFQ5eVc4jY/TNHgXcnwrHjONhPGYuuf//KQ==",
+      "dev": true,
+      "requires": {
+        "leb": "0.3.0"
+      }
+    },
+    "@webassemblyjs/validation": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/validation/-/validation-1.4.3.tgz",
+      "integrity": "sha512-R+rRMKfhd9mq0rj2mhU9A9NKI2l/Rw65vIYzz4lui7eTKPcCu1l7iZNi4b9Gen8D42Sqh/KGiaQNk/x5Tn/iBQ==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/ast": "1.4.3"
+      }
+    },
+    "@webassemblyjs/wasm-edit": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-edit/-/wasm-edit-1.4.3.tgz",
+      "integrity": "sha512-qzuwUn771PV6/LilqkXcS0ozJYAeY/OKbXIWU3a8gexuqb6De2p4ya/baBeH5JQ2WJdfhWhSvSbu86Vienttpw==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/ast": "1.4.3",
+        "@webassemblyjs/helper-buffer": "1.4.3",
+        "@webassemblyjs/helper-wasm-bytecode": "1.4.3",
+        "@webassemblyjs/helper-wasm-section": "1.4.3",
+        "@webassemblyjs/wasm-gen": "1.4.3",
+        "@webassemblyjs/wasm-opt": "1.4.3",
+        "@webassemblyjs/wasm-parser": "1.4.3",
+        "@webassemblyjs/wast-printer": "1.4.3",
+        "debug": "3.1.0"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "3.1.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+          "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+          "dev": true,
+          "requires": {
+            "ms": "2.0.0"
+          }
+        }
+      }
+    },
+    "@webassemblyjs/wasm-gen": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-gen/-/wasm-gen-1.4.3.tgz",
+      "integrity": "sha512-eR394T8dHZfpLJ7U/Z5pFSvxl1L63JdREebpv9gYc55zLhzzdJPAuxjBYT4XqevUdW67qU2s0nNA3kBuNJHbaQ==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/ast": "1.4.3",
+        "@webassemblyjs/helper-wasm-bytecode": "1.4.3",
+        "@webassemblyjs/leb128": "1.4.3"
+      }
+    },
+    "@webassemblyjs/wasm-opt": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-opt/-/wasm-opt-1.4.3.tgz",
+      "integrity": "sha512-7Gp+nschuKiDuAL1xmp4Xz0rgEbxioFXw4nCFYEmy+ytynhBnTeGc9W9cB1XRu1w8pqRU2lbj2VBBA4cL5Z2Kw==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/ast": "1.4.3",
+        "@webassemblyjs/helper-buffer": "1.4.3",
+        "@webassemblyjs/wasm-gen": "1.4.3",
+        "@webassemblyjs/wasm-parser": "1.4.3",
+        "debug": "3.1.0"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "3.1.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+          "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+          "dev": true,
+          "requires": {
+            "ms": "2.0.0"
+          }
+        }
+      }
+    },
+    "@webassemblyjs/wasm-parser": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/wasm-parser/-/wasm-parser-1.4.3.tgz",
+      "integrity": "sha512-KXBjtlwA3BVukR/yWHC9GF+SCzBcgj0a7lm92kTOaa4cbjaTaa47bCjXw6cX4SGQpkncB9PU2hHGYVyyI7wFRg==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/ast": "1.4.3",
+        "@webassemblyjs/helper-wasm-bytecode": "1.4.3",
+        "@webassemblyjs/leb128": "1.4.3",
+        "@webassemblyjs/wasm-parser": "1.4.3",
+        "webassemblyjs": "1.4.3"
+      }
+    },
+    "@webassemblyjs/wast-parser": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-parser/-/wast-parser-1.4.3.tgz",
+      "integrity": "sha512-QhCsQzqV0CpsEkRYyTzQDilCNUZ+5j92f+g35bHHNqS22FppNTywNFfHPq8ZWZfYCgbectc+PoghD+xfzVFh1Q==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/ast": "1.4.3",
+        "@webassemblyjs/floating-point-hex-parser": "1.4.3",
+        "@webassemblyjs/helper-code-frame": "1.4.3",
+        "@webassemblyjs/helper-fsm": "1.4.3",
+        "long": "3.2.0",
+        "webassemblyjs": "1.4.3"
+      }
+    },
+    "@webassemblyjs/wast-printer": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/@webassemblyjs/wast-printer/-/wast-printer-1.4.3.tgz",
+      "integrity": "sha512-EgXk4anf8jKmuZJsqD8qy5bz2frEQhBvZruv+bqwNoLWUItjNSFygk8ywL3JTEz9KtxTlAmqTXNrdD1d9gNDtg==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/ast": "1.4.3",
+        "@webassemblyjs/wast-parser": "1.4.3",
+        "long": "3.2.0"
+      }
+    },
+    "abbrev": {
+      "version": "1.0.9",
+      "resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.0.9.tgz",
+      "integrity": "sha1-kbR5JYinc4wl813W9jdSovh3YTU=",
+      "dev": true
+    },
+    "accepts": {
+      "version": "1.3.5",
+      "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.5.tgz",
+      "integrity": "sha1-63d99gEXI6OxTopywIBcjoZ0a9I=",
+      "dev": true,
+      "requires": {
+        "mime-types": "2.1.20",
+        "negotiator": "0.6.1"
+      }
+    },
+    "acorn": {
+      "version": "5.7.2",
+      "resolved": "https://registry.npmjs.org/acorn/-/acorn-5.7.2.tgz",
+      "integrity": "sha512-cJrKCNcr2kv8dlDnbw+JPUGjHZzo4myaxOLmpOX8a+rgX94YeTcTMv/LFJUSByRpc+i4GgVnnhLxvMu/2Y+rqw==",
+      "dev": true
+    },
+    "acorn-dynamic-import": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/acorn-dynamic-import/-/acorn-dynamic-import-3.0.0.tgz",
+      "integrity": "sha512-zVWV8Z8lislJoOKKqdNMOB+s6+XV5WERty8MnKBeFgwA+19XJjJHs2RP5dzM57FftIs+jQnRToLiWazKr6sSWg==",
+      "dev": true,
+      "requires": {
+        "acorn": "5.7.2"
+      }
+    },
+    "adm-zip": {
+      "version": "0.4.4",
+      "resolved": "https://registry.npmjs.org/adm-zip/-/adm-zip-0.4.4.tgz",
+      "integrity": "sha1-ph7VrmkFw66lizplfSUDMJEFJzY=",
+      "dev": true
+    },
+    "after": {
+      "version": "0.8.2",
+      "resolved": "https://registry.npmjs.org/after/-/after-0.8.2.tgz",
+      "integrity": "sha1-/ts5T58OAqqXaOcCvaI7UF+ufh8=",
+      "dev": true
+    },
+    "agent-base": {
+      "version": "4.2.1",
+      "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-4.2.1.tgz",
+      "integrity": "sha512-JVwXMr9nHYTUXsBFKUqhJwvlcYU/blreOEUkhNR2eXZIvwd+c+o5V4MgDPKWnMS/56awN3TRzIP+KoPn+roQtg==",
+      "dev": true,
+      "requires": {
+        "es6-promisify": "5.0.0"
+      }
+    },
+    "ajv": {
+      "version": "6.4.0",
+      "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.4.0.tgz",
+      "integrity": "sha1-06/3jpJ3VJdx2vAWTP9ISCt1T8Y=",
+      "dev": true,
+      "requires": {
+        "fast-deep-equal": "1.1.0",
+        "fast-json-stable-stringify": "2.0.0",
+        "json-schema-traverse": "0.3.1",
+        "uri-js": "3.0.2"
+      }
+    },
+    "ajv-errors": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/ajv-errors/-/ajv-errors-1.0.0.tgz",
+      "integrity": "sha1-7PAh+hCP0X37Xms4Py3SM+Mf/Fk=",
+      "dev": true
+    },
+    "ajv-keywords": {
+      "version": "3.2.0",
+      "resolved": "https://registry.npmjs.org/ajv-keywords/-/ajv-keywords-3.2.0.tgz",
+      "integrity": "sha1-6GuBnGAs+IIa1jdBNpjx3sAhhHo=",
+      "dev": true
+    },
+    "align-text": {
+      "version": "0.1.4",
+      "resolved": "https://registry.npmjs.org/align-text/-/align-text-0.1.4.tgz",
+      "integrity": "sha1-DNkKVhCT810KmSVsIrcGlDP60Rc=",
+      "dev": true,
+      "requires": {
+        "kind-of": "3.2.2",
+        "longest": "1.0.1",
+        "repeat-string": "1.6.1"
+      },
+      "dependencies": {
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        }
+      }
+    },
+    "ambi": {
+      "version": "2.5.0",
+      "resolved": "http://registry.npmjs.org/ambi/-/ambi-2.5.0.tgz",
+      "integrity": "sha1-fI43K+SIkRV+fOoBy2+RQ9H3QiA=",
+      "dev": true,
+      "requires": {
+        "editions": "1.3.4",
+        "typechecker": "4.5.0"
+      }
+    },
+    "amdefine": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/amdefine/-/amdefine-1.0.1.tgz",
+      "integrity": "sha1-SlKCrBZHKek2Gbz9OtFR+BfOkfU=",
+      "dev": true
+    },
+    "ansi-align": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/ansi-align/-/ansi-align-2.0.0.tgz",
+      "integrity": "sha1-w2rsy6VjuJzrVW82kPCx2eNUf38=",
+      "dev": true,
+      "requires": {
+        "string-width": "2.1.1"
+      },
+      "dependencies": {
+        "ansi-regex": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz",
+          "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=",
+          "dev": true
+        },
+        "is-fullwidth-code-point": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz",
+          "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=",
+          "dev": true
+        },
+        "string-width": {
+          "version": "2.1.1",
+          "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz",
+          "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==",
+          "dev": true,
+          "requires": {
+            "is-fullwidth-code-point": "2.0.0",
+            "strip-ansi": "4.0.0"
+          }
+        },
+        "strip-ansi": {
+          "version": "4.0.0",
+          "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz",
+          "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=",
+          "dev": true,
+          "requires": {
+            "ansi-regex": "3.0.0"
+          }
+        }
+      }
+    },
+    "ansi-colors": {
+      "version": "3.0.5",
+      "resolved": "https://registry.npmjs.org/ansi-colors/-/ansi-colors-3.0.5.tgz",
+      "integrity": "sha512-VVjWpkfaphxUBFarydrQ3n26zX5nIK7hcbT3/ielrvwDDyBBjuh2vuSw1P9zkPq0cfqvdw7lkYHnu+OLSfIBsg==",
+      "dev": true
+    },
+    "ansi-gray": {
+      "version": "0.1.1",
+      "resolved": "https://registry.npmjs.org/ansi-gray/-/ansi-gray-0.1.1.tgz",
+      "integrity": "sha1-KWLPVOyXksSFEKPetSRDaGHvclE=",
+      "dev": true,
+      "requires": {
+        "ansi-wrap": "0.1.0"
+      }
+    },
+    "ansi-html": {
+      "version": "0.0.7",
+      "resolved": "https://registry.npmjs.org/ansi-html/-/ansi-html-0.0.7.tgz",
+      "integrity": "sha1-gTWEAhliqenm/QOflA0S9WynhZ4=",
+      "dev": true
+    },
+    "ansi-regex": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-2.1.1.tgz",
+      "integrity": "sha1-w7M6te42DYbg5ijwRorn7yfWVN8=",
+      "dev": true
+    },
+    "ansi-styles": {
+      "version": "3.2.1",
+      "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz",
+      "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==",
+      "dev": true,
+      "requires": {
+        "color-convert": "1.9.3"
+      }
+    },
+    "ansi-wrap": {
+      "version": "0.1.0",
+      "resolved": "https://registry.npmjs.org/ansi-wrap/-/ansi-wrap-0.1.0.tgz",
+      "integrity": "sha1-qCJQ3bABXponyoLoLqYDu/pF768=",
+      "dev": true
+    },
+    "anymatch": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-2.0.0.tgz",
+      "integrity": "sha512-5teOsQWABXHHBFP9y3skS5P3d/WfWXpv3FUpy+LorMrNYaT9pI4oLMQX7jzQ2KklNpGpWHzdCXTDT2Y3XGlZBw==",
+      "dev": true,
+      "requires": {
+        "micromatch": "3.1.10",
+        "normalize-path": "2.1.1"
+      }
+    },
+    "apache-crypt": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/apache-crypt/-/apache-crypt-1.1.2.tgz",
+      "integrity": "sha1-ggeCozu2pf0nEggvDtOiTjybAhQ=",
+      "dev": true,
+      "requires": {
+        "unix-crypt-td-js": "1.0.0"
+      }
+    },
+    "apache-md5": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/apache-md5/-/apache-md5-1.0.6.tgz",
+      "integrity": "sha1-RwI51AxU58Mt2dbrEbw1eOzJA8I=",
+      "dev": true
+    },
+    "app-root-path": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/app-root-path/-/app-root-path-2.1.0.tgz",
+      "integrity": "sha1-mL9lmTJ+zqGZMJhm6BQDaP0uZGo=",
+      "dev": true
+    },
+    "append-transform": {
+      "version": "0.4.0",
+      "resolved": "https://registry.npmjs.org/append-transform/-/append-transform-0.4.0.tgz",
+      "integrity": "sha1-126/jKlNJ24keja61EpLdKthGZE=",
+      "dev": true,
+      "requires": {
+        "default-require-extensions": "1.0.0"
+      }
+    },
+    "aproba": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/aproba/-/aproba-1.2.0.tgz",
+      "integrity": "sha512-Y9J6ZjXtoYh8RnXVCMOU/ttDmk1aBjunq9vO0ta5x85WDQiQfUF9sIPBITdbiiIVcBo03Hi3jMxigBtsddlXRw==",
+      "dev": true
+    },
+    "are-we-there-yet": {
+      "version": "1.1.5",
+      "resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.1.5.tgz",
+      "integrity": "sha512-5hYdAkZlcG8tOLujVDTgCT+uPX0VnpAH28gWsLfzpXYm7wP6mp5Q/gYyR7YQ0cKVJcXJnl3j2kpBan13PtQf6w==",
+      "dev": true,
+      "requires": {
+        "delegates": "1.0.0",
+        "readable-stream": "2.3.6"
+      }
+    },
+    "argparse": {
+      "version": "1.0.10",
+      "resolved": "https://registry.npmjs.org/argparse/-/argparse-1.0.10.tgz",
+      "integrity": "sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==",
+      "dev": true,
+      "requires": {
+        "sprintf-js": "1.0.3"
+      }
+    },
+    "arr-diff": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-4.0.0.tgz",
+      "integrity": "sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA=",
+      "dev": true
+    },
+    "arr-flatten": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/arr-flatten/-/arr-flatten-1.1.0.tgz",
+      "integrity": "sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg==",
+      "dev": true
+    },
+    "arr-union": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/arr-union/-/arr-union-3.1.0.tgz",
+      "integrity": "sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ=",
+      "dev": true
+    },
+    "array-differ": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/array-differ/-/array-differ-1.0.0.tgz",
+      "integrity": "sha1-7/UuN1gknTO+QCuLuOVkuytdQDE=",
+      "dev": true
+    },
+    "array-find-index": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/array-find-index/-/array-find-index-1.0.2.tgz",
+      "integrity": "sha1-3wEKoSh+Fku9pvlyOwqWoexBh6E=",
+      "dev": true
+    },
+    "array-flatten": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-2.1.1.tgz",
+      "integrity": "sha1-Qmu52oQJDBg42BLIFQryCoMx4pY=",
+      "dev": true
+    },
+    "array-slice": {
+      "version": "0.2.3",
+      "resolved": "https://registry.npmjs.org/array-slice/-/array-slice-0.2.3.tgz",
+      "integrity": "sha1-3Tz7gO15c6dRF82sabC5nshhhvU=",
+      "dev": true
+    },
+    "array-union": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/array-union/-/array-union-1.0.2.tgz",
+      "integrity": "sha1-mjRBDk9OPaI96jdb5b5w8kd47Dk=",
+      "dev": true,
+      "requires": {
+        "array-uniq": "1.0.3"
+      }
+    },
+    "array-uniq": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/array-uniq/-/array-uniq-1.0.3.tgz",
+      "integrity": "sha1-r2rId6Jcx/dOBYiUdThY39sk/bY=",
+      "dev": true
+    },
+    "array-unique": {
+      "version": "0.3.2",
+      "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.3.2.tgz",
+      "integrity": "sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg=",
+      "dev": true
+    },
+    "arraybuffer.slice": {
+      "version": "0.0.6",
+      "resolved": "https://registry.npmjs.org/arraybuffer.slice/-/arraybuffer.slice-0.0.6.tgz",
+      "integrity": "sha1-8zshWfBTKj8xB6JywMz70a0peco=",
+      "dev": true
+    },
+    "arrify": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/arrify/-/arrify-1.0.1.tgz",
+      "integrity": "sha1-iYUI2iIm84DfkEcoRWhJwVAaSw0=",
+      "dev": true
+    },
+    "asap": {
+      "version": "2.0.6",
+      "resolved": "https://registry.npmjs.org/asap/-/asap-2.0.6.tgz",
+      "integrity": "sha1-5QNHYR1+aQlDIIu9r+vLwvuGbUY=",
+      "dev": true,
+      "optional": true
+    },
+    "asn1": {
+      "version": "0.2.4",
+      "resolved": "https://registry.npmjs.org/asn1/-/asn1-0.2.4.tgz",
+      "integrity": "sha512-jxwzQpLQjSmWXgwaCZE9Nz+glAG01yF1QnWgbhGwHI5A6FRIEY6IVqtHhIepHqI7/kyEyQEagBC5mBEFlIYvdg==",
+      "dev": true,
+      "requires": {
+        "safer-buffer": "2.1.2"
+      }
+    },
+    "asn1.js": {
+      "version": "4.10.1",
+      "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-4.10.1.tgz",
+      "integrity": "sha512-p32cOF5q0Zqs9uBiONKYLm6BClCoBCM5O9JfeUSlnQLBTxYdTK+pW+nXflm8UkKd2UYlEbYz5qEi0JuZR9ckSw==",
+      "dev": true,
+      "requires": {
+        "bn.js": "4.11.8",
+        "inherits": "2.0.3",
+        "minimalistic-assert": "1.0.1"
+      }
+    },
+    "assert": {
+      "version": "1.4.1",
+      "resolved": "https://registry.npmjs.org/assert/-/assert-1.4.1.tgz",
+      "integrity": "sha1-mZEtWRg2tab1s0XA8H7vwI/GXZE=",
+      "dev": true,
+      "requires": {
+        "util": "0.10.3"
+      },
+      "dependencies": {
+        "inherits": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.1.tgz",
+          "integrity": "sha1-sX0I0ya0Qj5Wjv9xn5GwscvfafE=",
+          "dev": true
+        },
+        "util": {
+          "version": "0.10.3",
+          "resolved": "https://registry.npmjs.org/util/-/util-0.10.3.tgz",
+          "integrity": "sha1-evsa/lCAUkZInj23/g7TeTNqwPk=",
+          "dev": true,
+          "requires": {
+            "inherits": "2.0.1"
+          }
+        }
+      }
+    },
+    "assert-plus": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/assert-plus/-/assert-plus-1.0.0.tgz",
+      "integrity": "sha1-8S4PPF13sLHN2RRpQuTpbB5N1SU=",
+      "dev": true
+    },
+    "assign-symbols": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/assign-symbols/-/assign-symbols-1.0.0.tgz",
+      "integrity": "sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c=",
+      "dev": true
+    },
+    "async": {
+      "version": "1.5.2",
+      "resolved": "https://registry.npmjs.org/async/-/async-1.5.2.tgz",
+      "integrity": "sha1-7GphrlZIDAw8skHJVhjiCJL5Zyo=",
+      "dev": true
+    },
+    "async-each": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/async-each/-/async-each-1.0.1.tgz",
+      "integrity": "sha1-GdOGodntxufByF04iu28xW0zYC0=",
+      "dev": true
+    },
+    "async-foreach": {
+      "version": "0.1.3",
+      "resolved": "https://registry.npmjs.org/async-foreach/-/async-foreach-0.1.3.tgz",
+      "integrity": "sha1-NhIfhFwFeBct5Bmpfb6x0W7DRUI=",
+      "dev": true
+    },
+    "asynckit": {
+      "version": "0.4.0",
+      "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz",
+      "integrity": "sha1-x57Zf380y48robyXkLzDZkdLS3k=",
+      "dev": true
+    },
+    "atob": {
+      "version": "2.1.2",
+      "resolved": "https://registry.npmjs.org/atob/-/atob-2.1.2.tgz",
+      "integrity": "sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg==",
+      "dev": true
+    },
+    "autoprefixer": {
+      "version": "8.6.5",
+      "resolved": "https://registry.npmjs.org/autoprefixer/-/autoprefixer-8.6.5.tgz",
+      "integrity": "sha512-PLWJN3Xo/rycNkx+mp8iBDMTm3FeWe4VmYaZDSqL5QQB9sLsQkG5k8n+LNDFnhh9kdq2K+egL/icpctOmDHwig==",
+      "dev": true,
+      "requires": {
+        "browserslist": "3.2.8",
+        "caniuse-lite": "1.0.30000885",
+        "normalize-range": "0.1.2",
+        "num2fraction": "1.2.2",
+        "postcss": "6.0.23",
+        "postcss-value-parser": "3.3.0"
+      }
+    },
+    "aws-sign2": {
+      "version": "0.7.0",
+      "resolved": "https://registry.npmjs.org/aws-sign2/-/aws-sign2-0.7.0.tgz",
+      "integrity": "sha1-tG6JCTSpWR8tL2+G1+ap8bP+dqg=",
+      "dev": true
+    },
+    "aws4": {
+      "version": "1.8.0",
+      "resolved": "https://registry.npmjs.org/aws4/-/aws4-1.8.0.tgz",
+      "integrity": "sha512-ReZxvNHIOv88FlT7rxcXIIC0fPt4KZqZbOlivyWtXLt8ESx84zd3kMC6iK5jVeS2qt+g7ftS7ye4fi06X5rtRQ==",
+      "dev": true
+    },
+    "babel-code-frame": {
+      "version": "6.26.0",
+      "resolved": "https://registry.npmjs.org/babel-code-frame/-/babel-code-frame-6.26.0.tgz",
+      "integrity": "sha1-Y/1D99weO7fONZR9uP42mj9Yx0s=",
+      "dev": true,
+      "requires": {
+        "chalk": "1.1.3",
+        "esutils": "2.0.2",
+        "js-tokens": "3.0.2"
+      },
+      "dependencies": {
+        "ansi-styles": {
+          "version": "2.2.1",
+          "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz",
+          "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=",
+          "dev": true
+        },
+        "chalk": {
+          "version": "1.1.3",
+          "resolved": "http://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz",
+          "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=",
+          "dev": true,
+          "requires": {
+            "ansi-styles": "2.2.1",
+            "escape-string-regexp": "1.0.5",
+            "has-ansi": "2.0.0",
+            "strip-ansi": "3.0.1",
+            "supports-color": "2.0.0"
+          }
+        },
+        "supports-color": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz",
+          "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=",
+          "dev": true
+        }
+      }
+    },
+    "babel-generator": {
+      "version": "6.26.1",
+      "resolved": "https://registry.npmjs.org/babel-generator/-/babel-generator-6.26.1.tgz",
+      "integrity": "sha512-HyfwY6ApZj7BYTcJURpM5tznulaBvyio7/0d4zFOeMPUmfxkCjHocCuoLa2SAGzBI8AREcH3eP3758F672DppA==",
+      "dev": true,
+      "requires": {
+        "babel-messages": "6.23.0",
+        "babel-runtime": "6.26.0",
+        "babel-types": "6.26.0",
+        "detect-indent": "4.0.0",
+        "jsesc": "1.3.0",
+        "lodash": "4.17.10",
+        "source-map": "0.5.7",
+        "trim-right": "1.0.1"
+      }
+    },
+    "babel-messages": {
+      "version": "6.23.0",
+      "resolved": "https://registry.npmjs.org/babel-messages/-/babel-messages-6.23.0.tgz",
+      "integrity": "sha1-8830cDhYA1sqKVHG7F7fbGLyYw4=",
+      "dev": true,
+      "requires": {
+        "babel-runtime": "6.26.0"
+      }
+    },
+    "babel-runtime": {
+      "version": "6.26.0",
+      "resolved": "https://registry.npmjs.org/babel-runtime/-/babel-runtime-6.26.0.tgz",
+      "integrity": "sha1-llxwWGaOgrVde/4E/yM3vItWR/4=",
+      "dev": true,
+      "requires": {
+        "core-js": "2.5.7",
+        "regenerator-runtime": "0.11.1"
+      }
+    },
+    "babel-template": {
+      "version": "6.26.0",
+      "resolved": "https://registry.npmjs.org/babel-template/-/babel-template-6.26.0.tgz",
+      "integrity": "sha1-3gPi0WOWsGn0bdn/+FIfsaDjXgI=",
+      "dev": true,
+      "requires": {
+        "babel-runtime": "6.26.0",
+        "babel-traverse": "6.26.0",
+        "babel-types": "6.26.0",
+        "babylon": "6.18.0",
+        "lodash": "4.17.10"
+      }
+    },
+    "babel-traverse": {
+      "version": "6.26.0",
+      "resolved": "https://registry.npmjs.org/babel-traverse/-/babel-traverse-6.26.0.tgz",
+      "integrity": "sha1-RqnL1+3MYsjlwGTi0tjQ9ANXZu4=",
+      "dev": true,
+      "requires": {
+        "babel-code-frame": "6.26.0",
+        "babel-messages": "6.23.0",
+        "babel-runtime": "6.26.0",
+        "babel-types": "6.26.0",
+        "babylon": "6.18.0",
+        "debug": "2.6.9",
+        "globals": "9.18.0",
+        "invariant": "2.2.4",
+        "lodash": "4.17.10"
+      }
+    },
+    "babel-types": {
+      "version": "6.26.0",
+      "resolved": "https://registry.npmjs.org/babel-types/-/babel-types-6.26.0.tgz",
+      "integrity": "sha1-o7Bz+Uq0nrb6Vc1lInozQ4BjJJc=",
+      "dev": true,
+      "requires": {
+        "babel-runtime": "6.26.0",
+        "esutils": "2.0.2",
+        "lodash": "4.17.10",
+        "to-fast-properties": "1.0.3"
+      }
+    },
+    "babylon": {
+      "version": "6.18.0",
+      "resolved": "https://registry.npmjs.org/babylon/-/babylon-6.18.0.tgz",
+      "integrity": "sha512-q/UEjfGJ2Cm3oKV71DJz9d25TPnq5rhBVL2Q4fA5wcC3jcrdn7+SssEybFIxwAvvP+YCsCYNKughoF33GxgycQ==",
+      "dev": true
+    },
+    "backo2": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/backo2/-/backo2-1.0.2.tgz",
+      "integrity": "sha1-MasayLEpNjRj41s+u2n038+6eUc=",
+      "dev": true
+    },
+    "balanced-match": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.0.tgz",
+      "integrity": "sha1-ibTRmasr7kneFk6gK4nORi1xt2c=",
+      "dev": true
+    },
+    "base": {
+      "version": "0.11.2",
+      "resolved": "https://registry.npmjs.org/base/-/base-0.11.2.tgz",
+      "integrity": "sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg==",
+      "dev": true,
+      "requires": {
+        "cache-base": "1.0.1",
+        "class-utils": "0.3.6",
+        "component-emitter": "1.2.1",
+        "define-property": "1.0.0",
+        "isobject": "3.0.1",
+        "mixin-deep": "1.3.1",
+        "pascalcase": "0.1.1"
+      },
+      "dependencies": {
+        "define-property": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
+          "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
+          "dev": true,
+          "requires": {
+            "is-descriptor": "1.0.2"
+          }
+        },
+        "is-accessor-descriptor": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
+          "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
+          "dev": true,
+          "requires": {
+            "kind-of": "6.0.2"
+          }
+        },
+        "is-data-descriptor": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
+          "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
+          "dev": true,
+          "requires": {
+            "kind-of": "6.0.2"
+          }
+        },
+        "is-descriptor": {
+          "version": "1.0.2",
+          "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
+          "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
+          "dev": true,
+          "requires": {
+            "is-accessor-descriptor": "1.0.0",
+            "is-data-descriptor": "1.0.0",
+            "kind-of": "6.0.2"
+          }
+        }
+      }
+    },
+    "base64-arraybuffer": {
+      "version": "0.1.5",
+      "resolved": "https://registry.npmjs.org/base64-arraybuffer/-/base64-arraybuffer-0.1.5.tgz",
+      "integrity": "sha1-c5JncZI7Whl0etZmqlzUv5xunOg=",
+      "dev": true
+    },
+    "base64-js": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/base64-js/-/base64-js-1.3.0.tgz",
+      "integrity": "sha512-ccav/yGvoa80BQDljCxsmmQ3Xvx60/UpBIij5QN21W3wBi/hhIC9OoO+KLpu9IJTS9j4DRVJ3aDDF9cMSoa2lw==",
+      "dev": true
+    },
+    "base64id": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/base64id/-/base64id-1.0.0.tgz",
+      "integrity": "sha1-R2iMuZu2gE8OBtPnY7HDLlfY5rY=",
+      "dev": true
+    },
+    "basic-auth": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/basic-auth/-/basic-auth-2.0.0.tgz",
+      "integrity": "sha1-AV2z81PgLlY3d1X5YnQuiYHnu7o=",
+      "dev": true,
+      "requires": {
+        "safe-buffer": "5.1.1"
+      },
+      "dependencies": {
+        "safe-buffer": {
+          "version": "5.1.1",
+          "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.1.tgz",
+          "integrity": "sha512-kKvNJn6Mm93gAczWVJg7wH+wGYWNrDHdWvpUmHyEsgCtIwwo3bqPtV4tR5tuPaUhTOo/kvhVwd8XwwOllGYkbg==",
+          "dev": true
+        }
+      }
+    },
+    "batch": {
+      "version": "0.6.1",
+      "resolved": "https://registry.npmjs.org/batch/-/batch-0.6.1.tgz",
+      "integrity": "sha1-3DQxT05nkxgJP8dgJyUl+UvyXBY=",
+      "dev": true
+    },
+    "bcrypt-pbkdf": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.2.tgz",
+      "integrity": "sha1-pDAdOJtqQ/m2f/PKEaP2Y342Dp4=",
+      "dev": true,
+      "optional": true,
+      "requires": {
+        "tweetnacl": "0.14.5"
+      }
+    },
+    "better-assert": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/better-assert/-/better-assert-1.0.2.tgz",
+      "integrity": "sha1-QIZrnhueC1W0gYlDEeaPr/rrxSI=",
+      "dev": true,
+      "requires": {
+        "callsite": "1.0.0"
+      }
+    },
+    "big.js": {
+      "version": "3.2.0",
+      "resolved": "https://registry.npmjs.org/big.js/-/big.js-3.2.0.tgz",
+      "integrity": "sha512-+hN/Zh2D08Mx65pZ/4g5bsmNiZUuChDiQfTUQ7qJr4/kuopCr88xZsAXv6mBoZEsUI4OuGHlX59qE94K2mMW8Q==",
+      "dev": true
+    },
+    "binary-extensions": {
+      "version": "1.11.0",
+      "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-1.11.0.tgz",
+      "integrity": "sha1-RqoXUftqL5PuXmibsQh9SxTGwgU=",
+      "dev": true
+    },
+    "blob": {
+      "version": "0.0.4",
+      "resolved": "https://registry.npmjs.org/blob/-/blob-0.0.4.tgz",
+      "integrity": "sha1-vPEwUspURj8w+fx+lbmkdjCpSSE=",
+      "dev": true
+    },
+    "block-stream": {
+      "version": "0.0.9",
+      "resolved": "https://registry.npmjs.org/block-stream/-/block-stream-0.0.9.tgz",
+      "integrity": "sha1-E+v+d4oDIFz+A3UUgeu0szAMEmo=",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3"
+      }
+    },
+    "blocking-proxy": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/blocking-proxy/-/blocking-proxy-1.0.1.tgz",
+      "integrity": "sha512-KE8NFMZr3mN2E0HcvCgRtX7DjhiIQrwle+nSVJVC/yqFb9+xznHl2ZcoBp2L9qzkI4t4cBFJ1efXF8Dwi132RA==",
+      "dev": true,
+      "requires": {
+        "minimist": "1.2.0"
+      },
+      "dependencies": {
+        "minimist": {
+          "version": "1.2.0",
+          "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+          "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+          "dev": true
+        }
+      }
+    },
+    "bluebird": {
+      "version": "3.5.2",
+      "resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.5.2.tgz",
+      "integrity": "sha512-dhHTWMI7kMx5whMQntl7Vr9C6BvV10lFXDAasnqnrMYhXVCzzk6IO9Fo2L75jXHT07WrOngL1WDXOp+yYS91Yg==",
+      "dev": true
+    },
+    "bn.js": {
+      "version": "4.11.8",
+      "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.11.8.tgz",
+      "integrity": "sha512-ItfYfPLkWHUjckQCk8xC+LwxgK8NYcXywGigJgSwOP8Y2iyWT4f2vsZnoOXTTbo+o5yXmIUJ4gn5538SO5S3gA==",
+      "dev": true
+    },
+    "body-parser": {
+      "version": "1.18.2",
+      "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.18.2.tgz",
+      "integrity": "sha1-h2eKGdhLR9hZuDGZvVm84iKxBFQ=",
+      "dev": true,
+      "requires": {
+        "bytes": "3.0.0",
+        "content-type": "1.0.4",
+        "debug": "2.6.9",
+        "depd": "1.1.2",
+        "http-errors": "1.6.3",
+        "iconv-lite": "0.4.19",
+        "on-finished": "2.3.0",
+        "qs": "6.5.1",
+        "raw-body": "2.3.2",
+        "type-is": "1.6.16"
+      },
+      "dependencies": {
+        "qs": {
+          "version": "6.5.1",
+          "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.1.tgz",
+          "integrity": "sha512-eRzhrN1WSINYCDCbrz796z37LOe3m5tmW7RQf6oBntukAG1nmovJvhnwHHRMAfeoItc1m2Hk02WER2aQ/iqs+A==",
+          "dev": true
+        }
+      }
+    },
+    "bonjour": {
+      "version": "3.5.0",
+      "resolved": "https://registry.npmjs.org/bonjour/-/bonjour-3.5.0.tgz",
+      "integrity": "sha1-jokKGD2O6aI5OzhExpGkK897yfU=",
+      "dev": true,
+      "requires": {
+        "array-flatten": "2.1.1",
+        "deep-equal": "1.0.1",
+        "dns-equal": "1.0.0",
+        "dns-txt": "2.0.2",
+        "multicast-dns": "6.2.3",
+        "multicast-dns-service-types": "1.1.0"
+      }
+    },
+    "boolbase": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/boolbase/-/boolbase-1.0.0.tgz",
+      "integrity": "sha1-aN/1++YMUes3cl6p4+0xDcwed24=",
+      "dev": true
+    },
+    "boxen": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/boxen/-/boxen-1.3.0.tgz",
+      "integrity": "sha512-TNPjfTr432qx7yOjQyaXm3dSR0MH9vXp7eT1BFSl/C51g+EFnOR9hTg1IreahGBmDNCehscshe45f+C1TBZbLw==",
+      "dev": true,
+      "requires": {
+        "ansi-align": "2.0.0",
+        "camelcase": "4.1.0",
+        "chalk": "2.2.2",
+        "cli-boxes": "1.0.0",
+        "string-width": "2.1.1",
+        "term-size": "1.2.0",
+        "widest-line": "2.0.0"
+      },
+      "dependencies": {
+        "ansi-regex": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz",
+          "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=",
+          "dev": true
+        },
+        "camelcase": {
+          "version": "4.1.0",
+          "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz",
+          "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=",
+          "dev": true
+        },
+        "is-fullwidth-code-point": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz",
+          "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=",
+          "dev": true
+        },
+        "string-width": {
+          "version": "2.1.1",
+          "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz",
+          "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==",
+          "dev": true,
+          "requires": {
+            "is-fullwidth-code-point": "2.0.0",
+            "strip-ansi": "4.0.0"
+          }
+        },
+        "strip-ansi": {
+          "version": "4.0.0",
+          "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz",
+          "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=",
+          "dev": true,
+          "requires": {
+            "ansi-regex": "3.0.0"
+          }
+        }
+      }
+    },
+    "brace-expansion": {
+      "version": "1.1.11",
+      "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
+      "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
+      "dev": true,
+      "requires": {
+        "balanced-match": "1.0.0",
+        "concat-map": "0.0.1"
+      }
+    },
+    "braces": {
+      "version": "2.3.2",
+      "resolved": "https://registry.npmjs.org/braces/-/braces-2.3.2.tgz",
+      "integrity": "sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w==",
+      "dev": true,
+      "requires": {
+        "arr-flatten": "1.1.0",
+        "array-unique": "0.3.2",
+        "extend-shallow": "2.0.1",
+        "fill-range": "4.0.0",
+        "isobject": "3.0.1",
+        "repeat-element": "1.1.3",
+        "snapdragon": "0.8.2",
+        "snapdragon-node": "2.1.1",
+        "split-string": "3.1.0",
+        "to-regex": "3.0.2"
+      },
+      "dependencies": {
+        "extend-shallow": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+          "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+          "dev": true,
+          "requires": {
+            "is-extendable": "0.1.1"
+          }
+        }
+      }
+    },
+    "brorand": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/brorand/-/brorand-1.1.0.tgz",
+      "integrity": "sha1-EsJe/kCkXjwyPrhnWgoM5XsiNx8=",
+      "dev": true
+    },
+    "browserify-aes": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/browserify-aes/-/browserify-aes-1.2.0.tgz",
+      "integrity": "sha512-+7CHXqGuspUn/Sl5aO7Ea0xWGAtETPXNSAjHo48JfLdPWcMng33Xe4znFvQweqc/uzk5zSOI3H52CYnjCfb5hA==",
+      "dev": true,
+      "requires": {
+        "buffer-xor": "1.0.3",
+        "cipher-base": "1.0.4",
+        "create-hash": "1.2.0",
+        "evp_bytestokey": "1.0.3",
+        "inherits": "2.0.3",
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "browserify-cipher": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/browserify-cipher/-/browserify-cipher-1.0.1.tgz",
+      "integrity": "sha512-sPhkz0ARKbf4rRQt2hTpAHqn47X3llLkUGn+xEJzLjwY8LRs2p0v7ljvI5EyoRO/mexrNunNECisZs+gw2zz1w==",
+      "dev": true,
+      "requires": {
+        "browserify-aes": "1.2.0",
+        "browserify-des": "1.0.2",
+        "evp_bytestokey": "1.0.3"
+      }
+    },
+    "browserify-des": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/browserify-des/-/browserify-des-1.0.2.tgz",
+      "integrity": "sha512-BioO1xf3hFwz4kc6iBhI3ieDFompMhrMlnDFC4/0/vd5MokpuAc3R+LYbwTA9A5Yc9pq9UYPqffKpW2ObuwX5A==",
+      "dev": true,
+      "requires": {
+        "cipher-base": "1.0.4",
+        "des.js": "1.0.0",
+        "inherits": "2.0.3",
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "browserify-rsa": {
+      "version": "4.0.1",
+      "resolved": "https://registry.npmjs.org/browserify-rsa/-/browserify-rsa-4.0.1.tgz",
+      "integrity": "sha1-IeCr+vbyApzy+vsTNWenAdQTVSQ=",
+      "dev": true,
+      "requires": {
+        "bn.js": "4.11.8",
+        "randombytes": "2.0.6"
+      }
+    },
+    "browserify-sign": {
+      "version": "4.0.4",
+      "resolved": "https://registry.npmjs.org/browserify-sign/-/browserify-sign-4.0.4.tgz",
+      "integrity": "sha1-qk62jl17ZYuqa/alfmMMvXqT0pg=",
+      "dev": true,
+      "requires": {
+        "bn.js": "4.11.8",
+        "browserify-rsa": "4.0.1",
+        "create-hash": "1.2.0",
+        "create-hmac": "1.1.7",
+        "elliptic": "6.4.1",
+        "inherits": "2.0.3",
+        "parse-asn1": "5.1.1"
+      }
+    },
+    "browserify-zlib": {
+      "version": "0.2.0",
+      "resolved": "https://registry.npmjs.org/browserify-zlib/-/browserify-zlib-0.2.0.tgz",
+      "integrity": "sha512-Z942RysHXmJrhqk88FmKBVq/v5tqmSkDz7p54G/MGyjMnCFFnC79XWNbg+Vta8W6Wb2qtSZTSxIGkJrRpCFEiA==",
+      "dev": true,
+      "requires": {
+        "pako": "1.0.6"
+      }
+    },
+    "browserslist": {
+      "version": "3.2.8",
+      "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-3.2.8.tgz",
+      "integrity": "sha512-WHVocJYavUwVgVViC0ORikPHQquXwVh939TaelZ4WDqpWgTX/FsGhl/+P4qBUAGcRvtOgDgC+xftNWWp2RUTAQ==",
+      "dev": true,
+      "requires": {
+        "caniuse-lite": "1.0.30000885",
+        "electron-to-chromium": "1.3.63"
+      }
+    },
+    "buffer": {
+      "version": "4.9.1",
+      "resolved": "http://registry.npmjs.org/buffer/-/buffer-4.9.1.tgz",
+      "integrity": "sha1-bRu2AbB6TvztlwlBMgkwJ8lbwpg=",
+      "dev": true,
+      "requires": {
+        "base64-js": "1.3.0",
+        "ieee754": "1.1.12",
+        "isarray": "1.0.0"
+      }
+    },
+    "buffer-alloc": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/buffer-alloc/-/buffer-alloc-1.2.0.tgz",
+      "integrity": "sha512-CFsHQgjtW1UChdXgbyJGtnm+O/uLQeZdtbDo8mfUgYXCHSM1wgrVxXm6bSyrUuErEb+4sYVGCzASBRot7zyrow==",
+      "dev": true,
+      "requires": {
+        "buffer-alloc-unsafe": "1.1.0",
+        "buffer-fill": "1.0.0"
+      }
+    },
+    "buffer-alloc-unsafe": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/buffer-alloc-unsafe/-/buffer-alloc-unsafe-1.1.0.tgz",
+      "integrity": "sha512-TEM2iMIEQdJ2yjPJoSIsldnleVaAk1oW3DBVUykyOLsEsFmEc9kn+SFFPz+gl54KQNxlDnAwCXosOS9Okx2xAg==",
+      "dev": true
+    },
+    "buffer-fill": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/buffer-fill/-/buffer-fill-1.0.0.tgz",
+      "integrity": "sha1-+PeLdniYiO858gXNY39o5wISKyw=",
+      "dev": true
+    },
+    "buffer-from": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.1.tgz",
+      "integrity": "sha512-MQcXEUbCKtEo7bhqEs6560Hyd4XaovZlO/k9V3hjVUF/zwW7KBVdSK4gIt/bzwS9MbR5qob+F5jusZsb0YQK2A==",
+      "dev": true
+    },
+    "buffer-indexof": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/buffer-indexof/-/buffer-indexof-1.1.1.tgz",
+      "integrity": "sha512-4/rOEg86jivtPTeOUUT61jJO1Ya1TrR/OkqCSZDyq84WJh3LuuiphBYJN+fm5xufIk4XAFcEwte/8WzC8If/1g==",
+      "dev": true
+    },
+    "buffer-xor": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/buffer-xor/-/buffer-xor-1.0.3.tgz",
+      "integrity": "sha1-JuYe0UIvtw3ULm42cp7VHYVf6Nk=",
+      "dev": true
+    },
+    "builtin-modules": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/builtin-modules/-/builtin-modules-1.1.1.tgz",
+      "integrity": "sha1-Jw8HbFpywC9bZaR9+Uxf46J4iS8=",
+      "dev": true
+    },
+    "builtin-status-codes": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz",
+      "integrity": "sha1-hZgoeOIbmOHGZCXgPQF0eI9Wnug=",
+      "dev": true
+    },
+    "builtins": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/builtins/-/builtins-1.0.3.tgz",
+      "integrity": "sha1-y5T662HIaWRR2zZTThQi+U8K7og=",
+      "dev": true
+    },
+    "bytes": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.0.0.tgz",
+      "integrity": "sha1-0ygVQE1olpn4Wk6k+odV3ROpYEg=",
+      "dev": true
+    },
+    "cacache": {
+      "version": "10.0.4",
+      "resolved": "https://registry.npmjs.org/cacache/-/cacache-10.0.4.tgz",
+      "integrity": "sha512-Dph0MzuH+rTQzGPNT9fAnrPmMmjKfST6trxJeK7NQuHRaVw24VzPRWTmg9MpcwOVQZO0E1FBICUlFeNaKPIfHA==",
+      "dev": true,
+      "requires": {
+        "bluebird": "3.5.2",
+        "chownr": "1.0.1",
+        "glob": "7.1.3",
+        "graceful-fs": "4.1.11",
+        "lru-cache": "4.1.3",
+        "mississippi": "2.0.0",
+        "mkdirp": "0.5.1",
+        "move-concurrently": "1.0.1",
+        "promise-inflight": "1.0.1",
+        "rimraf": "2.6.2",
+        "ssri": "5.3.0",
+        "unique-filename": "1.1.0",
+        "y18n": "4.0.0"
+      }
+    },
+    "cache-base": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/cache-base/-/cache-base-1.0.1.tgz",
+      "integrity": "sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ==",
+      "dev": true,
+      "requires": {
+        "collection-visit": "1.0.0",
+        "component-emitter": "1.2.1",
+        "get-value": "2.0.6",
+        "has-value": "1.0.0",
+        "isobject": "3.0.1",
+        "set-value": "2.0.0",
+        "to-object-path": "0.3.0",
+        "union-value": "1.0.0",
+        "unset-value": "1.0.0"
+      }
+    },
+    "cache-loader": {
+      "version": "1.2.2",
+      "resolved": "https://registry.npmjs.org/cache-loader/-/cache-loader-1.2.2.tgz",
+      "integrity": "sha512-rsGh4SIYyB9glU+d0OcHwiXHXBoUgDhHZaQ1KAbiXqfz1CDPxtTboh1gPbJ0q2qdO8a9lfcjgC5CJ2Ms32y5bw==",
+      "dev": true,
+      "requires": {
+        "loader-utils": "1.1.0",
+        "mkdirp": "0.5.1",
+        "neo-async": "2.5.2",
+        "schema-utils": "0.4.7"
+      }
+    },
+    "call-me-maybe": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/call-me-maybe/-/call-me-maybe-1.0.1.tgz",
+      "integrity": "sha1-JtII6onje1y95gJQoV8DHBak1ms=",
+      "dev": true
+    },
+    "callsite": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/callsite/-/callsite-1.0.0.tgz",
+      "integrity": "sha1-KAOY5dZkvXQDi28JBRU+borxvCA=",
+      "dev": true
+    },
+    "camel-case": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/camel-case/-/camel-case-3.0.0.tgz",
+      "integrity": "sha1-yjw2iKTpzzpM2nd9xNy8cTJJz3M=",
+      "dev": true,
+      "requires": {
+        "no-case": "2.3.2",
+        "upper-case": "1.1.3"
+      }
+    },
+    "camelcase": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-2.1.1.tgz",
+      "integrity": "sha1-fB0W1nmhu+WcoCys7PsBHiAfWh8=",
+      "dev": true
+    },
+    "camelcase-keys": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/camelcase-keys/-/camelcase-keys-2.1.0.tgz",
+      "integrity": "sha1-MIvur/3ygRkFHvodkyITyRuPkuc=",
+      "dev": true,
+      "requires": {
+        "camelcase": "2.1.1",
+        "map-obj": "1.0.1"
+      }
+    },
+    "caniuse-lite": {
+      "version": "1.0.30000885",
+      "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30000885.tgz",
+      "integrity": "sha512-cXKbYwpxBLd7qHyej16JazPoUacqoVuDhvR61U7Fr5vSxMUiodzcYa1rQYRYfZ5GexV03vGZHd722vNPLjPJGQ==",
+      "dev": true
+    },
+    "capture-stack-trace": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/capture-stack-trace/-/capture-stack-trace-1.0.1.tgz",
+      "integrity": "sha512-mYQLZnx5Qt1JgB1WEiMCf2647plpGeQ2NMR/5L0HNZzGQo4fuSPnK+wjfPnKZV0aiJDgzmWqqkV/g7JD+DW0qw==",
+      "dev": true
+    },
+    "caseless": {
+      "version": "0.12.0",
+      "resolved": "https://registry.npmjs.org/caseless/-/caseless-0.12.0.tgz",
+      "integrity": "sha1-G2gcIf+EAzyCZUMJBolCDRhxUdw=",
+      "dev": true
+    },
+    "center-align": {
+      "version": "0.1.3",
+      "resolved": "https://registry.npmjs.org/center-align/-/center-align-0.1.3.tgz",
+      "integrity": "sha1-qg0yYptu6XIgBBHL1EYckHvCt60=",
+      "dev": true,
+      "optional": true,
+      "requires": {
+        "align-text": "0.1.4",
+        "lazy-cache": "1.0.4"
+      }
+    },
+    "chalk": {
+      "version": "2.2.2",
+      "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.2.2.tgz",
+      "integrity": "sha512-LvixLAQ4MYhbf7hgL4o5PeK32gJKvVzDRiSNIApDofQvyhl8adgG2lJVXn4+ekQoK7HL9RF8lqxwerpe0x2pCw==",
+      "dev": true,
+      "requires": {
+        "ansi-styles": "3.2.1",
+        "escape-string-regexp": "1.0.5",
+        "supports-color": "4.5.0"
+      },
+      "dependencies": {
+        "has-flag": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-2.0.0.tgz",
+          "integrity": "sha1-6CB68cx7MNRGzHC3NLXovhj4jVE=",
+          "dev": true
+        },
+        "supports-color": {
+          "version": "4.5.0",
+          "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-4.5.0.tgz",
+          "integrity": "sha1-vnoN5ITexcXN34s9WRJQRJEvY1s=",
+          "dev": true,
+          "requires": {
+            "has-flag": "2.0.0"
+          }
+        }
+      }
+    },
+    "cheerio": {
+      "version": "1.0.0-rc.2",
+      "resolved": "https://registry.npmjs.org/cheerio/-/cheerio-1.0.0-rc.2.tgz",
+      "integrity": "sha1-S59TqBsn5NXawxwP/Qz6A8xoMNs=",
+      "dev": true,
+      "requires": {
+        "css-select": "1.2.0",
+        "dom-serializer": "0.1.0",
+        "entities": "1.1.1",
+        "htmlparser2": "3.9.2",
+        "lodash": "4.17.10",
+        "parse5": "3.0.3"
+      },
+      "dependencies": {
+        "domhandler": {
+          "version": "2.4.2",
+          "resolved": "https://registry.npmjs.org/domhandler/-/domhandler-2.4.2.tgz",
+          "integrity": "sha512-JiK04h0Ht5u/80fdLMCEmV4zkNh2BcoMFBmZ/91WtYZ8qVXSKjiw7fXMgFPnHcSZgOo3XdinHvmnDUeMf5R4wA==",
+          "dev": true,
+          "requires": {
+            "domelementtype": "1.3.0"
+          }
+        },
+        "htmlparser2": {
+          "version": "3.9.2",
+          "resolved": "https://registry.npmjs.org/htmlparser2/-/htmlparser2-3.9.2.tgz",
+          "integrity": "sha1-G9+HrMoPP55T+k/M6w9LTLsAszg=",
+          "dev": true,
+          "requires": {
+            "domelementtype": "1.3.0",
+            "domhandler": "2.4.2",
+            "domutils": "1.5.1",
+            "entities": "1.1.1",
+            "inherits": "2.0.3",
+            "readable-stream": "2.3.6"
+          }
+        },
+        "parse5": {
+          "version": "3.0.3",
+          "resolved": "https://registry.npmjs.org/parse5/-/parse5-3.0.3.tgz",
+          "integrity": "sha512-rgO9Zg5LLLkfJF9E6CCmXlSE4UVceloys8JrFqCcHloC3usd/kJCyPDwH2SOlzix2j3xaP9sUX3e8+kvkuleAA==",
+          "dev": true,
+          "requires": {
+            "@types/node": "8.9.5"
+          }
+        }
+      }
+    },
+    "chokidar": {
+      "version": "2.0.4",
+      "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-2.0.4.tgz",
+      "integrity": "sha512-z9n7yt9rOvIJrMhvDtDictKrkFHeihkNl6uWMmZlmL6tJtX9Cs+87oK+teBx+JIgzvbX3yZHT3eF8vpbDxHJXQ==",
+      "dev": true,
+      "requires": {
+        "anymatch": "2.0.0",
+        "async-each": "1.0.1",
+        "braces": "2.3.2",
+        "fsevents": "1.2.4",
+        "glob-parent": "3.1.0",
+        "inherits": "2.0.3",
+        "is-binary-path": "1.0.1",
+        "is-glob": "4.0.0",
+        "lodash.debounce": "4.0.8",
+        "normalize-path": "2.1.1",
+        "path-is-absolute": "1.0.1",
+        "readdirp": "2.1.0",
+        "upath": "1.1.0"
+      }
+    },
+    "chownr": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/chownr/-/chownr-1.0.1.tgz",
+      "integrity": "sha1-4qdQQqlVGQi+vSW4Uj1fl2nXkYE=",
+      "dev": true
+    },
+    "chrome-trace-event": {
+      "version": "0.1.3",
+      "resolved": "https://registry.npmjs.org/chrome-trace-event/-/chrome-trace-event-0.1.3.tgz",
+      "integrity": "sha512-sjndyZHrrWiu4RY7AkHgjn80GfAM2ZSzUkZLV/Js59Ldmh6JDThf0SUmOHU53rFu2rVxxfCzJ30Ukcfch3Gb/A==",
+      "dev": true
+    },
+    "ci-info": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/ci-info/-/ci-info-1.4.0.tgz",
+      "integrity": "sha512-Oqmw2pVfCl8sCL+1QgMywPfdxPJPkC51y4usw0iiE2S9qnEOAqXy8bwl1CpMpnoU39g4iKJTz6QZj+28FvOnjQ==",
+      "dev": true
+    },
+    "cipher-base": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/cipher-base/-/cipher-base-1.0.4.tgz",
+      "integrity": "sha512-Kkht5ye6ZGmwv40uUDZztayT2ThLQGfnj/T71N/XzeZeo3nf8foyW7zGTsPYkEya3m5f3cAypH+qe7YOrM1U2Q==",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3",
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "circular-dependency-plugin": {
+      "version": "5.0.2",
+      "resolved": "https://registry.npmjs.org/circular-dependency-plugin/-/circular-dependency-plugin-5.0.2.tgz",
+      "integrity": "sha512-oC7/DVAyfcY3UWKm0sN/oVoDedQDQiw/vIiAnuTWTpE5s0zWf7l3WY417Xw/Fbi/QbAjctAkxgMiS9P0s3zkmA==",
+      "dev": true
+    },
+    "class-utils": {
+      "version": "0.3.6",
+      "resolved": "https://registry.npmjs.org/class-utils/-/class-utils-0.3.6.tgz",
+      "integrity": "sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg==",
+      "dev": true,
+      "requires": {
+        "arr-union": "3.1.0",
+        "define-property": "0.2.5",
+        "isobject": "3.0.1",
+        "static-extend": "0.1.2"
+      },
+      "dependencies": {
+        "define-property": {
+          "version": "0.2.5",
+          "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
+          "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
+          "dev": true,
+          "requires": {
+            "is-descriptor": "0.1.6"
+          }
+        }
+      }
+    },
+    "clean-css": {
+      "version": "4.2.1",
+      "resolved": "https://registry.npmjs.org/clean-css/-/clean-css-4.2.1.tgz",
+      "integrity": "sha512-4ZxI6dy4lrY6FHzfiy1aEOXgu4LIsW2MhwG0VBKdcoGoH/XLFgaHSdLTGr4O8Be6A8r3MOphEiI8Gc1n0ecf3g==",
+      "dev": true,
+      "requires": {
+        "source-map": "0.6.1"
+      },
+      "dependencies": {
+        "source-map": {
+          "version": "0.6.1",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+          "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+          "dev": true
+        }
+      }
+    },
+    "cli-boxes": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/cli-boxes/-/cli-boxes-1.0.0.tgz",
+      "integrity": "sha1-T6kXw+WclKAEzWH47lCdplFocUM=",
+      "dev": true
+    },
+    "cliui": {
+      "version": "3.2.0",
+      "resolved": "https://registry.npmjs.org/cliui/-/cliui-3.2.0.tgz",
+      "integrity": "sha1-EgYBU3qRbSmUD5NNo7SNWFo5IT0=",
+      "dev": true,
+      "requires": {
+        "string-width": "1.0.2",
+        "strip-ansi": "3.0.1",
+        "wrap-ansi": "2.1.0"
+      }
+    },
+    "clone": {
+      "version": "2.1.2",
+      "resolved": "https://registry.npmjs.org/clone/-/clone-2.1.2.tgz",
+      "integrity": "sha1-G39Ln1kfHo+DZwQBYANFoCiHQ18=",
+      "dev": true
+    },
+    "clone-deep": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/clone-deep/-/clone-deep-2.0.2.tgz",
+      "integrity": "sha512-SZegPTKjCgpQH63E+eN6mVEEPdQBOUzjyJm5Pora4lrwWRFS8I0QAxV/KD6vV/i0WuijHZWQC1fMsPEdxfdVCQ==",
+      "dev": true,
+      "requires": {
+        "for-own": "1.0.0",
+        "is-plain-object": "2.0.4",
+        "kind-of": "6.0.2",
+        "shallow-clone": "1.0.0"
+      }
+    },
+    "co": {
+      "version": "4.6.0",
+      "resolved": "https://registry.npmjs.org/co/-/co-4.6.0.tgz",
+      "integrity": "sha1-bqa989hTrlTMuOR7+gvz+QMfsYQ=",
+      "dev": true
+    },
+    "code-block-writer": {
+      "version": "7.2.1",
+      "resolved": "https://registry.npmjs.org/code-block-writer/-/code-block-writer-7.2.1.tgz",
+      "integrity": "sha512-SYGE48EEUA1yeu7dcd93McZIc4+eLjMiw9uC9+Q3TMe8GibkgjVVLLz43kfTCSOA6wAAZKjdACEVZmcdW6m8ag==",
+      "dev": true
+    },
+    "code-point-at": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/code-point-at/-/code-point-at-1.1.0.tgz",
+      "integrity": "sha1-DQcLTQQ6W+ozovGkDi7bPZpMz3c=",
+      "dev": true
+    },
+    "codelyzer": {
+      "version": "4.2.1",
+      "resolved": "https://registry.npmjs.org/codelyzer/-/codelyzer-4.2.1.tgz",
+      "integrity": "sha512-CKwfgpfkqi9dyzy4s6ELaxJ54QgJ6A8iTSsM4bzHbLuTpbKncvNc3DUlCvpnkHBhK47gEf4qFsWoYqLrJPhy6g==",
+      "dev": true,
+      "requires": {
+        "app-root-path": "2.1.0",
+        "css-selector-tokenizer": "0.7.0",
+        "cssauron": "1.4.0",
+        "semver-dsl": "1.0.1",
+        "source-map": "0.5.7",
+        "sprintf-js": "1.0.3"
+      }
+    },
+    "collection-visit": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/collection-visit/-/collection-visit-1.0.0.tgz",
+      "integrity": "sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA=",
+      "dev": true,
+      "requires": {
+        "map-visit": "1.0.0",
+        "object-visit": "1.0.1"
+      }
+    },
+    "color-convert": {
+      "version": "1.9.3",
+      "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz",
+      "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==",
+      "dev": true,
+      "requires": {
+        "color-name": "1.1.3"
+      }
+    },
+    "color-name": {
+      "version": "1.1.3",
+      "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz",
+      "integrity": "sha1-p9BVi9icQveV3UIyj3QIMcpTvCU=",
+      "dev": true
+    },
+    "color-support": {
+      "version": "1.1.3",
+      "resolved": "https://registry.npmjs.org/color-support/-/color-support-1.1.3.tgz",
+      "integrity": "sha512-qiBjkpbMLO/HL68y+lh4q0/O1MZFj2RX6X/KmMa3+gJD3z+WwI1ZzDHysvqHGS3mP6mznPckpXmw1nI9cJjyRg==",
+      "dev": true
+    },
+    "colors": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/colors/-/colors-1.1.2.tgz",
+      "integrity": "sha1-FopHAXVran9RoSzgyXv6KMCE7WM=",
+      "dev": true
+    },
+    "combine-lists": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/combine-lists/-/combine-lists-1.0.1.tgz",
+      "integrity": "sha1-RYwH4J4NkA/Ci3Cj/sLazR0st/Y=",
+      "dev": true,
+      "requires": {
+        "lodash": "4.17.10"
+      }
+    },
+    "combined-stream": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.6.tgz",
+      "integrity": "sha1-cj599ugBrFYTETp+RFqbactjKBg=",
+      "dev": true,
+      "requires": {
+        "delayed-stream": "1.0.0"
+      }
+    },
+    "commander": {
+      "version": "2.17.1",
+      "resolved": "https://registry.npmjs.org/commander/-/commander-2.17.1.tgz",
+      "integrity": "sha512-wPMUt6FnH2yzG95SA6mzjQOEKUU3aLaDEmzs1ti+1E9h+CsrZghRlqEM/EJ4KscsQVG8uNN4uVreUeT8+drlgg=="
+    },
+    "commondir": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/commondir/-/commondir-1.0.1.tgz",
+      "integrity": "sha1-3dgA2gxmEnOTzKWVDqloo6rxJTs=",
+      "dev": true
+    },
+    "component-bind": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/component-bind/-/component-bind-1.0.0.tgz",
+      "integrity": "sha1-AMYIq33Nk4l8AAllGx06jh5zu9E=",
+      "dev": true
+    },
+    "component-emitter": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.2.1.tgz",
+      "integrity": "sha1-E3kY1teCg/ffemt8WmPhQOaUJeY=",
+      "dev": true
+    },
+    "component-inherit": {
+      "version": "0.0.3",
+      "resolved": "https://registry.npmjs.org/component-inherit/-/component-inherit-0.0.3.tgz",
+      "integrity": "sha1-ZF/ErfWLcrZJ1crmUTVhnbJv8UM=",
+      "dev": true
+    },
+    "compressible": {
+      "version": "2.0.14",
+      "resolved": "https://registry.npmjs.org/compressible/-/compressible-2.0.14.tgz",
+      "integrity": "sha1-MmxfUH+7BV9UEWeCuWmoG2einac=",
+      "dev": true,
+      "requires": {
+        "mime-db": "1.36.0"
+      }
+    },
+    "compression": {
+      "version": "1.7.3",
+      "resolved": "https://registry.npmjs.org/compression/-/compression-1.7.3.tgz",
+      "integrity": "sha512-HSjyBG5N1Nnz7tF2+O7A9XUhyjru71/fwgNb7oIsEVHR0WShfs2tIS/EySLgiTe98aOK18YDlMXpzjCXY/n9mg==",
+      "dev": true,
+      "requires": {
+        "accepts": "1.3.5",
+        "bytes": "3.0.0",
+        "compressible": "2.0.14",
+        "debug": "2.6.9",
+        "on-headers": "1.0.1",
+        "safe-buffer": "5.1.2",
+        "vary": "1.1.2"
+      }
+    },
+    "concat-map": {
+      "version": "0.0.1",
+      "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz",
+      "integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=",
+      "dev": true
+    },
+    "concat-stream": {
+      "version": "1.6.2",
+      "resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-1.6.2.tgz",
+      "integrity": "sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==",
+      "dev": true,
+      "requires": {
+        "buffer-from": "1.1.1",
+        "inherits": "2.0.3",
+        "readable-stream": "2.3.6",
+        "typedarray": "0.0.6"
+      }
+    },
+    "configstore": {
+      "version": "3.1.2",
+      "resolved": "https://registry.npmjs.org/configstore/-/configstore-3.1.2.tgz",
+      "integrity": "sha512-vtv5HtGjcYUgFrXc6Kx747B83MRRVS5R1VTEQoXvuP+kMI+if6uywV0nDGoiydJRy4yk7h9od5Og0kxx4zUXmw==",
+      "dev": true,
+      "requires": {
+        "dot-prop": "4.2.0",
+        "graceful-fs": "4.1.11",
+        "make-dir": "1.3.0",
+        "unique-string": "1.0.0",
+        "write-file-atomic": "2.3.0",
+        "xdg-basedir": "3.0.0"
+      }
+    },
+    "connect": {
+      "version": "3.6.6",
+      "resolved": "https://registry.npmjs.org/connect/-/connect-3.6.6.tgz",
+      "integrity": "sha1-Ce/2xVr3I24TcTWnJXSFi2eG9SQ=",
+      "dev": true,
+      "requires": {
+        "debug": "2.6.9",
+        "finalhandler": "1.1.0",
+        "parseurl": "1.3.2",
+        "utils-merge": "1.0.1"
+      },
+      "dependencies": {
+        "finalhandler": {
+          "version": "1.1.0",
+          "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.0.tgz",
+          "integrity": "sha1-zgtoVbRYU+eRsvzGgARtiCU91/U=",
+          "dev": true,
+          "requires": {
+            "debug": "2.6.9",
+            "encodeurl": "1.0.2",
+            "escape-html": "1.0.3",
+            "on-finished": "2.3.0",
+            "parseurl": "1.3.2",
+            "statuses": "1.3.1",
+            "unpipe": "1.0.0"
+          }
+        },
+        "statuses": {
+          "version": "1.3.1",
+          "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.3.1.tgz",
+          "integrity": "sha1-+vUbnrdKrvOzrPStX2Gr8ky3uT4=",
+          "dev": true
+        }
+      }
+    },
+    "connect-history-api-fallback": {
+      "version": "1.5.0",
+      "resolved": "https://registry.npmjs.org/connect-history-api-fallback/-/connect-history-api-fallback-1.5.0.tgz",
+      "integrity": "sha1-sGhzk0vF40T+9hGhlqb6rgruAVo=",
+      "dev": true
+    },
+    "console-browserify": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/console-browserify/-/console-browserify-1.1.0.tgz",
+      "integrity": "sha1-8CQcRXMKn8YyOyBtvzjtx0HQuxA=",
+      "dev": true,
+      "requires": {
+        "date-now": "0.1.4"
+      }
+    },
+    "console-control-strings": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz",
+      "integrity": "sha1-PXz0Rk22RG6mRL9LOVB/mFEAjo4=",
+      "dev": true
+    },
+    "constants-browserify": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/constants-browserify/-/constants-browserify-1.0.0.tgz",
+      "integrity": "sha1-wguW2MYXdIqvHBYCF2DNJ/y4y3U=",
+      "dev": true
+    },
+    "content-disposition": {
+      "version": "0.5.2",
+      "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.2.tgz",
+      "integrity": "sha1-DPaLud318r55YcOoUXjLhdunjLQ=",
+      "dev": true
+    },
+    "content-type": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.4.tgz",
+      "integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==",
+      "dev": true
+    },
+    "convert-source-map": {
+      "version": "1.6.0",
+      "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-1.6.0.tgz",
+      "integrity": "sha512-eFu7XigvxdZ1ETfbgPBohgyQ/Z++C0eEhTor0qRwBw9unw+L0/6V8wkSuGgzdThkiS5lSpdptOQPD8Ak40a+7A==",
+      "dev": true,
+      "requires": {
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "cookie": {
+      "version": "0.3.1",
+      "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.3.1.tgz",
+      "integrity": "sha1-5+Ch+e9DtMi6klxcWpboBtFoc7s=",
+      "dev": true
+    },
+    "cookie-signature": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz",
+      "integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=",
+      "dev": true
+    },
+    "copy-concurrently": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/copy-concurrently/-/copy-concurrently-1.0.5.tgz",
+      "integrity": "sha512-f2domd9fsVDFtaFcbaRZuYXwtdmnzqbADSwhSWYxYB/Q8zsdUUFMXVRwXGDMWmbEzAn1kdRrtI1T/KTFOL4X2A==",
+      "dev": true,
+      "requires": {
+        "aproba": "1.2.0",
+        "fs-write-stream-atomic": "1.0.10",
+        "iferr": "0.1.5",
+        "mkdirp": "0.5.1",
+        "rimraf": "2.6.2",
+        "run-queue": "1.0.3"
+      }
+    },
+    "copy-descriptor": {
+      "version": "0.1.1",
+      "resolved": "https://registry.npmjs.org/copy-descriptor/-/copy-descriptor-0.1.1.tgz",
+      "integrity": "sha1-Z29us8OZl8LuGsOpJP1hJHSPV40=",
+      "dev": true
+    },
+    "copy-webpack-plugin": {
+      "version": "4.5.2",
+      "resolved": "https://registry.npmjs.org/copy-webpack-plugin/-/copy-webpack-plugin-4.5.2.tgz",
+      "integrity": "sha512-zmC33E8FFSq3AbflTvqvPvBo621H36Afsxlui91d+QyZxPIuXghfnTsa1CuqiAaCPgJoSUWfTFbKJnadZpKEbQ==",
+      "dev": true,
+      "requires": {
+        "cacache": "10.0.4",
+        "find-cache-dir": "1.0.0",
+        "globby": "7.1.1",
+        "is-glob": "4.0.0",
+        "loader-utils": "1.1.0",
+        "minimatch": "3.0.4",
+        "p-limit": "1.3.0",
+        "serialize-javascript": "1.5.0"
+      }
+    },
+    "core-js": {
+      "version": "2.5.7",
+      "resolved": "https://registry.npmjs.org/core-js/-/core-js-2.5.7.tgz",
+      "integrity": "sha512-RszJCAxg/PP6uzXVXL6BsxSXx/B05oJAQ2vkJRjyjrEcNVycaqOmNb5OTxZPE3xa5gwZduqza6L9JOCenh/Ecw=="
+    },
+    "core-util-is": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz",
+      "integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=",
+      "dev": true
+    },
+    "cors": {
+      "version": "2.8.4",
+      "resolved": "https://registry.npmjs.org/cors/-/cors-2.8.4.tgz",
+      "integrity": "sha1-K9OB8usgECAQXNUOpZ2mMJBpRoY=",
+      "dev": true,
+      "requires": {
+        "object-assign": "4.1.1",
+        "vary": "1.1.2"
+      }
+    },
+    "cosmiconfig": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/cosmiconfig/-/cosmiconfig-4.0.0.tgz",
+      "integrity": "sha512-6e5vDdrXZD+t5v0L8CrurPeybg4Fmf+FCSYxXKYVAqLUtyCSbuyqE059d0kDthTNRzKVjL7QMgNpEUlsoYH3iQ==",
+      "dev": true,
+      "requires": {
+        "is-directory": "0.3.1",
+        "js-yaml": "3.12.0",
+        "parse-json": "4.0.0",
+        "require-from-string": "2.0.2"
+      },
+      "dependencies": {
+        "parse-json": {
+          "version": "4.0.0",
+          "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz",
+          "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=",
+          "dev": true,
+          "requires": {
+            "error-ex": "1.3.2",
+            "json-parse-better-errors": "1.0.2"
+          }
+        }
+      }
+    },
+    "create-ecdh": {
+      "version": "4.0.3",
+      "resolved": "https://registry.npmjs.org/create-ecdh/-/create-ecdh-4.0.3.tgz",
+      "integrity": "sha512-GbEHQPMOswGpKXM9kCWVrremUcBmjteUaQ01T9rkKCPDXfUHX0IoP9LpHYo2NPFampa4e+/pFDc3jQdxrxQLaw==",
+      "dev": true,
+      "requires": {
+        "bn.js": "4.11.8",
+        "elliptic": "6.4.1"
+      }
+    },
+    "create-error-class": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/create-error-class/-/create-error-class-3.0.2.tgz",
+      "integrity": "sha1-Br56vvlHo/FKMP1hBnHUAbyot7Y=",
+      "dev": true,
+      "requires": {
+        "capture-stack-trace": "1.0.1"
+      }
+    },
+    "create-hash": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/create-hash/-/create-hash-1.2.0.tgz",
+      "integrity": "sha512-z00bCGNHDG8mHAkP7CtT1qVu+bFQUPjYq/4Iv3C3kWjTFV10zIjfSoeqXo9Asws8gwSHDGj/hl2u4OGIjapeCg==",
+      "dev": true,
+      "requires": {
+        "cipher-base": "1.0.4",
+        "inherits": "2.0.3",
+        "md5.js": "1.3.4",
+        "ripemd160": "2.0.2",
+        "sha.js": "2.4.11"
+      }
+    },
+    "create-hmac": {
+      "version": "1.1.7",
+      "resolved": "https://registry.npmjs.org/create-hmac/-/create-hmac-1.1.7.tgz",
+      "integrity": "sha512-MJG9liiZ+ogc4TzUwuvbER1JRdgvUFSB5+VR/g5h82fGaIRWMWddtKBHi7/sVhfjQZ6SehlyhvQYrcYkaUIpLg==",
+      "dev": true,
+      "requires": {
+        "cipher-base": "1.0.4",
+        "create-hash": "1.2.0",
+        "inherits": "2.0.3",
+        "ripemd160": "2.0.2",
+        "safe-buffer": "5.1.2",
+        "sha.js": "2.4.11"
+      }
+    },
+    "cross-spawn": {
+      "version": "3.0.1",
+      "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-3.0.1.tgz",
+      "integrity": "sha1-ElYDfsufDF9549bvE14wdwGEuYI=",
+      "dev": true,
+      "requires": {
+        "lru-cache": "4.1.3",
+        "which": "1.3.1"
+      }
+    },
+    "crypto-browserify": {
+      "version": "3.12.0",
+      "resolved": "https://registry.npmjs.org/crypto-browserify/-/crypto-browserify-3.12.0.tgz",
+      "integrity": "sha512-fz4spIh+znjO2VjL+IdhEpRJ3YN6sMzITSBijk6FK2UvTqruSQW+/cCZTSNsMiZNvUeq0CqurF+dAbyiGOY6Wg==",
+      "dev": true,
+      "requires": {
+        "browserify-cipher": "1.0.1",
+        "browserify-sign": "4.0.4",
+        "create-ecdh": "4.0.3",
+        "create-hash": "1.2.0",
+        "create-hmac": "1.1.7",
+        "diffie-hellman": "5.0.3",
+        "inherits": "2.0.3",
+        "pbkdf2": "3.0.16",
+        "public-encrypt": "4.0.2",
+        "randombytes": "2.0.6",
+        "randomfill": "1.0.4"
+      }
+    },
+    "crypto-random-string": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/crypto-random-string/-/crypto-random-string-1.0.0.tgz",
+      "integrity": "sha1-ojD2T1aDEOFJgAmUB5DsmVRbyn4=",
+      "dev": true
+    },
+    "csextends": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/csextends/-/csextends-1.2.0.tgz",
+      "integrity": "sha512-S/8k1bDTJIwuGgQYmsRoE+8P+ohV32WhQ0l4zqrc0XDdxOhjQQD7/wTZwCzoZX53jSX3V/qwjT+OkPTxWQcmjg==",
+      "dev": true
+    },
+    "css-parse": {
+      "version": "1.7.0",
+      "resolved": "https://registry.npmjs.org/css-parse/-/css-parse-1.7.0.tgz",
+      "integrity": "sha1-Mh9s9zeCpv91ERE5D8BeLGV9jJs=",
+      "dev": true
+    },
+    "css-select": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/css-select/-/css-select-1.2.0.tgz",
+      "integrity": "sha1-KzoRBTnFNV8c2NMUYj6HCxIeyFg=",
+      "dev": true,
+      "requires": {
+        "boolbase": "1.0.0",
+        "css-what": "2.1.0",
+        "domutils": "1.5.1",
+        "nth-check": "1.0.1"
+      }
+    },
+    "css-selector-tokenizer": {
+      "version": "0.7.0",
+      "resolved": "https://registry.npmjs.org/css-selector-tokenizer/-/css-selector-tokenizer-0.7.0.tgz",
+      "integrity": "sha1-5piEdK6MlTR3v15+/s/OzNnPTIY=",
+      "dev": true,
+      "requires": {
+        "cssesc": "0.1.0",
+        "fastparse": "1.1.1",
+        "regexpu-core": "1.0.0"
+      }
+    },
+    "css-what": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/css-what/-/css-what-2.1.0.tgz",
+      "integrity": "sha1-lGfQMsOM+u+58teVASUwYvh/ob0=",
+      "dev": true
+    },
+    "cssauron": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/cssauron/-/cssauron-1.4.0.tgz",
+      "integrity": "sha1-pmAt/34EqDBtwNuaVR6S6LVmKtg=",
+      "dev": true,
+      "requires": {
+        "through": "2.3.8"
+      }
+    },
+    "cssesc": {
+      "version": "0.1.0",
+      "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-0.1.0.tgz",
+      "integrity": "sha1-yBSQPkViM3GgR3tAEJqq++6t27Q=",
+      "dev": true
+    },
+    "cuint": {
+      "version": "0.2.2",
+      "resolved": "https://registry.npmjs.org/cuint/-/cuint-0.2.2.tgz",
+      "integrity": "sha1-QICG1AlVDCYxFVYZ6fp7ytw7mRs=",
+      "dev": true
+    },
+    "currently-unhandled": {
+      "version": "0.4.1",
+      "resolved": "https://registry.npmjs.org/currently-unhandled/-/currently-unhandled-0.4.1.tgz",
+      "integrity": "sha1-mI3zP+qxke95mmE2nddsF635V+o=",
+      "dev": true,
+      "requires": {
+        "array-find-index": "1.0.2"
+      }
+    },
+    "custom-event": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/custom-event/-/custom-event-1.0.1.tgz",
+      "integrity": "sha1-XQKkaFCt8bSjF5RqOSj8y1v9BCU=",
+      "dev": true
+    },
+    "cyclist": {
+      "version": "0.2.2",
+      "resolved": "https://registry.npmjs.org/cyclist/-/cyclist-0.2.2.tgz",
+      "integrity": "sha1-GzN5LhHpFKL9bW7WRHRkRE5fpkA=",
+      "dev": true
+    },
+    "d3": {
+      "version": "5.7.0",
+      "resolved": "https://registry.npmjs.org/d3/-/d3-5.7.0.tgz",
+      "integrity": "sha512-8KEIfx+dFm8PlbJN9PI0suazrZ41QcaAufsKE9PRcqYPWLngHIyWJZX96n6IQKePGgeSu0l7rtlueSSNq8Zc3g==",
+      "requires": {
+        "d3-array": "1.2.4",
+        "d3-axis": "1.0.12",
+        "d3-brush": "1.0.6",
+        "d3-chord": "1.0.6",
+        "d3-collection": "1.0.7",
+        "d3-color": "1.2.3",
+        "d3-contour": "1.3.2",
+        "d3-dispatch": "1.0.5",
+        "d3-drag": "1.2.3",
+        "d3-dsv": "1.0.10",
+        "d3-ease": "1.0.5",
+        "d3-fetch": "1.1.2",
+        "d3-force": "1.1.2",
+        "d3-format": "1.3.2",
+        "d3-geo": "1.11.1",
+        "d3-hierarchy": "1.1.8",
+        "d3-interpolate": "1.3.2",
+        "d3-path": "1.0.7",
+        "d3-polygon": "1.0.5",
+        "d3-quadtree": "1.0.5",
+        "d3-random": "1.1.2",
+        "d3-scale": "2.1.2",
+        "d3-scale-chromatic": "1.3.3",
+        "d3-selection": "1.3.2",
+        "d3-shape": "1.2.2",
+        "d3-time": "1.0.10",
+        "d3-time-format": "2.1.3",
+        "d3-timer": "1.0.9",
+        "d3-transition": "1.1.3",
+        "d3-voronoi": "1.1.4",
+        "d3-zoom": "1.7.3"
+      }
+    },
+    "d3-array": {
+      "version": "1.2.4",
+      "resolved": "https://registry.npmjs.org/d3-array/-/d3-array-1.2.4.tgz",
+      "integrity": "sha512-KHW6M86R+FUPYGb3R5XiYjXPq7VzwxZ22buHhAEVG5ztoEcZZMLov530mmccaqA1GghZArjQV46fuc8kUqhhHw=="
+    },
+    "d3-axis": {
+      "version": "1.0.12",
+      "resolved": "https://registry.npmjs.org/d3-axis/-/d3-axis-1.0.12.tgz",
+      "integrity": "sha512-ejINPfPSNdGFKEOAtnBtdkpr24c4d4jsei6Lg98mxf424ivoDP2956/5HDpIAtmHo85lqT4pruy+zEgvRUBqaQ=="
+    },
+    "d3-brush": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/d3-brush/-/d3-brush-1.0.6.tgz",
+      "integrity": "sha512-lGSiF5SoSqO5/mYGD5FAeGKKS62JdA1EV7HPrU2b5rTX4qEJJtpjaGLJngjnkewQy7UnGstnFd3168wpf5z76w==",
+      "requires": {
+        "d3-dispatch": "1.0.5",
+        "d3-drag": "1.2.3",
+        "d3-interpolate": "1.3.2",
+        "d3-selection": "1.3.2",
+        "d3-transition": "1.1.3"
+      }
+    },
+    "d3-chord": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/d3-chord/-/d3-chord-1.0.6.tgz",
+      "integrity": "sha512-JXA2Dro1Fxw9rJe33Uv+Ckr5IrAa74TlfDEhE/jfLOaXegMQFQTAgAw9WnZL8+HxVBRXaRGCkrNU7pJeylRIuA==",
+      "requires": {
+        "d3-array": "1.2.4",
+        "d3-path": "1.0.7"
+      }
+    },
+    "d3-collection": {
+      "version": "1.0.7",
+      "resolved": "https://registry.npmjs.org/d3-collection/-/d3-collection-1.0.7.tgz",
+      "integrity": "sha512-ii0/r5f4sjKNTfh84Di+DpztYwqKhEyUlKoPrzUFfeSkWxjW49xU2QzO9qrPrNkpdI0XJkfzvmTu8V2Zylln6A=="
+    },
+    "d3-color": {
+      "version": "1.2.3",
+      "resolved": "https://registry.npmjs.org/d3-color/-/d3-color-1.2.3.tgz",
+      "integrity": "sha512-x37qq3ChOTLd26hnps36lexMRhNXEtVxZ4B25rL0DVdDsGQIJGB18S7y9XDwlDD6MD/ZBzITCf4JjGMM10TZkw=="
+    },
+    "d3-contour": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/d3-contour/-/d3-contour-1.3.2.tgz",
+      "integrity": "sha512-hoPp4K/rJCu0ladiH6zmJUEz6+u3lgR+GSm/QdM2BBvDraU39Vr7YdDCicJcxP1z8i9B/2dJLgDC1NcvlF8WCg==",
+      "requires": {
+        "d3-array": "1.2.4"
+      }
+    },
+    "d3-dispatch": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/d3-dispatch/-/d3-dispatch-1.0.5.tgz",
+      "integrity": "sha512-vwKx+lAqB1UuCeklr6Jh1bvC4SZgbSqbkGBLClItFBIYH4vqDJCA7qfoy14lXmJdnBOdxndAMxjCbImJYW7e6g=="
+    },
+    "d3-drag": {
+      "version": "1.2.3",
+      "resolved": "https://registry.npmjs.org/d3-drag/-/d3-drag-1.2.3.tgz",
+      "integrity": "sha512-8S3HWCAg+ilzjJsNtWW1Mutl74Nmzhb9yU6igspilaJzeZVFktmY6oO9xOh5TDk+BM2KrNFjttZNoJJmDnkjkg==",
+      "requires": {
+        "d3-dispatch": "1.0.5",
+        "d3-selection": "1.3.2"
+      }
+    },
+    "d3-dsv": {
+      "version": "1.0.10",
+      "resolved": "https://registry.npmjs.org/d3-dsv/-/d3-dsv-1.0.10.tgz",
+      "integrity": "sha512-vqklfpxmtO2ZER3fq/B33R/BIz3A1PV0FaZRuFM8w6jLo7sUX1BZDh73fPlr0s327rzq4H6EN1q9U+eCBCSN8g==",
+      "requires": {
+        "commander": "2.17.1",
+        "iconv-lite": "0.4.19",
+        "rw": "1.3.3"
+      }
+    },
+    "d3-ease": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/d3-ease/-/d3-ease-1.0.5.tgz",
+      "integrity": "sha512-Ct1O//ly5y5lFM9YTdu+ygq7LleSgSE4oj7vUt9tPLHUi8VCV7QoizGpdWRWAwCO9LdYzIrQDg97+hGVdsSGPQ=="
+    },
+    "d3-fetch": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/d3-fetch/-/d3-fetch-1.1.2.tgz",
+      "integrity": "sha512-S2loaQCV/ZeyTyIF2oP8D1K9Z4QizUzW7cWeAOAS4U88qOt3Ucf6GsmgthuYSdyB2HyEm4CeGvkQxWsmInsIVA==",
+      "requires": {
+        "d3-dsv": "1.0.10"
+      }
+    },
+    "d3-force": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/d3-force/-/d3-force-1.1.2.tgz",
+      "integrity": "sha512-p1vcHAUF1qH7yR+e8ip7Bs61AHjLeKkIn8Z2gzwU2lwEf2wkSpWdjXG0axudTHsVFnYGlMkFaEsVy2l8tAg1Gw==",
+      "requires": {
+        "d3-collection": "1.0.7",
+        "d3-dispatch": "1.0.5",
+        "d3-quadtree": "1.0.5",
+        "d3-timer": "1.0.9"
+      }
+    },
+    "d3-format": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/d3-format/-/d3-format-1.3.2.tgz",
+      "integrity": "sha512-Z18Dprj96ExragQ0DeGi+SYPQ7pPfRMtUXtsg/ChVIKNBCzjO8XYJvRTC1usblx52lqge56V5ect+frYTQc8WQ=="
+    },
+    "d3-geo": {
+      "version": "1.11.1",
+      "resolved": "https://registry.npmjs.org/d3-geo/-/d3-geo-1.11.1.tgz",
+      "integrity": "sha512-GsG7x9G9sykseLviOVSJ3h5yjw0ItLopOtuDQKUt1TRklEegCw5WAmnIpYYiCkSH/QgUMleAeE2xZK38Qb+1+Q==",
+      "requires": {
+        "d3-array": "1.2.4"
+      }
+    },
+    "d3-hierarchy": {
+      "version": "1.1.8",
+      "resolved": "https://registry.npmjs.org/d3-hierarchy/-/d3-hierarchy-1.1.8.tgz",
+      "integrity": "sha512-L+GHMSZNwTpiq4rt9GEsNcpLa4M96lXMR8M/nMG9p5hBE0jy6C+3hWtyZMenPQdwla249iJy7Nx0uKt3n+u9+w=="
+    },
+    "d3-interpolate": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/d3-interpolate/-/d3-interpolate-1.3.2.tgz",
+      "integrity": "sha512-NlNKGopqaz9qM1PXh9gBF1KSCVh+jSFErrSlD/4hybwoNX/gt1d8CDbDW+3i+5UOHhjC6s6nMvRxcuoMVNgL2w==",
+      "requires": {
+        "d3-color": "1.2.3"
+      }
+    },
+    "d3-path": {
+      "version": "1.0.7",
+      "resolved": "https://registry.npmjs.org/d3-path/-/d3-path-1.0.7.tgz",
+      "integrity": "sha512-q0cW1RpvA5c5ma2rch62mX8AYaiLX0+bdaSM2wxSU9tXjU4DNvkx9qiUvjkuWCj3p22UO/hlPivujqMiR9PDzA=="
+    },
+    "d3-polygon": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/d3-polygon/-/d3-polygon-1.0.5.tgz",
+      "integrity": "sha512-RHhh1ZUJZfhgoqzWWuRhzQJvO7LavchhitSTHGu9oj6uuLFzYZVeBzaWTQ2qSO6bz2w55RMoOCf0MsLCDB6e0w=="
+    },
+    "d3-quadtree": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/d3-quadtree/-/d3-quadtree-1.0.5.tgz",
+      "integrity": "sha512-U2tjwDFbZ75JRAg8A+cqMvqPg1G3BE7UTJn3h8DHjY/pnsAfWdbJKgyfcy7zKjqGtLAmI0q8aDSeG1TVIKRaHQ=="
+    },
+    "d3-random": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/d3-random/-/d3-random-1.1.2.tgz",
+      "integrity": "sha512-6AK5BNpIFqP+cx/sreKzNjWbwZQCSUatxq+pPRmFIQaWuoD+NrbVWw7YWpHiXpCQ/NanKdtGDuB+VQcZDaEmYQ=="
+    },
+    "d3-scale": {
+      "version": "2.1.2",
+      "resolved": "https://registry.npmjs.org/d3-scale/-/d3-scale-2.1.2.tgz",
+      "integrity": "sha512-bESpd64ylaKzCDzvULcmHKZTlzA/6DGSVwx7QSDj/EnX9cpSevsdiwdHFYI9ouo9tNBbV3v5xztHS2uFeOzh8Q==",
+      "requires": {
+        "d3-array": "1.2.4",
+        "d3-collection": "1.0.7",
+        "d3-format": "1.3.2",
+        "d3-interpolate": "1.3.2",
+        "d3-time": "1.0.10",
+        "d3-time-format": "2.1.3"
+      }
+    },
+    "d3-scale-chromatic": {
+      "version": "1.3.3",
+      "resolved": "https://registry.npmjs.org/d3-scale-chromatic/-/d3-scale-chromatic-1.3.3.tgz",
+      "integrity": "sha512-BWTipif1CimXcYfT02LKjAyItX5gKiwxuPRgr4xM58JwlLocWbjPLI7aMEjkcoOQXMkYsmNsvv3d2yl/OKuHHw==",
+      "requires": {
+        "d3-color": "1.2.3",
+        "d3-interpolate": "1.3.2"
+      }
+    },
+    "d3-selection": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/d3-selection/-/d3-selection-1.3.2.tgz",
+      "integrity": "sha512-OoXdv1nZ7h2aKMVg3kaUFbLLK5jXUFAMLD/Tu5JA96mjf8f2a9ZUESGY+C36t8R1WFeWk/e55hy54Ml2I62CRQ=="
+    },
+    "d3-shape": {
+      "version": "1.2.2",
+      "resolved": "https://registry.npmjs.org/d3-shape/-/d3-shape-1.2.2.tgz",
+      "integrity": "sha512-hUGEozlKecFZ2bOSNt7ENex+4Tk9uc/m0TtTEHBvitCBxUNjhzm5hS2GrrVRD/ae4IylSmxGeqX5tWC2rASMlQ==",
+      "requires": {
+        "d3-path": "1.0.7"
+      }
+    },
+    "d3-time": {
+      "version": "1.0.10",
+      "resolved": "https://registry.npmjs.org/d3-time/-/d3-time-1.0.10.tgz",
+      "integrity": "sha512-hF+NTLCaJHF/JqHN5hE8HVGAXPStEq6/omumPE/SxyHVrR7/qQxusFDo0t0c/44+sCGHthC7yNGFZIEgju0P8g=="
+    },
+    "d3-time-format": {
+      "version": "2.1.3",
+      "resolved": "https://registry.npmjs.org/d3-time-format/-/d3-time-format-2.1.3.tgz",
+      "integrity": "sha512-6k0a2rZryzGm5Ihx+aFMuO1GgelgIz+7HhB4PH4OEndD5q2zGn1mDfRdNrulspOfR6JXkb2sThhDK41CSK85QA==",
+      "requires": {
+        "d3-time": "1.0.10"
+      }
+    },
+    "d3-timer": {
+      "version": "1.0.9",
+      "resolved": "https://registry.npmjs.org/d3-timer/-/d3-timer-1.0.9.tgz",
+      "integrity": "sha512-rT34J5HnQUHhcLvhSB9GjCkN0Ddd5Y8nCwDBG2u6wQEeYxT/Lf51fTFFkldeib/sE/J0clIe0pnCfs6g/lRbyg=="
+    },
+    "d3-transition": {
+      "version": "1.1.3",
+      "resolved": "https://registry.npmjs.org/d3-transition/-/d3-transition-1.1.3.tgz",
+      "integrity": "sha512-tEvo3qOXL6pZ1EzcXxFcPNxC/Ygivu5NoBY6mbzidATAeML86da+JfVIUzon3dNM6UX6zjDx+xbYDmMVtTSjuA==",
+      "requires": {
+        "d3-color": "1.2.3",
+        "d3-dispatch": "1.0.5",
+        "d3-ease": "1.0.5",
+        "d3-interpolate": "1.3.2",
+        "d3-selection": "1.3.2",
+        "d3-timer": "1.0.9"
+      }
+    },
+    "d3-voronoi": {
+      "version": "1.1.4",
+      "resolved": "https://registry.npmjs.org/d3-voronoi/-/d3-voronoi-1.1.4.tgz",
+      "integrity": "sha512-dArJ32hchFsrQ8uMiTBLq256MpnZjeuBtdHpaDlYuQyjU0CVzCJl/BVW+SkszaAeH95D/8gxqAhgx0ouAWAfRg=="
+    },
+    "d3-zoom": {
+      "version": "1.7.3",
+      "resolved": "https://registry.npmjs.org/d3-zoom/-/d3-zoom-1.7.3.tgz",
+      "integrity": "sha512-xEBSwFx5Z9T3/VrwDkMt+mr0HCzv7XjpGURJ8lWmIC8wxe32L39eWHIasEe/e7Ox8MPU4p1hvH8PKN2olLzIBg==",
+      "requires": {
+        "d3-dispatch": "1.0.5",
+        "d3-drag": "1.2.3",
+        "d3-interpolate": "1.3.2",
+        "d3-selection": "1.3.2",
+        "d3-transition": "1.1.3"
+      }
+    },
+    "dashdash": {
+      "version": "1.14.1",
+      "resolved": "https://registry.npmjs.org/dashdash/-/dashdash-1.14.1.tgz",
+      "integrity": "sha1-hTz6D3y+L+1d4gMmuN1YEDX24vA=",
+      "dev": true,
+      "requires": {
+        "assert-plus": "1.0.0"
+      }
+    },
+    "date-now": {
+      "version": "0.1.4",
+      "resolved": "https://registry.npmjs.org/date-now/-/date-now-0.1.4.tgz",
+      "integrity": "sha1-6vQ5/U1ISK105cx9vvIAZyueNFs=",
+      "dev": true
+    },
+    "debug": {
+      "version": "2.6.9",
+      "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
+      "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+      "dev": true,
+      "requires": {
+        "ms": "2.0.0"
+      }
+    },
+    "decamelize": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz",
+      "integrity": "sha1-9lNNFRSCabIDUue+4m9QH5oZEpA=",
+      "dev": true
+    },
+    "decode-uri-component": {
+      "version": "0.2.0",
+      "resolved": "https://registry.npmjs.org/decode-uri-component/-/decode-uri-component-0.2.0.tgz",
+      "integrity": "sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU=",
+      "dev": true
+    },
+    "deep-equal": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/deep-equal/-/deep-equal-1.0.1.tgz",
+      "integrity": "sha1-9dJgKStmDghO/0zbyfCK0yR0SLU=",
+      "dev": true
+    },
+    "deep-extend": {
+      "version": "0.6.0",
+      "resolved": "https://registry.npmjs.org/deep-extend/-/deep-extend-0.6.0.tgz",
+      "integrity": "sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==",
+      "dev": true
+    },
+    "deep-is": {
+      "version": "0.1.3",
+      "resolved": "https://registry.npmjs.org/deep-is/-/deep-is-0.1.3.tgz",
+      "integrity": "sha1-s2nW+128E+7PUk+RsHD+7cNXzzQ=",
+      "dev": true
+    },
+    "default-gateway": {
+      "version": "2.7.2",
+      "resolved": "https://registry.npmjs.org/default-gateway/-/default-gateway-2.7.2.tgz",
+      "integrity": "sha512-lAc4i9QJR0YHSDFdzeBQKfZ1SRDG3hsJNEkrpcZa8QhBfidLAilT60BDEIVUUGqosFp425KOgB3uYqcnQrWafQ==",
+      "dev": true,
+      "requires": {
+        "execa": "0.10.0",
+        "ip-regex": "2.1.0"
+      }
+    },
+    "default-require-extensions": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/default-require-extensions/-/default-require-extensions-1.0.0.tgz",
+      "integrity": "sha1-836hXT4T/9m0N9M+GnW1+5eHTLg=",
+      "dev": true,
+      "requires": {
+        "strip-bom": "2.0.0"
+      }
+    },
+    "define-properties": {
+      "version": "1.1.3",
+      "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.1.3.tgz",
+      "integrity": "sha512-3MqfYKj2lLzdMSf8ZIZE/V+Zuy+BgD6f164e8K2w7dgnpKArBDerGYpM46IYYcjnkdPNMjPk9A6VFB8+3SKlXQ==",
+      "dev": true,
+      "requires": {
+        "object-keys": "1.0.12"
+      }
+    },
+    "define-property": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/define-property/-/define-property-2.0.2.tgz",
+      "integrity": "sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ==",
+      "dev": true,
+      "requires": {
+        "is-descriptor": "1.0.2",
+        "isobject": "3.0.1"
+      },
+      "dependencies": {
+        "is-accessor-descriptor": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
+          "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
+          "dev": true,
+          "requires": {
+            "kind-of": "6.0.2"
+          }
+        },
+        "is-data-descriptor": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
+          "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
+          "dev": true,
+          "requires": {
+            "kind-of": "6.0.2"
+          }
+        },
+        "is-descriptor": {
+          "version": "1.0.2",
+          "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
+          "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
+          "dev": true,
+          "requires": {
+            "is-accessor-descriptor": "1.0.0",
+            "is-data-descriptor": "1.0.0",
+            "kind-of": "6.0.2"
+          }
+        }
+      }
+    },
+    "del": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/del/-/del-3.0.0.tgz",
+      "integrity": "sha1-U+z2mf/LyzljdpGrE7rxYIGXZuU=",
+      "dev": true,
+      "requires": {
+        "globby": "6.1.0",
+        "is-path-cwd": "1.0.0",
+        "is-path-in-cwd": "1.0.1",
+        "p-map": "1.2.0",
+        "pify": "3.0.0",
+        "rimraf": "2.6.2"
+      },
+      "dependencies": {
+        "globby": {
+          "version": "6.1.0",
+          "resolved": "https://registry.npmjs.org/globby/-/globby-6.1.0.tgz",
+          "integrity": "sha1-9abXDoOV4hyFj7BInWTfAkJNUGw=",
+          "dev": true,
+          "requires": {
+            "array-union": "1.0.2",
+            "glob": "7.1.3",
+            "object-assign": "4.1.1",
+            "pify": "2.3.0",
+            "pinkie-promise": "2.0.1"
+          },
+          "dependencies": {
+            "pify": {
+              "version": "2.3.0",
+              "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+              "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=",
+              "dev": true
+            }
+          }
+        }
+      }
+    },
+    "delayed-stream": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz",
+      "integrity": "sha1-3zrhmayt+31ECqrgsp4icrJOxhk=",
+      "dev": true
+    },
+    "delegates": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/delegates/-/delegates-1.0.0.tgz",
+      "integrity": "sha1-hMbhWbgZBP3KWaDvRM2HDTElD5o=",
+      "dev": true
+    },
+    "depd": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz",
+      "integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=",
+      "dev": true
+    },
+    "des.js": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/des.js/-/des.js-1.0.0.tgz",
+      "integrity": "sha1-wHTS4qpqipoH29YfmhXCzYPsjsw=",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3",
+        "minimalistic-assert": "1.0.1"
+      }
+    },
+    "destroy": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.4.tgz",
+      "integrity": "sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA=",
+      "dev": true
+    },
+    "detect-indent": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/detect-indent/-/detect-indent-4.0.0.tgz",
+      "integrity": "sha1-920GQ1LN9Docts5hnE7jqUdd4gg=",
+      "dev": true,
+      "requires": {
+        "repeating": "2.0.1"
+      }
+    },
+    "detect-node": {
+      "version": "2.0.4",
+      "resolved": "https://registry.npmjs.org/detect-node/-/detect-node-2.0.4.tgz",
+      "integrity": "sha512-ZIzRpLJrOj7jjP2miAtgqIfmzbxa4ZOr5jJc601zklsfEx9oTzmmj2nVpIPRpNlRTIh8lc1kyViIY7BWSGNmKw==",
+      "dev": true
+    },
+    "di": {
+      "version": "0.0.1",
+      "resolved": "https://registry.npmjs.org/di/-/di-0.0.1.tgz",
+      "integrity": "sha1-gGZJMmzqp8qjMG112YXqJ0i6kTw=",
+      "dev": true
+    },
+    "diff": {
+      "version": "3.5.0",
+      "resolved": "https://registry.npmjs.org/diff/-/diff-3.5.0.tgz",
+      "integrity": "sha512-A46qtFgd+g7pDZinpnwiRJtxbC1hpgf0uzP3iG89scHk0AUC7A1TGxf5OiiOUv/JMZR8GOt8hL900hV0bOy5xA==",
+      "dev": true
+    },
+    "diffie-hellman": {
+      "version": "5.0.3",
+      "resolved": "https://registry.npmjs.org/diffie-hellman/-/diffie-hellman-5.0.3.tgz",
+      "integrity": "sha512-kqag/Nl+f3GwyK25fhUMYj81BUOrZ9IuJsjIcDE5icNM9FJHAVm3VcUDxdLPoQtTuUylWm6ZIknYJwwaPxsUzg==",
+      "dev": true,
+      "requires": {
+        "bn.js": "4.11.8",
+        "miller-rabin": "4.0.1",
+        "randombytes": "2.0.6"
+      }
+    },
+    "dir-glob": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/dir-glob/-/dir-glob-2.0.0.tgz",
+      "integrity": "sha512-37qirFDz8cA5fimp9feo43fSuRo2gHwaIn6dXL8Ber1dGwUosDrGZeCCXq57WnIqE4aQ+u3eQZzsk1yOzhdwag==",
+      "dev": true,
+      "requires": {
+        "arrify": "1.0.1",
+        "path-type": "3.0.0"
+      }
+    },
+    "dns-equal": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/dns-equal/-/dns-equal-1.0.0.tgz",
+      "integrity": "sha1-s55/HabrCnW6nBcySzR1PEfgZU0=",
+      "dev": true
+    },
+    "dns-packet": {
+      "version": "1.3.1",
+      "resolved": "https://registry.npmjs.org/dns-packet/-/dns-packet-1.3.1.tgz",
+      "integrity": "sha512-0UxfQkMhYAUaZI+xrNZOz/as5KgDU0M/fQ9b6SpkyLbk3GEswDi6PADJVaYJradtRVsRIlF1zLyOodbcTCDzUg==",
+      "dev": true,
+      "requires": {
+        "ip": "1.1.5",
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "dns-txt": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/dns-txt/-/dns-txt-2.0.2.tgz",
+      "integrity": "sha1-uR2Ab10nGI5Ks+fRB9iBocxGQrY=",
+      "dev": true,
+      "requires": {
+        "buffer-indexof": "1.1.1"
+      }
+    },
+    "dom-converter": {
+      "version": "0.1.4",
+      "resolved": "https://registry.npmjs.org/dom-converter/-/dom-converter-0.1.4.tgz",
+      "integrity": "sha1-pF71cnuJDJv/5tfIduexnLDhfzs=",
+      "dev": true,
+      "requires": {
+        "utila": "0.3.3"
+      },
+      "dependencies": {
+        "utila": {
+          "version": "0.3.3",
+          "resolved": "https://registry.npmjs.org/utila/-/utila-0.3.3.tgz",
+          "integrity": "sha1-1+jn1+MJEHCSsF+NloiCTWM6QiY=",
+          "dev": true
+        }
+      }
+    },
+    "dom-serialize": {
+      "version": "2.2.1",
+      "resolved": "https://registry.npmjs.org/dom-serialize/-/dom-serialize-2.2.1.tgz",
+      "integrity": "sha1-ViromZ9Evl6jB29UGdzVnrQ6yVs=",
+      "dev": true,
+      "requires": {
+        "custom-event": "1.0.1",
+        "ent": "2.2.0",
+        "extend": "3.0.2",
+        "void-elements": "2.0.1"
+      }
+    },
+    "dom-serializer": {
+      "version": "0.1.0",
+      "resolved": "https://registry.npmjs.org/dom-serializer/-/dom-serializer-0.1.0.tgz",
+      "integrity": "sha1-BzxpdUbOB4DOI75KKOKT5AvDDII=",
+      "dev": true,
+      "requires": {
+        "domelementtype": "1.1.3",
+        "entities": "1.1.1"
+      },
+      "dependencies": {
+        "domelementtype": {
+          "version": "1.1.3",
+          "resolved": "https://registry.npmjs.org/domelementtype/-/domelementtype-1.1.3.tgz",
+          "integrity": "sha1-vSh3PiZCiBrsUVRJJCmcXNgiGFs=",
+          "dev": true
+        }
+      }
+    },
+    "domain-browser": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/domain-browser/-/domain-browser-1.2.0.tgz",
+      "integrity": "sha512-jnjyiM6eRyZl2H+W8Q/zLMA481hzi0eszAaBUzIVnmYVDBbnLxVNnfu1HgEBvCbL+71FrxMl3E6lpKH7Ge3OXA==",
+      "dev": true
+    },
+    "domelementtype": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/domelementtype/-/domelementtype-1.3.0.tgz",
+      "integrity": "sha1-sXrtguirWeUt2cGbF1bg/BhyBMI=",
+      "dev": true
+    },
+    "domhandler": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/domhandler/-/domhandler-2.1.0.tgz",
+      "integrity": "sha1-0mRvXlf2w7qxHPbLBdPArPdBJZQ=",
+      "dev": true,
+      "requires": {
+        "domelementtype": "1.3.0"
+      }
+    },
+    "domutils": {
+      "version": "1.5.1",
+      "resolved": "https://registry.npmjs.org/domutils/-/domutils-1.5.1.tgz",
+      "integrity": "sha1-3NhIiib1Y9YQeeSMn3t+Mjc2gs8=",
+      "dev": true,
+      "requires": {
+        "dom-serializer": "0.1.0",
+        "domelementtype": "1.3.0"
+      }
+    },
+    "dot": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/dot/-/dot-1.1.2.tgz",
+      "integrity": "sha1-xzdwGfxOVQeYkosrmv62ar+h8vk=",
+      "dev": true
+    },
+    "dot-prop": {
+      "version": "4.2.0",
+      "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-4.2.0.tgz",
+      "integrity": "sha512-tUMXrxlExSW6U2EXiiKGSBVdYgtV8qlHL+C10TsW4PURY/ic+eaysnSkwB4kA/mBlCyy/IKDJ+Lc3wbWeaXtuQ==",
+      "dev": true,
+      "requires": {
+        "is-obj": "1.0.1"
+      }
+    },
+    "duplexer": {
+      "version": "0.1.1",
+      "resolved": "https://registry.npmjs.org/duplexer/-/duplexer-0.1.1.tgz",
+      "integrity": "sha1-rOb/gIwc5mtX0ev5eXessCM0z8E=",
+      "dev": true
+    },
+    "duplexer3": {
+      "version": "0.1.4",
+      "resolved": "https://registry.npmjs.org/duplexer3/-/duplexer3-0.1.4.tgz",
+      "integrity": "sha1-7gHdHKwO08vH/b6jfcCo8c4ALOI=",
+      "dev": true
+    },
+    "duplexify": {
+      "version": "3.6.0",
+      "resolved": "https://registry.npmjs.org/duplexify/-/duplexify-3.6.0.tgz",
+      "integrity": "sha512-fO3Di4tBKJpYTFHAxTU00BcfWMY9w24r/x21a6rZRbsD/ToUgGxsMbiGRmB7uVAXeGKXD9MwiLZa5E97EVgIRQ==",
+      "dev": true,
+      "requires": {
+        "end-of-stream": "1.4.1",
+        "inherits": "2.0.3",
+        "readable-stream": "2.3.6",
+        "stream-shift": "1.0.0"
+      }
+    },
+    "eachr": {
+      "version": "3.2.0",
+      "resolved": "https://registry.npmjs.org/eachr/-/eachr-3.2.0.tgz",
+      "integrity": "sha1-LDXkPqCGUW95l8+At6pk1VpKRIQ=",
+      "dev": true,
+      "requires": {
+        "editions": "1.3.4",
+        "typechecker": "4.5.0"
+      }
+    },
+    "ecc-jsbn": {
+      "version": "0.1.2",
+      "resolved": "https://registry.npmjs.org/ecc-jsbn/-/ecc-jsbn-0.1.2.tgz",
+      "integrity": "sha1-OoOpBOVDUyh4dMVkt1SThoSamMk=",
+      "dev": true,
+      "optional": true,
+      "requires": {
+        "jsbn": "0.1.1",
+        "safer-buffer": "2.1.2"
+      }
+    },
+    "editions": {
+      "version": "1.3.4",
+      "resolved": "https://registry.npmjs.org/editions/-/editions-1.3.4.tgz",
+      "integrity": "sha512-gzao+mxnYDzIysXKMQi/+M1mjy/rjestjg6OPoYTtI+3Izp23oiGZitsl9lPDPiTGXbcSIk1iJWhliSaglxnUg==",
+      "dev": true
+    },
+    "ee-first": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz",
+      "integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=",
+      "dev": true
+    },
+    "ejs": {
+      "version": "2.6.1",
+      "resolved": "https://registry.npmjs.org/ejs/-/ejs-2.6.1.tgz",
+      "integrity": "sha512-0xy4A/twfrRCnkhfk8ErDi5DqdAsAqeGxht4xkCUrsvhhbQNs7E+4jV0CN7+NKIY0aHE72+XvqtBIXzD31ZbXQ==",
+      "dev": true
+    },
+    "electron-to-chromium": {
+      "version": "1.3.63",
+      "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.3.63.tgz",
+      "integrity": "sha512-Ec35NNY040HKuSxMAzBMgz/uUI78amSWpBUD9x2gN7R7gkb/wgAcClngWklcLP0/lm/g0UUYHnC/tUIlZj8UvQ==",
+      "dev": true
+    },
+    "elliptic": {
+      "version": "6.4.1",
+      "resolved": "https://registry.npmjs.org/elliptic/-/elliptic-6.4.1.tgz",
+      "integrity": "sha512-BsXLz5sqX8OHcsh7CqBMztyXARmGQ3LWPtGjJi6DiJHq5C/qvi9P3OqgswKSDftbu8+IoI/QDTAm2fFnQ9SZSQ==",
+      "dev": true,
+      "requires": {
+        "bn.js": "4.11.8",
+        "brorand": "1.1.0",
+        "hash.js": "1.1.5",
+        "hmac-drbg": "1.0.1",
+        "inherits": "2.0.3",
+        "minimalistic-assert": "1.0.1",
+        "minimalistic-crypto-utils": "1.0.1"
+      }
+    },
+    "emojis-list": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/emojis-list/-/emojis-list-2.1.0.tgz",
+      "integrity": "sha1-TapNnbAPmBmIDHn6RXrlsJof04k=",
+      "dev": true
+    },
+    "encodeurl": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz",
+      "integrity": "sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k=",
+      "dev": true
+    },
+    "end-of-stream": {
+      "version": "1.4.1",
+      "resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.1.tgz",
+      "integrity": "sha512-1MkrZNvWTKCaigbn+W15elq2BB/L22nqrSY5DKlo3X6+vclJm8Bb5djXJBmEX6fS3+zCh/F4VBK5Z2KxJt4s2Q==",
+      "dev": true,
+      "requires": {
+        "once": "1.4.0"
+      }
+    },
+    "engine.io": {
+      "version": "1.8.3",
+      "resolved": "https://registry.npmjs.org/engine.io/-/engine.io-1.8.3.tgz",
+      "integrity": "sha1-jef5eJXSDTm4X4ju7nd7K9QrE9Q=",
+      "dev": true,
+      "requires": {
+        "accepts": "1.3.3",
+        "base64id": "1.0.0",
+        "cookie": "0.3.1",
+        "debug": "2.3.3",
+        "engine.io-parser": "1.3.2",
+        "ws": "1.1.2"
+      },
+      "dependencies": {
+        "accepts": {
+          "version": "1.3.3",
+          "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.3.tgz",
+          "integrity": "sha1-w8p0NJOGSMPg2cHjKN1otiLChMo=",
+          "dev": true,
+          "requires": {
+            "mime-types": "2.1.20",
+            "negotiator": "0.6.1"
+          }
+        },
+        "debug": {
+          "version": "2.3.3",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-2.3.3.tgz",
+          "integrity": "sha1-QMRT5n5uE8kB3ewxeviYbNqe/4w=",
+          "dev": true,
+          "requires": {
+            "ms": "0.7.2"
+          }
+        },
+        "ms": {
+          "version": "0.7.2",
+          "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
+          "integrity": "sha1-riXPJRKziFodldfwN4aNhDESR2U=",
+          "dev": true
+        }
+      }
+    },
+    "engine.io-client": {
+      "version": "1.8.3",
+      "resolved": "https://registry.npmjs.org/engine.io-client/-/engine.io-client-1.8.3.tgz",
+      "integrity": "sha1-F5jtk0USRkU9TG9jXXogH+lA1as=",
+      "dev": true,
+      "requires": {
+        "component-emitter": "1.2.1",
+        "component-inherit": "0.0.3",
+        "debug": "2.3.3",
+        "engine.io-parser": "1.3.2",
+        "has-cors": "1.1.0",
+        "indexof": "0.0.1",
+        "parsejson": "0.0.3",
+        "parseqs": "0.0.5",
+        "parseuri": "0.0.5",
+        "ws": "1.1.2",
+        "xmlhttprequest-ssl": "1.5.3",
+        "yeast": "0.1.2"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "2.3.3",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-2.3.3.tgz",
+          "integrity": "sha1-QMRT5n5uE8kB3ewxeviYbNqe/4w=",
+          "dev": true,
+          "requires": {
+            "ms": "0.7.2"
+          }
+        },
+        "ms": {
+          "version": "0.7.2",
+          "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
+          "integrity": "sha1-riXPJRKziFodldfwN4aNhDESR2U=",
+          "dev": true
+        }
+      }
+    },
+    "engine.io-parser": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/engine.io-parser/-/engine.io-parser-1.3.2.tgz",
+      "integrity": "sha1-k3sHnwAH0Ik+xW1GyyILjLQ1Igo=",
+      "dev": true,
+      "requires": {
+        "after": "0.8.2",
+        "arraybuffer.slice": "0.0.6",
+        "base64-arraybuffer": "0.1.5",
+        "blob": "0.0.4",
+        "has-binary": "0.1.7",
+        "wtf-8": "1.0.0"
+      }
+    },
+    "enhanced-resolve": {
+      "version": "4.1.0",
+      "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-4.1.0.tgz",
+      "integrity": "sha512-F/7vkyTtyc/llOIn8oWclcB25KdRaiPBpZYDgJHgh/UHtpgT2p2eldQgtQnLtUvfMKPKxbRaQM/hHkvLHt1Vng==",
+      "dev": true,
+      "requires": {
+        "graceful-fs": "4.1.11",
+        "memory-fs": "0.4.1",
+        "tapable": "1.0.0"
+      }
+    },
+    "ent": {
+      "version": "2.2.0",
+      "resolved": "https://registry.npmjs.org/ent/-/ent-2.2.0.tgz",
+      "integrity": "sha1-6WQhkyWiHQX0RGai9obtbOX13R0=",
+      "dev": true
+    },
+    "entities": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/entities/-/entities-1.1.1.tgz",
+      "integrity": "sha1-blwtClYhtdra7O+AuQ7ftc13cvA=",
+      "dev": true
+    },
+    "errlop": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/errlop/-/errlop-1.0.3.tgz",
+      "integrity": "sha512-5VTnt0yikY4LlQEfCXVSqfE6oLj1HVM4zVSvAKMnoYjL/zrb6nqiLowZS4XlG7xENfyj7lpYWvT+wfSCr6dtlA==",
+      "dev": true,
+      "requires": {
+        "editions": "1.3.4"
+      }
+    },
+    "errno": {
+      "version": "0.1.7",
+      "resolved": "https://registry.npmjs.org/errno/-/errno-0.1.7.tgz",
+      "integrity": "sha512-MfrRBDWzIWifgq6tJj60gkAwtLNb6sQPlcFrSOflcP1aFmmruKQ2wRnze/8V6kgyz7H3FF8Npzv78mZ7XLLflg==",
+      "dev": true,
+      "requires": {
+        "prr": "1.0.1"
+      }
+    },
+    "error-ex": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/error-ex/-/error-ex-1.3.2.tgz",
+      "integrity": "sha512-7dFHNmqeFSEt2ZBsCriorKnn3Z2pj+fd9kmI6QoWw4//DL+icEBfc0U7qJCisqrTsKTjw4fNFy2pW9OqStD84g==",
+      "dev": true,
+      "requires": {
+        "is-arrayish": "0.2.1"
+      }
+    },
+    "es-abstract": {
+      "version": "1.12.0",
+      "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.12.0.tgz",
+      "integrity": "sha512-C8Fx/0jFmV5IPoMOFPA9P9G5NtqW+4cOPit3MIuvR2t7Ag2K15EJTpxnHAYTzL+aYQJIESYeXZmDBfOBE1HcpA==",
+      "dev": true,
+      "requires": {
+        "es-to-primitive": "1.1.1",
+        "function-bind": "1.1.1",
+        "has": "1.0.3",
+        "is-callable": "1.1.4",
+        "is-regex": "1.0.4"
+      }
+    },
+    "es-to-primitive": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.1.1.tgz",
+      "integrity": "sha1-RTVSSKiJeQNLZ5Lhm7gfK3l13Q0=",
+      "dev": true,
+      "requires": {
+        "is-callable": "1.1.4",
+        "is-date-object": "1.0.1",
+        "is-symbol": "1.0.1"
+      }
+    },
+    "es6-promise": {
+      "version": "4.2.4",
+      "resolved": "https://registry.npmjs.org/es6-promise/-/es6-promise-4.2.4.tgz",
+      "integrity": "sha512-/NdNZVJg+uZgtm9eS3O6lrOLYmQag2DjdEXuPaHlZ6RuVqgqaVZfgYCepEIKsLqwdQArOPtC3XzRLqGGfT8KQQ==",
+      "dev": true
+    },
+    "es6-promisify": {
+      "version": "5.0.0",
+      "resolved": "https://registry.npmjs.org/es6-promisify/-/es6-promisify-5.0.0.tgz",
+      "integrity": "sha1-UQnWLz5W6pZ8S2NQWu8IKRyKUgM=",
+      "dev": true,
+      "requires": {
+        "es6-promise": "4.2.4"
+      }
+    },
+    "escape-html": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz",
+      "integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=",
+      "dev": true
+    },
+    "escape-string-regexp": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz",
+      "integrity": "sha1-G2HAViGQqN/2rjuyzwIAyhMLhtQ=",
+      "dev": true
+    },
+    "escodegen": {
+      "version": "1.8.1",
+      "resolved": "https://registry.npmjs.org/escodegen/-/escodegen-1.8.1.tgz",
+      "integrity": "sha1-WltTr0aTEQvrsIZ6o0MN07cKEBg=",
+      "dev": true,
+      "requires": {
+        "esprima": "2.7.3",
+        "estraverse": "1.9.3",
+        "esutils": "2.0.2",
+        "optionator": "0.8.2",
+        "source-map": "0.2.0"
+      },
+      "dependencies": {
+        "source-map": {
+          "version": "0.2.0",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.2.0.tgz",
+          "integrity": "sha1-2rc/vPwrqBm03gO9b26qSBZLP50=",
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "amdefine": "1.0.1"
+          }
+        }
+      }
+    },
+    "eslint-scope": {
+      "version": "3.7.3",
+      "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-3.7.3.tgz",
+      "integrity": "sha512-W+B0SvF4gamyCTmUc+uITPY0989iXVfKvhwtmJocTaYoc/3khEHmEmvfY/Gn9HA9VV75jrQECsHizkNw1b68FA==",
+      "dev": true,
+      "requires": {
+        "esrecurse": "4.2.1",
+        "estraverse": "4.2.0"
+      },
+      "dependencies": {
+        "estraverse": {
+          "version": "4.2.0",
+          "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-4.2.0.tgz",
+          "integrity": "sha1-De4/7TH81GlhjOc0IJn8GvoL2xM=",
+          "dev": true
+        }
+      }
+    },
+    "esprima": {
+      "version": "2.7.3",
+      "resolved": "https://registry.npmjs.org/esprima/-/esprima-2.7.3.tgz",
+      "integrity": "sha1-luO3DVd59q1JzQMmc9HDEnZ7pYE=",
+      "dev": true
+    },
+    "esrecurse": {
+      "version": "4.2.1",
+      "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.2.1.tgz",
+      "integrity": "sha512-64RBB++fIOAXPw3P9cy89qfMlvZEXZkqqJkjqqXIvzP5ezRZjW+lPWjw35UX/3EhUPFYbg5ER4JYgDw4007/DQ==",
+      "dev": true,
+      "requires": {
+        "estraverse": "4.2.0"
+      },
+      "dependencies": {
+        "estraverse": {
+          "version": "4.2.0",
+          "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-4.2.0.tgz",
+          "integrity": "sha1-De4/7TH81GlhjOc0IJn8GvoL2xM=",
+          "dev": true
+        }
+      }
+    },
+    "estraverse": {
+      "version": "1.9.3",
+      "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-1.9.3.tgz",
+      "integrity": "sha1-r2fy3JIlgkFZUJJgkaQAXSnJu0Q=",
+      "dev": true
+    },
+    "estree-walker": {
+      "version": "0.5.2",
+      "resolved": "https://registry.npmjs.org/estree-walker/-/estree-walker-0.5.2.tgz",
+      "integrity": "sha512-XpCnW/AE10ws/kDAs37cngSkvgIR8aN3G0MS85m7dUpuK2EREo9VJ00uvw6Dg/hXEpfsE1I1TvJOJr+Z+TL+ig==",
+      "dev": true
+    },
+    "esutils": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.2.tgz",
+      "integrity": "sha1-Cr9PHKpbyx96nYrMbepPqqBLrJs=",
+      "dev": true
+    },
+    "etag": {
+      "version": "1.8.1",
+      "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz",
+      "integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=",
+      "dev": true
+    },
+    "event-stream": {
+      "version": "3.3.5",
+      "resolved": "https://registry.npmjs.org/event-stream/-/event-stream-3.3.5.tgz",
+      "integrity": "sha512-vyibDcu5JL20Me1fP734QBH/kenBGLZap2n0+XXM7mvuUPzJ20Ydqj1aKcIeMdri1p+PU+4yAKugjN8KCVst+g==",
+      "dev": true,
+      "requires": {
+        "duplexer": "0.1.1",
+        "from": "0.1.7",
+        "map-stream": "0.0.7",
+        "pause-stream": "0.0.11",
+        "split": "1.0.1",
+        "stream-combiner": "0.2.2",
+        "through": "2.3.8"
+      }
+    },
+    "eventemitter3": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/eventemitter3/-/eventemitter3-3.1.0.tgz",
+      "integrity": "sha512-ivIvhpq/Y0uSjcHDcOIccjmYjGLcP09MFGE7ysAwkAvkXfpZlC985pH2/ui64DKazbTW/4kN3yqozUxlXzI6cA==",
+      "dev": true
+    },
+    "events": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/events/-/events-1.1.1.tgz",
+      "integrity": "sha1-nr23Y1rQmccNzEwqH1AEKI6L2SQ=",
+      "dev": true
+    },
+    "eventsource": {
+      "version": "0.1.6",
+      "resolved": "https://registry.npmjs.org/eventsource/-/eventsource-0.1.6.tgz",
+      "integrity": "sha1-Cs7ehJ7X3RzMMsgRuxG5RNTykjI=",
+      "dev": true,
+      "requires": {
+        "original": "1.0.2"
+      }
+    },
+    "evp_bytestokey": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/evp_bytestokey/-/evp_bytestokey-1.0.3.tgz",
+      "integrity": "sha512-/f2Go4TognH/KvCISP7OUsHn85hT9nUkxxA9BEWxFn+Oj9o8ZNLm/40hdlgSLyuOimsrTKLUMEorQexp/aPQeA==",
+      "dev": true,
+      "requires": {
+        "md5.js": "1.3.4",
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "execa": {
+      "version": "0.10.0",
+      "resolved": "https://registry.npmjs.org/execa/-/execa-0.10.0.tgz",
+      "integrity": "sha512-7XOMnz8Ynx1gGo/3hyV9loYNPWM94jG3+3T3Y8tsfSstFmETmENCMU/A/zj8Lyaj1lkgEepKepvd6240tBRvlw==",
+      "dev": true,
+      "requires": {
+        "cross-spawn": "6.0.5",
+        "get-stream": "3.0.0",
+        "is-stream": "1.1.0",
+        "npm-run-path": "2.0.2",
+        "p-finally": "1.0.0",
+        "signal-exit": "3.0.2",
+        "strip-eof": "1.0.0"
+      },
+      "dependencies": {
+        "cross-spawn": {
+          "version": "6.0.5",
+          "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-6.0.5.tgz",
+          "integrity": "sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ==",
+          "dev": true,
+          "requires": {
+            "nice-try": "1.0.5",
+            "path-key": "2.0.1",
+            "semver": "5.5.1",
+            "shebang-command": "1.2.0",
+            "which": "1.3.1"
+          }
+        }
+      }
+    },
+    "exit": {
+      "version": "0.1.2",
+      "resolved": "https://registry.npmjs.org/exit/-/exit-0.1.2.tgz",
+      "integrity": "sha1-BjJjj42HfMghB9MKD/8aF8uhzQw=",
+      "dev": true
+    },
+    "expand-braces": {
+      "version": "0.1.2",
+      "resolved": "https://registry.npmjs.org/expand-braces/-/expand-braces-0.1.2.tgz",
+      "integrity": "sha1-SIsdHSRRyz06axks/AMPRMWFX+o=",
+      "dev": true,
+      "requires": {
+        "array-slice": "0.2.3",
+        "array-unique": "0.2.1",
+        "braces": "0.1.5"
+      },
+      "dependencies": {
+        "array-unique": {
+          "version": "0.2.1",
+          "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.2.1.tgz",
+          "integrity": "sha1-odl8yvy8JiXMcPrc6zalDFiwGlM=",
+          "dev": true
+        },
+        "braces": {
+          "version": "0.1.5",
+          "resolved": "https://registry.npmjs.org/braces/-/braces-0.1.5.tgz",
+          "integrity": "sha1-wIVxEIUpHYt1/ddOqw+FlygHEeY=",
+          "dev": true,
+          "requires": {
+            "expand-range": "0.1.1"
+          }
+        },
+        "expand-range": {
+          "version": "0.1.1",
+          "resolved": "https://registry.npmjs.org/expand-range/-/expand-range-0.1.1.tgz",
+          "integrity": "sha1-TLjtoJk8pW+k9B/ELzy7TMrf8EQ=",
+          "dev": true,
+          "requires": {
+            "is-number": "0.1.1",
+            "repeat-string": "0.2.2"
+          }
+        },
+        "is-number": {
+          "version": "0.1.1",
+          "resolved": "https://registry.npmjs.org/is-number/-/is-number-0.1.1.tgz",
+          "integrity": "sha1-aaevEWlj1HIG7JvZtIoUIW8eOAY=",
+          "dev": true
+        },
+        "repeat-string": {
+          "version": "0.2.2",
+          "resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-0.2.2.tgz",
+          "integrity": "sha1-x6jTI2BoNiBZp+RlH8aITosftK4=",
+          "dev": true
+        }
+      }
+    },
+    "expand-brackets": {
+      "version": "2.1.4",
+      "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-2.1.4.tgz",
+      "integrity": "sha1-t3c14xXOMPa27/D4OwQVGiJEliI=",
+      "dev": true,
+      "requires": {
+        "debug": "2.6.9",
+        "define-property": "0.2.5",
+        "extend-shallow": "2.0.1",
+        "posix-character-classes": "0.1.1",
+        "regex-not": "1.0.2",
+        "snapdragon": "0.8.2",
+        "to-regex": "3.0.2"
+      },
+      "dependencies": {
+        "define-property": {
+          "version": "0.2.5",
+          "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
+          "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
+          "dev": true,
+          "requires": {
+            "is-descriptor": "0.1.6"
+          }
+        },
+        "extend-shallow": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+          "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+          "dev": true,
+          "requires": {
+            "is-extendable": "0.1.1"
+          }
+        }
+      }
+    },
+    "expand-range": {
+      "version": "1.8.2",
+      "resolved": "https://registry.npmjs.org/expand-range/-/expand-range-1.8.2.tgz",
+      "integrity": "sha1-opnv/TNf4nIeuujiV+x5ZE/IUzc=",
+      "dev": true,
+      "requires": {
+        "fill-range": "2.2.4"
+      },
+      "dependencies": {
+        "fill-range": {
+          "version": "2.2.4",
+          "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-2.2.4.tgz",
+          "integrity": "sha512-cnrcCbj01+j2gTG921VZPnHbjmdAf8oQV/iGeV2kZxGSyfYjjTyY79ErsK1WJWMpw6DaApEX72binqJE+/d+5Q==",
+          "dev": true,
+          "requires": {
+            "is-number": "2.1.0",
+            "isobject": "2.1.0",
+            "randomatic": "3.1.0",
+            "repeat-element": "1.1.3",
+            "repeat-string": "1.6.1"
+          }
+        },
+        "is-number": {
+          "version": "2.1.0",
+          "resolved": "https://registry.npmjs.org/is-number/-/is-number-2.1.0.tgz",
+          "integrity": "sha1-Afy7s5NGOlSPL0ZszhbezknbkI8=",
+          "dev": true,
+          "requires": {
+            "kind-of": "3.2.2"
+          }
+        },
+        "isobject": {
+          "version": "2.1.0",
+          "resolved": "https://registry.npmjs.org/isobject/-/isobject-2.1.0.tgz",
+          "integrity": "sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=",
+          "dev": true,
+          "requires": {
+            "isarray": "1.0.0"
+          }
+        },
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        }
+      }
+    },
+    "express": {
+      "version": "4.16.3",
+      "resolved": "http://registry.npmjs.org/express/-/express-4.16.3.tgz",
+      "integrity": "sha1-avilAjUNsyRuzEvs9rWjTSL37VM=",
+      "dev": true,
+      "requires": {
+        "accepts": "1.3.5",
+        "array-flatten": "1.1.1",
+        "body-parser": "1.18.2",
+        "content-disposition": "0.5.2",
+        "content-type": "1.0.4",
+        "cookie": "0.3.1",
+        "cookie-signature": "1.0.6",
+        "debug": "2.6.9",
+        "depd": "1.1.2",
+        "encodeurl": "1.0.2",
+        "escape-html": "1.0.3",
+        "etag": "1.8.1",
+        "finalhandler": "1.1.1",
+        "fresh": "0.5.2",
+        "merge-descriptors": "1.0.1",
+        "methods": "1.1.2",
+        "on-finished": "2.3.0",
+        "parseurl": "1.3.2",
+        "path-to-regexp": "0.1.7",
+        "proxy-addr": "2.0.4",
+        "qs": "6.5.1",
+        "range-parser": "1.2.0",
+        "safe-buffer": "5.1.1",
+        "send": "0.16.2",
+        "serve-static": "1.13.2",
+        "setprototypeof": "1.1.0",
+        "statuses": "1.4.0",
+        "type-is": "1.6.16",
+        "utils-merge": "1.0.1",
+        "vary": "1.1.2"
+      },
+      "dependencies": {
+        "array-flatten": {
+          "version": "1.1.1",
+          "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz",
+          "integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=",
+          "dev": true
+        },
+        "qs": {
+          "version": "6.5.1",
+          "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.1.tgz",
+          "integrity": "sha512-eRzhrN1WSINYCDCbrz796z37LOe3m5tmW7RQf6oBntukAG1nmovJvhnwHHRMAfeoItc1m2Hk02WER2aQ/iqs+A==",
+          "dev": true
+        },
+        "safe-buffer": {
+          "version": "5.1.1",
+          "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.1.tgz",
+          "integrity": "sha512-kKvNJn6Mm93gAczWVJg7wH+wGYWNrDHdWvpUmHyEsgCtIwwo3bqPtV4tR5tuPaUhTOo/kvhVwd8XwwOllGYkbg==",
+          "dev": true
+        }
+      }
+    },
+    "extend": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/extend/-/extend-3.0.2.tgz",
+      "integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g==",
+      "dev": true
+    },
+    "extend-shallow": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-3.0.2.tgz",
+      "integrity": "sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg=",
+      "dev": true,
+      "requires": {
+        "assign-symbols": "1.0.0",
+        "is-extendable": "1.0.1"
+      },
+      "dependencies": {
+        "is-extendable": {
+          "version": "1.0.1",
+          "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz",
+          "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==",
+          "dev": true,
+          "requires": {
+            "is-plain-object": "2.0.4"
+          }
+        }
+      }
+    },
+    "extendr": {
+      "version": "3.3.0",
+      "resolved": "https://registry.npmjs.org/extendr/-/extendr-3.3.0.tgz",
+      "integrity": "sha512-BmBSu+KOX2XOo3XMECiekGY8VAr3O4aGYgOaHQDNg2ez5rOYW+SDfNStao4VNzr+6N27Vw3A7HJKJMrHmAAXvQ==",
+      "dev": true,
+      "requires": {
+        "editions": "1.3.4",
+        "typechecker": "4.5.0"
+      }
+    },
+    "extglob": {
+      "version": "2.0.4",
+      "resolved": "https://registry.npmjs.org/extglob/-/extglob-2.0.4.tgz",
+      "integrity": "sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw==",
+      "dev": true,
+      "requires": {
+        "array-unique": "0.3.2",
+        "define-property": "1.0.0",
+        "expand-brackets": "2.1.4",
+        "extend-shallow": "2.0.1",
+        "fragment-cache": "0.2.1",
+        "regex-not": "1.0.2",
+        "snapdragon": "0.8.2",
+        "to-regex": "3.0.2"
+      },
+      "dependencies": {
+        "define-property": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
+          "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
+          "dev": true,
+          "requires": {
+            "is-descriptor": "1.0.2"
+          }
+        },
+        "extend-shallow": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+          "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+          "dev": true,
+          "requires": {
+            "is-extendable": "0.1.1"
+          }
+        },
+        "is-accessor-descriptor": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
+          "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
+          "dev": true,
+          "requires": {
+            "kind-of": "6.0.2"
+          }
+        },
+        "is-data-descriptor": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
+          "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
+          "dev": true,
+          "requires": {
+            "kind-of": "6.0.2"
+          }
+        },
+        "is-descriptor": {
+          "version": "1.0.2",
+          "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
+          "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
+          "dev": true,
+          "requires": {
+            "is-accessor-descriptor": "1.0.0",
+            "is-data-descriptor": "1.0.0",
+            "kind-of": "6.0.2"
+          }
+        }
+      }
+    },
+    "extract-opts": {
+      "version": "3.3.1",
+      "resolved": "https://registry.npmjs.org/extract-opts/-/extract-opts-3.3.1.tgz",
+      "integrity": "sha1-WrvtyYwNUgLjJ4cn+Rktfghsa+E=",
+      "dev": true,
+      "requires": {
+        "eachr": "3.2.0",
+        "editions": "1.3.4",
+        "typechecker": "4.5.0"
+      }
+    },
+    "extsprintf": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/extsprintf/-/extsprintf-1.3.0.tgz",
+      "integrity": "sha1-lpGEQOMEGnpBT4xS48V06zw+HgU=",
+      "dev": true
+    },
+    "fancy-log": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/fancy-log/-/fancy-log-1.3.2.tgz",
+      "integrity": "sha1-9BEl49hPLn2JpD0G2VjI94vha+E=",
+      "dev": true,
+      "requires": {
+        "ansi-gray": "0.1.1",
+        "color-support": "1.1.3",
+        "time-stamp": "1.1.0"
+      }
+    },
+    "fast-deep-equal": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-1.1.0.tgz",
+      "integrity": "sha1-wFNHeBfIa1HaqFPIHgWbcz0CNhQ=",
+      "dev": true
+    },
+    "fast-glob": {
+      "version": "2.2.2",
+      "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-2.2.2.tgz",
+      "integrity": "sha512-TR6zxCKftDQnUAPvkrCWdBgDq/gbqx8A3ApnBrR5rMvpp6+KMJI0Igw7fkWPgeVK0uhRXTXdvO3O+YP0CaUX2g==",
+      "dev": true,
+      "requires": {
+        "@mrmlnc/readdir-enhanced": "2.2.1",
+        "@nodelib/fs.stat": "1.1.2",
+        "glob-parent": "3.1.0",
+        "is-glob": "4.0.0",
+        "merge2": "1.2.2",
+        "micromatch": "3.1.10"
+      }
+    },
+    "fast-json-stable-stringify": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz",
+      "integrity": "sha1-1RQsDK7msRifh9OnYREGT4bIu/I=",
+      "dev": true
+    },
+    "fast-levenshtein": {
+      "version": "2.0.6",
+      "resolved": "https://registry.npmjs.org/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz",
+      "integrity": "sha1-PYpcZog6FqMMqGQ+hR8Zuqd5eRc=",
+      "dev": true
+    },
+    "fastparse": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/fastparse/-/fastparse-1.1.1.tgz",
+      "integrity": "sha1-0eJkOzipTXWDtHkGDmxK/8lAcfg=",
+      "dev": true
+    },
+    "faye-websocket": {
+      "version": "0.10.0",
+      "resolved": "https://registry.npmjs.org/faye-websocket/-/faye-websocket-0.10.0.tgz",
+      "integrity": "sha1-TkkvjQTftviQA1B/btvy1QHnxvQ=",
+      "dev": true,
+      "requires": {
+        "websocket-driver": "0.7.0"
+      }
+    },
+    "file-loader": {
+      "version": "1.1.11",
+      "resolved": "https://registry.npmjs.org/file-loader/-/file-loader-1.1.11.tgz",
+      "integrity": "sha512-TGR4HU7HUsGg6GCOPJnFk06RhWgEWFLAGWiT6rcD+GRC2keU3s9RGJ+b3Z6/U73jwwNb2gKLJ7YCrp+jvU4ALg==",
+      "dev": true,
+      "requires": {
+        "loader-utils": "1.1.0",
+        "schema-utils": "0.4.7"
+      }
+    },
+    "filename-regex": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/filename-regex/-/filename-regex-2.0.1.tgz",
+      "integrity": "sha1-wcS5vuPglyXdsQa3XB4wH+LxiyY=",
+      "dev": true
+    },
+    "fileset": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/fileset/-/fileset-2.0.3.tgz",
+      "integrity": "sha1-jnVIqW08wjJ+5eZ0FocjozO7oqA=",
+      "dev": true,
+      "requires": {
+        "glob": "7.1.3",
+        "minimatch": "3.0.4"
+      }
+    },
+    "fill-range": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-4.0.0.tgz",
+      "integrity": "sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc=",
+      "dev": true,
+      "requires": {
+        "extend-shallow": "2.0.1",
+        "is-number": "3.0.0",
+        "repeat-string": "1.6.1",
+        "to-regex-range": "2.1.1"
+      },
+      "dependencies": {
+        "extend-shallow": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+          "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+          "dev": true,
+          "requires": {
+            "is-extendable": "0.1.1"
+          }
+        }
+      }
+    },
+    "finalhandler": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.1.tgz",
+      "integrity": "sha512-Y1GUDo39ez4aHAw7MysnUD5JzYX+WaIj8I57kO3aEPT1fFRL4sr7mjei97FgnwhAyyzRYmQZaTHb2+9uZ1dPtg==",
+      "dev": true,
+      "requires": {
+        "debug": "2.6.9",
+        "encodeurl": "1.0.2",
+        "escape-html": "1.0.3",
+        "on-finished": "2.3.0",
+        "parseurl": "1.3.2",
+        "statuses": "1.4.0",
+        "unpipe": "1.0.0"
+      }
+    },
+    "find-cache-dir": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/find-cache-dir/-/find-cache-dir-1.0.0.tgz",
+      "integrity": "sha1-kojj6ePMN0hxfTnq3hfPcfww7m8=",
+      "dev": true,
+      "requires": {
+        "commondir": "1.0.1",
+        "make-dir": "1.3.0",
+        "pkg-dir": "2.0.0"
+      }
+    },
+    "find-parent-dir": {
+      "version": "0.3.0",
+      "resolved": "https://registry.npmjs.org/find-parent-dir/-/find-parent-dir-0.3.0.tgz",
+      "integrity": "sha1-M8RLQpqysvBkYpnF+fcY83b/jVQ=",
+      "dev": true
+    },
+    "find-up": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/find-up/-/find-up-2.1.0.tgz",
+      "integrity": "sha1-RdG35QbHF93UgndaK3eSCjwMV6c=",
+      "dev": true,
+      "requires": {
+        "locate-path": "2.0.0"
+      }
+    },
+    "findit2": {
+      "version": "2.2.3",
+      "resolved": "https://registry.npmjs.org/findit2/-/findit2-2.2.3.tgz",
+      "integrity": "sha1-WKRmaX34piBc39vzlVNri9d3pfY=",
+      "dev": true
+    },
+    "flush-write-stream": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/flush-write-stream/-/flush-write-stream-1.0.3.tgz",
+      "integrity": "sha512-calZMC10u0FMUqoiunI2AiGIIUtUIvifNwkHhNupZH4cbNnW1Itkoh/Nf5HFYmDrwWPjrUxpkZT0KhuCq0jmGw==",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3",
+        "readable-stream": "2.3.6"
+      }
+    },
+    "follow-redirects": {
+      "version": "1.5.7",
+      "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.5.7.tgz",
+      "integrity": "sha512-NONJVIFiX7Z8k2WxfqBjtwqMifx7X42ORLFrOZ2LTKGj71G3C0kfdyTqGqr8fx5zSX6Foo/D95dgGWbPUiwnew==",
+      "dev": true,
+      "requires": {
+        "debug": "3.1.0"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "3.1.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+          "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+          "dev": true,
+          "requires": {
+            "ms": "2.0.0"
+          }
+        }
+      }
+    },
+    "for-in": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/for-in/-/for-in-1.0.2.tgz",
+      "integrity": "sha1-gQaNKVqBQuwKxybG4iAMMPttXoA=",
+      "dev": true
+    },
+    "for-own": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/for-own/-/for-own-1.0.0.tgz",
+      "integrity": "sha1-xjMy9BXO3EsE2/5wz4NklMU8tEs=",
+      "dev": true,
+      "requires": {
+        "for-in": "1.0.2"
+      }
+    },
+    "forever-agent": {
+      "version": "0.6.1",
+      "resolved": "https://registry.npmjs.org/forever-agent/-/forever-agent-0.6.1.tgz",
+      "integrity": "sha1-+8cfDEGt6zf5bFd60e1C2P2sypE=",
+      "dev": true
+    },
+    "form-data": {
+      "version": "2.3.2",
+      "resolved": "https://registry.npmjs.org/form-data/-/form-data-2.3.2.tgz",
+      "integrity": "sha1-SXBJi+YEwgwAXU9cI67NIda0kJk=",
+      "dev": true,
+      "requires": {
+        "asynckit": "0.4.0",
+        "combined-stream": "1.0.6",
+        "mime-types": "2.1.20"
+      }
+    },
+    "forwarded": {
+      "version": "0.1.2",
+      "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.2.tgz",
+      "integrity": "sha1-mMI9qxF1ZXuMBXPozszZGw/xjIQ=",
+      "dev": true
+    },
+    "fragment-cache": {
+      "version": "0.2.1",
+      "resolved": "https://registry.npmjs.org/fragment-cache/-/fragment-cache-0.2.1.tgz",
+      "integrity": "sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk=",
+      "dev": true,
+      "requires": {
+        "map-cache": "0.2.2"
+      }
+    },
+    "fresh": {
+      "version": "0.5.2",
+      "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz",
+      "integrity": "sha1-PYyt2Q2XZWn6g1qx+OSyOhBWBac=",
+      "dev": true
+    },
+    "from": {
+      "version": "0.1.7",
+      "resolved": "https://registry.npmjs.org/from/-/from-0.1.7.tgz",
+      "integrity": "sha1-g8YK/Fi5xWmXAH7Rp2izqzA6RP4=",
+      "dev": true
+    },
+    "from2": {
+      "version": "2.3.0",
+      "resolved": "https://registry.npmjs.org/from2/-/from2-2.3.0.tgz",
+      "integrity": "sha1-i/tVAr3kpNNs/e6gB/zKIdfjgq8=",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3",
+        "readable-stream": "2.3.6"
+      }
+    },
+    "fs-access": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/fs-access/-/fs-access-1.0.1.tgz",
+      "integrity": "sha1-1qh/JiJxzv6+wwxVNAf7mV2od3o=",
+      "dev": true,
+      "requires": {
+        "null-check": "1.0.0"
+      }
+    },
+    "fs-extra": {
+      "version": "6.0.1",
+      "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-6.0.1.tgz",
+      "integrity": "sha512-GnyIkKhhzXZUWFCaJzvyDLEEgDkPfb4/TPvJCJVuS8MWZgoSsErf++QpiAlDnKFcqhRlm+tIOcencCjyJE6ZCA==",
+      "dev": true,
+      "requires": {
+        "graceful-fs": "4.1.11",
+        "jsonfile": "4.0.0",
+        "universalify": "0.1.2"
+      }
+    },
+    "fs-write-stream-atomic": {
+      "version": "1.0.10",
+      "resolved": "https://registry.npmjs.org/fs-write-stream-atomic/-/fs-write-stream-atomic-1.0.10.tgz",
+      "integrity": "sha1-tH31NJPvkR33VzHnCp3tAYnbQMk=",
+      "dev": true,
+      "requires": {
+        "graceful-fs": "4.1.11",
+        "iferr": "0.1.5",
+        "imurmurhash": "0.1.4",
+        "readable-stream": "2.3.6"
+      }
+    },
+    "fs.realpath": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz",
+      "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=",
+      "dev": true
+    },
+    "fsevents": {
+      "version": "1.2.4",
+      "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-1.2.4.tgz",
+      "integrity": "sha512-z8H8/diyk76B7q5wg+Ud0+CqzcAF3mBBI/bA5ne5zrRUUIvNkJY//D3BqyH571KuAC4Nr7Rw7CjWX4r0y9DvNg==",
+      "dev": true,
+      "optional": true,
+      "requires": {
+        "nan": "2.11.0",
+        "node-pre-gyp": "0.10.0"
+      },
+      "dependencies": {
+        "abbrev": {
+          "version": "1.1.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "ansi-regex": {
+          "version": "2.1.1",
+          "bundled": true,
+          "dev": true
+        },
+        "aproba": {
+          "version": "1.2.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "are-we-there-yet": {
+          "version": "1.1.4",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "delegates": "1.0.0",
+            "readable-stream": "2.3.6"
+          }
+        },
+        "balanced-match": {
+          "version": "1.0.0",
+          "bundled": true,
+          "dev": true
+        },
+        "brace-expansion": {
+          "version": "1.1.11",
+          "bundled": true,
+          "dev": true,
+          "requires": {
+            "balanced-match": "1.0.0",
+            "concat-map": "0.0.1"
+          }
+        },
+        "chownr": {
+          "version": "1.0.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "code-point-at": {
+          "version": "1.1.0",
+          "bundled": true,
+          "dev": true
+        },
+        "concat-map": {
+          "version": "0.0.1",
+          "bundled": true,
+          "dev": true
+        },
+        "console-control-strings": {
+          "version": "1.1.0",
+          "bundled": true,
+          "dev": true
+        },
+        "core-util-is": {
+          "version": "1.0.2",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "debug": {
+          "version": "2.6.9",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "ms": "2.0.0"
+          }
+        },
+        "deep-extend": {
+          "version": "0.5.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "delegates": {
+          "version": "1.0.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "detect-libc": {
+          "version": "1.0.3",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "fs-minipass": {
+          "version": "1.2.5",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "minipass": "2.2.4"
+          }
+        },
+        "fs.realpath": {
+          "version": "1.0.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "gauge": {
+          "version": "2.7.4",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "aproba": "1.2.0",
+            "console-control-strings": "1.1.0",
+            "has-unicode": "2.0.1",
+            "object-assign": "4.1.1",
+            "signal-exit": "3.0.2",
+            "string-width": "1.0.2",
+            "strip-ansi": "3.0.1",
+            "wide-align": "1.1.2"
+          }
+        },
+        "glob": {
+          "version": "7.1.2",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "fs.realpath": "1.0.0",
+            "inflight": "1.0.6",
+            "inherits": "2.0.3",
+            "minimatch": "3.0.4",
+            "once": "1.4.0",
+            "path-is-absolute": "1.0.1"
+          }
+        },
+        "has-unicode": {
+          "version": "2.0.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "iconv-lite": {
+          "version": "0.4.21",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "safer-buffer": "2.1.2"
+          }
+        },
+        "ignore-walk": {
+          "version": "3.0.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "minimatch": "3.0.4"
+          }
+        },
+        "inflight": {
+          "version": "1.0.6",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "once": "1.4.0",
+            "wrappy": "1.0.2"
+          }
+        },
+        "inherits": {
+          "version": "2.0.3",
+          "bundled": true,
+          "dev": true
+        },
+        "ini": {
+          "version": "1.3.5",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "is-fullwidth-code-point": {
+          "version": "1.0.0",
+          "bundled": true,
+          "dev": true,
+          "requires": {
+            "number-is-nan": "1.0.1"
+          }
+        },
+        "isarray": {
+          "version": "1.0.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "minimatch": {
+          "version": "3.0.4",
+          "bundled": true,
+          "dev": true,
+          "requires": {
+            "brace-expansion": "1.1.11"
+          }
+        },
+        "minimist": {
+          "version": "0.0.8",
+          "bundled": true,
+          "dev": true
+        },
+        "minipass": {
+          "version": "2.2.4",
+          "bundled": true,
+          "dev": true,
+          "requires": {
+            "safe-buffer": "5.1.1",
+            "yallist": "3.0.2"
+          }
+        },
+        "minizlib": {
+          "version": "1.1.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "minipass": "2.2.4"
+          }
+        },
+        "mkdirp": {
+          "version": "0.5.1",
+          "bundled": true,
+          "dev": true,
+          "requires": {
+            "minimist": "0.0.8"
+          }
+        },
+        "ms": {
+          "version": "2.0.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "needle": {
+          "version": "2.2.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "debug": "2.6.9",
+            "iconv-lite": "0.4.21",
+            "sax": "1.2.4"
+          }
+        },
+        "node-pre-gyp": {
+          "version": "0.10.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "detect-libc": "1.0.3",
+            "mkdirp": "0.5.1",
+            "needle": "2.2.0",
+            "nopt": "4.0.1",
+            "npm-packlist": "1.1.10",
+            "npmlog": "4.1.2",
+            "rc": "1.2.7",
+            "rimraf": "2.6.2",
+            "semver": "5.5.0",
+            "tar": "4.4.1"
+          }
+        },
+        "nopt": {
+          "version": "4.0.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "abbrev": "1.1.1",
+            "osenv": "0.1.5"
+          }
+        },
+        "npm-bundled": {
+          "version": "1.0.3",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "npm-packlist": {
+          "version": "1.1.10",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "ignore-walk": "3.0.1",
+            "npm-bundled": "1.0.3"
+          }
+        },
+        "npmlog": {
+          "version": "4.1.2",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "are-we-there-yet": "1.1.4",
+            "console-control-strings": "1.1.0",
+            "gauge": "2.7.4",
+            "set-blocking": "2.0.0"
+          }
+        },
+        "number-is-nan": {
+          "version": "1.0.1",
+          "bundled": true,
+          "dev": true
+        },
+        "object-assign": {
+          "version": "4.1.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "once": {
+          "version": "1.4.0",
+          "bundled": true,
+          "dev": true,
+          "requires": {
+            "wrappy": "1.0.2"
+          }
+        },
+        "os-homedir": {
+          "version": "1.0.2",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "os-tmpdir": {
+          "version": "1.0.2",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "osenv": {
+          "version": "0.1.5",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "os-homedir": "1.0.2",
+            "os-tmpdir": "1.0.2"
+          }
+        },
+        "path-is-absolute": {
+          "version": "1.0.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "process-nextick-args": {
+          "version": "2.0.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "rc": {
+          "version": "1.2.7",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "deep-extend": "0.5.1",
+            "ini": "1.3.5",
+            "minimist": "1.2.0",
+            "strip-json-comments": "2.0.1"
+          },
+          "dependencies": {
+            "minimist": {
+              "version": "1.2.0",
+              "bundled": true,
+              "dev": true,
+              "optional": true
+            }
+          }
+        },
+        "readable-stream": {
+          "version": "2.3.6",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "core-util-is": "1.0.2",
+            "inherits": "2.0.3",
+            "isarray": "1.0.0",
+            "process-nextick-args": "2.0.0",
+            "safe-buffer": "5.1.1",
+            "string_decoder": "1.1.1",
+            "util-deprecate": "1.0.2"
+          }
+        },
+        "rimraf": {
+          "version": "2.6.2",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "glob": "7.1.2"
+          }
+        },
+        "safe-buffer": {
+          "version": "5.1.1",
+          "bundled": true,
+          "dev": true
+        },
+        "safer-buffer": {
+          "version": "2.1.2",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "sax": {
+          "version": "1.2.4",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "semver": {
+          "version": "5.5.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "set-blocking": {
+          "version": "2.0.0",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "signal-exit": {
+          "version": "3.0.2",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "string-width": {
+          "version": "1.0.2",
+          "bundled": true,
+          "dev": true,
+          "requires": {
+            "code-point-at": "1.1.0",
+            "is-fullwidth-code-point": "1.0.0",
+            "strip-ansi": "3.0.1"
+          }
+        },
+        "string_decoder": {
+          "version": "1.1.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "safe-buffer": "5.1.1"
+          }
+        },
+        "strip-ansi": {
+          "version": "3.0.1",
+          "bundled": true,
+          "dev": true,
+          "requires": {
+            "ansi-regex": "2.1.1"
+          }
+        },
+        "strip-json-comments": {
+          "version": "2.0.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "tar": {
+          "version": "4.4.1",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "chownr": "1.0.1",
+            "fs-minipass": "1.2.5",
+            "minipass": "2.2.4",
+            "minizlib": "1.1.0",
+            "mkdirp": "0.5.1",
+            "safe-buffer": "5.1.1",
+            "yallist": "3.0.2"
+          }
+        },
+        "util-deprecate": {
+          "version": "1.0.2",
+          "bundled": true,
+          "dev": true,
+          "optional": true
+        },
+        "wide-align": {
+          "version": "1.1.2",
+          "bundled": true,
+          "dev": true,
+          "optional": true,
+          "requires": {
+            "string-width": "1.0.2"
+          }
+        },
+        "wrappy": {
+          "version": "1.0.2",
+          "bundled": true,
+          "dev": true
+        },
+        "yallist": {
+          "version": "3.0.2",
+          "bundled": true,
+          "dev": true
+        }
+      }
+    },
+    "fstream": {
+      "version": "1.0.11",
+      "resolved": "https://registry.npmjs.org/fstream/-/fstream-1.0.11.tgz",
+      "integrity": "sha1-XB+x8RdHcRTwYyoOtLcbPLD9MXE=",
+      "dev": true,
+      "requires": {
+        "graceful-fs": "4.1.11",
+        "inherits": "2.0.3",
+        "mkdirp": "0.5.1",
+        "rimraf": "2.6.2"
+      }
+    },
+    "function-bind": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz",
+      "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==",
+      "dev": true
+    },
+    "gauge": {
+      "version": "2.7.4",
+      "resolved": "https://registry.npmjs.org/gauge/-/gauge-2.7.4.tgz",
+      "integrity": "sha1-LANAXHU4w51+s3sxcCLjJfsBi/c=",
+      "dev": true,
+      "requires": {
+        "aproba": "1.2.0",
+        "console-control-strings": "1.1.0",
+        "has-unicode": "2.0.1",
+        "object-assign": "4.1.1",
+        "signal-exit": "3.0.2",
+        "string-width": "1.0.2",
+        "strip-ansi": "3.0.1",
+        "wide-align": "1.1.3"
+      }
+    },
+    "gaze": {
+      "version": "1.1.3",
+      "resolved": "https://registry.npmjs.org/gaze/-/gaze-1.1.3.tgz",
+      "integrity": "sha512-BRdNm8hbWzFzWHERTrejLqwHDfS4GibPoq5wjTPIoJHoBtKGPg3xAFfxmM+9ztbXelxcf2hwQcaz1PtmFeue8g==",
+      "dev": true,
+      "requires": {
+        "globule": "1.2.1"
+      }
+    },
+    "get-caller-file": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-1.0.3.tgz",
+      "integrity": "sha512-3t6rVToeoZfYSGd8YoLFR2DJkiQrIiUrGcjvFX2mDw3bn6k2OtwHN0TNCLbBO+w8qTvimhDkv+LSscbJY1vE6w==",
+      "dev": true
+    },
+    "get-stdin": {
+      "version": "4.0.1",
+      "resolved": "https://registry.npmjs.org/get-stdin/-/get-stdin-4.0.1.tgz",
+      "integrity": "sha1-uWjGsKBDhDJJAui/Gl3zJXmkUP4=",
+      "dev": true
+    },
+    "get-stream": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-3.0.0.tgz",
+      "integrity": "sha1-jpQ9E1jcN1VQVOy+LtsFqhdO3hQ=",
+      "dev": true
+    },
+    "get-value": {
+      "version": "2.0.6",
+      "resolved": "https://registry.npmjs.org/get-value/-/get-value-2.0.6.tgz",
+      "integrity": "sha1-3BXKHGcjh8p2vTesCjlbogQqLCg=",
+      "dev": true
+    },
+    "getpass": {
+      "version": "0.1.7",
+      "resolved": "https://registry.npmjs.org/getpass/-/getpass-0.1.7.tgz",
+      "integrity": "sha1-Xv+OPmhNVprkyysSgmBOi6YhSfo=",
+      "dev": true,
+      "requires": {
+        "assert-plus": "1.0.0"
+      }
+    },
+    "glob": {
+      "version": "7.1.3",
+      "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.3.tgz",
+      "integrity": "sha512-vcfuiIxogLV4DlGBHIUOwI0IbrJ8HWPc4MU7HzviGeNho/UJDfi6B5p3sHeWIQ0KGIU0Jpxi5ZHxemQfLkkAwQ==",
+      "dev": true,
+      "requires": {
+        "fs.realpath": "1.0.0",
+        "inflight": "1.0.6",
+        "inherits": "2.0.3",
+        "minimatch": "3.0.4",
+        "once": "1.4.0",
+        "path-is-absolute": "1.0.1"
+      }
+    },
+    "glob-base": {
+      "version": "0.3.0",
+      "resolved": "https://registry.npmjs.org/glob-base/-/glob-base-0.3.0.tgz",
+      "integrity": "sha1-27Fk9iIbHAscz4Kuoyi0l98Oo8Q=",
+      "dev": true,
+      "requires": {
+        "glob-parent": "2.0.0",
+        "is-glob": "2.0.1"
+      },
+      "dependencies": {
+        "glob-parent": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-2.0.0.tgz",
+          "integrity": "sha1-gTg9ctsFT8zPUzbaqQLxgvbtuyg=",
+          "dev": true,
+          "requires": {
+            "is-glob": "2.0.1"
+          }
+        },
+        "is-extglob": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-1.0.0.tgz",
+          "integrity": "sha1-rEaBd8SUNAWgkvyPKXYMb/xiBsA=",
+          "dev": true
+        },
+        "is-glob": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-2.0.1.tgz",
+          "integrity": "sha1-0Jb5JqPe1WAPP9/ZEZjLCIjC2GM=",
+          "dev": true,
+          "requires": {
+            "is-extglob": "1.0.0"
+          }
+        }
+      }
+    },
+    "glob-parent": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-3.1.0.tgz",
+      "integrity": "sha1-nmr2KZ2NO9K9QEMIMr0RPfkGxa4=",
+      "dev": true,
+      "requires": {
+        "is-glob": "3.1.0",
+        "path-dirname": "1.0.2"
+      },
+      "dependencies": {
+        "is-glob": {
+          "version": "3.1.0",
+          "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-3.1.0.tgz",
+          "integrity": "sha1-e6WuJCF4BKxwcHuWkiVnSGzD6Eo=",
+          "dev": true,
+          "requires": {
+            "is-extglob": "2.1.1"
+          }
+        }
+      }
+    },
+    "glob-to-regexp": {
+      "version": "0.3.0",
+      "resolved": "https://registry.npmjs.org/glob-to-regexp/-/glob-to-regexp-0.3.0.tgz",
+      "integrity": "sha1-jFoUlNIGbFcMw7/kSWF1rMTVAqs=",
+      "dev": true
+    },
+    "global-dirs": {
+      "version": "0.1.1",
+      "resolved": "https://registry.npmjs.org/global-dirs/-/global-dirs-0.1.1.tgz",
+      "integrity": "sha1-sxnA3UYH81PzvpzKTHL8FIxJ9EU=",
+      "dev": true,
+      "requires": {
+        "ini": "1.3.5"
+      }
+    },
+    "globals": {
+      "version": "9.18.0",
+      "resolved": "https://registry.npmjs.org/globals/-/globals-9.18.0.tgz",
+      "integrity": "sha512-S0nG3CLEQiY/ILxqtztTWH/3iRRdyBLw6KMDxnKMchrtbj2OFmehVh0WUCfW3DUrIgx/qFrJPICrq4Z4sTR9UQ==",
+      "dev": true
+    },
+    "globby": {
+      "version": "7.1.1",
+      "resolved": "https://registry.npmjs.org/globby/-/globby-7.1.1.tgz",
+      "integrity": "sha1-+yzP+UAfhgCUXfral0QMypcrhoA=",
+      "dev": true,
+      "requires": {
+        "array-union": "1.0.2",
+        "dir-glob": "2.0.0",
+        "glob": "7.1.3",
+        "ignore": "3.3.10",
+        "pify": "3.0.0",
+        "slash": "1.0.0"
+      }
+    },
+    "globule": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/globule/-/globule-1.2.1.tgz",
+      "integrity": "sha512-g7QtgWF4uYSL5/dn71WxubOrS7JVGCnFPEnoeChJmBnyR9Mw8nGoEwOgJL/RC2Te0WhbsEUCejfH8SZNJ+adYQ==",
+      "dev": true,
+      "requires": {
+        "glob": "7.1.3",
+        "lodash": "4.17.10",
+        "minimatch": "3.0.4"
+      }
+    },
+    "got": {
+      "version": "6.7.1",
+      "resolved": "http://registry.npmjs.org/got/-/got-6.7.1.tgz",
+      "integrity": "sha1-JAzQV4WpoY5WHcG0S0HHY+8ejbA=",
+      "dev": true,
+      "requires": {
+        "create-error-class": "3.0.2",
+        "duplexer3": "0.1.4",
+        "get-stream": "3.0.0",
+        "is-redirect": "1.0.0",
+        "is-retry-allowed": "1.1.0",
+        "is-stream": "1.1.0",
+        "lowercase-keys": "1.0.1",
+        "safe-buffer": "5.1.2",
+        "timed-out": "4.0.1",
+        "unzip-response": "2.0.1",
+        "url-parse-lax": "1.0.0"
+      }
+    },
+    "graceful-fs": {
+      "version": "4.1.11",
+      "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.1.11.tgz",
+      "integrity": "sha1-Dovf5NHduIVNZOBOp8AOKgJuVlg=",
+      "dev": true
+    },
+    "handle-thing": {
+      "version": "1.2.5",
+      "resolved": "https://registry.npmjs.org/handle-thing/-/handle-thing-1.2.5.tgz",
+      "integrity": "sha1-/Xqtcmvxpf0W38KbL3pmAdJxOcQ=",
+      "dev": true
+    },
+    "handlebars": {
+      "version": "4.0.12",
+      "resolved": "https://registry.npmjs.org/handlebars/-/handlebars-4.0.12.tgz",
+      "integrity": "sha512-RhmTekP+FZL+XNhwS1Wf+bTTZpdLougwt5pcgA1tuz6Jcx0fpH/7z0qd71RKnZHBCxIRBHfBOnio4gViPemNzA==",
+      "dev": true,
+      "requires": {
+        "async": "2.6.1",
+        "optimist": "0.6.1",
+        "source-map": "0.6.1",
+        "uglify-js": "3.4.9"
+      },
+      "dependencies": {
+        "async": {
+          "version": "2.6.1",
+          "resolved": "https://registry.npmjs.org/async/-/async-2.6.1.tgz",
+          "integrity": "sha512-fNEiL2+AZt6AlAw/29Cr0UDe4sRAHCpEHh54WMz+Bb7QfNcFw4h3loofyJpLeQs4Yx7yuqu/2dLgM5hKOs6HlQ==",
+          "dev": true,
+          "requires": {
+            "lodash": "4.17.10"
+          }
+        },
+        "source-map": {
+          "version": "0.6.1",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+          "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+          "dev": true
+        }
+      }
+    },
+    "har-schema": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/har-schema/-/har-schema-2.0.0.tgz",
+      "integrity": "sha1-qUwiJOvKwEeCoNkDVSHyRzW37JI=",
+      "dev": true
+    },
+    "har-validator": {
+      "version": "5.1.0",
+      "resolved": "https://registry.npmjs.org/har-validator/-/har-validator-5.1.0.tgz",
+      "integrity": "sha512-+qnmNjI4OfH2ipQ9VQOw23bBd/ibtfbVdK2fYbY4acTDqKTW/YDp9McimZdDbG8iV9fZizUqQMD5xvriB146TA==",
+      "dev": true,
+      "requires": {
+        "ajv": "5.5.2",
+        "har-schema": "2.0.0"
+      },
+      "dependencies": {
+        "ajv": {
+          "version": "5.5.2",
+          "resolved": "https://registry.npmjs.org/ajv/-/ajv-5.5.2.tgz",
+          "integrity": "sha1-c7Xuyj+rZT49P5Qis0GtQiBdyWU=",
+          "dev": true,
+          "requires": {
+            "co": "4.6.0",
+            "fast-deep-equal": "1.1.0",
+            "fast-json-stable-stringify": "2.0.0",
+            "json-schema-traverse": "0.3.1"
+          }
+        }
+      }
+    },
+    "has": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz",
+      "integrity": "sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==",
+      "dev": true,
+      "requires": {
+        "function-bind": "1.1.1"
+      }
+    },
+    "has-ansi": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/has-ansi/-/has-ansi-2.0.0.tgz",
+      "integrity": "sha1-NPUEnOHs3ysGSa8+8k5F7TVBbZE=",
+      "dev": true,
+      "requires": {
+        "ansi-regex": "2.1.1"
+      }
+    },
+    "has-binary": {
+      "version": "0.1.7",
+      "resolved": "https://registry.npmjs.org/has-binary/-/has-binary-0.1.7.tgz",
+      "integrity": "sha1-aOYesWIQyVRaClzOBqhzkS/h5ow=",
+      "dev": true,
+      "requires": {
+        "isarray": "0.0.1"
+      },
+      "dependencies": {
+        "isarray": {
+          "version": "0.0.1",
+          "resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz",
+          "integrity": "sha1-ihis/Kmo9Bd+Cav8YDiTmwXR7t8=",
+          "dev": true
+        }
+      }
+    },
+    "has-cors": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/has-cors/-/has-cors-1.1.0.tgz",
+      "integrity": "sha1-XkdHk/fqmEPRu5nCPu9J/xJv/zk=",
+      "dev": true
+    },
+    "has-flag": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz",
+      "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=",
+      "dev": true
+    },
+    "has-unicode": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/has-unicode/-/has-unicode-2.0.1.tgz",
+      "integrity": "sha1-4Ob+aijPUROIVeCG0Wkedx3iqLk=",
+      "dev": true
+    },
+    "has-value": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/has-value/-/has-value-1.0.0.tgz",
+      "integrity": "sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc=",
+      "dev": true,
+      "requires": {
+        "get-value": "2.0.6",
+        "has-values": "1.0.0",
+        "isobject": "3.0.1"
+      }
+    },
+    "has-values": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/has-values/-/has-values-1.0.0.tgz",
+      "integrity": "sha1-lbC2P+whRmGab+V/51Yo1aOe/k8=",
+      "dev": true,
+      "requires": {
+        "is-number": "3.0.0",
+        "kind-of": "4.0.0"
+      },
+      "dependencies": {
+        "kind-of": {
+          "version": "4.0.0",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz",
+          "integrity": "sha1-IIE989cSkosgc3hpGkUGb65y3Vc=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        }
+      }
+    },
+    "hash-base": {
+      "version": "3.0.4",
+      "resolved": "https://registry.npmjs.org/hash-base/-/hash-base-3.0.4.tgz",
+      "integrity": "sha1-X8hoaEfs1zSZQDMZprCj8/auSRg=",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3",
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "hash.js": {
+      "version": "1.1.5",
+      "resolved": "https://registry.npmjs.org/hash.js/-/hash.js-1.1.5.tgz",
+      "integrity": "sha512-eWI5HG9Np+eHV1KQhisXWwM+4EPPYe5dFX1UZZH7k/E3JzDEazVH+VGlZi6R94ZqImq+A3D1mCEtrFIfg/E7sA==",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3",
+        "minimalistic-assert": "1.0.1"
+      }
+    },
+    "he": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/he/-/he-1.1.1.tgz",
+      "integrity": "sha1-k0EP0hsAlzUVH4howvJx80J+I/0=",
+      "dev": true
+    },
+    "hmac-drbg": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/hmac-drbg/-/hmac-drbg-1.0.1.tgz",
+      "integrity": "sha1-0nRXAQJabHdabFRXk+1QL8DGSaE=",
+      "dev": true,
+      "requires": {
+        "hash.js": "1.1.5",
+        "minimalistic-assert": "1.0.1",
+        "minimalistic-crypto-utils": "1.0.1"
+      }
+    },
+    "hosted-git-info": {
+      "version": "2.7.1",
+      "resolved": "https://registry.npmjs.org/hosted-git-info/-/hosted-git-info-2.7.1.tgz",
+      "integrity": "sha512-7T/BxH19zbcCTa8XkMlbK5lTo1WtgkFi3GvdWEyNuc4Vex7/9Dqbnpsf4JMydcfj9HCg4zUWFTL3Za6lapg5/w==",
+      "dev": true
+    },
+    "hpack.js": {
+      "version": "2.1.6",
+      "resolved": "https://registry.npmjs.org/hpack.js/-/hpack.js-2.1.6.tgz",
+      "integrity": "sha1-h3dMCUnlE/QuhFdbPEVoH63ioLI=",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3",
+        "obuf": "1.1.2",
+        "readable-stream": "2.3.6",
+        "wbuf": "1.7.3"
+      }
+    },
+    "html-entities": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/html-entities/-/html-entities-1.2.1.tgz",
+      "integrity": "sha1-DfKTUfByEWNRXfueVUPl9u7VFi8=",
+      "dev": true
+    },
+    "html-minifier": {
+      "version": "3.5.20",
+      "resolved": "https://registry.npmjs.org/html-minifier/-/html-minifier-3.5.20.tgz",
+      "integrity": "sha512-ZmgNLaTp54+HFKkONyLFEfs5dd/ZOtlquKaTnqIWFmx3Av5zG6ZPcV2d0o9XM2fXOTxxIf6eDcwzFFotke/5zA==",
+      "dev": true,
+      "requires": {
+        "camel-case": "3.0.0",
+        "clean-css": "4.2.1",
+        "commander": "2.17.1",
+        "he": "1.1.1",
+        "param-case": "2.1.1",
+        "relateurl": "0.2.7",
+        "uglify-js": "3.4.9"
+      }
+    },
+    "html-webpack-plugin": {
+      "version": "3.2.0",
+      "resolved": "http://registry.npmjs.org/html-webpack-plugin/-/html-webpack-plugin-3.2.0.tgz",
+      "integrity": "sha1-sBq71yOsqqeze2r0SS69oD2d03s=",
+      "dev": true,
+      "requires": {
+        "html-minifier": "3.5.20",
+        "loader-utils": "0.2.17",
+        "lodash": "4.17.10",
+        "pretty-error": "2.1.1",
+        "tapable": "1.0.0",
+        "toposort": "1.0.7",
+        "util.promisify": "1.0.0"
+      },
+      "dependencies": {
+        "loader-utils": {
+          "version": "0.2.17",
+          "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-0.2.17.tgz",
+          "integrity": "sha1-+G5jdNQyBabmxg6RlvF8Apm/s0g=",
+          "dev": true,
+          "requires": {
+            "big.js": "3.2.0",
+            "emojis-list": "2.1.0",
+            "json5": "0.5.1",
+            "object-assign": "4.1.1"
+          }
+        }
+      }
+    },
+    "htmlparser2": {
+      "version": "3.3.0",
+      "resolved": "https://registry.npmjs.org/htmlparser2/-/htmlparser2-3.3.0.tgz",
+      "integrity": "sha1-zHDQWln2VC5D8OaFyYLhTJJKnv4=",
+      "dev": true,
+      "requires": {
+        "domelementtype": "1.3.0",
+        "domhandler": "2.1.0",
+        "domutils": "1.1.6",
+        "readable-stream": "1.0.34"
+      },
+      "dependencies": {
+        "domutils": {
+          "version": "1.1.6",
+          "resolved": "https://registry.npmjs.org/domutils/-/domutils-1.1.6.tgz",
+          "integrity": "sha1-vdw94Jm5ou+sxRxiPyj0FuzFdIU=",
+          "dev": true,
+          "requires": {
+            "domelementtype": "1.3.0"
+          }
+        },
+        "isarray": {
+          "version": "0.0.1",
+          "resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz",
+          "integrity": "sha1-ihis/Kmo9Bd+Cav8YDiTmwXR7t8=",
+          "dev": true
+        },
+        "readable-stream": {
+          "version": "1.0.34",
+          "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-1.0.34.tgz",
+          "integrity": "sha1-Elgg40vIQtLyqq+v5MKRbuMsFXw=",
+          "dev": true,
+          "requires": {
+            "core-util-is": "1.0.2",
+            "inherits": "2.0.3",
+            "isarray": "0.0.1",
+            "string_decoder": "0.10.31"
+          }
+        },
+        "string_decoder": {
+          "version": "0.10.31",
+          "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz",
+          "integrity": "sha1-YuIDvEF2bGwoyfyEMB2rHFMQ+pQ=",
+          "dev": true
+        }
+      }
+    },
+    "http-auth": {
+      "version": "2.4.11",
+      "resolved": "https://registry.npmjs.org/http-auth/-/http-auth-2.4.11.tgz",
+      "integrity": "sha1-YfAkpuDnxIk0lEiVyHoTlVCcYZs=",
+      "dev": true,
+      "requires": {
+        "apache-crypt": "1.1.2",
+        "apache-md5": "1.0.6",
+        "node-uuid": "1.4.8"
+      }
+    },
+    "http-deceiver": {
+      "version": "1.2.7",
+      "resolved": "https://registry.npmjs.org/http-deceiver/-/http-deceiver-1.2.7.tgz",
+      "integrity": "sha1-+nFolEq5pRnTN8sL7HKE3D5yPYc=",
+      "dev": true
+    },
+    "http-errors": {
+      "version": "1.6.3",
+      "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.6.3.tgz",
+      "integrity": "sha1-i1VoC7S+KDoLW/TqLjhYC+HZMg0=",
+      "dev": true,
+      "requires": {
+        "depd": "1.1.2",
+        "inherits": "2.0.3",
+        "setprototypeof": "1.1.0",
+        "statuses": "1.4.0"
+      }
+    },
+    "http-parser-js": {
+      "version": "0.4.13",
+      "resolved": "https://registry.npmjs.org/http-parser-js/-/http-parser-js-0.4.13.tgz",
+      "integrity": "sha1-O9bW/ebjFyyTNMOzO2wZPYD+ETc=",
+      "dev": true
+    },
+    "http-proxy": {
+      "version": "1.17.0",
+      "resolved": "https://registry.npmjs.org/http-proxy/-/http-proxy-1.17.0.tgz",
+      "integrity": "sha512-Taqn+3nNvYRfJ3bGvKfBSRwy1v6eePlm3oc/aWVxZp57DQr5Eq3xhKJi7Z4hZpS8PC3H4qI+Yly5EmFacGuA/g==",
+      "dev": true,
+      "requires": {
+        "eventemitter3": "3.1.0",
+        "follow-redirects": "1.5.7",
+        "requires-port": "1.0.0"
+      }
+    },
+    "http-proxy-middleware": {
+      "version": "0.18.0",
+      "resolved": "http://registry.npmjs.org/http-proxy-middleware/-/http-proxy-middleware-0.18.0.tgz",
+      "integrity": "sha512-Fs25KVMPAIIcgjMZkVHJoKg9VcXcC1C8yb9JUgeDvVXY0S/zgVIhMb+qVswDIgtJe2DfckMSY2d6TuTEutlk6Q==",
+      "dev": true,
+      "requires": {
+        "http-proxy": "1.17.0",
+        "is-glob": "4.0.0",
+        "lodash": "4.17.10",
+        "micromatch": "3.1.10"
+      }
+    },
+    "http-signature": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/http-signature/-/http-signature-1.2.0.tgz",
+      "integrity": "sha1-muzZJRFHcvPZW2WmCruPfBj7rOE=",
+      "dev": true,
+      "requires": {
+        "assert-plus": "1.0.0",
+        "jsprim": "1.4.1",
+        "sshpk": "1.14.2"
+      }
+    },
+    "https-browserify": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/https-browserify/-/https-browserify-1.0.0.tgz",
+      "integrity": "sha1-7AbBDgo0wPL68Zn3/X/Hj//QPHM=",
+      "dev": true
+    },
+    "https-proxy-agent": {
+      "version": "2.2.1",
+      "resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-2.2.1.tgz",
+      "integrity": "sha512-HPCTS1LW51bcyMYbxUIOO4HEOlQ1/1qRaFWcyxvwaqUS9TY88aoEuHUY33kuAh1YhVVaDQhLZsnPd+XNARWZlQ==",
+      "dev": true,
+      "requires": {
+        "agent-base": "4.2.1",
+        "debug": "3.1.0"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "3.1.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+          "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+          "dev": true,
+          "requires": {
+            "ms": "2.0.0"
+          }
+        }
+      }
+    },
+    "i18next": {
+      "version": "11.7.0",
+      "resolved": "https://registry.npmjs.org/i18next/-/i18next-11.7.0.tgz",
+      "integrity": "sha512-k4nu76PQMUnN4W8OGFQHK3/FWwG8k/GwXdemzMmYUVLPnpBdF6VfWbpMOpTT3DOFmFw7D6Ndj46EH1EbNNtMjw==",
+      "dev": true
+    },
+    "iconv-lite": {
+      "version": "0.4.19",
+      "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.19.tgz",
+      "integrity": "sha512-oTZqweIP51xaGPI4uPa56/Pri/480R+mo7SeU+YETByQNhDG55ycFyNLIgta9vXhILrxXDmF7ZGhqZIcuN0gJQ=="
+    },
+    "ieee754": {
+      "version": "1.1.12",
+      "resolved": "https://registry.npmjs.org/ieee754/-/ieee754-1.1.12.tgz",
+      "integrity": "sha512-GguP+DRY+pJ3soyIiGPTvdiVXjZ+DbXOxGpXn3eMvNW4x4irjqXm4wHKscC+TfxSJ0yw/S1F24tqdMNsMZTiLA==",
+      "dev": true
+    },
+    "iferr": {
+      "version": "0.1.5",
+      "resolved": "https://registry.npmjs.org/iferr/-/iferr-0.1.5.tgz",
+      "integrity": "sha1-xg7taebY/bazEEofy8ocGS3FtQE=",
+      "dev": true
+    },
+    "ignore": {
+      "version": "3.3.10",
+      "resolved": "https://registry.npmjs.org/ignore/-/ignore-3.3.10.tgz",
+      "integrity": "sha512-Pgs951kaMm5GXP7MOvxERINe3gsaVjUWFm+UZPSq9xYriQAksyhg0csnS0KXSNRD5NmNdapXEpjxG49+AKh/ug==",
+      "dev": true
+    },
+    "ignorefs": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/ignorefs/-/ignorefs-1.2.0.tgz",
+      "integrity": "sha1-2ln7hYl25KXkNwLM0fKC/byeV1Y=",
+      "dev": true,
+      "requires": {
+        "editions": "1.3.4",
+        "ignorepatterns": "1.1.0"
+      }
+    },
+    "ignorepatterns": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/ignorepatterns/-/ignorepatterns-1.1.0.tgz",
+      "integrity": "sha1-rI9DbyI5td+2bV8NOpBKh6xnzF4=",
+      "dev": true
+    },
+    "image-size": {
+      "version": "0.5.5",
+      "resolved": "https://registry.npmjs.org/image-size/-/image-size-0.5.5.tgz",
+      "integrity": "sha1-Cd/Uq50g4p6xw+gLiZA3jfnjy5w=",
+      "dev": true,
+      "optional": true
+    },
+    "immediate": {
+      "version": "3.0.6",
+      "resolved": "https://registry.npmjs.org/immediate/-/immediate-3.0.6.tgz",
+      "integrity": "sha1-nbHb0Pr43m++D13V5Wu2BigN5ps=",
+      "dev": true
+    },
+    "import-cwd": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/import-cwd/-/import-cwd-2.1.0.tgz",
+      "integrity": "sha1-qmzzbnInYShcs3HsZRn1PiQ1sKk=",
+      "dev": true,
+      "requires": {
+        "import-from": "2.1.0"
+      }
+    },
+    "import-from": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/import-from/-/import-from-2.1.0.tgz",
+      "integrity": "sha1-M1238qev/VOqpHHUuAId7ja387E=",
+      "dev": true,
+      "requires": {
+        "resolve-from": "3.0.0"
+      }
+    },
+    "import-lazy": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/import-lazy/-/import-lazy-2.1.0.tgz",
+      "integrity": "sha1-BWmOPUXIjo1+nZLLBYTnfwlvPkM=",
+      "dev": true
+    },
+    "import-local": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/import-local/-/import-local-1.0.0.tgz",
+      "integrity": "sha512-vAaZHieK9qjGo58agRBg+bhHX3hoTZU/Oa3GESWLz7t1U62fk63aHuDJJEteXoDeTCcPmUT+z38gkHPZkkmpmQ==",
+      "dev": true,
+      "requires": {
+        "pkg-dir": "2.0.0",
+        "resolve-cwd": "2.0.0"
+      }
+    },
+    "imurmurhash": {
+      "version": "0.1.4",
+      "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz",
+      "integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=",
+      "dev": true
+    },
+    "in-publish": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/in-publish/-/in-publish-2.0.0.tgz",
+      "integrity": "sha1-4g/146KvwmkDILbcVSaCqcf631E=",
+      "dev": true
+    },
+    "indent-string": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-2.1.0.tgz",
+      "integrity": "sha1-ji1INIdCEhtKghi3oTfppSBJ3IA=",
+      "dev": true,
+      "requires": {
+        "repeating": "2.0.1"
+      }
+    },
+    "indexof": {
+      "version": "0.0.1",
+      "resolved": "https://registry.npmjs.org/indexof/-/indexof-0.0.1.tgz",
+      "integrity": "sha1-gtwzbSMrkGIXnQWrMpOmYFn9Q10=",
+      "dev": true
+    },
+    "inflight": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz",
+      "integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=",
+      "dev": true,
+      "requires": {
+        "once": "1.4.0",
+        "wrappy": "1.0.2"
+      }
+    },
+    "inherits": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.3.tgz",
+      "integrity": "sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4=",
+      "dev": true
+    },
+    "ini": {
+      "version": "1.3.5",
+      "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.5.tgz",
+      "integrity": "sha512-RZY5huIKCMRWDUqZlEi72f/lmXKMvuszcMBduliQ3nnWbx9X/ZBQO7DijMEYS9EhHBb2qacRUMtC7svLwe0lcw==",
+      "dev": true
+    },
+    "injection-js": {
+      "version": "2.2.1",
+      "resolved": "https://registry.npmjs.org/injection-js/-/injection-js-2.2.1.tgz",
+      "integrity": "sha512-zHI+E+dM0PXix5FFTO1Y4/UOyAzE7zG1l/QwAn4jchTThOoBq+UYRFK4AVG7lQgFL+go62SbrzSsjXy9DFEZUg==",
+      "dev": true
+    },
+    "inside": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/inside/-/inside-1.0.0.tgz",
+      "integrity": "sha1-20Xpk1c82z23C5gy6ChbrUZCR3A=",
+      "dev": true
+    },
+    "internal-ip": {
+      "version": "3.0.1",
+      "resolved": "https://registry.npmjs.org/internal-ip/-/internal-ip-3.0.1.tgz",
+      "integrity": "sha512-NXXgESC2nNVtU+pqmC9e6R8B1GpKxzsAQhffvh5AL79qKnodd+L7tnEQmTiUAVngqLalPbSqRA7XGIEL5nCd0Q==",
+      "dev": true,
+      "requires": {
+        "default-gateway": "2.7.2",
+        "ipaddr.js": "1.8.0"
+      }
+    },
+    "invariant": {
+      "version": "2.2.4",
+      "resolved": "https://registry.npmjs.org/invariant/-/invariant-2.2.4.tgz",
+      "integrity": "sha512-phJfQVBuaJM5raOpJjSfkiD6BpbCE4Ns//LaXl6wGYtUBY83nWS6Rf9tXm2e8VaK60JEjYldbPif/A2B1C2gNA==",
+      "dev": true,
+      "requires": {
+        "loose-envify": "1.4.0"
+      }
+    },
+    "invert-kv": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/invert-kv/-/invert-kv-1.0.0.tgz",
+      "integrity": "sha1-EEqOSqym09jNFXqO+L+rLXo//bY=",
+      "dev": true
+    },
+    "ip": {
+      "version": "1.1.5",
+      "resolved": "https://registry.npmjs.org/ip/-/ip-1.1.5.tgz",
+      "integrity": "sha1-vd7XARQpCCjAoDnnLvJfWq7ENUo=",
+      "dev": true
+    },
+    "ip-regex": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/ip-regex/-/ip-regex-2.1.0.tgz",
+      "integrity": "sha1-+ni/XS5pE8kRzp+BnuUUa7bYROk=",
+      "dev": true
+    },
+    "ipaddr.js": {
+      "version": "1.8.0",
+      "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.8.0.tgz",
+      "integrity": "sha1-6qM9bd16zo9/b+DJygRA5wZzix4=",
+      "dev": true
+    },
+    "is-absolute": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-absolute/-/is-absolute-1.0.0.tgz",
+      "integrity": "sha512-dOWoqflvcydARa360Gvv18DZ/gRuHKi2NU/wU5X1ZFzdYfH29nkiNZsF3mp4OJ3H4yo9Mx8A/uAGNzpzPN3yBA==",
+      "dev": true,
+      "requires": {
+        "is-relative": "1.0.0",
+        "is-windows": "1.0.2"
+      }
+    },
+    "is-accessor-descriptor": {
+      "version": "0.1.6",
+      "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz",
+      "integrity": "sha1-qeEss66Nh2cn7u84Q/igiXtcmNY=",
+      "dev": true,
+      "requires": {
+        "kind-of": "3.2.2"
+      },
+      "dependencies": {
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        }
+      }
+    },
+    "is-arrayish": {
+      "version": "0.2.1",
+      "resolved": "https://registry.npmjs.org/is-arrayish/-/is-arrayish-0.2.1.tgz",
+      "integrity": "sha1-d8mYQFJ6qOyxqLppe4BkWnqSap0=",
+      "dev": true
+    },
+    "is-binary-path": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-1.0.1.tgz",
+      "integrity": "sha1-dfFmQrSA8YenEcgUFh/TpKdlWJg=",
+      "dev": true,
+      "requires": {
+        "binary-extensions": "1.11.0"
+      }
+    },
+    "is-buffer": {
+      "version": "1.1.6",
+      "resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz",
+      "integrity": "sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w==",
+      "dev": true
+    },
+    "is-builtin-module": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-builtin-module/-/is-builtin-module-1.0.0.tgz",
+      "integrity": "sha1-VAVy0096wxGfj3bDDLwbHgN6/74=",
+      "dev": true,
+      "requires": {
+        "builtin-modules": "1.1.1"
+      }
+    },
+    "is-callable": {
+      "version": "1.1.4",
+      "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.1.4.tgz",
+      "integrity": "sha512-r5p9sxJjYnArLjObpjA4xu5EKI3CuKHkJXMhT7kwbpUyIFD1n5PMAsoPvWnvtZiNz7LjkYDRZhd7FlI0eMijEA==",
+      "dev": true
+    },
+    "is-ci": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/is-ci/-/is-ci-1.2.0.tgz",
+      "integrity": "sha512-plgvKjQtalH2P3Gytb7L61Lmz95g2DlpzFiQyRSFew8WoJKxtKRzrZMeyRN2supblm3Psc8OQGy7Xjb6XG11jw==",
+      "dev": true,
+      "requires": {
+        "ci-info": "1.4.0"
+      }
+    },
+    "is-data-descriptor": {
+      "version": "0.1.4",
+      "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz",
+      "integrity": "sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y=",
+      "dev": true,
+      "requires": {
+        "kind-of": "3.2.2"
+      },
+      "dependencies": {
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        }
+      }
+    },
+    "is-date-object": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.1.tgz",
+      "integrity": "sha1-mqIOtq7rv/d/vTPnTKAbM1gdOhY=",
+      "dev": true
+    },
+    "is-descriptor": {
+      "version": "0.1.6",
+      "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-0.1.6.tgz",
+      "integrity": "sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg==",
+      "dev": true,
+      "requires": {
+        "is-accessor-descriptor": "0.1.6",
+        "is-data-descriptor": "0.1.4",
+        "kind-of": "5.1.0"
+      },
+      "dependencies": {
+        "kind-of": {
+          "version": "5.1.0",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz",
+          "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==",
+          "dev": true
+        }
+      }
+    },
+    "is-directory": {
+      "version": "0.3.1",
+      "resolved": "https://registry.npmjs.org/is-directory/-/is-directory-0.3.1.tgz",
+      "integrity": "sha1-YTObbyR1/Hcv2cnYP1yFddwVSuE=",
+      "dev": true
+    },
+    "is-dotfile": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/is-dotfile/-/is-dotfile-1.0.3.tgz",
+      "integrity": "sha1-pqLzL/0t+wT1yiXs0Pa4PPeYoeE=",
+      "dev": true
+    },
+    "is-equal-shallow": {
+      "version": "0.1.3",
+      "resolved": "https://registry.npmjs.org/is-equal-shallow/-/is-equal-shallow-0.1.3.tgz",
+      "integrity": "sha1-IjgJj8Ih3gvPpdnqxMRdY4qhxTQ=",
+      "dev": true,
+      "requires": {
+        "is-primitive": "2.0.0"
+      }
+    },
+    "is-extendable": {
+      "version": "0.1.1",
+      "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-0.1.1.tgz",
+      "integrity": "sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik=",
+      "dev": true
+    },
+    "is-extglob": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz",
+      "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=",
+      "dev": true
+    },
+    "is-finite": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/is-finite/-/is-finite-1.0.2.tgz",
+      "integrity": "sha1-zGZ3aVYCvlUO8R6LSqYwU0K20Ko=",
+      "dev": true,
+      "requires": {
+        "number-is-nan": "1.0.1"
+      }
+    },
+    "is-fullwidth-code-point": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz",
+      "integrity": "sha1-754xOG8DGn8NZDr4L95QxFfvAMs=",
+      "dev": true,
+      "requires": {
+        "number-is-nan": "1.0.1"
+      }
+    },
+    "is-glob": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.0.tgz",
+      "integrity": "sha1-lSHHaEXMJhCoUgPd8ICpWML/q8A=",
+      "dev": true,
+      "requires": {
+        "is-extglob": "2.1.1"
+      }
+    },
+    "is-installed-globally": {
+      "version": "0.1.0",
+      "resolved": "https://registry.npmjs.org/is-installed-globally/-/is-installed-globally-0.1.0.tgz",
+      "integrity": "sha1-Df2Y9akRFxbdU13aZJL2e/PSWoA=",
+      "dev": true,
+      "requires": {
+        "global-dirs": "0.1.1",
+        "is-path-inside": "1.0.1"
+      }
+    },
+    "is-module": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-module/-/is-module-1.0.0.tgz",
+      "integrity": "sha1-Mlj7afeMFNW4FdZkM2tM/7ZEFZE=",
+      "dev": true
+    },
+    "is-negated-glob": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-negated-glob/-/is-negated-glob-1.0.0.tgz",
+      "integrity": "sha1-aRC8pdqMleeEtXUbl2z1oQ/uNtI=",
+      "dev": true
+    },
+    "is-npm": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-npm/-/is-npm-1.0.0.tgz",
+      "integrity": "sha1-8vtjpl5JBbQGyGBydloaTceTufQ=",
+      "dev": true
+    },
+    "is-number": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz",
+      "integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=",
+      "dev": true,
+      "requires": {
+        "kind-of": "3.2.2"
+      },
+      "dependencies": {
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        }
+      }
+    },
+    "is-obj": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/is-obj/-/is-obj-1.0.1.tgz",
+      "integrity": "sha1-PkcprB9f3gJc19g6iW2rn09n2w8=",
+      "dev": true
+    },
+    "is-path-cwd": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-path-cwd/-/is-path-cwd-1.0.0.tgz",
+      "integrity": "sha1-0iXsIxMuie3Tj9p2dHLmLmXxEG0=",
+      "dev": true
+    },
+    "is-path-in-cwd": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/is-path-in-cwd/-/is-path-in-cwd-1.0.1.tgz",
+      "integrity": "sha512-FjV1RTW48E7CWM7eE/J2NJvAEEVektecDBVBE5Hh3nM1Jd0kvhHtX68Pr3xsDf857xt3Y4AkwVULK1Vku62aaQ==",
+      "dev": true,
+      "requires": {
+        "is-path-inside": "1.0.1"
+      }
+    },
+    "is-path-inside": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-1.0.1.tgz",
+      "integrity": "sha1-jvW33lBDej/cprToZe96pVy0gDY=",
+      "dev": true,
+      "requires": {
+        "path-is-inside": "1.0.2"
+      }
+    },
+    "is-plain-object": {
+      "version": "2.0.4",
+      "resolved": "https://registry.npmjs.org/is-plain-object/-/is-plain-object-2.0.4.tgz",
+      "integrity": "sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og==",
+      "dev": true,
+      "requires": {
+        "isobject": "3.0.1"
+      }
+    },
+    "is-posix-bracket": {
+      "version": "0.1.1",
+      "resolved": "https://registry.npmjs.org/is-posix-bracket/-/is-posix-bracket-0.1.1.tgz",
+      "integrity": "sha1-MzTceXdDaOkvAW5vvAqI9c1ua8Q=",
+      "dev": true
+    },
+    "is-primitive": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/is-primitive/-/is-primitive-2.0.0.tgz",
+      "integrity": "sha1-IHurkWOEmcB7Kt8kCkGochADRXU=",
+      "dev": true
+    },
+    "is-redirect": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-redirect/-/is-redirect-1.0.0.tgz",
+      "integrity": "sha1-HQPd7VO9jbDzDCbk+V02/HyH3CQ=",
+      "dev": true
+    },
+    "is-regex": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.0.4.tgz",
+      "integrity": "sha1-VRdIm1RwkbCTDglWVM7SXul+lJE=",
+      "dev": true,
+      "requires": {
+        "has": "1.0.3"
+      }
+    },
+    "is-relative": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-relative/-/is-relative-1.0.0.tgz",
+      "integrity": "sha512-Kw/ReK0iqwKeu0MITLFuj0jbPAmEiOsIwyIXvvbfa6QfmN9pkD1M+8pdk7Rl/dTKbH34/XBFMbgD4iMJhLQbGA==",
+      "dev": true,
+      "requires": {
+        "is-unc-path": "1.0.0"
+      }
+    },
+    "is-retry-allowed": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/is-retry-allowed/-/is-retry-allowed-1.1.0.tgz",
+      "integrity": "sha1-EaBgVotnM5REAz0BJaYaINVk+zQ=",
+      "dev": true
+    },
+    "is-stream": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/is-stream/-/is-stream-1.1.0.tgz",
+      "integrity": "sha1-EtSj3U5o4Lec6428hBc66A2RykQ=",
+      "dev": true
+    },
+    "is-symbol": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.1.tgz",
+      "integrity": "sha1-PMWfAAJRlLarLjjbrmaJJWtmBXI=",
+      "dev": true
+    },
+    "is-typedarray": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-typedarray/-/is-typedarray-1.0.0.tgz",
+      "integrity": "sha1-5HnICFjfDBsR3dppQPlgEfzaSpo=",
+      "dev": true
+    },
+    "is-unc-path": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/is-unc-path/-/is-unc-path-1.0.0.tgz",
+      "integrity": "sha512-mrGpVd0fs7WWLfVsStvgF6iEJnbjDFZh9/emhRDcGWTduTfNHd9CHeUwH3gYIjdbwo4On6hunkztwOaAw0yllQ==",
+      "dev": true,
+      "requires": {
+        "unc-path-regex": "0.1.2"
+      }
+    },
+    "is-utf8": {
+      "version": "0.2.1",
+      "resolved": "https://registry.npmjs.org/is-utf8/-/is-utf8-0.2.1.tgz",
+      "integrity": "sha1-Sw2hRCEE0bM2NA6AeX6GXPOffXI=",
+      "dev": true
+    },
+    "is-windows": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/is-windows/-/is-windows-1.0.2.tgz",
+      "integrity": "sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA==",
+      "dev": true
+    },
+    "is-wsl": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-1.1.0.tgz",
+      "integrity": "sha1-HxbkqiKwTRM2tmGIpmrzxgDDpm0=",
+      "dev": true
+    },
+    "isarray": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/isarray/-/isarray-1.0.0.tgz",
+      "integrity": "sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE=",
+      "dev": true
+    },
+    "isbinaryfile": {
+      "version": "3.0.3",
+      "resolved": "https://registry.npmjs.org/isbinaryfile/-/isbinaryfile-3.0.3.tgz",
+      "integrity": "sha512-8cJBL5tTd2OS0dM4jz07wQd5g0dCCqIhUxPIGtZfa5L6hWlvV5MHTITy/DBAsF+Oe2LS1X3krBUhNwaGUWpWxw==",
+      "dev": true,
+      "requires": {
+        "buffer-alloc": "1.2.0"
+      }
+    },
+    "isexe": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz",
+      "integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA=",
+      "dev": true
+    },
+    "isobject": {
+      "version": "3.0.1",
+      "resolved": "https://registry.npmjs.org/isobject/-/isobject-3.0.1.tgz",
+      "integrity": "sha1-TkMekrEalzFjaqH5yNHMvP2reN8=",
+      "dev": true
+    },
+    "isstream": {
+      "version": "0.1.2",
+      "resolved": "https://registry.npmjs.org/isstream/-/isstream-0.1.2.tgz",
+      "integrity": "sha1-R+Y/evVa+m+S4VAOaQ64uFKcCZo=",
+      "dev": true
+    },
+    "istanbul": {
+      "version": "0.4.5",
+      "resolved": "https://registry.npmjs.org/istanbul/-/istanbul-0.4.5.tgz",
+      "integrity": "sha1-ZcfXPUxNqE1POsMQuRj7C4Azczs=",
+      "dev": true,
+      "requires": {
+        "abbrev": "1.0.9",
+        "async": "1.5.2",
+        "escodegen": "1.8.1",
+        "esprima": "2.7.3",
+        "glob": "5.0.15",
+        "handlebars": "4.0.12",
+        "js-yaml": "3.12.0",
+        "mkdirp": "0.5.1",
+        "nopt": "3.0.6",
+        "once": "1.4.0",
+        "resolve": "1.1.7",
+        "supports-color": "3.2.3",
+        "which": "1.3.1",
+        "wordwrap": "1.0.0"
+      },
+      "dependencies": {
+        "glob": {
+          "version": "5.0.15",
+          "resolved": "https://registry.npmjs.org/glob/-/glob-5.0.15.tgz",
+          "integrity": "sha1-G8k2ueAvSmA/zCIuz3Yz0wuLk7E=",
+          "dev": true,
+          "requires": {
+            "inflight": "1.0.6",
+            "inherits": "2.0.3",
+            "minimatch": "3.0.4",
+            "once": "1.4.0",
+            "path-is-absolute": "1.0.1"
+          }
+        },
+        "has-flag": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-1.0.0.tgz",
+          "integrity": "sha1-nZ55MWXOAXoA8AQYxD+UKnsdEfo=",
+          "dev": true
+        },
+        "resolve": {
+          "version": "1.1.7",
+          "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.1.7.tgz",
+          "integrity": "sha1-IDEU2CrSxe2ejgQRs5ModeiJ6Xs=",
+          "dev": true
+        },
+        "supports-color": {
+          "version": "3.2.3",
+          "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-3.2.3.tgz",
+          "integrity": "sha1-ZawFBLOVQXHYpklGsq48u4pfVPY=",
+          "dev": true,
+          "requires": {
+            "has-flag": "1.0.0"
+          }
+        }
+      }
+    },
+    "istanbul-api": {
+      "version": "1.3.7",
+      "resolved": "https://registry.npmjs.org/istanbul-api/-/istanbul-api-1.3.7.tgz",
+      "integrity": "sha512-4/ApBnMVeEPG3EkSzcw25wDe4N66wxwn+KKn6b47vyek8Xb3NBAcg4xfuQbS7BqcZuTX4wxfD5lVagdggR3gyA==",
+      "dev": true,
+      "requires": {
+        "async": "2.6.1",
+        "fileset": "2.0.3",
+        "istanbul-lib-coverage": "1.2.1",
+        "istanbul-lib-hook": "1.2.2",
+        "istanbul-lib-instrument": "1.10.2",
+        "istanbul-lib-report": "1.1.5",
+        "istanbul-lib-source-maps": "1.2.6",
+        "istanbul-reports": "1.5.1",
+        "js-yaml": "3.12.0",
+        "mkdirp": "0.5.1",
+        "once": "1.4.0"
+      },
+      "dependencies": {
+        "async": {
+          "version": "2.6.1",
+          "resolved": "https://registry.npmjs.org/async/-/async-2.6.1.tgz",
+          "integrity": "sha512-fNEiL2+AZt6AlAw/29Cr0UDe4sRAHCpEHh54WMz+Bb7QfNcFw4h3loofyJpLeQs4Yx7yuqu/2dLgM5hKOs6HlQ==",
+          "dev": true,
+          "requires": {
+            "lodash": "4.17.10"
+          }
+        }
+      }
+    },
+    "istanbul-instrumenter-loader": {
+      "version": "3.0.1",
+      "resolved": "https://registry.npmjs.org/istanbul-instrumenter-loader/-/istanbul-instrumenter-loader-3.0.1.tgz",
+      "integrity": "sha512-a5SPObZgS0jB/ixaKSMdn6n/gXSrK2S6q/UfRJBT3e6gQmVjwZROTODQsYW5ZNwOu78hG62Y3fWlebaVOL0C+w==",
+      "dev": true,
+      "requires": {
+        "convert-source-map": "1.6.0",
+        "istanbul-lib-instrument": "1.10.2",
+        "loader-utils": "1.1.0",
+        "schema-utils": "0.3.0"
+      },
+      "dependencies": {
+        "ajv": {
+          "version": "5.5.2",
+          "resolved": "https://registry.npmjs.org/ajv/-/ajv-5.5.2.tgz",
+          "integrity": "sha1-c7Xuyj+rZT49P5Qis0GtQiBdyWU=",
+          "dev": true,
+          "requires": {
+            "co": "4.6.0",
+            "fast-deep-equal": "1.1.0",
+            "fast-json-stable-stringify": "2.0.0",
+            "json-schema-traverse": "0.3.1"
+          }
+        },
+        "schema-utils": {
+          "version": "0.3.0",
+          "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-0.3.0.tgz",
+          "integrity": "sha1-9YdyIs4+kx7a4DnxfrNxbnE3+M8=",
+          "dev": true,
+          "requires": {
+            "ajv": "5.5.2"
+          }
+        }
+      }
+    },
+    "istanbul-lib-coverage": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/istanbul-lib-coverage/-/istanbul-lib-coverage-1.2.1.tgz",
+      "integrity": "sha512-PzITeunAgyGbtY1ibVIUiV679EFChHjoMNRibEIobvmrCRaIgwLxNucOSimtNWUhEib/oO7QY2imD75JVgCJWQ==",
+      "dev": true
+    },
+    "istanbul-lib-hook": {
+      "version": "1.2.2",
+      "resolved": "https://registry.npmjs.org/istanbul-lib-hook/-/istanbul-lib-hook-1.2.2.tgz",
+      "integrity": "sha512-/Jmq7Y1VeHnZEQ3TL10VHyb564mn6VrQXHchON9Jf/AEcmQ3ZIiyD1BVzNOKTZf/G3gE+kiGK6SmpF9y3qGPLw==",
+      "dev": true,
+      "requires": {
+        "append-transform": "0.4.0"
+      }
+    },
+    "istanbul-lib-instrument": {
+      "version": "1.10.2",
+      "resolved": "https://registry.npmjs.org/istanbul-lib-instrument/-/istanbul-lib-instrument-1.10.2.tgz",
+      "integrity": "sha512-aWHxfxDqvh/ZlxR8BBaEPVSWDPUkGD63VjGQn3jcw8jCp7sHEMKcrj4xfJn/ABzdMEHiQNyvDQhqm5o8+SQg7A==",
+      "dev": true,
+      "requires": {
+        "babel-generator": "6.26.1",
+        "babel-template": "6.26.0",
+        "babel-traverse": "6.26.0",
+        "babel-types": "6.26.0",
+        "babylon": "6.18.0",
+        "istanbul-lib-coverage": "1.2.1",
+        "semver": "5.5.1"
+      }
+    },
+    "istanbul-lib-report": {
+      "version": "1.1.5",
+      "resolved": "https://registry.npmjs.org/istanbul-lib-report/-/istanbul-lib-report-1.1.5.tgz",
+      "integrity": "sha512-UsYfRMoi6QO/doUshYNqcKJqVmFe9w51GZz8BS3WB0lYxAllQYklka2wP9+dGZeHYaWIdcXUx8JGdbqaoXRXzw==",
+      "dev": true,
+      "requires": {
+        "istanbul-lib-coverage": "1.2.1",
+        "mkdirp": "0.5.1",
+        "path-parse": "1.0.6",
+        "supports-color": "3.2.3"
+      },
+      "dependencies": {
+        "has-flag": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-1.0.0.tgz",
+          "integrity": "sha1-nZ55MWXOAXoA8AQYxD+UKnsdEfo=",
+          "dev": true
+        },
+        "supports-color": {
+          "version": "3.2.3",
+          "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-3.2.3.tgz",
+          "integrity": "sha1-ZawFBLOVQXHYpklGsq48u4pfVPY=",
+          "dev": true,
+          "requires": {
+            "has-flag": "1.0.0"
+          }
+        }
+      }
+    },
+    "istanbul-lib-source-maps": {
+      "version": "1.2.6",
+      "resolved": "https://registry.npmjs.org/istanbul-lib-source-maps/-/istanbul-lib-source-maps-1.2.6.tgz",
+      "integrity": "sha512-TtbsY5GIHgbMsMiRw35YBHGpZ1DVFEO19vxxeiDMYaeOFOCzfnYVxvl6pOUIZR4dtPhAGpSMup8OyF8ubsaqEg==",
+      "dev": true,
+      "requires": {
+        "debug": "3.1.0",
+        "istanbul-lib-coverage": "1.2.1",
+        "mkdirp": "0.5.1",
+        "rimraf": "2.6.2",
+        "source-map": "0.5.7"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "3.1.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+          "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+          "dev": true,
+          "requires": {
+            "ms": "2.0.0"
+          }
+        }
+      }
+    },
+    "istanbul-reports": {
+      "version": "1.5.1",
+      "resolved": "https://registry.npmjs.org/istanbul-reports/-/istanbul-reports-1.5.1.tgz",
+      "integrity": "sha512-+cfoZ0UXzWjhAdzosCPP3AN8vvef8XDkWtTfgaN+7L3YTpNYITnCaEkceo5SEYy644VkHka/P1FvkWvrG/rrJw==",
+      "dev": true,
+      "requires": {
+        "handlebars": "4.0.12"
+      }
+    },
+    "jasmine": {
+      "version": "2.8.0",
+      "resolved": "https://registry.npmjs.org/jasmine/-/jasmine-2.8.0.tgz",
+      "integrity": "sha1-awicChFXax8W3xG4AUbZHU6Lij4=",
+      "dev": true,
+      "requires": {
+        "exit": "0.1.2",
+        "glob": "7.1.3",
+        "jasmine-core": "2.8.0"
+      },
+      "dependencies": {
+        "jasmine-core": {
+          "version": "2.8.0",
+          "resolved": "https://registry.npmjs.org/jasmine-core/-/jasmine-core-2.8.0.tgz",
+          "integrity": "sha1-vMl5rh+f0FcB5F5S5l06XWPxok4=",
+          "dev": true
+        }
+      }
+    },
+    "jasmine-core": {
+      "version": "2.99.1",
+      "resolved": "https://registry.npmjs.org/jasmine-core/-/jasmine-core-2.99.1.tgz",
+      "integrity": "sha1-5kAN8ea1bhMLYcS80JPap/boyhU=",
+      "dev": true
+    },
+    "jasmine-diff": {
+      "version": "0.1.3",
+      "resolved": "https://registry.npmjs.org/jasmine-diff/-/jasmine-diff-0.1.3.tgz",
+      "integrity": "sha1-k8zC3MQQKMXd1GBlWAdIOfLe6qg=",
+      "dev": true,
+      "requires": {
+        "diff": "3.5.0"
+      }
+    },
+    "jasmine-spec-reporter": {
+      "version": "4.2.1",
+      "resolved": "https://registry.npmjs.org/jasmine-spec-reporter/-/jasmine-spec-reporter-4.2.1.tgz",
+      "integrity": "sha512-FZBoZu7VE5nR7Nilzy+Np8KuVIOxF4oXDPDknehCYBDE080EnlPu0afdZNmpGDBRCUBv3mj5qgqCRmk6W/K8vg==",
+      "dev": true,
+      "requires": {
+        "colors": "1.1.2"
+      }
+    },
+    "jasminewd2": {
+      "version": "2.2.0",
+      "resolved": "https://registry.npmjs.org/jasminewd2/-/jasminewd2-2.2.0.tgz",
+      "integrity": "sha1-43zwsX8ZnM4jvqcbIDk5Uka07E4=",
+      "dev": true
+    },
+    "js-base64": {
+      "version": "2.4.9",
+      "resolved": "https://registry.npmjs.org/js-base64/-/js-base64-2.4.9.tgz",
+      "integrity": "sha512-xcinL3AuDJk7VSzsHgb9DvvIXayBbadtMZ4HFPx8rUszbW1MuNMlwYVC4zzCZ6e1sqZpnNS5ZFYOhXqA39T7LQ==",
+      "dev": true
+    },
+    "js-tokens": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-3.0.2.tgz",
+      "integrity": "sha1-mGbfOVECEw449/mWvOtlRDIJwls=",
+      "dev": true
+    },
+    "js-yaml": {
+      "version": "3.12.0",
+      "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-3.12.0.tgz",
+      "integrity": "sha512-PIt2cnwmPfL4hKNwqeiuz4bKfnzHTBv6HyVgjahA6mPLwPDzjDWrplJBMjHUFxku/N3FlmrbyPclad+I+4mJ3A==",
+      "dev": true,
+      "requires": {
+        "argparse": "1.0.10",
+        "esprima": "4.0.1"
+      },
+      "dependencies": {
+        "esprima": {
+          "version": "4.0.1",
+          "resolved": "https://registry.npmjs.org/esprima/-/esprima-4.0.1.tgz",
+          "integrity": "sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A==",
+          "dev": true
+        }
+      }
+    },
+    "jsbn": {
+      "version": "0.1.1",
+      "resolved": "https://registry.npmjs.org/jsbn/-/jsbn-0.1.1.tgz",
+      "integrity": "sha1-peZUwuWi3rXyAdls77yoDA7y9RM=",
+      "dev": true,
+      "optional": true
+    },
+    "jsesc": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-1.3.0.tgz",
+      "integrity": "sha1-RsP+yMGJKxKwgz25vHYiF226s0s=",
+      "dev": true
+    },
+    "json-parse-better-errors": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/json-parse-better-errors/-/json-parse-better-errors-1.0.2.tgz",
+      "integrity": "sha512-mrqyZKfX5EhL7hvqcV6WG1yYjnjeuYDzDhhcAAUrq8Po85NBQBJP+ZDUT75qZQ98IkUoBqdkExkukOU7Ts2wrw==",
+      "dev": true
+    },
+    "json-schema": {
+      "version": "0.2.3",
+      "resolved": "https://registry.npmjs.org/json-schema/-/json-schema-0.2.3.tgz",
+      "integrity": "sha1-tIDIkuWaLwWVTOcnvT8qTogvnhM=",
+      "dev": true
+    },
+    "json-schema-traverse": {
+      "version": "0.3.1",
+      "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.3.1.tgz",
+      "integrity": "sha1-NJptRMU6Ud6JtAgFxdXlm0F9M0A=",
+      "dev": true
+    },
+    "json-stringify-safe": {
+      "version": "5.0.1",
+      "resolved": "https://registry.npmjs.org/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz",
+      "integrity": "sha1-Epai1Y/UXxmg9s4B1lcB4sc1tus=",
+      "dev": true
+    },
+    "json3": {
+      "version": "3.3.2",
+      "resolved": "https://registry.npmjs.org/json3/-/json3-3.3.2.tgz",
+      "integrity": "sha1-PAQ0dD35Pi9cQq7nsZvLSDV19OE=",
+      "dev": true
+    },
+    "json5": {
+      "version": "0.5.1",
+      "resolved": "https://registry.npmjs.org/json5/-/json5-0.5.1.tgz",
+      "integrity": "sha1-Hq3nrMASA0rYTiOWdn6tn6VJWCE=",
+      "dev": true
+    },
+    "jsonfile": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/jsonfile/-/jsonfile-4.0.0.tgz",
+      "integrity": "sha1-h3Gq4HmbZAdrdmQPygWPnBDjPss=",
+      "dev": true,
+      "requires": {
+        "graceful-fs": "4.1.11"
+      }
+    },
+    "jsprim": {
+      "version": "1.4.1",
+      "resolved": "https://registry.npmjs.org/jsprim/-/jsprim-1.4.1.tgz",
+      "integrity": "sha1-MT5mvB5cwG5Di8G3SZwuXFastqI=",
+      "dev": true,
+      "requires": {
+        "assert-plus": "1.0.0",
+        "extsprintf": "1.3.0",
+        "json-schema": "0.2.3",
+        "verror": "1.10.0"
+      }
+    },
+    "jszip": {
+      "version": "3.1.5",
+      "resolved": "https://registry.npmjs.org/jszip/-/jszip-3.1.5.tgz",
+      "integrity": "sha512-5W8NUaFRFRqTOL7ZDDrx5qWHJyBXy6velVudIzQUSoqAAYqzSh2Z7/m0Rf1QbmQJccegD0r+YZxBjzqoBiEeJQ==",
+      "dev": true,
+      "requires": {
+        "core-js": "2.3.0",
+        "es6-promise": "3.0.2",
+        "lie": "3.1.1",
+        "pako": "1.0.6",
+        "readable-stream": "2.0.6"
+      },
+      "dependencies": {
+        "core-js": {
+          "version": "2.3.0",
+          "resolved": "https://registry.npmjs.org/core-js/-/core-js-2.3.0.tgz",
+          "integrity": "sha1-+rg/uwstjchfpjbEudNMdUIMbWU=",
+          "dev": true
+        },
+        "es6-promise": {
+          "version": "3.0.2",
+          "resolved": "https://registry.npmjs.org/es6-promise/-/es6-promise-3.0.2.tgz",
+          "integrity": "sha1-AQ1YWEI6XxGJeWZfRkhqlcbuK7Y=",
+          "dev": true
+        },
+        "process-nextick-args": {
+          "version": "1.0.7",
+          "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-1.0.7.tgz",
+          "integrity": "sha1-FQ4gt1ZZCtP5EJPyWk8q2L/zC6M=",
+          "dev": true
+        },
+        "readable-stream": {
+          "version": "2.0.6",
+          "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.0.6.tgz",
+          "integrity": "sha1-j5A0HmilPMySh4jaz80Rs265t44=",
+          "dev": true,
+          "requires": {
+            "core-util-is": "1.0.2",
+            "inherits": "2.0.3",
+            "isarray": "1.0.0",
+            "process-nextick-args": "1.0.7",
+            "string_decoder": "0.10.31",
+            "util-deprecate": "1.0.2"
+          }
+        },
+        "string_decoder": {
+          "version": "0.10.31",
+          "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz",
+          "integrity": "sha1-YuIDvEF2bGwoyfyEMB2rHFMQ+pQ=",
+          "dev": true
+        }
+      }
+    },
+    "karma": {
+      "version": "1.7.1",
+      "resolved": "https://registry.npmjs.org/karma/-/karma-1.7.1.tgz",
+      "integrity": "sha512-k5pBjHDhmkdaUccnC7gE3mBzZjcxyxYsYVaqiL2G5AqlfLyBO5nw2VdNK+O16cveEPd/gIOWULH7gkiYYwVNHg==",
+      "dev": true,
+      "requires": {
+        "bluebird": "3.5.2",
+        "body-parser": "1.18.2",
+        "chokidar": "1.7.0",
+        "colors": "1.1.2",
+        "combine-lists": "1.0.1",
+        "connect": "3.6.6",
+        "core-js": "2.5.7",
+        "di": "0.0.1",
+        "dom-serialize": "2.2.1",
+        "expand-braces": "0.1.2",
+        "glob": "7.1.3",
+        "graceful-fs": "4.1.11",
+        "http-proxy": "1.17.0",
+        "isbinaryfile": "3.0.3",
+        "lodash": "3.10.1",
+        "log4js": "0.6.38",
+        "mime": "1.6.0",
+        "minimatch": "3.0.4",
+        "optimist": "0.6.1",
+        "qjobs": "1.2.0",
+        "range-parser": "1.2.0",
+        "rimraf": "2.6.2",
+        "safe-buffer": "5.1.2",
+        "socket.io": "1.7.3",
+        "source-map": "0.5.7",
+        "tmp": "0.0.31",
+        "useragent": "2.3.0"
+      },
+      "dependencies": {
+        "anymatch": {
+          "version": "1.3.2",
+          "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-1.3.2.tgz",
+          "integrity": "sha512-0XNayC8lTHQ2OI8aljNCN3sSx6hsr/1+rlcDAotXJR7C1oZZHCNsfpbKwMjRA3Uqb5tF1Rae2oloTr4xpq+WjA==",
+          "dev": true,
+          "requires": {
+            "micromatch": "2.3.11",
+            "normalize-path": "2.1.1"
+          }
+        },
+        "arr-diff": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-2.0.0.tgz",
+          "integrity": "sha1-jzuCf5Vai9ZpaX5KQlasPOrjVs8=",
+          "dev": true,
+          "requires": {
+            "arr-flatten": "1.1.0"
+          }
+        },
+        "array-unique": {
+          "version": "0.2.1",
+          "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.2.1.tgz",
+          "integrity": "sha1-odl8yvy8JiXMcPrc6zalDFiwGlM=",
+          "dev": true
+        },
+        "braces": {
+          "version": "1.8.5",
+          "resolved": "https://registry.npmjs.org/braces/-/braces-1.8.5.tgz",
+          "integrity": "sha1-uneWLhLf+WnWt2cR6RS3N4V79qc=",
+          "dev": true,
+          "requires": {
+            "expand-range": "1.8.2",
+            "preserve": "0.2.0",
+            "repeat-element": "1.1.3"
+          }
+        },
+        "chokidar": {
+          "version": "1.7.0",
+          "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-1.7.0.tgz",
+          "integrity": "sha1-eY5ol3gVHIB2tLNg5e3SjNortGg=",
+          "dev": true,
+          "requires": {
+            "anymatch": "1.3.2",
+            "async-each": "1.0.1",
+            "fsevents": "1.2.4",
+            "glob-parent": "2.0.0",
+            "inherits": "2.0.3",
+            "is-binary-path": "1.0.1",
+            "is-glob": "2.0.1",
+            "path-is-absolute": "1.0.1",
+            "readdirp": "2.1.0"
+          }
+        },
+        "expand-brackets": {
+          "version": "0.1.5",
+          "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-0.1.5.tgz",
+          "integrity": "sha1-3wcoTjQqgHzXM6xa9yQR5YHRF3s=",
+          "dev": true,
+          "requires": {
+            "is-posix-bracket": "0.1.1"
+          }
+        },
+        "extglob": {
+          "version": "0.3.2",
+          "resolved": "https://registry.npmjs.org/extglob/-/extglob-0.3.2.tgz",
+          "integrity": "sha1-Lhj/PS9JqydlzskCPwEdqo2DSaE=",
+          "dev": true,
+          "requires": {
+            "is-extglob": "1.0.0"
+          }
+        },
+        "glob-parent": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-2.0.0.tgz",
+          "integrity": "sha1-gTg9ctsFT8zPUzbaqQLxgvbtuyg=",
+          "dev": true,
+          "requires": {
+            "is-glob": "2.0.1"
+          }
+        },
+        "is-extglob": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-1.0.0.tgz",
+          "integrity": "sha1-rEaBd8SUNAWgkvyPKXYMb/xiBsA=",
+          "dev": true
+        },
+        "is-glob": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-2.0.1.tgz",
+          "integrity": "sha1-0Jb5JqPe1WAPP9/ZEZjLCIjC2GM=",
+          "dev": true,
+          "requires": {
+            "is-extglob": "1.0.0"
+          }
+        },
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        },
+        "lodash": {
+          "version": "3.10.1",
+          "resolved": "http://registry.npmjs.org/lodash/-/lodash-3.10.1.tgz",
+          "integrity": "sha1-W/Rejkm6QYnhfUgnid/RW9FAt7Y=",
+          "dev": true
+        },
+        "micromatch": {
+          "version": "2.3.11",
+          "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-2.3.11.tgz",
+          "integrity": "sha1-hmd8l9FyCzY0MdBNDRUpO9OMFWU=",
+          "dev": true,
+          "requires": {
+            "arr-diff": "2.0.0",
+            "array-unique": "0.2.1",
+            "braces": "1.8.5",
+            "expand-brackets": "0.1.5",
+            "extglob": "0.3.2",
+            "filename-regex": "2.0.1",
+            "is-extglob": "1.0.0",
+            "is-glob": "2.0.1",
+            "kind-of": "3.2.2",
+            "normalize-path": "2.1.1",
+            "object.omit": "2.0.1",
+            "parse-glob": "3.0.4",
+            "regex-cache": "0.4.4"
+          }
+        }
+      }
+    },
+    "karma-chrome-launcher": {
+      "version": "2.2.0",
+      "resolved": "https://registry.npmjs.org/karma-chrome-launcher/-/karma-chrome-launcher-2.2.0.tgz",
+      "integrity": "sha512-uf/ZVpAabDBPvdPdveyk1EPgbnloPvFFGgmRhYLTDH7gEB4nZdSBk8yTU47w1g/drLSx5uMOkjKk7IWKfWg/+w==",
+      "dev": true,
+      "requires": {
+        "fs-access": "1.0.1",
+        "which": "1.3.1"
+      }
+    },
+    "karma-coverage-istanbul-reporter": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/karma-coverage-istanbul-reporter/-/karma-coverage-istanbul-reporter-1.4.3.tgz",
+      "integrity": "sha1-O13/RmT6W41RlrmInj9hwforgNk=",
+      "dev": true,
+      "requires": {
+        "istanbul-api": "1.3.7",
+        "minimatch": "3.0.4"
+      }
+    },
+    "karma-firefox-launcher": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/karma-firefox-launcher/-/karma-firefox-launcher-1.1.0.tgz",
+      "integrity": "sha512-LbZ5/XlIXLeQ3cqnCbYLn+rOVhuMIK9aZwlP6eOLGzWdo1UVp7t6CN3DP4SafiRLjexKwHeKHDm0c38Mtd3VxA==",
+      "dev": true
+    },
+    "karma-jasmine": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/karma-jasmine/-/karma-jasmine-1.1.2.tgz",
+      "integrity": "sha1-OU8rJf+0pkS5rabyLUQ+L9CIhsM=",
+      "dev": true
+    },
+    "karma-jasmine-html-reporter": {
+      "version": "0.2.2",
+      "resolved": "https://registry.npmjs.org/karma-jasmine-html-reporter/-/karma-jasmine-html-reporter-0.2.2.tgz",
+      "integrity": "sha1-SKjl7xiAdhfuK14zwRlMNbQ5Ukw=",
+      "dev": true,
+      "requires": {
+        "karma-jasmine": "1.1.2"
+      }
+    },
+    "karma-source-map-support": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/karma-source-map-support/-/karma-source-map-support-1.3.0.tgz",
+      "integrity": "sha512-HcPqdAusNez/ywa+biN4EphGz62MmQyPggUsDfsHqa7tSe4jdsxgvTKuDfIazjL+IOxpVWyT7Pr4dhAV+sxX5Q==",
+      "dev": true,
+      "requires": {
+        "source-map-support": "0.5.9"
+      }
+    },
+    "killable": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/killable/-/killable-1.0.0.tgz",
+      "integrity": "sha1-2ouEvUfeU5WHj5XWTQLyRJ/gXms=",
+      "dev": true
+    },
+    "kind-of": {
+      "version": "6.0.2",
+      "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-6.0.2.tgz",
+      "integrity": "sha512-s5kLOcnH0XqDO+FvuaLX8DDjZ18CGFk7VygH40QoKPUQhW4e2rvM0rwUq0t8IQDOwYSeLK01U90OjzBTme2QqA==",
+      "dev": true
+    },
+    "latest-version": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/latest-version/-/latest-version-3.1.0.tgz",
+      "integrity": "sha1-ogU4P+oyKzO1rjsYq+4NwvNW7hU=",
+      "dev": true,
+      "requires": {
+        "package-json": "4.0.1"
+      }
+    },
+    "lazy-cache": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/lazy-cache/-/lazy-cache-1.0.4.tgz",
+      "integrity": "sha1-odePw6UEdMuAhF07O24dpJpEbo4=",
+      "dev": true,
+      "optional": true
+    },
+    "lcid": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/lcid/-/lcid-1.0.0.tgz",
+      "integrity": "sha1-MIrMr6C8SDo4Z7S28rlQYlHRuDU=",
+      "dev": true,
+      "requires": {
+        "invert-kv": "1.0.0"
+      }
+    },
+    "leb": {
+      "version": "0.3.0",
+      "resolved": "https://registry.npmjs.org/leb/-/leb-0.3.0.tgz",
+      "integrity": "sha1-Mr7p+tFoMo1q6oUi2DP0GA7tHaM=",
+      "dev": true
+    },
+    "less": {
+      "version": "3.8.1",
+      "resolved": "https://registry.npmjs.org/less/-/less-3.8.1.tgz",
+      "integrity": "sha512-8HFGuWmL3FhQR0aH89escFNBQH/nEiYPP2ltDFdQw2chE28Yx2E3lhAIq9Y2saYwLSwa699s4dBVEfCY8Drf7Q==",
+      "dev": true,
+      "requires": {
+        "clone": "2.1.2",
+        "errno": "0.1.7",
+        "graceful-fs": "4.1.11",
+        "image-size": "0.5.5",
+        "mime": "1.6.0",
+        "mkdirp": "0.5.1",
+        "promise": "7.3.1",
+        "request": "2.88.0",
+        "source-map": "0.6.1"
+      },
+      "dependencies": {
+        "source-map": {
+          "version": "0.6.1",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+          "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+          "dev": true,
+          "optional": true
+        }
+      }
+    },
+    "less-loader": {
+      "version": "4.1.0",
+      "resolved": "https://registry.npmjs.org/less-loader/-/less-loader-4.1.0.tgz",
+      "integrity": "sha512-KNTsgCE9tMOM70+ddxp9yyt9iHqgmSs0yTZc5XH5Wo+g80RWRIYNqE58QJKm/yMud5wZEvz50ugRDuzVIkyahg==",
+      "dev": true,
+      "requires": {
+        "clone": "2.1.2",
+        "loader-utils": "1.1.0",
+        "pify": "3.0.0"
+      }
+    },
+    "levn": {
+      "version": "0.3.0",
+      "resolved": "https://registry.npmjs.org/levn/-/levn-0.3.0.tgz",
+      "integrity": "sha1-OwmSTt+fCDwEkP3UwLxEIeBHZO4=",
+      "dev": true,
+      "requires": {
+        "prelude-ls": "1.1.2",
+        "type-check": "0.3.2"
+      }
+    },
+    "license-webpack-plugin": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/license-webpack-plugin/-/license-webpack-plugin-1.4.0.tgz",
+      "integrity": "sha512-iwuNFMWbXS76WiQXJBTs8/7Tby4NQnY8AIkBMuJG5El79UT8zWrJQMfpW+KRXt4Y2Bs5uk+Myg/MO7ROSF8jzA==",
+      "dev": true,
+      "requires": {
+        "ejs": "2.6.1"
+      }
+    },
+    "lie": {
+      "version": "3.1.1",
+      "resolved": "https://registry.npmjs.org/lie/-/lie-3.1.1.tgz",
+      "integrity": "sha1-mkNrLMd0bKWd56QfpGmz77dr2H4=",
+      "dev": true,
+      "requires": {
+        "immediate": "3.0.6"
+      }
+    },
+    "live-server": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/live-server/-/live-server-1.1.0.tgz",
+      "integrity": "sha1-pp8ObKWB4DkapXlBlw4XwwjdSGk=",
+      "dev": true,
+      "requires": {
+        "colors": "1.3.2",
+        "connect": "3.4.1",
+        "cors": "2.8.4",
+        "event-stream": "3.3.5",
+        "faye-websocket": "0.11.1",
+        "http-auth": "2.4.11",
+        "morgan": "1.9.0",
+        "object-assign": "4.1.1",
+        "opn": "5.3.0",
+        "proxy-middleware": "0.15.0",
+        "send": "0.16.2",
+        "serve-index": "1.9.1",
+        "watchr": "2.6.0"
+      },
+      "dependencies": {
+        "colors": {
+          "version": "1.3.2",
+          "resolved": "https://registry.npmjs.org/colors/-/colors-1.3.2.tgz",
+          "integrity": "sha512-rhP0JSBGYvpcNQj4s5AdShMeE5ahMop96cTeDl/v9qQQm2fYClE2QXZRi8wLzc+GmXSxdIqqbOIAhyObEXDbfQ==",
+          "dev": true
+        },
+        "connect": {
+          "version": "3.4.1",
+          "resolved": "https://registry.npmjs.org/connect/-/connect-3.4.1.tgz",
+          "integrity": "sha1-ohNh0/QJnvdhzabcSpc7seuwo00=",
+          "dev": true,
+          "requires": {
+            "debug": "2.2.0",
+            "finalhandler": "0.4.1",
+            "parseurl": "1.3.2",
+            "utils-merge": "1.0.0"
+          }
+        },
+        "debug": {
+          "version": "2.2.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz",
+          "integrity": "sha1-+HBX6ZWxofauaklgZkE3vFbwOdo=",
+          "dev": true,
+          "requires": {
+            "ms": "0.7.1"
+          }
+        },
+        "faye-websocket": {
+          "version": "0.11.1",
+          "resolved": "https://registry.npmjs.org/faye-websocket/-/faye-websocket-0.11.1.tgz",
+          "integrity": "sha1-8O/hjE9W5PQK/H4Gxxn9XuYYjzg=",
+          "dev": true,
+          "requires": {
+            "websocket-driver": "0.7.0"
+          }
+        },
+        "finalhandler": {
+          "version": "0.4.1",
+          "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-0.4.1.tgz",
+          "integrity": "sha1-haF8bFmpRxfSYtYSMNSw6+PUoU0=",
+          "dev": true,
+          "requires": {
+            "debug": "2.2.0",
+            "escape-html": "1.0.3",
+            "on-finished": "2.3.0",
+            "unpipe": "1.0.0"
+          }
+        },
+        "mime": {
+          "version": "1.4.1",
+          "resolved": "https://registry.npmjs.org/mime/-/mime-1.4.1.tgz",
+          "integrity": "sha512-KI1+qOZu5DcW6wayYHSzR/tXKCDC5Om4s1z2QJjDULzLcmf3DvzS7oluY4HCTrc+9FiKmWUgeNLg7W3uIQvxtQ==",
+          "dev": true
+        },
+        "ms": {
+          "version": "0.7.1",
+          "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz",
+          "integrity": "sha1-nNE8A62/8ltl7/3nzoZO6VIBcJg=",
+          "dev": true
+        },
+        "object-assign": {
+          "version": "4.1.1",
+          "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
+          "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=",
+          "dev": true
+        },
+        "opn": {
+          "version": "5.3.0",
+          "resolved": "https://registry.npmjs.org/opn/-/opn-5.3.0.tgz",
+          "integrity": "sha512-bYJHo/LOmoTd+pfiYhfZDnf9zekVJrY+cnS2a5F2x+w5ppvTqObojTP7WiFG+kVZs9Inw+qQ/lw7TroWwhdd2g==",
+          "dev": true,
+          "requires": {
+            "is-wsl": "1.1.0"
+          }
+        },
+        "send": {
+          "version": "0.16.2",
+          "resolved": "https://registry.npmjs.org/send/-/send-0.16.2.tgz",
+          "integrity": "sha512-E64YFPUssFHEFBvpbbjr44NCLtI1AohxQ8ZSiJjQLskAdKuriYEP6VyGEsRDH8ScozGpkaX1BGvhanqCwkcEZw==",
+          "dev": true,
+          "requires": {
+            "debug": "2.6.9",
+            "depd": "1.1.2",
+            "destroy": "1.0.4",
+            "encodeurl": "1.0.2",
+            "escape-html": "1.0.3",
+            "etag": "1.8.1",
+            "fresh": "0.5.2",
+            "http-errors": "1.6.3",
+            "mime": "1.4.1",
+            "ms": "2.0.0",
+            "on-finished": "2.3.0",
+            "range-parser": "1.2.0",
+            "statuses": "1.4.0"
+          },
+          "dependencies": {
+            "debug": {
+              "version": "2.6.9",
+              "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
+              "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+              "dev": true,
+              "requires": {
+                "ms": "2.0.0"
+              }
+            },
+            "ms": {
+              "version": "2.0.0",
+              "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
+              "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=",
+              "dev": true
+            }
+          }
+        },
+        "utils-merge": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.0.tgz",
+          "integrity": "sha1-ApT7kiu5N1FTVBxPcJYjHyh8ivg=",
+          "dev": true
+        }
+      }
+    },
+    "load-json-file": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-1.1.0.tgz",
+      "integrity": "sha1-lWkFcI1YtLq0wiYbBPWfMcmTdMA=",
+      "dev": true,
+      "requires": {
+        "graceful-fs": "4.1.11",
+        "parse-json": "2.2.0",
+        "pify": "2.3.0",
+        "pinkie-promise": "2.0.1",
+        "strip-bom": "2.0.0"
+      },
+      "dependencies": {
+        "pify": {
+          "version": "2.3.0",
+          "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+          "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=",
+          "dev": true
+        }
+      }
+    },
+    "loader-runner": {
+      "version": "2.3.0",
+      "resolved": "https://registry.npmjs.org/loader-runner/-/loader-runner-2.3.0.tgz",
+      "integrity": "sha1-9IKuqC1UPgeSFwDVpG7yb9rGuKI=",
+      "dev": true
+    },
+    "loader-utils": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/loader-utils/-/loader-utils-1.1.0.tgz",
+      "integrity": "sha1-yYrvSIvM7aL/teLeZG1qdUQp9c0=",
+      "dev": true,
+      "requires": {
+        "big.js": "3.2.0",
+        "emojis-list": "2.1.0",
+        "json5": "0.5.1"
+      }
+    },
+    "locate-path": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-2.0.0.tgz",
+      "integrity": "sha1-K1aLJl7slExtnA3pw9u7ygNUzY4=",
+      "dev": true,
+      "requires": {
+        "p-locate": "2.0.0",
+        "path-exists": "3.0.0"
+      }
+    },
+    "lodash": {
+      "version": "4.17.10",
+      "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.10.tgz",
+      "integrity": "sha512-UejweD1pDoXu+AD825lWwp4ZGtSwgnpZxb3JDViD7StjQz+Nb/6l093lx4OQ0foGWNRoc19mWy7BzL+UAK2iVg==",
+      "dev": true
+    },
+    "lodash.assign": {
+      "version": "4.2.0",
+      "resolved": "https://registry.npmjs.org/lodash.assign/-/lodash.assign-4.2.0.tgz",
+      "integrity": "sha1-DZnzzNem0mHRm9rrkkUAXShYCOc=",
+      "dev": true
+    },
+    "lodash.clonedeep": {
+      "version": "4.5.0",
+      "resolved": "https://registry.npmjs.org/lodash.clonedeep/-/lodash.clonedeep-4.5.0.tgz",
+      "integrity": "sha1-4j8/nE+Pvd6HJSnBBxhXoIblzO8=",
+      "dev": true
+    },
+    "lodash.debounce": {
+      "version": "4.0.8",
+      "resolved": "https://registry.npmjs.org/lodash.debounce/-/lodash.debounce-4.0.8.tgz",
+      "integrity": "sha1-gteb/zCmfEAF/9XiUVMArZyk168=",
+      "dev": true
+    },
+    "lodash.mergewith": {
+      "version": "4.6.1",
+      "resolved": "https://registry.npmjs.org/lodash.mergewith/-/lodash.mergewith-4.6.1.tgz",
+      "integrity": "sha512-eWw5r+PYICtEBgrBE5hhlT6aAa75f411bgDz/ZL2KZqYV03USvucsxcHUIlGTDTECs1eunpI7HOV7U+WLDvNdQ==",
+      "dev": true
+    },
+    "lodash.tail": {
+      "version": "4.1.1",
+      "resolved": "https://registry.npmjs.org/lodash.tail/-/lodash.tail-4.1.1.tgz",
+      "integrity": "sha1-0jM6NtnncXyK0vfKyv7HwytERmQ=",
+      "dev": true
+    },
+    "log4js": {
+      "version": "0.6.38",
+      "resolved": "http://registry.npmjs.org/log4js/-/log4js-0.6.38.tgz",
+      "integrity": "sha1-LElBFmldb7JUgJQ9P8hy5mKlIv0=",
+      "dev": true,
+      "requires": {
+        "readable-stream": "1.0.34",
+        "semver": "4.3.6"
+      },
+      "dependencies": {
+        "isarray": {
+          "version": "0.0.1",
+          "resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz",
+          "integrity": "sha1-ihis/Kmo9Bd+Cav8YDiTmwXR7t8=",
+          "dev": true
+        },
+        "readable-stream": {
+          "version": "1.0.34",
+          "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-1.0.34.tgz",
+          "integrity": "sha1-Elgg40vIQtLyqq+v5MKRbuMsFXw=",
+          "dev": true,
+          "requires": {
+            "core-util-is": "1.0.2",
+            "inherits": "2.0.3",
+            "isarray": "0.0.1",
+            "string_decoder": "0.10.31"
+          }
+        },
+        "semver": {
+          "version": "4.3.6",
+          "resolved": "https://registry.npmjs.org/semver/-/semver-4.3.6.tgz",
+          "integrity": "sha1-MAvG4OhjdPe6YQaLWx7NV/xlMto=",
+          "dev": true
+        },
+        "string_decoder": {
+          "version": "0.10.31",
+          "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-0.10.31.tgz",
+          "integrity": "sha1-YuIDvEF2bGwoyfyEMB2rHFMQ+pQ=",
+          "dev": true
+        }
+      }
+    },
+    "loglevel": {
+      "version": "1.6.1",
+      "resolved": "https://registry.npmjs.org/loglevel/-/loglevel-1.6.1.tgz",
+      "integrity": "sha1-4PyVEztu8nbNyIh82vJKpvFW+Po=",
+      "dev": true
+    },
+    "long": {
+      "version": "3.2.0",
+      "resolved": "https://registry.npmjs.org/long/-/long-3.2.0.tgz",
+      "integrity": "sha1-2CG3E4yhy1gcFymQ7xTbIAtcR0s=",
+      "dev": true
+    },
+    "longest": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/longest/-/longest-1.0.1.tgz",
+      "integrity": "sha1-MKCy2jj3N3DoKUoNIuZiXtd9AJc=",
+      "dev": true
+    },
+    "loose-envify": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz",
+      "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==",
+      "dev": true,
+      "requires": {
+        "js-tokens": "3.0.2"
+      }
+    },
+    "loud-rejection": {
+      "version": "1.6.0",
+      "resolved": "https://registry.npmjs.org/loud-rejection/-/loud-rejection-1.6.0.tgz",
+      "integrity": "sha1-W0b4AUft7leIcPCG0Eghz5mOVR8=",
+      "dev": true,
+      "requires": {
+        "currently-unhandled": "0.4.1",
+        "signal-exit": "3.0.2"
+      }
+    },
+    "lower-case": {
+      "version": "1.1.4",
+      "resolved": "https://registry.npmjs.org/lower-case/-/lower-case-1.1.4.tgz",
+      "integrity": "sha1-miyr0bno4K6ZOkv31YdcOcQujqw=",
+      "dev": true
+    },
+    "lowercase-keys": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/lowercase-keys/-/lowercase-keys-1.0.1.tgz",
+      "integrity": "sha512-G2Lj61tXDnVFFOi8VZds+SoQjtQC3dgokKdDG2mTm1tx4m50NUHBOZSBwQQHyy0V12A0JTG4icfZQH+xPyh8VA==",
+      "dev": true
+    },
+    "lru-cache": {
+      "version": "4.1.3",
+      "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-4.1.3.tgz",
+      "integrity": "sha512-fFEhvcgzuIoJVUF8fYr5KR0YqxD238zgObTps31YdADwPPAp82a4M8TrckkWyx7ekNlf9aBcVn81cFwwXngrJA==",
+      "dev": true,
+      "requires": {
+        "pseudomap": "1.0.2",
+        "yallist": "2.1.2"
+      }
+    },
+    "lunr": {
+      "version": "2.3.2",
+      "resolved": "https://registry.npmjs.org/lunr/-/lunr-2.3.2.tgz",
+      "integrity": "sha512-3wO9shK+cBcJ260ibDtw3JGY+xE0so0y90Dt5YY4e+VmhZO8z8l4cwdau09Fiud0nZHdSgNsIKFHUy3MbXm00A==",
+      "dev": true
+    },
+    "macos-release": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/macos-release/-/macos-release-1.1.0.tgz",
+      "integrity": "sha512-mmLbumEYMi5nXReB9js3WGsB8UE6cDBWyIO62Z4DNx6GbRhDxHNjA1MlzSpJ2S2KM1wyiPRA0d19uHWYYvMHjA==",
+      "dev": true
+    },
+    "magic-string": {
+      "version": "0.22.5",
+      "resolved": "https://registry.npmjs.org/magic-string/-/magic-string-0.22.5.tgz",
+      "integrity": "sha512-oreip9rJZkzvA8Qzk9HFs8fZGF/u7H/gtrE8EN6RjKJ9kh2HlC+yQ2QezifqTZfGyiuAV0dRv5a+y/8gBb1m9w==",
+      "dev": true,
+      "requires": {
+        "vlq": "0.2.3"
+      }
+    },
+    "make-dir": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-1.3.0.tgz",
+      "integrity": "sha512-2w31R7SJtieJJnQtGc7RVL2StM2vGYVfqUOvUDxH6bC6aJTxPxTF0GnIgCyu7tjockiUWAYQRbxa7vKn34s5sQ==",
+      "dev": true,
+      "requires": {
+        "pify": "3.0.0"
+      }
+    },
+    "make-error": {
+      "version": "1.3.5",
+      "resolved": "https://registry.npmjs.org/make-error/-/make-error-1.3.5.tgz",
+      "integrity": "sha512-c3sIjNUow0+8swNwVpqoH4YCShKNFkMaw6oH1mNS2haDZQqkeZFlHS3dhoeEbKKmJB4vXpJucU6oH75aDYeE9g==",
+      "dev": true
+    },
+    "map-cache": {
+      "version": "0.2.2",
+      "resolved": "https://registry.npmjs.org/map-cache/-/map-cache-0.2.2.tgz",
+      "integrity": "sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8=",
+      "dev": true
+    },
+    "map-obj": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/map-obj/-/map-obj-1.0.1.tgz",
+      "integrity": "sha1-2TPOuSBdgr3PSIb2dCvcK03qFG0=",
+      "dev": true
+    },
+    "map-stream": {
+      "version": "0.0.7",
+      "resolved": "https://registry.npmjs.org/map-stream/-/map-stream-0.0.7.tgz",
+      "integrity": "sha1-ih8HiW2CsQkmvTdEokIACfiJdKg=",
+      "dev": true
+    },
+    "map-visit": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/map-visit/-/map-visit-1.0.0.tgz",
+      "integrity": "sha1-7Nyo8TFE5mDxtb1B8S80edmN+48=",
+      "dev": true,
+      "requires": {
+        "object-visit": "1.0.1"
+      }
+    },
+    "marked": {
+      "version": "0.4.0",
+      "resolved": "https://registry.npmjs.org/marked/-/marked-0.4.0.tgz",
+      "integrity": "sha512-tMsdNBgOsrUophCAFQl0XPe6Zqk/uy9gnue+jIIKhykO51hxyu6uNx7zBPy0+y/WKYVZZMspV9YeXLNdKk+iYw==",
+      "dev": true
+    },
+    "math-random": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/math-random/-/math-random-1.0.1.tgz",
+      "integrity": "sha1-izqsWIuKZuSXXjzepn97sylgH6w=",
+      "dev": true
+    },
+    "md5.js": {
+      "version": "1.3.4",
+      "resolved": "https://registry.npmjs.org/md5.js/-/md5.js-1.3.4.tgz",
+      "integrity": "sha1-6b296UogpawYsENA/Fdk1bCdkB0=",
+      "dev": true,
+      "requires": {
+        "hash-base": "3.0.4",
+        "inherits": "2.0.3"
+      }
+    },
+    "media-typer": {
+      "version": "0.3.0",
+      "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz",
+      "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=",
+      "dev": true
+    },
+    "mem": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/mem/-/mem-1.1.0.tgz",
+      "integrity": "sha1-Xt1StIXKHZAP5kiVUFOZoN+kX3Y=",
+      "dev": true,
+      "requires": {
+        "mimic-fn": "1.2.0"
+      }
+    },
+    "memory-fs": {
+      "version": "0.4.1",
+      "resolved": "https://registry.npmjs.org/memory-fs/-/memory-fs-0.4.1.tgz",
+      "integrity": "sha1-OpoguEYlI+RHz7x+i7gO1me/xVI=",
+      "dev": true,
+      "requires": {
+        "errno": "0.1.7",
+        "readable-stream": "2.3.6"
+      }
+    },
+    "meow": {
+      "version": "3.7.0",
+      "resolved": "https://registry.npmjs.org/meow/-/meow-3.7.0.tgz",
+      "integrity": "sha1-cstmi0JSKCkKu/qFaJJYcwioAfs=",
+      "dev": true,
+      "requires": {
+        "camelcase-keys": "2.1.0",
+        "decamelize": "1.2.0",
+        "loud-rejection": "1.6.0",
+        "map-obj": "1.0.1",
+        "minimist": "1.2.0",
+        "normalize-package-data": "2.4.0",
+        "object-assign": "4.1.1",
+        "read-pkg-up": "1.0.1",
+        "redent": "1.0.0",
+        "trim-newlines": "1.0.0"
+      },
+      "dependencies": {
+        "minimist": {
+          "version": "1.2.0",
+          "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+          "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+          "dev": true
+        }
+      }
+    },
+    "merge-descriptors": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz",
+      "integrity": "sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E=",
+      "dev": true
+    },
+    "merge2": {
+      "version": "1.2.2",
+      "resolved": "https://registry.npmjs.org/merge2/-/merge2-1.2.2.tgz",
+      "integrity": "sha512-bgM8twH86rWni21thii6WCMQMRMmwqqdW3sGWi9IipnVAszdLXRjwDwAnyrVXo6DuP3AjRMMttZKUB48QWIFGg==",
+      "dev": true
+    },
+    "methods": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz",
+      "integrity": "sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4=",
+      "dev": true
+    },
+    "micromatch": {
+      "version": "3.1.10",
+      "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-3.1.10.tgz",
+      "integrity": "sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg==",
+      "dev": true,
+      "requires": {
+        "arr-diff": "4.0.0",
+        "array-unique": "0.3.2",
+        "braces": "2.3.2",
+        "define-property": "2.0.2",
+        "extend-shallow": "3.0.2",
+        "extglob": "2.0.4",
+        "fragment-cache": "0.2.1",
+        "kind-of": "6.0.2",
+        "nanomatch": "1.2.13",
+        "object.pick": "1.3.0",
+        "regex-not": "1.0.2",
+        "snapdragon": "0.8.2",
+        "to-regex": "3.0.2"
+      }
+    },
+    "miller-rabin": {
+      "version": "4.0.1",
+      "resolved": "https://registry.npmjs.org/miller-rabin/-/miller-rabin-4.0.1.tgz",
+      "integrity": "sha512-115fLhvZVqWwHPbClyntxEVfVDfl9DLLTuJvq3g2O/Oxi8AiNouAHvDSzHS0viUJc+V5vm3eq91Xwqn9dp4jRA==",
+      "dev": true,
+      "requires": {
+        "bn.js": "4.11.8",
+        "brorand": "1.1.0"
+      }
+    },
+    "mime": {
+      "version": "1.6.0",
+      "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz",
+      "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==",
+      "dev": true
+    },
+    "mime-db": {
+      "version": "1.36.0",
+      "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.36.0.tgz",
+      "integrity": "sha512-L+xvyD9MkoYMXb1jAmzI/lWYAxAMCPvIBSWur0PZ5nOf5euahRLVqH//FKW9mWp2lkqUgYiXPgkzfMUFi4zVDw==",
+      "dev": true
+    },
+    "mime-types": {
+      "version": "2.1.20",
+      "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.20.tgz",
+      "integrity": "sha512-HrkrPaP9vGuWbLK1B1FfgAkbqNjIuy4eHlIYnFi7kamZyLLrGlo2mpcx0bBmNpKqBtYtAfGbodDddIgddSJC2A==",
+      "dev": true,
+      "requires": {
+        "mime-db": "1.36.0"
+      }
+    },
+    "mimic-fn": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/mimic-fn/-/mimic-fn-1.2.0.tgz",
+      "integrity": "sha512-jf84uxzwiuiIVKiOLpfYk7N46TSy8ubTonmneY9vrpHNAnp0QBt2BxWV9dO3/j+BoVAb+a5G6YDPW3M5HOdMWQ==",
+      "dev": true
+    },
+    "mini-css-extract-plugin": {
+      "version": "0.4.2",
+      "resolved": "https://registry.npmjs.org/mini-css-extract-plugin/-/mini-css-extract-plugin-0.4.2.tgz",
+      "integrity": "sha512-ots7URQH4wccfJq9Ssrzu2+qupbncAce4TmTzunI9CIwlQMp2XI+WNUw6xWF6MMAGAm1cbUVINrSjATaVMyKXg==",
+      "dev": true,
+      "requires": {
+        "loader-utils": "1.1.0",
+        "schema-utils": "1.0.0",
+        "webpack-sources": "1.2.0"
+      },
+      "dependencies": {
+        "schema-utils": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz",
+          "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==",
+          "dev": true,
+          "requires": {
+            "ajv": "6.4.0",
+            "ajv-errors": "1.0.0",
+            "ajv-keywords": "3.2.0"
+          }
+        }
+      }
+    },
+    "minimalistic-assert": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz",
+      "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A==",
+      "dev": true
+    },
+    "minimalistic-crypto-utils": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/minimalistic-crypto-utils/-/minimalistic-crypto-utils-1.0.1.tgz",
+      "integrity": "sha1-9sAMHAsIIkblxNmd+4x8CDsrWCo=",
+      "dev": true
+    },
+    "minimatch": {
+      "version": "3.0.4",
+      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.0.4.tgz",
+      "integrity": "sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==",
+      "dev": true,
+      "requires": {
+        "brace-expansion": "1.1.11"
+      }
+    },
+    "minimist": {
+      "version": "0.0.8",
+      "resolved": "http://registry.npmjs.org/minimist/-/minimist-0.0.8.tgz",
+      "integrity": "sha1-hX/Kv8M5fSYluCKCYuhqp6ARsF0=",
+      "dev": true
+    },
+    "mississippi": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/mississippi/-/mississippi-2.0.0.tgz",
+      "integrity": "sha512-zHo8v+otD1J10j/tC+VNoGK9keCuByhKovAvdn74dmxJl9+mWHnx6EMsDN4lgRoMI/eYo2nchAxniIbUPb5onw==",
+      "dev": true,
+      "requires": {
+        "concat-stream": "1.6.2",
+        "duplexify": "3.6.0",
+        "end-of-stream": "1.4.1",
+        "flush-write-stream": "1.0.3",
+        "from2": "2.3.0",
+        "parallel-transform": "1.1.0",
+        "pump": "2.0.1",
+        "pumpify": "1.5.1",
+        "stream-each": "1.2.3",
+        "through2": "2.0.3"
+      }
+    },
+    "mixin-deep": {
+      "version": "1.3.1",
+      "resolved": "https://registry.npmjs.org/mixin-deep/-/mixin-deep-1.3.1.tgz",
+      "integrity": "sha512-8ZItLHeEgaqEvd5lYBXfm4EZSFCX29Jb9K+lAHhDKzReKBQKj3R+7NOF6tjqYi9t4oI8VUfaWITJQm86wnXGNQ==",
+      "dev": true,
+      "requires": {
+        "for-in": "1.0.2",
+        "is-extendable": "1.0.1"
+      },
+      "dependencies": {
+        "is-extendable": {
+          "version": "1.0.1",
+          "resolved": "https://registry.npmjs.org/is-extendable/-/is-extendable-1.0.1.tgz",
+          "integrity": "sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA==",
+          "dev": true,
+          "requires": {
+            "is-plain-object": "2.0.4"
+          }
+        }
+      }
+    },
+    "mixin-object": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/mixin-object/-/mixin-object-2.0.1.tgz",
+      "integrity": "sha1-T7lJRB2rGCVA8f4DW6YOGUel5X4=",
+      "dev": true,
+      "requires": {
+        "for-in": "0.1.8",
+        "is-extendable": "0.1.1"
+      },
+      "dependencies": {
+        "for-in": {
+          "version": "0.1.8",
+          "resolved": "https://registry.npmjs.org/for-in/-/for-in-0.1.8.tgz",
+          "integrity": "sha1-2Hc5COMSVhCZUrH9ubP6hn0ndeE=",
+          "dev": true
+        }
+      }
+    },
+    "mkdirp": {
+      "version": "0.5.1",
+      "resolved": "http://registry.npmjs.org/mkdirp/-/mkdirp-0.5.1.tgz",
+      "integrity": "sha1-MAV0OOrGz3+MR2fzhkjWaX11yQM=",
+      "dev": true,
+      "requires": {
+        "minimist": "0.0.8"
+      }
+    },
+    "morgan": {
+      "version": "1.9.0",
+      "resolved": "https://registry.npmjs.org/morgan/-/morgan-1.9.0.tgz",
+      "integrity": "sha1-0B+mxlhZt2/PMbPLU6OCGjEdgFE=",
+      "dev": true,
+      "requires": {
+        "basic-auth": "2.0.0",
+        "debug": "2.6.9",
+        "depd": "1.1.2",
+        "on-finished": "2.3.0",
+        "on-headers": "1.0.1"
+      }
+    },
+    "move-concurrently": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/move-concurrently/-/move-concurrently-1.0.1.tgz",
+      "integrity": "sha1-viwAX9oy4LKa8fBdfEszIUxwH5I=",
+      "dev": true,
+      "requires": {
+        "aproba": "1.2.0",
+        "copy-concurrently": "1.0.5",
+        "fs-write-stream-atomic": "1.0.10",
+        "mkdirp": "0.5.1",
+        "rimraf": "2.6.2",
+        "run-queue": "1.0.3"
+      }
+    },
+    "ms": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
+      "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=",
+      "dev": true
+    },
+    "multicast-dns": {
+      "version": "6.2.3",
+      "resolved": "https://registry.npmjs.org/multicast-dns/-/multicast-dns-6.2.3.tgz",
+      "integrity": "sha512-ji6J5enbMyGRHIAkAOu3WdV8nggqviKCEKtXcOqfphZZtQrmHKycfynJ2V7eVPUA4NhJ6V7Wf4TmGbTwKE9B6g==",
+      "dev": true,
+      "requires": {
+        "dns-packet": "1.3.1",
+        "thunky": "1.0.2"
+      }
+    },
+    "multicast-dns-service-types": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/multicast-dns-service-types/-/multicast-dns-service-types-1.1.0.tgz",
+      "integrity": "sha1-iZ8R2WhuXgXLkbNdXw5jt3PPyQE=",
+      "dev": true
+    },
+    "multimatch": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/multimatch/-/multimatch-2.1.0.tgz",
+      "integrity": "sha1-nHkGoi+0wCkZ4vX3UWG0zb1LKis=",
+      "dev": true,
+      "requires": {
+        "array-differ": "1.0.0",
+        "array-union": "1.0.2",
+        "arrify": "1.0.1",
+        "minimatch": "3.0.4"
+      }
+    },
+    "nan": {
+      "version": "2.11.0",
+      "resolved": "https://registry.npmjs.org/nan/-/nan-2.11.0.tgz",
+      "integrity": "sha512-F4miItu2rGnV2ySkXOQoA8FKz/SR2Q2sWP0sbTxNxz/tuokeC8WxOhPMcwi0qIyGtVn/rrSeLbvVkznqCdwYnw==",
+      "dev": true
+    },
+    "nanomatch": {
+      "version": "1.2.13",
+      "resolved": "https://registry.npmjs.org/nanomatch/-/nanomatch-1.2.13.tgz",
+      "integrity": "sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA==",
+      "dev": true,
+      "requires": {
+        "arr-diff": "4.0.0",
+        "array-unique": "0.3.2",
+        "define-property": "2.0.2",
+        "extend-shallow": "3.0.2",
+        "fragment-cache": "0.2.1",
+        "is-windows": "1.0.2",
+        "kind-of": "6.0.2",
+        "object.pick": "1.3.0",
+        "regex-not": "1.0.2",
+        "snapdragon": "0.8.2",
+        "to-regex": "3.0.2"
+      }
+    },
+    "negotiator": {
+      "version": "0.6.1",
+      "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.1.tgz",
+      "integrity": "sha1-KzJxhOiZIQEXeyhWP7XnECrNDKk=",
+      "dev": true
+    },
+    "neo-async": {
+      "version": "2.5.2",
+      "resolved": "https://registry.npmjs.org/neo-async/-/neo-async-2.5.2.tgz",
+      "integrity": "sha512-vdqTKI9GBIYcAEbFAcpKPErKINfPF5zIuz3/niBfq8WUZjpT2tytLlFVrBgWdOtqI4uaA/Rb6No0hux39XXDuw==",
+      "dev": true
+    },
+    "ng-packagr": {
+      "version": "3.0.6",
+      "resolved": "https://registry.npmjs.org/ng-packagr/-/ng-packagr-3.0.6.tgz",
+      "integrity": "sha512-gVhJdrf0RNygxBLk6Qfby7l+y6pIjpVikyS95wuKPwzihvW14cz/KNKQOwNPbKCeVwPhVxflpH2atW5vxsq9cQ==",
+      "dev": true,
+      "requires": {
+        "@ngtools/json-schema": "1.1.0",
+        "autoprefixer": "8.6.5",
+        "browserslist": "3.2.8",
+        "chalk": "2.4.1",
+        "commander": "2.17.1",
+        "fs-extra": "6.0.1",
+        "glob": "7.1.3",
+        "injection-js": "2.2.1",
+        "less": "3.8.1",
+        "node-sass": "4.9.3",
+        "node-sass-tilde-importer": "1.0.2",
+        "postcss": "6.0.23",
+        "postcss-clean": "1.1.0",
+        "postcss-url": "7.3.2",
+        "read-pkg-up": "3.0.0",
+        "rimraf": "2.6.2",
+        "rollup": "0.59.4",
+        "rollup-plugin-commonjs": "9.1.6",
+        "rollup-plugin-node-resolve": "3.4.0",
+        "rollup-plugin-sourcemaps": "0.4.2",
+        "rxjs": "6.3.2",
+        "strip-bom": "3.0.0",
+        "stylus": "0.54.5",
+        "uglify-js": "3.4.9",
+        "update-notifier": "2.5.0"
+      },
+      "dependencies": {
+        "chalk": {
+          "version": "2.4.1",
+          "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.1.tgz",
+          "integrity": "sha512-ObN6h1v2fTJSmUXoS3nMQ92LbDK9be4TV+6G+omQlGJFdcUX5heKi1LZ1YnRMIgwTLEj3E24bT6tYni50rlCfQ==",
+          "dev": true,
+          "requires": {
+            "ansi-styles": "3.2.1",
+            "escape-string-regexp": "1.0.5",
+            "supports-color": "5.5.0"
+          }
+        },
+        "load-json-file": {
+          "version": "4.0.0",
+          "resolved": "https://registry.npmjs.org/load-json-file/-/load-json-file-4.0.0.tgz",
+          "integrity": "sha1-L19Fq5HjMhYjT9U62rZo607AmTs=",
+          "dev": true,
+          "requires": {
+            "graceful-fs": "4.1.11",
+            "parse-json": "4.0.0",
+            "pify": "3.0.0",
+            "strip-bom": "3.0.0"
+          }
+        },
+        "parse-json": {
+          "version": "4.0.0",
+          "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-4.0.0.tgz",
+          "integrity": "sha1-vjX1Qlvh9/bHRxhPmKeIy5lHfuA=",
+          "dev": true,
+          "requires": {
+            "error-ex": "1.3.2",
+            "json-parse-better-errors": "1.0.2"
+          }
+        },
+        "read-pkg": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-3.0.0.tgz",
+          "integrity": "sha1-nLxoaXj+5l0WwA4rGcI3/Pbjg4k=",
+          "dev": true,
+          "requires": {
+            "load-json-file": "4.0.0",
+            "normalize-package-data": "2.4.0",
+            "path-type": "3.0.0"
+          }
+        },
+        "read-pkg-up": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-3.0.0.tgz",
+          "integrity": "sha1-PtSWaF26D4/hGNBpHcUfSh/5bwc=",
+          "dev": true,
+          "requires": {
+            "find-up": "2.1.0",
+            "read-pkg": "3.0.0"
+          }
+        },
+        "strip-bom": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz",
+          "integrity": "sha1-IzTBjpx1n3vdVv3vfprj1YjmjtM=",
+          "dev": true
+        }
+      }
+    },
+    "nice-try": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/nice-try/-/nice-try-1.0.5.tgz",
+      "integrity": "sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ==",
+      "dev": true
+    },
+    "no-case": {
+      "version": "2.3.2",
+      "resolved": "https://registry.npmjs.org/no-case/-/no-case-2.3.2.tgz",
+      "integrity": "sha512-rmTZ9kz+f3rCvK2TD1Ue/oZlns7OGoIWP4fc3llxxRXlOkHKoWPPWJOfFYpITabSow43QJbRIoHQXtt10VldyQ==",
+      "dev": true,
+      "requires": {
+        "lower-case": "1.1.4"
+      }
+    },
+    "node-forge": {
+      "version": "0.7.5",
+      "resolved": "https://registry.npmjs.org/node-forge/-/node-forge-0.7.5.tgz",
+      "integrity": "sha512-MmbQJ2MTESTjt3Gi/3yG1wGpIMhUfcIypUCGtTizFR9IiccFwxSpfp0vtIZlkFclEqERemxfnSdZEMR9VqqEFQ==",
+      "dev": true
+    },
+    "node-gyp": {
+      "version": "3.8.0",
+      "resolved": "https://registry.npmjs.org/node-gyp/-/node-gyp-3.8.0.tgz",
+      "integrity": "sha512-3g8lYefrRRzvGeSowdJKAKyks8oUpLEd/DyPV4eMhVlhJ0aNaZqIrNUIPuEWWTAoPqyFkfGrM67MC69baqn6vA==",
+      "dev": true,
+      "requires": {
+        "fstream": "1.0.11",
+        "glob": "7.1.3",
+        "graceful-fs": "4.1.11",
+        "mkdirp": "0.5.1",
+        "nopt": "3.0.6",
+        "npmlog": "4.1.2",
+        "osenv": "0.1.5",
+        "request": "2.88.0",
+        "rimraf": "2.6.2",
+        "semver": "5.3.0",
+        "tar": "2.2.1",
+        "which": "1.3.1"
+      },
+      "dependencies": {
+        "semver": {
+          "version": "5.3.0",
+          "resolved": "https://registry.npmjs.org/semver/-/semver-5.3.0.tgz",
+          "integrity": "sha1-myzl094C0XxgEq0yaqa00M9U+U8=",
+          "dev": true
+        }
+      }
+    },
+    "node-libs-browser": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/node-libs-browser/-/node-libs-browser-2.1.0.tgz",
+      "integrity": "sha512-5AzFzdoIMb89hBGMZglEegffzgRg+ZFoUmisQ8HI4j1KDdpx13J0taNp2y9xPbur6W61gepGDDotGBVQ7mfUCg==",
+      "dev": true,
+      "requires": {
+        "assert": "1.4.1",
+        "browserify-zlib": "0.2.0",
+        "buffer": "4.9.1",
+        "console-browserify": "1.1.0",
+        "constants-browserify": "1.0.0",
+        "crypto-browserify": "3.12.0",
+        "domain-browser": "1.2.0",
+        "events": "1.1.1",
+        "https-browserify": "1.0.0",
+        "os-browserify": "0.3.0",
+        "path-browserify": "0.0.0",
+        "process": "0.11.10",
+        "punycode": "1.4.1",
+        "querystring-es3": "0.2.1",
+        "readable-stream": "2.3.6",
+        "stream-browserify": "2.0.1",
+        "stream-http": "2.8.3",
+        "string_decoder": "1.1.1",
+        "timers-browserify": "2.0.10",
+        "tty-browserify": "0.0.0",
+        "url": "0.11.0",
+        "util": "0.10.4",
+        "vm-browserify": "0.0.4"
+      },
+      "dependencies": {
+        "punycode": {
+          "version": "1.4.1",
+          "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz",
+          "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=",
+          "dev": true
+        }
+      }
+    },
+    "node-sass": {
+      "version": "4.9.3",
+      "resolved": "https://registry.npmjs.org/node-sass/-/node-sass-4.9.3.tgz",
+      "integrity": "sha512-XzXyGjO+84wxyH7fV6IwBOTrEBe2f0a6SBze9QWWYR/cL74AcQUks2AsqcCZenl/Fp/JVbuEaLpgrLtocwBUww==",
+      "dev": true,
+      "requires": {
+        "async-foreach": "0.1.3",
+        "chalk": "1.1.3",
+        "cross-spawn": "3.0.1",
+        "gaze": "1.1.3",
+        "get-stdin": "4.0.1",
+        "glob": "7.1.3",
+        "in-publish": "2.0.0",
+        "lodash.assign": "4.2.0",
+        "lodash.clonedeep": "4.5.0",
+        "lodash.mergewith": "4.6.1",
+        "meow": "3.7.0",
+        "mkdirp": "0.5.1",
+        "nan": "2.11.0",
+        "node-gyp": "3.8.0",
+        "npmlog": "4.1.2",
+        "request": "2.87.0",
+        "sass-graph": "2.2.4",
+        "stdout-stream": "1.4.1",
+        "true-case-path": "1.0.3"
+      },
+      "dependencies": {
+        "ajv": {
+          "version": "5.5.2",
+          "resolved": "https://registry.npmjs.org/ajv/-/ajv-5.5.2.tgz",
+          "integrity": "sha1-c7Xuyj+rZT49P5Qis0GtQiBdyWU=",
+          "dev": true,
+          "requires": {
+            "co": "4.6.0",
+            "fast-deep-equal": "1.1.0",
+            "fast-json-stable-stringify": "2.0.0",
+            "json-schema-traverse": "0.3.1"
+          }
+        },
+        "ansi-styles": {
+          "version": "2.2.1",
+          "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz",
+          "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=",
+          "dev": true
+        },
+        "chalk": {
+          "version": "1.1.3",
+          "resolved": "http://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz",
+          "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=",
+          "dev": true,
+          "requires": {
+            "ansi-styles": "2.2.1",
+            "escape-string-regexp": "1.0.5",
+            "has-ansi": "2.0.0",
+            "strip-ansi": "3.0.1",
+            "supports-color": "2.0.0"
+          }
+        },
+        "har-validator": {
+          "version": "5.0.3",
+          "resolved": "https://registry.npmjs.org/har-validator/-/har-validator-5.0.3.tgz",
+          "integrity": "sha1-ukAsJmGU8VlW7xXg/PJCmT9qff0=",
+          "dev": true,
+          "requires": {
+            "ajv": "5.5.2",
+            "har-schema": "2.0.0"
+          }
+        },
+        "oauth-sign": {
+          "version": "0.8.2",
+          "resolved": "https://registry.npmjs.org/oauth-sign/-/oauth-sign-0.8.2.tgz",
+          "integrity": "sha1-Rqarfwrq2N6unsBWV4C31O/rnUM=",
+          "dev": true
+        },
+        "punycode": {
+          "version": "1.4.1",
+          "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz",
+          "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=",
+          "dev": true
+        },
+        "request": {
+          "version": "2.87.0",
+          "resolved": "https://registry.npmjs.org/request/-/request-2.87.0.tgz",
+          "integrity": "sha512-fcogkm7Az5bsS6Sl0sibkbhcKsnyon/jV1kF3ajGmF0c8HrttdKTPRT9hieOaQHA5HEq6r8OyWOo/o781C1tNw==",
+          "dev": true,
+          "requires": {
+            "aws-sign2": "0.7.0",
+            "aws4": "1.8.0",
+            "caseless": "0.12.0",
+            "combined-stream": "1.0.6",
+            "extend": "3.0.2",
+            "forever-agent": "0.6.1",
+            "form-data": "2.3.2",
+            "har-validator": "5.0.3",
+            "http-signature": "1.2.0",
+            "is-typedarray": "1.0.0",
+            "isstream": "0.1.2",
+            "json-stringify-safe": "5.0.1",
+            "mime-types": "2.1.20",
+            "oauth-sign": "0.8.2",
+            "performance-now": "2.1.0",
+            "qs": "6.5.2",
+            "safe-buffer": "5.1.2",
+            "tough-cookie": "2.3.4",
+            "tunnel-agent": "0.6.0",
+            "uuid": "3.3.2"
+          }
+        },
+        "supports-color": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz",
+          "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=",
+          "dev": true
+        },
+        "tough-cookie": {
+          "version": "2.3.4",
+          "resolved": "https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.3.4.tgz",
+          "integrity": "sha512-TZ6TTfI5NtZnuyy/Kecv+CnoROnyXn2DN97LontgQpCwsX2XyLYCC0ENhYkehSOwAp8rTQKc/NUIF7BkQ5rKLA==",
+          "dev": true,
+          "requires": {
+            "punycode": "1.4.1"
+          }
+        }
+      }
+    },
+    "node-sass-tilde-importer": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/node-sass-tilde-importer/-/node-sass-tilde-importer-1.0.2.tgz",
+      "integrity": "sha512-Swcmr38Y7uB78itQeBm3mThjxBy9/Ah/ykPIaURY/L6Nec9AyRoL/jJ7ECfMR+oZeCTVQNxVMu/aHU+TLRVbdg==",
+      "dev": true,
+      "requires": {
+        "find-parent-dir": "0.3.0"
+      }
+    },
+    "node-uuid": {
+      "version": "1.4.8",
+      "resolved": "https://registry.npmjs.org/node-uuid/-/node-uuid-1.4.8.tgz",
+      "integrity": "sha1-sEDrCSOWivq/jTL7HxfxFn/auQc=",
+      "dev": true
+    },
+    "nopt": {
+      "version": "3.0.6",
+      "resolved": "https://registry.npmjs.org/nopt/-/nopt-3.0.6.tgz",
+      "integrity": "sha1-xkZdvwirzU2zWTF/eaxopkayj/k=",
+      "dev": true,
+      "requires": {
+        "abbrev": "1.0.9"
+      }
+    },
+    "normalize-package-data": {
+      "version": "2.4.0",
+      "resolved": "https://registry.npmjs.org/normalize-package-data/-/normalize-package-data-2.4.0.tgz",
+      "integrity": "sha512-9jjUFbTPfEy3R/ad/2oNbKtW9Hgovl5O1FvFWKkKblNXoN/Oou6+9+KKohPK13Yc3/TyunyWhJp6gvRNR/PPAw==",
+      "dev": true,
+      "requires": {
+        "hosted-git-info": "2.7.1",
+        "is-builtin-module": "1.0.0",
+        "semver": "5.5.1",
+        "validate-npm-package-license": "3.0.4"
+      }
+    },
+    "normalize-path": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-2.1.1.tgz",
+      "integrity": "sha1-GrKLVW4Zg2Oowab35vogE3/mrtk=",
+      "dev": true,
+      "requires": {
+        "remove-trailing-separator": "1.1.0"
+      }
+    },
+    "normalize-range": {
+      "version": "0.1.2",
+      "resolved": "https://registry.npmjs.org/normalize-range/-/normalize-range-0.1.2.tgz",
+      "integrity": "sha1-LRDAa9/TEuqXd2laTShDlFa3WUI=",
+      "dev": true
+    },
+    "npm-package-arg": {
+      "version": "6.1.0",
+      "resolved": "https://registry.npmjs.org/npm-package-arg/-/npm-package-arg-6.1.0.tgz",
+      "integrity": "sha512-zYbhP2k9DbJhA0Z3HKUePUgdB1x7MfIfKssC+WLPFMKTBZKpZh5m13PgexJjCq6KW7j17r0jHWcCpxEqnnncSA==",
+      "dev": true,
+      "requires": {
+        "hosted-git-info": "2.7.1",
+        "osenv": "0.1.5",
+        "semver": "5.5.1",
+        "validate-npm-package-name": "3.0.0"
+      }
+    },
+    "npm-registry-client": {
+      "version": "8.6.0",
+      "resolved": "https://registry.npmjs.org/npm-registry-client/-/npm-registry-client-8.6.0.tgz",
+      "integrity": "sha512-Qs6P6nnopig+Y8gbzpeN/dkt+n7IyVd8f45NTMotGk6Qo7GfBmzwYx6jRLoOOgKiMnaQfYxsuyQlD8Mc3guBhg==",
+      "dev": true,
+      "requires": {
+        "concat-stream": "1.6.2",
+        "graceful-fs": "4.1.11",
+        "normalize-package-data": "2.4.0",
+        "npm-package-arg": "6.1.0",
+        "npmlog": "4.1.2",
+        "once": "1.4.0",
+        "request": "2.88.0",
+        "retry": "0.10.1",
+        "safe-buffer": "5.1.2",
+        "semver": "5.5.1",
+        "slide": "1.1.6",
+        "ssri": "5.3.0"
+      }
+    },
+    "npm-run-path": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-2.0.2.tgz",
+      "integrity": "sha1-NakjLfo11wZ7TLLd8jV7GHFTbF8=",
+      "dev": true,
+      "requires": {
+        "path-key": "2.0.1"
+      }
+    },
+    "npmlog": {
+      "version": "4.1.2",
+      "resolved": "https://registry.npmjs.org/npmlog/-/npmlog-4.1.2.tgz",
+      "integrity": "sha512-2uUqazuKlTaSI/dC8AzicUck7+IrEaOnN/e0jd3Xtt1KcGpwx30v50mL7oPyr/h9bL3E4aZccVwpwP+5W9Vjkg==",
+      "dev": true,
+      "requires": {
+        "are-we-there-yet": "1.1.5",
+        "console-control-strings": "1.1.0",
+        "gauge": "2.7.4",
+        "set-blocking": "2.0.0"
+      }
+    },
+    "nth-check": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/nth-check/-/nth-check-1.0.1.tgz",
+      "integrity": "sha1-mSms32KPwsQQmN6rgqxYDPFJquQ=",
+      "dev": true,
+      "requires": {
+        "boolbase": "1.0.0"
+      }
+    },
+    "null-check": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/null-check/-/null-check-1.0.0.tgz",
+      "integrity": "sha1-l33/1xdgErnsMNKjnbXPcqBDnt0=",
+      "dev": true
+    },
+    "num2fraction": {
+      "version": "1.2.2",
+      "resolved": "https://registry.npmjs.org/num2fraction/-/num2fraction-1.2.2.tgz",
+      "integrity": "sha1-b2gragJ6Tp3fpFZM0lidHU5mnt4=",
+      "dev": true
+    },
+    "number-is-nan": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/number-is-nan/-/number-is-nan-1.0.1.tgz",
+      "integrity": "sha1-CXtgK1NCKlIsGvuHkDGDNpQaAR0=",
+      "dev": true
+    },
+    "oauth-sign": {
+      "version": "0.9.0",
+      "resolved": "https://registry.npmjs.org/oauth-sign/-/oauth-sign-0.9.0.tgz",
+      "integrity": "sha512-fexhUFFPTGV8ybAtSIGbV6gOkSv8UtRbDBnAyLQw4QPKkgNlsH2ByPGtMUqdWkos6YCRmAqViwgZrJc/mRDzZQ==",
+      "dev": true
+    },
+    "object-assign": {
+      "version": "4.1.1",
+      "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
+      "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=",
+      "dev": true
+    },
+    "object-component": {
+      "version": "0.0.3",
+      "resolved": "https://registry.npmjs.org/object-component/-/object-component-0.0.3.tgz",
+      "integrity": "sha1-8MaapQ78lbhmwYb0AKM3acsvEpE=",
+      "dev": true
+    },
+    "object-copy": {
+      "version": "0.1.0",
+      "resolved": "https://registry.npmjs.org/object-copy/-/object-copy-0.1.0.tgz",
+      "integrity": "sha1-fn2Fi3gb18mRpBupde04EnVOmYw=",
+      "dev": true,
+      "requires": {
+        "copy-descriptor": "0.1.1",
+        "define-property": "0.2.5",
+        "kind-of": "3.2.2"
+      },
+      "dependencies": {
+        "define-property": {
+          "version": "0.2.5",
+          "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
+          "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
+          "dev": true,
+          "requires": {
+            "is-descriptor": "0.1.6"
+          }
+        },
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        }
+      }
+    },
+    "object-keys": {
+      "version": "1.0.12",
+      "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.0.12.tgz",
+      "integrity": "sha512-FTMyFUm2wBcGHnH2eXmz7tC6IwlqQZ6mVZ+6dm6vZ4IQIHjs6FdNsQBuKGPuUUUY6NfJw2PshC08Tn6LzLDOag==",
+      "dev": true
+    },
+    "object-visit": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/object-visit/-/object-visit-1.0.1.tgz",
+      "integrity": "sha1-95xEk68MU3e1n+OdOV5BBC3QRbs=",
+      "dev": true,
+      "requires": {
+        "isobject": "3.0.1"
+      }
+    },
+    "object.getownpropertydescriptors": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/object.getownpropertydescriptors/-/object.getownpropertydescriptors-2.0.3.tgz",
+      "integrity": "sha1-h1jIRvW0B62rDyNuCYbxSwUcqhY=",
+      "dev": true,
+      "requires": {
+        "define-properties": "1.1.3",
+        "es-abstract": "1.12.0"
+      }
+    },
+    "object.omit": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/object.omit/-/object.omit-2.0.1.tgz",
+      "integrity": "sha1-Gpx0SCnznbuFjHbKNXmuKlTr0fo=",
+      "dev": true,
+      "requires": {
+        "for-own": "0.1.5",
+        "is-extendable": "0.1.1"
+      },
+      "dependencies": {
+        "for-own": {
+          "version": "0.1.5",
+          "resolved": "https://registry.npmjs.org/for-own/-/for-own-0.1.5.tgz",
+          "integrity": "sha1-UmXGgaTylNq78XyVCbZ2OqhFEM4=",
+          "dev": true,
+          "requires": {
+            "for-in": "1.0.2"
+          }
+        }
+      }
+    },
+    "object.pick": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/object.pick/-/object.pick-1.3.0.tgz",
+      "integrity": "sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c=",
+      "dev": true,
+      "requires": {
+        "isobject": "3.0.1"
+      }
+    },
+    "obuf": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/obuf/-/obuf-1.1.2.tgz",
+      "integrity": "sha512-PX1wu0AmAdPqOL1mWhqmlOd8kOIZQwGZw6rh7uby9fTc5lhaOWFLX3I6R1hrF9k3zUY40e6igsLGkDXK92LJNg==",
+      "dev": true
+    },
+    "on-finished": {
+      "version": "2.3.0",
+      "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz",
+      "integrity": "sha1-IPEzZIGwg811M3mSoWlxqi2QaUc=",
+      "dev": true,
+      "requires": {
+        "ee-first": "1.1.1"
+      }
+    },
+    "on-headers": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/on-headers/-/on-headers-1.0.1.tgz",
+      "integrity": "sha1-ko9dD0cNSTQmUepnlLCFfBAGk/c=",
+      "dev": true
+    },
+    "once": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz",
+      "integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=",
+      "dev": true,
+      "requires": {
+        "wrappy": "1.0.2"
+      }
+    },
+    "opn": {
+      "version": "5.3.0",
+      "resolved": "https://registry.npmjs.org/opn/-/opn-5.3.0.tgz",
+      "integrity": "sha512-bYJHo/LOmoTd+pfiYhfZDnf9zekVJrY+cnS2a5F2x+w5ppvTqObojTP7WiFG+kVZs9Inw+qQ/lw7TroWwhdd2g==",
+      "dev": true,
+      "requires": {
+        "is-wsl": "1.1.0"
+      }
+    },
+    "optimist": {
+      "version": "0.6.1",
+      "resolved": "https://registry.npmjs.org/optimist/-/optimist-0.6.1.tgz",
+      "integrity": "sha1-2j6nRob6IaGaERwybpDrFaAZZoY=",
+      "dev": true,
+      "requires": {
+        "minimist": "0.0.8",
+        "wordwrap": "0.0.3"
+      },
+      "dependencies": {
+        "wordwrap": {
+          "version": "0.0.3",
+          "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-0.0.3.tgz",
+          "integrity": "sha1-o9XabNXAvAAI03I0u68b7WMFkQc=",
+          "dev": true
+        }
+      }
+    },
+    "optionator": {
+      "version": "0.8.2",
+      "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.8.2.tgz",
+      "integrity": "sha1-NkxeQJ0/TWMB1sC0wFu6UBgK62Q=",
+      "dev": true,
+      "requires": {
+        "deep-is": "0.1.3",
+        "fast-levenshtein": "2.0.6",
+        "levn": "0.3.0",
+        "prelude-ls": "1.1.2",
+        "type-check": "0.3.2",
+        "wordwrap": "1.0.0"
+      }
+    },
+    "options": {
+      "version": "0.0.6",
+      "resolved": "https://registry.npmjs.org/options/-/options-0.0.6.tgz",
+      "integrity": "sha1-7CLTEoBrtT5zF3Pnza788cZDEo8=",
+      "dev": true
+    },
+    "original": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/original/-/original-1.0.2.tgz",
+      "integrity": "sha512-hyBVl6iqqUOJ8FqRe+l/gS8H+kKYjrEndd5Pm1MfBtsEKA038HkkdbAl/72EAXGyonD/PFsvmVG+EvcIpliMBg==",
+      "dev": true,
+      "requires": {
+        "url-parse": "1.4.3"
+      }
+    },
+    "os-browserify": {
+      "version": "0.3.0",
+      "resolved": "https://registry.npmjs.org/os-browserify/-/os-browserify-0.3.0.tgz",
+      "integrity": "sha1-hUNzx/XCMVkU/Jv8a9gjj92h7Cc=",
+      "dev": true
+    },
+    "os-homedir": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/os-homedir/-/os-homedir-1.0.2.tgz",
+      "integrity": "sha1-/7xJiDNuDoM94MFox+8VISGqf7M=",
+      "dev": true
+    },
+    "os-locale": {
+      "version": "1.4.0",
+      "resolved": "http://registry.npmjs.org/os-locale/-/os-locale-1.4.0.tgz",
+      "integrity": "sha1-IPnxeuKe00XoveWDsT0gCYA8FNk=",
+      "dev": true,
+      "requires": {
+        "lcid": "1.0.0"
+      }
+    },
+    "os-name": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/os-name/-/os-name-2.0.1.tgz",
+      "integrity": "sha1-uaOGNhwXrjohc27wWZQFyajF3F4=",
+      "dev": true,
+      "requires": {
+        "macos-release": "1.1.0",
+        "win-release": "1.1.1"
+      }
+    },
+    "os-tmpdir": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/os-tmpdir/-/os-tmpdir-1.0.2.tgz",
+      "integrity": "sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ=",
+      "dev": true
+    },
+    "osenv": {
+      "version": "0.1.5",
+      "resolved": "https://registry.npmjs.org/osenv/-/osenv-0.1.5.tgz",
+      "integrity": "sha512-0CWcCECdMVc2Rw3U5w9ZjqX6ga6ubk1xDVKxtBQPK7wis/0F2r9T6k4ydGYhecl7YUBxBVxhL5oisPsNxAPe2g==",
+      "dev": true,
+      "requires": {
+        "os-homedir": "1.0.2",
+        "os-tmpdir": "1.0.2"
+      }
+    },
+    "p-finally": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/p-finally/-/p-finally-1.0.0.tgz",
+      "integrity": "sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4=",
+      "dev": true
+    },
+    "p-limit": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-1.3.0.tgz",
+      "integrity": "sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q==",
+      "dev": true,
+      "requires": {
+        "p-try": "1.0.0"
+      }
+    },
+    "p-locate": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-2.0.0.tgz",
+      "integrity": "sha1-IKAQOyIqcMj9OcwuWAaA893l7EM=",
+      "dev": true,
+      "requires": {
+        "p-limit": "1.3.0"
+      }
+    },
+    "p-map": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/p-map/-/p-map-1.2.0.tgz",
+      "integrity": "sha512-r6zKACMNhjPJMTl8KcFH4li//gkrXWfbD6feV8l6doRHlzljFWGJ2AP6iKaCJXyZmAUMOPtvbW7EXkbWO/pLEA==",
+      "dev": true
+    },
+    "p-try": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/p-try/-/p-try-1.0.0.tgz",
+      "integrity": "sha1-y8ec26+P1CKOE/Yh8rGiN8GyB7M=",
+      "dev": true
+    },
+    "package-json": {
+      "version": "4.0.1",
+      "resolved": "https://registry.npmjs.org/package-json/-/package-json-4.0.1.tgz",
+      "integrity": "sha1-iGmgQBJTZhxMTKPabCEh7VVfXu0=",
+      "dev": true,
+      "requires": {
+        "got": "6.7.1",
+        "registry-auth-token": "3.3.2",
+        "registry-url": "3.1.0",
+        "semver": "5.5.1"
+      }
+    },
+    "pako": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/pako/-/pako-1.0.6.tgz",
+      "integrity": "sha512-lQe48YPsMJAig+yngZ87Lus+NF+3mtu7DVOBu6b/gHO1YpKwIj5AWjZ/TOS7i46HD/UixzWb1zeWDZfGZ3iYcg==",
+      "dev": true
+    },
+    "parallel-transform": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/parallel-transform/-/parallel-transform-1.1.0.tgz",
+      "integrity": "sha1-1BDwZbBdojCB/NEPKIVMKb2jOwY=",
+      "dev": true,
+      "requires": {
+        "cyclist": "0.2.2",
+        "inherits": "2.0.3",
+        "readable-stream": "2.3.6"
+      }
+    },
+    "param-case": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/param-case/-/param-case-2.1.1.tgz",
+      "integrity": "sha1-35T9jPZTHs915r75oIWPvHK+Ikc=",
+      "dev": true,
+      "requires": {
+        "no-case": "2.3.2"
+      }
+    },
+    "parse-asn1": {
+      "version": "5.1.1",
+      "resolved": "https://registry.npmjs.org/parse-asn1/-/parse-asn1-5.1.1.tgz",
+      "integrity": "sha512-KPx7flKXg775zZpnp9SxJlz00gTd4BmJ2yJufSc44gMCRrRQ7NSzAcSJQfifuOLgW6bEi+ftrALtsgALeB2Adw==",
+      "dev": true,
+      "requires": {
+        "asn1.js": "4.10.1",
+        "browserify-aes": "1.2.0",
+        "create-hash": "1.2.0",
+        "evp_bytestokey": "1.0.3",
+        "pbkdf2": "3.0.16"
+      }
+    },
+    "parse-glob": {
+      "version": "3.0.4",
+      "resolved": "https://registry.npmjs.org/parse-glob/-/parse-glob-3.0.4.tgz",
+      "integrity": "sha1-ssN2z7EfNVE7rdFz7wu246OIORw=",
+      "dev": true,
+      "requires": {
+        "glob-base": "0.3.0",
+        "is-dotfile": "1.0.3",
+        "is-extglob": "1.0.0",
+        "is-glob": "2.0.1"
+      },
+      "dependencies": {
+        "is-extglob": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-1.0.0.tgz",
+          "integrity": "sha1-rEaBd8SUNAWgkvyPKXYMb/xiBsA=",
+          "dev": true
+        },
+        "is-glob": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-2.0.1.tgz",
+          "integrity": "sha1-0Jb5JqPe1WAPP9/ZEZjLCIjC2GM=",
+          "dev": true,
+          "requires": {
+            "is-extglob": "1.0.0"
+          }
+        }
+      }
+    },
+    "parse-json": {
+      "version": "2.2.0",
+      "resolved": "https://registry.npmjs.org/parse-json/-/parse-json-2.2.0.tgz",
+      "integrity": "sha1-9ID0BDTvgHQfhGkJn43qGPVaTck=",
+      "dev": true,
+      "requires": {
+        "error-ex": "1.3.2"
+      }
+    },
+    "parse5": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/parse5/-/parse5-4.0.0.tgz",
+      "integrity": "sha512-VrZ7eOd3T1Fk4XWNXMgiGBK/z0MG48BWG2uQNU4I72fkQuKUTZpl+u9k+CxEG0twMVzSmXEEz12z5Fnw1jIQFA==",
+      "dev": true
+    },
+    "parsejson": {
+      "version": "0.0.3",
+      "resolved": "https://registry.npmjs.org/parsejson/-/parsejson-0.0.3.tgz",
+      "integrity": "sha1-q343WfIJ7OmUN5c/fQ8fZK4OZKs=",
+      "dev": true,
+      "requires": {
+        "better-assert": "1.0.2"
+      }
+    },
+    "parseqs": {
+      "version": "0.0.5",
+      "resolved": "https://registry.npmjs.org/parseqs/-/parseqs-0.0.5.tgz",
+      "integrity": "sha1-1SCKNzjkZ2bikbouoXNoSSGouJ0=",
+      "dev": true,
+      "requires": {
+        "better-assert": "1.0.2"
+      }
+    },
+    "parseuri": {
+      "version": "0.0.5",
+      "resolved": "https://registry.npmjs.org/parseuri/-/parseuri-0.0.5.tgz",
+      "integrity": "sha1-gCBKUNTbt3m/3G6+J3jZDkvOMgo=",
+      "dev": true,
+      "requires": {
+        "better-assert": "1.0.2"
+      }
+    },
+    "parseurl": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.2.tgz",
+      "integrity": "sha1-/CidTtiZMRlGDBViUyYs3I3mW/M=",
+      "dev": true
+    },
+    "pascalcase": {
+      "version": "0.1.1",
+      "resolved": "https://registry.npmjs.org/pascalcase/-/pascalcase-0.1.1.tgz",
+      "integrity": "sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ=",
+      "dev": true
+    },
+    "path-browserify": {
+      "version": "0.0.0",
+      "resolved": "https://registry.npmjs.org/path-browserify/-/path-browserify-0.0.0.tgz",
+      "integrity": "sha1-oLhwcpquIUAFt9UDLsLLuw+0RRo=",
+      "dev": true
+    },
+    "path-dirname": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/path-dirname/-/path-dirname-1.0.2.tgz",
+      "integrity": "sha1-zDPSTVJeCZpTiMAzbG4yuRYGCeA=",
+      "dev": true
+    },
+    "path-exists": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-3.0.0.tgz",
+      "integrity": "sha1-zg6+ql94yxiSXqfYENe1mwEP1RU=",
+      "dev": true
+    },
+    "path-is-absolute": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz",
+      "integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=",
+      "dev": true
+    },
+    "path-is-inside": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/path-is-inside/-/path-is-inside-1.0.2.tgz",
+      "integrity": "sha1-NlQX3t5EQw0cEa9hAn+s8HS9/FM=",
+      "dev": true
+    },
+    "path-key": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/path-key/-/path-key-2.0.1.tgz",
+      "integrity": "sha1-QRyttXTFoUDTpLGRDUDYDMn0C0A=",
+      "dev": true
+    },
+    "path-parse": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.6.tgz",
+      "integrity": "sha512-GSmOT2EbHrINBf9SR7CDELwlJ8AENk3Qn7OikK4nFYAu3Ote2+JYNVvkpAEQm3/TLNEJFD/xZJjzyxg3KBWOzw==",
+      "dev": true
+    },
+    "path-to-regexp": {
+      "version": "0.1.7",
+      "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz",
+      "integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=",
+      "dev": true
+    },
+    "path-type": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/path-type/-/path-type-3.0.0.tgz",
+      "integrity": "sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg==",
+      "dev": true,
+      "requires": {
+        "pify": "3.0.0"
+      }
+    },
+    "pause-stream": {
+      "version": "0.0.11",
+      "resolved": "https://registry.npmjs.org/pause-stream/-/pause-stream-0.0.11.tgz",
+      "integrity": "sha1-/lo0sMvOErWqaitAPuLnO2AvFEU=",
+      "dev": true,
+      "requires": {
+        "through": "2.3.8"
+      }
+    },
+    "pbkdf2": {
+      "version": "3.0.16",
+      "resolved": "https://registry.npmjs.org/pbkdf2/-/pbkdf2-3.0.16.tgz",
+      "integrity": "sha512-y4CXP3thSxqf7c0qmOF+9UeOTrifiVTIM+u7NWlq+PRsHbr7r7dpCmvzrZxa96JJUNi0Y5w9VqG5ZNeCVMoDcA==",
+      "dev": true,
+      "requires": {
+        "create-hash": "1.2.0",
+        "create-hmac": "1.1.7",
+        "ripemd160": "2.0.2",
+        "safe-buffer": "5.1.2",
+        "sha.js": "2.4.11"
+      }
+    },
+    "performance-now": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/performance-now/-/performance-now-2.1.0.tgz",
+      "integrity": "sha1-Ywn04OX6kT7BxpMHrjZLSzd8nns=",
+      "dev": true
+    },
+    "pify": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/pify/-/pify-3.0.0.tgz",
+      "integrity": "sha1-5aSs0sEB/fPZpNB/DbxNtJ3SgXY=",
+      "dev": true
+    },
+    "pinkie": {
+      "version": "2.0.4",
+      "resolved": "https://registry.npmjs.org/pinkie/-/pinkie-2.0.4.tgz",
+      "integrity": "sha1-clVrgM+g1IqXToDnckjoDtT3+HA=",
+      "dev": true
+    },
+    "pinkie-promise": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/pinkie-promise/-/pinkie-promise-2.0.1.tgz",
+      "integrity": "sha1-ITXW36ejWMBprJsXh3YogihFD/o=",
+      "dev": true,
+      "requires": {
+        "pinkie": "2.0.4"
+      }
+    },
+    "pkg-dir": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/pkg-dir/-/pkg-dir-2.0.0.tgz",
+      "integrity": "sha1-9tXREJ4Z1j7fQo4L1X4Sd3YVM0s=",
+      "dev": true,
+      "requires": {
+        "find-up": "2.1.0"
+      }
+    },
+    "portfinder": {
+      "version": "1.0.17",
+      "resolved": "https://registry.npmjs.org/portfinder/-/portfinder-1.0.17.tgz",
+      "integrity": "sha512-syFcRIRzVI1BoEFOCaAiizwDolh1S1YXSodsVhncbhjzjZQulhczNRbqnUl9N31Q4dKGOXsNDqxC2BWBgSMqeQ==",
+      "dev": true,
+      "requires": {
+        "async": "1.5.2",
+        "debug": "2.6.9",
+        "mkdirp": "0.5.1"
+      }
+    },
+    "posix-character-classes": {
+      "version": "0.1.1",
+      "resolved": "https://registry.npmjs.org/posix-character-classes/-/posix-character-classes-0.1.1.tgz",
+      "integrity": "sha1-AerA/jta9xoqbAL+q7jB/vfgDqs=",
+      "dev": true
+    },
+    "postcss": {
+      "version": "6.0.23",
+      "resolved": "https://registry.npmjs.org/postcss/-/postcss-6.0.23.tgz",
+      "integrity": "sha512-soOk1h6J3VMTZtVeVpv15/Hpdl2cBLX3CAw4TAbkpTJiNPk9YP/zWcD1ND+xEtvyuuvKzbxliTOIyvkSeSJ6ag==",
+      "dev": true,
+      "requires": {
+        "chalk": "2.4.1",
+        "source-map": "0.6.1",
+        "supports-color": "5.5.0"
+      },
+      "dependencies": {
+        "chalk": {
+          "version": "2.4.1",
+          "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.1.tgz",
+          "integrity": "sha512-ObN6h1v2fTJSmUXoS3nMQ92LbDK9be4TV+6G+omQlGJFdcUX5heKi1LZ1YnRMIgwTLEj3E24bT6tYni50rlCfQ==",
+          "dev": true,
+          "requires": {
+            "ansi-styles": "3.2.1",
+            "escape-string-regexp": "1.0.5",
+            "supports-color": "5.5.0"
+          }
+        },
+        "source-map": {
+          "version": "0.6.1",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+          "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+          "dev": true
+        }
+      }
+    },
+    "postcss-clean": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/postcss-clean/-/postcss-clean-1.1.0.tgz",
+      "integrity": "sha512-83g3GqMbCM5NL6MlbbPLJ/m2NrUepBF44MoDk4Gt04QGXeXKh9+ilQa0DzLnYnvqYHQCw83nckuEzBFr2muwbg==",
+      "dev": true,
+      "requires": {
+        "clean-css": "4.2.1",
+        "postcss": "6.0.23"
+      }
+    },
+    "postcss-import": {
+      "version": "11.1.0",
+      "resolved": "https://registry.npmjs.org/postcss-import/-/postcss-import-11.1.0.tgz",
+      "integrity": "sha512-5l327iI75POonjxkXgdRCUS+AlzAdBx4pOvMEhTKTCjb1p8IEeVR9yx3cPbmN7LIWJLbfnIXxAhoB4jpD0c/Cw==",
+      "dev": true,
+      "requires": {
+        "postcss": "6.0.23",
+        "postcss-value-parser": "3.3.0",
+        "read-cache": "1.0.0",
+        "resolve": "1.8.1"
+      }
+    },
+    "postcss-load-config": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/postcss-load-config/-/postcss-load-config-2.0.0.tgz",
+      "integrity": "sha512-V5JBLzw406BB8UIfsAWSK2KSwIJ5yoEIVFb4gVkXci0QdKgA24jLmHZ/ghe/GgX0lJ0/D1uUK1ejhzEY94MChQ==",
+      "dev": true,
+      "requires": {
+        "cosmiconfig": "4.0.0",
+        "import-cwd": "2.1.0"
+      }
+    },
+    "postcss-loader": {
+      "version": "2.1.6",
+      "resolved": "https://registry.npmjs.org/postcss-loader/-/postcss-loader-2.1.6.tgz",
+      "integrity": "sha512-hgiWSc13xVQAq25cVw80CH0l49ZKlAnU1hKPOdRrNj89bokRr/bZF2nT+hebPPF9c9xs8c3gw3Fr2nxtmXYnNg==",
+      "dev": true,
+      "requires": {
+        "loader-utils": "1.1.0",
+        "postcss": "6.0.23",
+        "postcss-load-config": "2.0.0",
+        "schema-utils": "0.4.7"
+      }
+    },
+    "postcss-url": {
+      "version": "7.3.2",
+      "resolved": "https://registry.npmjs.org/postcss-url/-/postcss-url-7.3.2.tgz",
+      "integrity": "sha512-QMV5mA+pCYZQcUEPQkmor9vcPQ2MT+Ipuu8qdi1gVxbNiIiErEGft+eny1ak19qALoBkccS5AHaCaCDzh7b9MA==",
+      "dev": true,
+      "requires": {
+        "mime": "1.6.0",
+        "minimatch": "3.0.4",
+        "mkdirp": "0.5.1",
+        "postcss": "6.0.23",
+        "xxhashjs": "0.2.2"
+      }
+    },
+    "postcss-value-parser": {
+      "version": "3.3.0",
+      "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.0.tgz",
+      "integrity": "sha1-h/OPnxj3dKSrTIojL1xc6IcqnRU=",
+      "dev": true
+    },
+    "prelude-ls": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/prelude-ls/-/prelude-ls-1.1.2.tgz",
+      "integrity": "sha1-IZMqVJ9eUv/ZqCf1cOBL5iqX2lQ=",
+      "dev": true
+    },
+    "prepend-http": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/prepend-http/-/prepend-http-1.0.4.tgz",
+      "integrity": "sha1-1PRWKwzjaW5BrFLQ4ALlemNdxtw=",
+      "dev": true
+    },
+    "preserve": {
+      "version": "0.2.0",
+      "resolved": "https://registry.npmjs.org/preserve/-/preserve-0.2.0.tgz",
+      "integrity": "sha1-gV7R9uvGWSb4ZbMQwHE7yzMVzks=",
+      "dev": true
+    },
+    "pretty-error": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/pretty-error/-/pretty-error-2.1.1.tgz",
+      "integrity": "sha1-X0+HyPkeWuPzuoerTPXgOxoX8aM=",
+      "dev": true,
+      "requires": {
+        "renderkid": "2.0.1",
+        "utila": "0.4.0"
+      }
+    },
+    "process": {
+      "version": "0.11.10",
+      "resolved": "https://registry.npmjs.org/process/-/process-0.11.10.tgz",
+      "integrity": "sha1-czIwDoQBYb2j5podHZGn1LwW8YI=",
+      "dev": true
+    },
+    "process-nextick-args": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/process-nextick-args/-/process-nextick-args-2.0.0.tgz",
+      "integrity": "sha512-MtEC1TqN0EU5nephaJ4rAtThHtC86dNN9qCuEhtshvpVBkAW5ZO7BASN9REnF9eoXGcRub+pFuKEpOHE+HbEMw==",
+      "dev": true
+    },
+    "promise": {
+      "version": "7.3.1",
+      "resolved": "https://registry.npmjs.org/promise/-/promise-7.3.1.tgz",
+      "integrity": "sha512-nolQXZ/4L+bP/UGlkfaIujX9BKxGwmQ9OT4mOt5yvy8iK1h3wqTEJCijzGANTCCl9nWjY41juyAn2K3Q1hLLTg==",
+      "dev": true,
+      "optional": true,
+      "requires": {
+        "asap": "2.0.6"
+      }
+    },
+    "promise-inflight": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/promise-inflight/-/promise-inflight-1.0.1.tgz",
+      "integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM=",
+      "dev": true
+    },
+    "protractor": {
+      "version": "5.3.2",
+      "resolved": "https://registry.npmjs.org/protractor/-/protractor-5.3.2.tgz",
+      "integrity": "sha512-pw4uwwiy5lHZjIguxNpkEwJJa7hVz+bJsvaTI+IbXlfn2qXwzbF8eghW/RmrZwE2sGx82I8etb8lVjQ+JrjejA==",
+      "dev": true,
+      "requires": {
+        "@types/node": "6.0.117",
+        "@types/q": "0.0.32",
+        "@types/selenium-webdriver": "2.53.43",
+        "blocking-proxy": "1.0.1",
+        "chalk": "1.1.3",
+        "glob": "7.1.3",
+        "jasmine": "2.8.0",
+        "jasminewd2": "2.2.0",
+        "optimist": "0.6.1",
+        "q": "1.4.1",
+        "saucelabs": "1.5.0",
+        "selenium-webdriver": "3.6.0",
+        "source-map-support": "0.4.18",
+        "webdriver-js-extender": "1.0.0",
+        "webdriver-manager": "12.1.0"
+      },
+      "dependencies": {
+        "@types/node": {
+          "version": "6.0.117",
+          "resolved": "https://registry.npmjs.org/@types/node/-/node-6.0.117.tgz",
+          "integrity": "sha512-sihk0SnN8PpiS5ihu5xJQ5ddnURNq4P+XPmW+nORlKkHy21CoZO/IVHK/Wq/l3G8fFW06Fkltgnqx229uPlnRg==",
+          "dev": true
+        },
+        "adm-zip": {
+          "version": "0.4.11",
+          "resolved": "https://registry.npmjs.org/adm-zip/-/adm-zip-0.4.11.tgz",
+          "integrity": "sha512-L8vcjDTCOIJk7wFvmlEUN7AsSb8T+2JrdP7KINBjzr24TJ5Mwj590sLu3BC7zNZowvJWa/JtPmD8eJCzdtDWjA==",
+          "dev": true
+        },
+        "ansi-styles": {
+          "version": "2.2.1",
+          "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.2.1.tgz",
+          "integrity": "sha1-tDLdM1i2NM914eRmQ2gkBTPB3b4=",
+          "dev": true
+        },
+        "chalk": {
+          "version": "1.1.3",
+          "resolved": "http://registry.npmjs.org/chalk/-/chalk-1.1.3.tgz",
+          "integrity": "sha1-qBFcVeSnAv5NFQq9OHKCKn4J/Jg=",
+          "dev": true,
+          "requires": {
+            "ansi-styles": "2.2.1",
+            "escape-string-regexp": "1.0.5",
+            "has-ansi": "2.0.0",
+            "strip-ansi": "3.0.1",
+            "supports-color": "2.0.0"
+          }
+        },
+        "del": {
+          "version": "2.2.2",
+          "resolved": "https://registry.npmjs.org/del/-/del-2.2.2.tgz",
+          "integrity": "sha1-wSyYHQZ4RshLyvhiz/kw2Qf/0ag=",
+          "dev": true,
+          "requires": {
+            "globby": "5.0.0",
+            "is-path-cwd": "1.0.0",
+            "is-path-in-cwd": "1.0.1",
+            "object-assign": "4.1.1",
+            "pify": "2.3.0",
+            "pinkie-promise": "2.0.1",
+            "rimraf": "2.6.2"
+          }
+        },
+        "globby": {
+          "version": "5.0.0",
+          "resolved": "https://registry.npmjs.org/globby/-/globby-5.0.0.tgz",
+          "integrity": "sha1-69hGZ8oNuzMLmbz8aOrCvFQ3Dg0=",
+          "dev": true,
+          "requires": {
+            "array-union": "1.0.2",
+            "arrify": "1.0.1",
+            "glob": "7.1.3",
+            "object-assign": "4.1.1",
+            "pify": "2.3.0",
+            "pinkie-promise": "2.0.1"
+          }
+        },
+        "minimist": {
+          "version": "1.2.0",
+          "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+          "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+          "dev": true
+        },
+        "pify": {
+          "version": "2.3.0",
+          "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+          "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=",
+          "dev": true
+        },
+        "source-map-support": {
+          "version": "0.4.18",
+          "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.4.18.tgz",
+          "integrity": "sha512-try0/JqxPLF9nOjvSta7tVondkP5dwgyLDjVoyMDlmjugT2lRZ1OfsrYTkCd2hkDnJTKRbO/Rl3orm8vlsUzbA==",
+          "dev": true,
+          "requires": {
+            "source-map": "0.5.7"
+          }
+        },
+        "supports-color": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-2.0.0.tgz",
+          "integrity": "sha1-U10EXOa2Nj+kARcIRimZXp3zJMc=",
+          "dev": true
+        },
+        "webdriver-manager": {
+          "version": "12.1.0",
+          "resolved": "https://registry.npmjs.org/webdriver-manager/-/webdriver-manager-12.1.0.tgz",
+          "integrity": "sha512-oEc5fmkpz6Yh6udhwir5m0eN5mgRPq9P/NU5YWuT3Up5slt6Zz+znhLU7q4+8rwCZz/Qq3Fgpr/4oao7NPCm2A==",
+          "dev": true,
+          "requires": {
+            "adm-zip": "0.4.11",
+            "chalk": "1.1.3",
+            "del": "2.2.2",
+            "glob": "7.1.3",
+            "ini": "1.3.5",
+            "minimist": "1.2.0",
+            "q": "1.4.1",
+            "request": "2.88.0",
+            "rimraf": "2.6.2",
+            "semver": "5.5.1",
+            "xml2js": "0.4.19"
+          }
+        }
+      }
+    },
+    "proxy-addr": {
+      "version": "2.0.4",
+      "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.4.tgz",
+      "integrity": "sha512-5erio2h9jp5CHGwcybmxmVqHmnCBZeewlfJ0pex+UW7Qny7OOZXTtH56TGNyBizkgiOwhJtMKrVzDTeKcySZwA==",
+      "dev": true,
+      "requires": {
+        "forwarded": "0.1.2",
+        "ipaddr.js": "1.8.0"
+      }
+    },
+    "proxy-middleware": {
+      "version": "0.15.0",
+      "resolved": "https://registry.npmjs.org/proxy-middleware/-/proxy-middleware-0.15.0.tgz",
+      "integrity": "sha1-o/3xvvtzD5UZZYcqwvYHTGFHelY=",
+      "dev": true
+    },
+    "prr": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/prr/-/prr-1.0.1.tgz",
+      "integrity": "sha1-0/wRS6BplaRexok/SEzrHXj19HY=",
+      "dev": true
+    },
+    "pseudomap": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/pseudomap/-/pseudomap-1.0.2.tgz",
+      "integrity": "sha1-8FKijacOYYkX7wqKw0wa5aaChrM=",
+      "dev": true
+    },
+    "psl": {
+      "version": "1.1.29",
+      "resolved": "https://registry.npmjs.org/psl/-/psl-1.1.29.tgz",
+      "integrity": "sha512-AeUmQ0oLN02flVHXWh9sSJF7mcdFq0ppid/JkErufc3hGIV/AMa8Fo9VgDo/cT2jFdOWoFvHp90qqBH54W+gjQ==",
+      "dev": true
+    },
+    "public-encrypt": {
+      "version": "4.0.2",
+      "resolved": "https://registry.npmjs.org/public-encrypt/-/public-encrypt-4.0.2.tgz",
+      "integrity": "sha512-4kJ5Esocg8X3h8YgJsKAuoesBgB7mqH3eowiDzMUPKiRDDE7E/BqqZD1hnTByIaAFiwAw246YEltSq7tdrOH0Q==",
+      "dev": true,
+      "requires": {
+        "bn.js": "4.11.8",
+        "browserify-rsa": "4.0.1",
+        "create-hash": "1.2.0",
+        "parse-asn1": "5.1.1",
+        "randombytes": "2.0.6"
+      }
+    },
+    "pump": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/pump/-/pump-2.0.1.tgz",
+      "integrity": "sha512-ruPMNRkN3MHP1cWJc9OWr+T/xDP0jhXYCLfJcBuX54hhfIBnaQmAUMfDcG4DM5UMWByBbJY69QSphm3jtDKIkA==",
+      "dev": true,
+      "requires": {
+        "end-of-stream": "1.4.1",
+        "once": "1.4.0"
+      }
+    },
+    "pumpify": {
+      "version": "1.5.1",
+      "resolved": "https://registry.npmjs.org/pumpify/-/pumpify-1.5.1.tgz",
+      "integrity": "sha512-oClZI37HvuUJJxSKKrC17bZ9Cu0ZYhEAGPsPUy9KlMUmv9dKX2o77RUmq7f3XjIxbwyGwYzbzQ1L2Ks8sIradQ==",
+      "dev": true,
+      "requires": {
+        "duplexify": "3.6.0",
+        "inherits": "2.0.3",
+        "pump": "2.0.1"
+      }
+    },
+    "punycode": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.1.1.tgz",
+      "integrity": "sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A==",
+      "dev": true
+    },
+    "q": {
+      "version": "1.4.1",
+      "resolved": "https://registry.npmjs.org/q/-/q-1.4.1.tgz",
+      "integrity": "sha1-VXBbzZPF82c1MMLCy8DCs63cKG4=",
+      "dev": true
+    },
+    "qjobs": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/qjobs/-/qjobs-1.2.0.tgz",
+      "integrity": "sha512-8YOJEHtxpySA3fFDyCRxA+UUV+fA+rTWnuWvylOK/NCjhY+b4ocCtmu8TtsWb+mYeU+GCHf/S66KZF/AsteKHg==",
+      "dev": true
+    },
+    "qs": {
+      "version": "6.5.2",
+      "resolved": "https://registry.npmjs.org/qs/-/qs-6.5.2.tgz",
+      "integrity": "sha512-N5ZAX4/LxJmF+7wN74pUD6qAh9/wnvdQcjq9TZjevvXzSUo7bfmw91saqMjzGS2xq91/odN2dW/WOl7qQHNDGA==",
+      "dev": true
+    },
+    "querystring": {
+      "version": "0.2.0",
+      "resolved": "https://registry.npmjs.org/querystring/-/querystring-0.2.0.tgz",
+      "integrity": "sha1-sgmEkgO7Jd+CDadW50cAWHhSFiA=",
+      "dev": true
+    },
+    "querystring-es3": {
+      "version": "0.2.1",
+      "resolved": "https://registry.npmjs.org/querystring-es3/-/querystring-es3-0.2.1.tgz",
+      "integrity": "sha1-nsYfeQSYdXB9aUFFlv2Qek1xHnM=",
+      "dev": true
+    },
+    "querystringify": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/querystringify/-/querystringify-2.0.0.tgz",
+      "integrity": "sha512-eTPo5t/4bgaMNZxyjWx6N2a6AuE0mq51KWvpc7nU/MAqixcI6v6KrGUKES0HaomdnolQBBXU/++X6/QQ9KL4tw==",
+      "dev": true
+    },
+    "randomatic": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/randomatic/-/randomatic-3.1.0.tgz",
+      "integrity": "sha512-KnGPVE0lo2WoXxIZ7cPR8YBpiol4gsSuOwDSg410oHh80ZMp5EiypNqL2K4Z77vJn6lB5rap7IkAmcUlalcnBQ==",
+      "dev": true,
+      "requires": {
+        "is-number": "4.0.0",
+        "kind-of": "6.0.2",
+        "math-random": "1.0.1"
+      },
+      "dependencies": {
+        "is-number": {
+          "version": "4.0.0",
+          "resolved": "https://registry.npmjs.org/is-number/-/is-number-4.0.0.tgz",
+          "integrity": "sha512-rSklcAIlf1OmFdyAqbnWTLVelsQ58uvZ66S/ZyawjWqIviTWCjg2PzVGw8WUA+nNuPTqb4wgA+NszrJ+08LlgQ==",
+          "dev": true
+        }
+      }
+    },
+    "randombytes": {
+      "version": "2.0.6",
+      "resolved": "https://registry.npmjs.org/randombytes/-/randombytes-2.0.6.tgz",
+      "integrity": "sha512-CIQ5OFxf4Jou6uOKe9t1AOgqpeU5fd70A8NPdHSGeYXqXsPe6peOwI0cUl88RWZ6sP1vPMV3avd/R6cZ5/sP1A==",
+      "dev": true,
+      "requires": {
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "randomfill": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/randomfill/-/randomfill-1.0.4.tgz",
+      "integrity": "sha512-87lcbR8+MhcWcUiQ+9e+Rwx8MyR2P7qnt15ynUlbm3TU/fjbgz4GsvfSUDTemtCCtVCqb4ZcEFlyPNTh9bBTLw==",
+      "dev": true,
+      "requires": {
+        "randombytes": "2.0.6",
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "range-parser": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.0.tgz",
+      "integrity": "sha1-9JvmtIeJTdxA3MlKMi9hEJLgDV4=",
+      "dev": true
+    },
+    "raw-body": {
+      "version": "2.3.2",
+      "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.3.2.tgz",
+      "integrity": "sha1-vNYMd9Prk83gBQKVw/N5OJvIj4k=",
+      "dev": true,
+      "requires": {
+        "bytes": "3.0.0",
+        "http-errors": "1.6.2",
+        "iconv-lite": "0.4.19",
+        "unpipe": "1.0.0"
+      },
+      "dependencies": {
+        "depd": {
+          "version": "1.1.1",
+          "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.1.tgz",
+          "integrity": "sha1-V4O04cRZ8G+lyif5kfPQbnoxA1k=",
+          "dev": true
+        },
+        "http-errors": {
+          "version": "1.6.2",
+          "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-1.6.2.tgz",
+          "integrity": "sha1-CgAsyFcHGSp+eUbO7cERVfYOxzY=",
+          "dev": true,
+          "requires": {
+            "depd": "1.1.1",
+            "inherits": "2.0.3",
+            "setprototypeof": "1.0.3",
+            "statuses": "1.4.0"
+          }
+        },
+        "setprototypeof": {
+          "version": "1.0.3",
+          "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.0.3.tgz",
+          "integrity": "sha1-ZlZ+NwQ+608E2RvWWMDL77VbjgQ=",
+          "dev": true
+        }
+      }
+    },
+    "raw-loader": {
+      "version": "0.5.1",
+      "resolved": "https://registry.npmjs.org/raw-loader/-/raw-loader-0.5.1.tgz",
+      "integrity": "sha1-DD0L6u2KAclm2Xh793goElKpeao=",
+      "dev": true
+    },
+    "rc": {
+      "version": "1.2.8",
+      "resolved": "https://registry.npmjs.org/rc/-/rc-1.2.8.tgz",
+      "integrity": "sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==",
+      "dev": true,
+      "requires": {
+        "deep-extend": "0.6.0",
+        "ini": "1.3.5",
+        "minimist": "1.2.0",
+        "strip-json-comments": "2.0.1"
+      },
+      "dependencies": {
+        "minimist": {
+          "version": "1.2.0",
+          "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+          "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+          "dev": true
+        }
+      }
+    },
+    "read-cache": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/read-cache/-/read-cache-1.0.0.tgz",
+      "integrity": "sha1-5mTvMRYRZsl1HNvo28+GtftY93Q=",
+      "dev": true,
+      "requires": {
+        "pify": "2.3.0"
+      },
+      "dependencies": {
+        "pify": {
+          "version": "2.3.0",
+          "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+          "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=",
+          "dev": true
+        }
+      }
+    },
+    "read-pkg": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/read-pkg/-/read-pkg-1.1.0.tgz",
+      "integrity": "sha1-9f+qXs0pyzHAR0vKfXVra7KePyg=",
+      "dev": true,
+      "requires": {
+        "load-json-file": "1.1.0",
+        "normalize-package-data": "2.4.0",
+        "path-type": "1.1.0"
+      },
+      "dependencies": {
+        "path-type": {
+          "version": "1.1.0",
+          "resolved": "https://registry.npmjs.org/path-type/-/path-type-1.1.0.tgz",
+          "integrity": "sha1-WcRPfuSR2nBNpBXaWkBwuk+P5EE=",
+          "dev": true,
+          "requires": {
+            "graceful-fs": "4.1.11",
+            "pify": "2.3.0",
+            "pinkie-promise": "2.0.1"
+          }
+        },
+        "pify": {
+          "version": "2.3.0",
+          "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz",
+          "integrity": "sha1-7RQaasBDqEnqWISY59yosVMw6Qw=",
+          "dev": true
+        }
+      }
+    },
+    "read-pkg-up": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/read-pkg-up/-/read-pkg-up-1.0.1.tgz",
+      "integrity": "sha1-nWPBMnbAZZGNV/ACpX9AobZD+wI=",
+      "dev": true,
+      "requires": {
+        "find-up": "1.1.2",
+        "read-pkg": "1.1.0"
+      },
+      "dependencies": {
+        "find-up": {
+          "version": "1.1.2",
+          "resolved": "https://registry.npmjs.org/find-up/-/find-up-1.1.2.tgz",
+          "integrity": "sha1-ay6YIrGizgpgq2TWEOzK1TyyTQ8=",
+          "dev": true,
+          "requires": {
+            "path-exists": "2.1.0",
+            "pinkie-promise": "2.0.1"
+          }
+        },
+        "path-exists": {
+          "version": "2.1.0",
+          "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-2.1.0.tgz",
+          "integrity": "sha1-D+tsZPD8UY2adU3V77YscCJ2H0s=",
+          "dev": true,
+          "requires": {
+            "pinkie-promise": "2.0.1"
+          }
+        }
+      }
+    },
+    "readable-stream": {
+      "version": "2.3.6",
+      "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-2.3.6.tgz",
+      "integrity": "sha512-tQtKA9WIAhBF3+VLAseyMqZeBjW0AHJoxOtYqSUZNJxauErmLbVm2FW1y+J/YA9dUrAC39ITejlZWhVIwawkKw==",
+      "dev": true,
+      "requires": {
+        "core-util-is": "1.0.2",
+        "inherits": "2.0.3",
+        "isarray": "1.0.0",
+        "process-nextick-args": "2.0.0",
+        "safe-buffer": "5.1.2",
+        "string_decoder": "1.1.1",
+        "util-deprecate": "1.0.2"
+      }
+    },
+    "readdirp": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-2.1.0.tgz",
+      "integrity": "sha1-TtCtBg3zBzMAxIRANz9y0cxkLXg=",
+      "dev": true,
+      "requires": {
+        "graceful-fs": "4.1.11",
+        "minimatch": "3.0.4",
+        "readable-stream": "2.3.6",
+        "set-immediate-shim": "1.0.1"
+      }
+    },
+    "redent": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/redent/-/redent-1.0.0.tgz",
+      "integrity": "sha1-z5Fqsf1fHxbfsggi3W7H9zDCr94=",
+      "dev": true,
+      "requires": {
+        "indent-string": "2.1.0",
+        "strip-indent": "1.0.1"
+      }
+    },
+    "reflect-metadata": {
+      "version": "0.1.12",
+      "resolved": "https://registry.npmjs.org/reflect-metadata/-/reflect-metadata-0.1.12.tgz",
+      "integrity": "sha512-n+IyV+nGz3+0q3/Yf1ra12KpCyi001bi4XFxSjbiWWjfqb52iTTtpGXmCCAOWWIAn9KEuFZKGqBERHmrtScZ3A==",
+      "dev": true
+    },
+    "regenerate": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/regenerate/-/regenerate-1.4.0.tgz",
+      "integrity": "sha512-1G6jJVDWrt0rK99kBjvEtziZNCICAuvIPkSiUFIQxVP06RCVpq3dmDo2oi6ABpYaDYaTRr67BEhL8r1wgEZZKg==",
+      "dev": true
+    },
+    "regenerator-runtime": {
+      "version": "0.11.1",
+      "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz",
+      "integrity": "sha512-MguG95oij0fC3QV3URf4V2SDYGJhJnJGqvIIgdECeODCT98wSWDAJ94SSuVpYQUoTcGUIL6L4yNB7j1DFFHSBg==",
+      "dev": true
+    },
+    "regex-cache": {
+      "version": "0.4.4",
+      "resolved": "https://registry.npmjs.org/regex-cache/-/regex-cache-0.4.4.tgz",
+      "integrity": "sha512-nVIZwtCjkC9YgvWkpM55B5rBhBYRZhAaJbgcFYXXsHnbZ9UZI9nnVWYZpBlCqv9ho2eZryPnWrZGsOdPwVWXWQ==",
+      "dev": true,
+      "requires": {
+        "is-equal-shallow": "0.1.3"
+      }
+    },
+    "regex-not": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/regex-not/-/regex-not-1.0.2.tgz",
+      "integrity": "sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A==",
+      "dev": true,
+      "requires": {
+        "extend-shallow": "3.0.2",
+        "safe-regex": "1.1.0"
+      }
+    },
+    "regexpu-core": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/regexpu-core/-/regexpu-core-1.0.0.tgz",
+      "integrity": "sha1-hqdj9Y7k18L2sQLkdkBQ3n7ZDGs=",
+      "dev": true,
+      "requires": {
+        "regenerate": "1.4.0",
+        "regjsgen": "0.2.0",
+        "regjsparser": "0.1.5"
+      }
+    },
+    "registry-auth-token": {
+      "version": "3.3.2",
+      "resolved": "https://registry.npmjs.org/registry-auth-token/-/registry-auth-token-3.3.2.tgz",
+      "integrity": "sha512-JL39c60XlzCVgNrO+qq68FoNb56w/m7JYvGR2jT5iR1xBrUA3Mfx5Twk5rqTThPmQKMWydGmq8oFtDlxfrmxnQ==",
+      "dev": true,
+      "requires": {
+        "rc": "1.2.8",
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "registry-url": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/registry-url/-/registry-url-3.1.0.tgz",
+      "integrity": "sha1-PU74cPc93h138M+aOBQyRE4XSUI=",
+      "dev": true,
+      "requires": {
+        "rc": "1.2.8"
+      }
+    },
+    "regjsgen": {
+      "version": "0.2.0",
+      "resolved": "https://registry.npmjs.org/regjsgen/-/regjsgen-0.2.0.tgz",
+      "integrity": "sha1-bAFq3qxVT3WCP+N6wFuS1aTtsfc=",
+      "dev": true
+    },
+    "regjsparser": {
+      "version": "0.1.5",
+      "resolved": "https://registry.npmjs.org/regjsparser/-/regjsparser-0.1.5.tgz",
+      "integrity": "sha1-fuj4Tcb6eS0/0K4ijSS9lJ6tIFw=",
+      "dev": true,
+      "requires": {
+        "jsesc": "0.5.0"
+      },
+      "dependencies": {
+        "jsesc": {
+          "version": "0.5.0",
+          "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-0.5.0.tgz",
+          "integrity": "sha1-597mbjXW/Bb3EP6R1c9p9w8IkR0=",
+          "dev": true
+        }
+      }
+    },
+    "relateurl": {
+      "version": "0.2.7",
+      "resolved": "https://registry.npmjs.org/relateurl/-/relateurl-0.2.7.tgz",
+      "integrity": "sha1-VNvzd+UUQKypCkzSdGANP/LYiKk=",
+      "dev": true
+    },
+    "remove-trailing-separator": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz",
+      "integrity": "sha1-wkvOKig62tW8P1jg1IJJuSN52O8=",
+      "dev": true
+    },
+    "renderkid": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/renderkid/-/renderkid-2.0.1.tgz",
+      "integrity": "sha1-iYyr/Ivt5Le5ETWj/9Mj5YwNsxk=",
+      "dev": true,
+      "requires": {
+        "css-select": "1.2.0",
+        "dom-converter": "0.1.4",
+        "htmlparser2": "3.3.0",
+        "strip-ansi": "3.0.1",
+        "utila": "0.3.3"
+      },
+      "dependencies": {
+        "utila": {
+          "version": "0.3.3",
+          "resolved": "https://registry.npmjs.org/utila/-/utila-0.3.3.tgz",
+          "integrity": "sha1-1+jn1+MJEHCSsF+NloiCTWM6QiY=",
+          "dev": true
+        }
+      }
+    },
+    "repeat-element": {
+      "version": "1.1.3",
+      "resolved": "https://registry.npmjs.org/repeat-element/-/repeat-element-1.1.3.tgz",
+      "integrity": "sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g==",
+      "dev": true
+    },
+    "repeat-string": {
+      "version": "1.6.1",
+      "resolved": "https://registry.npmjs.org/repeat-string/-/repeat-string-1.6.1.tgz",
+      "integrity": "sha1-jcrkcOHIirwtYA//Sndihtp15jc=",
+      "dev": true
+    },
+    "repeating": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/repeating/-/repeating-2.0.1.tgz",
+      "integrity": "sha1-UhTFOpJtNVJwdSf7q0FdvAjQbdo=",
+      "dev": true,
+      "requires": {
+        "is-finite": "1.0.2"
+      }
+    },
+    "request": {
+      "version": "2.88.0",
+      "resolved": "https://registry.npmjs.org/request/-/request-2.88.0.tgz",
+      "integrity": "sha512-NAqBSrijGLZdM0WZNsInLJpkJokL72XYjUpnB0iwsRgxh7dB6COrHnTBNwN0E+lHDAJzu7kLAkDeY08z2/A0hg==",
+      "dev": true,
+      "requires": {
+        "aws-sign2": "0.7.0",
+        "aws4": "1.8.0",
+        "caseless": "0.12.0",
+        "combined-stream": "1.0.6",
+        "extend": "3.0.2",
+        "forever-agent": "0.6.1",
+        "form-data": "2.3.2",
+        "har-validator": "5.1.0",
+        "http-signature": "1.2.0",
+        "is-typedarray": "1.0.0",
+        "isstream": "0.1.2",
+        "json-stringify-safe": "5.0.1",
+        "mime-types": "2.1.20",
+        "oauth-sign": "0.9.0",
+        "performance-now": "2.1.0",
+        "qs": "6.5.2",
+        "safe-buffer": "5.1.2",
+        "tough-cookie": "2.4.3",
+        "tunnel-agent": "0.6.0",
+        "uuid": "3.3.2"
+      }
+    },
+    "require-directory": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz",
+      "integrity": "sha1-jGStX9MNqxyXbiNE/+f3kqam30I=",
+      "dev": true
+    },
+    "require-from-string": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/require-from-string/-/require-from-string-2.0.2.tgz",
+      "integrity": "sha512-Xf0nWe6RseziFMu+Ap9biiUbmplq6S9/p+7w7YXP/JBHhrUDDUhwa+vANyubuqfZWTveU//DYVGsDG7RKL/vEw==",
+      "dev": true
+    },
+    "require-main-filename": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-1.0.1.tgz",
+      "integrity": "sha1-l/cXtp1IeE9fUmpsWqj/3aBVpNE=",
+      "dev": true
+    },
+    "requires-port": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/requires-port/-/requires-port-1.0.0.tgz",
+      "integrity": "sha1-kl0mAdOaxIXgkc8NpcbmlNw9yv8=",
+      "dev": true
+    },
+    "resolve": {
+      "version": "1.8.1",
+      "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.8.1.tgz",
+      "integrity": "sha512-AicPrAC7Qu1JxPCZ9ZgCZlY35QgFnNqc+0LtbRNxnVw4TXvjQ72wnuL9JQcEBgXkI9JM8MsT9kaQoHcpCRJOYA==",
+      "dev": true,
+      "requires": {
+        "path-parse": "1.0.6"
+      }
+    },
+    "resolve-cwd": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/resolve-cwd/-/resolve-cwd-2.0.0.tgz",
+      "integrity": "sha1-AKn3OHVW4nA46uIyyqNypqWbZlo=",
+      "dev": true,
+      "requires": {
+        "resolve-from": "3.0.0"
+      }
+    },
+    "resolve-from": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-3.0.0.tgz",
+      "integrity": "sha1-six699nWiBvItuZTM17rywoYh0g=",
+      "dev": true
+    },
+    "resolve-url": {
+      "version": "0.2.1",
+      "resolved": "https://registry.npmjs.org/resolve-url/-/resolve-url-0.2.1.tgz",
+      "integrity": "sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo=",
+      "dev": true
+    },
+    "ret": {
+      "version": "0.1.15",
+      "resolved": "https://registry.npmjs.org/ret/-/ret-0.1.15.tgz",
+      "integrity": "sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg==",
+      "dev": true
+    },
+    "retry": {
+      "version": "0.10.1",
+      "resolved": "https://registry.npmjs.org/retry/-/retry-0.10.1.tgz",
+      "integrity": "sha1-52OI0heZLCUnUCQdPTlW/tmNj/Q=",
+      "dev": true
+    },
+    "right-align": {
+      "version": "0.1.3",
+      "resolved": "https://registry.npmjs.org/right-align/-/right-align-0.1.3.tgz",
+      "integrity": "sha1-YTObci/mo1FWiSENJOFMlhSGE+8=",
+      "dev": true,
+      "optional": true,
+      "requires": {
+        "align-text": "0.1.4"
+      }
+    },
+    "rimraf": {
+      "version": "2.6.2",
+      "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.6.2.tgz",
+      "integrity": "sha512-lreewLK/BlghmxtfH36YYVg1i8IAce4TI7oao75I1g245+6BctqTVQiBP3YUJ9C6DQOXJmkYR9X9fCLtCOJc5w==",
+      "dev": true,
+      "requires": {
+        "glob": "7.1.3"
+      }
+    },
+    "ripemd160": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/ripemd160/-/ripemd160-2.0.2.tgz",
+      "integrity": "sha512-ii4iagi25WusVoiC4B4lq7pbXfAp3D9v5CwfkY33vffw2+pkDjY1D8GaN7spsxvCSx8dkPqOZCEZyfxcmJG2IA==",
+      "dev": true,
+      "requires": {
+        "hash-base": "3.0.4",
+        "inherits": "2.0.3"
+      }
+    },
+    "rollup": {
+      "version": "0.59.4",
+      "resolved": "https://registry.npmjs.org/rollup/-/rollup-0.59.4.tgz",
+      "integrity": "sha512-ISiMqq/aJa+57QxX2MRcvLESHdJ7wSavmr6U1euMr+6UgFe6KM+3QANrYy8LQofwhTC1I7BcAdlLnDiaODs1BA==",
+      "dev": true,
+      "requires": {
+        "@types/estree": "0.0.39",
+        "@types/node": "8.9.5"
+      }
+    },
+    "rollup-plugin-commonjs": {
+      "version": "9.1.6",
+      "resolved": "https://registry.npmjs.org/rollup-plugin-commonjs/-/rollup-plugin-commonjs-9.1.6.tgz",
+      "integrity": "sha512-J7GOJm9uzEeLqkVxYSgjyoieh34hATWpa9G2M1ilGzWOLYGfQx5IDQ9ewG8QUj/Z2dzgV+d0/AyloAzElkABAA==",
+      "dev": true,
+      "requires": {
+        "estree-walker": "0.5.2",
+        "magic-string": "0.22.5",
+        "resolve": "1.8.1",
+        "rollup-pluginutils": "2.3.1"
+      }
+    },
+    "rollup-plugin-node-resolve": {
+      "version": "3.4.0",
+      "resolved": "https://registry.npmjs.org/rollup-plugin-node-resolve/-/rollup-plugin-node-resolve-3.4.0.tgz",
+      "integrity": "sha512-PJcd85dxfSBWih84ozRtBkB731OjXk0KnzN0oGp7WOWcarAFkVa71cV5hTJg2qpVsV2U8EUwrzHP3tvy9vS3qg==",
+      "dev": true,
+      "requires": {
+        "builtin-modules": "2.0.0",
+        "is-module": "1.0.0",
+        "resolve": "1.8.1"
+      },
+      "dependencies": {
+        "builtin-modules": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/builtin-modules/-/builtin-modules-2.0.0.tgz",
+          "integrity": "sha512-3U5kUA5VPsRUA3nofm/BXX7GVHKfxz0hOBAPxXrIvHzlDRkQVqEn6yi8QJegxl4LzOHLdvb7XF5dVawa/VVYBg==",
+          "dev": true
+        }
+      }
+    },
+    "rollup-plugin-sourcemaps": {
+      "version": "0.4.2",
+      "resolved": "https://registry.npmjs.org/rollup-plugin-sourcemaps/-/rollup-plugin-sourcemaps-0.4.2.tgz",
+      "integrity": "sha1-YhJaqUCHqt97g+9N+vYptHMTXoc=",
+      "dev": true,
+      "requires": {
+        "rollup-pluginutils": "2.3.1",
+        "source-map-resolve": "0.5.2"
+      }
+    },
+    "rollup-pluginutils": {
+      "version": "2.3.1",
+      "resolved": "https://registry.npmjs.org/rollup-pluginutils/-/rollup-pluginutils-2.3.1.tgz",
+      "integrity": "sha512-JZS8aJMHEHhqmY2QVPMXwKP6lsD1ShkrcGYjhAIvqKKdXQyPHw/9NF0tl3On/xOJ4ACkxfeG7AF+chfCN1NpBg==",
+      "dev": true,
+      "requires": {
+        "estree-walker": "0.5.2",
+        "micromatch": "2.3.11"
+      },
+      "dependencies": {
+        "arr-diff": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/arr-diff/-/arr-diff-2.0.0.tgz",
+          "integrity": "sha1-jzuCf5Vai9ZpaX5KQlasPOrjVs8=",
+          "dev": true,
+          "requires": {
+            "arr-flatten": "1.1.0"
+          }
+        },
+        "array-unique": {
+          "version": "0.2.1",
+          "resolved": "https://registry.npmjs.org/array-unique/-/array-unique-0.2.1.tgz",
+          "integrity": "sha1-odl8yvy8JiXMcPrc6zalDFiwGlM=",
+          "dev": true
+        },
+        "braces": {
+          "version": "1.8.5",
+          "resolved": "https://registry.npmjs.org/braces/-/braces-1.8.5.tgz",
+          "integrity": "sha1-uneWLhLf+WnWt2cR6RS3N4V79qc=",
+          "dev": true,
+          "requires": {
+            "expand-range": "1.8.2",
+            "preserve": "0.2.0",
+            "repeat-element": "1.1.3"
+          }
+        },
+        "expand-brackets": {
+          "version": "0.1.5",
+          "resolved": "https://registry.npmjs.org/expand-brackets/-/expand-brackets-0.1.5.tgz",
+          "integrity": "sha1-3wcoTjQqgHzXM6xa9yQR5YHRF3s=",
+          "dev": true,
+          "requires": {
+            "is-posix-bracket": "0.1.1"
+          }
+        },
+        "extglob": {
+          "version": "0.3.2",
+          "resolved": "https://registry.npmjs.org/extglob/-/extglob-0.3.2.tgz",
+          "integrity": "sha1-Lhj/PS9JqydlzskCPwEdqo2DSaE=",
+          "dev": true,
+          "requires": {
+            "is-extglob": "1.0.0"
+          }
+        },
+        "is-extglob": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-1.0.0.tgz",
+          "integrity": "sha1-rEaBd8SUNAWgkvyPKXYMb/xiBsA=",
+          "dev": true
+        },
+        "is-glob": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-2.0.1.tgz",
+          "integrity": "sha1-0Jb5JqPe1WAPP9/ZEZjLCIjC2GM=",
+          "dev": true,
+          "requires": {
+            "is-extglob": "1.0.0"
+          }
+        },
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        },
+        "micromatch": {
+          "version": "2.3.11",
+          "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-2.3.11.tgz",
+          "integrity": "sha1-hmd8l9FyCzY0MdBNDRUpO9OMFWU=",
+          "dev": true,
+          "requires": {
+            "arr-diff": "2.0.0",
+            "array-unique": "0.2.1",
+            "braces": "1.8.5",
+            "expand-brackets": "0.1.5",
+            "extglob": "0.3.2",
+            "filename-regex": "2.0.1",
+            "is-extglob": "1.0.0",
+            "is-glob": "2.0.1",
+            "kind-of": "3.2.2",
+            "normalize-path": "2.1.1",
+            "object.omit": "2.0.1",
+            "parse-glob": "3.0.4",
+            "regex-cache": "0.4.4"
+          }
+        }
+      }
+    },
+    "run-queue": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/run-queue/-/run-queue-1.0.3.tgz",
+      "integrity": "sha1-6Eg5bwV9Ij8kOGkkYY4laUFh7Ec=",
+      "dev": true,
+      "requires": {
+        "aproba": "1.2.0"
+      }
+    },
+    "rw": {
+      "version": "1.3.3",
+      "resolved": "https://registry.npmjs.org/rw/-/rw-1.3.3.tgz",
+      "integrity": "sha1-P4Yt+pGrdmsUiF700BEkv9oHT7Q="
+    },
+    "rxjs": {
+      "version": "6.3.2",
+      "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-6.3.2.tgz",
+      "integrity": "sha512-hV7criqbR0pe7EeL3O66UYVg92IR0XsA97+9y+BWTePK9SKmEI5Qd3Zj6uPnGkNzXsBywBQWTvujPl+1Kn9Zjw==",
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "safe-buffer": {
+      "version": "5.1.2",
+      "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz",
+      "integrity": "sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g==",
+      "dev": true
+    },
+    "safe-regex": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/safe-regex/-/safe-regex-1.1.0.tgz",
+      "integrity": "sha1-QKNmnzsHfR6UPURinhV91IAjvy4=",
+      "dev": true,
+      "requires": {
+        "ret": "0.1.15"
+      }
+    },
+    "safefs": {
+      "version": "4.1.0",
+      "resolved": "https://registry.npmjs.org/safefs/-/safefs-4.1.0.tgz",
+      "integrity": "sha1-+CrrS9165R9lPrIPZyizBYyNZEU=",
+      "dev": true,
+      "requires": {
+        "editions": "1.3.4",
+        "graceful-fs": "4.1.11"
+      }
+    },
+    "safer-buffer": {
+      "version": "2.1.2",
+      "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz",
+      "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==",
+      "dev": true
+    },
+    "sass-graph": {
+      "version": "2.2.4",
+      "resolved": "https://registry.npmjs.org/sass-graph/-/sass-graph-2.2.4.tgz",
+      "integrity": "sha1-E/vWPNHK8JCLn9k0dq1DpR0eC0k=",
+      "dev": true,
+      "requires": {
+        "glob": "7.1.3",
+        "lodash": "4.17.10",
+        "scss-tokenizer": "0.2.3",
+        "yargs": "7.1.0"
+      }
+    },
+    "sass-loader": {
+      "version": "7.1.0",
+      "resolved": "https://registry.npmjs.org/sass-loader/-/sass-loader-7.1.0.tgz",
+      "integrity": "sha512-+G+BKGglmZM2GUSfT9TLuEp6tzehHPjAMoRRItOojWIqIGPloVCMhNIQuG639eJ+y033PaGTSjLaTHts8Kw79w==",
+      "dev": true,
+      "requires": {
+        "clone-deep": "2.0.2",
+        "loader-utils": "1.1.0",
+        "lodash.tail": "4.1.1",
+        "neo-async": "2.5.2",
+        "pify": "3.0.0",
+        "semver": "5.5.1"
+      }
+    },
+    "saucelabs": {
+      "version": "1.5.0",
+      "resolved": "https://registry.npmjs.org/saucelabs/-/saucelabs-1.5.0.tgz",
+      "integrity": "sha512-jlX3FGdWvYf4Q3LFfFWS1QvPg3IGCGWxIc8QBFdPTbpTJnt/v17FHXYVAn7C8sHf1yUXo2c7yIM0isDryfYtHQ==",
+      "dev": true,
+      "requires": {
+        "https-proxy-agent": "2.2.1"
+      }
+    },
+    "sax": {
+      "version": "0.5.8",
+      "resolved": "http://registry.npmjs.org/sax/-/sax-0.5.8.tgz",
+      "integrity": "sha1-1HLbIo6zMcJQaw6MFVJK25OdEsE=",
+      "dev": true
+    },
+    "scandirectory": {
+      "version": "2.5.0",
+      "resolved": "https://registry.npmjs.org/scandirectory/-/scandirectory-2.5.0.tgz",
+      "integrity": "sha1-bOA/VKCQtmjjy+2/IO354xBZPnI=",
+      "dev": true,
+      "requires": {
+        "ignorefs": "1.2.0",
+        "safefs": "3.2.2",
+        "taskgroup": "4.3.1"
+      },
+      "dependencies": {
+        "safefs": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/safefs/-/safefs-3.2.2.tgz",
+          "integrity": "sha1-gXDBRE1wOOCMrqBaN0+uL6NJ4Vw=",
+          "dev": true,
+          "requires": {
+            "graceful-fs": "4.1.11"
+          }
+        },
+        "taskgroup": {
+          "version": "4.3.1",
+          "resolved": "https://registry.npmjs.org/taskgroup/-/taskgroup-4.3.1.tgz",
+          "integrity": "sha1-feGT/r12gnPEV3MElwJNUSwnkVo=",
+          "dev": true,
+          "requires": {
+            "ambi": "2.5.0",
+            "csextends": "1.2.0"
+          }
+        }
+      }
+    },
+    "schema-utils": {
+      "version": "0.4.7",
+      "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-0.4.7.tgz",
+      "integrity": "sha512-v/iwU6wvwGK8HbU9yi3/nhGzP0yGSuhQMzL6ySiec1FSrZZDkhm4noOSWzrNFo/jEc+SJY6jRTwuwbSXJPDUnQ==",
+      "dev": true,
+      "requires": {
+        "ajv": "6.4.0",
+        "ajv-keywords": "3.2.0"
+      }
+    },
+    "scss-tokenizer": {
+      "version": "0.2.3",
+      "resolved": "https://registry.npmjs.org/scss-tokenizer/-/scss-tokenizer-0.2.3.tgz",
+      "integrity": "sha1-jrBtualyMzOCTT9VMGQRSYR85dE=",
+      "dev": true,
+      "requires": {
+        "js-base64": "2.4.9",
+        "source-map": "0.4.4"
+      },
+      "dependencies": {
+        "source-map": {
+          "version": "0.4.4",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.4.4.tgz",
+          "integrity": "sha1-66T12pwNyZneaAMti092FzZSA2s=",
+          "dev": true,
+          "requires": {
+            "amdefine": "1.0.1"
+          }
+        }
+      }
+    },
+    "select-hose": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/select-hose/-/select-hose-2.0.0.tgz",
+      "integrity": "sha1-Yl2GWPhlr0Psliv8N2o3NZpJlMo=",
+      "dev": true
+    },
+    "selenium-webdriver": {
+      "version": "3.6.0",
+      "resolved": "https://registry.npmjs.org/selenium-webdriver/-/selenium-webdriver-3.6.0.tgz",
+      "integrity": "sha512-WH7Aldse+2P5bbFBO4Gle/nuQOdVwpHMTL6raL3uuBj/vPG07k6uzt3aiahu352ONBr5xXh0hDlM3LhtXPOC4Q==",
+      "dev": true,
+      "requires": {
+        "jszip": "3.1.5",
+        "rimraf": "2.6.2",
+        "tmp": "0.0.30",
+        "xml2js": "0.4.19"
+      },
+      "dependencies": {
+        "tmp": {
+          "version": "0.0.30",
+          "resolved": "https://registry.npmjs.org/tmp/-/tmp-0.0.30.tgz",
+          "integrity": "sha1-ckGdSovn1s51FI/YsyTlk6cRwu0=",
+          "dev": true,
+          "requires": {
+            "os-tmpdir": "1.0.2"
+          }
+        }
+      }
+    },
+    "selfsigned": {
+      "version": "1.10.3",
+      "resolved": "https://registry.npmjs.org/selfsigned/-/selfsigned-1.10.3.tgz",
+      "integrity": "sha512-vmZenZ+8Al3NLHkWnhBQ0x6BkML1eCP2xEi3JE+f3D9wW9fipD9NNJHYtE9XJM4TsPaHGZJIamrSI6MTg1dU2Q==",
+      "dev": true,
+      "requires": {
+        "node-forge": "0.7.5"
+      }
+    },
+    "semver": {
+      "version": "5.5.1",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-5.5.1.tgz",
+      "integrity": "sha512-PqpAxfrEhlSUWge8dwIp4tZnQ25DIOthpiaHNIthsjEFQD6EvqUKUDM7L8O2rShkFccYo1VjJR0coWfNkCubRw==",
+      "dev": true
+    },
+    "semver-diff": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/semver-diff/-/semver-diff-2.1.0.tgz",
+      "integrity": "sha1-S7uEN8jTfksM8aaP1ybsbWRdbTY=",
+      "dev": true,
+      "requires": {
+        "semver": "5.5.1"
+      }
+    },
+    "semver-dsl": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/semver-dsl/-/semver-dsl-1.0.1.tgz",
+      "integrity": "sha1-02eN5VVeimH2Ke7QJTZq5fJzQKA=",
+      "dev": true,
+      "requires": {
+        "semver": "5.5.1"
+      }
+    },
+    "semver-intersect": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/semver-intersect/-/semver-intersect-1.4.0.tgz",
+      "integrity": "sha512-d8fvGg5ycKAq0+I6nfWeCx6ffaWJCsBYU0H2Rq56+/zFePYfT8mXkB3tWBSjR5BerkHNZ5eTPIk1/LBYas35xQ==",
+      "dev": true,
+      "requires": {
+        "semver": "5.5.1"
+      }
+    },
+    "send": {
+      "version": "0.16.2",
+      "resolved": "https://registry.npmjs.org/send/-/send-0.16.2.tgz",
+      "integrity": "sha512-E64YFPUssFHEFBvpbbjr44NCLtI1AohxQ8ZSiJjQLskAdKuriYEP6VyGEsRDH8ScozGpkaX1BGvhanqCwkcEZw==",
+      "dev": true,
+      "requires": {
+        "debug": "2.6.9",
+        "depd": "1.1.2",
+        "destroy": "1.0.4",
+        "encodeurl": "1.0.2",
+        "escape-html": "1.0.3",
+        "etag": "1.8.1",
+        "fresh": "0.5.2",
+        "http-errors": "1.6.3",
+        "mime": "1.4.1",
+        "ms": "2.0.0",
+        "on-finished": "2.3.0",
+        "range-parser": "1.2.0",
+        "statuses": "1.4.0"
+      },
+      "dependencies": {
+        "mime": {
+          "version": "1.4.1",
+          "resolved": "https://registry.npmjs.org/mime/-/mime-1.4.1.tgz",
+          "integrity": "sha512-KI1+qOZu5DcW6wayYHSzR/tXKCDC5Om4s1z2QJjDULzLcmf3DvzS7oluY4HCTrc+9FiKmWUgeNLg7W3uIQvxtQ==",
+          "dev": true
+        }
+      }
+    },
+    "serialize-javascript": {
+      "version": "1.5.0",
+      "resolved": "https://registry.npmjs.org/serialize-javascript/-/serialize-javascript-1.5.0.tgz",
+      "integrity": "sha512-Ga8c8NjAAp46Br4+0oZ2WxJCwIzwP60Gq1YPgU+39PiTVxyed/iKE/zyZI6+UlVYH5Q4PaQdHhcegIFPZTUfoQ==",
+      "dev": true
+    },
+    "serve-index": {
+      "version": "1.9.1",
+      "resolved": "https://registry.npmjs.org/serve-index/-/serve-index-1.9.1.tgz",
+      "integrity": "sha1-03aNabHn2C5c4FD/9bRTvqEqkjk=",
+      "dev": true,
+      "requires": {
+        "accepts": "1.3.5",
+        "batch": "0.6.1",
+        "debug": "2.6.9",
+        "escape-html": "1.0.3",
+        "http-errors": "1.6.3",
+        "mime-types": "2.1.20",
+        "parseurl": "1.3.2"
+      }
+    },
+    "serve-static": {
+      "version": "1.13.2",
+      "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.13.2.tgz",
+      "integrity": "sha512-p/tdJrO4U387R9oMjb1oj7qSMaMfmOyd4j9hOFoxZe2baQszgHcSWjuya/CiT5kgZZKRudHNOA0pYXOl8rQ5nw==",
+      "dev": true,
+      "requires": {
+        "encodeurl": "1.0.2",
+        "escape-html": "1.0.3",
+        "parseurl": "1.3.2",
+        "send": "0.16.2"
+      }
+    },
+    "set-blocking": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz",
+      "integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=",
+      "dev": true
+    },
+    "set-immediate-shim": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/set-immediate-shim/-/set-immediate-shim-1.0.1.tgz",
+      "integrity": "sha1-SysbJ+uAip+NzEgaWOXlb1mfP2E=",
+      "dev": true
+    },
+    "set-value": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/set-value/-/set-value-2.0.0.tgz",
+      "integrity": "sha512-hw0yxk9GT/Hr5yJEYnHNKYXkIA8mVJgd9ditYZCe16ZczcaELYYcfvaXesNACk2O8O0nTiPQcQhGUQj8JLzeeg==",
+      "dev": true,
+      "requires": {
+        "extend-shallow": "2.0.1",
+        "is-extendable": "0.1.1",
+        "is-plain-object": "2.0.4",
+        "split-string": "3.1.0"
+      },
+      "dependencies": {
+        "extend-shallow": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+          "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+          "dev": true,
+          "requires": {
+            "is-extendable": "0.1.1"
+          }
+        }
+      }
+    },
+    "setimmediate": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/setimmediate/-/setimmediate-1.0.5.tgz",
+      "integrity": "sha1-KQy7Iy4waULX1+qbg3Mqt4VvgoU=",
+      "dev": true
+    },
+    "setprototypeof": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.1.0.tgz",
+      "integrity": "sha512-BvE/TwpZX4FXExxOxZyRGQQv651MSwmWKZGqvmPcRIjDqWub67kTKuIMx43cZZrS/cBBzwBcNDWoFxt2XEFIpQ==",
+      "dev": true
+    },
+    "sha.js": {
+      "version": "2.4.11",
+      "resolved": "https://registry.npmjs.org/sha.js/-/sha.js-2.4.11.tgz",
+      "integrity": "sha512-QMEp5B7cftE7APOjk5Y6xgrbWu+WkLVQwk8JNjZ8nKRciZaByEW6MubieAiToS7+dwvrjGhH8jRXz3MVd0AYqQ==",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3",
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "shallow-clone": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/shallow-clone/-/shallow-clone-1.0.0.tgz",
+      "integrity": "sha512-oeXreoKR/SyNJtRJMAKPDSvd28OqEwG4eR/xc856cRGBII7gX9lvAqDxusPm0846z/w/hWYjI1NpKwJ00NHzRA==",
+      "dev": true,
+      "requires": {
+        "is-extendable": "0.1.1",
+        "kind-of": "5.1.0",
+        "mixin-object": "2.0.1"
+      },
+      "dependencies": {
+        "kind-of": {
+          "version": "5.1.0",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-5.1.0.tgz",
+          "integrity": "sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw==",
+          "dev": true
+        }
+      }
+    },
+    "shebang-command": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-1.2.0.tgz",
+      "integrity": "sha1-RKrGW2lbAzmJaMOfNj/uXer98eo=",
+      "dev": true,
+      "requires": {
+        "shebang-regex": "1.0.0"
+      }
+    },
+    "shebang-regex": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-1.0.0.tgz",
+      "integrity": "sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM=",
+      "dev": true
+    },
+    "signal-exit": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.2.tgz",
+      "integrity": "sha1-tf3AjxKH6hF4Yo5BXiUTK3NkbG0=",
+      "dev": true
+    },
+    "silent-error": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/silent-error/-/silent-error-1.1.0.tgz",
+      "integrity": "sha1-IglwbxyFCp8dENDYQJGLRvJuG8k=",
+      "dev": true,
+      "requires": {
+        "debug": "2.6.9"
+      }
+    },
+    "slash": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/slash/-/slash-1.0.0.tgz",
+      "integrity": "sha1-xB8vbDn8FtHNF61LXYlhFK5HDVU=",
+      "dev": true
+    },
+    "slide": {
+      "version": "1.1.6",
+      "resolved": "https://registry.npmjs.org/slide/-/slide-1.1.6.tgz",
+      "integrity": "sha1-VusCfWW00tzmyy4tMsTUr8nh1wc=",
+      "dev": true
+    },
+    "snapdragon": {
+      "version": "0.8.2",
+      "resolved": "https://registry.npmjs.org/snapdragon/-/snapdragon-0.8.2.tgz",
+      "integrity": "sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg==",
+      "dev": true,
+      "requires": {
+        "base": "0.11.2",
+        "debug": "2.6.9",
+        "define-property": "0.2.5",
+        "extend-shallow": "2.0.1",
+        "map-cache": "0.2.2",
+        "source-map": "0.5.7",
+        "source-map-resolve": "0.5.2",
+        "use": "3.1.1"
+      },
+      "dependencies": {
+        "define-property": {
+          "version": "0.2.5",
+          "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
+          "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
+          "dev": true,
+          "requires": {
+            "is-descriptor": "0.1.6"
+          }
+        },
+        "extend-shallow": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+          "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+          "dev": true,
+          "requires": {
+            "is-extendable": "0.1.1"
+          }
+        }
+      }
+    },
+    "snapdragon-node": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/snapdragon-node/-/snapdragon-node-2.1.1.tgz",
+      "integrity": "sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw==",
+      "dev": true,
+      "requires": {
+        "define-property": "1.0.0",
+        "isobject": "3.0.1",
+        "snapdragon-util": "3.0.1"
+      },
+      "dependencies": {
+        "define-property": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/define-property/-/define-property-1.0.0.tgz",
+          "integrity": "sha1-dp66rz9KY6rTr56NMEybvnm/sOY=",
+          "dev": true,
+          "requires": {
+            "is-descriptor": "1.0.2"
+          }
+        },
+        "is-accessor-descriptor": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz",
+          "integrity": "sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ==",
+          "dev": true,
+          "requires": {
+            "kind-of": "6.0.2"
+          }
+        },
+        "is-data-descriptor": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz",
+          "integrity": "sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ==",
+          "dev": true,
+          "requires": {
+            "kind-of": "6.0.2"
+          }
+        },
+        "is-descriptor": {
+          "version": "1.0.2",
+          "resolved": "https://registry.npmjs.org/is-descriptor/-/is-descriptor-1.0.2.tgz",
+          "integrity": "sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg==",
+          "dev": true,
+          "requires": {
+            "is-accessor-descriptor": "1.0.0",
+            "is-data-descriptor": "1.0.0",
+            "kind-of": "6.0.2"
+          }
+        }
+      }
+    },
+    "snapdragon-util": {
+      "version": "3.0.1",
+      "resolved": "https://registry.npmjs.org/snapdragon-util/-/snapdragon-util-3.0.1.tgz",
+      "integrity": "sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ==",
+      "dev": true,
+      "requires": {
+        "kind-of": "3.2.2"
+      },
+      "dependencies": {
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        }
+      }
+    },
+    "socket.io": {
+      "version": "1.7.3",
+      "resolved": "https://registry.npmjs.org/socket.io/-/socket.io-1.7.3.tgz",
+      "integrity": "sha1-uK+cq6AJSeVo42nxMn6pvp6iRhs=",
+      "dev": true,
+      "requires": {
+        "debug": "2.3.3",
+        "engine.io": "1.8.3",
+        "has-binary": "0.1.7",
+        "object-assign": "4.1.0",
+        "socket.io-adapter": "0.5.0",
+        "socket.io-client": "1.7.3",
+        "socket.io-parser": "2.3.1"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "2.3.3",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-2.3.3.tgz",
+          "integrity": "sha1-QMRT5n5uE8kB3ewxeviYbNqe/4w=",
+          "dev": true,
+          "requires": {
+            "ms": "0.7.2"
+          }
+        },
+        "ms": {
+          "version": "0.7.2",
+          "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
+          "integrity": "sha1-riXPJRKziFodldfwN4aNhDESR2U=",
+          "dev": true
+        },
+        "object-assign": {
+          "version": "4.1.0",
+          "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.0.tgz",
+          "integrity": "sha1-ejs9DpgGPUP0wD8uiubNUahog6A=",
+          "dev": true
+        }
+      }
+    },
+    "socket.io-adapter": {
+      "version": "0.5.0",
+      "resolved": "https://registry.npmjs.org/socket.io-adapter/-/socket.io-adapter-0.5.0.tgz",
+      "integrity": "sha1-y21LuL7IHhB4uZZ3+c7QBGBmu4s=",
+      "dev": true,
+      "requires": {
+        "debug": "2.3.3",
+        "socket.io-parser": "2.3.1"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "2.3.3",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-2.3.3.tgz",
+          "integrity": "sha1-QMRT5n5uE8kB3ewxeviYbNqe/4w=",
+          "dev": true,
+          "requires": {
+            "ms": "0.7.2"
+          }
+        },
+        "ms": {
+          "version": "0.7.2",
+          "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
+          "integrity": "sha1-riXPJRKziFodldfwN4aNhDESR2U=",
+          "dev": true
+        }
+      }
+    },
+    "socket.io-client": {
+      "version": "1.7.3",
+      "resolved": "https://registry.npmjs.org/socket.io-client/-/socket.io-client-1.7.3.tgz",
+      "integrity": "sha1-sw6GqhDV7zVGYBwJzeR2Xjgdo3c=",
+      "dev": true,
+      "requires": {
+        "backo2": "1.0.2",
+        "component-bind": "1.0.0",
+        "component-emitter": "1.2.1",
+        "debug": "2.3.3",
+        "engine.io-client": "1.8.3",
+        "has-binary": "0.1.7",
+        "indexof": "0.0.1",
+        "object-component": "0.0.3",
+        "parseuri": "0.0.5",
+        "socket.io-parser": "2.3.1",
+        "to-array": "0.1.4"
+      },
+      "dependencies": {
+        "debug": {
+          "version": "2.3.3",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-2.3.3.tgz",
+          "integrity": "sha1-QMRT5n5uE8kB3ewxeviYbNqe/4w=",
+          "dev": true,
+          "requires": {
+            "ms": "0.7.2"
+          }
+        },
+        "ms": {
+          "version": "0.7.2",
+          "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.2.tgz",
+          "integrity": "sha1-riXPJRKziFodldfwN4aNhDESR2U=",
+          "dev": true
+        }
+      }
+    },
+    "socket.io-parser": {
+      "version": "2.3.1",
+      "resolved": "https://registry.npmjs.org/socket.io-parser/-/socket.io-parser-2.3.1.tgz",
+      "integrity": "sha1-3VMgJRA85Clpcya+/WQAX8/ltKA=",
+      "dev": true,
+      "requires": {
+        "component-emitter": "1.1.2",
+        "debug": "2.2.0",
+        "isarray": "0.0.1",
+        "json3": "3.3.2"
+      },
+      "dependencies": {
+        "component-emitter": {
+          "version": "1.1.2",
+          "resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.1.2.tgz",
+          "integrity": "sha1-KWWU8nU9qmOZbSrwjRWpURbJrsM=",
+          "dev": true
+        },
+        "debug": {
+          "version": "2.2.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz",
+          "integrity": "sha1-+HBX6ZWxofauaklgZkE3vFbwOdo=",
+          "dev": true,
+          "requires": {
+            "ms": "0.7.1"
+          }
+        },
+        "isarray": {
+          "version": "0.0.1",
+          "resolved": "https://registry.npmjs.org/isarray/-/isarray-0.0.1.tgz",
+          "integrity": "sha1-ihis/Kmo9Bd+Cav8YDiTmwXR7t8=",
+          "dev": true
+        },
+        "ms": {
+          "version": "0.7.1",
+          "resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz",
+          "integrity": "sha1-nNE8A62/8ltl7/3nzoZO6VIBcJg=",
+          "dev": true
+        }
+      }
+    },
+    "sockjs": {
+      "version": "0.3.19",
+      "resolved": "https://registry.npmjs.org/sockjs/-/sockjs-0.3.19.tgz",
+      "integrity": "sha512-V48klKZl8T6MzatbLlzzRNhMepEys9Y4oGFpypBFFn1gLI/QQ9HtLLyWJNbPlwGLelOVOEijUbTTJeLLI59jLw==",
+      "dev": true,
+      "requires": {
+        "faye-websocket": "0.10.0",
+        "uuid": "3.3.2"
+      }
+    },
+    "sockjs-client": {
+      "version": "1.1.5",
+      "resolved": "https://registry.npmjs.org/sockjs-client/-/sockjs-client-1.1.5.tgz",
+      "integrity": "sha1-G7fA9yIsQPQq3xT0RCy9Eml3GoM=",
+      "dev": true,
+      "requires": {
+        "debug": "2.6.9",
+        "eventsource": "0.1.6",
+        "faye-websocket": "0.11.1",
+        "inherits": "2.0.3",
+        "json3": "3.3.2",
+        "url-parse": "1.4.3"
+      },
+      "dependencies": {
+        "faye-websocket": {
+          "version": "0.11.1",
+          "resolved": "https://registry.npmjs.org/faye-websocket/-/faye-websocket-0.11.1.tgz",
+          "integrity": "sha1-8O/hjE9W5PQK/H4Gxxn9XuYYjzg=",
+          "dev": true,
+          "requires": {
+            "websocket-driver": "0.7.0"
+          }
+        }
+      }
+    },
+    "source-list-map": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/source-list-map/-/source-list-map-2.0.0.tgz",
+      "integrity": "sha512-I2UmuJSRr/T8jisiROLU3A3ltr+swpniSmNPI4Ml3ZCX6tVnDsuZzK7F2hl5jTqbZBWCEKlj5HRQiPExXLgE8A==",
+      "dev": true
+    },
+    "source-map": {
+      "version": "0.5.7",
+      "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.5.7.tgz",
+      "integrity": "sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w=",
+      "dev": true
+    },
+    "source-map-resolve": {
+      "version": "0.5.2",
+      "resolved": "https://registry.npmjs.org/source-map-resolve/-/source-map-resolve-0.5.2.tgz",
+      "integrity": "sha512-MjqsvNwyz1s0k81Goz/9vRBe9SZdB09Bdw+/zYyO+3CuPk6fouTaxscHkgtE8jKvf01kVfl8riHzERQ/kefaSA==",
+      "dev": true,
+      "requires": {
+        "atob": "2.1.2",
+        "decode-uri-component": "0.2.0",
+        "resolve-url": "0.2.1",
+        "source-map-url": "0.4.0",
+        "urix": "0.1.0"
+      }
+    },
+    "source-map-support": {
+      "version": "0.5.9",
+      "resolved": "https://registry.npmjs.org/source-map-support/-/source-map-support-0.5.9.tgz",
+      "integrity": "sha512-gR6Rw4MvUlYy83vP0vxoVNzM6t8MUXqNuRsuBmBHQDu1Fh6X015FrLdgoDKcNdkwGubozq0P4N0Q37UyFVr1EA==",
+      "dev": true,
+      "requires": {
+        "buffer-from": "1.1.1",
+        "source-map": "0.6.1"
+      },
+      "dependencies": {
+        "source-map": {
+          "version": "0.6.1",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+          "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+          "dev": true
+        }
+      }
+    },
+    "source-map-url": {
+      "version": "0.4.0",
+      "resolved": "https://registry.npmjs.org/source-map-url/-/source-map-url-0.4.0.tgz",
+      "integrity": "sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM=",
+      "dev": true
+    },
+    "spdx-correct": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/spdx-correct/-/spdx-correct-3.0.0.tgz",
+      "integrity": "sha512-N19o9z5cEyc8yQQPukRCZ9EUmb4HUpnrmaL/fxS2pBo2jbfcFRVuFZ/oFC+vZz0MNNk0h80iMn5/S6qGZOL5+g==",
+      "dev": true,
+      "requires": {
+        "spdx-expression-parse": "3.0.0",
+        "spdx-license-ids": "3.0.0"
+      }
+    },
+    "spdx-exceptions": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/spdx-exceptions/-/spdx-exceptions-2.1.0.tgz",
+      "integrity": "sha512-4K1NsmrlCU1JJgUrtgEeTVyfx8VaYea9J9LvARxhbHtVtohPs/gFGG5yy49beySjlIMhhXZ4QqujIZEfS4l6Cg==",
+      "dev": true
+    },
+    "spdx-expression-parse": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/spdx-expression-parse/-/spdx-expression-parse-3.0.0.tgz",
+      "integrity": "sha512-Yg6D3XpRD4kkOmTpdgbUiEJFKghJH03fiC1OPll5h/0sO6neh2jqRDVHOQ4o/LMea0tgCkbMgea5ip/e+MkWyg==",
+      "dev": true,
+      "requires": {
+        "spdx-exceptions": "2.1.0",
+        "spdx-license-ids": "3.0.0"
+      }
+    },
+    "spdx-license-ids": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/spdx-license-ids/-/spdx-license-ids-3.0.0.tgz",
+      "integrity": "sha512-2+EPwgbnmOIl8HjGBXXMd9NAu02vLjOO1nWw4kmeRDFyHn+M/ETfHxQUK0oXg8ctgVnl9t3rosNVsZ1jG61nDA==",
+      "dev": true
+    },
+    "spdy": {
+      "version": "3.4.7",
+      "resolved": "https://registry.npmjs.org/spdy/-/spdy-3.4.7.tgz",
+      "integrity": "sha1-Qv9B7OXMD5mjpsKKq7c/XDsDrLw=",
+      "dev": true,
+      "requires": {
+        "debug": "2.6.9",
+        "handle-thing": "1.2.5",
+        "http-deceiver": "1.2.7",
+        "safe-buffer": "5.1.2",
+        "select-hose": "2.0.0",
+        "spdy-transport": "2.1.0"
+      }
+    },
+    "spdy-transport": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/spdy-transport/-/spdy-transport-2.1.0.tgz",
+      "integrity": "sha512-bpUeGpZcmZ692rrTiqf9/2EUakI6/kXX1Rpe0ib/DyOzbiexVfXkw6GnvI9hVGvIwVaUhkaBojjCZwLNRGQg1g==",
+      "dev": true,
+      "requires": {
+        "debug": "2.6.9",
+        "detect-node": "2.0.4",
+        "hpack.js": "2.1.6",
+        "obuf": "1.1.2",
+        "readable-stream": "2.3.6",
+        "safe-buffer": "5.1.2",
+        "wbuf": "1.7.3"
+      }
+    },
+    "split": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/split/-/split-1.0.1.tgz",
+      "integrity": "sha512-mTyOoPbrivtXnwnIxZRFYRrPNtEFKlpB2fvjSnCQUiAA6qAZzqwna5envK4uk6OIeP17CsdF3rSBGYVBsU0Tkg==",
+      "dev": true,
+      "requires": {
+        "through": "2.3.8"
+      }
+    },
+    "split-string": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/split-string/-/split-string-3.1.0.tgz",
+      "integrity": "sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw==",
+      "dev": true,
+      "requires": {
+        "extend-shallow": "3.0.2"
+      }
+    },
+    "sprintf-js": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/sprintf-js/-/sprintf-js-1.0.3.tgz",
+      "integrity": "sha1-BOaSb2YolTVPPdAVIDYzuFcpfiw=",
+      "dev": true
+    },
+    "sshpk": {
+      "version": "1.14.2",
+      "resolved": "https://registry.npmjs.org/sshpk/-/sshpk-1.14.2.tgz",
+      "integrity": "sha1-xvxhZIo9nE52T9P8306hBeSSupg=",
+      "dev": true,
+      "requires": {
+        "asn1": "0.2.4",
+        "assert-plus": "1.0.0",
+        "bcrypt-pbkdf": "1.0.2",
+        "dashdash": "1.14.1",
+        "ecc-jsbn": "0.1.2",
+        "getpass": "0.1.7",
+        "jsbn": "0.1.1",
+        "safer-buffer": "2.1.2",
+        "tweetnacl": "0.14.5"
+      }
+    },
+    "ssri": {
+      "version": "5.3.0",
+      "resolved": "https://registry.npmjs.org/ssri/-/ssri-5.3.0.tgz",
+      "integrity": "sha512-XRSIPqLij52MtgoQavH/x/dU1qVKtWUAAZeOHsR9c2Ddi4XerFy3mc1alf+dLJKl9EUIm/Ht+EowFkTUOA6GAQ==",
+      "dev": true,
+      "requires": {
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "static-extend": {
+      "version": "0.1.2",
+      "resolved": "https://registry.npmjs.org/static-extend/-/static-extend-0.1.2.tgz",
+      "integrity": "sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY=",
+      "dev": true,
+      "requires": {
+        "define-property": "0.2.5",
+        "object-copy": "0.1.0"
+      },
+      "dependencies": {
+        "define-property": {
+          "version": "0.2.5",
+          "resolved": "https://registry.npmjs.org/define-property/-/define-property-0.2.5.tgz",
+          "integrity": "sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY=",
+          "dev": true,
+          "requires": {
+            "is-descriptor": "0.1.6"
+          }
+        }
+      }
+    },
+    "stats-webpack-plugin": {
+      "version": "0.6.2",
+      "resolved": "https://registry.npmjs.org/stats-webpack-plugin/-/stats-webpack-plugin-0.6.2.tgz",
+      "integrity": "sha1-LFlJtTHgf4eojm6k3PrFOqjHWis=",
+      "dev": true,
+      "requires": {
+        "lodash": "4.17.10"
+      }
+    },
+    "statuses": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.4.0.tgz",
+      "integrity": "sha512-zhSCtt8v2NDrRlPQpCNtw/heZLtfUDqxBM1udqikb/Hbk52LK4nQSwr10u77iopCW5LsyHpuXS0GnEc48mLeew==",
+      "dev": true
+    },
+    "stdout-stream": {
+      "version": "1.4.1",
+      "resolved": "https://registry.npmjs.org/stdout-stream/-/stdout-stream-1.4.1.tgz",
+      "integrity": "sha512-j4emi03KXqJWcIeF8eIXkjMFN1Cmb8gUlDYGeBALLPo5qdyTfA9bOtl8m33lRoC+vFMkP3gl0WsDr6+gzxbbTA==",
+      "dev": true,
+      "requires": {
+        "readable-stream": "2.3.6"
+      }
+    },
+    "stream-browserify": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/stream-browserify/-/stream-browserify-2.0.1.tgz",
+      "integrity": "sha1-ZiZu5fm9uZQKTkUUyvtDu3Hlyds=",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3",
+        "readable-stream": "2.3.6"
+      }
+    },
+    "stream-combiner": {
+      "version": "0.2.2",
+      "resolved": "https://registry.npmjs.org/stream-combiner/-/stream-combiner-0.2.2.tgz",
+      "integrity": "sha1-rsjLrBd7Vrb0+kec7YwZEs7lKFg=",
+      "dev": true,
+      "requires": {
+        "duplexer": "0.1.1",
+        "through": "2.3.8"
+      }
+    },
+    "stream-each": {
+      "version": "1.2.3",
+      "resolved": "https://registry.npmjs.org/stream-each/-/stream-each-1.2.3.tgz",
+      "integrity": "sha512-vlMC2f8I2u/bZGqkdfLQW/13Zihpej/7PmSiMQsbYddxuTsJp8vRe2x2FvVExZg7FaOds43ROAuFJwPR4MTZLw==",
+      "dev": true,
+      "requires": {
+        "end-of-stream": "1.4.1",
+        "stream-shift": "1.0.0"
+      }
+    },
+    "stream-http": {
+      "version": "2.8.3",
+      "resolved": "https://registry.npmjs.org/stream-http/-/stream-http-2.8.3.tgz",
+      "integrity": "sha512-+TSkfINHDo4J+ZobQLWiMouQYB+UVYFttRA94FpEzzJ7ZdqcL4uUUQ7WkdkI4DSozGmgBUE/a47L+38PenXhUw==",
+      "dev": true,
+      "requires": {
+        "builtin-status-codes": "3.0.0",
+        "inherits": "2.0.3",
+        "readable-stream": "2.3.6",
+        "to-arraybuffer": "1.0.1",
+        "xtend": "4.0.1"
+      }
+    },
+    "stream-shift": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/stream-shift/-/stream-shift-1.0.0.tgz",
+      "integrity": "sha1-1cdSgl5TZ+eG944Y5EXqIjoVWVI=",
+      "dev": true
+    },
+    "string-width": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/string-width/-/string-width-1.0.2.tgz",
+      "integrity": "sha1-EYvfW4zcUaKn5w0hHgfisLmxB9M=",
+      "dev": true,
+      "requires": {
+        "code-point-at": "1.1.0",
+        "is-fullwidth-code-point": "1.0.0",
+        "strip-ansi": "3.0.1"
+      }
+    },
+    "string_decoder": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.1.1.tgz",
+      "integrity": "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg==",
+      "dev": true,
+      "requires": {
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "strip-ansi": {
+      "version": "3.0.1",
+      "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-3.0.1.tgz",
+      "integrity": "sha1-ajhfuIU9lS1f8F0Oiq+UJ43GPc8=",
+      "dev": true,
+      "requires": {
+        "ansi-regex": "2.1.1"
+      }
+    },
+    "strip-bom": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-2.0.0.tgz",
+      "integrity": "sha1-YhmoVhZSBJHzV4i9vxRHqZx+aw4=",
+      "dev": true,
+      "requires": {
+        "is-utf8": "0.2.1"
+      }
+    },
+    "strip-eof": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/strip-eof/-/strip-eof-1.0.0.tgz",
+      "integrity": "sha1-u0P/VZim6wXYm1n80SnJgzE2Br8=",
+      "dev": true
+    },
+    "strip-indent": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-1.0.1.tgz",
+      "integrity": "sha1-DHlipq3vp7vUrDZkYKY4VSrhoKI=",
+      "dev": true,
+      "requires": {
+        "get-stdin": "4.0.1"
+      }
+    },
+    "strip-json-comments": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-2.0.1.tgz",
+      "integrity": "sha1-PFMZQukIwml8DsNEhYwobHygpgo=",
+      "dev": true
+    },
+    "style-loader": {
+      "version": "0.21.0",
+      "resolved": "https://registry.npmjs.org/style-loader/-/style-loader-0.21.0.tgz",
+      "integrity": "sha512-T+UNsAcl3Yg+BsPKs1vd22Fr8sVT+CJMtzqc6LEw9bbJZb43lm9GoeIfUcDEefBSWC0BhYbcdupV1GtI4DGzxg==",
+      "dev": true,
+      "requires": {
+        "loader-utils": "1.1.0",
+        "schema-utils": "0.4.7"
+      }
+    },
+    "stylus": {
+      "version": "0.54.5",
+      "resolved": "https://registry.npmjs.org/stylus/-/stylus-0.54.5.tgz",
+      "integrity": "sha1-QrlWCTHKcJDOhRWnmLqeaqPW3Hk=",
+      "dev": true,
+      "requires": {
+        "css-parse": "1.7.0",
+        "debug": "2.6.9",
+        "glob": "7.0.6",
+        "mkdirp": "0.5.1",
+        "sax": "0.5.8",
+        "source-map": "0.1.43"
+      },
+      "dependencies": {
+        "glob": {
+          "version": "7.0.6",
+          "resolved": "https://registry.npmjs.org/glob/-/glob-7.0.6.tgz",
+          "integrity": "sha1-IRuvr0nlJbjNkyYNFKsTYVKz9Xo=",
+          "dev": true,
+          "requires": {
+            "fs.realpath": "1.0.0",
+            "inflight": "1.0.6",
+            "inherits": "2.0.3",
+            "minimatch": "3.0.4",
+            "once": "1.4.0",
+            "path-is-absolute": "1.0.1"
+          }
+        },
+        "source-map": {
+          "version": "0.1.43",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.1.43.tgz",
+          "integrity": "sha1-wkvBRspRfBRx9drL4lcbK3+eM0Y=",
+          "dev": true,
+          "requires": {
+            "amdefine": "1.0.1"
+          }
+        }
+      }
+    },
+    "stylus-loader": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/stylus-loader/-/stylus-loader-3.0.2.tgz",
+      "integrity": "sha512-+VomPdZ6a0razP+zinir61yZgpw2NfljeSsdUF5kJuEzlo3khXhY19Fn6l8QQz1GRJGtMCo8nG5C04ePyV7SUA==",
+      "dev": true,
+      "requires": {
+        "loader-utils": "1.1.0",
+        "lodash.clonedeep": "4.5.0",
+        "when": "3.6.4"
+      }
+    },
+    "supports-color": {
+      "version": "5.5.0",
+      "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz",
+      "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==",
+      "dev": true,
+      "requires": {
+        "has-flag": "3.0.0"
+      }
+    },
+    "symbol-observable": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/symbol-observable/-/symbol-observable-1.2.0.tgz",
+      "integrity": "sha512-e900nM8RRtGhlV36KGEU9k65K3mPb1WV70OdjfxlG2EAuM1noi/E/BaW/uMhL7bPEssK8QV57vN3esixjUvcXQ==",
+      "dev": true
+    },
+    "tapable": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/tapable/-/tapable-1.0.0.tgz",
+      "integrity": "sha512-dQRhbNQkRnaqauC7WqSJ21EEksgT0fYZX2lqXzGkpo8JNig9zGZTYoMGvyI2nWmXlE2VSVXVDu7wLVGu/mQEsg==",
+      "dev": true
+    },
+    "tar": {
+      "version": "2.2.1",
+      "resolved": "https://registry.npmjs.org/tar/-/tar-2.2.1.tgz",
+      "integrity": "sha1-jk0qJWwOIYXGsYrWlK7JaLg8sdE=",
+      "dev": true,
+      "requires": {
+        "block-stream": "0.0.9",
+        "fstream": "1.0.11",
+        "inherits": "2.0.3"
+      }
+    },
+    "taskgroup": {
+      "version": "5.3.0",
+      "resolved": "https://registry.npmjs.org/taskgroup/-/taskgroup-5.3.0.tgz",
+      "integrity": "sha512-++j3Yi3XZGYgAvmGzRtNa+BnDvkPbdroyMffCY+Gj9A4iH2IJ1S7/g6LewGVXQkVw/KOzlfE1TimARYXvOEsgQ==",
+      "dev": true,
+      "requires": {
+        "ambi": "3.1.1",
+        "eachr": "3.2.0",
+        "editions": "1.3.4",
+        "extendr": "3.3.0",
+        "unbounded": "1.1.0"
+      },
+      "dependencies": {
+        "ambi": {
+          "version": "3.1.1",
+          "resolved": "https://registry.npmjs.org/ambi/-/ambi-3.1.1.tgz",
+          "integrity": "sha512-aObUKDykDPXOvovML+jDLJMw1cRS3/VhYb7vI3GmtQB7hmWeILWDzMYwC/9pljYL5gK3ZMb2QzUA9qQn5VAx7A==",
+          "dev": true,
+          "requires": {
+            "editions": "2.0.2",
+            "typechecker": "4.5.0"
+          },
+          "dependencies": {
+            "editions": {
+              "version": "2.0.2",
+              "resolved": "https://registry.npmjs.org/editions/-/editions-2.0.2.tgz",
+              "integrity": "sha512-0B8aSTWUu9+JW99zHoeogavCi+lkE5l35FK0OKe0pCobixJYoeof3ZujtqYzSsU2MskhRadY5V9oWUuyG4aJ3A==",
+              "dev": true,
+              "requires": {
+                "errlop": "1.0.3",
+                "semver": "5.5.1"
+              }
+            }
+          }
+        }
+      }
+    },
+    "term-size": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/term-size/-/term-size-1.2.0.tgz",
+      "integrity": "sha1-RYuDiH8oj8Vtb/+/rSYuJmOO+mk=",
+      "dev": true,
+      "requires": {
+        "execa": "0.7.0"
+      },
+      "dependencies": {
+        "cross-spawn": {
+          "version": "5.1.0",
+          "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-5.1.0.tgz",
+          "integrity": "sha1-6L0O/uWPz/b4+UUQoKVUu/ojVEk=",
+          "dev": true,
+          "requires": {
+            "lru-cache": "4.1.3",
+            "shebang-command": "1.2.0",
+            "which": "1.3.1"
+          }
+        },
+        "execa": {
+          "version": "0.7.0",
+          "resolved": "https://registry.npmjs.org/execa/-/execa-0.7.0.tgz",
+          "integrity": "sha1-lEvs00zEHuMqY6n68nrVpl/Fl3c=",
+          "dev": true,
+          "requires": {
+            "cross-spawn": "5.1.0",
+            "get-stream": "3.0.0",
+            "is-stream": "1.1.0",
+            "npm-run-path": "2.0.2",
+            "p-finally": "1.0.0",
+            "signal-exit": "3.0.2",
+            "strip-eof": "1.0.0"
+          }
+        }
+      }
+    },
+    "through": {
+      "version": "2.3.8",
+      "resolved": "https://registry.npmjs.org/through/-/through-2.3.8.tgz",
+      "integrity": "sha1-DdTJ/6q8NXlgsbckEV1+Doai4fU=",
+      "dev": true
+    },
+    "through2": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/through2/-/through2-2.0.3.tgz",
+      "integrity": "sha1-AARWmzfHx0ujnEPzzteNGtlBQL4=",
+      "dev": true,
+      "requires": {
+        "readable-stream": "2.3.6",
+        "xtend": "4.0.1"
+      }
+    },
+    "thunky": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/thunky/-/thunky-1.0.2.tgz",
+      "integrity": "sha1-qGLgGOP7HqLsP85dVWBc9X8kc3E=",
+      "dev": true
+    },
+    "time-stamp": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/time-stamp/-/time-stamp-1.1.0.tgz",
+      "integrity": "sha1-dkpaEa9QVhkhsTPztE5hhofg9cM=",
+      "dev": true
+    },
+    "timed-out": {
+      "version": "4.0.1",
+      "resolved": "https://registry.npmjs.org/timed-out/-/timed-out-4.0.1.tgz",
+      "integrity": "sha1-8y6srFoXW+ol1/q1Zas+2HQe9W8=",
+      "dev": true
+    },
+    "timers-browserify": {
+      "version": "2.0.10",
+      "resolved": "https://registry.npmjs.org/timers-browserify/-/timers-browserify-2.0.10.tgz",
+      "integrity": "sha512-YvC1SV1XdOUaL6gx5CoGroT3Gu49pK9+TZ38ErPldOWW4j49GI1HKs9DV+KGq/w6y+LZ72W1c8cKz2vzY+qpzg==",
+      "dev": true,
+      "requires": {
+        "setimmediate": "1.0.5"
+      }
+    },
+    "tmp": {
+      "version": "0.0.31",
+      "resolved": "https://registry.npmjs.org/tmp/-/tmp-0.0.31.tgz",
+      "integrity": "sha1-jzirlDjhcxXl29izZX6L+yd65Kc=",
+      "dev": true,
+      "requires": {
+        "os-tmpdir": "1.0.2"
+      }
+    },
+    "to-array": {
+      "version": "0.1.4",
+      "resolved": "https://registry.npmjs.org/to-array/-/to-array-0.1.4.tgz",
+      "integrity": "sha1-F+bBH3PdTz10zaek/zI46a2b+JA=",
+      "dev": true
+    },
+    "to-arraybuffer": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz",
+      "integrity": "sha1-fSKbH8xjfkZsoIEYCDanqr/4P0M=",
+      "dev": true
+    },
+    "to-fast-properties": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-1.0.3.tgz",
+      "integrity": "sha1-uDVx+k2MJbguIxsG46MFXeTKGkc=",
+      "dev": true
+    },
+    "to-object-path": {
+      "version": "0.3.0",
+      "resolved": "https://registry.npmjs.org/to-object-path/-/to-object-path-0.3.0.tgz",
+      "integrity": "sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68=",
+      "dev": true,
+      "requires": {
+        "kind-of": "3.2.2"
+      },
+      "dependencies": {
+        "kind-of": {
+          "version": "3.2.2",
+          "resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
+          "integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
+          "dev": true,
+          "requires": {
+            "is-buffer": "1.1.6"
+          }
+        }
+      }
+    },
+    "to-regex": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/to-regex/-/to-regex-3.0.2.tgz",
+      "integrity": "sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw==",
+      "dev": true,
+      "requires": {
+        "define-property": "2.0.2",
+        "extend-shallow": "3.0.2",
+        "regex-not": "1.0.2",
+        "safe-regex": "1.1.0"
+      }
+    },
+    "to-regex-range": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-2.1.1.tgz",
+      "integrity": "sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg=",
+      "dev": true,
+      "requires": {
+        "is-number": "3.0.0",
+        "repeat-string": "1.6.1"
+      }
+    },
+    "toposort": {
+      "version": "1.0.7",
+      "resolved": "https://registry.npmjs.org/toposort/-/toposort-1.0.7.tgz",
+      "integrity": "sha1-LmhELZ9k7HILjMieZEOsbKqVACk=",
+      "dev": true
+    },
+    "tough-cookie": {
+      "version": "2.4.3",
+      "resolved": "https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.4.3.tgz",
+      "integrity": "sha512-Q5srk/4vDM54WJsJio3XNn6K2sCG+CQ8G5Wz6bZhRZoAe/+TxjWB/GlFAnYEbkYVlON9FMk/fE3h2RLpPXo4lQ==",
+      "dev": true,
+      "requires": {
+        "psl": "1.1.29",
+        "punycode": "1.4.1"
+      },
+      "dependencies": {
+        "punycode": {
+          "version": "1.4.1",
+          "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.4.1.tgz",
+          "integrity": "sha1-wNWmOycYgArY4esPpSachN1BhF4=",
+          "dev": true
+        }
+      }
+    },
+    "traverse": {
+      "version": "0.6.6",
+      "resolved": "https://registry.npmjs.org/traverse/-/traverse-0.6.6.tgz",
+      "integrity": "sha1-y99WD9e5r2MlAv7UD5GMFX6pcTc=",
+      "dev": true
+    },
+    "tree-kill": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/tree-kill/-/tree-kill-1.2.0.tgz",
+      "integrity": "sha512-DlX6dR0lOIRDFxI0mjL9IYg6OTncLm/Zt+JiBhE5OlFcAR8yc9S7FFXU9so0oda47frdM/JFsk7UjNt9vscKcg==",
+      "dev": true
+    },
+    "trim-newlines": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/trim-newlines/-/trim-newlines-1.0.0.tgz",
+      "integrity": "sha1-WIeWa7WCpFA6QetST301ARgVphM=",
+      "dev": true
+    },
+    "trim-right": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/trim-right/-/trim-right-1.0.1.tgz",
+      "integrity": "sha1-yy4SAwZ+DI3h9hQJS5/kVwTqYAM=",
+      "dev": true
+    },
+    "true-case-path": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/true-case-path/-/true-case-path-1.0.3.tgz",
+      "integrity": "sha512-m6s2OdQe5wgpFMC+pAJ+q9djG82O2jcHPOI6RNg1yy9rCYR+WD6Nbpl32fDpfC56nirdRy+opFa/Vk7HYhqaew==",
+      "dev": true,
+      "requires": {
+        "glob": "7.1.3"
+      }
+    },
+    "ts-node": {
+      "version": "5.0.1",
+      "resolved": "https://registry.npmjs.org/ts-node/-/ts-node-5.0.1.tgz",
+      "integrity": "sha512-XK7QmDcNHVmZkVtkiwNDWiERRHPyU8nBqZB1+iv2UhOG0q3RQ9HsZ2CMqISlFbxjrYFGfG2mX7bW4dAyxBVzUw==",
+      "dev": true,
+      "requires": {
+        "arrify": "1.0.1",
+        "chalk": "2.4.1",
+        "diff": "3.5.0",
+        "make-error": "1.3.5",
+        "minimist": "1.2.0",
+        "mkdirp": "0.5.1",
+        "source-map-support": "0.5.9",
+        "yn": "2.0.0"
+      },
+      "dependencies": {
+        "chalk": {
+          "version": "2.4.1",
+          "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.1.tgz",
+          "integrity": "sha512-ObN6h1v2fTJSmUXoS3nMQ92LbDK9be4TV+6G+omQlGJFdcUX5heKi1LZ1YnRMIgwTLEj3E24bT6tYni50rlCfQ==",
+          "dev": true,
+          "requires": {
+            "ansi-styles": "3.2.1",
+            "escape-string-regexp": "1.0.5",
+            "supports-color": "5.5.0"
+          }
+        },
+        "minimist": {
+          "version": "1.2.0",
+          "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+          "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+          "dev": true
+        }
+      }
+    },
+    "ts-simple-ast": {
+      "version": "12.4.0",
+      "resolved": "https://registry.npmjs.org/ts-simple-ast/-/ts-simple-ast-12.4.0.tgz",
+      "integrity": "sha512-7GJFZlyTZY7uMAEhX62ZLxdwOpGDJzc/nwpi1nRPZ7N2ICcqqrMjDtRnki15IUBv2ZjIGu6KBqk/pUqJFODFsg==",
+      "dev": true,
+      "requires": {
+        "@dsherret/to-absolute-glob": "2.0.2",
+        "code-block-writer": "7.2.1",
+        "fs-extra": "6.0.1",
+        "glob-parent": "3.1.0",
+        "globby": "8.0.1",
+        "is-negated-glob": "1.0.0",
+        "multimatch": "2.1.0",
+        "object-assign": "4.1.1",
+        "tslib": "1.9.3",
+        "typescript": "2.9.1"
+      },
+      "dependencies": {
+        "globby": {
+          "version": "8.0.1",
+          "resolved": "https://registry.npmjs.org/globby/-/globby-8.0.1.tgz",
+          "integrity": "sha512-oMrYrJERnKBLXNLVTqhm3vPEdJ/b2ZE28xN4YARiix1NOIOBPEpOUnm844K1iu/BkphCaf2WNFwMszv8Soi1pw==",
+          "dev": true,
+          "requires": {
+            "array-union": "1.0.2",
+            "dir-glob": "2.0.0",
+            "fast-glob": "2.2.2",
+            "glob": "7.1.3",
+            "ignore": "3.3.10",
+            "pify": "3.0.0",
+            "slash": "1.0.0"
+          }
+        },
+        "typescript": {
+          "version": "2.9.1",
+          "resolved": "https://registry.npmjs.org/typescript/-/typescript-2.9.1.tgz",
+          "integrity": "sha512-h6pM2f/GDchCFlldnriOhs1QHuwbnmj6/v7499eMHqPeW4V2G0elua2eIc2nu8v2NdHV0Gm+tzX83Hr6nUFjQA==",
+          "dev": true
+        }
+      }
+    },
+    "tsickle": {
+      "version": "0.32.1",
+      "resolved": "https://registry.npmjs.org/tsickle/-/tsickle-0.32.1.tgz",
+      "integrity": "sha512-JW9j+W0SaMSZGejIFZBk0AiPfnhljK3oLx5SaqxrJhjlvzFyPml5zqG1/PuScUj6yTe1muEqwk5CnDK0cOZmKw==",
+      "dev": true,
+      "requires": {
+        "jasmine-diff": "0.1.3",
+        "minimist": "1.2.0",
+        "mkdirp": "0.5.1",
+        "source-map": "0.6.1",
+        "source-map-support": "0.5.9"
+      },
+      "dependencies": {
+        "minimist": {
+          "version": "1.2.0",
+          "resolved": "http://registry.npmjs.org/minimist/-/minimist-1.2.0.tgz",
+          "integrity": "sha1-o1AIsg9BOD7sH7kU9M1d95omQoQ=",
+          "dev": true
+        },
+        "source-map": {
+          "version": "0.6.1",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+          "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+          "dev": true
+        }
+      }
+    },
+    "tslib": {
+      "version": "1.9.3",
+      "resolved": "https://registry.npmjs.org/tslib/-/tslib-1.9.3.tgz",
+      "integrity": "sha512-4krF8scpejhaOgqzBEcGM7yDIEfi0/8+8zDRZhNZZ2kjmHJ4hv3zCbQWxoJGz1iw5U0Jl0nma13xzHXcncMavQ=="
+    },
+    "tslint": {
+      "version": "5.9.1",
+      "resolved": "https://registry.npmjs.org/tslint/-/tslint-5.9.1.tgz",
+      "integrity": "sha1-ElX4ej/1frCw4fDmEKi0dIBGya4=",
+      "dev": true,
+      "requires": {
+        "babel-code-frame": "6.26.0",
+        "builtin-modules": "1.1.1",
+        "chalk": "2.4.1",
+        "commander": "2.17.1",
+        "diff": "3.5.0",
+        "glob": "7.1.3",
+        "js-yaml": "3.12.0",
+        "minimatch": "3.0.4",
+        "resolve": "1.8.1",
+        "semver": "5.5.1",
+        "tslib": "1.9.3",
+        "tsutils": "2.29.0"
+      },
+      "dependencies": {
+        "chalk": {
+          "version": "2.4.1",
+          "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.1.tgz",
+          "integrity": "sha512-ObN6h1v2fTJSmUXoS3nMQ92LbDK9be4TV+6G+omQlGJFdcUX5heKi1LZ1YnRMIgwTLEj3E24bT6tYni50rlCfQ==",
+          "dev": true,
+          "requires": {
+            "ansi-styles": "3.2.1",
+            "escape-string-regexp": "1.0.5",
+            "supports-color": "5.5.0"
+          }
+        }
+      }
+    },
+    "tsutils": {
+      "version": "2.29.0",
+      "resolved": "https://registry.npmjs.org/tsutils/-/tsutils-2.29.0.tgz",
+      "integrity": "sha512-g5JVHCIJwzfISaXpXE1qvNalca5Jwob6FjI4AoPlqMusJ6ftFE7IkkFoMhVLRgK+4Kx3gkzb8UZK5t5yTTvEmA==",
+      "dev": true,
+      "requires": {
+        "tslib": "1.9.3"
+      }
+    },
+    "tty-browserify": {
+      "version": "0.0.0",
+      "resolved": "https://registry.npmjs.org/tty-browserify/-/tty-browserify-0.0.0.tgz",
+      "integrity": "sha1-oVe6QC2iTpv5V/mqadUk7tQpAaY=",
+      "dev": true
+    },
+    "tunnel-agent": {
+      "version": "0.6.0",
+      "resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.6.0.tgz",
+      "integrity": "sha1-J6XeoGs2sEoKmWZ3SykIaPD8QP0=",
+      "dev": true,
+      "requires": {
+        "safe-buffer": "5.1.2"
+      }
+    },
+    "tweetnacl": {
+      "version": "0.14.5",
+      "resolved": "https://registry.npmjs.org/tweetnacl/-/tweetnacl-0.14.5.tgz",
+      "integrity": "sha1-WuaBd/GS1EViadEIr6k/+HQ/T2Q=",
+      "dev": true,
+      "optional": true
+    },
+    "type-check": {
+      "version": "0.3.2",
+      "resolved": "https://registry.npmjs.org/type-check/-/type-check-0.3.2.tgz",
+      "integrity": "sha1-WITKtRLPHTVeP7eE8wgEsrUg23I=",
+      "dev": true,
+      "requires": {
+        "prelude-ls": "1.1.2"
+      }
+    },
+    "type-is": {
+      "version": "1.6.16",
+      "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.16.tgz",
+      "integrity": "sha512-HRkVv/5qY2G6I8iab9cI7v1bOIdhm94dVjQCPFElW9W+3GeDOSHmy2EBYe4VTApuzolPcmgFTN3ftVJRKR2J9Q==",
+      "dev": true,
+      "requires": {
+        "media-typer": "0.3.0",
+        "mime-types": "2.1.20"
+      }
+    },
+    "typechecker": {
+      "version": "4.5.0",
+      "resolved": "https://registry.npmjs.org/typechecker/-/typechecker-4.5.0.tgz",
+      "integrity": "sha512-bqPE/ck3bVIaXP7gMKTKSHrypT32lpYTpiqzPYeYzdSQnmaGvaGhy7TnN/M/+5R+2rs/kKcp9ZLPRp/Q9Yj+4w==",
+      "dev": true,
+      "requires": {
+        "editions": "1.3.4"
+      }
+    },
+    "typedarray": {
+      "version": "0.0.6",
+      "resolved": "https://registry.npmjs.org/typedarray/-/typedarray-0.0.6.tgz",
+      "integrity": "sha1-hnrHTjhkGHsdPUfZlqeOxciDB3c=",
+      "dev": true
+    },
+    "typescript": {
+      "version": "2.7.2",
+      "resolved": "http://registry.npmjs.org/typescript/-/typescript-2.7.2.tgz",
+      "integrity": "sha512-p5TCYZDAO0m4G344hD+wx/LATebLWZNkkh2asWUFqSsD2OrDNhbAHuSjobrmsUmdzjJjEeZVU9g1h3O6vpstnw==",
+      "dev": true
+    },
+    "uglify-js": {
+      "version": "3.4.9",
+      "resolved": "https://registry.npmjs.org/uglify-js/-/uglify-js-3.4.9.tgz",
+      "integrity": "sha512-8CJsbKOtEbnJsTyv6LE6m6ZKniqMiFWmm9sRbopbkGs3gMPPfd3Fh8iIA4Ykv5MgaTbqHr4BaoGLJLZNhsrW1Q==",
+      "dev": true,
+      "requires": {
+        "commander": "2.17.1",
+        "source-map": "0.6.1"
+      },
+      "dependencies": {
+        "source-map": {
+          "version": "0.6.1",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+          "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+          "dev": true
+        }
+      }
+    },
+    "uglify-to-browserify": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/uglify-to-browserify/-/uglify-to-browserify-1.0.2.tgz",
+      "integrity": "sha1-bgkk1r2mta/jSeOabWMoUKD4grc=",
+      "dev": true,
+      "optional": true
+    },
+    "uglifyjs-webpack-plugin": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/uglifyjs-webpack-plugin/-/uglifyjs-webpack-plugin-1.3.0.tgz",
+      "integrity": "sha512-ovHIch0AMlxjD/97j9AYovZxG5wnHOPkL7T1GKochBADp/Zwc44pEWNqpKl1Loupp1WhFg7SlYmHZRUfdAacgw==",
+      "dev": true,
+      "requires": {
+        "cacache": "10.0.4",
+        "find-cache-dir": "1.0.0",
+        "schema-utils": "0.4.7",
+        "serialize-javascript": "1.5.0",
+        "source-map": "0.6.1",
+        "uglify-es": "3.3.9",
+        "webpack-sources": "1.2.0",
+        "worker-farm": "1.6.0"
+      },
+      "dependencies": {
+        "commander": {
+          "version": "2.13.0",
+          "resolved": "https://registry.npmjs.org/commander/-/commander-2.13.0.tgz",
+          "integrity": "sha512-MVuS359B+YzaWqjCL/c+22gfryv+mCBPHAv3zyVI2GN8EY6IRP8VwtasXn8jyyhvvq84R4ImN1OKRtcbIasjYA==",
+          "dev": true
+        },
+        "source-map": {
+          "version": "0.6.1",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+          "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+          "dev": true
+        },
+        "uglify-es": {
+          "version": "3.3.9",
+          "resolved": "https://registry.npmjs.org/uglify-es/-/uglify-es-3.3.9.tgz",
+          "integrity": "sha512-r+MU0rfv4L/0eeW3xZrd16t4NZfK8Ld4SWVglYBb7ez5uXFWHuVRs6xCTrf1yirs9a4j4Y27nn7SRfO6v67XsQ==",
+          "dev": true,
+          "requires": {
+            "commander": "2.13.0",
+            "source-map": "0.6.1"
+          }
+        }
+      }
+    },
+    "ultron": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/ultron/-/ultron-1.0.2.tgz",
+      "integrity": "sha1-rOEWq1V80Zc4ak6I9GhTeMiy5Po=",
+      "dev": true
+    },
+    "unbounded": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/unbounded/-/unbounded-1.1.0.tgz",
+      "integrity": "sha512-kmPrjST7m53WbxoMqk6QUFvWOp/ZGssCA0Zls63pbt+7cZqST4i0YIVLNX97ZlsMv/ml+0CPBVN15sVdSi/yZA==",
+      "dev": true,
+      "requires": {
+        "editions": "1.3.4"
+      }
+    },
+    "unc-path-regex": {
+      "version": "0.1.2",
+      "resolved": "https://registry.npmjs.org/unc-path-regex/-/unc-path-regex-0.1.2.tgz",
+      "integrity": "sha1-5z3T17DXxe2G+6xrCufYxqadUPo=",
+      "dev": true
+    },
+    "union-value": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/union-value/-/union-value-1.0.0.tgz",
+      "integrity": "sha1-XHHDTLW61dzr4+oM0IIHulqhrqQ=",
+      "dev": true,
+      "requires": {
+        "arr-union": "3.1.0",
+        "get-value": "2.0.6",
+        "is-extendable": "0.1.1",
+        "set-value": "0.4.3"
+      },
+      "dependencies": {
+        "extend-shallow": {
+          "version": "2.0.1",
+          "resolved": "https://registry.npmjs.org/extend-shallow/-/extend-shallow-2.0.1.tgz",
+          "integrity": "sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8=",
+          "dev": true,
+          "requires": {
+            "is-extendable": "0.1.1"
+          }
+        },
+        "set-value": {
+          "version": "0.4.3",
+          "resolved": "https://registry.npmjs.org/set-value/-/set-value-0.4.3.tgz",
+          "integrity": "sha1-fbCPnT0i3H945Trzw79GZuzfzPE=",
+          "dev": true,
+          "requires": {
+            "extend-shallow": "2.0.1",
+            "is-extendable": "0.1.1",
+            "is-plain-object": "2.0.4",
+            "to-object-path": "0.3.0"
+          }
+        }
+      }
+    },
+    "unique-filename": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/unique-filename/-/unique-filename-1.1.0.tgz",
+      "integrity": "sha1-0F8v5AMlYIcfMOk8vnNe6iAVFPM=",
+      "dev": true,
+      "requires": {
+        "unique-slug": "2.0.0"
+      }
+    },
+    "unique-slug": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/unique-slug/-/unique-slug-2.0.0.tgz",
+      "integrity": "sha1-22Z258fMBimHj/GWCXx4hVrp9Ks=",
+      "dev": true,
+      "requires": {
+        "imurmurhash": "0.1.4"
+      }
+    },
+    "unique-string": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/unique-string/-/unique-string-1.0.0.tgz",
+      "integrity": "sha1-nhBXzKhRq7kzmPizOuGHuZyuwRo=",
+      "dev": true,
+      "requires": {
+        "crypto-random-string": "1.0.0"
+      }
+    },
+    "universalify": {
+      "version": "0.1.2",
+      "resolved": "https://registry.npmjs.org/universalify/-/universalify-0.1.2.tgz",
+      "integrity": "sha512-rBJeI5CXAlmy1pV+617WB9J63U6XcazHHF2f2dbJix4XzpUF0RS3Zbj0FGIOCAva5P/d/GBOYaACQ1w+0azUkg==",
+      "dev": true
+    },
+    "unix-crypt-td-js": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/unix-crypt-td-js/-/unix-crypt-td-js-1.0.0.tgz",
+      "integrity": "sha1-HAgkFQSBvHoB1J6Y8exmjYJBLzs=",
+      "dev": true
+    },
+    "unpipe": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz",
+      "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=",
+      "dev": true
+    },
+    "unset-value": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/unset-value/-/unset-value-1.0.0.tgz",
+      "integrity": "sha1-g3aHP30jNRef+x5vw6jtDfyKtVk=",
+      "dev": true,
+      "requires": {
+        "has-value": "0.3.1",
+        "isobject": "3.0.1"
+      },
+      "dependencies": {
+        "has-value": {
+          "version": "0.3.1",
+          "resolved": "https://registry.npmjs.org/has-value/-/has-value-0.3.1.tgz",
+          "integrity": "sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8=",
+          "dev": true,
+          "requires": {
+            "get-value": "2.0.6",
+            "has-values": "0.1.4",
+            "isobject": "2.1.0"
+          },
+          "dependencies": {
+            "isobject": {
+              "version": "2.1.0",
+              "resolved": "https://registry.npmjs.org/isobject/-/isobject-2.1.0.tgz",
+              "integrity": "sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk=",
+              "dev": true,
+              "requires": {
+                "isarray": "1.0.0"
+              }
+            }
+          }
+        },
+        "has-values": {
+          "version": "0.1.4",
+          "resolved": "https://registry.npmjs.org/has-values/-/has-values-0.1.4.tgz",
+          "integrity": "sha1-bWHeldkd/Km5oCCJrThL/49it3E=",
+          "dev": true
+        }
+      }
+    },
+    "unzip-response": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/unzip-response/-/unzip-response-2.0.1.tgz",
+      "integrity": "sha1-0vD3N9FrBhXnKmk17QQhRXLVb5c=",
+      "dev": true
+    },
+    "upath": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/upath/-/upath-1.1.0.tgz",
+      "integrity": "sha512-bzpH/oBhoS/QI/YtbkqCg6VEiPYjSZtrHQM6/QnJS6OL9pKUFLqb3aFh4Scvwm45+7iAgiMkLhSbaZxUqmrprw==",
+      "dev": true
+    },
+    "update-notifier": {
+      "version": "2.5.0",
+      "resolved": "https://registry.npmjs.org/update-notifier/-/update-notifier-2.5.0.tgz",
+      "integrity": "sha512-gwMdhgJHGuj/+wHJJs9e6PcCszpxR1b236igrOkUofGhqJuG+amlIKwApH1IW1WWl7ovZxsX49lMBWLxSdm5Dw==",
+      "dev": true,
+      "requires": {
+        "boxen": "1.3.0",
+        "chalk": "2.2.2",
+        "configstore": "3.1.2",
+        "import-lazy": "2.1.0",
+        "is-ci": "1.2.0",
+        "is-installed-globally": "0.1.0",
+        "is-npm": "1.0.0",
+        "latest-version": "3.1.0",
+        "semver-diff": "2.1.0",
+        "xdg-basedir": "3.0.0"
+      }
+    },
+    "upper-case": {
+      "version": "1.1.3",
+      "resolved": "https://registry.npmjs.org/upper-case/-/upper-case-1.1.3.tgz",
+      "integrity": "sha1-9rRQHC7EzdJrp4vnIilh3ndiFZg=",
+      "dev": true
+    },
+    "uri-js": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-3.0.2.tgz",
+      "integrity": "sha1-+QuFhQf4HepNz7s8TD2/orVX+qo=",
+      "dev": true,
+      "requires": {
+        "punycode": "2.1.1"
+      }
+    },
+    "urix": {
+      "version": "0.1.0",
+      "resolved": "https://registry.npmjs.org/urix/-/urix-0.1.0.tgz",
+      "integrity": "sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI=",
+      "dev": true
+    },
+    "url": {
+      "version": "0.11.0",
+      "resolved": "https://registry.npmjs.org/url/-/url-0.11.0.tgz",
+      "integrity": "sha1-ODjpfPxgUh63PFJajlW/3Z4uKPE=",
+      "dev": true,
+      "requires": {
+        "punycode": "1.3.2",
+        "querystring": "0.2.0"
+      },
+      "dependencies": {
+        "punycode": {
+          "version": "1.3.2",
+          "resolved": "https://registry.npmjs.org/punycode/-/punycode-1.3.2.tgz",
+          "integrity": "sha1-llOgNvt8HuQjQvIyXM7v6jkmxI0=",
+          "dev": true
+        }
+      }
+    },
+    "url-join": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/url-join/-/url-join-4.0.0.tgz",
+      "integrity": "sha1-TTNA6AfTdzvamZH4MFrNzCpmXSo=",
+      "dev": true
+    },
+    "url-loader": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/url-loader/-/url-loader-1.1.1.tgz",
+      "integrity": "sha512-vugEeXjyYFBCUOpX+ZuaunbK3QXMKaQ3zUnRfIpRBlGkY7QizCnzyyn2ASfcxsvyU3ef+CJppVywnl3Kgf13Gg==",
+      "dev": true,
+      "requires": {
+        "loader-utils": "1.1.0",
+        "mime": "2.3.1",
+        "schema-utils": "1.0.0"
+      },
+      "dependencies": {
+        "mime": {
+          "version": "2.3.1",
+          "resolved": "https://registry.npmjs.org/mime/-/mime-2.3.1.tgz",
+          "integrity": "sha512-OEUllcVoydBHGN1z84yfQDimn58pZNNNXgZlHXSboxMlFvgI6MXSWpWKpFRra7H1HxpVhHTkrghfRW49k6yjeg==",
+          "dev": true
+        },
+        "schema-utils": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz",
+          "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==",
+          "dev": true,
+          "requires": {
+            "ajv": "6.4.0",
+            "ajv-errors": "1.0.0",
+            "ajv-keywords": "3.2.0"
+          }
+        }
+      }
+    },
+    "url-parse": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/url-parse/-/url-parse-1.4.3.tgz",
+      "integrity": "sha512-rh+KuAW36YKo0vClhQzLLveoj8FwPJNu65xLb7Mrt+eZht0IPT0IXgSv8gcMegZ6NvjJUALf6Mf25POlMwD1Fw==",
+      "dev": true,
+      "requires": {
+        "querystringify": "2.0.0",
+        "requires-port": "1.0.0"
+      }
+    },
+    "url-parse-lax": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/url-parse-lax/-/url-parse-lax-1.0.0.tgz",
+      "integrity": "sha1-evjzA2Rem9eaJy56FKxovAYJ2nM=",
+      "dev": true,
+      "requires": {
+        "prepend-http": "1.0.4"
+      }
+    },
+    "use": {
+      "version": "3.1.1",
+      "resolved": "https://registry.npmjs.org/use/-/use-3.1.1.tgz",
+      "integrity": "sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ==",
+      "dev": true
+    },
+    "useragent": {
+      "version": "2.3.0",
+      "resolved": "https://registry.npmjs.org/useragent/-/useragent-2.3.0.tgz",
+      "integrity": "sha512-4AoH4pxuSvHCjqLO04sU6U/uE65BYza8l/KKBS0b0hnUPWi+cQ2BpeTEwejCSx9SPV5/U03nniDTrWx5NrmKdw==",
+      "dev": true,
+      "requires": {
+        "lru-cache": "4.1.3",
+        "tmp": "0.0.31"
+      }
+    },
+    "util": {
+      "version": "0.10.4",
+      "resolved": "https://registry.npmjs.org/util/-/util-0.10.4.tgz",
+      "integrity": "sha512-0Pm9hTQ3se5ll1XihRic3FDIku70C+iHUdT/W926rSgHV5QgXsYbKZN8MSC3tJtSkhuROzvsQjAaFENRXr+19A==",
+      "dev": true,
+      "requires": {
+        "inherits": "2.0.3"
+      }
+    },
+    "util-deprecate": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
+      "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=",
+      "dev": true
+    },
+    "util.promisify": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/util.promisify/-/util.promisify-1.0.0.tgz",
+      "integrity": "sha512-i+6qA2MPhvoKLuxnJNpXAGhg7HphQOSUq2LKMZD0m15EiskXUkMvKdF4Uui0WYeCUGea+o2cw/ZuwehtfsrNkA==",
+      "dev": true,
+      "requires": {
+        "define-properties": "1.1.3",
+        "object.getownpropertydescriptors": "2.0.3"
+      }
+    },
+    "utila": {
+      "version": "0.4.0",
+      "resolved": "https://registry.npmjs.org/utila/-/utila-0.4.0.tgz",
+      "integrity": "sha1-ihagXURWV6Oupe7MWxKk+lN5dyw=",
+      "dev": true
+    },
+    "utils-merge": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz",
+      "integrity": "sha1-n5VxD1CiZ5R7LMwSR0HBAoQn5xM=",
+      "dev": true
+    },
+    "uuid": {
+      "version": "3.3.2",
+      "resolved": "https://registry.npmjs.org/uuid/-/uuid-3.3.2.tgz",
+      "integrity": "sha512-yXJmeNaw3DnnKAOKJE51sL/ZaYfWJRl1pK9dr19YFCu0ObS231AB1/LbqTKRAQ5kw8A90rA6fr4riOUpTZvQZA==",
+      "dev": true
+    },
+    "validate-npm-package-license": {
+      "version": "3.0.4",
+      "resolved": "https://registry.npmjs.org/validate-npm-package-license/-/validate-npm-package-license-3.0.4.tgz",
+      "integrity": "sha512-DpKm2Ui/xN7/HQKCtpZxoRWBhZ9Z0kqtygG8XCgNQ8ZlDnxuQmWhj566j8fN4Cu3/JmbhsDo7fcAJq4s9h27Ew==",
+      "dev": true,
+      "requires": {
+        "spdx-correct": "3.0.0",
+        "spdx-expression-parse": "3.0.0"
+      }
+    },
+    "validate-npm-package-name": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/validate-npm-package-name/-/validate-npm-package-name-3.0.0.tgz",
+      "integrity": "sha1-X6kS2B630MdK/BQN5zF/DKffQ34=",
+      "dev": true,
+      "requires": {
+        "builtins": "1.0.3"
+      }
+    },
+    "vary": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz",
+      "integrity": "sha1-IpnwLG3tMNSllhsLn3RSShj2NPw=",
+      "dev": true
+    },
+    "verror": {
+      "version": "1.10.0",
+      "resolved": "https://registry.npmjs.org/verror/-/verror-1.10.0.tgz",
+      "integrity": "sha1-OhBcoXBTr1XW4nDB+CiGguGNpAA=",
+      "dev": true,
+      "requires": {
+        "assert-plus": "1.0.0",
+        "core-util-is": "1.0.2",
+        "extsprintf": "1.3.0"
+      }
+    },
+    "viz.js": {
+      "version": "1.8.2",
+      "resolved": "https://registry.npmjs.org/viz.js/-/viz.js-1.8.2.tgz",
+      "integrity": "sha512-W+1+N/hdzLpQZEcvz79n2IgUE9pfx6JLdHh3Kh8RGvLL8P1LdJVQmi2OsDcLdY4QVID4OUy+FPelyerX0nJxIQ==",
+      "dev": true
+    },
+    "vlq": {
+      "version": "0.2.3",
+      "resolved": "https://registry.npmjs.org/vlq/-/vlq-0.2.3.tgz",
+      "integrity": "sha512-DRibZL6DsNhIgYQ+wNdWDL2SL3bKPlVrRiBqV5yuMm++op8W4kGFtaQfCs4KEJn0wBZcHVHJ3eoywX8983k1ow==",
+      "dev": true
+    },
+    "vm-browserify": {
+      "version": "0.0.4",
+      "resolved": "https://registry.npmjs.org/vm-browserify/-/vm-browserify-0.0.4.tgz",
+      "integrity": "sha1-XX6kW7755Kb/ZflUOOCofDV9WnM=",
+      "dev": true,
+      "requires": {
+        "indexof": "0.0.1"
+      }
+    },
+    "void-elements": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/void-elements/-/void-elements-2.0.1.tgz",
+      "integrity": "sha1-wGavtYK7HLQSjWDqkjkulNXp2+w=",
+      "dev": true
+    },
+    "watchpack": {
+      "version": "1.6.0",
+      "resolved": "https://registry.npmjs.org/watchpack/-/watchpack-1.6.0.tgz",
+      "integrity": "sha512-i6dHe3EyLjMmDlU1/bGQpEw25XSjkJULPuAVKCbNRefQVq48yXKUpwg538F7AZTf9kyr57zj++pQFltUa5H7yA==",
+      "dev": true,
+      "requires": {
+        "chokidar": "2.0.4",
+        "graceful-fs": "4.1.11",
+        "neo-async": "2.5.2"
+      }
+    },
+    "watchr": {
+      "version": "2.6.0",
+      "resolved": "https://registry.npmjs.org/watchr/-/watchr-2.6.0.tgz",
+      "integrity": "sha1-51xCOxC+eSZ6DD73bi6hBP4CZ6U=",
+      "dev": true,
+      "requires": {
+        "eachr": "3.2.0",
+        "extendr": "3.3.0",
+        "extract-opts": "3.3.1",
+        "ignorefs": "1.2.0",
+        "safefs": "4.1.0",
+        "scandirectory": "2.5.0",
+        "taskgroup": "5.3.0",
+        "typechecker": "4.5.0"
+      }
+    },
+    "wbuf": {
+      "version": "1.7.3",
+      "resolved": "https://registry.npmjs.org/wbuf/-/wbuf-1.7.3.tgz",
+      "integrity": "sha512-O84QOnr0icsbFGLS0O3bI5FswxzRr8/gHwWkDlQFskhSPryQXvrTMxjxGP4+iWYoauLoBvfDpkrOauZ+0iZpDA==",
+      "dev": true,
+      "requires": {
+        "minimalistic-assert": "1.0.1"
+      }
+    },
+    "webassemblyjs": {
+      "version": "1.4.3",
+      "resolved": "https://registry.npmjs.org/webassemblyjs/-/webassemblyjs-1.4.3.tgz",
+      "integrity": "sha512-4lOV1Lv6olz0PJkDGQEp82HempAn147e6BXijWDzz9g7/2nSebVP9GVg62Fz5ZAs55mxq13GA0XLyvY8XkyDjg==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/ast": "1.4.3",
+        "@webassemblyjs/validation": "1.4.3",
+        "@webassemblyjs/wasm-parser": "1.4.3",
+        "@webassemblyjs/wast-parser": "1.4.3",
+        "long": "3.2.0"
+      }
+    },
+    "webdriver-js-extender": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/webdriver-js-extender/-/webdriver-js-extender-1.0.0.tgz",
+      "integrity": "sha1-gcUzqeM9W/tZe05j4s2yW1R3dRU=",
+      "dev": true,
+      "requires": {
+        "@types/selenium-webdriver": "2.53.43",
+        "selenium-webdriver": "2.53.3"
+      },
+      "dependencies": {
+        "sax": {
+          "version": "0.6.1",
+          "resolved": "http://registry.npmjs.org/sax/-/sax-0.6.1.tgz",
+          "integrity": "sha1-VjsZx8HeiS4Jv8Ty/DDjwn8JUrk=",
+          "dev": true
+        },
+        "selenium-webdriver": {
+          "version": "2.53.3",
+          "resolved": "https://registry.npmjs.org/selenium-webdriver/-/selenium-webdriver-2.53.3.tgz",
+          "integrity": "sha1-0p/1qVff8aG0ncRXdW5OS/vc4IU=",
+          "dev": true,
+          "requires": {
+            "adm-zip": "0.4.4",
+            "rimraf": "2.6.2",
+            "tmp": "0.0.24",
+            "ws": "1.1.2",
+            "xml2js": "0.4.4"
+          }
+        },
+        "tmp": {
+          "version": "0.0.24",
+          "resolved": "https://registry.npmjs.org/tmp/-/tmp-0.0.24.tgz",
+          "integrity": "sha1-1qXhmNFKmDXMby18PZ4wJCjIzxI=",
+          "dev": true
+        },
+        "xml2js": {
+          "version": "0.4.4",
+          "resolved": "https://registry.npmjs.org/xml2js/-/xml2js-0.4.4.tgz",
+          "integrity": "sha1-MREBAAMAiuGSQOuhdJe1fHKcVV0=",
+          "dev": true,
+          "requires": {
+            "sax": "0.6.1",
+            "xmlbuilder": "9.0.7"
+          }
+        }
+      }
+    },
+    "webpack": {
+      "version": "4.8.3",
+      "resolved": "https://registry.npmjs.org/webpack/-/webpack-4.8.3.tgz",
+      "integrity": "sha512-/hfAjBISycdK597lxONjKEFX7dSIU1PsYwC3XlXUXoykWBlv9QV5HnO+ql3HvrrgfBJ7WXdnjO9iGPR2aAc5sw==",
+      "dev": true,
+      "requires": {
+        "@webassemblyjs/ast": "1.4.3",
+        "@webassemblyjs/wasm-edit": "1.4.3",
+        "@webassemblyjs/wasm-parser": "1.4.3",
+        "acorn": "5.7.2",
+        "acorn-dynamic-import": "3.0.0",
+        "ajv": "6.4.0",
+        "ajv-keywords": "3.2.0",
+        "chrome-trace-event": "0.1.3",
+        "enhanced-resolve": "4.1.0",
+        "eslint-scope": "3.7.3",
+        "loader-runner": "2.3.0",
+        "loader-utils": "1.1.0",
+        "memory-fs": "0.4.1",
+        "micromatch": "3.1.10",
+        "mkdirp": "0.5.1",
+        "neo-async": "2.5.2",
+        "node-libs-browser": "2.1.0",
+        "schema-utils": "0.4.7",
+        "tapable": "1.0.0",
+        "uglifyjs-webpack-plugin": "1.3.0",
+        "watchpack": "1.6.0",
+        "webpack-sources": "1.2.0"
+      }
+    },
+    "webpack-core": {
+      "version": "0.6.9",
+      "resolved": "https://registry.npmjs.org/webpack-core/-/webpack-core-0.6.9.tgz",
+      "integrity": "sha1-/FcViMhVjad76e+23r3Fo7FyvcI=",
+      "dev": true,
+      "requires": {
+        "source-list-map": "0.1.8",
+        "source-map": "0.4.4"
+      },
+      "dependencies": {
+        "source-list-map": {
+          "version": "0.1.8",
+          "resolved": "https://registry.npmjs.org/source-list-map/-/source-list-map-0.1.8.tgz",
+          "integrity": "sha1-xVCyq1Qn9rPyH1r+rYjE9Vh7IQY=",
+          "dev": true
+        },
+        "source-map": {
+          "version": "0.4.4",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.4.4.tgz",
+          "integrity": "sha1-66T12pwNyZneaAMti092FzZSA2s=",
+          "dev": true,
+          "requires": {
+            "amdefine": "1.0.1"
+          }
+        }
+      }
+    },
+    "webpack-dev-middleware": {
+      "version": "3.2.0",
+      "resolved": "https://registry.npmjs.org/webpack-dev-middleware/-/webpack-dev-middleware-3.2.0.tgz",
+      "integrity": "sha512-YJLMF/96TpKXaEQwaLEo+Z4NDK8aV133ROF6xp9pe3gQoS7sxfpXh4Rv9eC+8vCvWfmDjRQaMSlRPbO+9G6jgA==",
+      "dev": true,
+      "requires": {
+        "loud-rejection": "1.6.0",
+        "memory-fs": "0.4.1",
+        "mime": "2.3.1",
+        "path-is-absolute": "1.0.1",
+        "range-parser": "1.2.0",
+        "url-join": "4.0.0",
+        "webpack-log": "2.0.0"
+      },
+      "dependencies": {
+        "mime": {
+          "version": "2.3.1",
+          "resolved": "https://registry.npmjs.org/mime/-/mime-2.3.1.tgz",
+          "integrity": "sha512-OEUllcVoydBHGN1z84yfQDimn58pZNNNXgZlHXSboxMlFvgI6MXSWpWKpFRra7H1HxpVhHTkrghfRW49k6yjeg==",
+          "dev": true
+        }
+      }
+    },
+    "webpack-dev-server": {
+      "version": "3.1.7",
+      "resolved": "https://registry.npmjs.org/webpack-dev-server/-/webpack-dev-server-3.1.7.tgz",
+      "integrity": "sha512-KagFrNHf3QKndS61cXqzkQ4gpdXo0d1LZTTplAJzNK1Ev2ZyJiu+BzerW/2dixYYfpnGzp0AcvCXpmYXIOkFOA==",
+      "dev": true,
+      "requires": {
+        "ansi-html": "0.0.7",
+        "bonjour": "3.5.0",
+        "chokidar": "2.0.4",
+        "compression": "1.7.3",
+        "connect-history-api-fallback": "1.5.0",
+        "debug": "3.1.0",
+        "del": "3.0.0",
+        "express": "4.16.3",
+        "html-entities": "1.2.1",
+        "http-proxy-middleware": "0.18.0",
+        "import-local": "1.0.0",
+        "internal-ip": "3.0.1",
+        "ip": "1.1.5",
+        "killable": "1.0.0",
+        "loglevel": "1.6.1",
+        "opn": "5.3.0",
+        "portfinder": "1.0.17",
+        "schema-utils": "1.0.0",
+        "selfsigned": "1.10.3",
+        "serve-index": "1.9.1",
+        "sockjs": "0.3.19",
+        "sockjs-client": "1.1.5",
+        "spdy": "3.4.7",
+        "strip-ansi": "3.0.1",
+        "supports-color": "5.5.0",
+        "webpack-dev-middleware": "3.2.0",
+        "webpack-log": "2.0.0",
+        "yargs": "12.0.1"
+      },
+      "dependencies": {
+        "ansi-regex": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz",
+          "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=",
+          "dev": true
+        },
+        "camelcase": {
+          "version": "4.1.0",
+          "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-4.1.0.tgz",
+          "integrity": "sha1-1UVjW+HjPFQmScaRc+Xeas+uNN0=",
+          "dev": true
+        },
+        "cliui": {
+          "version": "4.1.0",
+          "resolved": "https://registry.npmjs.org/cliui/-/cliui-4.1.0.tgz",
+          "integrity": "sha512-4FG+RSG9DL7uEwRUZXZn3SS34DiDPfzP0VOiEwtUWlE+AR2EIg+hSyvrIgUUfhdgR/UkAeW2QHgeP+hWrXs7jQ==",
+          "dev": true,
+          "requires": {
+            "string-width": "2.1.1",
+            "strip-ansi": "4.0.0",
+            "wrap-ansi": "2.1.0"
+          },
+          "dependencies": {
+            "strip-ansi": {
+              "version": "4.0.0",
+              "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz",
+              "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=",
+              "dev": true,
+              "requires": {
+                "ansi-regex": "3.0.0"
+              }
+            }
+          }
+        },
+        "cross-spawn": {
+          "version": "5.1.0",
+          "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-5.1.0.tgz",
+          "integrity": "sha1-6L0O/uWPz/b4+UUQoKVUu/ojVEk=",
+          "dev": true,
+          "requires": {
+            "lru-cache": "4.1.3",
+            "shebang-command": "1.2.0",
+            "which": "1.3.1"
+          }
+        },
+        "debug": {
+          "version": "3.1.0",
+          "resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+          "integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+          "dev": true,
+          "requires": {
+            "ms": "2.0.0"
+          }
+        },
+        "decamelize": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-2.0.0.tgz",
+          "integrity": "sha512-Ikpp5scV3MSYxY39ymh45ZLEecsTdv/Xj2CaQfI8RLMuwi7XvjX9H/fhraiSuU+C5w5NTDu4ZU72xNiZnurBPg==",
+          "dev": true,
+          "requires": {
+            "xregexp": "4.0.0"
+          }
+        },
+        "execa": {
+          "version": "0.7.0",
+          "resolved": "https://registry.npmjs.org/execa/-/execa-0.7.0.tgz",
+          "integrity": "sha1-lEvs00zEHuMqY6n68nrVpl/Fl3c=",
+          "dev": true,
+          "requires": {
+            "cross-spawn": "5.1.0",
+            "get-stream": "3.0.0",
+            "is-stream": "1.1.0",
+            "npm-run-path": "2.0.2",
+            "p-finally": "1.0.0",
+            "signal-exit": "3.0.2",
+            "strip-eof": "1.0.0"
+          }
+        },
+        "find-up": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/find-up/-/find-up-3.0.0.tgz",
+          "integrity": "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg==",
+          "dev": true,
+          "requires": {
+            "locate-path": "3.0.0"
+          }
+        },
+        "is-fullwidth-code-point": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz",
+          "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=",
+          "dev": true
+        },
+        "locate-path": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-3.0.0.tgz",
+          "integrity": "sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A==",
+          "dev": true,
+          "requires": {
+            "p-locate": "3.0.0",
+            "path-exists": "3.0.0"
+          }
+        },
+        "os-locale": {
+          "version": "2.1.0",
+          "resolved": "https://registry.npmjs.org/os-locale/-/os-locale-2.1.0.tgz",
+          "integrity": "sha512-3sslG3zJbEYcaC4YVAvDorjGxc7tv6KVATnLPZONiljsUncvihe9BQoVCEs0RZ1kmf4Hk9OBqlZfJZWI4GanKA==",
+          "dev": true,
+          "requires": {
+            "execa": "0.7.0",
+            "lcid": "1.0.0",
+            "mem": "1.1.0"
+          }
+        },
+        "p-limit": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.0.0.tgz",
+          "integrity": "sha512-fl5s52lI5ahKCernzzIyAP0QAZbGIovtVHGwpcu1Jr/EpzLVDI2myISHwGqK7m8uQFugVWSrbxH7XnhGtvEc+A==",
+          "dev": true,
+          "requires": {
+            "p-try": "2.0.0"
+          }
+        },
+        "p-locate": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-3.0.0.tgz",
+          "integrity": "sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ==",
+          "dev": true,
+          "requires": {
+            "p-limit": "2.0.0"
+          }
+        },
+        "p-try": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.0.0.tgz",
+          "integrity": "sha512-hMp0onDKIajHfIkdRk3P4CdCmErkYAxxDtP3Wx/4nZ3aGlau2VKh3mZpcuFkH27WQkL/3WBCPOktzA9ZOAnMQQ==",
+          "dev": true
+        },
+        "schema-utils": {
+          "version": "1.0.0",
+          "resolved": "https://registry.npmjs.org/schema-utils/-/schema-utils-1.0.0.tgz",
+          "integrity": "sha512-i27Mic4KovM/lnGsy8whRCHhc7VicJajAjTrYg11K9zfZXnYIt4k5F+kZkwjnrhKzLic/HLU4j11mjsz2G/75g==",
+          "dev": true,
+          "requires": {
+            "ajv": "6.4.0",
+            "ajv-errors": "1.0.0",
+            "ajv-keywords": "3.2.0"
+          }
+        },
+        "string-width": {
+          "version": "2.1.1",
+          "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz",
+          "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==",
+          "dev": true,
+          "requires": {
+            "is-fullwidth-code-point": "2.0.0",
+            "strip-ansi": "4.0.0"
+          },
+          "dependencies": {
+            "strip-ansi": {
+              "version": "4.0.0",
+              "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz",
+              "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=",
+              "dev": true,
+              "requires": {
+                "ansi-regex": "3.0.0"
+              }
+            }
+          }
+        },
+        "which-module": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.0.tgz",
+          "integrity": "sha1-2e8H3Od7mQK4o6j6SzHD4/fm6Ho=",
+          "dev": true
+        },
+        "yargs": {
+          "version": "12.0.1",
+          "resolved": "https://registry.npmjs.org/yargs/-/yargs-12.0.1.tgz",
+          "integrity": "sha512-B0vRAp1hRX4jgIOWFtjfNjd9OA9RWYZ6tqGA9/I/IrTMsxmKvtWy+ersM+jzpQqbC3YfLzeABPdeTgcJ9eu1qQ==",
+          "dev": true,
+          "requires": {
+            "cliui": "4.1.0",
+            "decamelize": "2.0.0",
+            "find-up": "3.0.0",
+            "get-caller-file": "1.0.3",
+            "os-locale": "2.1.0",
+            "require-directory": "2.1.1",
+            "require-main-filename": "1.0.1",
+            "set-blocking": "2.0.0",
+            "string-width": "2.1.1",
+            "which-module": "2.0.0",
+            "y18n": "4.0.0",
+            "yargs-parser": "10.1.0"
+          }
+        },
+        "yargs-parser": {
+          "version": "10.1.0",
+          "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-10.1.0.tgz",
+          "integrity": "sha512-VCIyR1wJoEBZUqk5PA+oOBF6ypbwh5aNB3I50guxAL/quggdfs4TtNHQrSazFA3fYZ+tEqfs0zIGlv0c/rgjbQ==",
+          "dev": true,
+          "requires": {
+            "camelcase": "4.1.0"
+          }
+        }
+      }
+    },
+    "webpack-log": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/webpack-log/-/webpack-log-2.0.0.tgz",
+      "integrity": "sha512-cX8G2vR/85UYG59FgkoMamwHUIkSSlV3bBMRsbxVXVUk2j6NleCKjQ/WE9eYg9WY4w25O9w8wKP4rzNZFmUcUg==",
+      "dev": true,
+      "requires": {
+        "ansi-colors": "3.0.5",
+        "uuid": "3.3.2"
+      }
+    },
+    "webpack-merge": {
+      "version": "4.1.4",
+      "resolved": "https://registry.npmjs.org/webpack-merge/-/webpack-merge-4.1.4.tgz",
+      "integrity": "sha512-TmSe1HZKeOPey3oy1Ov2iS3guIZjWvMT2BBJDzzT5jScHTjVC3mpjJofgueEzaEd6ibhxRDD6MIblDr8tzh8iQ==",
+      "dev": true,
+      "requires": {
+        "lodash": "4.17.10"
+      }
+    },
+    "webpack-sources": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/webpack-sources/-/webpack-sources-1.2.0.tgz",
+      "integrity": "sha512-9BZwxR85dNsjWz3blyxdOhTgtnQvv3OEs5xofI0wPYTwu5kaWxS08UuD1oI7WLBLpRO+ylf0ofnXLXWmGb2WMw==",
+      "dev": true,
+      "requires": {
+        "source-list-map": "2.0.0",
+        "source-map": "0.6.1"
+      },
+      "dependencies": {
+        "source-map": {
+          "version": "0.6.1",
+          "resolved": "https://registry.npmjs.org/source-map/-/source-map-0.6.1.tgz",
+          "integrity": "sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==",
+          "dev": true
+        }
+      }
+    },
+    "webpack-subresource-integrity": {
+      "version": "1.1.0-rc.4",
+      "resolved": "https://registry.npmjs.org/webpack-subresource-integrity/-/webpack-subresource-integrity-1.1.0-rc.4.tgz",
+      "integrity": "sha1-xcTj1pD50vZKlVDgeodn+Xlqpdg=",
+      "dev": true,
+      "requires": {
+        "webpack-core": "0.6.9"
+      }
+    },
+    "websocket-driver": {
+      "version": "0.7.0",
+      "resolved": "https://registry.npmjs.org/websocket-driver/-/websocket-driver-0.7.0.tgz",
+      "integrity": "sha1-DK+dLXVdk67gSdS90NP+LMoqJOs=",
+      "dev": true,
+      "requires": {
+        "http-parser-js": "0.4.13",
+        "websocket-extensions": "0.1.3"
+      }
+    },
+    "websocket-extensions": {
+      "version": "0.1.3",
+      "resolved": "https://registry.npmjs.org/websocket-extensions/-/websocket-extensions-0.1.3.tgz",
+      "integrity": "sha512-nqHUnMXmBzT0w570r2JpJxfiSD1IzoI+HGVdd3aZ0yNi3ngvQ4jv1dtHt5VGxfI2yj5yqImPhOK4vmIh2xMbGg==",
+      "dev": true
+    },
+    "when": {
+      "version": "3.6.4",
+      "resolved": "https://registry.npmjs.org/when/-/when-3.6.4.tgz",
+      "integrity": "sha1-RztRfsFZ4rhQBUl6E5g/CVQS404=",
+      "dev": true
+    },
+    "which": {
+      "version": "1.3.1",
+      "resolved": "https://registry.npmjs.org/which/-/which-1.3.1.tgz",
+      "integrity": "sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ==",
+      "dev": true,
+      "requires": {
+        "isexe": "2.0.0"
+      }
+    },
+    "which-module": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/which-module/-/which-module-1.0.0.tgz",
+      "integrity": "sha1-u6Y8qGGUiZT/MHc2CJ47lgJsKk8=",
+      "dev": true
+    },
+    "wide-align": {
+      "version": "1.1.3",
+      "resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.3.tgz",
+      "integrity": "sha512-QGkOQc8XL6Bt5PwnsExKBPuMKBxnGxWWW3fU55Xt4feHozMUhdUMaBCk290qpm/wG5u/RSKzwdAC4i51YigihA==",
+      "dev": true,
+      "requires": {
+        "string-width": "1.0.2"
+      }
+    },
+    "widest-line": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/widest-line/-/widest-line-2.0.0.tgz",
+      "integrity": "sha1-AUKk6KJD+IgsAjOqDgKBqnYVInM=",
+      "dev": true,
+      "requires": {
+        "string-width": "2.1.1"
+      },
+      "dependencies": {
+        "ansi-regex": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-3.0.0.tgz",
+          "integrity": "sha1-7QMXwyIGT3lGbAKWa922Bas32Zg=",
+          "dev": true
+        },
+        "is-fullwidth-code-point": {
+          "version": "2.0.0",
+          "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz",
+          "integrity": "sha1-o7MKXE8ZkYMWeqq5O+764937ZU8=",
+          "dev": true
+        },
+        "string-width": {
+          "version": "2.1.1",
+          "resolved": "https://registry.npmjs.org/string-width/-/string-width-2.1.1.tgz",
+          "integrity": "sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw==",
+          "dev": true,
+          "requires": {
+            "is-fullwidth-code-point": "2.0.0",
+            "strip-ansi": "4.0.0"
+          }
+        },
+        "strip-ansi": {
+          "version": "4.0.0",
+          "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-4.0.0.tgz",
+          "integrity": "sha1-qEeQIusaw2iocTibY1JixQXuNo8=",
+          "dev": true,
+          "requires": {
+            "ansi-regex": "3.0.0"
+          }
+        }
+      }
+    },
+    "win-release": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/win-release/-/win-release-1.1.1.tgz",
+      "integrity": "sha1-X6VeAr58qTTt/BJmVjLoSbcuUgk=",
+      "dev": true,
+      "requires": {
+        "semver": "5.5.1"
+      }
+    },
+    "window-size": {
+      "version": "0.1.0",
+      "resolved": "https://registry.npmjs.org/window-size/-/window-size-0.1.0.tgz",
+      "integrity": "sha1-VDjNLqk7IC76Ohn+iIeu58lPnJ0=",
+      "dev": true,
+      "optional": true
+    },
+    "wordwrap": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/wordwrap/-/wordwrap-1.0.0.tgz",
+      "integrity": "sha1-J1hIEIkUVqQXHI0CJkQa3pDLyus=",
+      "dev": true
+    },
+    "worker-farm": {
+      "version": "1.6.0",
+      "resolved": "https://registry.npmjs.org/worker-farm/-/worker-farm-1.6.0.tgz",
+      "integrity": "sha512-6w+3tHbM87WnSWnENBUvA2pxJPLhQUg5LKwUQHq3r+XPhIM+Gh2R5ycbwPCyuGbNg+lPgdcnQUhuC02kJCvffQ==",
+      "dev": true,
+      "requires": {
+        "errno": "0.1.7"
+      }
+    },
+    "wrap-ansi": {
+      "version": "2.1.0",
+      "resolved": "http://registry.npmjs.org/wrap-ansi/-/wrap-ansi-2.1.0.tgz",
+      "integrity": "sha1-2Pw9KE3QV5T+hJc8rs3Rz4JP3YU=",
+      "dev": true,
+      "requires": {
+        "string-width": "1.0.2",
+        "strip-ansi": "3.0.1"
+      }
+    },
+    "wrappy": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz",
+      "integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=",
+      "dev": true
+    },
+    "write-file-atomic": {
+      "version": "2.3.0",
+      "resolved": "https://registry.npmjs.org/write-file-atomic/-/write-file-atomic-2.3.0.tgz",
+      "integrity": "sha512-xuPeK4OdjWqtfi59ylvVL0Yn35SF3zgcAcv7rBPFHVaEapaDr4GdGgm3j7ckTwH9wHL7fGmgfAnb0+THrHb8tA==",
+      "dev": true,
+      "requires": {
+        "graceful-fs": "4.1.11",
+        "imurmurhash": "0.1.4",
+        "signal-exit": "3.0.2"
+      }
+    },
+    "ws": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/ws/-/ws-1.1.2.tgz",
+      "integrity": "sha1-iiRPoFJAHgjJiGz0SoUYnh/UBn8=",
+      "dev": true,
+      "requires": {
+        "options": "0.0.6",
+        "ultron": "1.0.2"
+      }
+    },
+    "wtf-8": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/wtf-8/-/wtf-8-1.0.0.tgz",
+      "integrity": "sha1-OS2LotDxw00e4tYw8V0O+2jhBIo=",
+      "dev": true
+    },
+    "xdg-basedir": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/xdg-basedir/-/xdg-basedir-3.0.0.tgz",
+      "integrity": "sha1-SWsswQnsqNus/i3HK2A8F8WHCtQ=",
+      "dev": true
+    },
+    "xml2js": {
+      "version": "0.4.19",
+      "resolved": "https://registry.npmjs.org/xml2js/-/xml2js-0.4.19.tgz",
+      "integrity": "sha512-esZnJZJOiJR9wWKMyuvSE1y6Dq5LCuJanqhxslH2bxM6duahNZ+HMpCLhBQGZkbX6xRf8x1Y2eJlgt2q3qo49Q==",
+      "dev": true,
+      "requires": {
+        "sax": "1.2.4",
+        "xmlbuilder": "9.0.7"
+      },
+      "dependencies": {
+        "sax": {
+          "version": "1.2.4",
+          "resolved": "https://registry.npmjs.org/sax/-/sax-1.2.4.tgz",
+          "integrity": "sha512-NqVDv9TpANUjFm0N8uM5GxL36UgKi9/atZw+x7YFnQ8ckwFGKrl4xX4yWtrey3UJm5nP1kUbnYgLopqWNSRhWw==",
+          "dev": true
+        }
+      }
+    },
+    "xmlbuilder": {
+      "version": "9.0.7",
+      "resolved": "https://registry.npmjs.org/xmlbuilder/-/xmlbuilder-9.0.7.tgz",
+      "integrity": "sha1-Ey7mPS7FVlxVfiD0wi35rKaGsQ0=",
+      "dev": true
+    },
+    "xmlhttprequest-ssl": {
+      "version": "1.5.3",
+      "resolved": "https://registry.npmjs.org/xmlhttprequest-ssl/-/xmlhttprequest-ssl-1.5.3.tgz",
+      "integrity": "sha1-GFqIjATspGw+QHDZn3tJ3jUomS0=",
+      "dev": true
+    },
+    "xregexp": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/xregexp/-/xregexp-4.0.0.tgz",
+      "integrity": "sha512-PHyM+sQouu7xspQQwELlGwwd05mXUFqwFYfqPO0cC7x4fxyHnnuetmQr6CjJiafIDoH4MogHb9dOoJzR/Y4rFg==",
+      "dev": true
+    },
+    "xtend": {
+      "version": "4.0.1",
+      "resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.1.tgz",
+      "integrity": "sha1-pcbVMr5lbiPbgg77lDofBJmNY68=",
+      "dev": true
+    },
+    "xxhashjs": {
+      "version": "0.2.2",
+      "resolved": "https://registry.npmjs.org/xxhashjs/-/xxhashjs-0.2.2.tgz",
+      "integrity": "sha512-AkTuIuVTET12tpsVIQo+ZU6f/qDmKuRUcjaqR+OIvm+aCBsZ95i7UVY5WJ9TMsSaZ0DA2WxoZ4acu0sPH+OKAw==",
+      "dev": true,
+      "requires": {
+        "cuint": "0.2.2"
+      }
+    },
+    "y18n": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.0.tgz",
+      "integrity": "sha512-r9S/ZyXu/Xu9q1tYlpsLIsa3EeLXXk0VwlxqTcFRfg9EhMW+17kbt9G0NrgCmhGb5vT2hyhJZLfDGx+7+5Uj/w==",
+      "dev": true
+    },
+    "yallist": {
+      "version": "2.1.2",
+      "resolved": "https://registry.npmjs.org/yallist/-/yallist-2.1.2.tgz",
+      "integrity": "sha1-HBH5IY8HYImkfdUS+TxmmaaoHVI=",
+      "dev": true
+    },
+    "yargs": {
+      "version": "7.1.0",
+      "resolved": "https://registry.npmjs.org/yargs/-/yargs-7.1.0.tgz",
+      "integrity": "sha1-a6MY6xaWFyf10oT46gA+jWFU0Mg=",
+      "dev": true,
+      "requires": {
+        "camelcase": "3.0.0",
+        "cliui": "3.2.0",
+        "decamelize": "1.2.0",
+        "get-caller-file": "1.0.3",
+        "os-locale": "1.4.0",
+        "read-pkg-up": "1.0.1",
+        "require-directory": "2.1.1",
+        "require-main-filename": "1.0.1",
+        "set-blocking": "2.0.0",
+        "string-width": "1.0.2",
+        "which-module": "1.0.0",
+        "y18n": "3.2.1",
+        "yargs-parser": "5.0.0"
+      },
+      "dependencies": {
+        "camelcase": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-3.0.0.tgz",
+          "integrity": "sha1-MvxLn82vhF/N9+c7uXysImHwqwo=",
+          "dev": true
+        },
+        "y18n": {
+          "version": "3.2.1",
+          "resolved": "https://registry.npmjs.org/y18n/-/y18n-3.2.1.tgz",
+          "integrity": "sha1-bRX7qITAhnnA136I53WegR4H+kE=",
+          "dev": true
+        }
+      }
+    },
+    "yargs-parser": {
+      "version": "5.0.0",
+      "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-5.0.0.tgz",
+      "integrity": "sha1-J17PDX/+Bcd+ZOfIbkzZS/DhIoo=",
+      "dev": true,
+      "requires": {
+        "camelcase": "3.0.0"
+      },
+      "dependencies": {
+        "camelcase": {
+          "version": "3.0.0",
+          "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-3.0.0.tgz",
+          "integrity": "sha1-MvxLn82vhF/N9+c7uXysImHwqwo=",
+          "dev": true
+        }
+      }
+    },
+    "yeast": {
+      "version": "0.1.2",
+      "resolved": "https://registry.npmjs.org/yeast/-/yeast-0.1.2.tgz",
+      "integrity": "sha1-AI4G2AlDIMNy28L47XagymyKxBk=",
+      "dev": true
+    },
+    "yn": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/yn/-/yn-2.0.0.tgz",
+      "integrity": "sha1-5a2ryKz0CPY4X8dklWhMiOavaJo=",
+      "dev": true
+    },
+    "zone.js": {
+      "version": "0.8.26",
+      "resolved": "https://registry.npmjs.org/zone.js/-/zone.js-0.8.26.tgz",
+      "integrity": "sha512-W9Nj+UmBJG251wkCacIkETgra4QgBo/vgoEkb4a2uoLzpQG7qF9nzwoLXWU5xj3Fg2mxGvEDh47mg24vXccYjA=="
+    }
+  }
+}
diff --git a/web/gui2-fw-lib/package.json b/web/gui2-fw-lib/package.json
new file mode 100644
index 0000000..88595cc
--- /dev/null
+++ b/web/gui2-fw-lib/package.json
@@ -0,0 +1,54 @@
+{
+  "name": "gui2-fw-lib-app",
+  "version": "2.0.0",
+  "license": "MIT",
+  "scripts": {
+    "ng": "ng",
+    "start": "ng serve",
+    "build": "ng build",
+    "test": "ng test",
+    "lint": "ng lint",
+    "e2e": "ng e2e"
+  },
+  "private": true,
+  "dependencies": {
+    "@angular/animations": "^6.0.0",
+    "@angular/common": "^6.0.0",
+    "@angular/compiler": "^6.0.0",
+    "@angular/core": "^6.0.0",
+    "@angular/forms": "^6.0.0",
+    "@angular/http": "^6.0.0",
+    "@angular/platform-browser": "^6.0.0",
+    "@angular/platform-browser-dynamic": "^6.0.0",
+    "@angular/router": "^6.0.0",
+    "core-js": "^2.5.4",
+    "d3": "^5.2.0",
+    "rxjs": "^6.0.0",
+    "zone.js": "^0.8.26"
+  },
+  "devDependencies": {
+    "@angular-devkit/build-angular": "~0.6.0",
+    "@angular-devkit/build-ng-packagr": "~0.6.0",
+    "ng-packagr": "^3.0.0-rc.2",
+    "@angular/cli": "~6.0.0",
+    "@angular/compiler-cli": "^6.0.0",
+    "@angular/language-service": "^6.0.0",
+    "@compodoc/compodoc": "^1.1.3",
+    "@types/jasmine": "~2.8.6",
+    "@types/jasminewd2": "~2.0.3",
+    "@types/node": "~8.9.4",
+    "codelyzer": "^4.2.1",
+    "jasmine-core": "~2.99.1",
+    "jasmine-spec-reporter": "~4.2.1",
+    "karma": "~1.7.1",
+    "karma-chrome-launcher": "~2.2.0",
+    "karma-coverage-istanbul-reporter": "~1.4.2",
+    "karma-firefox-launcher": "^1.1.0",
+    "karma-jasmine": "~1.1.1",
+    "karma-jasmine-html-reporter": "^0.2.2",
+    "protractor": "~5.3.0",
+    "ts-node": "~5.0.1",
+    "tslint": "~5.9.1",
+    "typescript": "~2.7.2"
+  }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/karma.conf.js b/web/gui2-fw-lib/projects/gui2-fw-lib/karma.conf.js
new file mode 100644
index 0000000..a7aca9d
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/karma.conf.js
@@ -0,0 +1,48 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// Karma configuration file, see link for more information
+// https://karma-runner.github.io/1.0/config/configuration-file.html
+
+module.exports = function (config) {
+  config.set({
+    basePath: '',
+    frameworks: ['jasmine', '@angular-devkit/build-angular'],
+    plugins: [
+      require('karma-jasmine'),
+      require('karma-chrome-launcher'),
+      require('karma-firefox-launcher'),
+      require('karma-jasmine-html-reporter'),
+      require('karma-coverage-istanbul-reporter'),
+      require('@angular-devkit/build-angular/plugins/karma')
+    ],
+    client: {
+      clearContext: false // leave Jasmine Spec Runner output visible in browser
+    },
+    coverageIstanbulReporter: {
+      dir: require('path').join(__dirname, '../../coverage'),
+      reports: ['html', 'lcovonly'],
+      fixWebpackSourcePaths: true
+    },
+    reporters: ['progress', 'kjhtml'],
+    port: 9876,
+    colors: true,
+    logLevel: config.LOG_INFO,
+    autoWatch: true,
+    browsers: ['Chrome', 'Firefox'],
+    singleRun: false
+  });
+};
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.json b/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.json
new file mode 100644
index 0000000..c43fcfb
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.json
@@ -0,0 +1,8 @@
+{
+  "$schema": "../../node_modules/ng-packagr/ng-package.schema.json",
+  "dest": "../../dist/gui2-fw-lib",
+  "deleteDestPath": false,
+  "lib": {
+    "entryFile": "src/public_api.ts"
+  }
+}
\ No newline at end of file
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.prod.json b/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.prod.json
new file mode 100644
index 0000000..e41eef4
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/ng-package.prod.json
@@ -0,0 +1,7 @@
+{
+  "$schema": "../../node_modules/ng-packagr/ng-package.schema.json",
+  "dest": "../../dist/gui2-fw-lib",
+  "lib": {
+    "entryFile": "src/public_api.ts"
+  }
+}
\ No newline at end of file
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/package.json b/web/gui2-fw-lib/projects/gui2-fw-lib/package.json
new file mode 100644
index 0000000..a130774
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/package.json
@@ -0,0 +1,8 @@
+{
+  "name": "gui2-fw-lib",
+  "version": "0.14.0",
+  "peerDependencies": {
+    "@angular/common": "^6.0.0-rc.0 || ^6.0.0",
+    "@angular/core": "^6.0.0-rc.0 || ^6.0.0"
+  }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.prod.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.prod.ts
new file mode 100644
index 0000000..ba55732
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.prod.ts
@@ -0,0 +1,18 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+export const environment = {
+  production: true
+};
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.ts
new file mode 100644
index 0000000..bca9ca2
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/environments/environment.ts
@@ -0,0 +1,24 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+// The file contents for the current environment will overwrite these during build.
+// The build system defaults to the dev environment which uses `environment.ts`, but if you do
+// `ng build --env=prod` then `environment.prod.ts` will be used instead.
+// The list of which env maps to which file can be found in `.angular-cli.json`.
+
+export const environment = {
+  production: false,
+  isDebugMode: true
+};
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/consolelogger.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/consolelogger.service.ts
new file mode 100644
index 0000000..a682fb3
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/consolelogger.service.ts
@@ -0,0 +1,61 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { environment } from '../environments/environment';
+import { Logger } from './log.service';
+
+export let isDebugMode: boolean = !environment.production;
+
+const noop = (): any => undefined;
+
+/**
+ * ONOS GUI -- LogService
+ * Inspired by https://robferguson.org/blog/2017/09/09/a-simple-logging-service-for-angular-4/
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class ConsoleLoggerService implements Logger {
+
+  get debug() {
+    if (isDebugMode) {
+      return console.debug.bind(console);
+    } else {
+      return noop;
+    }
+  }
+
+  get info() {
+    if (isDebugMode) {
+      return console.info.bind(console);
+    } else {
+      return noop;
+    }
+  }
+
+  get warn() {
+    return console.warn.bind(console);
+  }
+
+  get error() {
+    return console.error.bind(console);
+  }
+
+  invokeConsoleMethod(type: string, args?: any): void {
+    const logFn: Function = (console)[type] || console.log || noop;
+    logFn.apply(console, [args]);
+  }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/detectbrowser.directive.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/detectbrowser.directive.ts
new file mode 100644
index 0000000..a2ec16d
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/detectbrowser.directive.ts
@@ -0,0 +1,65 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Inject } from '@angular/core';
+import { Directive } from '@angular/core';
+import { FnService } from './util/fn.service';
+import { LogService } from './log.service';
+import { OnosService } from './onos.service';
+
+/**
+ * ONOS GUI -- Detect Browser Directive
+ */
+@Directive({
+  selector: '[onosDetectBrowser]'
+})
+export class DetectBrowserDirective {
+  constructor(
+    private fs: FnService,
+    private log: LogService,
+    private onos: OnosService,
+
+    // TODO: Change the any type to Window when https://github.com/angular/angular/issues/15640 is fixed.
+    @Inject('Window') private w: any
+  ) {
+        const body: HTMLBodyElement = document.getElementsByTagName('body')[0];
+//        let body = d3.select('body');
+        let browser = '';
+        if (fs.isChrome()) {
+            browser = 'chrome';
+        } else if (fs.isChromeHeadless()) {
+            browser = 'chromeheadless';
+        } else if (fs.isSafari()) {
+            browser = 'safari';
+        } else if (fs.isFirefox()) {
+            browser = 'firefox';
+        } else {
+            this.log.warn('Unknown browser. ',
+            'Vendor:', this.w.navigator.vendor,
+            'Agent:', this.w.navigator.userAgent);
+            return;
+        }
+        body.classList.add(browser);
+//        body.classed(browser, true);
+        this.onos.browser = browser;
+
+        if (fs.isMobile()) {
+            body.classList.add('mobile');
+            this.onos.mobile = true;
+        }
+
+//        this.log.debug('Detected browser is', fs.cap(browser));
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/gui2-fw-lib.module.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/gui2-fw-lib.module.ts
new file mode 100644
index 0000000..6004bce
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/gui2-fw-lib.module.ts
@@ -0,0 +1,52 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { NgModule } from '@angular/core';
+import { CommonModule } from '@angular/common';
+import { DetectBrowserDirective } from './detectbrowser.directive';
+import { IconComponent } from './svg/icon/icon.component';
+import { VeilComponent } from './layer/veil/veil.component';
+import { FlashComponent } from './layer/flash/flash.component';
+import { ConfirmComponent } from './layer/confirm/confirm.component';
+import { MastComponent } from './mast/mast/mast.component';
+import { TableFilterPipe } from './widget/tablefilter.pipe';
+import { TableResizeDirective } from './widget/tableresize.directive';
+
+@NgModule({
+  imports: [
+    CommonModule
+  ],
+  declarations: [
+    DetectBrowserDirective,
+    TableResizeDirective,
+    IconComponent,
+    VeilComponent,
+    FlashComponent,
+    ConfirmComponent,
+    MastComponent,
+    TableFilterPipe
+  ],
+  exports: [
+    DetectBrowserDirective,
+    TableResizeDirective,
+    IconComponent,
+    VeilComponent,
+    FlashComponent,
+    ConfirmComponent,
+    MastComponent,
+    TableFilterPipe
+  ]
+})
+export class Gui2FwLibModule { }
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.css
new file mode 100644
index 0000000..b097534
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.css
@@ -0,0 +1,39 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Confirm Component (layout) -- CSS file
+ */
+#app-dialog {
+    top: 140px;
+    padding: 12px;
+}
+
+#app-dialog h3 {
+    display: inline-block;
+    font-weight: bold;
+    font-size: 18pt;
+}
+
+#app-dialog p {
+    font-size: 12pt;
+}
+
+#app-dialog p.strong {
+    font-weight: bold;
+    padding: 8px;
+    text-align: center;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.html b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.html
new file mode 100644
index 0000000..a8e2489
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.html
@@ -0,0 +1,22 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~     http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+<div id="app-dialog" class="floatpanel dialog" [@confirmDlgState]="message!==''">
+    <h3> {{ lionFn('dlg_confirm_action') }} </h3>
+    <p>{{ message }}</p>
+    <p *ngIf="warning" class="warning strong">{{ warning }}</p>
+    <div tabindex="10" class="dialog-button" (click)="choice(true)">OK</div>
+    <div tabindex="11" class="dialog-button" (click)="choice(false)">Cancel</div>
+</div>
\ No newline at end of file
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.spec.ts
new file mode 100644
index 0000000..f4e76e0
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.spec.ts
@@ -0,0 +1,86 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { async, ComponentFixture, TestBed } from '@angular/core/testing';
+import { BrowserAnimationsModule } from '@angular/platform-browser/animations';
+import { DebugElement } from '@angular/core';
+import { By } from '@angular/platform-browser';
+import { LionService } from '../../util/lion.service';
+
+import { ConsoleLoggerService } from '../../consolelogger.service';
+import { LogService } from '../../log.service';
+import { ConfirmComponent } from './confirm.component';
+
+/**
+ * ONOS GUI -- Layer -- Confirm Component - Unit Tests
+ */
+describe('ConfirmComponent', () => {
+    let log: LogService;
+    let component: ConfirmComponent;
+    let fixture: ComponentFixture<ConfirmComponent>;
+    const bundleObj = {
+        'core.view.App': {
+            test: 'test1'
+        }
+    };
+    const mockLion = (key) => {
+        return bundleObj[key] || '%' + key + '%';
+    };
+
+    beforeEach(async(() => {
+        log = new ConsoleLoggerService();
+        TestBed.configureTestingModule({
+            imports: [ BrowserAnimationsModule ],
+            declarations: [ ConfirmComponent ],
+            providers: [
+                { provide: LogService, useValue: log },
+                {
+                    provide: LionService, useFactory: (() => {
+                        return {
+                            bundle: ((bundleId) => mockLion),
+                            ubercache: new Array(),
+                            loadCbs: new Map<string, () => void>([])
+                        };
+                    })
+                },
+            ]
+        });
+    }));
+
+    beforeEach(() => {
+        fixture = TestBed.createComponent(ConfirmComponent);
+        component = fixture.debugElement.componentInstance;
+        fixture.detectChanges();
+    });
+
+    it('should create', () => {
+        expect(component).toBeTruthy();
+    });
+
+    it('should have a h3 inside a div#app-dialog', () => {
+        const appDe: DebugElement = fixture.debugElement;
+        const divDe = appDe.query(By.css('div#app-dialog h3'));
+        const div: HTMLElement = divDe.nativeElement;
+        expect(div.textContent).toEqual(' %dlg_confirm_action% ');
+    });
+
+    it('should have a div.dialog-button inside a div#app-dialog', () => {
+        const appDe: DebugElement = fixture.debugElement;
+        const divDe = appDe.query(By.css('div#app-dialog div.dialog-button'));
+        const div: HTMLElement = divDe.nativeElement;
+        // It selects the first one
+        expect(div.textContent).toEqual('OK');
+    });
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.ts
new file mode 100644
index 0000000..fca6419
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.component.ts
@@ -0,0 +1,87 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Component, Input, Output, EventEmitter } from '@angular/core';
+import { trigger, state, style, animate, transition } from '@angular/animations';
+import { LogService } from '../../log.service';
+import { LionService } from '../../util/lion.service';
+
+/**
+ * ONOS GUI -- Layer -- Confirm Component
+ *
+ * Replaces Flash Service in old GUI.
+ * Provides a mechanism to present a confirm dialog to the screen
+ *
+ * To use add an element to the template like
+ *   <onos-confirm message="Performing something dangerous. Would you like to proceed"></onos-flash>
+ *
+ * An event is raised with either OK or Cancel
+ */
+@Component({
+    selector: 'onos-confirm',
+    templateUrl: './confirm.component.html',
+    styleUrls: [
+        './confirm.component.css',
+        './confirm.theme.css',
+        '../dialog.css',
+        '../dialog.theme.css',
+        '../../widget/panel.css',
+        '../../widget/panel-theme.css'
+    ],
+    animations: [
+        trigger('confirmDlgState', [
+            state('true', style({
+                transform: 'translateX(-100%)',
+                opacity: '100'
+            })),
+            state('false', style({
+                transform: 'translateX(0%)',
+                opacity: '0'
+            })),
+            transition('0 => 1', animate('100ms ease-in')),
+            transition('1 => 0', animate('100ms ease-out'))
+        ])
+    ]
+})
+export class ConfirmComponent {
+
+    lionFn; // Function
+
+    @Input() message: string;
+    @Input() warning: string;
+    @Output() chosen: EventEmitter<boolean> = new EventEmitter();
+
+    constructor(
+        private log: LogService,
+        private lion: LionService,
+    ) {
+        this.log.debug('ConfirmComponent constructed');
+        this.doLion();
+    }
+
+    /**
+     * When OK or Cancel is pressed, send an event to parent with choice
+     */
+    choice(chosen: boolean): void {
+        this.chosen.emit(chosen);
+    }
+
+    /**
+     * Read the LION bundle for App to get confirm dialouge header
+     */
+    doLion() {
+        this.lionFn = this.lion.bundle('core.view.App');
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.theme.css
new file mode 100644
index 0000000..db97648
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/confirm/confirm.theme.css
@@ -0,0 +1,33 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Confirm Component (theme) -- CSS file
+ */
+/* temporarily removed .light */
+#app-dialog p.strong {
+    color: white;
+    background-color: #ce5b58;
+}
+
+#app-dialog.floatpanel.dialog {
+    background-color: #ffffff;
+}
+
+#app-dialog p.strong {
+    color: white;
+    background-color: #ce5b58;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.css
new file mode 100644
index 0000000..6792a3d
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.css
@@ -0,0 +1,36 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Dialog Service (layout) -- CSS file
+ */
+
+.dialog h2 {
+    margin: 0;
+    word-wrap: break-word;
+    display: inline-block;
+    width: 210px;
+    vertical-align: middle;
+}
+
+.dialog .dialog-button {
+    display: inline-block;
+    cursor: pointer;
+    height: 20px;
+    padding: 6px 8px 2px 8px;
+    margin: 4px;
+    float: right;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.theme.css
new file mode 100644
index 0000000..24cd5fa
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/dialog.theme.css
@@ -0,0 +1,33 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Dialog Service (theme) -- CSS file
+ */
+
+/* temporarily removed .light */
+.dialog .dialog-button {
+    background-color: #518ecc;
+    color: white;
+}
+
+
+/* ========== DARK Theme ========== */
+
+.dark .dialog .dialog-button {
+    background-color: #345e85;
+    color: #cccccd;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.css
new file mode 100644
index 0000000..66b8f3b
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.css
@@ -0,0 +1,68 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Flash Component (layout) -- CSS file
+ */
+
+#flash {
+    position: fixed;
+    top: 50%;
+    left: 50%;
+    transform: translate(-50%, -50%);
+    z-index: 1400;
+}
+
+#flash.warning div#flashBox {
+    border: 2px solid #222222;
+    border-radius: 10px;
+    background: #FFFFFF;
+    padding: 10px;
+}
+
+#flash div#flashBox {
+    background: #CCCCCC;
+    border-radius: 10px;
+    padding: 1px;
+}
+
+#flash div#flashBox div.dialog-button {
+    transform :translateY(-32px);
+}
+
+#flash.warning p#flashText {
+    stroke: #FF0000;
+    color: #FF0000;
+    text-anchor: middle;
+    alignment-baseline: middle;
+    text-align: center;
+    font-size: 16pt;
+    border-radius: 10px;
+    background: #FFFFFF;
+    padding: 10px;
+}
+
+#flash p#flashText {
+    stroke: none;
+    color: #222222;
+    text-anchor: middle;
+    alignment-baseline: middle;
+    text-align: center;
+    font-size: 16pt;
+    border-radius: 10px;
+    background: #CCCCCC;
+    padding: 5px;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.html b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.html
new file mode 100644
index 0000000..46b6de9
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.html
@@ -0,0 +1,21 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~     http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+<div id="flash" class="dialog" [ngClass]="warning?'warning':''" [@flashState]="visible">
+    <div id="flashBox" *ngIf="visible">
+        <p id="flashText">{{ message }}</p>
+        <div class="dialog-button" *ngIf="dwell>1200" (click)="closeNow()">Dismiss</div>
+    </div>
+</div>
\ No newline at end of file
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.spec.ts
new file mode 100644
index 0000000..661e223
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.spec.ts
@@ -0,0 +1,60 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { async, ComponentFixture, TestBed } from '@angular/core/testing';
+import { BrowserAnimationsModule } from '@angular/platform-browser/animations';
+import { DebugElement } from '@angular/core';
+import { By } from '@angular/platform-browser';
+
+import { ConsoleLoggerService } from '../../consolelogger.service';
+import { LogService } from '../../log.service';
+import { FlashComponent } from './flash.component';
+
+/**
+ * ONOS GUI -- Layer -- Flash Component - Unit Tests
+ */
+describe('FlashComponent', () => {
+    let log: LogService;
+    let component: FlashComponent;
+    let fixture: ComponentFixture<FlashComponent>;
+
+    beforeEach(async(() => {
+        log = new ConsoleLoggerService();
+        TestBed.configureTestingModule({
+            imports: [ BrowserAnimationsModule ],
+            declarations: [ FlashComponent ],
+            providers: [
+                { provide: LogService, useValue: log },
+            ]
+        });
+    }));
+
+    beforeEach(() => {
+        fixture = TestBed.createComponent(FlashComponent);
+        component = fixture.debugElement.componentInstance;
+        fixture.detectChanges();
+    });
+
+    it('should create', () => {
+        expect(component).toBeTruthy();
+    });
+
+//    it('should have a div#flash', () => {
+//        component.enabled = true;
+//        const appDe: DebugElement = fixture.debugElement;
+//        const divDe = appDe.query(By.css('div#flash'));
+//        expect(divDe).toBeTruthy();
+//    });
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.ts
new file mode 100644
index 0000000..7dd721d
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/flash/flash.component.ts
@@ -0,0 +1,91 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Component, Input, Output, OnChanges, SimpleChange, EventEmitter } from '@angular/core';
+import { LogService } from '../../log.service';
+import { trigger, state, style, animate, transition } from '@angular/animations';
+
+/**
+ * ONOS GUI -- Layer -- Flash Component
+ *
+ * Replaces Flash Service in old GUI.
+ * Provides a mechanism to flash short informational messages to the screen
+ * to alert the user of something, e.g. "Hosts visible" or "Hosts hidden".
+ *
+ * It can be used in a warning mode, where text will appear in red
+ * The dwell time (milliseconds) can be controlled or the default is 1200ms
+ *
+ * To use add an element to the template like
+ *   <onos-flash message="Hosts visible" dwell="2000" warning="true"></onos-flash>
+ * This whole element can be disabled until needed with an ngIf, but if this is done
+ * the animated fade-in and fade-out will not happen
+ * There is also a (closed) event that tells you when the message is closed, or
+ * fades-out
+ */
+@Component({
+    selector: 'onos-flash',
+    templateUrl: './flash.component.html',
+    styleUrls: [
+        './flash.component.css',
+        '../dialog.css',
+        '../dialog.theme.css',
+    ],
+    animations: [
+        trigger('flashState', [
+            state('false', style({
+//                transform: 'translateY(-400%)',
+                opacity: '0.0',
+            })),
+            state('true', style({
+//                transform: 'translateY(0%)',
+                opacity: '1.0',
+            })),
+            transition('0 => 1', animate('200ms ease-in')),
+            transition('1 => 0', animate('200ms ease-out'))
+        ])
+    ]
+})
+export class FlashComponent implements OnChanges {
+    @Input() message: string;
+    @Input() dwell: number = 1200; // milliseconds
+    @Input() warning: boolean = false;
+    @Output() closed: EventEmitter<boolean> = new EventEmitter();
+
+    public visible: boolean = false;
+
+    /**
+     * Flash a message up for 1200ms then disappear again.
+     * See animation parameter for the ease in and ease out params
+     */
+    ngOnChanges(changes: {[propertyName: string]: SimpleChange}) {
+        if (changes['message'] && this.message && this.message !== '') {
+            this.visible = true;
+
+            setTimeout(() => {
+                this.visible = false;
+                this.closed.emit(false);
+            }, this.dwell);
+        }
+    }
+
+    /**
+     * The message will flash up for 'dwell' milliseconds
+     * If dwell is > 2000ms, then there will be a button that allows it to be dismissed now
+     */
+    closeNow() {
+        this.visible = false;
+        this.closed.emit(false);
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.css
new file mode 100644
index 0000000..4ba98a9
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.css
@@ -0,0 +1,27 @@
+/*
+ *  Copyright 2018-present Open Networking Foundation
+ *
+ *  Licensed under the Apache License, Version 2.0 (the "License");
+ *  you may not use this file except in compliance with the License.
+ *  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Loading Service -- CSS file
+ */
+
+#loading-anim {
+    position: fixed;
+    top: 50%;
+    left: 50%;
+    -webkit-transform: translate(-50%, -50%);
+    transform: translate(-50%, -50%);
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.ts
new file mode 100644
index 0000000..f7f54fa
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/loading.service.ts
@@ -0,0 +1,137 @@
+/*
+ *  Copyright 2018-present Open Networking Foundation
+ *
+ *  Licensed under the Apache License, Version 2.0 (the "License");
+ *  you may not use this file except in compliance with the License.
+ *  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+import { ThemeService } from '../util/theme.service';
+import { WebSocketService } from '../remote/websocket.service';
+import * as d3 from 'd3';
+
+const id = 'loading-anim';
+const dir = 'data/img/loading/';
+const pfx = '/load-';
+const nImgs = 16;
+const speed = 100;
+const waitDelay = 500;
+
+
+/**
+ * ONOS GUI -- Layer -- Loading Service
+ *
+ * Provides a mechanism to start/stop the loading animation, center screen.
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class LoadingService {
+    images: any[] = [];
+    idx = 0;
+    img: any;
+    theme: string;
+    task: any;
+    wait: number;
+
+    constructor(
+        private fs: FnService,
+        private log: LogService,
+        private ts: ThemeService,
+        private wss: WebSocketService
+    ) {
+        this.preloadImages();
+        this.log.debug('LoadingService constructed');
+    }
+
+    dbg(...args) {
+        this.fs.debug(this.constructor.name, args);
+    }
+
+    preloadImages() {
+        let idx: number;
+
+        this.dbg('preload images start...');
+        for (idx = 1; idx <= nImgs ; idx++) {
+            this.addImg('light', idx);
+            this.addImg('dark', idx);
+        }
+        this.dbg('preload images DONE!', this.images);
+    }
+
+    addImg(theme: string, idx: number) {
+        const img = new Image();
+        img.src = this.fname(idx, theme);
+        this.images.push(img);
+    }
+
+    fname(i: number, theme: string) {
+        const z = i > 9 ? '' : '0';
+        return dir + theme + pfx + z + i + '.png';
+    }
+
+    nextFrame() {
+        this.idx = this.idx === 16 ? 1 : this.idx + 1;
+        this.img.attr('src', this.fname(this.idx, this.theme));
+    }
+
+    // start displaying 'loading...' animation (idempotent)
+    startAnim() {
+        this.dbg('start ANIMATION');
+        this.theme = this.ts.getTheme();
+        let div = d3.select('#' + id);
+        if (div.empty()) {
+            div = d3.select('body')
+                .append('div')
+                .attr('id', id);
+            this.img = div
+                .append('img')
+                .attr('src', this.fname(1, this.theme));
+            this.idx = 1;
+            this.task = setInterval(() => this.nextFrame(), speed);
+        }
+    }
+
+    // stop displaying 'loading...' animation (idempotent)
+    stopAnim() {
+        this.dbg('*stop* ANIMATION');
+        if (this.task) {
+            clearInterval(this.task);
+            this.task = null;
+        }
+        d3.select('#' + id).remove();
+    }
+
+    // schedule function to start animation in the future
+    start() {
+        this.dbg('start (schedule)');
+        this.wait = setTimeout(this.startAnim(), waitDelay);
+    }
+
+    // cancel future start, if any; stop the animation
+    stop() {
+        if (this.wait) {
+            this.dbg('start CANCELED');
+            clearTimeout(this.wait);
+            this.wait = null;
+        }
+        this.stopAnim();
+    }
+
+    // return true if start() has been called but not stop()
+    waiting(): boolean {
+        return !!this.wait;
+    }
+
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/panel.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/panel.service.ts
new file mode 100644
index 0000000..151bd0e
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/panel.service.ts
@@ -0,0 +1,222 @@
+/*
+ *  Copyright 2018-present Open Networking Foundation
+ *
+ *  Licensed under the Apache License, Version 2.0 (the "License");
+ *  you may not use this file except in compliance with the License.
+ *  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ */
+import {Injectable} from '@angular/core';
+import {FnService} from '../util/fn.service';
+import {LogService} from '../log.service';
+import {ThemeService} from '../util/theme.service';
+import {WebSocketService} from '../remote/websocket.service';
+import * as d3 from 'd3';
+
+let fs;
+
+const defaultSettings = {
+    edge: 'right',
+    width: 200,
+    margin: 20,
+    hideMargin: 20,
+    xtnTime: 750,
+    fade: true,
+};
+
+let panels,
+    panelLayer;
+
+function init() {
+    panelLayer = d3.select('div#floatpanels');
+    panelLayer.text('');
+    panels = {};
+}
+
+// helpers for panel
+function noop() {
+}
+
+function margin(p: any) {
+    return p.settings.margin;
+}
+
+function hideMargin(p: any) {
+    return p.settings.hideMargin;
+}
+
+function noPx(p: any, what: any) {
+    return Number(p.el.style(what).replace(/px$/, ''));
+}
+
+function widthVal(p: any) {
+    return noPx(p, 'width');
+}
+
+function heightVal(p: any) {
+    return noPx(p, 'height');
+}
+
+function pxShow(p: any) {
+    return margin(p) + 'px';
+}
+
+function pxHide(p: any) {
+    return (-hideMargin(p) - widthVal(p) - (noPx(p, 'padding') * 2)) + 'px';
+}
+
+function makePanel(id: any, settings: any) {
+    const p = {
+            id: id,
+            settings: settings,
+            on: false,
+            el: null,
+        },
+        api = {
+            show: showPanel,
+            hide: hidePanel,
+            toggle: togglePanel,
+            empty: emptyPanel,
+            append: appendPanel,
+            width: panelWidth,
+            height: panelHeight,
+            bbox: panelBBox,
+            isVisible: panelIsVisible,
+            classed: classed,
+            el: panelEl,
+        };
+
+    p.el = panelLayer.append('div')
+        .attr('id', id)
+        .attr('class', 'floatpanel')
+        .style('opacity', 0);
+
+    // has to be called after el is set
+    p.el.style(p.settings.edge, pxHide(p));
+    panelWidth(p.settings.width);
+    if (p.settings.height) {
+        panelHeight(p.settings.height);
+    }
+
+    panels[id] = p;
+
+    function showPanel(cb: any) {
+        const endCb = fs.isF(cb) || noop;
+        p.on = true;
+        p.el.transition().duration(p.settings.xtnTime)
+            .style(p.settings.edge, pxShow(p))
+            .style('opacity', 1);
+    }
+
+    function hidePanel(cb: any) {
+        const endCb = fs.isF(cb) || noop,
+            endOpacity = p.settings.fade ? 0 : 1;
+        p.on = false;
+        p.el.transition().duration(p.settings.xtnTime)
+            .style(p.settings.edge, pxHide(p))
+            .style('opacity', endOpacity);
+    }
+
+    function togglePanel(cb: any) {
+        if (p.on) {
+            hidePanel(cb);
+        } else {
+            showPanel(cb);
+        }
+        return p.on;
+    }
+
+    function emptyPanel() {
+        return p.el.text('');
+    }
+
+    function appendPanel(what: any) {
+        return p.el.append(what);
+    }
+
+    function panelWidth(w: any) {
+        if (w === undefined) {
+            return widthVal(p);
+        }
+        p.el.style('width', w + 'px');
+    }
+
+    function panelHeight(h: any) {
+        if (h === undefined) {
+            return heightVal(p);
+        }
+        p.el.style('height', h + 'px');
+    }
+
+    function panelBBox() {
+        return p.el.node().getBoundingClientRect();
+    }
+
+    function panelIsVisible() {
+        return p.on;
+    }
+
+    function classed(cls: any, bool: any) {
+        return p.el.classed(cls, bool);
+    }
+
+    function panelEl() {
+        return p.el;
+    }
+
+    return api;
+}
+
+function removePanel(id: any) {
+    panelLayer.select('#' + id).remove();
+    delete panels[id];
+}
+
+@Injectable({
+    providedIn: 'root',
+})
+export class PanelService {
+    constructor(private funcs: FnService,
+                private log: LogService,
+                private ts: ThemeService,
+                private wss: WebSocketService) {
+        fs = this.funcs;
+        init();
+    }
+
+    createPanel(id: any, opts: any) {
+        const settings = Object.assign({}, defaultSettings, opts);
+        if (!id) {
+            this.log.warn('createPanel: no ID given');
+            return null;
+        }
+        if (panels[id]) {
+            this.log.warn('Panel with ID "' + id + '" already exists');
+            return null;
+        }
+        if (fs.debugOn('widget')) {
+            this.log.debug('creating panel:', id, settings);
+        }
+        return makePanel(id, settings);
+    }
+
+    destroyPanel(id: any) {
+        if (panels[id]) {
+            if (fs.debugOn('widget')) {
+                this.log.debug('destroying panel:', id);
+            }
+            removePanel(id);
+        } else {
+            if (fs.debugOn('widget')) {
+                this.log.debug('no panel to destroy:', id);
+            }
+        }
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.css
new file mode 100644
index 0000000..b688ae7
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.css
@@ -0,0 +1,35 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Veil Service (layout) -- CSS file
+ */
+
+#veil {
+    z-index: 5000;
+    display: block;
+    position: absolute;
+    top: 0;
+    left: 0;
+    padding: 60px;
+}
+
+#veil p {
+    display: block;
+    text-align: left;
+    font-size: 14pt;
+    font-style: italic;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.html b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.html
new file mode 100644
index 0000000..69410c5
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.html
@@ -0,0 +1,25 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~     http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+
+<div id="veil" *ngIf="enabled">
+    <p *ngFor="let msg of messages">{{ msg }}</p>
+    <svg [attr.width]="fs.windowSize().width" [attr.height]="fs.windowSize().height">
+        <use [attr.width]="birdDim" [attr.height]="birdDim" class="glyph"
+             style="opacity: 0.2;"
+             xlink:href = "#bird" [attr.transform]="trans"/>
+
+    </svg>
+</div>
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.spec.ts
new file mode 100644
index 0000000..72123dd
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.spec.ts
@@ -0,0 +1,72 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Layer -- Veil Service - Unit Tests
+ */
+import { async, ComponentFixture, TestBed } from '@angular/core/testing';
+import { ActivatedRoute, Params } from '@angular/router';
+
+import { VeilComponent } from './veil.component';
+import { ConsoleLoggerService } from '../../consolelogger.service';
+import { FnService } from '../../util/fn.service';
+import { LogService } from '../../log.service';
+import { GlyphService } from '../../svg/glyph.service';
+import { of } from 'rxjs';
+
+class MockActivatedRoute extends ActivatedRoute {
+    constructor(params: Params) {
+        super();
+        this.queryParams = of(params);
+    }
+}
+
+class MockGlyphService {}
+
+describe('VeilComponent', () => {
+    let fs: FnService;
+    let ar: MockActivatedRoute;
+    let windowMock: Window;
+    let logServiceSpy: jasmine.SpyObj<LogService>;
+
+    beforeEach(async(() => {
+        const logSpy = jasmine.createSpyObj('LogService', ['info', 'debug', 'warn', 'error']);
+        ar = new MockActivatedRoute({});
+        windowMock = <any>{
+            location: <any> {
+                hostname: 'foo'
+            }
+        };
+        fs = new FnService(ar, logSpy, windowMock);
+
+        TestBed.configureTestingModule({
+            declarations: [ VeilComponent ],
+            providers: [
+                { provide: FnService, useValue: fs },
+                { provide: LogService, useValue: logSpy },
+                { provide: GlyphService, useClass: MockGlyphService },
+                { provide: 'Window', useValue: windowMock },
+            ]
+        });
+        logServiceSpy = TestBed.get(LogService);
+    }));
+
+    it('should create', () => {
+        const fixture = TestBed.createComponent(VeilComponent);
+        const component = fixture.componentInstance;
+        expect(component).toBeTruthy();
+    });
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.theme.css
new file mode 100644
index 0000000..2939b9f
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.theme.css
@@ -0,0 +1,34 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Veil Service (theme) -- CSS file
+ */
+
+.light, #veil {
+    background-color: rgba(0,0,0,0.75);
+}
+.dark, #veil {
+    background-color: rgba(64,64,64,0.75);
+}
+
+#veil p {
+    color: #ddd;
+}
+
+#veil svg .glyph {
+    fill: #222;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.ts
new file mode 100644
index 0000000..b93d950
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/layer/veil/veil.component.ts
@@ -0,0 +1,84 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Component, OnInit } from '@angular/core';
+import { FnService } from '../../util/fn.service';
+import { GlyphService } from '../../svg/glyph.service';
+import { LogService } from '../../log.service';
+import { SvgUtilService } from '../../svg/svgutil.service';
+import { WebSocketService } from '../../remote/websocket.service';
+
+const BIRD = 'bird';
+
+/**
+ * ONOS GUI -- Layer -- Veil Component
+ *
+ * Provides a mechanism to display an overlaying div with information.
+ * Used mainly for web socket connection interruption.
+ *
+ * It can be added to an component's template as follows:
+ *     <onos-veil #veil></onos-veil>
+ *     <p (click)="veil.show(['t1','t2','t3'])">Test Veil</p>
+ */
+@Component({
+  selector: 'onos-veil',
+  templateUrl: './veil.component.html',
+  styleUrls: ['./veil.component.css', './veil.component.theme.css']
+})
+export class VeilComponent implements OnInit {
+    ww: number;
+    wh: number;
+    birdSvg: string;
+    birdDim: number;
+    enabled: boolean = false;
+    trans: string;
+    messages: string[] = [];
+    veilStyle: string;
+
+    constructor(
+        public fs: FnService,
+        private gs: GlyphService,
+        private log: LogService,
+        private sus: SvgUtilService,
+        private wss: WebSocketService
+    ) {
+        const wSize = this.fs.windowSize();
+        this.ww = wSize.width;
+        this.wh = wSize.height;
+        const shrink = this.wh * 0.3;
+        this.birdDim = this.wh - shrink;
+        const birdCenter = (this.ww - this.birdDim) / 2;
+        this.trans = this.sus.translate([birdCenter, shrink / 2]);
+
+        this.log.debug('VeilComponent with ' + BIRD + ' constructed');
+    }
+
+    ngOnInit() {
+    }
+
+    // msg should be an array of strings
+    show(msgs: string[]): void {
+        this.messages = msgs;
+        this.enabled = true;
+//        this.ks.enableKeys(false);
+    }
+
+    hide(): void {
+        this.veilStyle = 'display: none';
+//        this.ks.enableKeys(true);
+    }
+
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/log.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/log.service.ts
new file mode 100644
index 0000000..2835371
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/log.service.ts
@@ -0,0 +1,39 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+
+export abstract class Logger {
+  debug: any;
+  info: any;
+  warn: any;
+  error: any;
+}
+
+/**
+ * ONOS GUI -- LogService
+ * Inspired by https://robferguson.org/blog/2017/09/09/a-simple-logging-service-for-angular-4/
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class LogService extends Logger {
+  debug: any;
+  info: any;
+  warn: any;
+  error: any;
+
+  invokeConsoleMethod(type: string, args?: any): void {}
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast.service.ts
new file mode 100644
index 0000000..b279aec
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast.service.ts
@@ -0,0 +1,43 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+
+const PADMOBILE = 16;
+
+/**
+ * ONOS GUI -- Masthead Service
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class MastService {
+
+  public mastHeight = 48;
+
+  constructor(
+    private fs: FnService,
+    private log: LogService
+  ) {
+    if (this.fs.isMobile()) {
+        this.mastHeight += PADMOBILE;
+    }
+
+    this.log.debug('MastService constructed');
+  }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.css
new file mode 100644
index 0000000..5b2d464
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.css
@@ -0,0 +1,132 @@
+/*
+ * Copyright 2014-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Masthead (layout) -- CSS file
+ */
+#mast-top-block {
+    display: block;
+    z-index: -1;
+    height: 48px;
+    width: 100%;
+}
+
+#mast {
+    position: absolute;
+    width: 100%;
+    top: 0px;
+    height: 48px;
+    padding: 0;
+    z-index: 10000;
+}
+
+#mast a:hover {
+    text-decoration: none;
+}
+
+html[data-platform='iPad'] #mast {
+    padding-top: 16px;
+}
+
+#mast .nav-menu-button {
+    display: inline-block;
+    vertical-align: middle;
+    text-align: center;
+    line-height: 48px;
+    padding: 0 12px;
+    cursor: pointer; cursor: hand;
+    /* Needed to removed 3px space at the bottom of img tags */
+    font-size: 0;
+}
+
+#mast .nav-menu-button img {
+    width: 25px;
+    vertical-align: middle;
+}
+
+#mast .logo {
+    height: 47px;
+    width: 511px;
+    vertical-align: bottom;
+}
+
+#mast-right {
+    display: inline-block;
+    float: right;
+    position: relative;
+    top: 0;
+    padding-right: 15px;
+    line-height: 48px;
+}
+
+/*
+    MAST HEAD DROPDOWN MENU
+*/
+
+#mast-right div.ctrl-btns {
+    float: right;
+}
+
+#mast-right div.icon {
+    box-sizing: border-box;
+    position: relative;
+    height: 48px;
+    width: 48px;
+    padding: 9px;
+}
+
+#mast .dropdown-parent {
+    position: relative;
+    float: right;
+}
+
+#mast .dropdown-parent i.dropdown-icon {
+    display: inline-block;
+    height: 7px;
+    width: 9px;
+    margin-left: 10px;
+    background: url('/data/img/dropdown-icon.png') no-repeat;
+}
+
+#mast .dropdown {
+    position: absolute;
+    top: 40px;
+    right: -8px;
+    display: none;
+    min-width: 100px;
+    line-height: 16px;
+    font-size: 12pt;
+    z-index: 1000;
+}
+
+#mast .dropdown a {
+    text-decoration: none;
+    font-size: 12px;
+    display: block;
+    padding: 8px 16px 6px 12px;
+}
+
+#mast .dropdown-parent:hover .dropdown {
+    display: block;
+}
+
+#mast .dropdown-parent:hover i.dropdown-icon {
+    background-position-x: -14px
+}
+
+html[data-platform='iPad'] #mast .dropdown {
+    top: 57px;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.html b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.html
new file mode 100644
index 0000000..72242ba
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.html
@@ -0,0 +1,43 @@
+<!--
+~ Copyright 2014-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~     http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+<div id="mast-top-block"></div>
+<!-- The mast-top-block is an inline display element that pushes any
+  subsequent elements down the page. It has a height of 48px
+     The mast block overlays the mast-top-block. It is is positioned
+     absolutely so that the nav component can slide in behind it when
+     not shown -->
+<div id="mast" align="left">
+    <span class="nav-menu-button clickable" (click)="ns.toggleNav()">
+        <img src="data/img/nav-menu-mojo.png"/>
+    </span>
+    <img class="logo" src="data/img/masthead-logo-mojo.png">
+    <div id="mast-right">
+        <nav>
+            <div class="dropdown-parent">
+                <a class="clickable user-menu__name">{{ username }} <i class="dropdown-icon"></i></a>
+                <div class="dropdown">
+                    <a href="rs/logout"> {{ lionFn('logout') }} </a>
+                </div>
+            </div>
+            <div class="ctrl-btns">
+                <div class="active clickable icon" (click)="directTo()">
+                    <onos-icon iconId="query" iconSize="32" toolTip="{{ lionFn('tt_help') }}"></onos-icon>
+                </div>
+            </div>
+        </nav>
+
+    </div>
+</div>
\ No newline at end of file
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.spec.ts
new file mode 100644
index 0000000..de42b62
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.spec.ts
@@ -0,0 +1,131 @@
+/*
+ * Copyright 2015-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { async, ComponentFixture, TestBed } from '@angular/core/testing';
+import { DebugElement } from '@angular/core';
+import { By } from '@angular/platform-browser';
+
+import { LogService } from '../../log.service';
+import { ConsoleLoggerService } from '../../consolelogger.service';
+import { MastComponent } from './mast.component';
+import { IconComponent } from '../../svg/icon/icon.component';
+import { LionService } from '../../util/lion.service';
+import { IconService } from '../../svg/icon.service';
+import { NavService } from '../../nav/nav.service';
+import { WebSocketService } from '../../remote/websocket.service';
+
+class MockNavService {}
+
+class MockIconService {
+    loadIconDef() {}
+}
+
+class MockWebSocketService {
+    createWebSocket() {}
+    isConnected() { return false; }
+    unbindHandlers() {}
+    bindHandlers() {}
+}
+
+/**
+ * ONOS GUI -- Masthead Controller - Unit Tests
+ */
+describe('MastComponent', () => {
+    let log: LogService;
+    let windowMock: Window;
+    let component: MastComponent;
+    let fixture: ComponentFixture<MastComponent>;
+    const bundleObj = {
+        'core.view.App': {
+            test: 'test1',
+            tt_help: 'Help!'
+        }
+    };
+    const mockLion = (key) =>  {
+        return bundleObj[key] || '%' + key + '%';
+    };
+
+    beforeEach(async(() => {
+        log = new ConsoleLoggerService();
+        windowMock = <any>{
+            location: <any> {
+                hostname: 'foo',
+                pathname: 'apps',
+                host: 'foo',
+                port: '80',
+                protocol: 'http',
+                search: { debug: 'true'},
+                href: 'ws://foo:123/onos/ui/websock/path',
+                absUrl: 'ws://foo:123/onos/ui/websock/path'
+            }
+        };
+
+        TestBed.configureTestingModule({
+            declarations: [ MastComponent, IconComponent ],
+            providers: [
+                { provide: LogService, useValue: log },
+                { provide: NavService, useClass: MockNavService },
+                { provide: LionService, useFactory: (() => {
+                        return {
+                            bundle: ((bundleId) => mockLion),
+                            ubercache: new Array(),
+                            loadCbs: new Map<string, () => void>([])
+                        };
+                    })
+                },
+                { provide: IconService, useClass: MockIconService },
+                { provide: WebSocketService, useClass: MockWebSocketService },
+                { provide: 'Window', useValue: windowMock }
+            ]
+        })
+        .compileComponents();
+    }));
+
+    beforeEach(() => {
+        fixture = TestBed.createComponent(MastComponent);
+        component = fixture.debugElement.componentInstance;
+        fixture.detectChanges();
+    });
+
+    it('should create', () => {
+        expect(component).toBeTruthy();
+    });
+
+    it('should have a div#mast-top-block', () => {
+        const appDe: DebugElement = fixture.debugElement;
+        const divDe = appDe.query(By.css('div#mast-top-block'));
+        expect(divDe).toBeTruthy();
+    });
+
+    it('should have a span.nav-menu-button inside a div#mast', () => {
+        const appDe: DebugElement = fixture.debugElement;
+        const divDe = appDe.query(By.css('div#mast span.nav-menu-button'));
+        expect(divDe).toBeTruthy();
+    });
+
+    it('should have a div.dropdown-parent inside a div#mast-right inside a div#mast', () => {
+        const appDe: DebugElement = fixture.debugElement;
+        const divDe = appDe.query(By.css('div#mast div#mast-right div.dropdown-parent'));
+        const div: HTMLElement = divDe.nativeElement;
+        expect(div.textContent).toEqual('  %logout% ');
+    });
+
+    it('should have an onos-icon inside a div#mast-right inside a div#mast', () => {
+        const appDe: DebugElement = fixture.debugElement;
+        const divDe = appDe.query(By.css('div#mast div#mast-right div.ctrl-btns div.active onos-icon'));
+        expect(divDe).toBeTruthy();
+    });
+
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.ts
new file mode 100644
index 0000000..e6a927c
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.component.ts
@@ -0,0 +1,92 @@
+/*
+ * Copyright 2014-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Component, Input, OnInit, OnDestroy, Inject } from '@angular/core';
+import { LionService } from '../../util/lion.service';
+import { LogService } from '../../log.service';
+import { NavService } from '../../nav/nav.service';
+
+/**
+ * ONOS GUI -- Masthead Component
+ */
+@Component({
+  selector: 'onos-mast',
+  templateUrl: './mast.component.html',
+  styleUrls: ['./mast.component.css', './mast.theme.css']
+})
+export class MastComponent implements OnInit, OnDestroy {
+    @Input() username: string;
+
+    lionFn; // Function
+    viewMap = new Map<string, string>([]); // A map of app names
+
+    constructor(
+        private lion: LionService,
+        private log: LogService,
+        public ns: NavService,
+        @Inject('Window') private window: any,
+    ) {
+        this.viewMap.set('apps', 'https://wiki.onosproject.org/display/ONOS/GUI+Application+View');
+        this.viewMap.set('device', 'https://wiki.onosproject.org/display/ONOS/GUI+Device+View');
+        this.viewMap.set('', 'https://wiki.onosproject.org/display/ONOS/The+ONOS+Web+GUI');
+    }
+
+    ngOnInit() {
+        if (this.lion.ubercache.length === 0) {
+            this.lionFn = this.dummyLion;
+            this.lion.loadCbs.set('mast', () => this.doLion());
+            this.log.debug('LION not available when MastComponent initialized');
+        } else {
+            this.doLion();
+        }
+        this.log.debug('MastComponent initialized');
+    }
+
+    /**
+     * Nav component should never be closed, but in case it does, it's
+     * safer to tidy up after itself
+     */
+    ngOnDestroy() {
+        this.lion.loadCbs.delete('mast');
+    }
+
+    /**
+    * Read the LION bundle for App and set up the lionFn
+    */
+    doLion() {
+        this.lionFn = this.lion.bundle('core.fw.Mast');
+        if (this.username === undefined) {
+            this.username = this.lionFn('unknown_user');
+        }
+    }
+
+    /**
+    * A dummy implementation of the lionFn until the response is received and the LION
+    * bundle is received from the WebSocket
+    */
+    dummyLion(key: string): string {
+        return '%' + key + '%';
+    }
+
+    directTo() {
+        const curId = this.window.location.pathname.replace('/', '');
+        let helpUrl: string = this.viewMap.get(curId);
+        if (helpUrl === undefined) {
+            helpUrl = this.viewMap.get('');
+            this.log.warn('No help file linked for view:', curId);
+        }
+        this.window.open(helpUrl);
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.theme.css
new file mode 100644
index 0000000..6b92beb
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/mast/mast/mast.theme.css
@@ -0,0 +1,51 @@
+/*
+ * Copyright 2016-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Masthead (theme) -- CSS file
+ */
+
+#mast {
+    background-color: #231f20;
+}
+
+#mast .nav-menu-button:hover {
+    background-color: #888;
+}
+
+#mast-right a {
+    color: #009fdb;
+}
+
+#mast nav  {
+    color: #009fdb;
+}
+
+/* Theme styles for drop down menu */
+
+#mast .dropdown {
+    background-color: #231f20;
+    border: 1px solid #dddddd;
+}
+
+#mast .dropdown a {
+    color: #009fdb;
+    border-bottom: solid #444 1px;
+}
+
+#mast .dropdown a:hover {
+    color: #fff;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/nav/nav.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/nav/nav.service.ts
new file mode 100644
index 0000000..22f0549
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/nav/nav.service.ts
@@ -0,0 +1,52 @@
+/*
+ * Copyright 2015-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+
+/**
+ * ONOS GUI -- Navigation Service
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class NavService {
+    public showNav = false;
+
+    constructor(
+        private _fn_: FnService,
+        private log: LogService
+    ) {
+        this.log.debug('NavService constructed');
+    }
+
+    hideNav() {
+        this.showNav = !this.showNav;
+        if (!this.showNav) {
+            this.log.debug('Hiding Nav menu');
+        }
+    }
+
+    toggleNav() {
+        this.showNav = !this.showNav;
+        if (this.showNav) {
+            this.log.debug('Showing Nav menu');
+        } else {
+            this.log.debug('Hiding Nav menu');
+        }
+    }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/onos.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/onos.service.ts
new file mode 100644
index 0000000..17a30ff
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/onos.service.ts
@@ -0,0 +1,44 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { LogService } from './log.service';
+
+/**
+ * A structure of View elements for the OnosService
+ */
+export interface View {
+    id: string;
+    path: string;
+}
+
+/**
+ * ONOS GUI -- OnosService - a placeholder for the global onos variable
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class OnosService {
+    // Global variable
+    public browser: string;
+    public mobile: boolean;
+    public viewMap: View[];
+
+    constructor (
+        private log: LogService
+    ) {
+//        this.log.debug('OnosService constructed');
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.spec.ts
new file mode 100644
index 0000000..2c31610
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.spec.ts
@@ -0,0 +1,123 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { TestBed, inject } from '@angular/core/testing';
+
+import { LogService } from '../log.service';
+import { ConsoleLoggerService } from '../consolelogger.service';
+import { UrlFnService } from './urlfn.service';
+import { FnService } from '../util/fn.service';
+import { ActivatedRoute, Params } from '@angular/router';
+import { of } from 'rxjs';
+
+class MockActivatedRoute extends ActivatedRoute {
+    constructor(params: Params) {
+        super();
+        this.queryParams = of(params);
+    }
+}
+
+/**
+ * ONOS GUI -- Remote -- General Functions - Unit Tests
+ */
+describe('UrlFnService', () => {
+    let log: LogService;
+    let ufs: UrlFnService;
+    let fs: FnService;
+    let ar: MockActivatedRoute;
+    let windowMock: Window;
+
+    beforeEach(() => {
+        log = new ConsoleLoggerService();
+        ar = new MockActivatedRoute({'debug': 'TestService'});
+        windowMock = <any>{
+            location: <any> {
+                hostname: '',
+                host: '',
+                port: '',
+                protocol: '',
+                search: { debug: 'true'},
+                href: ''
+            }
+        };
+
+        fs = new FnService(ar, log, windowMock);
+
+        TestBed.configureTestingModule({
+            providers: [UrlFnService,
+                { provide: LogService, useValue: log },
+                { provide: 'Window', useFactory: (() => windowMock ) },
+            ]
+        });
+
+        ufs = TestBed.get(UrlFnService);
+    });
+
+    function setLoc(prot: string, h: string, p: string, ctx: string = '') {
+        windowMock.location.host = h;
+        windowMock.location.hostname = h;
+        windowMock.location.port = p;
+        windowMock.location.protocol = prot;
+        windowMock.location.href = prot + '://' + h + ':' + p +
+            ctx + '/onos/ui/';
+    }
+
+    it('should define UrlFnService', () => {
+        expect(ufs).toBeDefined();
+    });
+
+    it('should define api functions', () => {
+        expect(fs.areFunctions(ufs, [
+            'rsUrl', 'wsUrl', 'urlBase', 'httpPrefix',
+            'wsPrefix', 'matchSecure'
+        ])).toBeTruthy();
+    });
+
+    it('should return the correct (http) RS url', () => {
+        setLoc('http', 'foo', '123');
+        expect(ufs.rsUrl('path')).toEqual('http://foo:123/onos/ui/rs/path');
+    });
+
+    it('should return the correct (https) RS url', () => {
+        setLoc('https', 'foo', '123');
+        expect(ufs.rsUrl('path')).toEqual('https://foo:123/onos/ui/rs/path');
+    });
+
+    it('should return the correct (ws) WS url', () => {
+        setLoc('http', 'foo', '123');
+        expect(ufs.wsUrl('path')).toEqual('ws://foo:123/onos/ui/websock/path');
+    });
+
+    it('should return the correct (wss) WS url', () => {
+        setLoc('https', 'foo', '123');
+        expect(ufs.wsUrl('path')).toEqual('wss://foo:123/onos/ui/websock/path');
+    });
+
+    it('should allow us to define an alternate WS port', () => {
+        setLoc('http', 'foo', '123');
+        expect(ufs.wsUrl('xyyzy', '456')).toEqual('ws://foo:456/onos/ui/websock/xyyzy');
+    });
+
+    it('should allow us to define an alternate host', () => {
+        setLoc('http', 'foo', '123');
+        expect(ufs.wsUrl('core', '456', 'bar')).toEqual('ws://bar:456/onos/ui/websock/core');
+    });
+
+    it('should allow us to inject an app context', () => {
+        setLoc('http', 'foo', '123', '/my/app');
+        expect(ufs.wsUrl('path')).toEqual('ws://foo:123/my/app/onos/ui/websock/path');
+    });
+
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.ts
new file mode 100644
index 0000000..a7576c0
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/urlfn.service.ts
@@ -0,0 +1,78 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable, Inject } from '@angular/core';
+import { LogService } from '../log.service';
+
+const UICONTEXT = '/onos/ui/';
+const RSSUFFIX = UICONTEXT + 'rs/';
+const WSSUFFIX = UICONTEXT + 'websock/';
+
+/**
+ * ONOS GUI -- Remote -- General Purpose URL Functions
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class UrlFnService {
+    constructor(
+        private log: LogService,
+        @Inject('Window') private w: any
+    ) {
+        this.log.debug('UrlFnService constructed');
+    }
+
+    matchSecure(protocol: string): string {
+        const p: string = this.w.location.protocol;
+        const secure: boolean = (p === 'https' || p === 'wss');
+        return secure ? protocol + 's' : protocol;
+    }
+
+    /* A little bit of funky here. It is possible that ONOS sits
+     * behind a proxy and has an app prefix, e.g.
+     *      http://host:port/my/app/onos/ui...
+     * This bit of regex grabs everything after the host:port and
+     * before the UICONTEXT (/onos/ui/) and uses that as an app
+     * prefix by inserting it back into the WS URL.
+     * If no prefix, then no insert.
+     */
+    urlBase(protocol: string, port: string = '', host: string = ''): string {
+        const match = this.w.location.href.match('.*//[^/]+/(.+)' + UICONTEXT);
+        const appPrefix = match ? '/' + match[1] : '';
+
+        return this.matchSecure(protocol) +
+            '://' +
+            (host === '' ? this.w.location.hostname : host) +
+            ':' +
+            (port === '' ? this.w.location.port : port) +
+            appPrefix;
+    }
+
+    httpPrefix(suffix: string): string {
+        return this.urlBase('http') + suffix;
+    }
+
+    wsPrefix(suffix: string, wsport: string, host: string): string {
+        return this.urlBase('ws', wsport, host) + suffix;
+    }
+
+    rsUrl(path: string): string {
+        return this.httpPrefix(RSSUFFIX) + path;
+    }
+
+    wsUrl(path: string, wsport?: string, host?: string): string {
+        return this.wsPrefix(WSSUFFIX, wsport, host) + path;
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.spec.ts
new file mode 100644
index 0000000..7695e13
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.spec.ts
@@ -0,0 +1,278 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { TestBed, inject } from '@angular/core/testing';
+
+import { LogService } from '../log.service';
+import { WebSocketService, WsOptions, Callback, EventType } from './websocket.service';
+import { FnService } from '../util/fn.service';
+import { GlyphService } from '../svg/glyph.service';
+import { ActivatedRoute, Params } from '@angular/router';
+import { UrlFnService } from './urlfn.service';
+import { WSock } from './wsock.service';
+import { of } from 'rxjs';
+
+class MockActivatedRoute extends ActivatedRoute {
+    constructor(params: Params) {
+        super();
+        this.queryParams = of(params);
+    }
+}
+
+class MockGlyphService {}
+
+/**
+ * ONOS GUI -- Remote -- Web Socket Service - Unit Tests
+ */
+describe('WebSocketService', () => {
+    let wss: WebSocketService;
+    let fs: FnService;
+    let ar: MockActivatedRoute;
+    let windowMock: Window;
+    let logServiceSpy: jasmine.SpyObj<LogService>;
+
+    const noop = () => ({});
+    const send = jasmine.createSpy('send')
+        .and.callFake((ev) => ev);
+    const mockWebSocket = {
+        send: send,
+        onmessage: (msgEvent) => ({}),
+        onopen: () => ({}),
+        onclose: () => ({}),
+    };
+
+    beforeEach(() => {
+        const logSpy = jasmine.createSpyObj('LogService', ['info', 'debug', 'warn', 'error']);
+        ar = new MockActivatedRoute({'debug': 'txrx'});
+
+        windowMock = <any>{
+            location: <any> {
+                hostname: 'foo',
+                host: 'foo',
+                port: '80',
+                protocol: 'http',
+                search: { debug: 'true'},
+                href: 'ws://foo:123/onos/ui/websock/path',
+                absUrl: 'ws://foo:123/onos/ui/websock/path'
+            }
+        };
+        fs = new FnService(ar, logSpy, windowMock);
+
+        TestBed.configureTestingModule({
+            providers: [WebSocketService,
+                { provide: FnService, useValue: fs },
+                { provide: LogService, useValue: logSpy },
+                { provide: GlyphService, useClass: MockGlyphService },
+                { provide: UrlFnService, useValue: new UrlFnService(logSpy, windowMock) },
+                { provide: 'Window', useFactory: (() => windowMock ) },
+                { provide: WSock, useFactory: (() => {
+                        return {
+                            newWebSocket: (() => mockWebSocket)
+                        };
+                    })
+                }
+            ]
+        });
+
+        wss = TestBed.get(WebSocketService);
+        logServiceSpy = TestBed.get(LogService);
+    });
+
+    it('should define WebSocketService', () => {
+        expect(wss).toBeDefined();
+    });
+
+    it('should define api functions', () => {
+        expect(fs.areFunctions(wss, ['bootstrap', 'error',
+            'handleOpen', 'handleMessage', 'handleClose',
+            'findGuiSuccessor', 'informListeners', 'send',
+            'noHandlersWarn', 'resetState',
+            'createWebSocket', 'bindHandlers', 'unbindHandlers',
+            'addOpenListener', 'removeOpenListener', 'sendEvent',
+            'setVeilDelegate', 'setLoadingDelegate', 'isConnected',
+             'closeWebSocket', 'isHandling'
+        ])).toBeTruthy();
+    });
+
+    it('should use the appropriate URL, createWebsocket', () => {
+        const url = wss.createWebSocket();
+        expect(url).toEqual('ws://foo:80/onos/ui/websock/core');
+    });
+
+    it('should use the appropriate URL with modified port, createWebsocket',
+        () => {
+            const url = wss.createWebSocket(<WsOptions>{ wsport: 1243 });
+            expect(url).toEqual('ws://foo:1243/onos/ui/websock/core');
+    });
+
+    it('should verify websocket event handlers, createWebsocket', () => {
+        wss.createWebSocket({ wsport: 1234 });
+        expect(fs.isF(mockWebSocket.onopen)).toBeTruthy();
+        expect(fs.isF(mockWebSocket.onmessage)).toBeTruthy();
+        expect(fs.isF(mockWebSocket.onclose)).toBeTruthy();
+    });
+
+    it('should invoke listener callbacks when websocket is up, handleOpen',
+        () => {
+            let num = 0;
+            function incrementNum(host: string, url: string) {
+                expect(host).toEqual('foo');
+                num++;
+            }
+            wss.addOpenListener(incrementNum);
+            wss.createWebSocket({ wsport: 1234 });
+
+            mockWebSocket.onopen();
+            expect(num).toBe(1);
+    });
+
+    it('should send pending events, handleOpen', () => {
+        const fakeEvent = {
+            event: 'mockEv',
+            payload: { mock: 'thing' }
+        };
+        wss.sendEvent(fakeEvent.event, fakeEvent.payload);
+        // on opening the socket, a single authentication event should have
+        // been sent already...
+        expect(mockWebSocket.send.calls.count()).toEqual(1);
+
+        wss.createWebSocket({ wsport: 1234 });
+        mockWebSocket.onopen();
+        expect(mockWebSocket.send).toHaveBeenCalledWith(JSON.stringify(fakeEvent));
+    });
+
+    it('should handle an incoming bad JSON message, handleMessage', () => {
+        const badMsg = {
+            data: 'bad message'
+        };
+        wss.createWebSocket({ wsport: 1234 });
+        expect(mockWebSocket.onmessage(badMsg)).toBeNull();
+        expect(logServiceSpy.error).toHaveBeenCalled();
+    });
+
+    it('should verify message was handled, handleMessage', () => {
+        let num = 0;
+        function fakeHandler(data1: Object) { num++; }
+        const data = JSON.stringify(<EventType>{
+            event: 'mockEvResp',
+            payload: {}
+        });
+        const event = {
+            data: data
+        };
+
+        wss.createWebSocket({ wsport: 1234 });
+        wss.bindHandlers(new Map<string, (data) => void>([
+            ['mockEvResp', (data2) => fakeHandler(data2)]
+        ]));
+        expect(mockWebSocket.onmessage(event)).toBe(undefined);
+        expect(num).toBe(1);
+    });
+
+    it('should warn if there is an unhandled event, handleMessage', () => {
+        const data = { foo: 'bar', bar: 'baz'};
+        const dataString = JSON.stringify(data);
+        const badEv = {
+                data: dataString
+            };
+        wss.createWebSocket({ wsport: 1234 });
+        mockWebSocket.onmessage(badEv);
+        expect(logServiceSpy.warn).toHaveBeenCalledWith('Unhandled event:', data);
+    });
+
+    it('should not warn if valid input, bindHandlers', () => {
+        expect(wss.bindHandlers(new Map<string, (data) => void>([
+            ['test', noop ],
+            ['bar', noop ]
+        ]))).toBe(undefined);
+
+        expect(logServiceSpy.warn).not.toHaveBeenCalled();
+    });
+
+    it('should warn if no arguments, bindHandlers', () => {
+        expect(wss.bindHandlers(
+            new Map<string, (data) => void>([])
+        )).toBeNull();
+        expect(logServiceSpy.warn).toHaveBeenCalledWith(
+            'WSS.bindHandlers(): no event handlers'
+        );
+    });
+
+    it('should warn if duplicate handlers were given, bindHandlers',
+        () => {
+            wss.bindHandlers(
+                new Map<string, (data) => void>([
+                    ['noop', noop ]
+                ])
+            );
+            expect(wss.bindHandlers(
+                new Map<string, (data) => void>([
+                    ['noop', noop ]
+                ])
+            )).toBe(undefined);
+            expect(logServiceSpy.warn).toHaveBeenCalledWith('duplicate bindings ignored:',
+                                                    ['noop']);
+    });
+
+    it('should warn if no arguments, unbindHandlers', () => {
+        expect(wss.unbindHandlers([])).toBeNull();
+        expect(logServiceSpy.warn).toHaveBeenCalledWith(
+            'WSS.unbindHandlers(): no event handlers'
+        );
+    });
+    // Note: cannot test unbindHandlers' forEach due to it using closure variable
+
+    it('should not warn if valid argument, addOpenListener', () => {
+        let o = wss.addOpenListener(noop);
+        expect(o.id === 1);
+        expect(o.cb === noop);
+        expect(logServiceSpy.warn).not.toHaveBeenCalled();
+        o = wss.addOpenListener(noop);
+        expect(o.id === 2);
+        expect(o.cb === noop);
+        expect(logServiceSpy.warn).not.toHaveBeenCalled();
+    });
+
+    it('should log error if callback not a function, addOpenListener',
+        () => {
+            const o = wss.addOpenListener(null);
+            expect(o.id === 1);
+            expect(o.cb === null);
+            expect(o.error === 'No callback defined');
+            expect(logServiceSpy.error).toHaveBeenCalledWith(
+                'WSS.addOpenListener(): callback not a function'
+            );
+    });
+
+    it('should not warn if valid listener object, removeOpenListener', () => {
+        expect(wss.removeOpenListener(<Callback>{
+            id: 1,
+            error: 'error',
+            cb: noop
+        })).toBe(undefined);
+        expect(logServiceSpy.warn).not.toHaveBeenCalled();
+    });
+
+    it('should warn if listener is invalid, removeOpenListener', () => {
+        expect(wss.removeOpenListener(<Callback>{})).toBeNull();
+        expect(logServiceSpy.warn).toHaveBeenCalledWith(
+            'WSS.removeOpenListener(): invalid listener', {}
+        );
+    });
+
+    // Note: handleClose is not currently tested due to all work it does relies
+    //       on closure variables that cannot be mocked
+
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.ts
new file mode 100644
index 0000000..c4d5227
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/websocket.service.ts
@@ -0,0 +1,465 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable, Inject } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { GlyphService } from '../svg/glyph.service';
+import { LogService } from '../log.service';
+import { UrlFnService } from './urlfn.service';
+import { VeilComponent } from '../layer/veil/veil.component';
+import { WSock } from './wsock.service';
+
+/**
+ * Event Type structure for the WebSocketService
+ */
+export interface EventType {
+    event: string;
+    payload: Object;
+}
+
+export interface Callback {
+    id: number;
+    error: string;
+    cb(host: string, url: string): void;
+}
+
+interface ClusterNode {
+    id: string;
+    ip: string;
+    m_uiAttached: boolean;
+}
+
+interface Bootstrap {
+    user: string;
+    clusterNodes: ClusterNode[];
+    glyphs: any[]; // TODO: narrow this down to a known type
+}
+
+interface ErrorData {
+    message: string;
+}
+
+export interface WsOptions {
+    wsport: number;
+}
+
+/**
+ * ONOS GUI -- Remote -- Web Socket Service
+ *
+ * To see debug messages add ?debug=txrx to the URL
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class WebSocketService {
+    // internal state
+    private webSockOpts: WsOptions; // web socket options
+    private ws: WebSocket = null; // web socket reference
+    private wsUp: boolean = false; // web socket is good to go
+
+    // A map of event handler bindings - names and functions (that accept data and return void)
+    private handlers = new Map<string, (data: any) => void>([]);
+    private pendingEvents: EventType[] = []; // events TX'd while socket not up
+    private host: string; // web socket host
+    private url; // web socket URL
+    private clusterNodes: ClusterNode[] = []; // ONOS instances data for failover
+    private clusterIndex = -1; // the instance to which we are connected
+    private glyphs = [];
+    private connectRetries: number = 0; // limit our attempts at reconnecting
+
+    // A map of registered Callbacks for websocket open()
+    private openListeners = new Map<number, Callback>([]);
+    private nextListenerId: number = 1; // internal ID for open listeners
+    private loggedInUser = null; // name of logged-in user
+    private lcd: any; // The loading component delegate
+    private vcd: any; // The veil component delegate
+
+    /**
+     * built-in handler for the 'boostrap' event
+     */
+    private bootstrap(data: Bootstrap) {
+        this.loggedInUser = data.user;
+
+        this.clusterNodes = data.clusterNodes;
+        this.clusterNodes.forEach((d, i) => {
+            if (d.m_uiAttached) {
+                this.clusterIndex = i;
+                this.log.info('Connected to cluster node ' + d.ip);
+                // TODO: add connect info to masthead somewhere
+            }
+        });
+        this.glyphs = data.glyphs;
+        const glyphsMap = new Map<string, string>([]);
+        this.glyphs.forEach((d, i) => {
+            glyphsMap.set('_' + d.id, d.viewbox);
+            glyphsMap.set(d.id, d.path);
+            this.gs.registerGlyphs(glyphsMap);
+        });
+    }
+
+    private error(data: ErrorData) {
+        const m: string = data.message || 'error from server';
+        this.log.error(m, data);
+
+        // Unrecoverable error - throw up the veil...
+        if (this.vcd) {
+            this.vcd.show([
+                'Oops!',
+                'Server reports error...',
+                m,
+            ]);
+        }
+    }
+
+    constructor(
+        private fs: FnService,
+        private gs: GlyphService,
+        private log: LogService,
+        private ufs: UrlFnService,
+        private wsock: WSock,
+        @Inject('Window') private window: any
+    ) {
+        this.log.debug(window.location.hostname);
+
+        // Bind the boot strap event by default
+        this.bindHandlers(new Map<string, (data) => void>([
+            ['bootstrap', (data) => this.bootstrap(data)],
+            ['error', (data) => this.error(data)]
+        ]));
+
+        this.log.debug('WebSocketService constructed');
+    }
+
+
+    // ==========================
+    // === Web socket callbacks
+
+    /**
+     * Called when WebSocket has just opened
+     *
+     * Lift the Veil if it is displayed
+     * If there are any events pending, send them
+     * Mark the WSS as up and inform any listeners for this open event
+     */
+    handleOpen(): void {
+        this.log.info('Web socket open - ', this.url);
+        // Hide the veil
+        if (this.vcd) {
+            this.vcd.hide();
+        }
+
+        if (this.fs.debugOn('txrx')) {
+            this.log.debug('Sending ' + this.pendingEvents.length + ' pending event(s)...');
+        }
+        this.pendingEvents.forEach((ev) => {
+            this.send(ev);
+        });
+        this.pendingEvents = [];
+
+        this.connectRetries = 0;
+        this.wsUp = true;
+        this.informListeners(this.host, this.url);
+    }
+
+    /**
+     * Function called when WebSocket send a message
+     */
+    handleMessage(msgEvent: MessageEvent): void {
+        let ev: EventType;
+        let h;
+        try {
+            ev = JSON.parse(msgEvent.data);
+        } catch (e) {
+            this.log.error('Message.data is not valid JSON', msgEvent.data, e);
+            return null;
+        }
+        if (this.fs.debugOn('txrx')) {
+            this.log.debug(' << *Rx* ', ev.event, ev.payload);
+        }
+        h = this.handlers.get(ev.event);
+        if (h) {
+            try {
+                h(ev.payload);
+            } catch (e) {
+                this.log.error('Problem handling event:', ev, e);
+                return null;
+            }
+        } else {
+            this.log.warn('Unhandled event:', ev);
+        }
+    }
+
+    /**
+     * Called by the WebSocket if it is closed from the server end
+     *
+     * If the loading component is shown, call stop() on it
+     * Try to find another node in the cluster to connect to
+     * If this is not possible then show the Veil Component
+     */
+    handleClose(): void {
+        this.log.warn('Web socket closed');
+        if (this.lcd) {
+            this.lcd.stop();
+        }
+        this.wsUp = false;
+        let gsucc;
+
+        if (gsucc = this.findGuiSuccessor()) {
+            this.url = this.createWebSocket(this.webSockOpts, gsucc);
+        } else {
+            // If no controllers left to contact, show the Veil...
+            if (this.vcd) {
+                this.vcd.show([
+                    'Oops!',  // TODO: Localize this
+                    'Web-socket connection to server closed...',
+                    'Try refreshing the page.',
+                ]);
+            }
+        }
+    }
+
+    // ==============================
+    // === Private Helper Functions
+
+    /**
+     * Find the next node in the ONOS cluster.
+     *
+     * This is used if the WebSocket connection closes because a
+     * node in the cluster ges down - fail over should be automatic
+     */
+    findGuiSuccessor(): string {
+        const ncn = this.clusterNodes.length;
+        let ip: string;
+        let node;
+
+        while (this.connectRetries < ncn && !ip) {
+            this.connectRetries++;
+            this.clusterIndex = (this.clusterIndex + 1) % ncn;
+            node = this.clusterNodes[this.clusterIndex];
+            ip = node && node.ip;
+        }
+
+        return ip;
+    }
+
+    /**
+     * When the WebSocket is opened, inform any listeners that registered
+     * for that event
+     */
+    informListeners(host: string, url: string): void {
+        for (const [key, cb] of this.openListeners.entries()) {
+            cb.cb(host, url);
+        }
+    }
+
+    send(ev: EventType): void {
+        if (this.fs.debugOn('txrx')) {
+            this.log.debug(' *Tx* >> ', ev.event, ev.payload);
+        }
+        this.ws.send(JSON.stringify(ev));
+    }
+
+    /**
+     * Check if there are no WSS event handlers left
+     */
+    noHandlersWarn(handlers: Map<string, Object>, caller: string): boolean {
+        if (!handlers || handlers.size === 0) {
+            this.log.warn('WSS.' + caller + '(): no event handlers');
+            return true;
+        }
+        return false;
+    }
+
+    /* ===================
+     * === API Functions
+     */
+
+    /**
+     * Required for unit tests to set to known state
+     */
+    resetState(): void {
+        this.webSockOpts = undefined;
+        this.ws = null;
+        this.wsUp = false;
+        this.host = undefined;
+        this.url = undefined;
+        this.pendingEvents = [];
+        this.handlers.clear();
+        this.clusterNodes = [];
+        this.clusterIndex = -1;
+        this.glyphs = [];
+        this.connectRetries = 0;
+        this.openListeners.clear();
+        this.nextListenerId = 1;
+
+    }
+
+    /*
+     * Currently supported opts:
+     *  wsport: web socket port (other than default 8181)
+     *  host:   if defined, is the host address to use
+     */
+    createWebSocket(opts?: WsOptions, host?: string) {
+        this.webSockOpts = opts; // preserved for future calls
+        this.host = host === undefined ? this.window.location.host : host;
+        this.url = this.ufs.wsUrl('core', opts === undefined ? '' : opts['wsport'].toString(), host);
+
+        this.log.debug('Attempting to open websocket to: ' + this.url);
+        this.ws = this.wsock.newWebSocket(this.url);
+        if (this.ws) {
+            // fat arrow => syntax means that the 'this' context passed will
+            // be of WebSocketService, not the WebSocket
+            this.ws.onopen = (() => this.handleOpen());
+            this.ws.onmessage = ((msgEvent) => this.handleMessage(msgEvent));
+            this.ws.onclose = (() => this.handleClose());
+            const authToken = this.window['onosAuth'];
+            this.log.debug('Auth Token for opening WebSocket', authToken);
+            this.sendEvent('authentication', { token: authToken });
+        }
+        // Note: Wsock logs an error if the new WebSocket call fails
+        return this.url;
+    }
+
+    /**
+     * Tell the WebSocket to close - this should call the handleClose() method
+     */
+    closeWebSocket() {
+        this.ws.close();
+    }
+
+
+    /**
+     * Binds the message handlers to their message type (event type) as
+     *  specified in the given map. Note that keys are the event IDs; values
+     *  are either:
+     *     * the event handler function, or
+     *     * an API object which has an event handler for the key
+     */
+    bindHandlers(handlerMap: Map<string, (data) => void>): void {
+        const dups: string[] = [];
+
+        if (this.noHandlersWarn(handlerMap, 'bindHandlers')) {
+            return null;
+        }
+        for (const [eventId, api] of handlerMap) {
+            this.log.debug('Adding handler for ', eventId);
+            const fn = this.fs.isF(api) || this.fs.isF(api[eventId]);
+            if (!fn) {
+                this.log.warn(eventId + ' handler not a function');
+                return;
+            }
+
+            if (this.handlers.get(eventId)) {
+                dups.push(eventId);
+            } else {
+                this.handlers.set(eventId, fn);
+            }
+        }
+        if (dups.length) {
+            this.log.warn('duplicate bindings ignored:', dups);
+        }
+    }
+
+    /**
+     * Unbinds the specified message handlers.
+     *   Expected that the same map will be used, but we only care about keys
+     */
+    unbindHandlers(handlerIds: string[]): void {
+        if ( handlerIds.length === 0 ) {
+            this.log.warn('WSS.unbindHandlers(): no event handlers');
+            return null;
+        }
+        for (const eventId of handlerIds) {
+            this.handlers.delete(eventId);
+        }
+    }
+
+    isHandling(handlerId: string): boolean {
+        return this.handlers.get(handlerId) !== undefined;
+    }
+
+    /**
+     * Add a listener function for listening for WebSocket opening.
+     * The function must give a host and url and return void
+     */
+    addOpenListener(callback: (host: string, url: string) => void ): Callback {
+        const id: number = this.nextListenerId++;
+        const cb = this.fs.isF(callback);
+        const o: Callback = <Callback>{ id: id, cb: cb };
+
+        if (cb) {
+            this.openListeners.set(id, o);
+        } else {
+            this.log.error('WSS.addOpenListener(): callback not a function');
+            o.error = 'No callback defined';
+        }
+        return o;
+    }
+
+    /**
+     * Remove a listener of WebSocket opening
+     */
+    removeOpenListener(lsnr: Callback): void {
+        const id = this.fs.isO(lsnr) && lsnr.id;
+        let o;
+
+        if (!id) {
+            this.log.warn('WSS.removeOpenListener(): invalid listener', lsnr);
+            return null;
+        }
+        o = this.openListeners[id];
+
+        if (o) {
+            this.openListeners.delete(id);
+        }
+    }
+
+    /**
+     * Formulates an event message and sends it via the web-socket.
+     * If the websocket is not up yet, we store it in a pending list.
+     */
+    sendEvent(evType: string, payload: Object ): void {
+        const ev = <EventType> {
+            event: evType,
+            payload: payload
+        };
+
+        if (this.wsUp) {
+            this.send(ev);
+        } else {
+            this.pendingEvents.push(ev);
+        }
+    }
+
+    /**
+     * Binds the veil service as a delegate.
+     */
+    setVeilDelegate(vd: VeilComponent): void {
+        this.vcd = vd;
+    }
+
+    /**
+     * Binds the loading service as a delegate
+     */
+    setLoadingDelegate(ld: any): void {
+        // TODO - Investigate changing Loading Service to LoadingComponent
+        this.log.debug('Loading delegate set', ld);
+        this.lcd = ld;
+    }
+
+    isConnected(): boolean {
+        return this.wsUp;
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/wsock.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/wsock.service.ts
new file mode 100644
index 0000000..40e0b2a
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/remote/wsock.service.ts
@@ -0,0 +1,46 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { LogService } from '../log.service';
+
+/**
+ * ONOS GUI -- Remote -- Web Socket Wrapper Service
+ *
+ * This service provided specifically so that it can be mocked in unit tests.
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class WSock {
+
+  constructor(
+    private log: LogService,
+  ) {
+    this.log.debug('WSockService constructed');
+  }
+
+
+  newWebSocket(url) {
+      let ws = null;
+      try {
+          ws = new WebSocket(url);
+      } catch (e) {
+          this.log.error('Unable to create web socket:', e);
+      }
+      return ws;
+  }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyph.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyph.service.ts
new file mode 100644
index 0000000..56d62ab
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyph.service.ts
@@ -0,0 +1,208 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+import * as gds from './glyphdata.service';
+import * as d3 from 'd3';
+import { SvgUtilService } from './svgutil.service';
+
+// constants
+const msgGS = 'GlyphService.';
+const rg = 'registerGlyphs(): ';
+const rgs = 'registerGlyphSet(): ';
+
+/**
+ * ONOS GUI -- SVG -- Glyph Service
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class GlyphService {
+    // internal state
+    glyphs = d3.map();
+    api: Object;
+
+    constructor(
+        private fs: FnService,
+        //        private gd: GlyphDataService,
+        private log: LogService,
+        private sus: SvgUtilService
+    ) {
+        this.clear();
+        this.init();
+        this.api = {
+            registerGlyphs: this.registerGlyphs,
+            registerGlyphSet: this.registerGlyphSet,
+            ids: this.ids,
+            glyph: this.glyph,
+            glyphDefined: this.glyphDefined,
+            loadDefs: this.loadDefs,
+            addGlyph: this.addGlyph,
+        };
+        this.log.debug('GlyphService constructed');
+    }
+
+    warn(msg: string): void {
+        this.log.warn(msgGS + msg);
+    }
+
+    addToMap(key, value, vbox, overwrite: boolean, dups) {
+        if (!overwrite && this.glyphs.get(key)) {
+            dups.push(key);
+        } else {
+            this.glyphs.set(key, { id: key, vb: vbox, d: value });
+        }
+    }
+
+    reportDups(dups: string[], which: string): boolean {
+        const ok: boolean = (dups.length === 0);
+        const msg = 'ID collision: ';
+
+        if (!ok) {
+            dups.forEach((id) => {
+                this.warn(which + msg + '"' + id + '"');
+            });
+        }
+        return ok;
+    }
+
+    reportMissVb(missing: string[], which: string): boolean {
+        const ok: boolean = (missing.length === 0);
+        const msg = 'Missing viewbox property: ';
+
+        if (!ok) {
+            missing.forEach((vbk) => {
+                this.warn(which + msg + '"' + vbk + '"');
+            });
+        }
+        return ok;
+    }
+
+    clear() {
+        // start with a fresh map
+        this.glyphs = d3.map();
+    }
+
+    init() {
+        this.log.info('Registering glyphs');
+        this.registerGlyphs(gds.logos);
+        this.registerGlyphSet(gds.glyphDataSet);
+        this.registerGlyphSet(gds.badgeDataSet);
+        this.registerGlyphs(gds.spriteData);
+        this.registerGlyphSet(gds.mojoDataSet);
+        this.registerGlyphs(gds.extraGlyphs);
+    }
+
+    registerGlyphs(data: Map<string, string>, overwrite: boolean = false): boolean {
+        const dups: string[] = [];
+        const missvb: string[] = [];
+        for (const [key, value] of data.entries()) {
+            const vbk = '_' + key;
+            const vb = data.get(vbk);
+
+            if (key[0] !== '_') {
+                if (!vb) {
+                    missvb.push(vbk);
+                    continue;
+                }
+                this.addToMap(key, value, vb, overwrite, dups);
+            }
+        }
+        return this.reportDups(dups, rg) && this.reportMissVb(missvb, rg);
+    }
+
+    registerGlyphSet(data: Map<string, string>, overwrite: boolean = false): boolean {
+        const dups: string[] = [];
+        const vb: string = data.get('_viewbox');
+
+        if (!vb) {
+            this.warn(rgs + 'no "_viewbox" property found');
+            return false;
+        }
+
+        for (const [key, value] of data.entries()) {
+            //        angular.forEach(data, function (value, key) {
+            if (key[0] !== '_') {
+                this.addToMap(key, value, vb, overwrite, dups);
+            }
+        }
+        return this.reportDups(dups, rgs);
+    }
+
+    ids() {
+        return this.glyphs.keys();
+    }
+
+    glyph(id) {
+        return this.glyphs.get(id);
+    }
+
+    glyphDefined(id) {
+        return this.glyphs.has(id);
+    }
+
+
+    /**
+     * Load definitions of a glyph
+     *
+     * Note: defs should be a D3 selection of a single <defs> element
+     */
+    loadDefs(defs, glyphIds: string[], noClear: boolean) {
+        const list = this.fs.isA(glyphIds) || this.ids();
+
+        if (!noClear) {
+            // remove all existing content
+            defs.html(null);
+        }
+
+        // load up the requested glyphs
+        list.forEach((id) => {
+            const g = this.glyph(id);
+            if (g) {
+                if (noClear) {
+                    // quick exit if symbol is already present
+                    // TODO: check if this should be a continue or break instead
+                    if (defs.select('symbol#' + g.id).size() > 0) {
+                        return;
+                    }
+                }
+                defs.append('symbol')
+                    .attr('id', g.id)
+                    .attr('viewBox', g.vb)
+                    .append('path')
+                    .attr('d', g.d);
+            }
+        });
+    }
+
+    addGlyph(elem: any, glyphId: string, size: number, overlay: any, trans: any) {
+        const sz = size || 40,
+            ovr = !!overlay,
+            xns = this.fs.isA(trans),
+            atr = {
+                width: sz,
+                height: sz,
+                'class': 'glyph',
+                'xlink:href': '#' + glyphId,
+            };
+
+        if (xns) {
+            atr.class = this.sus.translate(trans);
+        }
+        return elem.append('use').attr(atr).classed('overlay', ovr);
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyphdata.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyphdata.service.ts
new file mode 100644
index 0000000..2ff3e85
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/glyphdata.service.ts
@@ -0,0 +1,1326 @@
+/*
+ *  Copyright 2018-present Open Networking Foundation
+ *
+ *  Licensed under the Apache License, Version 2.0 (the "License");
+ *  you may not use this file except in compliance with the License.
+ *  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { LogService } from '../log.service';
+
+
+// --- ONOS logo glyph ------------------------------------
+
+export const logos = new Map<string, string>([
+    [ '_bird', '352 224 113 112'],
+    [ 'bird', 'M427.7,300.4 c-6.9,0.6-13.1,5-19.2,7.1c-18.1,6.2-33.9,' +
+    '9.1-56.5,4.7c24.6,17.2,36.6,13,63.7,0.1c-0.5,0.6-0.7,1.3-1.3,' +
+    '1.9c1.4-0.4,2.4-1.7,3.4-2.2c-0.4,0.7-0.9,1.5-1.4,1.9c2.2-0.6,' +
+    '3.7-2.3,5.9-3.9c-2.4,2.1-4.2,5-6,8c-1.5,2.5-3.1,4.8-5.1,6.9c-1,' +
+    '1-1.9,1.9-2.9,2.9c-1.4,1.3-2.9,2.5-5.1,2.9c1.7,0.1,3.6-0.3,6.5' +
+    '-1.9c-1.6,2.4-7.1,6.2-9.9,7.2c10.5-2.6,19.2-15.9,25.7-18c18.3' +
+    '-5.9,13.8-3.4,27-14.2c1.6-1.3,3-1,5.1-0.8c1.1,0.1,2.1,0.3,3.2,' +
+    '0.5c0.8,0.2,1.4,0.4,2.2,0.8l1.8,0.9c-1.9-4.5-2.3-4.1-5.9-6c-2.3' +
+    '-1.3-3.3-3.8-6.2-4.9c-7.1-2.6-11.9,11.7-11.7-5c0.1-8,4.2-14.4,' +
+    '6.4-22c1.1-3.8,2.3-7.6,2.4-11.5c0.1-2.3,0-4.7-0.4-7c-2-11.2-8.4' +
+    '-21.5-19.7-24.8c-1-0.3-1.1-0.3-0.9,0c9.6,17.1,7.2,38.3,3.1,54.2' +
+    'C429.9,285.5,426.7,293.2,427.7,300.4z'],
+    [ '_cord', '0 0 110 110'],
+    [ 'cord', 'M92.5,62.3l-33,33,2.5,2.5c4.1,4.1,7.4,3.6,11.2-.1L95.9,75' +
+    'l-4.5-4.5,4.7-4.7-3.6-3.6Z' +
+    'm2.6,7L98.4,66l3.3,3.3-3.3,3.3-3.3-3.3Z' +
+    'M94.5,60l4.9-4.9,4.9,4.9-4.9,4.9Z' +
+    'M36.2,36.1L18.6,53.8c-7.8,7.8-5.8,17.4-2.4,22l-2.2-2.2' +
+    'c-10.6-10.6-11.2-20,0-31.2L28.2,28.1L31.3,25l8,8-3.1,3.1Z' +
+    'M55.5,55.4l3.6-3.6L66.9,44l-8-8l-2.5,2.5-5.2,5.2l-3.6,3.6' +
+    'L33.2,61.6C22,72.7,22.5,82.2,33.2,92.8L35.4,95' +
+    'c-3.4-4.5-5.4-14.1,2.4-22L55.5,55.4Z' +
+    'M50.7,21.7l-8-8L35,21.2l8,8,7.6-7.6Z' +
+    'M62.8,9.6L55.4,17l-8-8,7.4-7.4,8,8Z' +
+    'm0.7,18.3-7.6,7.6-8-8,7.6-7.6,8,8Z' +
+    'm26.1-6.6-8.1,8.1-8-8,8.1-8.1,8,8Z' +
+    'M79.3,31.5l-7.4,7.4-8-8,7.4-7.4,8,8Z' +
+    'M45.7,45.6L54.3,37l-8-8-8.6,8.6L23.4,51.8' +
+    'C12.2,63,12.8,72.4,23.4,83l2.2,2.2c-3.4-4.5-5.4-14.1,2.4-22Z' +
+    'M34.9,80.7l20.6,20.5c2,2,4.6,4.1,7.9,3.2-2.9,2.9-8.9,1.7-11.9-1.3' +
+    'L35.1,86.8,35,86.6H34.9l-0.8-.8' +
+    'a15,15,0,0,1,.1-1.9,14.7,14.7,0,0,1,.7-3.2Z' +
+    'm-0.6,7.4a21.3,21.3,0,0,0,5.9,11.7l5.7,5.7' +
+    'c3,3,9,4.1,11.9,1.3-3.3.9-5.9-1.2-7.9-3.2L34.3,88.1Z' +
+    'm3.5-12.4a16.6,16.6,0,0,0-2.3,3.6L57,100.8' +
+    'c3,3,9,4.1,11.9,1.3-3.3.9-5.9-1.2-7.9-3.2Z'],
+]);
+
+
+// --- Core glyphs ------------------------------------
+
+// NOTE: when adding glyphs, please also update GlyphConstants class.
+const tableFrame = 'M6.3,5.3h8.5v14.2h-8.5z' +
+        'M95.3,5.3h8.5v14.2h-8.5z' +
+        'M18.5,5.3h15.6v14.2h-15.6z' +
+        'M37.9,5.3h15.6v14.2h-15.6z' +
+        'M57,5.3h15.6v14.2h-15.6z' +
+        'M76.1,5.3h15.6v14.2h-15.6z' +
+        'M6.3,23.9h97.5v80.75h-97.5z';
+
+const rSquare = 'M10,20a10,10,0,0,1,10-10h70a10,10,0,0,1,10,10v70a10,10,' +
+        '0,0,1-10,10h-70a10,10,0,0,1-10-10z';
+
+const octagon = 'M10,35l25-25h40l25,25v40l-25,25h-40l-25-25z';
+
+const circle = 'M10,55A45,45,0,0,1,100,55A45,45,0,0,1,10,55';
+
+const arrowsLR = 'M58,26l12,0,0-8,18,13-18,13,0-8-12,0z' +
+        'M58,60l12,0,0-8,18,13-18,13,0-8-12,0z' +
+        'M52,40l-12,0,0-8-18,13,18,13,0-8,12,0z' +
+        'M52,74l-12,0,0-8-18,13,18,13,0-8,12,0z';
+
+const arrowsInHOutV = 'M20,50l12,0,0-8,18,13-18,13,0-8-12,0z' +
+        'M90,50l-12,0,0-8-18,13,18,13,0-8,12,0z' +
+        'M50,47l0-12-8,0,13-18,13,18-8,0,0,12z' +
+        'M50,63l0,12-8,0,13,18,13-18-8,0,0-12z';
+
+const laser = 'M47.2,68.4L31.1,84.5,25.6,79,41.7,62.9Z' +
+        'M76.3,30.6A3.4,3.4,0,0,0,72.9,34a3.3,3.3,0,0,0,.3,1.3L44.7,63.7' +
+        'l1.7,1.7L74.8,37a3.2,3.2,0,0,0,1.5.4A3.4,3.4,0,1,0,76.3,30.6Z' +
+        'm0.9-2.9V23.8a0.8,0.8,0,0,0-.8-0.8H76.1a0.8,0.8,0,0,0-.8.8v3.9' +
+        'a0.8,0.8,0,0,0,.8.8h0.3A0.8,0.8,0,0,0,77.2,27.7Z' +
+        'm3.5,3.2,3.6-3.6a0.9,0.9,0,0,0,0-1.2H84.3a0.9,0.9,0,0,0-1.2,0' +
+        'l-3.6,3.6a0.9,0.9,0,0,0,0,1.2h0.1A0.9,0.9,0,0,0,80.7,30.9Z' +
+        'm1.8,4h3.9a0.8,0.8,0,0,0,.8-0.8V33.7a0.8,0.8,0,0,0-.8-0.8H82.6' +
+        'a0.8,0.8,0,0,0-.8.8V34A0.8,0.8,0,0,0,82.6,34.8Z' +
+        'm-16.3.1h3.9a0.8,0.8,0,0,0,.8-0.8V33.8a0.8,0.8,0,0,0-.8-0.8' +
+        'H66.2a0.8,0.8,0,0,0-.8.8v0.3A0.8,0.8,0,0,0,66.2,34.9Z' +
+        'm6.8-5.2-3.8-3.8a0.9,0.9,0,0,0-1.3,0a0.9,0.9,0,0,0,0,1.3' +
+        'L71.8,31A0.9,0.9,0,0,0,73,31A0.9,0.9,0,0,0,73.1,29.7Z' +
+        'M84.8,40.9L80.9,37a0.9,0.9,0,0,0-1.3,0a0.9,0.9,0,0,0,0,1.3' +
+        'l3.9,3.9a0.9,0.9,0,0,0,1.3,0A0.9,0.9,0,0,0,84.8,40.9Z' +
+        'm-7.6,3.2V40.2a0.8,0.8,0,0,0-.8-0.8H76.2a0.8,0.8,0,0,0-.8.8' +
+        'v3.9a0.8,0.8,0,0,0,.8.8h0.3A0.8,0.8,0,0,0,77.3,44.1Z';
+
+const fiberStar = 'M89,60V57H70.6a15,15,0,0,1-3.2,7.6l13,12.9L82.8,75v7.5' +
+        'H75.2l2.2-2.2-12.8-13A14.9,14.9,0,0,1,57,70.6V89h3.1l-5.3,5.4' +
+        'L49.4,89H53V70.6a13.2,13.2,0,0,1-8-3.2l-13.1,13,2.3,2.3H26.5' +
+        'V75.1l2.3,2.3,13-12.8A15,15,0,0,1,38.7,57H21v3l-5.4-5.4L21,49.3' +
+        'V53H38.7a13.1,13.1,0,0,1,3.2-8l-13-13.1-2.2,2.1V26.4h7.5l-2.4,2.4' +
+        'L45,41.8a13.2,13.2,0,0,1,8-3.2V21H49.4l5.4-5.4L60.1,21H57V38.6' +
+        'a14.9,14.9,0,0,1,7.6,3.2l12.9-13-2.4-2.3h7.5v7.6l-2.3-2.3L67.4,45' +
+        'a13.1,13.1,0,0,1,3.2,8H89V49.3l5.4,5.3Z';
+
+export const glyphDataSet = new Map<string, string>([
+    ['_viewbox', '0 0 110 110'],
+
+    ['uiAttached', 'M91.9,16.7H18.1A5.3,5.3,0,0,0,12.8,22V68' +
+    'a5.3,5.3,0,0,0,5.3,5.3H91.9A5.3,5.3,0,0,0,97.2,68V22' +
+    'A5.3,5.3,0,0,0,91.9,16.7ZM91.6,65.2H18.4V22.3H91.6V65.2Z' +
+    'M71.5,87.5h3.8v5.9h-40.6v-5.9h3.8v-1.7h5.4v-9.7h22.3v9.7h5.3v1.7z'],
+
+    // Small dot
+    ['unknown', 'M35,40a5,5,0,0,1,5-5h30a5,5,0,0,1,5,5v30a5,5,0,0,1-5,5' +
+    'h-30a5,5,0,0,1-5-5z'],
+
+    // Question mark for unknown device types
+    ['query', 'M51.4,69.9c0-0.9,0-1.6,0-2.1c0-2.7,0.4-5.1,1.2-7.1' +
+    'c0.6-1.5,1.5-3,2.8-4.5c0.9-1.1,2.6-2.7,5.1-4.8c2.4-2.1,4-3.8,' +
+    '4.8-5.1 c0.7-1.3,1.1-2.6,1.1-4.1c0-2.7-1.1-5.1-3.2-7.1c-2.1-2' +
+    '-4.8-3.1-7.9-3.1c-3,0-5.5,0.9-7.5,2.8c-2,1.9-3.3,4.8-4,8.7l-7.2' +
+    '-0.8 c0.7-5.3,2.6-9.3,5.8-12.1c3.2-2.8,7.5-4.2,12.8-4.2c5.6,0,' +
+    '10.1,1.5,13.4,4.5c3.3,3,5,6.7,5,10.9c0,2.5-0.6,4.8-1.8,6.8 ' +
+    's-3.5,4.6-6.9,7.6c-2.3,2-3.8,3.5-4.5,4.4c-0.7,1-1.2,2-1.6,3.3' +
+    'c-0.3,1.2-0.5,3.2-0.6,6H51.4z M51,83.8v-7.9h8v7.9H51z'],
+
+
+    // --- ONOS cluster node ---
+    ['node', 'M15,100a5,5,0,0,1-5-5v-65a5,5,0,0,1,5-5h80a5,5,0,0,1,5,5' +
+    'v65a5,5,0,0,1-5,5zM14,22.5l11-11a10,3,0,0,1,10-2h40a10,3,0,0,1,' +
+    '10,2l11,11zM16,35a5,5,0,0,1,10,0a5,5,0,0,1-10,0z'],
+
+
+    // --- DEVICES ---
+    // See Device.DeviceType enum for the following...
+
+    // NOTE: 'other' should map to 'unknown' (.) above
+
+    // deprecated glyphs -- using Mojo Designs below -- m_*
+    ['switch', rSquare + arrowsLR],
+
+    ['router', circle + arrowsInHOutV],
+
+    ['roadm', octagon + arrowsLR],
+
+    ['otn', rSquare + laser],
+
+    ['roadm_otn', octagon + laser],
+
+    ['fiber_switch', rSquare + fiberStar],
+
+    ['microwave', 'M85,71.2c-8.9,10.5-29.6,8.7-45.3-3.5C23.9,55.4,19.8,' +
+    '37,28.6,26.5C29.9,38.6,71.5,69.9,85,71.2z M92.7,76.2M16.2,15 ' +
+    'M69.5,100.7v-4c0-1.4-1.2-2.2-2.6-2.2H19.3c-1.4,0-2.8,0.7-2.8,2.2' +
+    'v3.9c0,0.7,0.8,1,1.5,1h50.3C69,101.5,69.5,101.3,69.5,100.7z ' +
+    'M77.3,7.5l0,3.7c9,0.1,16.3,7.1,16.2,15.7l3.9,0C97.5,16.3,88.5,' +
+    '7.6,77.3,7.5z M77.6,14.7l0,2.5c5.3,0,9.7,4.2,9.6,9.3l2.6,0C89.9' +
+    ',20,84.4,14.7,77.6,14.7z M82.3,22.2c-1.3-1.2-2.9-1.9-4.7-1.9' +
+    'l0,1.2c1.4,0,2.8,0.6,3.8,1.5c1,1,1.6,2.3,1.6,3.7l1.3,0C84.3,25.1,' +
+    '83.6,23.4,82.3,22.2z M38.9,69.5l-5.1,23h16.5l-2.5-17.2C44.1,73.3,' +
+    '38.9,69.5,38.9,69.5zM58.1,54.1c13.7,10.1,26.5,16.8,29.2,13.7' +
+    'c2.7-3.1-5.6-13-19.3-24.4 M62.9,34.2 M62,37.9C47.7,27.3,33.7,20,' +
+    '31,23.1c-2.7,3.2,7,14.2,20.6,26 M73.9,25.7c-2.9,0.1-5.2,2.3-5.1,' +
+    '4.8c0,0.7,0.2,1.4,0.6,2l0,0L53.8,49.7l3.3,2.5L72.7,35l-0.4-0.3' +
+    'c0.6,0.2,1.3,0.3,1.9,0.3c2.9-0.1,5.2-2.3,5.1-4.9C79.3,27.6,76.8,' +
+    '25.6,73.9,25.7z'],
+
+    // NOTE: 'unrecognized' should map to 'query' (?) above
+
+
+    // --- HOSTS ---
+
+    // default glyph for a host
+    ['endstation', 'M10,15a5,5,0,0,1,5-5h65a5,5,0,0,1,5,5v80a5,5,0,0,1' +
+    '-5,5h-65a5,5,0,0,1-5-5zM87.5,14l11,11a3,10,0,0,1,2,10v40a3,10,' +
+    '0,0,1,-2,10l-11,11zM17,19a2,2,0,0,1,2-2h56a2,2,0,0,1,2,2v26a2,' +
+    '2,0,0,1-2,2h-56a2,2,0,0,1-2-2zM20,20h54v10h-54zM20,33h54v10h' +
+    '-54zM42,70a5,5,0,0,1,10,0a5,5,0,0,1-10,0z'],
+
+    ['bgpSpeaker', 'M10,40a45,35,0,0,1,90,0Q100,77,55,100Q10,77,10,40z' +
+    'M50,29l12,0,0-8,18,13-18,13,0-8-12,0zM60,57l-12,0,0-8-18,13,' +
+    '18,13,0-8,12,0z'],
+
+
+    // --- Miscellaneous glyphs ---------------------------------
+
+    ['chain', 'M60.4,77.6c-4.9,5.2-9.6,11.3-15.3,16.3c-8.6,7.5-20.4,6.8' +
+    '-28-0.8c-7.7-7.7-8.4-19.6-0.8-28.4c6.5-7.4,13.5-14.4,20.9-20.9' +
+    'c7.5-6.7,19.2-6.7,26.5-0.8c3.5,2.8,4.4,6.1,2.2,8.7c-2.7,3.1' +
+    '-5.5,2.5-8.5,0.3c-4.7-3.4-9.7-3.2-14,0.9C37.1,58.7,31,64.8,' +
+    '25.2,71c-4.2,4.4-4.2,10.6-0.6,14.3c3.7,3.7,9.7,3.7,14.3-0.4' +
+    'c2.9-2.5,5.3-5.5,8.3-8c1-0.9,3-1.1,4.4-0.9C54.8,76.3,57.9,77.1,' +
+    '60.4,77.6zM49.2,32.2c5-5.2,9.7-10.9,15.2-15.7c12.8-11,31.2' +
+    '-4.9,34.3,11.2C100,34.2,98.3,40.2,94,45c-6.7,7.4-13.7,14.6' +
+    '-21.2,21.2C65.1,73,53.2,72.7,46,66.5c-3.2-2.8-3.9-5.8-1.6-8.4' +
+    'c2.6-2.9,5.3-2.4,8.2-0.3c5.2,3.7,10,3.3,14.7-1.1c5.8-5.6,11.6' +
+    '-11.3,17.2-17.2c4.6-4.8,4.9-11.1,0.9-15c-3.9-3.9-10.1-3.4-15,' +
+    '1.2c-3.1,2.9-5.7,7.4-9.3,8.5C57.6,35.3,53,33,49.2,32.2z'],
+
+    ['crown', 'M99.5,21.6c0,3-2.3,5.4-5.1,5.4c-0.3,0-0.7,0-1-0.1c-1.8,' +
+    '4-4.8,10-7.2,17.3c-3.4,10.6-0.9,26.2,2.7,27.3C90.4,72,91.3,' +
+    '75,88,75H22.7c-3.3,0-2.4-3-0.9-3.5c3.6-1.1,6.1-16.7,2.7-27.3' +
+    'c-2.4-7.4-5.4-13.5-7.2-17.5c-0.5,0.2-1,0.3-1.6,0.3c-2.8,0' +
+    '-5.1-2.4-5.1-5.4c0-3,2.3-5.4,5.1-5.4c2.8,0,5.1,2.4,5.1,5.4c0,' +
+    '1-0.2,1.9-0.7,2.7c0.7,0.8,1.4,1.6,2.4,2.6c8.8,8.9,11.9,12.7,' +
+    '18.1,11.7c6.5-1,11-8.2,13.3-14.1c-2-0.8-3.3-2.7-3.3-5.1c0-3,' +
+    '2.3-5.4,5.1-5.4c2.8,0,5.1,2.4,5.1,5.4c0,2.5-1.6,4.5-3.7,5.2' +
+    'c2.3,5.9,6.8,13,13.2,14c6.2,1,9.3-2.7,18.1-11.7c0.7-0.7,1.4' +
+    '-1.5,2-2.1c-0.6-0.9-1-2-1-3.1c0-3,2.3-5.4,5.1-5.4C97.2,16.2,' +
+    '99.5,18.6,99.5,21.6zM92,87.9c0,2.2-1.7,4.1-3.8,4.1H22.4c' +
+    '-2.1,0-4.4-1.9-4.4-4.1v-3.3c0-2.2,2.3-4.5,4.4-4.5h65.8c2.1,' +
+    '0,3.8,2.3,3.8,4.5V87.9z'],
+
+    ['lock', 'M79.4,48.6h-2.7c0.2-5.7-0.2-20.4-7.9-28.8c-3.6-3.9-8.3' +
+    '-5.9-13.7-5.9c-5.4,0-10.2,2-13.8,5.9c-7.8,8.4-8.3,23.2-8.1,28.8' +
+    'h-2.7c-4.4,0-8,2.6-8,5.9v35.7c0,3.3,3.6,5.9,8,5.9h48.9c4.4,0,' +
+    '8-2.6,8-5.9V54.5C87.5,51.3,83.9,48.6,79.4,48.6z M48.1,26.1c1.9' +
+    '-2,4.1-2.9,7-2.9c2.9,0,5.1,0.9,6.9,2.9c5,5.4,5.6,17.1,5.4,22.6' +
+    'h-25C42.3,43.1,43.1,31.5,48.1,26.1z'],
+
+    ['topo', 'M97.2,76.3H86.6l-7.7-21.9H82c1,0,1.9-0.8,1.9-1.9V35.7c' +
+    '0-1-0.8-1.9-1.9-1.9H65.2c-1,0-1.9,0.8-1.9,1.9v2.6L33.4,26.1v-11' +
+    'c0-1-0.8-1.9-1.9-1.9H14.7c-1,0-1.9,0.8-1.9,1.9v16.8c0,1,0.8,' +
+    '1.9,1.9,1.9h16.8c1,0,1.9-0.8,1.9-1.9v-2.6l29.9,12.2v9L30.5,76.9' +
+    'c-0.3-0.3-0.8-0.5-1.3-0.5H12.4c-1,0-1.9,0.8-1.9,1.9V95c0,1,0.8,' +
+    '1.9,1.9,1.9h16.8c1,0,1.9-0.8,1.9-1.9v-6.9h47.4V95c0,1,0.8,1.9,' +
+    '1.9,1.9h16.8c1,0,1.9-0.8,1.9-1.9V78.2C99.1,77.2,98.2,76.3,97.2,' +
+    '76.3z M31.1,85.1v-4.9l32.8-26.4c0.3,0.3,0.8,0.5,1.3,0.5h10.5l' +
+    '7.7,21.9h-3c-1,0-1.9,0.8-1.9,1.9v6.9H31.1z'],
+
+    ['refresh',
+   'M99.7,53.8l-10,13.3L85,73.5,78,64,70.4,53.7h9' +
+   'A28.5,28.5,0,1,0,68.3,77.6l10.6,6.9A40.7,40.7,0,1,1,91.6,53.8h8.2Z'],
+
+    ['garbage', 'M55.1,31.1c9.4,0,18.7.1,28.1-.1,3.2-.1,4.2,1,3.7,4.1' +
+    'q-4.1,28.6-8,57.3c-0.3,2.3-1.3,3.4-3.5,3.4h-41' +
+    'c-2.2,0-2.9-1.2-3.2-3.2Q27,63.5,22.7,34.4c-0.4-2.8.6-3.4,3.1-3.4' +
+    'H55.1Z' +
+    'M44.3,81.9c0.4-1.1-2.5-27.4-3.8-40.5a3.2,3.2,0,0,0-3.7-3.2' +
+    'c-2.5.1-2.5,1.9-2.4,3.7,0.5,4.9,1,9.8,1.5,14.7,0.8,8.1,1.6,16.2,' +
+    '2.4,24.2,0.2,2.2,1.1,4.1,3.6,3.4A3.6,3.6,0,0,0,44.3,81.9Z' +
+    'm21.2,0a2.8,2.8,0,0,0,2.2,2.3' +
+    'c2.3,0.8,3.7-.7,4-3.1,1.3-12.9,2.6-25.7,3.8-38.6,0.2-2,.3-4.1-2.6-4.4' +
+    's-3.3,1.7-3.5,3.7C68.1,54.8,65.5,81.1,65.5,81.9Z' +
+    'M57.9,61.3q0-9.8,0-19.6c0-2.2-.8-3.6-3.2-3.5s-2.6,1.7-2.6,3.6' +
+    'q0,19.4,0,38.8c0,1.9,0,3.8,2.8,3.9s3-1.8,3-3.9Q57.9,70.9,57.9,61.3Z' +
+    'M19,24.7c0.3-2,.5-5.7,1.5-8a5.1,5.1,0,0,1,3.6-2.3' +
+    'c5.5-.5,17.3-0.8,17.3-0.8l4.3-3.3H62.9l5.6,3.5S84.5,14.6,87,15' +
+    's2.5,0.7,3.2,1.9,0.9,7.4.9,7.4Z'],
+
+    ['cog', 'M100.2,46.4L87.1,44.8l-2.1-5L93.1,29a2.3,2.3,0,0,0-.2-3' +
+    'l-8.7-8.8a2.4,2.4,0,0,0-3.1-.2l-11,7.9L66,23.1,63.1,9.5' +
+    'A2.1,2.1,0,0,0,60.8,8H49.3A2.1,2.1,0,0,0,47,9.5L44.2,22.7l-5,2.2' +
+    'L28.8,16.8a2.3,2.3,0,0,0-3.1.2l-9.2,9.2a2.4,2.4,0,0,0-.2,3.2' +
+    'l8.1,10.4-1.7,4.1L9.8,46.4A2.3,2.3,0,0,0,8,48.7V61.9' +
+    'a2.3,2.3,0,0,0,2,2.4L22.6,66l1.7,5.2-7.7,10a2.4,2.4,0,0,0,.2,3.2' +
+    'l9.1,9a2.4,2.4,0,0,0,3.3.1l9-8.2,4.8,2.2,2.6,12.7' +
+    'a2.3,2.3,0,0,0,2.4,1.9l13.9-.2a2.5,2.5,0,0,0,2.3-2.4' +
+    'l0.7-11.4,5.5-2.3,9.8,8.1a2.4,2.4,0,0,0,3.2-.1L93,83.9' +
+    'a2.4,2.4,0,0,0,.1-3.3L84.7,71,87,66l13.2-2.5a2.3,2.3,0,0,0,1.9-2.3' +
+    'l0.2-12.5A2.4,2.4,0,0,0,100.2,46.4ZM54.4,73' +
+    'A18.2,18.2,0,1,1,72.6,54.8,18.2,18.2,0,0,1,54.4,73Z'],
+
+    ['delta', 'M55,19.2L13.7,90.8h82.7L55,19.2z ' +
+    'M55,31.2l30.9,53.5H24.1L55,31.2z'],
+
+    ['nonzero', 'M76.7,25.1l7.8-13.5l-7.6-0.3l-5.7,9.9' +
+    'c-4.8-2.9-10.4-4.5-16.2-4.5c-19.1,0-34.7,17.2-34.7,38.4' +
+    'c0,12.5,5.4,23.6,13.7,30.6l-7.6,13.2l7.6,0.1l5.5-9.6' +
+    'c4.7,2.6,9.9,4,15.5,4c19.1,0,34.7-17.2,34.7-38.4' +
+    'C89.7,42.9,84.6,32.1,76.7,25.1z M27.9,55C27.9,38.4,40,25,55,25' +
+    'c4.4,0,8.5,1.2,12.2,3.2l-29,50.3C31.9,73,27.9,64.5,27.9,55z' +
+    'M55,85c-4.1,0-7.9-1-11.4-2.8l29-50.1c5.8,5.5,9.5,13.7,9.5,22.8' +
+    'C82.1,71.6,70,85,55,85z'],
+
+    ['download', 'M90.3,94.5H19.7V79.2H90.3V94.5Z' +
+    'm-49.1-79V44H26.2L55,72.3,83.8,44H68.9V15.5H41.1Z'],
+
+    ['upload', 'M90.3,79.4H19.7V94.6H90.3V79.4Z' +
+    'M41.1,71.8V43.5H26.2L55,15.4,83.8,43.5H68.9V71.8H41.1Z'],
+
+    // --- Navigation glyphs ------------------------------------
+
+    ['flowTable', tableFrame +
+    'M86,63.2c0,3.3-2.7,6-6,6c-2.8,0-5.1-1.9-5.8-' +
+    '4.5H63.3v5.1c0,0.9-0.7,1.5-1.5,1.5h-5.2v10.6c2.6,0.7,4.5,3,4.5,' +
+    '5.8c0,3.3-2.7,6-6,6c-3.3,0-6-2.7-6-6c0-2.8,1.9-5.1,4.4-5.8V71.3' +
+    'H48c-0.9,0-1.5-0.7-1.5-1.5v-5.1H36c-0.7,2.6-3,4.4-5.8,4.4c-3.3,' +
+    '0-6-2.7-6-6s2.7-6,6-6c2.8,0,5.2,1.9,5.8,4.5h10.5V56c0-0.9,0.7-' +
+    '1.5,1.5-1.5h5.5V43.8c-2.6-0.7-4.5-3-4.5-5.8c0-3.3,2.7-6,6-6s6,' +
+    '2.7,6,6c0,2.8-1.9,5.1-4.5,5.8v10.6h5.2c0.9,0,1.5,0.7,1.5,1.5v' +
+    '5.6h10.8c0.7-2.6,3-4.5,5.8-4.5C83.3,57.1,86,59.8,86,63.2z ' +
+    'M55.1,42.3c2.3,0,4.3-1.9,4.3-4.3c0-2.3-1.9-4.3-4.3-4.3' +
+    's-4.3,1.9-4.3,4.3C50.8,40.4,52.7,42.3,55.1,42.3z ' +
+    'M34.4,63.1c0-2.3-1.9-4.3-4.3-4.3s-4.3,1.9-4.3,4.3' +
+    's1.9,4.3,4.3,4.3S34.4,65.5,34.4,63.1z ' +
+    'M55.1,83.5c-2.3,0-4.3,1.9-4.3,4.3s1.9,4.3,4.3,4.3' +
+    's4.3-1.9,4.3-4.3S57.5,83.5,55.1,83.5z' +
+    'M84.2,63.2c0-2.3-1.9-4.3-4.3-4.3s-4.3,' +
+    '1.9-4.3,4.3s1.9,4.3,4.3,4.3S84.2,65.5,84.2,63.2z'],
+
+    ['portTable', tableFrame +
+    'M85.5,37.7c0-0.7-0.4-1.3-0.9-1.3H26.2c-0.5,0-' +
+    '0.9,0.6-0.9,1.3v34.6c0,0.7,0.4,1.3,0.9,1.3h11v9.6c0,1.1,0.5,2,' +
+    '1.2,2h9.1c0,0.2,0,0.3,0,0.5v3c0,1.1,0.5,2,1.2,2h13.5c0.6,0,1.2-' +
+    '0.9,1.2-2v-3c0-0.2,0-0.3,0-0.5h9.1c0.6,0,1.2-0.9,1.2-2v-9.6h11' +
+    'c0.5,0,0.9-0.6,0.9-1.3V37.7z M30.2,40h-1v8h1V40zM75.2,40h-2.1v8' +
+    'h2.1V40z M67.7,40h-2.1v8h2.1V40z M60.2,40h-2.1v8h2.1V40z M52.7,' +
+    '40h-2.1v8h2.1V40z M45.2,40h-2.1v8h2.1V40zM37.7,40h-2.1v8h2.1V40' +
+    'z M81.6,40h-1v8h1V40z'],
+
+    ['groupTable', tableFrame +
+    'M45.7,52.7c0.2-5.6,2.6-10.7,6.2-14.4c-2.6-1.5-5.7-2.5-8.9-2.5' +
+    'c-9.8,0-17.7,7.9-17.7,17.7c0,6.3,3.3,11.9,8.3,15' +
+    'C34.8,61.5,39.4,55.6,45.7,52.7z ' +
+    'M51.9,68.8c-3.1-3.1-5.2-7.2-6-11.7c-4.7,2.8-7.9,7.6-8.6,13.2' +
+    'c1.8,0.6,3.6,0.9,5.6,0.9C46.2,71.2,49.3,70.3,51.9,68.8z ' +
+    'M55.2,71.5c-3.5,2.4-7.7,3.7-12.2,3.7c-1.9,0-3.8-0.3-5.6-0.7' +
+    'C38.5,83.2,45.9,90,54.9,90c9,0,16.4-6.7,17.5-15.4' +
+    'c-1.6,0.4-3.4,0.6-5.1,0.6C62.8,75.2,58.6,73.8,55.2,71.5z ' +
+    'M54.9,50.6c1.9,0,3.8,0.3,5.6,0.7c-0.5-4.1-2.5-7.9-5.4-10.6' +
+    'c-2.9,2.7-4.8,6.4-5.3,10.5C51.5,50.8,53.2,50.6,54.9,50.6z ' +
+    'M49.7,55.4c0.5,4.3,2.4,8.1,5.4,10.9c2.9-2.8,4.9-6.6,5.4-10.8' +
+    'c-1.8-0.6-3.6-0.9-5.6-0.9C53.1,54.6,51.4,54.9,49.7,55.4z ' +
+    'M89,53.5c0-12-9.7-21.7-21.7-21.7c-4.5,0-8.7,1.4-12.2,3.7' +
+    'c-3.5-2.4-7.7-3.7-12.2-3.7c-12,0-21.7,9.7-21.7,21.7' +
+    'c0,8.5,4.9,15.9,12,19.4C33.6,84.6,43.2,94,54.9,94' +
+    'c11.7,0,21.2-9.3,21.7-20.9C84,69.7,89,62.2,89,53.5z ' +
+    'M64.3,57.3c-0.8,4.4-2.9,8.4-5.9,11.5c2.6,1.5,5.7,2.5,8.9,2.5' +
+    'c1.8,0,3.6-0.3,5.2-0.8C72,64.9,68.8,60.1,64.3,57.3z ' +
+    'M67.3,35.8c-3.3,0-6.3,0.9-8.9,2.5c3.7,3.8,6.1,8.9,6.2,14.6' +
+    'c6.1,3.1,10.6,8.9,11.7,15.8C81.5,65.6,85,60,85,53.5' +
+    'C85,43.8,77.1,35.8,67.3,35.8z'],
+
+    ['meterTable', tableFrame +
+    'M96.3,79.2c0-19.1-22.1-34.6-41.3-34.6S13.7,60.1,13.7,79.2' +
+    'H39.4c0-7.2,8.4-13.1,15.7-13.1S70.6,72,70.6,79.2H96.3z' +
+    'M48,65.6L36.8,53c0-.5-1.5.5-1.4,0.7l5.3,16.6z'],
+
+    ['pipeconfTable', tableFrame +
+    'M10,66h13v3h-13z' +
+    'M23,62.5L28,67.5L23,72.5z' +
+    'M30,55h12.5v25h-12.5z' +
+    'M45,66h13v3h-13z' +
+    'M58,62.5L63,67.5L58,72.5z' +
+    'M65,55h12.5v25h-12.5z' +
+    'M79,66h15v3h-15z' +
+    'M94,62.5L99,67.5L94,72.5z'],
+
+    // --- Topology toolbar specific glyphs ----------------------
+
+    ['summary', 'M95.8,9.2H14.2c-2.8,0-5,2.2-5,5v81.5c0,2.8,2.2,5,5,' +
+    '5h81.5c2.8,0,5-2.2,5-5V14.2C100.8,11.5,98.5,9.2,95.8,9.2z ' +
+    'M16.7,22.2c0-1.1,0.9-2,2-2h20.1c1.1,0,2,0.9,2,2v20.1c0,1.1-0.9,' +
+    '2-2,2H18.7c-1.1,0-2-0.9-2-2V22.2z M93,87c0,1.1-0.9,2-2,2H18.9' +
+    'c-1.1,0-2-0.9-2-2v-7c0-1.1,0.9-2,2-2H91c1.1,0,2,0.9,2,2V87z ' +
+    'M93,65c0,1.1-0.9,2-2,2H18.9c-1.1,0-2-0.9-2-2v-7c0-1.1,0.9-2,' +
+    '2-2H91c1.1,0,2,0.9,2,2V65z'],
+
+    ['details', 'M95.8,9.2H14.2c-2.8,0-5,2.2-5,5v81.5c0,2.8,2.2,5,5,' +
+    '5h81.5c2.8,0,5-2.2,5-5V14.2C100.8,11.5,98.5,9.2,95.8,9.2z M16.9,' +
+    '22.2c0-1.1,0.9-2,2-2H91c1.1,0,2,0.9,2,2v7c0,1.1-0.9,2-2,2H18.9c' +
+    '-1.1,0-2-0.9-2-2V22.2z M93,87.8c0,1.1-0.9,2-2,2H18.9c-1.1,' +
+    '0-2-0.9-2-2v-7c0-1.1,0.9-2,2-2H91c1.1,0,2,0.9,2,2V87.8z M93,68.2' +
+    'c0,1.1-0.9,2-2,2H18.9c-1.1,0-2-0.9-2-2v-7c0-1.1,0.9-2,2-2H91' +
+    'c1.1,0,2,0.9,2,2V68.2z M93,48.8c0,1.1-0.9,2-2,2H19c-1.1,0-2-' +
+    '0.9-2-2v-7c0-1.1,0.9-2,2-2H91c1.1,0,2,0.9,2,2V48.8z'],
+
+    ['ports', 'M98,9.2H79.6c-1.1,0-2.1,0.9-2.1,2.1v17.6l-5.4,5.4c-1.7' +
+    '-1.1-3.8-1.8-6-1.8c-6,0-10.9,4.9-10.9,10.9c0,2.2,0.7,4.3,1.8,6' +
+    'l-7.5,7.5c-1.8-1.2-3.9-1.9-6.2-1.9c-6,0-10.9,4.9-10.9,10.9c0,' +
+    '2.3,0.7,4.4,1.9,6.2l-6.2,6.2H11.3c-1.1,0-2.1,0.9-2.1,2.1v18.4' +
+    'c0,1.1,0.9,2.1,2.1,2.1h18.4c1.1,0,2.1-0.9,2.1-2.1v-16l7-6.9' +
+    'c1.4,0.7,3,1.1,4.7,1.1c6,0,10.9-4.9,10.9-10.9c0-1.7-0.4-3.3-' +
+    '1.1-4.7l8-8c1.5,0.7,3.1,1.1,4.8,1.1c6,0,10.9-4.9,10.9-10.9c0' +
+    '-1.7-0.4-3.4-1.1-4.8l6.9-6.9H98c1.1,0,2.1-0.9,2.1-2.1V11.3' +
+    'C100.1,10.2,99.2,9.2,98,9.2z M43.4,72c-3.3,0-6-2.7-6-6s2.7-6,' +
+    '6-6s6,2.7,6,6S46.7,72,43.4,72z M66.1,49.5c-3.3,0-6-2.7-6-6' +
+    'c0-3.3,2.7-6,6-6s6,2.7,6,6C72.2,46.8,69.5,49.5,66.1,49.5z'],
+
+    ['map', 'M95.8,9.2H14.2c-2.8,0-5,2.2-5,5v66c0.3-1.4,0.7-2.8,' +
+    '1.1-4.1l1.6,0.5c-0.9,2.4-1.6,4.8-2.2,7.3l-0.5-0.1v12c0,2.8,2.2,' +
+    '5,5,5h81.5c2.8,0,5-2.2,5-5V14.2C100.8,11.5,98.5,9.2,95.8,9.2z ' +
+    'M16.5,67.5c-0.4,0.5-0.7,1-1,1.5c-0.3,0.5-0.6,1-0.9,1.6l-1.9-0.9' +
+    'c0.3-0.6,0.6-1.2,0.9-1.8c0.3-0.6,0.6-1.2,1-1.7c0.7-1.1,1.5-2.2,' +
+    '2.5-3.2l1.8,1.8C18,65.6,17.2,66.5,16.5,67.5z M29.7,64.1' +
+    'c-0.4-0.4-0.8-0.8-1.2-1.1c-0.1-0.1-0.2-0.1-0.2-0.1c0,0-0.1,' +
+    '0-0.1-0.1l-0.1,0l0,0l-0.1,0c-0.3-0.1-0.5-0.2-0.8-0.2c-0.5-0.1' +
+    '-1.1-0.2-1.6-0.3c-0.6,0-1.1,0-1.6,0l-0.4-2.8c0.7-0.1,1.5-0.2,2.2' +
+    '-0.1c0.7,0,1.4,0.1,2.2,0.3c0.4,0.1,0.7,0.2,1,0.3l0.1,0l0,0l0.1,' +
+    '0l0.1,0c0.1,0,0.1,0,0.3,0.1c0.3,0.1,0.5,0.2,0.7,0.4c0.7,0.5,' +
+    '1.2,0.9,1.7,1.4L29.7,64.1z M39.4,74.7c-1.8-1.8-3.6-3.8-5.3-5.7' +
+    'l2.6-2.4c0.9,0.9,1.8,1.8,2.7,2.7c0.9,0.9,1.8,1.7,2.7,2.6L39.4,' +
+    '74.7z M50.8,84.2c-1.1-0.7-2.2-1.5-3.3-2.3c-0.5-0.4-1.1-0.8-1.6' +
+    '-1.2c-0.5-0.4-1-0.8-1.5-1.2l2.7-3.4c0.5,0.4,1,0.8,1.5,1.1c0.5,' +
+    '0.3,1,0.7,1.5,1c1,0.7,2.1,1.3,3.1,1.9L50.8,84.2z M61.3,' +
+    '88.7c-0.7-0.1-1.4-0.3-2.1-0.5c-0.7-0.2-1.4-0.5-2-0.7l1.8' +
+    '-4.8c0.6,0.2,1.1,0.4,1.6,0.5c0.5,0.2,1.1,0.3,1.6,0.4c1,0.2,2.1,' +
+    '0.2,3,0.1l0.7,5.1C64.3,89.1,62.7,88.9,61.3,88.7z M75.1,80.4c' +
+    '-0.2,0.7-0.5,1.4-0.9,2c-0.2,0.3-0.3,0.7-0.5,1l-0.3,0.5l-0.3,' +
+    '0.4l-3.9-2.8l0.3-0.4l0.2-0.3c0.1-0.2,0.3-0.4,0.4-0.7c0.3-0.5,' +
+    '0.5-0.9,0.7-1.5c0.4-1,0.8-2.1,1.1-3.3l4.2,0.9C75.9,77.7,75.6,' +
+    '79,75.1,80.4z M73,69.2l0.2-1.9l0.1-1.9c0.1-1.2,0.1-2.5,0.1-' +
+    '3.8l2.5-0.2c0.2,1.3,0.4,2.6,0.5,3.9l0.1,2l0.1,2L73,69.2z ' +
+    'M73,51l0.5-0.1c0.4,1.3,0.8,2.6,1.1,3.9L73.2,55C73.1,53.7,73.1,' +
+    '52.3,73,51z M91.9,20.4c-0.7,1.4-3.6,3.6-4.2,3.9c-1.5,0.8-5,' +
+    '2.8-10.1,7.7c3,2.9,5.8,5.4,7.3,6.4c2.6,1.8,3.4,4.3,3.6,6.1c0.1,' +
+    '1.1-0.1,2.5-0.4,3c-0.5,0.9-1.6,2-3,1.4c-2-0.8-11.5-9.6-13-11c' +
+    '-3.5,3.9-7.4,8.9-11.7,15.1c0,0-3.1,3.4-5.2,0.9C52.9,51.5,61,' +
+    '39.3,61,39.3s2.2-3.1,5.6-7c-2.9-3-5.9-6.3-6.6-7.3c0,0-3.7-5-1.3' +
+    '-6.6c3.2-2.1,6.3,0.8,6.3,0.8s3.1,3.3,7,7.2c4.7-4.7,10.1-9.2,' +
+    '14.7-10c0,0,3.3-1,5.2,1.7C92.5,18.8,92.4,19.6,91.9,20.4z'],
+
+    ['cycleLabels', 'M72.5,33.9c0,0.6-0.2,1-0.5,1H40c-0.3,0-0.5-0.4' +
+    '-0.5-1V20.7c0-0.6,0.2-1,0.5-1h32c0.3,0,0.5,0.4,0.5,1V33.9z ' +
+    'M41.2,61.8c0-0.6-0.2-1-0.5-1h-32c-0.3,0-0.5,0.4-0.5,1V75c0,0.6,' +
+    '0.2,1,0.5,1h32c0.3,0,0.5-0.4,0.5-1V61.8z M101.8,61.8c0-0.6-0.2' +
+    '-1-0.5-1h-32c-0.3,0-0.5,0.4-0.5,1V75c0,0.6,0.2,1,0.5,1h32c0.3,' +
+    '0,0.5-0.4,0.5-1V61.8z M17.2,52.9c0-0.1-0.3-7.1,4.6-13.6l-2.4-1.8' +
+    'c-5.4,7.3-5.2,15.2-5.1,15.5L17.2,52.9z M12.7,36.8l7.4,2.5l1.5,' +
+    '7.6L29.5,31L12.7,36.8z M94.2,42.3c-2.1-8.9-8.3-13.7-8.6-13.9l' +
+    '-1.8,2.4c0.1,0,5.6,4.3,7.5,12.2L94.2,42.3z M99,37.8l-6.6,4.1l' +
+    '-6.8-3.7l7.1,16.2L99,37.8z M69,90.2l-1.2-2.8c-0.1,0-6.6,2.8' +
+    '-14.3,0.6l-0.8,2.9c2.5,0.7,4.9,1,7,1C65,91.8,68.7,90.2,69,90.2z ' +
+    'M54.3,97.3L54,89.5l6.6-4.1l-17.6-1.7L54.3,97.3z'],
+
+    ['oblique', 'M80.9,30.2h4.3l15-16.9H24.8l-15,16.9h19v48.5h-4l-15,' +
+    '16.9h75.3l15-16.9H80.9V30.2z M78.6,78.7H56.1V30.2h22.5V78.7z' +
+    'M79.7,17.4c2.4,0,4.3,1.9,4.3,4.3c0,2.4-1.9,4.3-4.3,4.3s-4.3' +
+    '-1.9-4.3-4.3C75.4,19.3,77.4,17.4,79.7,17.4z M55,17.4c2.4,0,' +
+    '4.3,1.9,4.3,4.3c0,2.4-1.9,4.3-4.3,4.3s-4.3-1.9-4.3-4.3C50.7,' +
+    '19.3,52.6,17.4,55,17.4z M26.1,21.7c0-2.4,1.9-4.3,4.3-4.3c2.4,' +
+    '0,4.3,1.9,4.3,4.3c0,2.4-1.9,4.3-4.3,4.3C28,26,26.1,24.1,26.1,' +
+    '21.7z M31.1,30.2h22.6v48.5H31.1V30.2z M30.3,91.4c-2.4,0-4.3' +
+    '-1.9-4.3-4.3c0-2.4,1.9-4.3,4.3-4.3c2.4,0,4.3,1.9,4.3,4.3C34.6,' +
+    '89.5,32.7,91.4,30.3,91.4z M54.9,91.4c-2.4,0-4.3-1.9-4.3-4.3c0' +
+    '-2.4,1.9-4.3,4.3-4.3c2.4,0,4.3,1.9,4.3,4.3C59.2,89.5,57.3,' +
+    '91.4,54.9,91.4z M84,87.1c0,2.4-1.9,4.3-4.3,4.3c-2.4,0-4.3-1.9' +
+    '-4.3-4.3c0-2.4,1.9-4.3,4.3-4.3C82.1,82.8,84,84.7,84,87.1z'],
+
+    ['filters', 'M24.8,13.3L9.8,40.5h75.3l15.0-27.2H24.8z M72.8,32.1l-' +
+    '9.7-8.9l-19.3,8.9l-6.0-7.4L24.1,30.9l-1.2-2.7l15.7-7.1l6.0,7.4' +
+    'l19.0-8.8l9.7,8.8l11.5-5.6l1.3,2.7L72.8,32.1zM24.3,68.3L9.3,' +
+    '95.5h75.3l15.0-27.2H24.3z M84.3,85.9L70.7,79.8l-6.0,7.4l-19.3' +
+    '-8.9l-9.7,8.9l-13.3-6.5l1.3-2.7l11.5,5.6l9.7-8.8l19.0,8.8l6.0' +
+    '-7.4l15.7,7.1L84.3,85.9z M15.3,57h-6v-4h6V57zM88.1,57H76.0v-4h' +
+    '12.1V57z M69.9,57H57.8v-4h12.1V57z M51.7,57H39.6v-4H51.7V57z ' +
+    'M33.5,57H21.4v-4h12.1V57zM100.2,57h-6v-4h6V57z'],
+
+    ['resetZoom', 'M86,79.8L61.7,54.3c1.8-2.9,2.8-6.3,2.9-10c0.3-11.2' +
+    '-8.6-20.5-19.8-20.8C33.7,23.2,24.3,32,24.1,43.2c-0.3,11.2,8.6,' +
+    '20.5,19.8,20.8c4,0.1,8.9-0.8,11.9-3.6l23.7,25c1.5,1.6,4,2.3,' +
+    '5.3,1l1.6-1.6C87.7,83.7,87.5,81.4,86,79.8z M31.4,43.4c0.2-7.1,' +
+    '6.1-12.8,13.2-12.6C51.8,31,57.5,37,57.3,44.1c-0.2,7.1-6.1,12.8' +
+    '-13.2,12.6C36.9,56.5,31.3,50.6,31.4,43.4zM22.6,104H6V86.4c0' +
+    '-1.7,1.4-3.1,3.1-3.1s3.1,1.4,3.1,3.1v11.4h10.4c1.7,0,3.1,1.4,' +
+    '3.1,3.1S24.3,104,22.6,104z M25.7,9.1c0,1.7-1.4,3.1-3.1,3.1' +
+    'H12.2v11.4c0,1.7-1.4,3.1-3.1,3.1S6,25.3,6,23.6V6h16.6C24.3,6,' +
+    '25.7,7.4,25.7,9.1z M84.3,100.9c0-1.7,1.4-3.1,3.1-3.1h10.4V86.4' +
+    'c0-1.7,1.4-3.1,3.1-3.1s3.1,1.4,3.1,3.1V104H87.4C85.7,104,84.3,' +
+    '102.6,84.3,100.9z M87.4,6H104v17.6c0,1.7-1.4,3.1-3.1,3.1s-3.1' +
+    '-1.4-3.1-3.1V12.2H87.4c-1.7,0-3.1-1.4-3.1-3.1S85.7,6,87.4,6z'],
+
+    ['relatedIntents', 'M99.9,43.7v22.6c0,1.9-1.5,3.4-3.4,3.4H73.9c' +
+    '-1.9,0-3.4-1.5-3.4-3.4V43.7c0-1.9,1.5-3.4,3.4-3.4h22.6C98.4,' +
+    '40.3,99.9,41.8,99.9,43.7z M48.4,46.3l6.2,6.7h-4.6L38.5,38v9.7' +
+    'l4.7,5.3H10.1V57h33.2l-4.8,5.3v9.5L49.8,57h5.1v0l-6.5,7v11.5' +
+    'L64.1,55L48.4,34.4V46.3z'],
+
+    ['nextIntent', 'M88.1,55.7L34.6,13.1c0,0-1.6-0.5-2.1-0.2c-1.9,1.2' +
+    '-6.5,13.8-3.1,17.2c7,6.9,30.6,24.5,32.4,25.9c-1.8,1.4-25.4,19' +
+    '-32.4,25.9c-3.4,3.4,1.2,16,3.1,17.2c0.6,0.4,2.1-0.2,2.1-0.2' +
+    's53.1-42.4,53.5-42.7C88.5,56,88.1,55.7,88.1,55.7z'],
+
+    ['prevIntent', 'M22.5,55.6L76,12.9c0,0,1.6-0.5,2.2-0.2c1.9,1.2,' +
+    '6.5,13.8,3.1,17.2c-7,6.9-30.6,24.5-32.4,25.9c1.8,1.4,25.4,19,' +
+    '32.4,25.9c3.4,3.4-1.2,16-3.1,17.2c-0.6,0.4-2.2-0.2-2.2-0.2' +
+    'S22.9,56.3,22.5,56C22.2,55.8,22.5,55.6,22.5,55.6z'],
+
+    ['intentTraffic', 'M14.7,71.5h-6v-33h6V71.5z M88.5,38.5H76.9v33' +
+    'h11.7V38.5z M70.1,38.5H58.4v33h11.7V38.5z M51.6,38.5H39.9v33' +
+    'h11.7V38.5z M33.1,38.5H21.5v33h11.7V38.5z M101.3,38.5h-6v33h6' +
+    'V38.5z'],
+
+    ['allTraffic', 'M15.7,64.5h-7v-19h7V64.5z M78.6,45.5H62.9v19h15.7' +
+    'V45.5z M47.1,45.5H31.4v19h15.7V45.5z M101.3,45.5h-7v19h7V45.5z' +
+    'M14.7,14.1h-6v19h6V14.1z M88.5,14.1H76.9v19h11.7V14.1z M70.1,' +
+    '14.1H58.4v19h11.7V14.1z M51.6,14.1H39.9v19h11.7V14.1z M33.1,14.1' +
+    'H21.5v19h11.7V14.1z M101.3,14.1h-6v19h6V14.1z M14.7,76.9h-6v19' +
+    'h6V76.9z M88.5,76.9H76.9v19h11.7V76.9z M70.1,76.9H58.4v19h11.7' +
+    'V76.9z M51.6,76.9H39.9v19h11.7V76.9z M33.1,76.9H21.5v19h11.7' +
+    'V76.9z M101.3,76.9h-6v19h6V76.9z'],
+
+    ['flows', 'M93.8,46.1c-4.3,0-8,3-9,7H67.9v-8.8c0-1.3-1.1-2.4-2.4' +
+    '-2.4h-8.1V25.3c4-1,7-4.7,7-9.1c0-5.2-4.2-9.4-9.4-9.4c-5.2,0' +
+    '-9.4,4.2-9.4,9.4c0,4.3,3,8,7,9v16.5H44c-1.3,0-2.4,1.1-2.4,2.4' +
+    'v8.8H25.3c-1-4.1-4.7-7.1-9.1-7.1c-5.2,0-9.4,4.2-9.4,9.4s4.2,' +
+    '9.4,9.4,9.4c4.3,0,8-2.9,9-6.9h16.4v7.9c0,1.3,1.1,2.4,2.4,2.4' +
+    'h8.6v16.6c-4,1.1-6.9,4.7-6.9,9c0,5.2,4.2,9.4,9.4,9.4c5.2,0,' +
+    '9.4-4.2,9.4-9.4c0-4.4-3-8-7.1-9.1V68.2h8.1c1.3,0,2.4-1.1,2.4' +
+    '-2.4v-7.9h16.8c1.1,4,4.7,7,9,7c5.2,0,9.4-4.2,9.4-9.4S99,46.1,' +
+    '93.8,46.1z M48.7,16.3c0-3.5,2.9-6.4,6.4-6.4c3.5,0,6.4,2.9,6.4,' +
+    '6.4s-2.9,6.4-6.4,6.4C51.5,22.6,48.7,19.8,48.7,16.3zM16.2,61.7c' +
+    '-3.5,0-6.4-2.9-6.4-6.4c0-3.5,2.9-6.4,6.4-6.4s6.4,2.9,6.4,6.4' +
+    'C22.6,58.9,19.7,61.7,16.2,61.7z M61.4,93.7c0,3.5-2.9,6.4-6.4,' +
+    '6.4c-3.5,0-6.4-2.9-6.4-6.4c0-3.5,2.9-6.4,6.4-6.4C58.6,87.4,' +
+    '61.4,90.2,61.4,93.7z M93.8,61.8c-3.5,0-6.4-2.9-6.4-6.4c0-3.5,' +
+    '2.9-6.4,6.4-6.4s6.4,2.9,6.4,6.4C100.1,58.9,97.3,61.8,93.8,61.8z'],
+
+    ['eqMaster', 'M100.1,46.9l-10.8-25h0.2c0.5,0,0.8-0.5,0.8-1.1v-3.2' +
+    'c0-0.6-0.4-1.1-0.8-1.1H59.2v-5.1c0-0.5-0.8-1-1.7-1h-5.1c-0.9,0' +
+    '-1.7,0.4-1.7,1v5.1l-30.2,0c-0.5,0-0.8,0.5-0.8,1.1v3.2c0,0.6,' +
+    '0.4,1.1,0.8,1.1h0.1l-10.8,25C9,47.3,8.4,48,8.4,48.8v1.6l0,0h0' +
+    'v6.4c0,1.3,1.4,2.3,3.2,2.3h21.7c1.8,0,3.2-1,3.2-2.3v-8c0-0.9' +
+    '-0.7-1.6-1.7-2L22.9,21.9h27.9v59.6l-29,15.9c0,1.2,1.8,2.2,4.1,' +
+    '2.2h58.3c2.3,0,4.1-1,4.1-2.2l-29-15.9V21.9h27.8L75.2,46.8c-1,' +
+    '0.4-1.7,1.1-1.7,2v8c0,1.3,1.4,2.3,3.2,2.3h21.7c1.8,0,3.2-1,3.2' +
+    '-2.3v-8C101.6,48,101,47.3,100.1,46.9z M22,23.7l10.8,22.8H12.1' +
+    'L22,23.7z M97.9,46.5H77.2L88,23.7L97.9,46.5z'],
+
+    ['xClose', 'M20,8l35,35,35-35,12,12-35,35,35,35-12,12-35-35-35,35' +
+    '-12-12,35-35-35-35,12-12Z'],
+]);
+
+export const badgeDataSet = new Map<string, string>([
+    ['_viewbox', '0 0 10 10'],
+
+    ['checkMark', 'M8.6,3.4L4.4,7.7L1.4,4.7L2.5,3.6L4.4,5.5L7.5,2.3L8.6,3.4Z'],
+
+    ['xMark', 'M7.8,6.7L6.7,7.8,5,6.1,3.3,7.8,2.2,6.7,3.9,5,2.2,3.3,3.3,' +
+    '2.2,5,3.9,6.7,2.2,7.8,3.3,6.1,5Z'],
+
+    ['triangleUp', 'M0.5,6.2c0,0,3.8-3.8,4.2-4.2C5,1.7,5.3,2,5.3,2l4.3,' +
+    '4.3c0,0,0.4,0.4-0.1,0.4c-1.7,0-8.2,0-8.8,0C0,6.6,0.5,6.2,0.5,6.2z'],
+
+    ['triangleDown', 'M9.5,4.2c0,0-3.8,3.8-4.2,4.2c-0.3,0.3-0.5,0-0.5,' +
+    '0L0.5,4.2c0,0-0.4-0.4,0.1-0.4c1.7,0,8.2,0,8.8,0C10,3.8,9.5,4.2,' +
+    '9.5,4.2z'],
+
+    ['plus', 'M4,2h2v2h2v2h-2v2h-2v-2h-2v-2h2z'],
+
+    ['minus', 'M2,4h6v2h-6z'],
+
+    ['play', 'M3,1.5l3.5,3.5l-3.5,3.5z'],
+
+    ['stop', 'M2.5,2.5h5v5h-5z'],
+]);
+
+export const spriteData = new Map<string, string>([
+    ['_cloud', '0 0 110 110'],
+    ['cloud', 'M37.6,79.5c-6.9,8.7-20.4,8.6-22.2-2.7' +
+    'M16.3,41.2c-0.8-13.9,19.4-19.2,23.5-7.8' +
+    'M38.9,30.9c5.1-9.4,15.1-8.5,16.9-1.3' +
+    'M54.4,32.9c4-12.9,14.8-9.6,18.6-3.8' +
+    'M95.8,58.5c10-4.1,11.7-17.8-0.9-19.8' +
+    'M18.1,76.4C5.6,80.3,3.8,66,13.8,61.5' +
+    'M16.2,62.4C2.1,58.4,3.5,36,16.8,36.6' +
+    'M93.6,74.7c10.2-2,10.7-14,5.8-18.3' +
+    'M71.1,79.3c11.2,7.6,24.6,6.4,22.1-11.7' +
+    'M36.4,76.8c3.4,13.3,35.4,11.6,36.1-1.4' +
+    'M70.4,31c11.8-10.4,26.2-5.2,24.7,10.1'],
+]);
+
+
+    // --- Mojo Re-Design ---------------------------------------
+const m_octagon = 'M33.5,91.9a1.8,1.8,0,0,1-1.3-.5L8.7,68a1.8,1.8,0,0,' +
+    '1-.5-1.3V33.5a1.8,1.8,0,0,1,.5-1.3L32,8.7a1.8,1.8,0,0,1,1.3-.5' +
+    'H66.5a1.8,1.8,0,0,1,1.3.5L91.3,32a1.8,1.8,0,0,1,.5,1.3V66.5' +
+    'a1.8,1.8,0,0,1-.5,1.3L68,91.3a1.8,1.8,0,0,1-1.3.5H33.5Z' +
+    'm-21.7-26L34.3,88.2H65.9L88.2,65.7V34.1L65.7,11.8H34.1' +
+    'L11.8,34.3V65.9Z';
+
+const m_switch_arrows = 'M60,42.1l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V33.8' +
+    'a1.8,1.8,0,0,1,3.7,0v3.3l13-7.1L61.9,23v3.3' +
+    'A1.8,1.8,0,0,1,60,28.2h-7v3.7h1.7a1.8,1.8,0,0,1,0,3.7H51.2' +
+    'a1.8,1.8,0,0,1-1.8-1.8V26.4a1.8,1.8,0,0,1,1.8-1.8h7V20' +
+    'a1.8,1.8,0,0,1,2.7-1.6l18.7,10a1.8,1.8,0,0,1,0,3.2L60.9,41.8Z' +
+    'M60,69.2l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V60.9a1.8,1.8,0,0,1,3.7,0' +
+    'v3.3l13-7.1-13-6.9v3.3A1.8,1.8,0,0,1,60,55.3h-7V59h1.7' +
+    'a1.8,1.8,0,0,1,0,3.7H51.2a1.8,1.8,0,0,1-1.8-1.8V53.5' +
+    'a1.8,1.8,0,0,1,1.8-1.8h7V47.1a1.8,1.8,0,0,1,2.7-1.6l18.7,10' +
+    'a1.8,1.8,0,0,1,0,3.2L60.9,69ZM40,54.8l-0.9-.2L20.4,44.2' +
+    'a1.8,1.8,0,0,1,0-3.2L39.1,31a1.8,1.8,0,0,1,2.7,1.6v4.5h7' +
+    'A1.8,1.8,0,0,1,50.6,39v7.4a1.8,1.8,0,0,1-1.8,1.8H45.2' +
+    'a1.8,1.8,0,0,1,0-3.7h1.7V40.9H40A1.8,1.8,0,0,1,38.1,39' +
+    'V35.7l-13,6.9,13,7.1V46.4a1.8,1.8,0,0,1,3.7,0v6.5' +
+    'a1.8,1.8,0,0,1-.9,1.6ZM40,81.9l-0.9-.2L20.4,71.4' +
+    'a1.8,1.8,0,0,1,0-3.2l18.7-10a1.8,1.8,0,0,1,2.7,1.6v4.5h7' +
+    'a1.8,1.8,0,0,1,1.8,1.8v7.4a1.8,1.8,0,0,1-1.8,1.8H45.2' +
+    'a1.8,1.8,0,0,1,0-3.7h1.7V68H40a1.8,1.8,0,0,1-1.8-1.8V62.9' +
+    'l-13,6.9,13,7.1V73.6a1.8,1.8,0,0,1,3.7,0V80a1.8,1.8,0,0,1-.9,1.6Z';
+
+const m_diamond = 'M50,87a16.1,16.1,0,0,1-11.5-4.7L17.7,61.5a16.3,16.3,0,0,' +
+    '1,0-22.9L38.5,17.7a16.3,16.3,0,0,1,22.9,0L82.3,38.5' +
+    'a16.3,16.3,0,0,1,0,22.9L61.5,82.3A16.1,16.1,0,0,1,50,87Z' +
+    'm0-70.3a12.4,12.4,0,0,0-8.9,3.7L20.3,41.1a12.6,12.6,0,0,0,0,' +
+    '17.7L41.1,79.7a12.6,12.6,0,0,0,17.7,0L79.7,58.9a12.6,12.6,0,0,' +
+    '0,0-17.7L58.9,20.3A12.4,12.4,0,0,0,50,16.7Z';
+
+const m_trafficArrows = 'M41,66.7l-0.9-.2-16.8-9a1.8,1.8,0,0,1,0-3.2' +
+    'L40.1,45a1.8,1.8,0,0,1,2.7,1.6v5.8a1.8,1.8,0,0,1-3.7,0V49.7' +
+    'L28,55.8l11.1,5.9V59.1A1.8,1.8,0,0,1,41,57.2H47v-3H45.7' +
+    'a1.8,1.8,0,0,1,0-3.7h3.2a1.8,1.8,0,0,1,1.8,1.8v6.7' +
+    'a1.8,1.8,0,0,1-1.8,1.8H42.8v3.9a1.8,1.8,0,0,1-.9,1.6ZM59,55.3' +
+    'l-1-.3a1.8,1.8,0,0,1-.9-1.6V49.5H51.1a1.8,1.8,0,0,1-1.8-1.8' +
+    'V41a1.8,1.8,0,0,1,1.8-1.8h3.2a1.8,1.8,0,0,1,0,3.7H53v3H59' +
+    'a1.8,1.8,0,0,1,1.8,1.8v2.7L72,44.4,60.9,38.3V41' +
+    'a1.8,1.8,0,0,1-3.7,0V35.2a1.8,1.8,0,0,1,2.7-1.6l16.8,9.3' +
+    'a1.8,1.8,0,0,1,0,3.2L59.9,55Z';
+
+const m_otn_base = 'M63.1,79.8a7.5,7.5,0,0,1-5.3-12.8,7.7,7.7,0,0,1,10.7,0' +
+    'A7.5,7.5,0,0,1,63.1,79.8Zm0-11.3A3.8,3.8,0,0,0,60.4,75h0' +
+    'a3.9,3.9,0,0,0,5.4,0A3.8,3.8,0,0,0,63.1,68.4Z' +
+    'M63.1,35.2A7.5,7.5,0,1,1,68.5,33h0A7.5,7.5,0,0,1,63.1,35.2Z' +
+    'm4-3.5h0Zm-4-7.8A3.8,3.8,0,1,0,65.8,25,3.8,3.8,0,0,0,63.1,23.9Z' +
+    'M73.3,57.3a7.5,7.5,0,1,1,7.5-7.5A7.5,7.5,0,0,1,73.3,57.3Z' +
+    'm0-11.3a3.8,3.8,0,1,0,3.8,3.8A3.8,3.8,0,0,0,73.3,46Z' +
+    'M61.9,48.7H51.5V41.9l5-5a1.9,1.9,0,0,0-2.6-2.6l-4.2,4.2L38,48.7' +
+    'H34.1A7.3,7.3,0,0,0,32,45a7.6,7.6,0,0,0-10.7,0,7.5,7.5,0,0,0,0,' +
+    '10.6,7.6,7.6,0,0,0,10.7,0,7.4,7.4,0,0,0,1.9-3.2h5.2' +
+    'l11.4,9.9,3.4,3.4a1.8,1.8,0,0,0,2.6,0,1.8,1.8,0,0,0,0-2.6l-5-5' +
+    'V52.4H61.9A1.9,1.9,0,0,0,61.9,48.7ZM29.4,53a3.8,3.8,0,0,1-6.5-2.7' +
+    'A3.9,3.9,0,0,1,24,47.6a3.9,3.9,0,0,1,5.4,0A3.8,3.8,0,0,1,29.4,53Z';
+
+export const mojoDataSet = new Map<string, string>([
+    ['_viewbox', '0 0 100 100'],
+
+    ['m_cloud', 'M62,48.8H61.5a1.8,1.8,0,0,1-1.3-2.3,11,11,0,0,' +
+    '0-21.1-6.1,1.8,1.8,0,1,1-3.5-1,14.7,14.7,0,0,1,28.2,8.1' +
+    'A1.8,1.8,0,0,1,62,48.8ZM70.6,71.2H28.3' +
+    'A14.7,14.7,0,1,1,38.4,45.2,1.8,1.8,0,1,1,36,48' +
+    'a11,11,0,1,0-7.5,19.4H71.8A11,11,0,0,0,71,45.5' +
+    'a10.9,10.9,0,0,0-3.2.5,1.8,1.8,0,1,1-1.1-3.5,14.7,14.7,0,0,1,19,14' +
+    'A14.8,14.8,0,0,1,72.2,71.1H70.6Z'],
+
+    ['m_map', 'M50,17.6A32.4,32.4,0,1,0,82.4,50,32.4,32.4,0,0,0,50,17.6Z' +
+    'm0,61.1A28.7,28.7,0,1,1,78.7,50,28.7,28.7,0,0,1,50,78.7Z' +
+    'M75.9,48.8a1.8,1.8,0,0,1-1.8,1.8H65' +
+    'a38.3,38.3,0,0,1-8.4,22.9,1.8,1.8,0,0,1-1.4.7,1.8,1.8,0,0,' +
+    '1-1.2-.4,1.8,1.8,0,0,1-.3-2.6,34.6,34.6,0,0,0,7.5-20.5H39.2' +
+    'a34.5,34.5,0,0,0,7.6,20.7,1.8,1.8,0,0,1-1.4,3,1.8,1.8,0,0,' +
+    '1-1.4-.7,38.2,38.2,0,0,1-8.5-23H26.2a1.8,1.8,0,1,1,0-3.7' +
+    'h9.4a38.1,38.1,0,0,1,8.4-21.6,1.8,1.8,0,0,1,2.9,2.3,34.4,34.4,0,0,' +
+    '0-7.6,19.3h22a34.3,34.3,0,0,0-8-19.7,1.8,1.8,0,1,1,2.8-2.4,38,38,' +
+    '0,0,1,8.8,22.1h9.1A1.8,1.8,0,0,1,75.9,48.8Z'],
+
+    ['m_selectMap', 'M51.36,8.74A32.45,32.45,0,0,0,19,41.15' +
+    'a32.12,32.12,0,0,0,9.22,22.62L17,72.07a1.84,1.84,0,0,0,1,3.32' +
+    'L35.52,76h0l10,14.42a1.84,1.84,0,0,0,1.52.79,2.05,2.05,0,0,' +
+    '0,.49-0.06,1.84,1.84,0,0,0,1.35-1.66l2.68-39.19' +
+    'a1.73,1.73,0,0,0-.06-0.6,0.85,0.85,0,0,0-.09-0.24,1.7,1.7,0,0,' +
+    '0-.81-0.9l-0.18-.1a1.69,1.69,0,0,0-.94-0.16H49.33l-0.16,0' +
+    'a1,1,0,0,0-.31.12,1.52,1.52,0,0,0-.33.18L42.73,53' +
+    'a34.6,34.6,0,0,1-2.22-11.21H62.68a34.55,34.55,0,0,1-7.55,20.54' +
+    'A1.85,1.85,0,1,0,58,64.63a38.26,38.26,0,0,0,8.37-22.86h9.08' +
+    'a1.85,1.85,0,0,0,0-3.7H66.3a38.06,38.06,0,0,0-8.83-22.14,' +
+    '1.85,1.85,0,1,0-2.82,2.38,34.37,34.37,0,0,1,8,19.76h-22' +
+    'a34.38,34.38,0,0,1,7.58-19.3,1.85,1.85,0,1,0-2.87-2.33,' +
+    '38.11,38.11,0,0,0-8.41,21.63H27.53a1.85,1.85,0,0,0,0,3.7' +
+    'h9.28a38.43,38.43,0,0,0,2.85,13.48l-8.5,6.31a28.71,28.71,0,1,' +
+    '1,23.21,8.16,1.85,1.85,0,0,0,.19,3.68h0.19A32.41,32.41,0,0,' +
+    '0,51.36,8.74Zm-4,49.75L45.57,84l-6.85-9.87,2.64-4.92,0.56-1,2.8-5' +
+    'C45.61,61.58,46.49,60,47.31,58.49ZM44,56.63' +
+    'c-0.81,1.5-1.69,3.11-2.56,4.73l-3.3,6.11-0.19.35' +
+    'C37,69.4,36.19,70.93,35.4,72.34l-12-.44Z'],
+
+    ['thatsNoMoon', 'M50,83.4A33.2,33.2,0,1,1,83.2,50.2,33.2,33.2,0,0,' +
+    '1,50,83.4ZM79.3,50.1A29.3,29.3,0,1,0,50.1,79.4,29.3,29.3,0,0,0,' +
+    '79.3,50.1ZM65.4,46.9h9.1A1.9,1.9,0,0,1,76.4,48a1.9,1.9,0,0,' +
+    '1-.3,2.1,2.1,2.1,0,0,1-1.8.7H65.4c-0.1.6-.1,1.2-0.2,1.8' +
+    'A38.5,38.5,0,0,1,57,73.9a2.1,2.1,0,0,1-2.2.9,2,2,0,0,' +
+    '1-1.4-1.6,2.3,2.3,0,0,1,.6-1.7,33.6,33.6,0,0,0,4.9-8.5,34.6,34.6,' +
+    '0,0,0,2.5-11c0-.3,0-0.7,0-1.1H38.9c0.2,1.3.3,2.6,0.5,3.9' +
+    'a34.2,34.2,0,0,0,7.3,17,2,2,0,1,1-3,2.4A37.1,37.1,0,0,1,39.1,67' +
+    'a40.8,40.8,0,0,1-4-15.5V50.8H25.8a2,2,0,0,1-2.2-1.9,1.9,1.9,0,0,' +
+    '1,2.1-2H35l0.3-1.8-0.8-.2a7.5,7.5,0,0,1-5.5-8.5,12.4,12.4,0,0,' +
+    '1,10-10.3,15.5,15.5,0,0,1,3.4,0,0.6,0.6,0,0,0,.7-0.3l0.8-1.1' +
+    'a1.9,1.9,0,0,1,2.5-.4,1.8,1.8,0,0,1,.7,2.4,13.6,13.6,0,0,' +
+    '1-.8,1.4,7.7,7.7,0,0,1,2.1,6.3A11,11,0,0,1,46,40.2a12.6,12.6,0,0,' +
+    '1-6.3,4.5,0.5,0.5,0,0,0-.5.6c0,0.5-.1,1-0.1,1.6H61.5l-0.7-4' +
+    'A33.6,33.6,0,0,0,53.5,27c-0.8-1-.9-1.7-0.4-2.5a1.7,1.7,0,0,' +
+    '1,2.4-.7,3.6,3.6,0,0,1,1.1.9,37,37,0,0,1,8,17.1' +
+    'c0.3,1.5.4,3,.7,4.4v0.7Zm-28.8-4A10.1,10.1,0,0,0,46,34.1' +
+    'a5.3,5.3,0,0,0-6-5.8A10.2,10.2,0,0,0,31.3,36' +
+    'C30.4,39.9,32.8,42.9,36.6,42.9ZM34.9,35.1a4,4,0,0,' +
+    '1,2.7-3.2,2.7,2.7,0,0,1,3.8,2.6,4.4,4.4,0,0,1-2.5,4' +
+    'C36.8,39.5,34.7,38,34.9,35.1Zm2,0.7c0,0.7.3,1,.9,0.9' +
+    'a2.3,2.3,0,0,0,1.5-2.3,0.7,0.7,0,0,0-1.1-.6' +
+    'A2.2,2.2,0,0,0,36.9,35.8Z'],
+
+    ['m_ports', 'M83.2,20L80,16.8a4.8,4.8,0,0,0-6.8,0l-1.4,1.4' +
+    'a4.8,4.8,0,0,0-1.4,3.4l-4.5,5.9a3.8,3.8,0,0,0,.4,5l1.2,1.2' +
+    'a3.8,3.8,0,0,0,5,.4l5.4-3.9,0.5-.6h0a4.8,4.8,0,0,0,3.4-1.4' +
+    'l1.4-1.4A4.8,4.8,0,0,0,83.2,20ZM70.3,31.1H70.1l-1.2-1.2' +
+    'a0.2,0.2,0,0,1,0-.2l3.3-4.4,2.6,2.6Zm10.3-6.9-1.4,1.4' +
+    'a1.1,1.1,0,0,1-1.6,0l-3.2-3.2a1.1,1.1,0,0,1,0-1.6l1.4-1.4' +
+    'a1.1,1.1,0,0,1,1.6,0l3.2,3.2A1.1,1.1,0,0,1,80.6,24.2Z' +
+    'M33.7,67.5l-1.2-1.2a3.8,3.8,0,0,0-5-.4l-5.9,4.5' +
+    'a4.8,4.8,0,0,0-3.4,1.4l-1.4,1.4a4.8,4.8,0,0,0,0,6.8L20,83.2' +
+    'a4.8,4.8,0,0,0,6.8,0l1.4-1.4a4.8,4.8,0,0,0,1.4-3.5l4.5-5.9' +
+    'A3.8,3.8,0,0,0,33.7,67.5ZM25.6,79.3l-1.4,1.4' +
+    'a1.2,1.2,0,0,1-1.6,0l-3.2-3.2a1.1,1.1,0,0,1,0-1.6l1.4-1.4' +
+    'a1.1,1.1,0,0,1,.8-0.3,1.1,1.1,0,0,1,.8.3l3.2,3.2' +
+    'A1.1,1.1,0,0,1,25.6,79.3Zm5.6-9-3.3,4.4-2.5-2.5,4.3-3.3h0.2' +
+    'l1.2,1.2A0.2,0.2,0,0,1,31.1,70.3ZM65.4,61.9a6.2,6.2,0,0,1-8.8,0' +
+    'L37.2,42.5A2.5,2.5,0,1,0,33.7,46l7,7a6.2,6.2,0,0,1,.4,8.3h0' +
+    'l-0.2.2-0.2.2-3.6,3.6a1.8,1.8,0,0,1-2.6-2.6l3.6-3.6h0.1' +
+    'a2.5,2.5,0,0,0-.1-3.4l-7-7a6.2,6.2,0,0,1,8.8-8.8L59.3,59.3' +
+    'a2.5,2.5,0,0,0,3.5-3.5l-6.2-6.2a6.2,6.2,0,0,1,0-8.8l6.1-6.1' +
+    'a1.8,1.8,0,0,1,2.6,2.6l-6.1,6.1a2.5,2.5,0,0,0,0,3.5l6.2,6.2' +
+    'A6.2,6.2,0,0,1,65.4,61.9Z'],
+
+    ['m_switch', m_switch_arrows],
+
+    ['m_roadm', m_switch_arrows + m_octagon],
+
+    ['m_router', 'M29.3,60.9l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V55.2H21.4' +
+    'a1.8,1.8,0,0,1-1.8-1.8V46.7a1.8,1.8,0,0,1,1.8-1.8h3.2' +
+    'a1.8,1.8,0,0,1,0,3.7H23.2v3h6.1a1.8,1.8,0,0,1,1.8,1.8V56' +
+    'l11.1-5.9L31.1,44v2.7a1.8,1.8,0,0,1-3.7,0V40.8' +
+    'a1.8,1.8,0,0,1,2.7-1.6L47,48.5a1.8,1.8,0,0,1,0,3.2l-16.8,9Z' +
+    'M70.6,60.9l-0.9-.2L52.9,51.4a1.8,1.8,0,0,1,0-3.2l16.8-9' +
+    'a1.8,1.8,0,0,1,2.7,1.6v3.9h6.1a1.8,1.8,0,0,1,1.8,1.8v6.7' +
+    'a1.8,1.8,0,0,1-1.8,1.8H75.4a1.8,1.8,0,0,1,0-3.7h1.3v-3H70.6' +
+    'a1.8,1.8,0,0,1-1.8-1.8V43.9L57.7,49.8l11.1,6.1V53.2' +
+    'a1.8,1.8,0,0,1,3.7,0v5.8a1.8,1.8,0,0,1-.9,1.6Z' +
+    'M49.8,82.5h0a1.8,1.8,0,0,1-1.6-1l-9-16.8A1.8,1.8,0,0,1,40.8,62' +
+    'h3.9V55.9a1.8,1.8,0,0,1,1.8-1.8h6.7a1.8,1.8,0,0,1,1.8,1.8v3.2' +
+    'a1.8,1.8,0,0,1-3.7,0V57.8h-3v6.1a1.8,1.8,0,0,1-1.8,1.8H43.9' +
+    'l5.9,11.1,6.1-11.1H53.2a1.8,1.8,0,0,1,0-3.7h5.8' +
+    'a1.8,1.8,0,0,1,1.6,2.7L51.4,81.5A1.8,1.8,0,0,1,49.8,82.5Z' +
+    'M53.3,45.8H46.7A1.8,1.8,0,0,1,44.8,44V40.8a1.8,1.8,0,0,1,3.7,0' +
+    'v1.3h3V36a1.8,1.8,0,0,1,1.8-1.8H56L50.1,23.1,44,34.2h2.7' +
+    'a1.8,1.8,0,0,1,0,3.7H40.8a1.8,1.8,0,0,1-1.6-2.7l9.2-16.8' +
+    'a1.8,1.8,0,0,1,1.6-1h0a1.8,1.8,0,0,1,1.6,1l9,16.8' +
+    'a1.8,1.8,0,0,1-1.6,2.7H55.2V44A1.8,1.8,0,0,1,53.3,45.8Z' +
+    'M50,91.2A41.3,41.3,0,1,1,91.2,50,41.3,41.3,0,0,1,50,91.2Z' +
+    'm0-78.9A37.6,37.6,0,1,0,87.6,50,37.6,37.6,0,0,0,50,12.4Z'],
+
+    ['m_uiAttached', 'M73.6,61.3H26.4a4.9,4.9,0,0,1-4.9-4.9V27.7' +
+    'a4.9,4.9,0,0,1,4.9-4.9H73.6a4.9,4.9,0,0,1,4.9,4.9V56.5' +
+    'A4.9,4.9,0,0,1,73.6,61.3ZM26.4,26.5a1.2,1.2,0,0,0-1.2,1.2' +
+    'V56.5a1.2,1.2,0,0,0,1.2,1.2H73.6a1.2,1.2,0,0,0,1.2-1.2V27.7' +
+    'a1.2,1.2,0,0,0-1.2-1.2H26.4ZM63.5,75.3a1.8,1.8,0,0,1-1.8,1.8' +
+    'H38.4a1.8,1.8,0,0,1,0-3.7h9.8V65.7a1.8,1.8,0,0,1,3.7,0v7.8' +
+    'h9.8A1.8,1.8,0,0,1,63.5,75.3Z'],
+
+    ['m_office', 'M31.7,28.6h-6a1.8,1.8,0,1,1,0-3.7h6A1.8,1.8,0,0,' +
+    '1,31.7,28.6ZM45,28.6h-6a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,1,' +
+    '1,45,28.6ZM31.7,38.3h-6a1.8,1.8,0,1,1,0-3.7h6A1.8,1.8,0,0,' +
+    '1,31.7,38.3ZM45,38.3h-6a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,1,' +
+    '1,45,38.3ZM31.7,48.1h-6a1.8,1.8,0,1,1,0-3.7h6A1.8,1.8,0,0,' +
+    '1,31.7,48.1ZM45,48.1h-6a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,1,' +
+    '1,45,48.1ZM63.7,51.1h-6a1.8,1.8,0,1,1,0-3.7h6A1.8,1.8,0,0,' +
+    '1,63.7,51.1ZM77,51.1H71a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,0,' +
+    '1,77,51.1ZM63.7,60.9h-6a1.8,1.8,0,1,1,0-3.7h6A1.8,1.8,0,0,' +
+    '1,63.7,60.9ZM77,60.9H71a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,0,' +
+    '1,77,60.9ZM45,57.9h-6a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,1,1,' +
+    '45,57.9ZM45,67.6h-6a1.8,1.8,0,0,1,0-3.7h6A1.8,1.8,0,1,1,45,67.6Z' +
+    'M82.3,37.9H52.6V18a1.8,1.8,0,0,0-1.8-1.8H19.2A1.8,1.8,0,0,' +
+    '0,17.3,18V50.1a1.8,1.8,0,0,0,3.7,0V19.8H48.9V80.2H27.2V75.4' +
+    'c4-1.2,6.5-3.3,7.3-6.3,2-7.2-6.8-16.2-7.8-17.2a1.9,1.9,0,0,' +
+    '0-2.6,0c-1,1-9.9,10-7.9,17.2,0.8,3,3.3,5.1,7.3,6.3v4.7H21V77.9' +
+    'a1.8,1.8,0,0,0-3.7,0V82a1.8,1.8,0,0,0,1.9,1.8H82.3A1.8,1.8,0,0,' +
+    '0,84.1,82V39.7A1.8,1.8,0,0,0,82.3,37.9ZM25.4,62.5a1.9,1.9,0,0,' +
+    '0-1.9,1.8v7.2c-2.1-.8-3.4-1.9-3.8-3.4-1-3.7,3-9.2,5.6-12.2,2.6,' +
+    '3,6.6,8.5,5.6,12.2-0.4,1.5-1.7,2.6-3.8,3.4V64.4A1.8,1.8,0,0,' +
+    '0,25.4,62.5ZM71.5,80.2H63.3V70h8.2V80.2Zm8.9,0H75.2V68.1' +
+    'a1.8,1.8,0,0,0-1.8-1.8H61.5a1.8,1.8,0,0,0-1.8,1.8V80.2H52.6' +
+    'V41.6H80.4V80.2Z'],
+
+    ['m_home', 'M79.2,52.2a1.7,1.7,0,0,1-2.3,0l-5.8-5.8V77a1.7,1.7,0,0,' +
+    '1-1.7,1.7H30.6A1.7,1.7,0,0,1,28.9,77V52.1a1.7,1.7,0,1,1,3.3,0' +
+    'V75.3H67.8V43.8a1.7,1.7,0,0,1,.1-0.7L50.1,25.4l-26.9,27' +
+    'a1.7,1.7,0,0,1-1.2.5A1.7,1.7,0,0,1,20.8,50L48.9,21.8' +
+    'a1.7,1.7,0,0,1,2.4,0l28,28A1.7,1.7,0,0,1,79.2,52.2ZM57.1,61.6' +
+    'H42.9a1.7,1.7,0,0,1-1.7-1.7V45.6A1.7,1.7,0,0,1,42.9,44H57.1' +
+    'a1.7,1.7,0,0,1,1.7,1.7V59.9A1.7,1.7,0,0,1,57.1,61.6ZM44.5,58.2' +
+    'H55.5V47.3H44.5V58.2Z'],
+
+    ['m_summary', 'M73.9,79.9H26.1A4.9,4.9,0,0,1,21.2,75V25' +
+    'a4.9,4.9,0,0,1,4.9-4.9H73.9A4.9,4.9,0,0,1,78.8,25V75' +
+    'A4.9,4.9,0,0,1,73.9,79.9Zm-47.8-56A1.2,1.2,0,0,0,24.9,25V75' +
+    'a1.2,1.2,0,0,0,1.2,1.2H73.9A1.2,1.2,0,0,0,75.1,75V25' +
+    'a1.2,1.2,0,0,0-1.2-1.2H26.1ZM42.4,46.7h-8a4.9,4.9,0,0,1-4.9-4.9' +
+    'v-8A4.9,4.9,0,0,1,34.4,29h8a4.9,4.9,0,0,1,4.9,4.9v8' +
+    'A4.9,4.9,0,0,1,42.4,46.7Zm-8-14.1a1.2,1.2,0,0,0-1.2,1.2v8' +
+    'A1.2,1.2,0,0,0,34.4,43h8a1.2,1.2,0,0,0,1.2-1.2v-8' +
+    'a1.2,1.2,0,0,0-1.2-1.2h-8ZM68.7,57.3H31.3a1.8,1.8,0,0,1,0-3.7' +
+    'H68.7A1.8,1.8,0,0,1,68.7,57.3ZM68.7,66.5H31.3a1.8,1.8,0,0,1,0-3.7' +
+    'H68.7A1.8,1.8,0,0,1,68.7,66.5Z'],
+
+    ['m_details', 'M68.7,33.2H31.3a1.8,1.8,0,0,1,0-3.7H68.7' +
+    'A1.8,1.8,0,1,1,68.7,33.2ZM73.9,17.5H26.1a4.9,4.9,0,0,0-4.9,4.9' +
+    'V72.4a4.9,4.9,0,0,0,4.9,4.9h8.2l-4.1,6.6a1.9,1.9,0,0,0,.6,2.5' +
+    'l1,0.3a1.8,1.8,0,0,0,1.6-.9L46.1,64.9a15.1,15.1,0,0,' +
+    '0,4,.5,15.6,15.6,0,0,0,3.7-.4A15.9,15.9,0,0,0,57,63.9H68.7' +
+    'a1.8,1.8,0,0,0,0-3.7H61.9a16.6,16.6,0,0,0,1.6-2.2,15.5,15.5,0,0,' +
+    '0,2.2-9.4h2.9a1.8,1.8,0,0,0,0-3.7H65a15.7,15.7,0,0,0-29.8,0' +
+    'H31.3a1.8,1.8,0,1,0,0,3.7h3.2a15.7,15.7,0,0,0,.4,4.9,15.5,15.5,' +
+    '0,0,0,3.5,6.7H31.3a1.8,1.8,0,1,0,0,3.7H42.4l-6,9.8H26.1' +
+    'a1.2,1.2,0,0,1-1.2-1.2V22.4a1.2,1.2,0,0,1,1.2-1.2H73.9' +
+    'a1.2,1.2,0,0,1,1.2,1.2V72.4a1.2,1.2,0,0,1-1.2,1.2H44.5' +
+    'a1.8,1.8,0,0,0,0,3.7H73.9a4.9,4.9,0,0,0,4.9-4.9V22.4' +
+    'A4.9,4.9,0,0,0,73.9,17.5ZM38.5,52.6A12,12,0,0,1,50.2,37.8,12,12,' +
+    '0,0,1,61.8,47a10.7,10.7,0,0,1,.3,1.6,12,12,0,0,1-5.9,11.6,12,12,' +
+    '0,0,1-12,0L43.9,60A12,12,0,0,1,38.5,52.6Z'],
+
+    ['m_oblique', 'M82.1,30.5a1.8,1.8,0,0,0-1.7-1.1H30.2' +
+    'a1.8,1.8,0,0,0-1.4.7L18.2,42.8a1.8,1.8,0,0,0,1.4,3H40.9V62.2' +
+    'a1.8,1.8,0,1,0,3.7,0V45.8H55.4V62.2a1.9,1.9,0,1,0,3.7,0V45.8' +
+    'H69.8a1.9,1.9,0,0,0,1.4-.7L81.8,32.5A1.8,1.8,0,0,0,82.1,30.5Z' +
+    'M69,42.2H23.5l7.5-9H76.5ZM69.8,70.5H19.6a1.8,1.8,0,0,1-1.4-3' +
+    'L28.7,54.8a1.8,1.8,0,0,1,1.4-.7h7a1.8,1.8,0,0,1,0,3.7H31l-7.5,9' +
+    'H69l7.5-9H62.4a1.8,1.8,0,0,1,0-3.7H80.4a1.8,1.8,0,0,1,1.4,3' +
+    'L71.3,69.9A1.8,1.8,0,0,1,69.8,70.5ZM52.3,57.8H47.6' +
+    'a1.8,1.8,0,0,1,0-3.7h4.8A1.8,1.8,0,0,1,52.3,57.8Z'],
+
+    ['m_filters', 'M69.9,45.8H19.5a1.9,1.9,0,0,1-1.4-3L28.7,30' +
+    'a1.8,1.8,0,0,1,1.4-.7H80.5a1.8,1.8,0,0,1,1.4,3L71.3,45.1' +
+    'A1.8,1.8,0,0,1,69.9,45.8ZM23.5,42.1H69l7.5-9H31ZM69.9,58.2' +
+    'H19.5a1.8,1.8,0,0,1-1.4-3l6.1-7.3a1.8,1.8,0,0,1,2.8,2.4l-3.6,4.3' +
+    'H69l7.6-9.1a1.8,1.8,0,0,1,.5-3.6h3.4a1.8,1.8,0,0,1,1.4,3' +
+    'L71.3,57.5A1.8,1.8,0,0,1,69.9,58.2ZM69.9,70.7H19.5' +
+    'a1.9,1.9,0,0,1-1.4-3l5.6-6.7a1.8,1.8,0,0,1,2.8,2.4L23.5,67H69' +
+    'l7.5-9H76.3a1.8,1.8,0,0,1,0-3.7h4.1a1.9,1.9,0,0,1,1.4,3L71.3,70' +
+    'A1.8,1.8,0,0,1,69.9,70.7Z'],
+
+    ['m_cycleLabels', 'M78.5,74.7a34.2,34.2,0,0,1-47.7,6.8l-0.3-.3' +
+    'L30.4,81V80.8a1.8,1.8,0,0,1,.8-2.5l0.7-.3-5.2-3.4v6.2l0.7-.3' +
+    'a1.8,1.8,0,1,1,1.7,3.3l-3.4,1.8-0.9.2-1-.3a1.9,1.9,0,0,1-.9-1.6' +
+    'V71.1a1.8,1.8,0,0,1,2.8-1.5l10.7,7a1.9,1.9,0,0,1,.8,1.6,1.9,1.9,' +
+    '0,0,1-1,1.5l-0.7.4a30.5,30.5,0,0,0,40.1-7.7A1.8,1.8,0,0,' +
+    '1,78.5,74.7ZM30.8,25.7L29.5,38.4a1.8,1.8,0,0,1-1.1,1.5l-0.8.2' +
+    'a1.9,1.9,0,0,1-1.1-.3l-1.7-1.2a30.1,30.1,0,0,0-2.7,6,1.9,1.9,0,0,' +
+    '1-1.8,1.3H19.9a1.8,1.8,0,0,1-1.2-2.3A33.9,33.9,0,0,1,22.8,35' +
+    'a1.8,1.8,0,0,1,1.6-.8,1.9,1.9,0,0,1,1.2.3L26.2,35l0.7-6.2-5.5,2.8' +
+    'L21.9,32a1.8,1.8,0,1,1-2.1,3l-3.1-2.2a1.8,1.8,0,0,1,.2-3.2' +
+    'l11.3-5.8A1.8,1.8,0,0,1,30.8,25.7ZM85.2,30.8L84.7,43.4' +
+    'a1.8,1.8,0,0,1-1,1.6l-0.8.2a1.8,1.8,0,0,1-1.1-.4L71.4,37.4' +
+    'a1.8,1.8,0,0,1,.3-3.2l1.9-.9a30.5,30.5,0,0,0-3.9-5.3,1.8,1.8,0,0,' +
+    '1,2.7-2.5,34.3,34.3,0,0,1,5.3,7.7,2,2,0,0,1-.9,2.6' +
+    'l-0.7.3,5.1,3.6,0.3-6.2-0.7.3a1.8,1.8,0,0,1-1.6-3.3L82.6,29' +
+    'a1.8,1.8,0,0,1,1.8.1A1.9,1.9,0,0,1,85.2,30.8ZM62.4,32.2H40.2' +
+    'a4.9,4.9,0,0,1-4.9-4.9V16.6a4.9,4.9,0,0,1,4.9-4.9H62.4' +
+    'a4.9,4.9,0,0,1,4.9,4.9V27.3A4.9,4.9,0,0,1,62.4,32.2ZM40.2,15.4' +
+    'A1.2,1.2,0,0,0,39,16.6V27.3a1.2,1.2,0,0,0,1.2,1.2H62.4' +
+    'a1.2,1.2,0,0,0,1.2-1.2V16.6a1.2,1.2,0,0,0-1.2-1.2H40.2Z' +
+    'M88.4,68.1H66.2a4.9,4.9,0,0,1-4.9-4.9V52.6a4.9,4.9,0,0,1,4.9-4.9' +
+    'H88.4a4.9,4.9,0,0,1,4.9,4.9V63.2A4.9,4.9,0,0,1,88.4,68.1Z' +
+    'M66.2,51.4A1.2,1.2,0,0,0,65,52.6V63.2a1.2,1.2,0,0,0,1.2,1.2H88.4' +
+    'a1.2,1.2,0,0,0,1.2-1.2V52.6a1.2,1.2,0,0,0-1.2-1.2H66.2Z' +
+    'M33.8,68.1H11.6a4.9,4.9,0,0,1-4.9-4.9V52.6a4.9,4.9,0,0,1,4.9-4.9' +
+    'H33.8a4.9,4.9,0,0,1,4.9,4.9V63.2A4.9,4.9,0,0,1,33.8,68.1Z' +
+    'M11.6,51.4a1.2,1.2,0,0,0-1.2,1.2V63.2a1.2,1.2,0,0,0,1.2,1.2' +
+    'H33.8A1.2,1.2,0,0,0,35,63.2V52.6a1.2,1.2,0,0,0-1.2-1.2H11.6Z'],
+
+    ['m_prev', 'M59.8,72l-0.9-.2L21.8,51.3a1.8,1.8,0,0,1,0-3.2L58.9,28.2' +
+    'a1.8,1.8,0,0,1,2.7,1.6V40.7H77.3a1.8,1.8,0,0,1,1.8,1.8V57.3' +
+    'a1.8,1.8,0,0,1-1.8,1.8h-7a1.8,1.8,0,1,1,0-3.7h5.2v-11H59.8' +
+    'A1.8,1.8,0,0,1,58,42.6V33L26.6,49.7,58,67V57.3' +
+    'a1.8,1.8,0,0,1,3.7,0V70.1a1.8,1.8,0,0,1-.9,1.6Z'],
+
+    ['m_next', 'M40.2,72l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V57.3' +
+    'a1.8,1.8,0,0,1,3.7,0V67L73.5,49.7,42,32.9v9.6' +
+    'a1.8,1.8,0,0,1-1.8,1.8H24.5v11h5.2a1.8,1.8,0,1,1,0,3.7h-7' +
+    'a1.8,1.8,0,0,1-1.8-1.8V42.6a1.8,1.8,0,0,1,1.8-1.8H38.3V29.9' +
+    'a1.8,1.8,0,0,1,2.7-1.6L78.2,48.1a1.8,1.8,0,0,1,0,3.2L41.1,71.8Z'],
+
+    ['m_flows', 'M50.1,26.2a7.4,7.4,0,1,1,7.4-7.4A7.4,7.4,0,0,1,50.1,26.2Z' +
+    'm0-11.2a3.8,3.8,0,1,0,3.8,3.8A3.8,3.8,0,0,0,50.1,15Z' +
+    'M50.1,88.6a7.4,7.4,0,1,1,7.4-7.4A7.4,7.4,0,0,1,50.1,88.6Z' +
+    'm0-11.2a3.8,3.8,0,1,0,3.8,3.8A3.8,3.8,0,0,0,50.1,77.4Z' +
+    'M72,50.1a1.8,1.8,0,0,1-1.8,1.8H58.1V55a3,3,0,0,1-3,3H51.9V70.2' +
+    'a1.8,1.8,0,0,1-3.6,0V58.1h-3a3,3,0,0,1-3-3V51.9H29.8' +
+    'a1.8,1.8,0,1,1,0-3.6H42.3v-3a3,3,0,0,1,3-3h3a1.7,1.7,0,0,1,0-.3' +
+    'V29.8a1.8,1.8,0,0,1,3.6,0V41.9a1.7,1.7,0,0,1,0,.3h3.2' +
+    'a3,3,0,0,1,3,3v3H70.2A1.8,1.8,0,0,1,72,50.1ZM18.8,57.5' +
+    'a7.4,7.4,0,1,1,7.4-7.4A7.4,7.4,0,0,1,18.8,57.5Zm0-11.2' +
+    'a3.8,3.8,0,1,0,3.8,3.8A3.8,3.8,0,0,0,18.8,46.3ZM81.2,57.5' +
+    'a7.4,7.4,0,1,1,7.4-7.4A7.4,7.4,0,0,1,81.2,57.5Zm0-11.2' +
+    'A3.8,3.8,0,1,0,85,50.1,3.8,3.8,0,0,0,81.2,46.3Z'],
+
+    ['m_allTraffic', m_diamond + m_trafficArrows],
+
+    ['m_xMark', 'M76.8,73.7a2.2,2.2,0,0,1-3.1,3.1L50,53.1,26.3,76.7' +
+    'a2.2,2.2,0,1,1-3.1-3.1L46.9,50,23.2,26.3a2.2,2.2,0,0,1,3.1-3.1' +
+    'L50,46.9,73.7,23.2a2.2,2.2,0,1,1,3.1,3.1L53.1,50Z'],
+
+    ['m_resetZoom', 'M73.9,76.8H64.2a1.8,1.8,0,1,1,0-3.7h9.7' +
+    'a1.2,1.2,0,0,0,1.2-1.2V62.6a1.8,1.8,0,0,1,3.7,0v9.3' +
+    'A4.9,4.9,0,0,1,73.9,76.8ZM77,33.3a1.8,1.8,0,0,1-1.8-1.8V22' +
+    'a1.2,1.2,0,0,0-1.2-1.2H64.2a1.8,1.8,0,1,1,0-3.7h9.7' +
+    'A4.9,4.9,0,0,1,78.8,22v9.5A1.8,1.8,0,0,1,77,33.3ZM23,33.6' +
+    'a1.8,1.8,0,0,1-1.8-1.8V22a4.9,4.9,0,0,1,4.9-4.9h9.8' +
+    'a1.8,1.8,0,0,1,0,3.7H26.1A1.2,1.2,0,0,0,24.9,22v9.7' +
+    'A1.8,1.8,0,0,1,23,33.6ZM65.3,42.3A15.7,15.7,0,1,0,42.6,59.8' +
+    'L34.4,73.1H26.1a1.2,1.2,0,0,1-1.2-1.2V62.1a1.9,1.9,0,0,0-3.7,0' +
+    'v9.8a4.9,4.9,0,0,0,4.9,4.9h6.1l-2,3.3' +
+    'a1.8,1.8,0,0,0,.6,2.5,1.8,1.8,0,0,0,1,.3,1.8,1.8,0,0,0,1.6-.9' +
+    'L46,61.2a15.7,15.7,0,0,0,7.7.1A15.7,15.7,0,0,0,65.3,42.3Z' +
+    'm-5,9.9A12,12,0,1,1,50.1,34a12,12,0,0,1,11.7,9.2' +
+    'A11.9,11.9,0,0,1,60.3,52.3Z'],
+
+    ['m_eqMaster', 'M63,79.9H37.4a1.8,1.8,0,0,1-1.2-3.2L48.8,65.1' +
+    'a1.8,1.8,0,0,1,2.5,0L64.2,76.7A1.8,1.8,0,0,1,63,79.9Z' +
+    'M42.1,76.2H58.2l-8.1-7.3ZM19.7,65.8a1.8,1.8,0,0,1-.3-3.7' +
+    'l61-11.3a1.8,1.8,0,1,1,.7,3.6L20,65.8H19.7ZM34.2,53.5' +
+    'A16.7,16.7,0,1,1,50.9,36.8,16.7,16.7,0,0,1,34.2,53.5Zm0-29.7' +
+    'a13,13,0,1,0,13,13A13,13,0,0,0,34.2,23.8ZM70.7,45.7' +
+    'a8.6,8.6,0,1,1,8.6-8.6A8.6,8.6,0,0,1,70.7,45.7Zm0-13.6' +
+    'a4.9,4.9,0,1,0,4.9,4.9A4.9,4.9,0,0,0,70.7,32.2Z'],
+
+    ['m_unknown', 'M63.2,20.6H36.8A16.2,16.2,0,0,0,20.6,36.8V63.2' +
+    'A16.2,16.2,0,0,0,36.8,79.4H63.2A16.2,16.2,0,0,0,79.4,63.2V36.8' +
+    'A16.2,16.2,0,0,0,63.2,20.6ZM75.7,63.2A12.5,12.5,0,0,1,63.2,75.7' +
+    'H36.8A12.5,12.5,0,0,1,24.3,63.2V36.8A12.5,12.5,0,0,1,36.8,24.3' +
+    'H63.2A12.5,12.5,0,0,1,75.7,36.8V63.2ZM67.3,64.7' +
+    'a1.8,1.8,0,0,1-2.6,2.6L50,52.6,35.3,67.3a1.8,1.8,0,0,1-2.6-2.6' +
+    'L47.4,50,32.7,35.3a1.8,1.8,0,0,1,2.6-2.6L50,47.4,64.7,32.7' +
+    'a1.8,1.8,0,0,1,2.6,2.6L52.6,50Z'],
+
+    ['m_controller', 'M73.9,20.1H26.1A4.9,4.9,0,0,0,21.2,25V75' +
+    'a4.9,4.9,0,0,0,4.9,4.9H73.9A4.9,4.9,0,0,0,78.8,75V25' +
+    'A4.9,4.9,0,0,0,73.9,20.1ZM75.1,75a1.2,1.2,0,0,1-1.2,1.2H26.1' +
+    'A1.2,1.2,0,0,1,24.9,75V25a1.2,1.2,0,0,1,1.2-1.2H73.9' +
+    'A1.2,1.2,0,0,1,75.1,25V75ZM70.5,63a1.8,1.8,0,0,1-1.9,1.8H38.3' +
+    'v2.4a1.8,1.8,0,0,1-3.7,0V64.9H31.3a1.8,1.8,0,1,1,0-3.7h3.3V58.3' +
+    'a1.8,1.8,0,0,1,3.7,0v2.9H68.7A1.9,1.9,0,0,1,70.5,63ZM70.5,36.6' +
+    'a1.9,1.9,0,0,1-1.9,1.9H44.5v2.3a1.8,1.8,0,0,1-3.7,0V38.5H31.3' +
+    'a1.8,1.8,0,1,1,0-3.7h9.5v-3a1.8,1.8,0,0,1,3.7,0v3H68.7' +
+    'A1.8,1.8,0,0,1,70.5,36.6ZM70.5,49.8a1.9,1.9,0,0,1-1.9,1.8H60.9' +
+    'v2.1a1.8,1.8,0,1,1-3.7,0V51.7H31.3a1.8,1.8,0,1,1,0-3.7H57.2' +
+    'V44.8a1.8,1.8,0,1,1,3.7,0V48h7.8A1.9,1.9,0,0,1,70.5,49.8Z'],
+
+    ['m_virtual', 'M56.6,53.5l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V45.8' +
+    'a1.8,1.8,0,1,1,3.7,0v2.7l11.1-6.1L58.4,36.5v2.7' +
+    'A1.8,1.8,0,0,1,56.6,41H50.5v3h1.3a1.8,1.8,0,0,1,0,3.7H48.6' +
+    'a1.8,1.8,0,0,1-1.8-1.8V39.2a1.8,1.8,0,0,1,1.8-1.8h6.1V33.4' +
+    'a1.8,1.8,0,0,1,2.7-1.6l16.8,9a1.8,1.8,0,0,1,0,3.2L57.5,53.3Z' +
+    'M56.6,77.9l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V70.2a1.8,1.8,0,1,1,3.7,0' +
+    'v2.7l11.1-6.1L58.4,60.9v2.7a1.8,1.8,0,0,1-1.8,1.8H50.5v3h1.3' +
+    'a1.8,1.8,0,0,1,0,3.7H48.6a1.8,1.8,0,0,1-1.8-1.8V63.6' +
+    'a1.8,1.8,0,0,1,1.8-1.8h6.1V57.8a1.8,1.8,0,0,1,2.7-1.6l16.8,9' +
+    'a1.8,1.8,0,0,1,0,3.2L57.5,77.7ZM38.5,64.9l-0.9-.2L20.8,55.4' +
+    'a1.8,1.8,0,0,1,0-3.2l16.8-9a1.8,1.8,0,0,1,2.7,1.6v3.9h6.1' +
+    'a1.8,1.8,0,0,1,1.8,1.8v6.7a1.8,1.8,0,0,1-1.8,1.8H43.2' +
+    'a1.8,1.8,0,1,1,0-3.7h1.3v-3H38.5a1.8,1.8,0,0,1-1.8-1.8V47.9' +
+    'L25.6,53.8l11.1,6.1V57.2a1.8,1.8,0,0,1,3.7,0v5.8' +
+    'a1.8,1.8,0,0,1-.9,1.6ZM38.5,89.3l-0.9-.2L20.8,79.8' +
+    'a1.8,1.8,0,0,1,0-3.2l16.8-9a1.8,1.8,0,0,1,2.7,1.6v3.9h6.1' +
+    'A1.8,1.8,0,0,1,48.3,75v6.7a1.8,1.8,0,0,1-1.8,1.8H43.2' +
+    'a1.8,1.8,0,1,1,0-3.7h1.3v-3H38.5A1.8,1.8,0,0,1,36.6,75V72.3' +
+    'L25.6,78.2l11.1,6.1V81.6a1.8,1.8,0,1,1,3.7,0v5.8' +
+    'a1.8,1.8,0,0,1-.9,1.6ZM60.8,29.1H60.3A1.8,1.8,0,0,1,59,26.8' +
+    'a9.7,9.7,0,0,0-18.7-5.4,1.8,1.8,0,1,1-3.5-1,13.4,13.4,0,0,' +
+    '1,25.8,7.4A1.8,1.8,0,0,1,60.8,29.1ZM77.4,45.7a1.8,1.8,0,0,' +
+    '1-1.3-3.1,9.7,9.7,0,0,0-9.9-16A1.8,1.8,0,1,1,65,23.1,13.4,13.4,' +
+    '0,0,1,78.7,45.1,1.8,1.8,0,0,1,77.4,45.7ZM22.7,45.8a1.8,1.8,0,0,' +
+    '1-1.3-.6A13.4,13.4,0,0,1,39.6,25.6a1.8,1.8,0,1,1-2.4,2.8' +
+    'A9.7,9.7,0,0,0,24,42.6,1.8,1.8,0,0,1,22.7,45.8Z'],
+
+
+    ['m_other', 'M78.9,64.9H21.1A4.9,4.9,0,0,1,16.2,60V24.3a4.9,4.9,0,0,' +
+    '1,4.9-4.9H78.9a4.9,4.9,0,0,1,4.9,4.9V60A4.9,4.9,0,0,1,78.9,64.9Z' +
+    'M21.1,23.1a1.2,1.2,0,0,0-1.2,1.2V60a1.2,1.2,0,0,0,1.2,1.2H78.9' +
+    'A1.2,1.2,0,0,0,80.1,60V24.3a1.2,1.2,0,0,0-1.2-1.2H21.1Z' +
+    'M65.8,78.8a1.9,1.9,0,0,1-1.8,1.8H36.1a1.9,1.9,0,1,1,0-3.7H48.2' +
+    'V70.4a1.8,1.8,0,1,1,3.7,0v6.5H63.9A1.9,1.9,0,0,1,65.8,78.8Z' +
+    'M47.2,49.3V48.1c-0.3-2.3.5-4.9,2.7-7.5s3-4,3-5.9-1.4-3.7-4.1-3.7' +
+    'a7.7,7.7,0,0,0-4.4,1.3l-1-2.7A11.3,11.3,0,0,1,49.5,28' +
+    'c5,0,7.2,3.1,7.2,6.3s-1.6,5-3.7,7.5-2.6,4.1-2.5,6.3v1.1H47.2Z' +
+    'm-1,6a2.5,2.5,0,0,1,2.6-2.7A2.7,2.7,0,1,1,46.3,55.3Z'],
+
+    ['m_endstation', 'M75,49.5H25a1.8,1.8,0,0,1-1.8-1.8V27.1' +
+    'A1.8,1.8,0,0,1,25,25.3H75a1.8,1.8,0,0,1,1.8,1.8V47.7' +
+    'A1.8,1.8,0,0,1,75,49.5ZM26.9,45.8H73.1V28.9H26.9V45.8Z' +
+    'M35.5,43.2H30.7a1.8,1.8,0,1,1,0-3.7h4.8A1.8,1.8,0,1,1,35.5,43.2Z' +
+    'M72.1,72.9a1.8,1.8,0,0,1-1.8,1.8H29.7a1.8,1.8,0,1,1,0-3.7' +
+    'H48.2V53.5a1.8,1.8,0,1,1,3.7,0V71.1H70.3A1.9,1.9,0,0,1,72.1,72.9Z'],
+
+    ['m_bgpSpeaker', 'M59.2,49.6l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V43.3' +
+    'a1.8,1.8,0,1,1,3.7,0v1.3l7-3.9L61,37v1.3a1.8,1.8,0,0,1-1.8,1.8' +
+    'H47.5a1.8,1.8,0,1,1,0-3.7h9.8V33.9A1.8,1.8,0,0,1,60,32.3' +
+    'l12.8,6.8a1.8,1.8,0,0,1,0,3.2l-12.8,7Z' +
+    'M40,58.8l-0.9-.2-12.8-7a1.8,1.8,0,0,1,0-3.2l12.8-6.8' +
+    'a1.8,1.8,0,0,1,2.7,1.6v2.5h9.8a1.8,1.8,0,0,1,0,3.7H40' +
+    'a1.8,1.8,0,0,1-1.8-1.8V46.2l-7,3.8,7,3.9V52.5' +
+    'a1.8,1.8,0,0,1,3.7,0v4.4a1.8,1.8,0,0,1-.9,1.6Z' +
+    'M83.6,45.8c0,13.8-15.1,25-33.6,25a43.8,43.8,0,0,1-6.1-.4' +
+    'c-2.5,2.7-7.2,6.1-15.6,8.7H27.8a1.8,1.8,0,0,1-1.2-3.2' +
+    's5.4-5,5.8-10.2a1.8,1.8,0,0,1,2-1.7A1.8,1.8,0,0,1,36,66' +
+    'a16.2,16.2,0,0,1-2.5,7.2,24.4,24.4,0,0,0,8.3-5.9L42,67l0.2-.2' +
+    'h0l0.6-.2h0.6a41.4,41.4,0,0,0,6.5.5c16.5,0,29.9-9.5,29.9-21.3' +
+    'S66.5,24.5,50,24.5,20.1,34.1,20.1,45.8c0,5.4,2.9,10.6,8.2,14.6' +
+    'a1.8,1.8,0,0,1-2.2,2.9' +
+    'c-6.2-4.7-9.7-10.9-9.7-17.5,0-13.8,15.1-25,33.6-25' +
+    'S83.6,32,83.6,45.8Z'],
+
+    ['m_otn', m_otn_base],
+
+    ['m_roadm_otn', m_otn_base + m_octagon],
+
+    ['m_fiberSwitch', 'M47.5,37.2a1.8,1.8,0,0,1-1.8-1.8V25.6H43.4' +
+    'a1.8,1.8,0,0,1-1.6-2.7l6.4-12a1.8,1.8,0,0,1,1.6-1h0' +
+    'a1.8,1.8,0,0,1,1.6,1l6.6,12a1.8,1.8,0,0,1-1.6,2.7H53.2' +
+    'a1.8,1.8,0,0,1,0-3.7h0.1l-3.5-6.3L46.5,22h1a1.8,1.8,0,0,1,1.8,1.8' +
+    'V35.3A1.8,1.8,0,0,1,47.5,37.2Z' +
+    'M75.9,46.9H75.8a1.8,1.8,0,0,1-1.5-1l-1.8-3.4' +
+    'a1.8,1.8,0,1,1,3.2-1.7l0.4,0.8,4.2-6-7.1-.3,0.5,0.9' +
+    'a1.8,1.8,0,0,1-.8,2.5l-10.4,5a1.8,1.8,0,0,1-1.6-3.3l8.7-4.2-1-2' +
+    'a1.8,1.8,0,0,1,.1-1.8,1.8,1.8,0,0,1,1.6-.8l13.6,0.5' +
+    'A1.8,1.8,0,0,1,85.3,35L77.4,46.1A1.8,1.8,0,0,1,75.9,46.9Z' +
+    'M81.2,72.5H81.1l-13.6-.8A1.8,1.8,0,0,1,66,69l1.7-3.1' +
+    'a1.8,1.8,0,1,1,3.2,1.8l-0.3.5,7.3,0.4-3.5-6.2-0.5.9' +
+    'a1.8,1.8,0,0,1-2.5.6l-9.8-6.1a1.8,1.8,0,0,1,1.9-3.1' +
+    'l8.2,5.1,1.2-1.9a1.9,1.9,0,0,1,1.6-.9,1.8,1.8,0,0,1,1.6.9' +
+    'l6.8,11.8A1.8,1.8,0,0,1,81.2,72.5Z' +
+    'M48.8,89.7a1.8,1.8,0,0,1-1.6-1l-6.6-12a1.8,1.8,0,0,1,1.6-2.7h3.3' +
+    'a1.8,1.8,0,0,1,0,3.7H45.3L48.7,84l3.4-6.3h-1' +
+    'a1.8,1.8,0,0,1-1.8-1.8V64.4a1.8,1.8,0,0,1,1.8-1.8h0' +
+    'a1.8,1.8,0,0,1,1.8,1.8v9.7h2.3a1.8,1.8,0,0,1,1.6,2.7l-6.4,12' +
+    'a1.8,1.8,0,0,1-1.6,1h0Z' +
+    'M16.9,71.3a1.8,1.8,0,0,1-1.6-2.7l6.7-12' +
+    'a1.8,1.8,0,0,1,1.6-.9,1.9,1.9,0,0,1,1.6.9l1.7,2.8' +
+    'a1.8,1.8,0,1,1-3.1,1.9H23.7l-3.5,6.3,7.1-.5L26.8,66' +
+    'a1.8,1.8,0,0,1,.6-2.5l9.8-6.1a1.8,1.8,0,0,1,1.9,3.1l-8.2,5.1' +
+    'L32,67.6a1.8,1.8,0,0,1-1.4,2.8l-13.5.9H16.9Z' +
+    'M35.8,46.9L35,46.7l-8.7-4.3-1,2a1.8,1.8,0,0,1-3.1.3l-8-11' +
+    'a1.8,1.8,0,0,1,1.4-2.9l13.6-.7' +
+    'a1.8,1.8,0,0,1,1.6.8,1.8,1.8,0,0,1,.1,1.8l-1.6,3' +
+    'a1.8,1.8,0,1,1-3.3-1.7h0.1l-7.1.4,4.2,5.8,0.5-.9' +
+    'a1.8,1.8,0,0,1,2.5-.8l10.4,5.1A1.8,1.8,0,0,1,35.8,46.9Z' +
+    'M60.5,49.9a11.3,11.3,0,1,1-3.3-8A11.2,11.2,0,0,1,60.5,49.9Z'],
+
+    ['m_microwave', 'M63.5,38.9a2.8,2.8,0,0,0-2.1,1H49.6V15.1' +
+    'a1.8,1.8,0,0,0-.5-1.3,1.8,1.8,0,0,0-1.3-.5h0' +
+    'a28.4,28.4,0,0,0-15.7,52V82.5H22.8a1.8,1.8,0,0,0,0,3.7H45' +
+    'a1.8,1.8,0,1,0,0-3.7H35.8V67.4a28.4,28.4,0,0,0,12,2.8h0' +
+    'a1.9,1.9,0,0,0,1.8-1.8V43.6H61.3a2.8,2.8,0,0,0,2.1,1' +
+    'A2.8,2.8,0,1,0,63.5,38.9ZM46,66.4a24.8,24.8,0,0,1,0-49.4V66.4Z' +
+    'M41.7,64H41.2a24.3,24.3,0,0,1-12.9-9.7L28,53.9' +
+    'a1.8,1.8,0,0,1,3.1-2l0.2,0.3a20.3,20.3,0,0,0,10.9,8.2' +
+    'A1.8,1.8,0,0,1,41.7,64Z' +
+    'M66.4,53.1a1.8,1.8,0,0,1-.5-3.6A8.1,8.1,0,0,0,66,34' +
+    'a1.8,1.8,0,0,1,1.1-3.5A11.8,11.8,0,0,1,67,53H66.4Z' +
+    'M66.5,58.2a1.8,1.8,0,0,1-.4-3.6,13.1,13.1,0,0,0,0-25.7,' +
+    '1.8,1.8,0,1,1,.7-3.6,16.8,16.8,0,0,1,0,32.9H66.5Z'],
+
+    ['m_relatedIntents', 'M34.5,73.1A7.5,7.5,0,1,1,42,65.6,7.5,7.5,' +
+    '0,0,1,34.5,73.1Zm0-11.3a3.8,3.8,0,1,0,3.8,3.8' +
+    'A3.8,3.8,0,0,0,34.5,61.8Z' +
+    'M56.7,34.3a1.8,1.8,0,0,1-1.8,1.9H42.6v3.1a3.1,3.1,0,0,1-3,3' +
+    'H36.4V54.5a1.9,1.9,0,0,1-3.7,0V42.3h-3a3.1,3.1,0,0,1-3-3' +
+    'V29.5a3,3,0,0,1,3-3h9.8a3,3,0,0,1,3,3v3H54.8' +
+    'A1.8,1.8,0,0,1,56.7,34.3Z' +
+    'M66,41.8a7.5,7.5,0,1,1,7.5-7.5A7.5,7.5,0,0,1,66,41.8Z' +
+    'm0-11.3a3.8,3.8,0,1,0,3.8,3.8A3.8,3.8,0,0,0,66,30.5Z'],
+
+    ['m_intentTraffic', 'M28.9,77.6H28.5a1.8,1.8,0,0,1-1.4-2.2L39,23.3' +
+    'a1.8,1.8,0,0,1,3.6.8l-12,52.1A1.8,1.8,0,0,1,28.9,77.6Z' +
+    'M71.1,77.6a1.8,1.8,0,0,1-1.8-1.4l-12-52.1a1.8,1.8,0,0,1,3.6-.8' +
+    'l12,52.1a1.8,1.8,0,0,1-1.4,2.2H71.1Z' +
+    'M49.9,26.2A1.8,1.8,0,0,1,48,24.4V23.7a1.8,1.8,0,0,1,3.7,0' +
+    'v0.7A1.8,1.8,0,0,1,49.9,26.2Z' +
+    'M49.9,43.6A1.8,1.8,0,0,1,48,41.8V40.2a1.8,1.8,0,0,1,3.7,0' +
+    'v1.6A1.8,1.8,0,0,1,49.9,43.6Zm0-8.7A1.8,1.8,0,0,1,48,33.1' +
+    'V31.5a1.8,1.8,0,0,1,3.7,0v1.6A1.8,1.8,0,0,1,49.9,34.9Z' +
+    'M49.9,69.8A1.8,1.8,0,0,1,48,67.9V66.3a1.8,1.8,0,0,1,3.7,0' +
+    'v1.6A1.8,1.8,0,0,1,49.9,69.8Zm0-8.7A1.8,1.8,0,0,1,48,59.2' +
+    'V57.6a1.8,1.8,0,0,1,3.7,0v1.6A1.8,1.8,0,0,1,49.9,61.1Zm0-8.7' +
+    'A1.8,1.8,0,0,1,48,50.5V48.9a1.8,1.8,0,0,1,3.7,0v1.6' +
+    'A1.8,1.8,0,0,1,49.9,52.3Z' +
+    'M49.9,77.6A1.8,1.8,0,0,1,48,75.7V75a1.8,1.8,0,0,1,3.7,0v0.7' +
+    'A1.8,1.8,0,0,1,49.9,77.6Z'],
+
+    ['m_firewall', 'M75.3,88.8H65.6a4.9,4.9,0,0,1-4.9-4.9V79.1' +
+    'a4.9,4.9,0,0,1,4.9-4.9h9.7a4.9,4.9,0,0,1,4.9,4.9v4.8' +
+    'A4.9,4.9,0,0,1,75.3,88.8ZM65.6,77.9a1.2,1.2,0,0,0-1.2,1.2v4.8' +
+    'a1.2,1.2,0,0,0,1.2,1.2h9.7a1.2,1.2,0,0,0,1.2-1.2V79.1' +
+    'a1.2,1.2,0,0,0-1.2-1.2H65.6Z' +
+    'M53.9,88.8H24.7a4.9,4.9,0,0,1-4.9-4.9V79.1a4.9,4.9,0,0,1,4.9-4.9' +
+    'H53.9a4.9,4.9,0,0,1,4.9,4.9v4.8A4.9,4.9,0,0,1,53.9,88.8Z' +
+    'M24.7,77.9a1.2,1.2,0,0,0-1.2,1.2v4.8a1.2,1.2,0,0,0,1.2,1.2' +
+    'H53.9a1.2,1.2,0,0,0,1.2-1.2V79.1a1.2,1.2,0,0,0-1.2-1.2H24.7Z' +
+    'M34.4,72.1H24.7a4.9,4.9,0,0,1-4.9-4.9V62.4a4.9,4.9,0,0,1,4.9-4.9' +
+    'h9.7a4.9,4.9,0,0,1,4.9,4.9v4.8A4.9,4.9,0,0,1,34.4,72.1Z' +
+    'M24.7,61.2a1.2,1.2,0,0,0-1.2,1.2v4.8a1.2,1.2,0,0,0,1.2,1.2h9.7' +
+    'a1.2,1.2,0,0,0,1.2-1.2V62.4a1.2,1.2,0,0,0-1.2-1.2H24.7Z' +
+    'M75.3,72.1H46.1a4.9,4.9,0,0,1-4.9-4.9V62.4a4.9,4.9,0,0,1,4.9-4.9' +
+    'H75.3a4.9,4.9,0,0,1,4.9,4.9v4.8A4.9,4.9,0,0,1,75.3,72.1Z' +
+    'M46.1,61.2a1.2,1.2,0,0,0-1.2,1.2v4.8a1.2,1.2,0,0,0,1.2,1.2H75.3' +
+    'a1.2,1.2,0,0,0,1.2-1.2V62.4a1.2,1.2,0,0,0-1.2-1.2H46.1Z' +
+    'M67.7,40.7c-0.2-4.8-3.6-8.8-6.3-12s-3-3.6-3.3-4.8' +
+    'a13.1,13.1,0,0,1,1-9.7,2.2,2.2,0,0,0,.3-1.1,1.9,1.9,0,0,' +
+    '0-.8-1.5,1.8,1.8,0,0,0-1.7-.2c-0.3.1-8.1,3-10.4,14.7-1.4-2.3' +
+    '-3.4-4.6-5.9-5.4a1.8,1.8,0,0,0-2,.6,1.9,1.9,0,0,0-.2,2.1,6.8,6.8,' +
+    '0,0,1-.6,7.1c-1.4,1.8-5.9,8.3-4.1,14.9,1.2,4.1,4.6,7.3,10.2,9.4' +
+    'h1.6l0.2-.2h0.1l0.2-.3,0.2-.3h0V53.2a1.6,1.6,0,0,0,0-.4,1.7,1.7,' +
+    '0,0,0,0-.3h0V52.2h0V51.8L46,51.6H45.9c-0.3-.4-2.4-3-2.1-5.9' +
+    'a5,5,0,0,1,.7-2.1c1,2,2.7,4.4,5.5,4.6a5.1,5.1,0,0,0,3.9-1.3' +
+    'A8.2,8.2,0,0,0,56,43.5a7.3,7.3,0,0,1,.3,2.6,7.6,7.6,0,0,' +
+    '1-3.1,5.3,1.8,1.8,0,0,0,1.2,3.3h0c0.3,0,6.3-.1,10.1-4.3' +
+    'C66.9,47.9,67.9,44.6,67.7,40.7Zm-5.8,7.1a9,9,0,0,1-2.7,2,9.9,9.9,' +
+    '0,0,0,.9-3.5c0.3-5.1-3.4-9.2-3.5-9.4a1.8,1.8,0,0,0-3.2,1.2' +
+    'c0,1.4-.5,4.8-1.8,5.9a1.4,1.4,0,0,1-1.2.4c-1.7-.1-2.9-3.3-3.3-4.8' +
+    'a1.8,1.8,0,0,0-1.2-1.4,1.8,1.8,0,0,0-1.8.3,9.7,9.7,0,0,' +
+    '0-4,6.8,9.4,9.4,0,0,0,.3,3.1,8.4,8.4,0,0,1-3.1-4.4' +
+    'c-1.4-5,2.6-10.5,3.5-11.7A10,10,0,0,0,42.8,27,27.2,27.2,0,0,' +
+    '1,46,33.7a1.8,1.8,0,0,0,3.6-.6,33.2,33.2,0,0,1,.4-5.4,19.3,19.3,' +
+    '0,0,1,4-9.7,19.1,19.1,0,0,0,.5,6.7c0.5,2.1,2.2,4,4.1,6.3' +
+    's5.3,6.2,5.5,9.8A9.1,9.1,0,0,1,61.9,47.8Z'],
+
+    ['m_balancer', 'M33.4,56.6H26.7a3.1,3.1,0,0,1-3-3V46.9a3.1,3.1,0,0,1,3-3' +
+    'h6.7a3.1,3.1,0,0,1,3,3v6.7A3.1,3.1,0,0,1,33.4,56.6Z' +
+    'M73.3,36.5H66.6a3.1,3.1,0,0,1-3-3V26.7a3.1,3.1,0,0,1,3-3' +
+    'h6.7a3.1,3.1,0,0,1,3,3v6.7A3.1,3.1,0,0,1,73.3,36.5Z' +
+    'M73.3,56.1H66.6a3.1,3.1,0,0,1-3-3V46.4a3.1,3.1,0,0,1,3-3' +
+    'h6.7a3.1,3.1,0,0,1,3,3v6.7A3.1,3.1,0,0,1,73.3,56.1Z' +
+    'M73.3,76.3H66.6a3.1,3.1,0,0,1-3-3V66.6a3.1,3.1,0,0,1,3-3' +
+    'h6.7a3.1,3.1,0,0,1,3,3v6.7A3.1,3.1,0,0,1,73.3,76.3Z' +
+    'M62.7,70.4a1.9,1.9,0,0,1-1.8,1.5H60.5a15.2,15.2,0,0,1-10.9-9.1' +
+    'c-3.9-8.6-4.7-9.8-10.8-10.4a1.8,1.8,0,0,1-1.6-1.7,0.3,0.3,0,0,1,0-.1' +
+    'h0V50.1h0a1.8,1.8,0,0,1,1.7-2c6.2-.5,7-1.7,10.9-10.4' +
+    'a15.2,15.2,0,0,1,10.7-9.1,1.8,1.8,0,1,1,.8,3.6,11.5,11.5,0,0,0-8.2,7' +
+    'c-2,4.4-3.4,7.3-5.3,9.2H60.8a1.8,1.8,0,1,1,0,3.7h-13' +
+    'c1.8,1.9,3.2,4.8,5.2,9.1a11.5,11.5,0,0,0,8.3,7' +
+    'A1.9,1.9,0,0,1,62.7,70.4Z'],
+
+    ['m_ips', 'M79.4,26.8a0.9,0.9,0,0,0-.1-0.3V26.1l-0.3-.4-0.2-.2' +
+    'H78.6c-1.3-1-11-8-28.3-8H49.7c-18.7,0-28.1,7.8-28.5,8.1' +
+    'a2,2,0,0,0-.7,1.3c-1.1,22.8,6.7,36.8,13.4,44.4S48.3,82.4,49.1,82.7' +
+    'h1.6c0.3-.1,7.9-3.1,15.3-11.4S80.5,49.7,79.4,26.8ZM50,79' +
+    'c-3.9-1.7-27.3-13.4-25.8-51.1,2.3-1.6,10.7-6.8,25.5-6.8h0.5' +
+    'c14.4,0,23.2,5.2,25.5,6.8C77.2,65.6,53.9,77.3,50,79Z' +
+    'M41.7,41.9a1.8,1.8,0,0,1-1.8-1.9V37.3a9.8,9.8,0,0,1,9.8-9.8h0.6' +
+    'a9.8,9.8,0,0,1,9.8,9.8v2.6a1.8,1.8,0,1,1-3.7,0V37.3' +
+    'a6.1,6.1,0,0,0-6.1-6.1H49.6a6.1,6.1,0,0,0-6.1,6.1v2.8' +
+    'A1.8,1.8,0,0,1,41.7,41.9Z' +
+    'M58.6,63.1H41.3a3.7,3.7,0,0,1-3.6-3.7V47.3a3.7,3.7,0,0,1,3.6-3.7' +
+    'H58.6a3.8,3.8,0,0,1,3.6,3.7V59.4A3.7,3.7,0,0,1,58.6,63.1Z'],
+
+    ['m_ids', 'M69.7,41.5c-2.9,3.6-9.1,5-18.6,4.2a18.4,18.4,0,0,0-8.9,1.4' +
+    'H41.5a1.8,1.8,0,0,1-.7-3.5A22.2,22.2,0,0,1,51.5,42' +
+    'c7.4,0.6,12.5-.2,14.8-2.3L63.2,22.6c-5,2.9-12.5,2.4-15.9,1.9' +
+    'a18.7,18.7,0,0,0-12.7,3.4H34.3l9.5,52.4a1.9,1.9,0,0,1-1.5,2.1' +
+    'H42a1.8,1.8,0,0,1-1.8-1.5L29.9,24.3a1.8,1.8,0,1,1,3.6-.6v0.4' +
+    'a22.3,22.3,0,0,1,14.1-3.2C55,21.8,60.9,20.7,63,18' +
+    'a1.8,1.8,0,0,1,1.9-.6,1.8,1.8,0,0,1,1.4,1.5L70.1,40' +
+    'A1.9,1.9,0,0,1,69.7,41.5Z'],
+
+    ['m_olt', 'M83,47.6H64.5a1.8,1.8,0,0,0-1.9,1.9V74.3' +
+    'a1.8,1.8,0,0,0,1.9,1.8H83a1.8,1.8,0,0,0,1.8-1.8V49.5' +
+    'A1.8,1.8,0,0,0,83,47.6ZM81.1,72.5H77.7v-5a1.4,1.4,0,0,0-1.4-1.4' +
+    'H72.1a1.4,1.4,0,0,0-1.4,1.4v5H66.3V51.3H81.1V72.5Z' +
+    'M70.9,56.9H69.5a1.8,1.8,0,0,1,0-3.7h1.3A1.8,1.8,0,1,1,70.9,56.9Z' +
+    'M77.5,56.9H76.1a1.8,1.8,0,0,1,0-3.7h1.3A1.8,1.8,0,1,1,77.5,56.9Z' +
+    'M70.9,62.5H69.5a1.8,1.8,0,0,1,0-3.7h1.3A1.8,1.8,0,1,1,70.9,62.5Z' +
+    'M77.5,62.5H76.1a1.8,1.8,0,0,1,0-3.7h1.3A1.8,1.8,0,1,1,77.5,62.5Z' +
+    'M40.9,56.2H36.1a1.8,1.8,0,1,1,0-3.7h4.8A1.8,1.8,0,0,1,40.9,56.2Z' +
+    'M82.2,25.7V43.9a1.8,1.8,0,0,1-3.7,0V27.5H32.3V59.8H58.4' +
+    'a1.8,1.8,0,0,1,0,3.7h-28a1.9,1.9,0,0,1-1.8-1.9V45.5H17' +
+    'a1.8,1.8,0,0,1,0-3.7H28.6V25.7a1.8,1.8,0,0,1,1.8-1.8h50' +
+    'A1.8,1.8,0,0,1,82.2,25.7Z'],
+
+    ['m_onu', 'M39.8,58.7H35a1.8,1.8,0,1,1,0-3.7h4.9' +
+    'A1.8,1.8,0,1,1,39.8,58.7Z' +
+    'M81.4,28.3V46.5a1.9,1.9,0,0,1-3.7,0V30.2H31.2V62.4H57.4' +
+    'a1.8,1.8,0,1,1,0,3.7H29.3a1.8,1.8,0,0,1-1.8-1.9V48.1H15.9' +
+    'a1.8,1.8,0,1,1,0-3.7H27.5V28.3a1.8,1.8,0,0,1,1.8-1.8H79.5' +
+    'A1.8,1.8,0,0,1,81.4,28.3Z' +
+    'M85.8,60.3L75.1,49.6a1.8,1.8,0,0,0-2.6,0L61.6,60.3' +
+    'a1.8,1.8,0,0,0,0,2.6,1.8,1.8,0,0,0,2.6,0l0.2-.2v8.8' +
+    'a1.8,1.8,0,0,0,1.8,1.8H81.2a1.8,1.8,0,0,0,1.8-1.8V62.7l0.2,0.2' +
+    'A1.8,1.8,0,0,0,85.8,60.3Zm-6.5,9.4H68.1V59.1l5.6-5.6L79.4,59V69.7Z'],
+
+    ['m_swap', 'M62.2,54.7l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V47.1' +
+    'a1.8,1.8,0,1,1,3.7,0v2.6l10.8-6L64,38v2.6a1.8,1.8,0,0,1-1.8,1.8' +
+    'H47.1a1.8,1.8,0,0,1,0-3.7H60.3V34.9a1.8,1.8,0,0,1,2.7-1.6' +
+    'l16.5,8.8a1.8,1.8,0,0,1,0,3.2L63.1,54.5Z' +
+        'M37.4,66.6l-0.9-.2L20,57.2a1.8,1.8,0,0,1,0-3.2l16.5-8.8' +
+    'a1.8,1.8,0,0,1,2.7,1.6v3.8H52.5a1.8,1.8,0,0,1,0,3.7H37.4' +
+    'a1.8,1.8,0,0,1-1.8-1.8V49.9L24.8,55.7l10.8,6V59' +
+    'a1.8,1.8,0,1,1,3.7,0v5.7a1.8,1.8,0,0,1-.9,1.6Z'],
+
+    ['m_shortestGeoPath', 'M49.7,17.5A32.3,32.3,0,1,0,81.9,49.8,32.3,32.3,0,' +
+    '0,0,49.7,17.5Zm0,60.9A28.6,28.6,0,1,1,78.2,49.8,28.6,28.6,0,0,1,' +
+    '49.7,78.4Z M60.9,49a1.5,1.5,0,0,1-.1-0.4,0.8,0.8,0,0,1,0-.3' +
+    'C60.9,48.5,60.9,48.8,60.9,49Z' +
+    'M75.4,48.6a1.8,1.8,0,0,1-1.8,1.8h-9' +
+    'a38.2,38.2,0,0,1-8.3,22.8,1.8,1.8,0,0,1-1.4.7,1.8,1.8,0,0,' +
+    '1-1.1-.4,1.8,1.8,0,0,1-.3-2.6,34.6,34.6,0,0,0,7.5-21.6V49' +
+    'c0-.3,0-0.5,0-0.7a0.1,0.1,0,0,1,0-.1,33.2,33.2,0,0,0-.7-6.1H60' +
+    'a5.1,5.1,0,0,1-3.1-9.1A33,33,0,0,0,52.9,27' +
+    'a1.8,1.8,0,1,1,2.8-2.4,36.2,36.2,0,0,1,4.7,7.2,5.1,5.1,0,0,' +
+    '1,3.1,8.7,38.3,38.3,0,0,1,.9,6.2h9.1A1.8,1.8,0,0,1,75.4,48.6Z' +
+    'M46.5,71a1.8,1.8,0,0,1-1.4,3,1.8,1.8,0,0,1-1.4-.7,36.3,36.3,' +
+    '0,0,1-4.3-6.7H39a5.1,5.1,0,0,1-2.9-9.3,40.3,40.3,0,0,1-.8-6.9H26' +
+    'a1.8,1.8,0,0,1,0-3.7h9.3a38,38,0,0,1,8.3-21.5,1.8,1.8,0,1,1,2.8,' +
+    '2.3,34.5,34.5,0,0,0-7.6,21.8,36,36,0,0,0,.7,7.2,5.1,5.1,0,0,' +
+    '1,4.5,5.1,5,5,0,0,1-1.4,3.5A33.4,33.4,0,0,0,46.5,71Z' +
+    'M44.9,56.9a1.8,1.8,0,0,1-1.1-.4,1.8,1.8,0,0,1-.3-2.6l0.6-.8' +
+    'A1.8,1.8,0,1,1,47,55.3l-0.6.8A1.8,1.8,0,0,1,44.9,56.9Zm3.9-5' +
+    'a1.8,1.8,0,0,1-1.1-.4,1.8,1.8,0,0,1-.3-2.6l0.6-.8' +
+    'a1.8,1.8,0,1,1,2.9,2.3l-0.6.8A1.8,1.8,0,0,1,48.8,51.9Zm3.9-5' +
+    'a1.8,1.8,0,0,1-1.1-.4,1.8,1.8,0,0,1-.3-2.6l0.6-.8' +
+    'a1.8,1.8,0,1,1,2.9,2.3l-0.6.8A1.8,1.8,0,0,1,52.7,46.9Z'],
+
+    ['m_source', 'M71,63.8l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V57.1' +
+    'a1.8,1.8,0,0,1,3.7,0v1.7l8.2-4.5-8.2-4.4v1.7A1.8,1.8,0,0,1,71,53.4' +
+    'H58.2a1.8,1.8,0,0,1,0-3.7H69.2V46.8a1.8,1.8,0,0,1,2.7-1.6l14,7.5' +
+    'a1.8,1.8,0,0,1,0,3.2l-14,7.7Z' +
+    'M32.7,77.7a3.6,3.6,0,0,1-3.1-1.8L16.1,52.1l-0.9-1.6' +
+    'a19.3,19.3,0,0,1-2.1-8.7,19.6,19.6,0,0,1,6.1-14.2' +
+    'A19.5,19.5,0,0,1,52.1,40.5h0a19.5,19.5,0,0,1-2,9.9l-1,1.8' +
+    'L35.8,75.9A3.6,3.6,0,0,1,32.7,77.7Zm0-51.7' +
+    'A15.8,15.8,0,0,0,18.5,48.8l0.8,1.4L32.7,73.9,46,50.3l0.8-1.4' +
+    'a15.9,15.9,0,0,0,1.6-8.1h0A15.8,15.8,0,0,0,33.6,26h-1Z' +
+    'm0,21.1A8.2,8.2,0,1,1,40.8,39,8.2,8.2,0,0,1,32.7,47.1Z' +
+    'm0-12.6A4.5,4.5,0,1,0,37.1,39,4.5,4.5,0,0,0,32.7,34.5Z'],
+
+    ['m_destination', 'M30.3,63.8l-0.9-.3a1.8,1.8,0,0,1-.9-1.6V57.1' +
+    'a1.8,1.8,0,0,1,3.7,0v1.7l8.2-4.5-8.2-4.4v1.7a1.8,1.8,0,0,1-1.8,1.8' +
+    'H17.5a1.8,1.8,0,1,1,0-3.7H28.4V46.8a1.8,1.8,0,0,1,2.7-1.6l14,7.5' +
+    'a1.8,1.8,0,0,1,0,3.2l-14,7.7Z' +
+    'M64.9,77.7a3.6,3.6,0,0,1-3.1-1.8L48.3,52.1l-0.9-1.6' +
+    'a19.3,19.3,0,0,1-2-8.6,19.6,19.6,0,0,1,6.1-14.2' +
+    'A19.5,19.5,0,0,1,84.3,40.5a19.5,19.5,0,0,1-1.9,9.8v0.2l-0.9,1.7' +
+    'L68,75.9A3.6,3.6,0,0,1,64.9,77.7ZM50.7,48.8l0.8,1.4' +
+    'L64.9,73.9,78.2,50.3,79,48.8h0a15.8,15.8,0,0,0,1.6-8' +
+    'a15.8,15.8,0,1,0-29.9,8h0Zm14.1-1.7' +
+    'A8.2,8.2,0,1,1,73,39,8.2,8.2,0,0,1,64.9,47.1Z' +
+    'm0-12.6A4.5,4.5,0,1,0,69.3,39,4.5,4.5,0,0,0,64.9,34.5Z'],
+
+    ['m_topo', 'M31.3,73H21.5a3.1,3.1,0,0,1-3-3V60.1a3.1,3.1,0,0,1,3-3' +
+    'h9.8a3.2,3.2,0,0,1,3,3V70A3.1,3.1,0,0,1,31.3,73Z' +
+    'M78.5,46.7H68.7a3.1,3.1,0,0,1-3-3V33.8a3.1,3.1,0,0,1,3-3h9.8' +
+    'a3.1,3.1,0,0,1,3,3v9.8A3.1,3.1,0,0,1,78.5,46.7Z' +
+    'M40.8,42.9H31a3.1,3.1,0,0,1-3-3V30a3.1,3.1,0,0,1,3-3' +
+    'h9.9a2.9,2.9,0,0,1,2.9,3v9.8A3.1,3.1,0,0,1,40.8,42.9Z' +
+    'M37.4,66.1a1.8,1.8,0,0,1-1.2-3.3L61.1,42a1.8,1.8,0,1,1,2.4,2.8' +
+    'L38.6,65.7A1.8,1.8,0,0,1,37.4,66.1Z' +
+    'M27.4,55.5a1.8,1.8,0,0,1-1.5-3l5.8-7.7a1.8,1.8,0,1,1,2.9,2.2' +
+    'l-5.8,7.7A1.8,1.8,0,0,1,27.4,55.5Z' +
+    'M62.5,39.7H62.2L46.6,36.5a1.8,1.8,0,1,1,.7-3.6L62.9,36' +
+    'A1.8,1.8,0,0,1,62.5,39.7Z'],
+
+    ['m_shortestPath', 'M28.2,31.2H19.5a3,3,0,0,1-3-3V19.5a3,3,0,0,1,3-3' +
+    'h8.6c1.8,0.4,3,1.4,3,3v8.6A3,3,0,0,1,28.2,31.2Z' +
+    'M80.2,83.2H71.6a3,3,0,0,1-3-3V71.5a3,3,0,0,1,3-3h8.6' +
+    'c1.7,0.4,3,1.4,3,3v8.6A3,3,0,0,1,80.2,83.2Z' +
+    'M67.6,67.4a1.8,1.8,0,0,1-1.3.5,1.9,1.9,0,0,1-1.3-.5L54.7,57.1' +
+    'H45.6a3,3,0,0,1-3-3V45.5a2.1,2.1,0,0,1,.1-0.5L32.3,34.7' +
+    'a1.8,1.8,0,0,1,0-2.6,1.9,1.9,0,0,1,2.6,0L45.3,42.5h8.9' +
+    'a3,3,0,0,1,3,3v8.6a0.9,0.9,0,0,1,0,.2L67.6,64.8' +
+    'A1.8,1.8,0,0,1,67.6,67.4Z'],
+
+    ['m_disjointPaths', 'M67.7,59.8h9.4a2.9,2.9,0,0,1,3,3v9.4' +
+    'a3.1,3.1,0,0,1-3,3H67.7a3.1,3.1,0,0,1-3-3V62.9' +
+    'A3.1,3.1,0,0,1,67.7,59.8Z' +
+    'M22.9,59.8h9.4a2.9,2.9,0,0,1,3,3v9.4a3.1,3.1,0,0,1-3,3H22.9' +
+    'a3.1,3.1,0,0,1-3-3V62.9A3.1,3.1,0,0,1,22.9,59.8Z' +
+    'M45.3,24.7h9.4a2.9,2.9,0,0,1,3,3v9.4a3.1,3.1,0,0,1-3,3H45.3' +
+    'a3.1,3.1,0,0,1-3-3V27.7A3.1,3.1,0,0,1,45.3,24.7Z' +
+    'M65.9,58.5a1.8,1.8,0,0,1-1.5-.8L55.3,44.3a1.8,1.8,0,0,1,3.1-2.1' +
+    'l9.1,13.4A1.8,1.8,0,0,1,65.9,58.5Z' +
+    'M61.1,68.8H39.1a1.8,1.8,0,1,1,0-3.7H61.1A1.8,1.8,0,0,1,61.1,68.8Z' +
+    'M35.5,59.9l-1-.3a1.8,1.8,0,0,1-.6-2.5l8.8-14.3' +
+    'a1.8,1.8,0,0,1,3.1,1.9L37.1,59A1.8,1.8,0,0,1,35.5,59.9Z'],
+
+    ['m_region', 'M49.8,70.9a3.4,3.4,0,0,1-3-1.8L34.3,47l-0.8-1.5' +
+    'a18.2,18.2,0,0,1-1.9-8.2,18.4,18.4,0,0,1,5.8-13.3' +
+    'A18.3,18.3,0,0,1,68.1,36.1h0a18.4,18.4,0,0,1-1.9,9.3' +
+    'L65.3,47,52.8,69.2A3.4,3.4,0,0,1,49.8,70.9Zm0-48.3' +
+    'A14.6,14.6,0,0,0,36.7,43.8l0.7,1.3L49.8,67,62.2,45.2l0.8-1.3' +
+    'a14.7,14.7,0,0,0,1.5-7.5h0A14.8,14.8,0,0,0,50.7,22.7H49.8Z' +
+    'm0,19.7a7.7,7.7,0,1,1,7.7-7.7A7.7,7.7,0,0,1,49.8,42.4Zm0-11.8' +
+    'a4.1,4.1,0,1,0,4.1,4.1A4.1,4.1,0,0,0,49.8,30.6Z' +
+    'M81.7,80.8H17.9a1.8,1.8,0,0,1-1.6-2.7l9.2-16.8' +
+    'a1.8,1.8,0,0,1,1.6-1h9.5a1.8,1.8,0,1,1,0,3.7H28.2L21,77.1H78.6' +
+    'L71.4,64H61.9a1.8,1.8,0,1,1,0-3.7H72.5a1.8,1.8,0,0,1,1.6,1' +
+    'l9.2,16.8A1.8,1.8,0,0,1,81.7,80.8Z'],
+]);
+
+export const extraGlyphs = new Map<string, string>([
+        ['_yang', '0 0 400 400'],
+        ['yang', 'M323.3,199.2a33.2,33.2,0,1,1-66.4,0' +
+        'c0-18.4,14.9-34.1,33.2-33.3S323.3,180.8,323.3,199.2Z' +
+        'M286.5,289.9c-78.2-.3-86.6-72.2-86.9-89.1s-14.6-91.8-88.3-88.3' +
+        'c-7.5.3-34.6,1.2-56.9,20.1-25.8,21.8-29,53.9-30.5,68.2-0.2,' +
+        '2.2-.4,4.4-0.5,6.5h0a175.5,175.5,0,0,0,171,172.9H199' +
+        'a175.5,175.5,0,0,0,58.6-10l3.9-1.4,3.9-1.5,3.9-1.7h0' +
+        'l3.9-1.7,2.8-1.3,2.7-1.4a175.6,175.6,0,0,0,95.9-155.1' +
+        'C372.4,226.7,358,290.1,286.5,289.9ZM110.1,237.7' +
+        'A33.6,33.6,0,1,1,143.7,204,33.6,33.6,0,0,1,110.1,237.7Z'],
+]);
+
+
+/**
+ * ONOS GUI -- SVG -- Glyph Data Service
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class GlyphDataService {
+
+    constructor(
+        private log: LogService
+    ) {
+        this.log.debug('GlyphDataService constructed');
+    }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon.service.ts
new file mode 100644
index 0000000..6ced162
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon.service.ts
@@ -0,0 +1,245 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { GlyphService } from './glyph.service';
+import { LogService } from '../log.service';
+import { SvgUtilService } from './svgutil.service';
+import * as d3 from 'd3';
+
+const vboxSize = 50;
+const cornerSize = vboxSize / 10;
+const viewBox = '0 0 ' + vboxSize + ' ' + vboxSize;
+
+export const glyphMapping = new Map<string, string>([
+    // Maps icon ID to the glyph ID it uses.
+    // NOTE: icon ID maps to a CSS class for styling that icon
+    ['active', 'checkMark'],
+    ['inactive', 'xMark'],
+
+    ['plus', 'plus'],
+    ['minus', 'minus'],
+    ['play', 'play'],
+    ['stop', 'stop'],
+
+    ['upload', 'upload'],
+    ['download', 'download'],
+    ['delta', 'delta'],
+    ['nonzero', 'nonzero'],
+    ['close', 'xClose'],
+
+    ['m_ports', 'm_ports'],
+
+    ['topo', 'topo'],
+
+    ['refresh', 'refresh'],
+    ['query', 'query'],
+    ['garbage', 'garbage'],
+
+
+    ['upArrow', 'triangleUp'],
+    ['downArrow', 'triangleDown'],
+
+    ['appInactive', 'unknown'],
+
+    ['node', 'node'],
+    ['devIcon_SWITCH', 'switch'],
+    ['devIcon_ROADM', 'roadm'],
+    ['devIcon_OTN', 'otn'],
+
+    ['portIcon_DEFAULT', 'm_ports'],
+
+    ['meter', 'meterTable'], // TODO: m_meter icon?
+
+    ['deviceTable', 'switch'],
+    ['flowTable', 'flowTable'],
+    ['portTable', 'portTable'],
+    ['groupTable', 'groupTable'],
+    ['meterTable', 'meterTable'],
+    ['pipeconfTable', 'pipeconfTable'],
+
+    ['hostIcon_endstation', 'endstation'],
+    ['hostIcon_router', 'router'],
+    ['hostIcon_bgpSpeaker', 'bgpSpeaker'],
+
+    // navigation menu icons...
+    ['nav_apps', 'bird'],
+    ['nav_settings', 'cog'],
+    ['nav_cluster', 'node'],
+    ['nav_processors', 'allTraffic'],
+    ['nav_partitions', 'unknown'],
+
+    ['nav_topo', 'topo'],
+    ['nav_topo2', 'm_cloud'],
+    ['nav_devs', 'switch'],
+    ['nav_links', 'ports'],
+    ['nav_hosts', 'endstation'],
+    ['nav_intents', 'relatedIntents'],
+    ['nav_tunnels', 'ports'], // TODO: use tunnel glyph, when available
+    ['nav_yang', 'yang'],
+]);
+
+/**
+ * ONOS GUI -- SVG -- Icon Service
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class IconService {
+
+    constructor(
+        private gs: GlyphService,
+        private log: LogService,
+        private sus: SvgUtilService
+    ) {
+
+        this.log.debug('IconService constructed');
+    }
+
+    ensureIconLibDefs() {
+        const body = d3.select('body');
+        let svg = body.select('svg#IconLibDefs');
+        if (svg.empty()) {
+            svg = body.append('svg').attr('id', 'IconLibDefs');
+            svg.append('defs');
+        }
+        return svg.select('defs');
+    }
+
+    /**
+     * Load an icon
+     *
+     * @param div A D3 selection of the '&lt;div&gt;' element into which icon should load
+     * @param glyphId Identifies the glyph to use
+     * @param size The dimension of icon in pixels. Defaults to 20.
+     * @param installGlyph If truthy, will cause the glyph to be added to
+     *      well-known defs element. Defaults to false.
+     * @param svgClass The CSS class used to identify the SVG layer.
+     *      Defaults to 'embeddedIcon'.
+     */
+    loadIcon(div, glyphId: string = 'unknown', size: number = 20, installGlyph: boolean = true, svgClass: string = 'embeddedIcon') {
+        const dim = size || 20;
+        const svgCls = svgClass || 'embeddedIcon';
+        const gid = glyphId || 'unknown';
+        let g;
+        let svgIcon: any;
+
+        if (installGlyph) {
+            this.gs.loadDefs(this.ensureIconLibDefs(), [gid], true);
+        }
+        this.log.warn('loadEmbeddedIcon. install done');
+
+        svgIcon = div
+            .append('svg')
+            .attr('class', svgCls)
+            .attr('width', dim)
+            .attr('height', dim)
+            .attr('viewBox', viewBox);
+
+        g = svgIcon.append('g')
+            .attr('class', 'icon');
+
+        g.append('rect')
+            .attr('width', vboxSize)
+            .attr('height', vboxSize)
+            .attr('rx', cornerSize);
+
+        g.append('use')
+            .attr('width', vboxSize)
+            .attr('height', vboxSize)
+            .attr('class', 'glyph')
+            .attr('xlink:href', '#' + gid);
+    }
+
+    /**
+     * Load an icon by class.
+     * @param div A D3 selection of the <DIV> element into which icon should load
+     * @param iconCls The CSS class used to identify the icon
+     * @param size The dimension of icon in pixels. Defaults to 20.
+     * @param installGlyph If truthy, will cause the glyph to be added to
+     *      well-known defs element. Defaults to false.
+     * @param svgClass The CSS class used to identify the SVG layer.
+     *      Defaults to 'embeddedIcon'.
+     */
+    loadIconByClass(div, iconCls: string, size: number, installGlyph: boolean, svgClass= 'embeddedIcon') {
+        this.loadIcon(div, glyphMapping.get(iconCls), size, installGlyph, svgClass);
+        div.select('svg g').classed(iconCls, true);
+    }
+
+    /**
+     * Load an embedded icon.
+     */
+    loadEmbeddedIcon(div, iconCls: string, size: number) {
+        this.loadIconByClass(div, iconCls, size, true);
+    }
+
+    /**
+     * Load an icon only to the svg defs collection
+     *
+     * Note: This is added for use with IconComponent, where the icon's
+     * svg element is defined in the component template (and not built
+     * inline using d3 manipulation
+     *
+     * @param iconCls The icon class as a string
+     */
+    loadIconDef(iconCls: string): void {
+        this.gs.loadDefs(this.ensureIconLibDefs(), [glyphMapping.get(iconCls)], true);
+        this.log.debug('icon definition', iconCls, 'added to defs');
+    }
+
+
+    /**
+     * Add a device icon
+     *
+     * Adds a device glyph to the specified element.
+     * Returns the D3 selection of the glyph (use) element.
+     */
+    addDeviceIcon(elem, glyphId, iconDim) {
+        const gid = this.gs.glyphDefined(glyphId) ? glyphId : 'query';
+        return elem.append('use').attr({
+            'xlink:href': '#' + gid,
+            width: iconDim,
+            height: iconDim,
+        });
+    }
+
+    addHostIcon(elem, radius, glyphId) {
+        const dim = radius * 1.5;
+        const xlate = -dim / 2;
+        const g = elem.append('g')
+                .attr('class', 'svgIcon hostIcon');
+
+        g.append('circle').attr('r', radius);
+
+        g.append('use').attr({
+            'xlink:href': '#' + glyphId,
+            width: dim,
+            height: dim,
+            transform: this.sus.translate([xlate], xlate),
+        });
+        return g;
+    }
+
+    registerIconMapping(iconId, glyphId) {
+        if (glyphMapping[iconId]) {
+            this.log.warn('Icon with id', iconId, 'already mapped. Ignoring.');
+        } else {
+            // map icon-->glyph
+            glyphMapping[iconId] = glyphId;
+            // make sure definition is installed
+            this.gs.loadDefs(this.ensureIconLibDefs(), [glyphId], true);
+        }
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph-theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph-theme.css
new file mode 100644
index 0000000..12cdf30
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph-theme.css
@@ -0,0 +1,33 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Glyph Service (theme) -- CSS file
+ */
+
+.light svg .glyph,
+.dark svg .glyph.overlay {
+    fill: blue;
+}
+
+/*
+* NOTE: Keeping the theme black while we
+* wait for the mockup theme designs to be made
+*/
+.dark svg .glyph,
+.light svg .glyph.overlay {
+    fill: blue;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph.css
new file mode 100644
index 0000000..0743ff2
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/glyph.css
@@ -0,0 +1,24 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Glyph Service (layout) -- CSS file
+ */
+
+svg .glyph {
+    stroke: none;
+    fill-rule: evenodd;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.css
new file mode 100644
index 0000000..8350a75
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.css
@@ -0,0 +1,87 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Icon Service (layout) -- CSS file
+ */
+
+svg#IconLibDefs {
+  display: none;
+}
+
+svg .svgIcon {
+    fill-rule: evenodd;
+}
+
+svg.embeddedIcon g.icon {
+    fill: none;
+}
+
+.ctrl-btns div svg.embeddedIcon g.icon use {
+    fill: #e0dfd6;
+}
+
+.ctrl-btns div.active svg.embeddedIcon g.icon use {
+    fill: #939598;
+}
+.ctrl-btns div.active:hover svg.embeddedIcon g.icon use {
+    fill: #ce5b58;
+}
+
+.ctrl-btns div.current-view svg.embeddedIcon g.icon rect {
+    fill: #518ecc;
+}
+.ctrl-btns div.current-view svg.embeddedIcon g.icon use {
+    fill: white;
+}
+
+svg.embeddedIcon .icon.active .glyph {
+    fill: #04bf34;
+}
+
+svg.embeddedIcon .icon.inactive .glyph {
+    fill: #c0242b;
+}
+
+svg.embeddedIcon .icon.active-rect .glyph {
+    fill:#939598;
+}
+
+svg.embeddedIcon .icon.active-sort .glyph {
+    fill:#333333;
+}
+
+svg.embeddedIcon g.icon.active-rect:hover use {
+    fill: #ce5b58;
+}
+
+svg.embeddedIcon g.icon.active-type .glyph {
+    fill: #3c3a3a;
+}
+
+svg.embeddedIcon g.icon.active-close:hover use {
+    fill: #ce5b58;
+}
+
+svg.embeddedIcon g.icon.active-close .glyph {
+    fill: #333333;
+}
+
+svg.embeddedIcon g.icon.details-icon .glyph {
+    fill: #0071bd;;
+}
+
+
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.html b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.html
new file mode 100644
index 0000000..a301c3c
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.html
@@ -0,0 +1,28 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~     http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+<div class="tooltip">
+<svg class="embeddedIcon" [attr.width]="iconSize" [attr.height]="iconSize" viewBox="0 0 50 50" (mouseover)="toolTipDisp = toolTip" (mouseout)="toolTipDisp = undefined">
+    <g class="icon" [ngClass]="classes">
+        <rect width="50" height="50" rx="5"></rect>
+        <use width="50" height="50" class="glyph" [attr.href]="iconTag()"></use>
+    </g>
+</svg>
+<!-- I'm fixing class as light as view encapsulation changes how the hirerarchy of css is handled -->
+
+<!-- <p id="tooltip" class="light" *ngIf="toolTip" [ngStyle]="{ 'display': toolTipDisp ? 'inline-block':'none'}">{{ toolTipDisp }}</p> -->
+
+    <span class="tooltiptext" [ngStyle]="{ 'display': toolTipDisp ? 'inline-block':'none'}">{{toolTipDisp}}</span>
+</div>
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.ts
new file mode 100644
index 0000000..5267aef
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.component.ts
@@ -0,0 +1,79 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Component, OnInit, OnChanges, Input } from '@angular/core';
+import { IconService, glyphMapping } from '../icon.service';
+import { LogService } from '../../log.service';
+
+/**
+ * Icon Component
+ *
+ * Note: This is an alternative to the Icon Directive from ONOS 1.0.0
+ * It has been implemented as a Component because it was inadvertently adding
+ * in a template through d3 DOM manipulations - it's better to make it a Comp
+ * and build a template the Angular 6 way
+ *
+ * Remember: The CSS files applied here only apply to this component
+ */
+@Component({
+  selector: 'onos-icon',
+  templateUrl: './icon.component.html',
+  styleUrls: [
+    './icon.component.css', './icon.theme.css',
+    './glyph.css', './glyph-theme.css',
+    './tooltip.css', './tooltip-theme.css'
+    ]
+})
+export class IconComponent implements OnInit, OnChanges {
+    @Input() iconId: string;
+    @Input() iconSize: number = 20;
+    @Input() toolTip: string = undefined;
+    @Input() classes: string = undefined;
+
+    // The displayed tooltip - undefined until mouse hovers over, then equals toolTip
+    toolTipDisp: string = undefined;
+
+    constructor(
+        private is: IconService,
+        private log: LogService
+    ) {
+        // Note: iconId is not available until initialization
+        this.log.debug('IconComponent constructed');
+    }
+
+    /**
+     * Icons are loaded in to the DOM under iconDefs
+     * TODO: Change this to use more standard Angular 6 mechanism
+     */
+    ngOnInit() {
+        this.is.loadIconDef(this.iconId);
+    }
+
+    /**
+     * This is needed in case the iconId changes while icon component
+     * is displayed on screen.
+     */
+    ngOnChanges() {
+        this.is.loadIconDef(this.iconId);
+    }
+
+    /**
+     * Get the corresponding iconTag from the glyphMapping in the iconService
+     * @returns The iconTag corresponding to the iconId of this instance
+     */
+    iconTag(): string {
+        return '#' + glyphMapping.get(this.iconId);
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.theme.css
new file mode 100644
index 0000000..f267b10
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/icon.theme.css
@@ -0,0 +1,108 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Icon Service (theme) -- CSS file
+ */
+
+div.close-btn svg.embeddedIcon g.icon .glyph {
+    fill: #333333;
+}
+
+/* Sortable table headers */
+div.tableColSort svg.embeddedIcon .icon .glyph {
+    fill: #353333;
+}
+
+/* --- Control Buttons --- */
+
+/* INACTIVE */
+svg.embeddedIcon g.icon use {
+    fill: #e0dfd6;
+}
+/* note: no change for inactive buttons when hovered */
+
+
+/* ACTIVE */
+.ctrl-btns div.active svg.embeddedIcon g.icon use {
+    fill: #939598;
+}
+
+svg.embeddedIcon g.icon.active:hover use {
+    fill: #ce5b58;
+}
+
+/* CURRENT-VIEW */
+svg.embeddedIcon g.icon.current-view rect {
+    fill: #518ecc;
+}
+svg.embeddedIcon g.icon.current-view use {
+    fill: white;
+}
+
+/* REFRESH */
+svg.embeddedIcon g.icon.refresh use {
+    fill: #cdeff2;
+}
+svg.embeddedIcon g.icon.refresh:hover use {
+    fill: #ce5b58;
+}
+svg.embeddedIcon g.icon.refresh.active use {
+    fill: #009fdb;
+}
+svg.embeddedIcon g.icon.refresh.active:hover use {
+    fill: #ce5b58;
+}
+
+
+/* ========== DARK Theme ========== */
+
+ div.close-btn svg.embeddedIcon g.icon .glyph {
+    fill: #8d8d8d;
+}
+
+ div.tableColSort svg.embeddedIcon .icon .glyph {
+    fill: #888888;
+}
+
+ /*svg.embeddedIcon .icon.active .glyph {
+    fill: #04bf34;
+}
+ svg.embeddedIcon .icon.inactive .glyph {
+    fill: #c0242b;
+}*/
+
+ table svg.embeddedIcon .icon .glyph {
+    fill: #9999aa;
+}
+
+/*
+svg.embeddedIcon g.icon .glyph {
+    fill: #007dc4;
+}
+
+svg.embeddedIcon:hover g.icon .glyph {
+    fill: #20b2ff;
+}
+*/
+
+svg.embeddedIcon g.icon.devIcon_SWITCH .glyph {
+    fill: #0071bd;;
+}
+
+svg.embeddedIcon g.icon.hostIcon_endstation .glyph {
+    fill: #0071bd;;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip-theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip-theme.css
new file mode 100644
index 0000000..bcdcd55
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip-theme.css
@@ -0,0 +1,30 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Tooltip Service (theme) -- CSS file
+ */
+.light#tooltip {
+    background-color: #dbeffc;
+    color: #3c3a3a;
+    border-color: #c7c7c0;
+}
+
+.dark#tooltip {
+    background-color: #3a3a60;
+    border-color: #6c6a6a;
+    color: #c7c7c0;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip.css
new file mode 100644
index 0000000..eda38d9
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/icon/tooltip.css
@@ -0,0 +1,61 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Tooltip Service (layout) -- CSS file
+ */
+
+#tooltip {
+    text-align: center;
+    font-size: 80%;
+    border: 1px solid;
+    padding: 5px;
+    position: absolute;
+    z-index: 5000;
+    display: inline-block;
+    pointer-events: none;
+    top: 40px;
+    right: auto;
+    /* width: 240px; */
+}
+
+.tooltip {
+    position: relative;
+    display: inline-block;
+}
+
+.tooltip .tooltiptext {
+    display: inline-block;
+    visibility: hidden;
+    background-color: #dbeffc;
+    color: #3c3a3a;
+    border-color: #c7c7c0;
+    text-align: center;
+    border-radius: 6px;
+    font-size: 80%;
+    padding: 5px;
+
+    /* Position the tooltip */
+    position: absolute;
+    z-index: 5000;
+    top: 42px;
+    right: 10%;
+    white-space: nowrap;
+}
+
+.tooltip:hover .tooltiptext {
+    visibility: visible;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/svgutil.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/svgutil.service.ts
new file mode 100644
index 0000000..13327fe
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/svg/svgutil.service.ts
@@ -0,0 +1,43 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+
+/**
+ * ONOS GUI -- SVG -- Util Service
+ *
+ * The SVG Util Service provides a miscellany of utility functions.
+ */
+@Injectable({
+    providedIn: 'root',
+})
+export class SvgUtilService {
+
+    constructor(
+        private fs: FnService,
+        private log: LogService
+    ) {
+        this.log.debug('SvgUtilService constructed');
+    }
+
+    translate(x: number[], y?: any): string {
+        if (this.fs.isA(x) && x.length === 2 && !y) {
+            return 'translate(' + x[0] + ',' + x[1] + ')';
+        }
+        return 'translate(' + x + ',' + y + ')';
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.spec.ts
new file mode 100644
index 0000000..5b86d56
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.spec.ts
@@ -0,0 +1,492 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { TestBed, inject } from '@angular/core/testing';
+
+import { LogService } from '../log.service';
+import { ConsoleLoggerService } from '../consolelogger.service';
+import { FnService } from './fn.service';
+import { ActivatedRoute, Params } from '@angular/router';
+import { of } from 'rxjs';
+import * as d3 from 'd3';
+
+class MockActivatedRoute extends ActivatedRoute {
+    constructor(params: Params) {
+        super();
+        this.queryParams = of(params);
+    }
+}
+
+/**
+ * ONOS GUI -- Util -- General Purpose Functions - Unit Tests
+ */
+describe('FnService', () => {
+    let ar: ActivatedRoute;
+    let fs: FnService;
+    let mockWindow: Window;
+    let logServiceSpy: jasmine.SpyObj<LogService>;
+
+    const someFunction = () => {};
+    const someArray = [1, 2, 3];
+    const someObject = { foo: 'bar'};
+    const someNumber = 42;
+    const someString = 'xyyzy';
+    const someDate = new Date();
+    const stringArray = ['foo', 'bar'];
+
+    beforeEach(() => {
+        const logSpy = jasmine.createSpyObj('LogService', ['debug', 'warn']);
+        ar = new MockActivatedRoute({'debug': 'TestService'});
+        mockWindow = <any>{
+            innerWidth: 400,
+            innerHeight: 200,
+            navigator: {
+                userAgent: 'defaultUA'
+            }
+        };
+
+
+        TestBed.configureTestingModule({
+            providers: [FnService,
+                { provide: LogService, useValue: logSpy },
+                { provide: ActivatedRoute, useValue: ar },
+                { provide: 'Window', useFactory: (() => mockWindow ) }
+            ]
+        });
+
+        fs = TestBed.get(FnService);
+        logServiceSpy = TestBed.get(LogService);
+    });
+
+    it('should be created', () => {
+        expect(fs).toBeTruthy();
+    });
+
+    // === Tests for isF()
+    it('isF(): null for undefined', () => {
+        expect(fs.isF(undefined)).toBeNull();
+    });
+
+    it('isF(): null for null', () => {
+        expect(fs.isF(null)).toBeNull();
+    });
+    it('isF(): the reference for function', () => {
+        expect(fs.isF(someFunction)).toBe(someFunction);
+    });
+    it('isF(): null for string', () => {
+        expect(fs.isF(someString)).toBeNull();
+    });
+    it('isF(): null for number', () => {
+        expect(fs.isF(someNumber)).toBeNull();
+    });
+    it('isF(): null for Date', () => {
+        expect(fs.isF(someDate)).toBeNull();
+    });
+    it('isF(): null for array', () => {
+        expect(fs.isF(someArray)).toBeNull();
+    });
+    it('isF(): null for object', () => {
+        expect(fs.isF(someObject)).toBeNull();
+    });
+
+    // === Tests for isA()
+    it('isA(): null for undefined', () => {
+        expect(fs.isA(undefined)).toBeNull();
+    });
+    it('isA(): null for null', () => {
+        expect(fs.isA(null)).toBeNull();
+    });
+    it('isA(): null for function', () => {
+        expect(fs.isA(someFunction)).toBeNull();
+    });
+    it('isA(): null for string', () => {
+        expect(fs.isA(someString)).toBeNull();
+    });
+    it('isA(): null for number', () => {
+        expect(fs.isA(someNumber)).toBeNull();
+    });
+    it('isA(): null for Date', () => {
+        expect(fs.isA(someDate)).toBeNull();
+    });
+    it('isA(): the reference for array', () => {
+        expect(fs.isA(someArray)).toBe(someArray);
+    });
+    it('isA(): null for object', () => {
+        expect(fs.isA(someObject)).toBeNull();
+    });
+
+    // === Tests for isS()
+    it('isS(): null for undefined', () => {
+        expect(fs.isS(undefined)).toBeNull();
+    });
+    it('isS(): null for null', () => {
+        expect(fs.isS(null)).toBeNull();
+    });
+    it('isS(): null for function', () => {
+        expect(fs.isS(someFunction)).toBeNull();
+    });
+    it('isS(): the reference for string', () => {
+        expect(fs.isS(someString)).toBe(someString);
+    });
+    it('isS(): null for number', () => {
+        expect(fs.isS(someNumber)).toBeNull();
+    });
+    it('isS(): null for Date', () => {
+        expect(fs.isS(someDate)).toBeNull();
+    });
+    it('isS(): null for array', () => {
+        expect(fs.isS(someArray)).toBeNull();
+    });
+    it('isS(): null for object', () => {
+        expect(fs.isS(someObject)).toBeNull();
+    });
+
+    // === Tests for isO()
+    it('isO(): null for undefined', () => {
+        expect(fs.isO(undefined)).toBeNull();
+    });
+    it('isO(): null for null', () => {
+        expect(fs.isO(null)).toBeNull();
+    });
+    it('isO(): null for function', () => {
+        expect(fs.isO(someFunction)).toBeNull();
+    });
+    it('isO(): null for string', () => {
+        expect(fs.isO(someString)).toBeNull();
+    });
+    it('isO(): null for number', () => {
+        expect(fs.isO(someNumber)).toBeNull();
+    });
+    it('isO(): null for Date', () => {
+        expect(fs.isO(someDate)).toBeNull();
+    });
+    it('isO(): null for array', () => {
+        expect(fs.isO(someArray)).toBeNull();
+    });
+    it('isO(): the reference for object', () => {
+        expect(fs.isO(someObject)).toBe(someObject);
+    });
+
+
+    // === Tests for contains()
+    it('contains(): false for non-array', () => {
+        expect(fs.contains(null, 1)).toBeFalsy();
+    });
+    it('contains(): true for contained item', () => {
+        expect(fs.contains(someArray, 1)).toBeTruthy();
+        expect(fs.contains(stringArray, 'bar')).toBeTruthy();
+    });
+    it('contains(): false for non-contained item', () => {
+        expect(fs.contains(someArray, 109)).toBeFalsy();
+        expect(fs.contains(stringArray, 'zonko')).toBeFalsy();
+    });
+
+    // === Tests for areFunctions()
+    it('areFunctions(): true for empty-array', () => {
+        expect(fs.areFunctions({}, [])).toBeTruthy();
+    });
+    it('areFunctions(): true for some api', () => {
+        expect(fs.areFunctions({
+            a: () => {},
+            b: () => {}
+        }, ['b', 'a'])).toBeTruthy();
+    });
+    it('areFunctions(): false for some other api', () => {
+        expect(fs.areFunctions({
+            a: () => {},
+            b: 'not-a-function'
+        }, ['b', 'a'])).toBeFalsy();
+    });
+    it('areFunctions(): extraneous stuff NOT ignored', () => {
+        expect(fs.areFunctions({
+            a: () => {},
+            b: () => {},
+            c: 1,
+            d: 'foo'
+        }, ['a', 'b'])).toBeFalsy();
+    });
+    it('areFunctions(): extraneous stuff ignored (alternate fn)', () => {
+        expect(fs.areFunctionsNonStrict({
+            a: () => {},
+            b: () => {},
+            c: 1,
+            d: 'foo'
+        }, ['a', 'b'])).toBeTruthy();
+    });
+
+    // == use the now-tested areFunctions() on our own api:
+    it('should define api functions', () => {
+        expect(fs.areFunctions(fs, [
+            'isF', 'isA', 'isS', 'isO', 'contains',
+            'areFunctions', 'areFunctionsNonStrict', 'windowSize',
+            'isMobile', 'isChrome', 'isChromeHeadless', 'isSafari',
+            'isFirefox', 'parseDebugFlags',
+            'debugOn', 'debug', 'find', 'inArray', 'removeFromArray',
+            'isEmptyObject', 'cap', 'noPx', 'noPxStyle', 'endsWith',
+            'inEvilList', 'analyze', 'sanitize', 'sameObjProps', 'containsObj'
+//            'find', 'inArray', 'removeFromArray', 'isEmptyObject', 'sameObjProps', 'containsObj', 'cap',
+//            'eecode', 'noPx', 'noPxStyle', 'endsWith', 'addToTrie', 'removeFromTrie', 'trieLookup',
+//            'classNames', 'extend', 'sanitize'
+        ])).toBeTruthy();
+    });
+
+
+    // === Tests for windowSize()
+    it('windowSize(): adjust height', () => {
+        const dim = fs.windowSize(50);
+        expect(dim.width).toEqual(400);
+        expect(dim.height).toEqual(150);
+    });
+
+    it('windowSize(): adjust width', () => {
+        const dim = fs.windowSize(0, 50);
+        expect(dim.width).toEqual(350);
+        expect(dim.height).toEqual(200);
+    });
+
+    it('windowSize(): adjust width and height', () => {
+        const dim = fs.windowSize(101, 201);
+        expect(dim.width).toEqual(199);
+        expect(dim.height).toEqual(99);
+    });
+
+    // === Tests for isMobile()
+    const uaMap = {
+        chrome: 'Mozilla/5.0 (Macintosh; Intel Mac OS X 10_10_2) ' +
+                'AppleWebKit/537.36 (KHTML, like Gecko) ' +
+                'Chrome/41.0.2272.89 Safari/537.36',
+
+        iPad: 'Mozilla/5.0 (iPad; CPU OS 7_0 like Mac OS X) ' +
+                'AppleWebKit/537.51.1 (KHTML, like Gecko) Version/7.0 ' +
+                'Mobile/11A465 Safari/9537.53',
+
+        iPhone: 'Mozilla/5.0 (iPhone; CPU iPhone OS 7_0 like Mac OS X) ' +
+                'AppleWebKit/537.51.1 (KHTML, like Gecko) Version/7.0 ' +
+                'Mobile/11A465 Safari/9537.53'
+    };
+
+    function setUa(key) {
+        const str = uaMap[key];
+        expect(str).toBeTruthy();
+        (<any>mockWindow.navigator).userAgent = str;
+    }
+
+    it('isMobile(): should be false for Chrome on Mac OS X', () => {
+        setUa('chrome');
+        expect(fs.isMobile()).toBe(false);
+    });
+    it('isMobile(): should be true for Safari on iPad', () => {
+        setUa('iPad');
+        expect(fs.isMobile()).toBe(true);
+    });
+    it('isMobile(): should be true for Safari on iPhone', () => {
+        setUa('iPhone');
+        expect(fs.isMobile()).toBe(true);
+    });
+
+    // === Tests for find()
+    const dataset = [
+        { id: 'foo', name: 'Furby'},
+        { id: 'bar', name: 'Barbi'},
+        { id: 'baz', name: 'Basil'},
+        { id: 'goo', name: 'Gabby'},
+        { id: 'zoo', name: 'Zevvv'}
+    ];
+
+    it('should not find ooo', () => {
+        expect(fs.find('ooo', dataset)).toEqual(-1);
+    });
+    it('should find foo', () => {
+        expect(fs.find('foo', dataset)).toEqual(0);
+    });
+    it('should find zoo', () => {
+        expect(fs.find('zoo', dataset)).toEqual(4);
+    });
+
+    it('should not find Simon', () => {
+        expect(fs.find('Simon', dataset, 'name')).toEqual(-1);
+    });
+    it('should find Furby', () => {
+        expect(fs.find('Furby', dataset, 'name')).toEqual(0);
+    });
+    it('should find Zevvv', () => {
+        expect(fs.find('Zevvv', dataset, 'name')).toEqual(4);
+    });
+
+
+    // === Tests for inArray()
+    const objRef = { x: 1, y: 2 };
+    const array = [1, 3.14, 'hey', objRef, 'there', true];
+    const array2 = ['b', 'a', 'd', 'a', 's', 's'];
+
+    it('should not find HOO', () => {
+        expect(fs.inArray('HOO', array)).toEqual(-1);
+    });
+    it('should find 1', () => {
+        expect(fs.inArray(1, array)).toEqual(0);
+    });
+    it('should find pi', () => {
+        expect(fs.inArray(3.14, array)).toEqual(1);
+    });
+    it('should find hey', () => {
+        expect(fs.inArray('hey', array)).toEqual(2);
+    });
+    it('should find the object', () => {
+        expect(fs.inArray(objRef, array)).toEqual(3);
+    });
+    it('should find there', () => {
+        expect(fs.inArray('there', array)).toEqual(4);
+    });
+    it('should find true', () => {
+        expect(fs.inArray(true, array)).toEqual(5);
+    });
+
+    it('should find the first occurrence A', () => {
+        expect(fs.inArray('a', array2)).toEqual(1);
+    });
+    it('should find the first occurrence S', () => {
+        expect(fs.inArray('s', array2)).toEqual(4);
+    });
+    it('should not find X', () => {
+        expect(fs.inArray('x', array2)).toEqual(-1);
+    });
+
+    // === Tests for removeFromArray()
+    it('should keep the array the same, for non-match', () => {
+        const array1 = [1, 2, 3];
+        expect(fs.removeFromArray(4, array1)).toBe(false);
+        expect(array1).toEqual([1, 2, 3]);
+    });
+    it('should remove a value', () => {
+        const array1a = [1, 2, 3];
+        expect(fs.removeFromArray(2, array1a)).toBe(true);
+        expect(array1a).toEqual([1, 3]);
+    });
+    it('should remove the first occurrence', () => {
+        const array1b = ['x', 'y', 'z', 'z', 'y'];
+        expect(fs.removeFromArray('y', array1b)).toBe(true);
+        expect(array1b).toEqual(['x', 'z', 'z', 'y']);
+        expect(fs.removeFromArray('x', array1b)).toBe(true);
+        expect(array1b).toEqual(['z', 'z', 'y']);
+    });
+
+    // === Tests for isEmptyObject()
+    it('should return true if an object is empty', () => {
+        expect(fs.isEmptyObject({})).toBe(true);
+    });
+    it('should return false if an object is not empty', () => {
+        expect(fs.isEmptyObject({foo: 'bar'})).toBe(false);
+    });
+
+    // === Tests for cap()
+    it('should ignore non-alpha', () => {
+        expect(fs.cap('123')).toEqual('123');
+    });
+    it('should capitalize first char', () => {
+        expect(fs.cap('Foo')).toEqual('Foo');
+        expect(fs.cap('foo')).toEqual('Foo');
+        expect(fs.cap('foo bar')).toEqual('Foo bar');
+        expect(fs.cap('FOO BAR')).toEqual('Foo bar');
+        expect(fs.cap('foo Bar')).toEqual('Foo bar');
+    });
+
+    // === Tests for noPx()
+    it('should return the value without px suffix', () => {
+        expect(fs.noPx('10px')).toBe(10);
+        expect(fs.noPx('500px')).toBe(500);
+        expect(fs.noPx('-80px')).toBe(-80);
+    });
+
+    // === Tests for noPxStyle()
+    it('should give a style\'s property without px suffix', () => {
+        const d3Elem = d3.select('body')
+            .append('div')
+            .attr('id', 'fooElem')
+            .style('width', '500px')
+            .style('height', '200px')
+            .style('font-size', '12px');
+        expect(fs.noPxStyle(d3Elem, 'width')).toBe(500);
+        expect(fs.noPxStyle(d3Elem, 'height')).toBe(200);
+        expect(fs.noPxStyle(d3Elem, 'font-size')).toBe(12);
+        d3.select('#fooElem').remove();
+    });
+
+    // === Tests for endsWith()
+    it('should return true if string ends with foo', () => {
+        expect(fs.endsWith('barfoo', 'foo')).toBe(true);
+    });
+
+    it('should return false if string doesnt end with foo', () => {
+        expect(fs.endsWith('barfood', 'foo')).toBe(false);
+    });
+
+    // === Tests for sanitize()
+    it('should return foo', () => {
+        expect(fs.sanitize('foo')).toEqual('foo');
+    });
+    it('should retain < b > tags', () => {
+        const str = 'foo <b>bar</b> baz';
+        expect(fs.sanitize(str)).toEqual(str);
+    });
+    it('should retain < i > tags', () => {
+        const str = 'foo <i>bar</i> baz';
+        expect(fs.sanitize(str)).toEqual(str);
+    });
+    it('should retain < p > tags', () => {
+        const str = 'foo <p>bar</p> baz';
+        expect(fs.sanitize(str)).toEqual(str);
+    });
+    it('should retain < em > tags', () => {
+        const str = 'foo <em>bar</em> baz';
+        expect(fs.sanitize(str)).toEqual(str);
+    });
+    it('should retain < strong > tags', () => {
+        const str = 'foo <strong>bar</strong> baz';
+        expect(fs.sanitize(str)).toEqual(str);
+    });
+
+    it('should reject < a > tags', () => {
+        expect(fs.sanitize('test <a href="hah">something</a> this'))
+            .toEqual('test something this');
+    });
+
+    it('should log a warning for < script > tags', () => {
+        expect(fs.sanitize('<script>alert("foo");</script>'))
+            .toEqual('');
+        expect(logServiceSpy.warn).toHaveBeenCalledWith(
+            'Unsanitary HTML input -- <script> detected!'
+        );
+    });
+    it('should log a warning for < style > tags', () => {
+        expect(fs.sanitize('<style> h1 {color:red;} </style>'))
+            .toEqual('');
+        expect(logServiceSpy.warn).toHaveBeenCalledWith(
+            'Unsanitary HTML input -- <style> detected!'
+        );
+    });
+
+    it('should log a warning for < iframe > tags', () => {
+        expect(fs.sanitize('Foo<iframe><body><h1>fake</h1></body></iframe>Bar'))
+            .toEqual('FooBar');
+        expect(logServiceSpy.warn).toHaveBeenCalledWith(
+            'Unsanitary HTML input -- <iframe> detected!'
+        );
+    });
+
+    it('should completely strip < script >, remove < a >, retain < i >', () => {
+        expect(fs.sanitize('Hey <i>this</i> is <script>alert("foo");</script> <a href="meh">cool</a>'))
+            .toEqual('Hey <i>this</i> is  cool');
+    });
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.ts
new file mode 100644
index 0000000..506ce74
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/fn.service.ts
@@ -0,0 +1,564 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable, Inject } from '@angular/core';
+import { ActivatedRoute, Router} from '@angular/router';
+import { LogService } from '../log.service';
+
+// Angular>=2 workaround for missing definition
+declare const InstallTrigger: any;
+
+const matcher = /<\/?([a-zA-Z0-9]+)*(.*?)\/?>/igm;
+const whitelist: string[] = ['b', 'i', 'p', 'em', 'strong', 'br'];
+const evillist: string[] = ['script', 'style', 'iframe'];
+
+/**
+ * Used with the Window size function;
+ **/
+export interface WindowSize {
+    width: number;
+    height: number;
+}
+
+/**
+ * For the sanitize() and analyze() functions
+ */
+export interface Match {
+    full: string;
+    name: string;
+}
+
+// TODO Move all this trie stuff to its own class
+// Angular>=2 Tightened up on types to avoid compiler errors
+interface TrieC {
+    p: any;
+    s: string[];
+}
+// trie operation
+function _trieOp(op: string, trie, word: string, data) {
+    const p = trie;
+    const w: string = word.toUpperCase();
+    const s: Array<string> = w.split('');
+    let c: TrieC = { p: p, s: s };
+    let t = [];
+    let  x = 0;
+    const f1 = op === '+' ? add : probe;
+    const f2 = op === '+' ? insert : remove;
+
+    function add(cAdded): TrieC {
+        const q = cAdded.s.shift();
+        let np = cAdded.p[q];
+
+        if (!np) {
+            cAdded.p[q] = {};
+            np = cAdded.p[q];
+            x = 1;
+        }
+        return { p: np, s: cAdded.s };
+    }
+
+    function probe(cProbed): TrieC {
+        const q = cProbed.s.shift();
+        const k: number = Object.keys(cProbed.p).length;
+        const np = cProbed.p[q];
+
+        t.push({ q: q, k: k, p: cProbed.p });
+        if (!np) {
+            t = [];
+            return { p: [], s: [] };
+        }
+        return { p: np, s: cProbed.s };
+    }
+
+    function insert() {
+        c.p._data = data;
+        return x ? 'added' : 'updated';
+    }
+
+    function remove() {
+        if (t.length) {
+            t = t.reverse();
+            while (t.length) {
+                const d = t.shift();
+                delete d.p[d.q];
+                if (d.k > 1) {
+                    t = [];
+                }
+            }
+            return 'removed';
+        }
+        return 'absent';
+    }
+
+    while (c.s.length) {
+        c = f1(c);
+    }
+    return f2();
+}
+
+// add word to trie (word will be converted to uppercase)
+// data associated with the word
+// returns 'added' or 'updated'
+function addToTrie(trie, word, data) {
+    return _trieOp('+', trie, word, data);
+}
+
+// remove word from trie (word will be converted to uppercase)
+// returns 'removed' or 'absent'
+// Angular>=2 added in quotes for data. error TS2554: Expected 4 arguments, but got 3.
+function removeFromTrie(trie, word) {
+    return _trieOp('-', trie, word, '');
+}
+
+// lookup word (converted to uppercase) in trie
+// returns:
+//    undefined if the word is not in the trie
+//    -1 for a partial match (word is a prefix to an existing word)
+//    data for the word for an exact match
+function trieLookup(trie, word) {
+    const s = word.toUpperCase().split('');
+    let p = trie;
+    let n;
+
+    while (s.length) {
+        n = s.shift();
+        p = p[n];
+        if (!p) {
+            return undefined;
+        }
+    }
+    if (p._data) {
+        return p._data;
+    }
+    return -1;
+}
+
+
+/**
+ * ONOS GUI -- Util -- General Purpose Functions
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class FnService {
+    // internal state
+    private debugFlags = new Map<string, boolean>([
+//        [ "LoadingService", true ]
+    ]);
+
+    constructor(
+        private route: ActivatedRoute,
+        private log: LogService,
+        // TODO: Change the any type to Window when https://github.com/angular/angular/issues/15640 is fixed.
+        @Inject('Window') private w: any
+    ) {
+        this.route.queryParams.subscribe(params => {
+            const debugparam: string = params['debug'];
+//            log.debug('Param:', debugparam);
+            this.parseDebugFlags(debugparam);
+        });
+//        this.log.debug('FnService constructed');
+    }
+
+    /**
+     * Test if an argument is a function
+     *
+     * Note: the need for this would go away if all functions
+     * were strongly typed
+     */
+    isF(f: any): any {
+        return typeof f === 'function' ? f : null;
+    }
+
+    /**
+     * Test if an argument is an array
+     *
+     * Note: the need for this would go away if all arrays
+     * were strongly typed
+     */
+    isA(a: any): any {
+    // NOTE: Array.isArray() is part of EMCAScript 5.1
+        return Array.isArray(a) ? a : null;
+    }
+
+    /**
+     * Test if an argument is a string
+     *
+     * Note: the need for this would go away if all strings
+     * were strongly typed
+     */
+    isS(s: any): string {
+        return typeof s === 'string' ? s : null;
+    }
+
+    /**
+     * Test if an argument is an object
+     *
+     * Note: the need for this would go away if all objects
+     * were strongly typed
+     */
+    isO(o: any): Object {
+        return (o && typeof o === 'object' && o.constructor === Object) ? o : null;
+    }
+
+    /**
+     * Test that an array contains an object
+     */
+    contains(a: any[], x: any): boolean {
+        return this.isA(a) && a.indexOf(x) > -1;
+    }
+
+    /**
+     * Returns width and height of window inner dimensions.
+     * offH, offW : offset width/height are subtracted, if present
+     */
+    windowSize(offH: number = 0, offW: number = 0): WindowSize {
+        return {
+            height: this.w.innerHeight - offH,
+            width: this.w.innerWidth - offW
+        };
+    }
+
+    /**
+     * Returns true if all names in the array are defined as functions
+     * on the given api object; false otherwise.
+     * Also returns false if there are properties on the api that are NOT
+     * listed in the array of names.
+     *
+     * This gets extra complicated when the api Object is an
+     * Angular service - while the functions can be retrieved
+     * by an indexed get, the ownProperties does not show the
+     * functions of the class. We have to dive in to the prototypes
+     * properties to get these - and even then we have to filter
+     * out the constructor and any member variables
+     */
+    areFunctions(api: Object, fnNames: string[]): boolean {
+        const fnLookup: Map<string, boolean> = new Map();
+        let extraFound: boolean = false;
+
+        if (!this.isA(fnNames)) {
+            return false;
+        }
+
+        const n: number = fnNames.length;
+        let i: number;
+        let name: string;
+
+        for (i = 0; i < n; i++) {
+            name = fnNames[i];
+            if (!this.isF(api[name])) {
+                return false;
+            }
+            fnLookup.set(name, true);
+        }
+
+        // check for properties on the API that are not listed in the array,
+        const keys = Object.getOwnPropertyNames(api);
+        if (keys.length === 0) {
+            return true;
+        }
+        // If the api is a class it will have a name,
+        //  else it will just be called 'Object'
+        const apiObjectName: string = api.constructor.name;
+        if (apiObjectName === 'Object') {
+            Object.keys(api).forEach((key) => {
+                if (!fnLookup.get(key)) {
+                    extraFound = true;
+                }
+            });
+        } else { // It is a class, so its functions will be in the child (prototype)
+            const pObj: Object = Object.getPrototypeOf(api);
+            for ( const key in Object.getOwnPropertyDescriptors(pObj) ) {
+                if (key === 'constructor') { // Filter out constructor
+                    continue;
+                }
+                const value = Object.getOwnPropertyDescriptor(pObj, key);
+                // Only compare functions. Look for any not given in the map
+                if (this.isF(value.value) && !fnLookup.get(key)) {
+                    extraFound = true;
+                }
+            }
+        }
+        return !extraFound;
+    }
+
+    /**
+     * Returns true if all names in the array are defined as functions
+     * on the given api object; false otherwise. This is a non-strict version
+     * that does not care about other properties on the api.
+     */
+    areFunctionsNonStrict(api, fnNames): boolean {
+        if (!this.isA(fnNames)) {
+            return false;
+        }
+        const n = fnNames.length;
+        let i;
+        let name;
+
+        for (i = 0; i < n; i++) {
+            name = fnNames[i];
+            if (!this.isF(api[name])) {
+                return false;
+            }
+        }
+        return true;
+    }
+
+    /**
+     * Returns true if current browser determined to be a mobile device
+     */
+    isMobile() {
+        const ua = this.w.navigator.userAgent;
+        const patt = /iPhone|iPod|iPad|Silk|Android|BlackBerry|Opera Mini|IEMobile/;
+        return patt.test(ua);
+    }
+
+    /**
+     * Returns true if the current browser determined to be Chrome
+     */
+    isChrome() {
+        const isChromium = (this.w as any).chrome;
+        const vendorName = this.w.navigator.vendor;
+
+        const isOpera = this.w.navigator.userAgent.indexOf('OPR') > -1;
+        return (isChromium !== null &&
+        isChromium !== undefined &&
+        vendorName === 'Google Inc.' &&
+        isOpera === false);
+    }
+
+    isChromeHeadless() {
+        const vendorName = this.w.navigator.vendor;
+        const headlessChrome = this.w.navigator.userAgent.indexOf('HeadlessChrome') > -1;
+
+        return (vendorName === 'Google Inc.' && headlessChrome === true);
+    }
+
+    /**
+     * Returns true if the current browser determined to be Safari
+     */
+    isSafari() {
+        return (this.w.navigator.userAgent.indexOf('Safari') !== -1 &&
+        this.w.navigator.userAgent.indexOf('Chrome') === -1);
+    }
+
+    /**
+     * Returns true if the current browser determined to be Firefox
+     */
+    isFirefox() {
+        return typeof InstallTrigger !== 'undefined';
+    }
+
+    /**
+     * search through an array of objects, looking for the one with the
+     * tagged property matching the given key. tag defaults to 'id'.
+     * returns the index of the matching object, or -1 for no match.
+     */
+    find(key: string, array: Object[], tag: string = 'id'): number {
+        let idx: number;
+        const n: number = array.length;
+
+        for (idx = 0 ; idx < n; idx++) {
+            const d: Object = array[idx];
+            if (d[tag] === key) {
+                return idx;
+            }
+        }
+        return -1;
+    }
+
+    /**
+     * search through array to find (the first occurrence of) item,
+     * returning its index if found; otherwise returning -1.
+     */
+    inArray(item: any, array: any[]): number {
+        if (this.isA(array)) {
+            for (let i = 0; i < array.length; i++) {
+                if (array[i] === item) {
+                    return i;
+                }
+            }
+        }
+        return -1;
+    }
+
+    /**
+     * remove (the first occurrence of) the specified item from the given
+     * array, if any. Return true if the removal was made; false otherwise.
+     */
+    removeFromArray(item: any, array: any[]): boolean {
+        const i: number = this.inArray(item, array);
+        if (i >= 0) {
+            array.splice(i, 1);
+            return true;
+        }
+        return false;
+    }
+
+    /**
+     * return true if the object is empty, return false otherwise
+     */
+    isEmptyObject(obj: Object): boolean {
+        for (const key in obj) {
+            if (true) { return false; }
+        }
+        return true;
+    }
+
+    /**
+     * returns true if the two objects have all the same properties
+     */
+    sameObjProps(obj1: Object, obj2: Object): boolean {
+        for (const key in obj1) {
+            if (obj1.hasOwnProperty(key)) {
+                if (!(obj1[key] === obj2[key])) {
+                    return false;
+                }
+            }
+        }
+        return true;
+    }
+
+    /**
+     * returns true if the array contains the object
+     * does NOT use strict object reference equality,
+     * instead checks each property individually for equality
+     */
+    containsObj(arr: any[], obj: Object): boolean {
+        const len = arr.length;
+        for (let i = 0; i < len; i++) {
+            if (this.sameObjProps(arr[i], obj)) {
+                return true;
+            }
+        }
+        return false;
+    }
+
+    /**
+     * Return the given string with the first character capitalized.
+     */
+    cap(s: string): string {
+        return s ? s[0].toUpperCase() + s.slice(1).toLowerCase() : s;
+    }
+
+    /**
+     * return the parameter without a px suffix
+     */
+    noPx(num: string): number {
+        return Number(num.replace(/px$/, ''));
+    }
+
+    /**
+     * return an element's given style property without px suffix
+     */
+    noPxStyle(elem: any, prop: string): number {
+        return Number(elem.style(prop).replace(/px$/, ''));
+    }
+
+    /**
+     * Return true if a str ends with suffix
+     */
+    endsWith(str: string, suffix: string) {
+        return str.indexOf(suffix, str.length - suffix.length) !== -1;
+    }
+
+    /**
+     * output debug message to console, if debug tag set...
+     * e.g. fs.debug('mytag', arg1, arg2, ...)
+     */
+    debug(tag, ...args) {
+        if (this.debugFlags.get(tag)) {
+//            this.log.debug(tag, args.join());
+        }
+    }
+
+    private parseDebugFlags(dbgstr: string): void {
+        const bits = dbgstr ? dbgstr.split(',') : [];
+        bits.forEach((key) => {
+            this.debugFlags.set(key, true);
+        });
+//        this.log.debug('Debug flags:', dbgstr);
+    }
+
+    /**
+      * Return true if the given debug flag was specified in the query params
+      */
+    debugOn(tag: string): boolean {
+        return this.debugFlags.get(tag);
+    }
+
+
+
+    // -----------------------------------------------------------------
+    // The next section deals with sanitizing external strings destined
+    // to be loaded via a .html() function call.
+    //
+    // See definition of matcher, evillist and whitelist at the top of this file
+
+    /*
+     * Returns true if the tag is in the evil list, (and is not an end-tag)
+     */
+    inEvilList(tag: any): boolean {
+        return (evillist.indexOf(tag.name) !== -1 && tag.full.indexOf('/') === -1);
+    }
+
+    /*
+     * Returns an array of Matches of matcher in html
+     */
+    analyze(html: string): Match[] {
+        const matches: Match[] = [];
+        let match;
+
+        // extract all tags
+        while ((match = matcher.exec(html)) !== null) {
+            matches.push({
+                full: match[0],
+                name: match[1],
+                // NOTE: ignoring attributes {match[2].split(' ')} for now
+            });
+        }
+
+        return matches;
+    }
+
+    /*
+     * Returns a cleaned version of html
+     */
+    sanitize(html: string): string {
+        const matches: Match[] = this.analyze(html);
+
+        // completely obliterate evil tags and their contents...
+        evillist.forEach((tag) => {
+            const re = new RegExp('<' + tag + '(.*?)>(.*?[\r\n])*?(.*?)(.*?[\r\n])*?<\/' + tag + '>', 'gim');
+            html = html.replace(re, '');
+        });
+
+        // filter out all but white-listed tags and end-tags
+        matches.forEach((tag) => {
+            if (whitelist.indexOf(tag.name) === -1) {
+                html = html.replace(tag.full, '');
+                if (this.inEvilList(tag)) {
+                    this.log.warn('Unsanitary HTML input -- ' +
+                        tag.full + ' detected!');
+                }
+            }
+        });
+
+        // TODO: consider encoding HTML entities, e.g. '&' -> '&amp;'
+
+        return html;
+    }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/lion.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/lion.service.ts
new file mode 100644
index 0000000..b8cde73
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/lion.service.ts
@@ -0,0 +1,90 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ *
+ */
+import { Injectable } from '@angular/core';
+import { LogService } from '../log.service';
+import { WebSocketService } from '../remote/websocket.service';
+
+/**
+ * A definition of Lion data
+ */
+export interface Lion {
+    locale: any;
+    lion: any;
+}
+
+/**
+ * ONOS GUI -- Lion -- Localization Utilities
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class LionService {
+
+    ubercache: any[] = [];
+    loadCbs = new Map<string, () => void>([]); // A map of functions
+
+    /**
+     * Handler for uberlion event from WSS
+     */
+    uberlion(data: Lion) {
+        this.ubercache = data.lion;
+
+        this.log.info('LION service: Locale... [' + data.locale + ']');
+        this.log.info('LION service: Bundles installed...');
+
+        for (const p in this.ubercache) {
+            if (this.ubercache[p]) {
+                this.log.info('            :=> ', p);
+            }
+        }
+        // If any component had registered a callback, call it now
+        // that LION is loaded
+        for (const cbname of this.loadCbs.keys()) {
+            this.log.debug('Updating', cbname, 'with LION');
+            this.loadCbs.get(cbname)();
+        }
+
+        this.log.debug('LION service: uber-lion bundle received:', data);
+    }
+
+    constructor(
+        private log: LogService,
+        private wss: WebSocketService
+    ) {
+        this.wss.bindHandlers(new Map<string, (data) => void>([
+            ['uberlion', (data) => this.uberlion(data) ]
+        ]));
+        this.log.debug('LionService constructed');
+    }
+
+    /**
+     * Returns a lion bundle (function) for the given bundle ID (string)
+     * returns a function that takes a string and returns a string
+     */
+    bundle(bundleId: string): (string) => string {
+        let bundleObj = this.ubercache[bundleId];
+
+        if (!bundleObj) {
+            this.log.warn('No lion bundle registered:', bundleId);
+            bundleObj = {};
+        }
+
+        return (key) =>  {
+            return bundleObj[key] || '%' + key + '%';
+        };
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/prefs.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/prefs.service.ts
new file mode 100644
index 0000000..8145921
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/prefs.service.ts
@@ -0,0 +1,117 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { FnService } from './fn.service';
+import { LogService } from '../log.service';
+import { WebSocketService } from '../remote/websocket.service';
+
+/**
+ * ONOS GUI -- Util -- User Preference Service
+ */
+@Injectable({
+    providedIn: 'root',
+})
+export class PrefsService {
+    protected Prefs;
+    protected handlers: string[] = [];
+    cache: any;
+    listeners: any;
+    constructor(
+        protected fs: FnService,
+        protected log: LogService,
+        protected wss: WebSocketService
+    ) {
+        this.cache = {};
+        this.wss.bindHandlers(new Map<string, (data) => void>([
+            [this.Prefs, (data) => this.updatePrefs(data)]
+        ]));
+        this.handlers.push(this.Prefs);
+
+        this.log.debug('PrefsService constructed');
+    }
+
+    setPrefs(name: string, obj: any) {
+        // keep a cached copy of the object and send an update to server
+        this.cache[name] = obj;
+        this.wss.sendEvent('updatePrefReq', { key: name, value: obj });
+    }
+    updatePrefs(data: any) {
+        this.cache = data;
+        this.listeners.forEach(function (lsnr) { lsnr(); });
+    }
+
+    asNumbers(obj: any, keys?: any, not?: any) {
+        if (!obj) {
+            return null;
+        }
+
+        const skip = {};
+        if (not) {
+            keys.forEach(k => {
+                skip[k] = 1;
+            }
+            );
+        }
+
+        if (!keys || not) {
+            // do them all
+            Array.from(obj).forEach((v, k) => {
+                if (!not || !skip[k]) {
+                    obj[k] = Number(obj[k]);
+                }
+            });
+        } else {
+            // do the explicitly named keys
+            keys.forEach(k => {
+                obj[k] = Number(obj[k]);
+            });
+        }
+        return obj;
+    }
+
+    getPrefs(name: string, defaults: any, qparams?: string) {
+        const obj = Object.assign({}, defaults || {}, this.cache[name] || {});
+
+        // if query params are specified, they override...
+        if (this.fs.isO(qparams)) {
+            obj.forEach(k => {
+                if (qparams.hasOwnProperty(k)) {
+                    obj[k] = qparams[k];
+                }
+            });
+        }
+        return obj;
+    }
+
+    // merge preferences:
+    // The assumption here is that obj is a sparse object, and that the
+    //  defined keys should overwrite the corresponding values, but any
+    //  existing keys that are NOT explicitly defined here should be left
+    //  alone (not deleted).
+    mergePrefs(name: string, obj: any) {
+        const merged = this.cache[name] || {};
+        this.setPrefs(name, Object.assign(merged, obj));
+    }
+
+    addListener(listener: any) {
+        this.listeners.push(listener);
+    }
+
+    removeListener(listener: any) {
+        this.listeners = this.listeners.filter(function (obj) { return obj === listener; });
+    }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/theme.service.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/theme.service.ts
new file mode 100644
index 0000000..993d9f3
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/util/theme.service.ts
@@ -0,0 +1,44 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Injectable } from '@angular/core';
+import { LogService } from '../log.service';
+
+
+/**
+ * ONOS GUI -- Util -- Theme Service
+ */
+@Injectable({
+  providedIn: 'root',
+})
+export class ThemeService {
+    themes: string[] = ['light', 'dark'];
+    thidx = 0;
+
+    constructor(
+        private log: LogService
+    ) {
+        this.log.debug('ThemeService constructed');
+    }
+
+    getTheme(): string {
+        return this.themes[this.thidx];
+    }
+
+    themeStr(): string {
+        return this.themes.join(' ');
+    }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/detailspanel.base.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/detailspanel.base.ts
new file mode 100644
index 0000000..11dc8c9
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/detailspanel.base.ts
@@ -0,0 +1,114 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { FnService } from '../util/fn.service';
+import { LoadingService } from '../layer/loading.service';
+import { LogService } from '../log.service';
+import { WebSocketService } from '../remote/websocket.service';
+
+import { PanelBaseImpl } from './panel.base';
+import { Output, EventEmitter, Input } from '@angular/core';
+
+/**
+ * A generic model of the data returned from the *DetailsResponse
+ */
+export interface DetailsResponse {
+    details: any;
+}
+
+/**
+ * Extends the PanelBase abstract class specifically for showing details
+ *
+ * This makes another call through WSS to the server for specific
+ * details to fill the panel with
+ *
+ * This replaces the detailspanel service in the old gui
+ */
+export abstract class DetailsPanelBaseImpl extends PanelBaseImpl {
+
+    @Input() id: string;
+    @Output() closeEvent = new EventEmitter<string>();
+
+    private root: string;
+    private req: string;
+    private resp: string;
+    private handlers: string[] = [];
+    public detailsData: any = {};
+    public closed: boolean = false;
+
+    constructor(
+        protected fs: FnService,
+        protected ls: LoadingService,
+        protected log: LogService,
+        protected wss: WebSocketService,
+        protected tag: string,
+    ) {
+        super(fs, ls, log, wss, {});
+        this.root = tag + 's';
+        this.req = tag + 'DetailsRequest';
+        this.resp = tag + 'DetailsResponse';
+    }
+
+    /**
+     * When the details panel is created set up a listener on
+     * Web Socket for details responses
+     */
+    init() {
+        this.wss.bindHandlers(new Map<string, (data) => void>([
+            [this.resp, (data) => this.detailsPanelResponseCb(data)]
+        ]));
+        this.handlers.push(this.resp);
+    }
+
+    /**
+     * When the details panel is destroyed this should be called to
+     * de-register from the WebSocket
+     */
+    destroy() {
+        this.wss.unbindHandlers(this.handlers);
+    }
+
+    /**
+     * A callback that executes when the details data that was requested
+     * on WebSocketService arrives.
+     */
+    detailsPanelResponseCb(data: DetailsResponse) {
+        this.detailsData = data['details'];
+    }
+
+    /**
+     * Details Panel Data Request - should be called whenever row id changes
+     */
+    requestDetailsPanelData(query: any) {
+        this.closed = false;
+        // Do not send if the Web Socket hasn't opened
+        if (this.wss.isConnected()) {
+            if (this.fs.debugOn('panel')) {
+                this.log.debug('Details panel data REQUEST:', this.req, query);
+            }
+            this.wss.sendEvent(this.req, query);
+        }
+    }
+
+    /**
+     * this should be called when the details panel close button is clicked
+     */
+    close(): void {
+        this.closed = true;
+        this.id = null;
+        this.closeEvent.emit(this.id);
+    }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel-theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel-theme.css
new file mode 100644
index 0000000..2291136
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel-theme.css
@@ -0,0 +1,66 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Panel Service (theme) -- CSS file
+ */
+
+.light .floatpanel {
+    background-color: white;
+    color: #3c3a3a;
+    border: 1px solid #c7c7c0;
+}
+
+.light .floatpanel hr {
+    border: 1px solid #c7c7c0;
+}
+
+.light .floatpanel .bottom tr:nth-child(odd) {
+    background-color: #f4f4f4;
+}
+
+.light .floatpanel .bottom tr:nth-child(even) {
+    background-color: #fbfbfb;
+}
+
+
+/* ========== DARK Theme ========== */
+
+.dark .floatpanel {
+    background-color: #282528;
+    color: #888c8c;
+    border: 1px solid #364144;
+}
+
+.dark .floatpanel th {
+    background-color: #242424;
+}
+
+.dark .floatpanel h2 {
+    color: #dddddd;
+}
+
+.dark .floatpanel hr {
+    border: 1px solid #30303a;
+}
+
+.dark .floatpanel .bottom tr:nth-child(odd) {
+    background-color: #333333;
+}
+
+.dark .floatpanel .bottom tr:nth-child(even) {
+    background-color: #3a3a3a;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.base.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.base.ts
new file mode 100644
index 0000000..90cdfd5
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.base.ts
@@ -0,0 +1,167 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { FnService } from '../util/fn.service';
+import { LoadingService } from '../layer/loading.service';
+import { LogService } from '../log.service';
+import { WebSocketService } from '../remote/websocket.service';
+
+
+const noop = (): any => undefined;
+
+/**
+ ********* Static functions *********
+ */
+function margin(p) {
+    return p.settings.margin;
+}
+
+function hideMargin(p) {
+    return p.settings.hideMargin;
+}
+
+function noPx(p, what) {
+    return Number(p.el.style(what).replace(/px$/, ''));
+}
+
+function widthVal(p) {
+    return noPx(p, 'width');
+}
+
+function heightVal(p) {
+    return noPx(p, 'height');
+}
+
+function pxShow(p) {
+    return margin(p) + 'px';
+}
+
+function pxHide(p) {
+    return (-hideMargin(p) - widthVal(p) - (noPx(p, 'padding') * 2)) + 'px';
+}
+
+
+/**
+ * Base model of panel view - implemented by Panel components
+ */
+export interface PanelBase {
+    showPanel(cb: any): void;
+    hidePanel(cb: any): void;
+    togglePanel(cb: any): void;
+    emptyPanel(): void;
+    appendPanel(what: any): void;
+    panelWidth(w: number): number;
+    panelHeight(h: number): number;
+    panelBBox(): string;
+    panelIsVisible(): boolean;
+    classed(cls: any, bool: boolean): boolean;
+    panelEl(): any;
+}
+
+/**
+ * ONOS GUI -- Widget -- Panel Base class
+ *
+ * Replacing the panel service in the old implementation
+ */
+export abstract class PanelBaseImpl implements PanelBase {
+
+    protected on: boolean;
+    protected el: any;
+
+    constructor(
+        protected fs: FnService,
+        protected ls: LoadingService,
+        protected log: LogService,
+        protected wss: WebSocketService,
+        protected settings: any
+    ) {
+//        this.log.debug('Panel base class constructed');
+    }
+
+    showPanel(cb) {
+        const endCb = this.fs.isF(cb) || noop;
+        this.on = true;
+        this.el.transition().duration(this.settings.xtnTime)
+            .each('end', endCb)
+            .style(this.settings.edge, pxShow(this))
+            .style('opacity', 1);
+    }
+
+    hidePanel(cb) {
+        const endCb = this.fs.isF(cb) || noop;
+        const endOpacity = this.settings.fade ? 0 : 1;
+        this.on = false;
+        this.el.transition().duration(this.settings.xtnTime)
+            .each('end', endCb)
+            .style(this.settings.edge, pxHide(this))
+            .style('opacity', endOpacity);
+    }
+
+    togglePanel(cb): boolean {
+        if (this.on) {
+            this.hidePanel(cb);
+        } else {
+            this.showPanel(cb);
+        }
+        return this.on;
+    }
+
+    emptyPanel(): string {
+        return this.el.text('');
+    }
+
+    appendPanel(what) {
+        return this.el.append(what);
+    }
+
+    panelWidth(w: number): number {
+        if (w === undefined) {
+            return widthVal(this);
+        }
+        this.el.style('width', w + 'px');
+    }
+
+    panelHeight(h: number): number {
+        if (h === undefined) {
+            return heightVal(this);
+        }
+        this.el.style('height', h + 'px');
+    }
+
+    panelBBox(): string {
+        return this.el.node().getBoundingClientRect();
+    }
+
+    panelIsVisible(): boolean {
+        return this.on;
+    }
+
+    classed(cls, bool): boolean {
+        return this.el.classed(cls, bool);
+    }
+
+    panelEl() {
+        return this.el;
+    }
+
+
+    /**
+     * A dummy implementation of the lionFn until the response is received and the LION
+     * bundle is received from the WebSocket
+     */
+    dummyLion(key: string): string {
+        return '%' + key + '%';
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.css
new file mode 100644
index 0000000..77fa9f4
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/panel.css
@@ -0,0 +1,61 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ ONOS GUI -- Panel Service (layout) -- CSS file
+ */
+
+.floatpanel {
+    position: absolute;
+    z-index: 100;
+    display: block;
+    top: 160px;
+    width: 544px;
+    right: -550px;
+    opacity: 100;
+
+    padding: 2px;
+    font-size: 10pt;
+}
+
+/* The following 4 are copied here from Theme until we sort out the
+ * theme service
+ */
+.floatpanel {
+    background-color: white;
+    color: #3c3a3a;
+    border: 1px solid #c7c7c0;
+}
+
+.floatpanel hr {
+    border: 1px solid #c7c7c0;
+}
+
+.floatpanel .bottom tr:nth-child(odd) {
+    background-color: #f4f4f4;
+}
+
+.floatpanel .bottom tr:nth-child(even) {
+    background-color: #fbfbfb;
+}
+
+.floatpanel.dialog {
+    top: 180px;
+}
+
+html[data-platform='iPad'] .floatpanel {
+    top: 80px;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.base.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.base.ts
new file mode 100644
index 0000000..591aa77
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.base.ts
@@ -0,0 +1,298 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { FnService } from '../util/fn.service';
+import { LoadingService } from '../layer/loading.service';
+import { LogService } from '../log.service';
+import { WebSocketService } from '../remote/websocket.service';
+import { Observable, of } from 'rxjs';
+
+const REFRESH_INTERVAL = 2000;
+const SEARCH_REGEX = '\\W';
+
+/**
+ * Model of table annotations within this table base class
+ */
+export interface TableAnnots {
+    noRowsMsg: string;
+}
+
+/**
+ * A model of data returned from Web Socket in a TableResponse
+ *
+ * There is an interface extending from this one in the parent component
+ */
+export interface TableResponse {
+    annots: any;
+    // There will be other parts to the response depending on table type
+    // Expect one called tag+'s' e.g. devices or apps
+}
+
+/**
+ * A criteria for filtering the tableData
+ */
+export interface TableFilter {
+    queryStr: string;
+    queryBy: string;
+    sortBy: string;
+}
+
+/**
+ * Enumerated values for the sort dir
+ */
+export enum SortDir {
+    asc = 'asc', desc = 'desc'
+}
+
+/**
+ * A structure to format sort params for table
+ * This is sent to WebSocket as part of table request
+ */
+export interface SortParams {
+    firstCol: string;
+    firstDir: SortDir;
+    secondCol: string;
+    secondDir: SortDir;
+}
+
+export interface PayloadParams {
+    devId: string;
+}
+
+
+/**
+ * ONOS GUI -- Widget -- Table Base class
+ */
+export abstract class TableBaseImpl {
+    // attributes from the interface
+    protected annots: TableAnnots;
+    protected changedData: string[] = [];
+    protected payloadParams: PayloadParams;
+    protected sortParams: SortParams;
+    protected selectCallback; // Function
+    protected parentSelCb = null;
+    protected responseCallback; // Function
+    selId: string = undefined;
+    tableData: any[] = [];
+    tableDataFilter: TableFilter;
+    toggleRefresh; // Function
+    autoRefresh: boolean = true;
+    autoRefreshTip: string = 'Toggle auto refresh'; // TODO: get LION string
+
+    private root: string;
+    private req: string;
+    private resp: string;
+    private refreshPromise: any = null;
+    private handlers: string[] = [];
+
+    constructor(
+        protected fs: FnService,
+        protected ls: LoadingService,
+        protected log: LogService,
+        protected wss: WebSocketService,
+        protected tag: string,
+        protected idKey: string = 'id',
+        protected selCb = () => ({}) // Function
+    ) {
+        this.root = tag + 's';
+        this.req = tag + 'DataRequest';
+        this.resp = tag + 'DataResponse';
+
+        this.selectCallback = this.rowSelectionCb;
+        this.toggleRefresh = () => {
+            this.autoRefresh = !this.autoRefresh;
+            this.autoRefresh ? this.startRefresh() : this.stopRefresh();
+        };
+
+        // Mapped to the search and searchBy inputs in template
+        // Changes are handled through TableFilterPipe
+        this.tableDataFilter = <TableFilter>{
+            queryStr: '',
+            queryBy: '$',
+        };
+    }
+
+    init() {
+        this.wss.bindHandlers(new Map<string, (data) => void>([
+            [this.resp, (data) => this.tableDataResponseCb(data)]
+        ]));
+        this.handlers.push(this.resp);
+
+        this.annots = <TableAnnots>{
+            noRowsMsg: ''
+        };
+
+        // Now send the WebSocket request and make it repeat every 2 seconds
+        this.requestTableData();
+        this.startRefresh();
+        this.log.debug('TableBase initialized. Calling ', this.req,
+            'every', REFRESH_INTERVAL, 'ms');
+    }
+
+    destroy() {
+        this.wss.unbindHandlers(this.handlers);
+        this.stopRefresh();
+        this.ls.stop();
+    }
+
+    /**
+     * A callback that executes when the table data that was requested
+     * on WebSocketService arrives.
+     *
+     * Happens every 2 seconds
+     */
+    tableDataResponseCb(data: TableResponse) {
+        this.ls.stop();
+
+        const newTableData: any[] = Array.from(data[this.root]);
+        this.annots.noRowsMsg = data.annots.no_rows_msg;
+
+        // If the parents onResp() function is set then call it
+        if (this.responseCallback) {
+            this.responseCallback(data);
+        }
+        this.changedData = [];
+
+        // checks if data changed for row flashing
+        if (JSON.stringify(newTableData) !== JSON.stringify(this.tableData)) {
+            this.log.debug('table data has changed');
+            const oldTableData: any[] = this.tableData;
+            this.tableData = [...newTableData]; // ES6 spread syntax
+            // only flash the row if the data already exists
+            if (oldTableData.length > 0) {
+                for (const idx in newTableData) {
+                    if (!this.fs.containsObj(oldTableData, newTableData[idx])) {
+                        this.changedData.push(newTableData[idx][this.idKey]);
+                    }
+                }
+            }
+        }
+    }
+
+    /**
+     * Table Data Request
+     * Pass in sort parameters and the set will be returned sorted
+     * In the old GUI there was also a query parameter, but this was not
+     * implemented on the server end
+     */
+    requestTableData() {
+        const p = Object.assign({}, this.sortParams, this.payloadParams);
+
+        // Allow it to sit in pending events
+        if (this.wss.isConnected()) {
+            if (this.fs.debugOn('table')) {
+                this.log.debug('Table data REQUEST:', this.req, p);
+            }
+            this.wss.sendEvent(this.req, p);
+            this.ls.start();
+        }
+    }
+
+    /**
+     * Row Selected
+     */
+    rowSelectionCb(event: any, selRow: any): void {
+        const selId: string = selRow[this.idKey];
+        this.selId = (this.selId === selId) ? undefined : selId;
+        this.log.debug('Row', selId, 'selected');
+        if (this.parentSelCb) {
+            this.parentSelCb(event, selRow);
+        }
+    }
+
+    /**
+     * autoRefresh functions
+     */
+    startRefresh() {
+        this.refreshPromise =
+            setInterval(() => {
+                if (!this.ls.waiting()) {
+                    if (this.fs.debugOn('table')) {
+                        this.log.debug('Refreshing ' + this.root + ' page');
+                    }
+                    this.requestTableData();
+                }
+            }, REFRESH_INTERVAL);
+    }
+
+    stopRefresh() {
+        if (this.refreshPromise) {
+            clearInterval(this.refreshPromise);
+            this.refreshPromise = null;
+        }
+    }
+
+    isChanged(id: string): boolean {
+        return (this.fs.inArray(id, this.changedData) === -1) ? false : true;
+    }
+
+    /**
+     * A dummy implementation of the lionFn until the response is received and the LION
+     * bundle is received from the WebSocket
+     */
+    dummyLion(key: string): string {
+        return '%' + key + '%';
+    }
+
+    /**
+     * Change the sort order of the data returned
+     *
+     * sortParams are passed to the server by WebSocket and the data is
+     * returned sorted
+     *
+     * This is usually assigned to the (click) event on a column, and the column
+     * name passed in e.g. (click)="onSort('origin')
+     * If the column that is passed in is already the firstCol, then reverse its direction
+     * If a new column is passed in, then make the existing col the 2nd sort order
+     */
+    onSort(colName: string) {
+        if (this.sortParams.firstCol === colName) {
+            if (this.sortParams.firstDir === SortDir.desc) {
+                this.sortParams.firstDir = SortDir.asc;
+                return;
+            } else {
+                this.sortParams.firstDir = SortDir.desc;
+                return;
+            }
+        } else {
+            this.sortParams.secondCol = this.sortParams.firstCol;
+            this.sortParams.secondDir = this.sortParams.firstDir;
+            this.sortParams.firstCol = colName;
+            this.sortParams.firstDir = SortDir.desc;
+        }
+        this.log.debug('Sort params', this.sortParams);
+        this.requestTableData();
+    }
+
+    sortIcon(column: string): string {
+        if (this.sortParams.firstCol === column) {
+            if (this.sortParams.firstDir === SortDir.asc) {
+                return 'upArrow';
+            } else {
+                return 'downArrow';
+            }
+        } else {
+            return '';
+        }
+    }
+
+    /**
+     * De-selects the row
+     */
+    deselectRow(event) {
+        this.log.debug('Details panel close event');
+        this.selId = event;
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.css
new file mode 100644
index 0000000..6b78988
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.css
@@ -0,0 +1,109 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/* ------ for summary-list tables (layout) ------ */
+
+div.summary-list {
+    margin: 0 20px 16px 10px;
+    font-size: 10pt;
+    border-spacing: 0;
+}
+
+div.summary-list table {
+    border-collapse: collapse;
+    table-layout: fixed;
+    empty-cells: show;
+    margin: 0;
+}
+
+div.summary-list div.table-body {
+    overflow-y: scroll;
+}
+
+div.summary-list div.table-body::-webkit-scrollbar {
+    display: none;
+}
+
+div.summary-list div.table-body tr.no-data td {
+    text-align: center;
+    font-style: italic;
+}
+
+
+/* highlighting */
+div.summary-list tr {
+    transition: background-color 500ms;
+}
+
+div.summary-list td {
+    padding: 4px;
+    text-align: left;
+    word-wrap: break-word;
+    font-size: 10pt;
+}
+
+div.summary-list td.table-icon {
+    width: 42px;
+    padding-top: 4px;
+    padding-bottom: 0px;
+    padding-left: 4px;
+    text-align: center;
+}
+
+div.summary-list .table-header th {
+    font-weight: bold;
+    font-variant: small-caps;
+    text-transform: uppercase;
+    font-size: 10pt;
+    padding-top: 8px;
+    padding-bottom: 8px;
+    letter-spacing: 0.02em;
+    cursor: pointer;
+}
+
+/* rows are selectable */
+div.summary-list .table-body td {
+    cursor: pointer;
+}
+
+/* Tabular view controls */
+
+div.tabular-header .search {
+    margin: 0 0 10px 10px;
+}
+
+
+div.tabular-header div.ctrl-btns {
+    display: inline-block;
+    float: right;
+    height: 44px;
+    margin-top: 24px;
+    margin-right: 20px;
+    position: absolute;
+    right: 0px;
+}
+
+div.tabular-header div.ctrl-btns div {
+    display: inline-block;
+    cursor: pointer;
+}
+
+div.tabular-header div.ctrl-btns div.separator  {
+    width: 0;
+    height: 40px;
+    padding: 0;
+    border-right: 1px solid #c7c7c0;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.theme.css b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.theme.css
new file mode 100644
index 0000000..cc7e7e6
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/table.theme.css
@@ -0,0 +1,152 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/* ------ for summary-list tables (theme) ------ */
+
+.light div.summary-list, .table-header th {
+    background-color: #e5e5e6;
+    color: #3c3a3a;
+}
+
+.light div.summary-list, td {
+    color: #3c3a3a;
+}
+
+.light div.summary-list, tr:nth-child(even) {
+    background-color: #f4f4f4;
+}
+.light div.summary-list, tr:nth-child(odd) {
+    background-color: #fbfbfb;
+}
+
+.light div.summary-list, tr.selected {
+    background-color: #dbeffc !important;
+}
+
+
+.light div.summary-list, tr.data-change {
+    background-color: #FDFFDC;
+}
+
+/* --- Control Buttons --- */
+
+/* INACTIVE */
+.light .ctrl-btns div svg.embeddedIcon g.icon use {
+    fill: #e0dfd6;
+}
+/* note: no change for inactive buttons when hovered */
+
+
+/* ACTIVE */
+.light .ctrl-btns div.active svg.embeddedIcon g.icon use {
+    fill: #939598;
+}
+.light .ctrl-btns div.active:hover svg.embeddedIcon g.icon use {
+    fill: #ce5b58;
+}
+
+/* CURRENT-VIEW */
+.light .ctrl-btns div.current-view svg.embeddedIcon g.icon rect {
+    fill: #518ecc;
+}
+.light .ctrl-btns div.current-view svg.embeddedIcon g.icon use {
+    fill: white;
+}
+
+/* REFRESH */
+.light .ctrl-btns div.refresh svg.embeddedIcon g.icon use {
+    fill: #cdeff2;
+}
+.light .ctrl-btns div.refresh:hover svg.embeddedIcon g.icon use {
+    fill: #ce5b58;
+}
+.light .ctrl-btns div.refresh.active svg.embeddedIcon g.icon use {
+    fill: #009fdb;
+}
+.light .ctrl-btns div.refresh.active:hover svg.embeddedIcon g.icon use {
+    fill: #ce5b58;
+}
+
+
+/* ========== DARK Theme ========== */
+
+.dark div.summary-list .table-header td {
+    background-color: #222222;
+    color: #cccccc;
+}
+
+.dark div.summary-list td {
+    /* note: don't put background-color here */
+    color: #cccccc;
+}
+.dark div.summary-list tr.no-data td {
+    background-color: #333333;
+}
+
+.dark div.summary-list tr:nth-child(even) {
+    background-color: #333333;
+}
+.dark div.summary-list tr:nth-child(odd) {
+    background-color: #3a3a3a;
+}
+
+.dark div.summary-list tr.selected {
+    background-color: #304860 !important;
+}
+
+
+.dark div.summary-list tr.data-change {
+    background-color: #423708;
+}
+
+/* --- Control Buttons --- */
+
+/* INACTIVE */
+.dark .ctrl-btns div svg.embeddedIcon g.icon use {
+    fill: #444444;
+}
+/* note: no change for inactive buttons when hovered */
+
+
+/* ACTIVE */
+.dark .ctrl-btns div.active svg.embeddedIcon g.icon use {
+    fill: #939598;
+}
+.dark .ctrl-btns div.active:hover svg.embeddedIcon g.icon use {
+    fill: #ce5b58;
+}
+
+/* CURRENT-VIEW */
+.dark .ctrl-btns div.current-view svg.embeddedIcon g.icon rect {
+    fill: #518ecc;
+}
+.dark .ctrl-btns div.current-view svg.embeddedIcon g.icon use {
+    fill: #dddddd;
+}
+
+/* REFRESH */
+.dark .ctrl-btns div.refresh svg.embeddedIcon g.icon use {
+    fill: #364144;
+}
+.dark .ctrl-btns div.refresh:hover svg.embeddedIcon g.icon use {
+    fill: #ce5b58;
+}
+.dark .ctrl-btns div.refresh.active svg.embeddedIcon g.icon use {
+    fill: #0074a6;
+}
+.dark .ctrl-btns div.refresh.active:hover svg.embeddedIcon g.icon use {
+    fill: #ce5b58;
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.spec.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.spec.ts
new file mode 100644
index 0000000..8832feb
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.spec.ts
@@ -0,0 +1,104 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the 'License');
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an 'AS IS' BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { TableFilterPipe } from './tablefilter.pipe';
+import { TableFilter } from './table.base';
+
+describe('TableFilterPipe', () => {
+
+    const pipe = new TableFilterPipe();
+    const items: any[] = new Array();
+    // Array item 0
+    items.push({
+        id: 'abc',
+        title: 'def',
+        origin: 'ghi'
+    });
+    // Array item 1
+    items.push({
+        id: 'pqr',
+        title: 'stu',
+        origin: 'vwx'
+    });
+    // Array item 2
+    items.push({
+        id: 'dog',
+        title: 'mouse',
+        origin: 'cat'
+    });
+
+
+    it('create an instance', () => {
+        expect(pipe).toBeTruthy();
+    });
+
+    it('expect it to handle empty search', () => {
+        const filteredItems: any[] =
+            pipe.transform(items, <TableFilter>{queryStr: '', queryBy: 'title'});
+        expect(filteredItems).toEqual(items);
+    });
+
+    it('expect it to handle empty items', () => {
+        const filteredItems: any[] =
+            pipe.transform(new Array(), <TableFilter>{queryStr: 'de', queryBy: 'title'});
+        expect(filteredItems).toEqual(new Array());
+    });
+
+
+    it('expect it to match 0 by title', () => {
+        const filteredItems: any[] =
+            pipe.transform(items, <TableFilter>{queryStr: 'de', queryBy: 'title'});
+        expect(filteredItems).toEqual(items.slice(0, 1));
+    });
+
+    it('expect it to match 1 by title', () => {
+        const filteredItems: any[] =
+            pipe.transform(items, <TableFilter>{queryStr: 'st', queryBy: 'title'});
+        expect(filteredItems).toEqual(items.slice(1, 2));
+    });
+
+    it('expect it to match 1 by uppercase title', () => {
+        const filteredItems: any[] =
+            pipe.transform(items, <TableFilter>{queryStr: 'sT', queryBy: 'title'});
+        expect(filteredItems).toEqual(items.slice(1, 2));
+    });
+
+    it('expect it to not match by title', () => {
+        const filteredItems: any[] =
+            pipe.transform(items, <TableFilter>{queryStr: 'pq', queryBy: 'title'});
+        expect(filteredItems.length).toEqual(0);
+    });
+
+    it('expect it to match 1 by all fields', () => {
+        const filteredItems: any[] =
+            pipe.transform(items, <TableFilter>{queryStr: 'pq', queryBy: '$'});
+        expect(filteredItems).toEqual(items.slice(1, 2));
+    });
+
+    it('expect it to not match by all fields', () => {
+        const filteredItems: any[] =
+            pipe.transform(items, <TableFilter>{queryStr: 'yz', queryBy: '$'});
+        expect(filteredItems.length).toEqual(0);
+    });
+
+    /**
+     * Check that items one and two contain a 't' - title=stu and origin=cat
+     */
+    it('expect it to match 1,2 by all fields', () => {
+        const filteredItems: any[] =
+            pipe.transform(items, <TableFilter>{queryStr: 't', queryBy: '$'});
+        expect(filteredItems).toEqual(items.slice(1));
+    });
+});
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.ts
new file mode 100644
index 0000000..5ef048c
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tablefilter.pipe.ts
@@ -0,0 +1,58 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the 'License');
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an 'AS IS' BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { Pipe, PipeTransform } from '@angular/core';
+import { TableFilter } from './table.base';
+
+/**
+ * Only return the tabledata that matches filtering with some queries
+ *
+ * Note: the pipe is marked pure here as we need to filter on the
+ * content of the filter object (it's not a primitive type)
+ */
+@Pipe({
+  name: 'filter',
+  pure: false
+})
+export class TableFilterPipe implements PipeTransform {
+
+    /**
+     * From an array of table items just return those that match the filter
+     */
+    transform(items: any[], tableDataFilter: TableFilter): any[] {
+        if (!items) {
+            return [];
+        }
+        if (!tableDataFilter.queryStr) {
+            return items;
+        }
+
+        const queryStr = tableDataFilter.queryStr.toLowerCase();
+
+        return items.filter( it => {
+            if (tableDataFilter.queryBy === '$') {
+                const t1 = Object.values(it);
+                const t2 = Object.values(it).filter(value => {
+                               return (<string>value).toLowerCase().includes(queryStr);
+                           });
+                return Object.values(it).filter(value => {
+                    return (<string>value).toLowerCase().includes(queryStr);
+                }).length > 0;
+            } else {
+                return it[tableDataFilter.queryBy].toLowerCase().includes(queryStr);
+            }
+        });
+    }
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tableresize.directive.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tableresize.directive.ts
new file mode 100644
index 0000000..150d3a7
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/lib/widget/tableresize.directive.ts
@@ -0,0 +1,83 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { AfterContentChecked, Directive, ElementRef, Inject } from '@angular/core';
+import { FnService } from '../util/fn.service';
+import { LogService } from '../log.service';
+import { MastService } from '../mast/mast.service';
+import { HostListener } from '@angular/core';
+import * as d3 from 'd3';
+
+/**
+ * ONOS GUI -- Widget -- Table Resize Directive
+ */
+@Directive({
+    selector: '[onosTableResize]',
+})
+export class TableResizeDirective implements AfterContentChecked {
+
+    pdg = 22;
+    tables: any;
+
+    constructor(protected fs: FnService,
+        protected log: LogService,
+        protected mast: MastService,
+        protected el: ElementRef,
+        @Inject('Window') private w: any) {
+
+        log.info('TableResizeDirective constructed');
+    }
+
+    ngAfterContentChecked() {
+        this.tables = {
+            thead: d3.select('div.table-header').select('table'),
+            tbody: d3.select('div.table-body').select('table')
+        };
+        this.windowSize(this.tables);
+    }
+
+    windowSize(tables: any) {
+        const wsz = this.fs.windowSize(0, 30);
+        this.adjustTable(tables, wsz.width, wsz.height);
+    }
+
+    @HostListener('window:resize', ['event'])
+    onResize(event: any) {
+        this.windowSize(this.tables);
+        return {
+            h: this.w.innerHeight,
+            w: this.w.innerWidth
+        };
+    }
+
+    adjustTable(tables: any, width: number, height: number) {
+        this._width(tables.thead, width + 'px');
+        this._width(tables.tbody, width + 'px');
+
+        this.setHeight(tables.thead, d3.select('div.table-body'), height);
+    }
+
+    _width(elem, width) {
+        elem.style('width', width);
+    }
+
+    setHeight(thead: any, body: any, height: number) {
+        const h = height - (this.mast.mastHeight +
+            this.fs.noPxStyle(d3.select('.tabular-header'), 'height') +
+            this.fs.noPxStyle(thead, 'height') + this.pdg);
+        body.style('height', h + 'px');
+    }
+
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/public_api.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/public_api.ts
new file mode 100644
index 0000000..51cf201
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/public_api.ts
@@ -0,0 +1,57 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/*
+ * Public API Surface of gui2-fw-lib
+ */
+
+export * from './lib/gui2-fw-lib.module';
+
+export * from './lib/util/fn.service';
+export * from './lib/log.service';
+export * from './lib/consolelogger.service';
+export * from './lib/svg/icon.service';
+
+export * from './lib/nav/nav.service';
+export * from './lib/mast/mast.service';
+export * from './lib/remote/wsock.service';
+export * from './lib/remote/urlfn.service';
+export * from './lib/remote/websocket.service';
+export * from './lib/onos.service';
+export * from './lib/layer/loading.service';
+export * from './lib/layer/panel.service';
+export * from './lib/svg/svgutil.service';
+export * from './lib/svg/glyphdata.service';
+export * from './lib/svg/glyph.service';
+export * from './lib/util/prefs.service';
+export * from './lib/util/fn.service';
+export * from './lib/util/lion.service';
+export * from './lib/util/theme.service';
+
+export * from './lib/mast/mast/mast.component';
+export * from './lib/layer/veil/veil.component';
+export * from './lib/layer/flash/flash.component';
+export * from './lib/layer/confirm/confirm.component';
+export * from './lib/svg/icon/icon.component';
+
+export * from './lib/widget/tableresize.directive';
+export * from './lib/detectbrowser.directive';
+
+export * from './lib/widget/tablefilter.pipe';
+
+export * from './lib/widget/detailspanel.base';
+export * from './lib/widget/panel.base';
+export * from './lib/widget/table.base';
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/src/test.ts b/web/gui2-fw-lib/projects/gui2-fw-lib/src/test.ts
new file mode 100644
index 0000000..af048c5e
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/src/test.ts
@@ -0,0 +1,38 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// This file is required by karma.conf.js and loads recursively all the .spec and framework files
+
+import 'core-js/es7/reflect';
+import 'zone.js/dist/zone';
+import 'zone.js/dist/zone-testing';
+import { getTestBed } from '@angular/core/testing';
+import {
+  BrowserDynamicTestingModule,
+  platformBrowserDynamicTesting
+} from '@angular/platform-browser-dynamic/testing';
+
+declare const require: any;
+
+// First, initialize the Angular testing environment.
+getTestBed().initTestEnvironment(
+  BrowserDynamicTestingModule,
+  platformBrowserDynamicTesting()
+);
+// Then we find all the tests.
+const context = require.context('./', true, /\.spec\.ts$/);
+// And load the modules.
+context.keys().map(context);
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.lib.json b/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.lib.json
new file mode 100644
index 0000000..704bf8e
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.lib.json
@@ -0,0 +1,33 @@
+{
+  "extends": "../../tsconfig.json",
+  "compilerOptions": {
+    "outDir": "../../out-tsc/lib",
+    "target": "es2015",
+    "module": "es2015",
+    "moduleResolution": "node",
+    "declaration": true,
+    "sourceMap": true,
+    "inlineSources": true,
+    "emitDecoratorMetadata": true,
+    "experimentalDecorators": true,
+    "importHelpers": true,
+    "types": [],
+    "lib": [
+      "dom",
+      "es2017"
+    ]
+  },
+  "angularCompilerOptions": {
+    "annotateForClosureCompiler": true,
+    "skipTemplateCodegen": true,
+    "strictMetadataEmit": true,
+    "fullTemplateTypeCheck": true,
+    "strictInjectionParameters": true,
+    "flatModuleId": "AUTOGENERATED",
+    "flatModuleOutFile": "AUTOGENERATED"
+  },
+  "exclude": [
+    "src/test.ts",
+    "**/*.spec.ts"
+  ]
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.spec.json b/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.spec.json
new file mode 100644
index 0000000..16da33d
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/tsconfig.spec.json
@@ -0,0 +1,17 @@
+{
+  "extends": "../../tsconfig.json",
+  "compilerOptions": {
+    "outDir": "../../out-tsc/spec",
+    "types": [
+      "jasmine",
+      "node"
+    ]
+  },
+  "files": [
+    "src/test.ts"
+  ],
+  "include": [
+    "**/*.spec.ts",
+    "**/*.d.ts"
+  ]
+}
diff --git a/web/gui2-fw-lib/projects/gui2-fw-lib/tslint.json b/web/gui2-fw-lib/projects/gui2-fw-lib/tslint.json
new file mode 100644
index 0000000..3daf6d4
--- /dev/null
+++ b/web/gui2-fw-lib/projects/gui2-fw-lib/tslint.json
@@ -0,0 +1,17 @@
+{
+    "extends": "../../tslint.json",
+    "rules": {
+        "directive-selector": [
+            true,
+            "attribute",
+            "onos",
+            "camelCase"
+        ],
+        "component-selector": [
+            true,
+            "element",
+            "onos",
+            "kebab-case"
+        ]
+    }
+}
diff --git a/web/gui2-fw-lib/src/app/app.component.css b/web/gui2-fw-lib/src/app/app.component.css
new file mode 100644
index 0000000..85b86e1
--- /dev/null
+++ b/web/gui2-fw-lib/src/app/app.component.css
@@ -0,0 +1,19 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#tooltip {
+  visibility: visible;
+}
diff --git a/web/gui2-fw-lib/src/app/app.component.html b/web/gui2-fw-lib/src/app/app.component.html
new file mode 100644
index 0000000..26f2562
--- /dev/null
+++ b/web/gui2-fw-lib/src/app/app.component.html
@@ -0,0 +1,46 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~     http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+
+<div style="text-align:center">
+  <onos-icon iconId="nav_apps" iconSize="200" toolTip="Test app"></onos-icon>
+  <h1>
+    Welcome to {{ title }}!
+  </h1>
+</div>
+<h2>Test App - Do not use or extend</h2>
+<p>This app is just a wrapper around the GUI 2 Framework Library and is
+  necessary only to provide a base for that library.
+It has a use in validating that the library can be loaded.
+
+The library is linked in here by the addition of the paths statement in
+  tsconfig.json. This is fine for accessing a local library, but for another
+  project it should be added in through package.json, using the 'file' locator.
+  Then run "npm install" in that target project and the tar will be expanded in
+  to it's node_modules folder.
+
+A good article on the creation and use of libraries in Angular 6 is given in<br />
+  <a href="https://blog.angularindepth.com/creating-a-library-in-angular-6-87799552e7e5">The Angular Library Series - Creating a Library with the Angular CLI</a><br />
+  and <br />
+  <a href="https://blog.angularindepth.com/creating-a-library-in-angular-6-part-2-6e2bc1e14121">The Angular Library Series - Building and Packaging</a><br />
+
+This "app" component is not built by Bazel - it's only the library that is built
+  by bazel which in turn calls "ng build --prod gui2-fw-lib" and then "npm pack"
+  resulting in a tar file that can be used as an NPM package anywhere.
+<br />
+Note: Please remember that in Angular 6 rebuilding of libraries is not automatic.
+  If you change anything in the library, you will have to build it again before
+  it is picked up in this app.
+</p>
diff --git a/web/gui2-fw-lib/src/app/app.component.ts b/web/gui2-fw-lib/src/app/app.component.ts
new file mode 100644
index 0000000..b6a7c8b
--- /dev/null
+++ b/web/gui2-fw-lib/src/app/app.component.ts
@@ -0,0 +1,33 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { Component } from '@angular/core';
+import { FnService } from 'gui2-fw-lib';
+
+@Component({
+  selector: 'app-root',
+  templateUrl: './app.component.html',
+  styleUrls: ['./app.component.css']
+})
+export class AppComponent {
+  title = 'Test app for GUI Framework Library';
+
+  constructor(
+    protected fs: FnService
+  ) {
+    this.title = this.fs.cap(this.title);
+  }
+}
diff --git a/web/gui2-fw-lib/src/app/app.module.ts b/web/gui2-fw-lib/src/app/app.module.ts
new file mode 100644
index 0000000..dc92383
--- /dev/null
+++ b/web/gui2-fw-lib/src/app/app.module.ts
@@ -0,0 +1,42 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { BrowserModule } from '@angular/platform-browser';
+import { NgModule } from '@angular/core';
+import { RouterModule, Routes }  from '@angular/router';
+import { AppComponent } from './app.component';
+import { Gui2FwLibModule, ConsoleLoggerService, LogService } from 'gui2-fw-lib';
+
+const appRoutes: Routes = [
+  { path: '**', component: AppComponent }
+]
+
+@NgModule({
+  declarations: [
+    AppComponent
+  ],
+  imports: [
+    RouterModule.forRoot(appRoutes),
+    BrowserModule,
+    Gui2FwLibModule
+  ],
+  providers: [
+    { provide: 'Window', useValue: window },
+    { provide: LogService, useClass: ConsoleLoggerService },
+  ],
+  bootstrap: [AppComponent]
+})
+export class AppModule { }
diff --git a/web/gui2-fw-lib/src/assets/.gitkeep b/web/gui2-fw-lib/src/assets/.gitkeep
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/web/gui2-fw-lib/src/assets/.gitkeep
diff --git a/web/gui2-fw-lib/src/browserslist b/web/gui2-fw-lib/src/browserslist
new file mode 100644
index 0000000..8e09ab4
--- /dev/null
+++ b/web/gui2-fw-lib/src/browserslist
@@ -0,0 +1,9 @@
+# This file is currently used by autoprefixer to adjust CSS to support the below specified browsers
+# For additional information regarding the format and rule options, please see:
+# https://github.com/browserslist/browserslist#queries
+# For IE 9-11 support, please uncomment the last line of the file and adjust as needed
+> 0.5%
+last 2 versions
+Firefox ESR
+not dead
+# IE 9-11
\ No newline at end of file
diff --git a/web/gui2-fw-lib/src/environments/environment.prod.ts b/web/gui2-fw-lib/src/environments/environment.prod.ts
new file mode 100644
index 0000000..63a2bac
--- /dev/null
+++ b/web/gui2-fw-lib/src/environments/environment.prod.ts
@@ -0,0 +1,19 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+export const environment = {
+  production: true
+};
diff --git a/web/gui2-fw-lib/src/environments/environment.ts b/web/gui2-fw-lib/src/environments/environment.ts
new file mode 100644
index 0000000..5bb7d11
--- /dev/null
+++ b/web/gui2-fw-lib/src/environments/environment.ts
@@ -0,0 +1,31 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// This file can be replaced during build by using the `fileReplacements` array.
+// `ng build ---prod` replaces `environment.ts` with `environment.prod.ts`.
+// The list of file replacements can be found in `angular.json`.
+
+export const environment = {
+  production: false
+};
+
+/*
+ * In development mode, to ignore zone related error stack frames such as
+ * `zone.run`, `zoneDelegate.invokeTask` for easier debugging, you can
+ * import the following file, but please comment it out in production mode
+ * because it will have performance impact when throw error
+ */
+// import 'zone.js/dist/zone-error';  // Included with Angular CLI.
diff --git a/web/gui2-fw-lib/src/favicon.ico b/web/gui2-fw-lib/src/favicon.ico
new file mode 100644
index 0000000..8081c7c
--- /dev/null
+++ b/web/gui2-fw-lib/src/favicon.ico
Binary files differ
diff --git a/web/gui2-fw-lib/src/index.html b/web/gui2-fw-lib/src/index.html
new file mode 100644
index 0000000..a087a77
--- /dev/null
+++ b/web/gui2-fw-lib/src/index.html
@@ -0,0 +1,31 @@
+<!--
+~ Copyright 2018-present Open Networking Foundation
+~
+~ Licensed under the Apache License, Version 2.0 (the "License");
+~ you may not use this file except in compliance with the License.
+~ You may obtain a copy of the License at
+~
+~     http://www.apache.org/licenses/LICENSE-2.0
+~
+~ Unless required by applicable law or agreed to in writing, software
+~ distributed under the License is distributed on an "AS IS" BASIS,
+~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+~ See the License for the specific language governing permissions and
+~ limitations under the License.
+-->
+
+<!doctype html>
+<html lang="en">
+<head>
+  <meta charset="utf-8">
+  <title>Gui2FwLibApp</title>
+  <base href="/">
+
+  <meta name="viewport" content="width=device-width, initial-scale=1">
+  <link rel="icon" type="image/x-icon" href="favicon.ico">
+</head>
+<body>
+  <!-- See app/app.component.html for an explanation of this <app-root> component -->
+  <app-root></app-root>
+</body>
+</html>
diff --git a/web/gui2-fw-lib/src/karma.conf.js b/web/gui2-fw-lib/src/karma.conf.js
new file mode 100644
index 0000000..88edff0
--- /dev/null
+++ b/web/gui2-fw-lib/src/karma.conf.js
@@ -0,0 +1,47 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// Karma configuration file, see link for more information
+// https://karma-runner.github.io/1.0/config/configuration-file.html
+
+module.exports = function (config) {
+  config.set({
+    basePath: '',
+    frameworks: ['jasmine', '@angular-devkit/build-angular'],
+    plugins: [
+      require('karma-jasmine'),
+      require('karma-chrome-launcher'),
+      require('karma-jasmine-html-reporter'),
+      require('karma-coverage-istanbul-reporter'),
+      require('@angular-devkit/build-angular/plugins/karma')
+    ],
+    client: {
+      clearContext: false // leave Jasmine Spec Runner output visible in browser
+    },
+    coverageIstanbulReporter: {
+      dir: require('path').join(__dirname, '../coverage'),
+      reports: ['html', 'lcovonly'],
+      fixWebpackSourcePaths: true
+    },
+    reporters: ['progress', 'kjhtml'],
+    port: 9876,
+    colors: true,
+    logLevel: config.LOG_INFO,
+    autoWatch: true,
+    browsers: ['Chrome'],
+    singleRun: false
+  });
+};
diff --git a/web/gui2-fw-lib/src/main.ts b/web/gui2-fw-lib/src/main.ts
new file mode 100644
index 0000000..d7800c7
--- /dev/null
+++ b/web/gui2-fw-lib/src/main.ts
@@ -0,0 +1,28 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { enableProdMode } from '@angular/core';
+import { platformBrowserDynamic } from '@angular/platform-browser-dynamic';
+
+import { AppModule } from './app/app.module';
+import { environment } from './environments/environment';
+
+if (environment.production) {
+  enableProdMode();
+}
+
+platformBrowserDynamic().bootstrapModule(AppModule)
+  .catch(err => console.log(err));
diff --git a/web/gui2-fw-lib/src/polyfills.ts b/web/gui2-fw-lib/src/polyfills.ts
new file mode 100644
index 0000000..85bbb3a
--- /dev/null
+++ b/web/gui2-fw-lib/src/polyfills.ts
@@ -0,0 +1,96 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/**
+ * This file includes polyfills needed by Angular and is loaded before the app.
+ * You can add your own extra polyfills to this file.
+ *
+ * This file is divided into 2 sections:
+ *   1. Browser polyfills. These are applied before loading ZoneJS and are sorted by browsers.
+ *   2. Application imports. Files imported after ZoneJS that should be loaded before your main
+ *      file.
+ *
+ * The current setup is for so-called "evergreen" browsers; the last versions of browsers that
+ * automatically update themselves. This includes Safari >= 10, Chrome >= 55 (including Opera),
+ * Edge >= 13 on the desktop, and iOS 10 and Chrome on mobile.
+ *
+ * Learn more in https://angular.io/docs/ts/latest/guide/browser-support.html
+ */
+
+/***************************************************************************************************
+ * BROWSER POLYFILLS
+ */
+
+/** IE9, IE10 and IE11 requires all of the following polyfills. **/
+// import 'core-js/es6/symbol';
+// import 'core-js/es6/object';
+// import 'core-js/es6/function';
+// import 'core-js/es6/parse-int';
+// import 'core-js/es6/parse-float';
+// import 'core-js/es6/number';
+// import 'core-js/es6/math';
+// import 'core-js/es6/string';
+// import 'core-js/es6/date';
+// import 'core-js/es6/array';
+// import 'core-js/es6/regexp';
+// import 'core-js/es6/map';
+// import 'core-js/es6/weak-map';
+// import 'core-js/es6/set';
+
+/** IE10 and IE11 requires the following for NgClass support on SVG elements */
+// import 'classlist.js';  // Run `npm install --save classlist.js`.
+
+/** IE10 and IE11 requires the following for the Reflect API. */
+// import 'core-js/es6/reflect';
+
+
+/** Evergreen browsers require these. **/
+// Used for reflect-metadata in JIT. If you use AOT (and only Angular decorators), you can remove.
+import 'core-js/es7/reflect';
+
+
+/**
+ * Web Animations `@angular/platform-browser/animations`
+ * Only required if AnimationBuilder is used within the application and using IE/Edge or Safari.
+ * Standard animation support in Angular DOES NOT require any polyfills (as of Angular 6.0).
+ **/
+// import 'web-animations-js';  // Run `npm install --save web-animations-js`.
+
+/**
+ * By default, zone.js will patch all possible macroTask and DomEvents
+ * user can disable parts of macroTask/DomEvents patch by setting following flags
+ */
+
+ // (window as any).__Zone_disable_requestAnimationFrame = true; // disable patch requestAnimationFrame
+ // (window as any).__Zone_disable_on_property = true; // disable patch onProperty such as onclick
+ // (window as any).__zone_symbol__BLACK_LISTED_EVENTS = ['scroll', 'mousemove']; // disable patch specified eventNames
+
+ /*
+ * in IE/Edge developer tools, the addEventListener will also be wrapped by zone.js
+ * with the following flag, it will bypass `zone.js` patch for IE/Edge
+ */
+// (window as any).__Zone_enable_cross_context_check = true;
+
+/***************************************************************************************************
+ * Zone JS is required by default for Angular itself.
+ */
+import 'zone.js/dist/zone';  // Included with Angular CLI.
+
+
+
+/***************************************************************************************************
+ * APPLICATION IMPORTS
+ */
diff --git a/web/gui2-fw-lib/src/styles.css b/web/gui2-fw-lib/src/styles.css
new file mode 100644
index 0000000..90d4ee0
--- /dev/null
+++ b/web/gui2-fw-lib/src/styles.css
@@ -0,0 +1 @@
+/* You can add global styles to this file, and also import other style files */
diff --git a/web/gui2-fw-lib/src/test.ts b/web/gui2-fw-lib/src/test.ts
new file mode 100644
index 0000000..38acf1e
--- /dev/null
+++ b/web/gui2-fw-lib/src/test.ts
@@ -0,0 +1,36 @@
+/*
+ * Copyright 2018-present Open Networking Foundation
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// This file is required by karma.conf.js and loads recursively all the .spec and framework files
+
+import 'zone.js/dist/zone-testing';
+import { getTestBed } from '@angular/core/testing';
+import {
+  BrowserDynamicTestingModule,
+  platformBrowserDynamicTesting
+} from '@angular/platform-browser-dynamic/testing';
+
+declare const require: any;
+
+// First, initialize the Angular testing environment.
+getTestBed().initTestEnvironment(
+  BrowserDynamicTestingModule,
+  platformBrowserDynamicTesting()
+);
+// Then we find all the tests.
+const context = require.context('./', true, /\.spec\.ts$/);
+// And load the modules.
+context.keys().map(context);
diff --git a/web/gui2-fw-lib/src/tsconfig.app.json b/web/gui2-fw-lib/src/tsconfig.app.json
new file mode 100644
index 0000000..722c370
--- /dev/null
+++ b/web/gui2-fw-lib/src/tsconfig.app.json
@@ -0,0 +1,12 @@
+{
+  "extends": "../tsconfig.json",
+  "compilerOptions": {
+    "outDir": "../out-tsc/app",
+    "module": "es2015",
+    "types": []
+  },
+  "exclude": [
+    "src/test.ts",
+    "**/*.spec.ts"
+  ]
+}
diff --git a/web/gui2-fw-lib/src/tsconfig.spec.json b/web/gui2-fw-lib/src/tsconfig.spec.json
new file mode 100644
index 0000000..8f7cede
--- /dev/null
+++ b/web/gui2-fw-lib/src/tsconfig.spec.json
@@ -0,0 +1,19 @@
+{
+  "extends": "../tsconfig.json",
+  "compilerOptions": {
+    "outDir": "../out-tsc/spec",
+    "module": "commonjs",
+    "types": [
+      "jasmine",
+      "node"
+    ]
+  },
+  "files": [
+    "test.ts",
+    "polyfills.ts"
+  ],
+  "include": [
+    "**/*.spec.ts",
+    "**/*.d.ts"
+  ]
+}
diff --git a/web/gui2-fw-lib/src/tslint.json b/web/gui2-fw-lib/src/tslint.json
new file mode 100644
index 0000000..52e2c1a
--- /dev/null
+++ b/web/gui2-fw-lib/src/tslint.json
@@ -0,0 +1,17 @@
+{
+    "extends": "../tslint.json",
+    "rules": {
+        "directive-selector": [
+            true,
+            "attribute",
+            "app",
+            "camelCase"
+        ],
+        "component-selector": [
+            true,
+            "element",
+            "app",
+            "kebab-case"
+        ]
+    }
+}
diff --git a/web/gui2-fw-lib/tsconfig.json b/web/gui2-fw-lib/tsconfig.json
new file mode 100644
index 0000000..c8de447
--- /dev/null
+++ b/web/gui2-fw-lib/tsconfig.json
@@ -0,0 +1,28 @@
+{
+  "compileOnSave": false,
+  "compilerOptions": {
+    "baseUrl": "./",
+    "outDir": "./dist/out-tsc",
+    "sourceMap": true,
+    "declaration": false,
+    "moduleResolution": "node",
+    "emitDecoratorMetadata": true,
+    "experimentalDecorators": true,
+    "target": "es6",
+    "typeRoots": [
+      "node_modules/@types"
+    ],
+    "lib": [
+      "es2017",
+      "dom"
+    ],
+    "paths": {
+      "gui2-fw-lib": [
+        "dist/gui2-fw-lib"
+      ],
+      "gui2-fw-lib/*": [
+        "dist/gui2-fw-lib/*"
+      ]
+    }
+  }
+}
diff --git a/web/gui2-fw-lib/tslint.json b/web/gui2-fw-lib/tslint.json
new file mode 100644
index 0000000..494ac63
--- /dev/null
+++ b/web/gui2-fw-lib/tslint.json
@@ -0,0 +1,142 @@
+{
+  "rulesDirectory": [
+    "node_modules/codelyzer"
+  ],
+  "rules": {
+    "arrow-return-shorthand": true,
+    "callable-types": true,
+    "class-name": true,
+    "comment-format": [
+      true,
+      "check-space"
+    ],
+    "curly": true,
+    "deprecation": {
+      "severity": "warn"
+    },
+    "eofline": true,
+    "forin": true,
+    "import-blacklist": [
+      true,
+      "rxjs/Rx"
+    ],
+    "import-spacing": true,
+    "indent": [
+      true,
+      "spaces"
+    ],
+    "interface-over-type-literal": true,
+    "label-position": true,
+    "max-line-length": [
+      true,
+      140
+    ],
+    "member-access": false,
+    "member-ordering": [
+      true,
+      {
+        "order": [
+          "static-field",
+          "instance-field",
+          "static-method",
+          "instance-method"
+        ]
+      }
+    ],
+    "no-arg": true,
+    "no-bitwise": true,
+    "no-console": [
+      true,
+      "debug",
+      "info",
+      "time",
+      "timeEnd",
+      "trace"
+    ],
+    "no-construct": true,
+    "no-debugger": true,
+    "no-duplicate-super": true,
+    "no-empty": false,
+    "no-empty-interface": true,
+    "no-eval": true,
+    "no-inferrable-types": [
+      false,
+      "ignore-params"
+    ],
+    "no-misused-new": true,
+    "no-non-null-assertion": true,
+    "no-shadowed-variable": true,
+    "no-string-literal": false,
+    "no-string-throw": true,
+    "no-switch-case-fall-through": true,
+    "no-trailing-whitespace": true,
+    "no-unnecessary-initializer": true,
+    "no-unused-expression": true,
+    "no-use-before-declare": true,
+    "no-var-keyword": true,
+    "object-literal-sort-keys": false,
+    "one-line": [
+      true,
+      "check-open-brace",
+      "check-catch",
+      "check-else",
+      "check-whitespace"
+    ],
+    "prefer-const": true,
+    "quotemark": [
+      true,
+      "single"
+    ],
+    "radix": true,
+    "semicolon": [
+      true,
+      "always"
+    ],
+    "triple-equals": [
+      true,
+      "allow-null-check"
+    ],
+    "typedef-whitespace": [
+      true,
+      {
+        "call-signature": "nospace",
+        "index-signature": "nospace",
+        "parameter": "nospace",
+        "property-declaration": "nospace",
+        "variable-declaration": "nospace"
+      }
+    ],
+    "unified-signatures": true,
+    "variable-name": false,
+    "whitespace": [
+      true,
+      "check-branch",
+      "check-decl",
+      "check-operator",
+      "check-separator",
+      "check-type"
+    ],
+    "directive-selector": [
+      true,
+      "attribute",
+      "onos",
+      "camelCase"
+    ],
+    "component-selector": [
+      true,
+      "element",
+      "onos",
+      "kebab-case"
+    ],
+    "no-output-on-prefix": true,
+    "use-input-property-decorator": true,
+    "use-output-property-decorator": true,
+    "use-host-property-decorator": true,
+    "no-input-rename": true,
+    "no-output-rename": true,
+    "use-life-cycle-interface": true,
+    "use-pipe-transform-interface": true,
+    "component-class-suffix": true,
+    "directive-class-suffix": true
+  }
+}