[ONOS-4879][ONOS-5024][ONOS-5025]TE Topology NBI
The APP introduces IETF TE Topology YANG models as RESTCONF NBI,
and it works as an adapter for data conversion between
YMS(YANG generated JAVA classes) and TE Topology Core subsystem.
The APP implements the following interfaces:
IetfNetworkService Interface
IetfTopologyService Interface
IetfNetworkTopologyService Interface
Change-Id: I761ff684bde4b64ca42bb1b0d5b1ddfb8a2377fd
diff --git a/apps/tenbi/yangmodel/src/main/yang/ietf-yang-types@2013-07-15.yang b/apps/tenbi/yangmodel/src/main/yang/ietf-yang-types@2013-07-15.yang
new file mode 100755
index 0000000..371a091
--- /dev/null
+++ b/apps/tenbi/yangmodel/src/main/yang/ietf-yang-types@2013-07-15.yang
@@ -0,0 +1,480 @@
+module ietf-yang-types {
+
+ namespace "urn:ietf:params:xml:ns:yang:ietf-yang-types";
+ prefix "yang";
+
+ organization
+ "IETF NETMOD (NETCONF Data Modeling Language) Working Group";
+
+ contact
+ "WG Web: <http://tools.ietf.org/wg/netmod/>
+ WG List: <mailto:netmod@ietf.org>
+
+ WG Chair: David Kessens
+ <mailto:david.kessens@nsn.com>
+
+ WG Chair: Juergen Schoenwaelder
+ <mailto:j.schoenwaelder@jacobs-university.de>
+
+ Editor: Juergen Schoenwaelder
+ <mailto:j.schoenwaelder@jacobs-university.de>";
+
+ description
+ "This module contains a collection of generally useful derived
+ YANG data types.
+
+ Copyright (c) 2013 IETF Trust and the persons identified as
+ authors of the code. All rights reserved.
+
+ Redistribution and use in source and binary forms, with or
+ without modification, is permitted pursuant to, and subject
+ to the license terms contained in, the Simplified BSD License
+ set forth in Section 4.c of the IETF Trust's Legal Provisions
+ Relating to IETF Documents
+ (http://trustee.ietf.org/license-info).
+
+ This version of this YANG module is part of RFC 6991; see
+ the RFC itself for full legal notices.";
+
+ revision 2013-07-15 {
+ description
+ "This revision adds the following new data types:
+ - yang-identifier
+ - hex-string
+ - uuid
+ - dotted-quad";
+ reference
+ "RFC 6991: Common YANG Data Types";
+ }
+
+ revision 2010-09-24 {
+ description
+ "Initial revision.";
+ reference
+ "RFC 6021: Common YANG Data Types";
+ }
+
+ /*** collection of counter and gauge types ***/
+
+ typedef counter32 {
+ type uint32;
+ description
+ "The counter32 type represents a non-negative integer
+ that monotonically increases until it reaches a
+ maximum value of 2^32-1 (4294967295 decimal), when it
+ wraps around and starts increasing again from zero.
+
+ Counters have no defined 'initial' value, and thus, a
+ single value of a counter has (in general) no information
+ content. Discontinuities in the monotonically increasing
+ value normally occur at re-initialization of the
+ management system, and at other times as specified in the
+ description of a schema node using this type. If such
+ other times can occur, for example, the creation of
+ a schema node of type counter32 at times other than
+ re-initialization, then a corresponding schema node
+ should be defined, with an appropriate type, to indicate
+ the last discontinuity.
+
+ The counter32 type should not be used for configuration
+ schema nodes. A default statement SHOULD NOT be used in
+ combination with the type counter32.
+
+ In the value set and its semantics, this type is equivalent
+ to the Counter32 type of the SMIv2.";
+ reference
+ "RFC 2578: Structure of Management Information Version 2
+ (SMIv2)";
+ }
+
+ typedef zero-based-counter32 {
+ type yang:counter32;
+ default "0";
+ description
+ "The zero-based-counter32 type represents a counter32
+ that has the defined 'initial' value zero.
+
+ A schema node of this type will be set to zero (0) on creation
+ and will thereafter increase monotonically until it reaches
+ a maximum value of 2^32-1 (4294967295 decimal), when it
+ wraps around and starts increasing again from zero.
+
+ Provided that an application discovers a new schema node
+ of this type within the minimum time to wrap, it can use the
+ 'initial' value as a delta. It is important for a management
+ station to be aware of this minimum time and the actual time
+ between polls, and to discard data if the actual time is too
+ long or there is no defined minimum time.
+
+ In the value set and its semantics, this type is equivalent
+ to the ZeroBasedCounter32 textual convention of the SMIv2.";
+ reference
+ "RFC 4502: Remote Network Monitoring Management Information
+ Base Version 2";
+ }
+
+ typedef counter64 {
+ type uint64;
+ description
+ "The counter64 type represents a non-negative integer
+ that monotonically increases until it reaches a
+ maximum value of 2^64-1 (18446744073709551615 decimal),
+ when it wraps around and starts increasing again from zero.
+
+ Counters have no defined 'initial' value, and thus, a
+ single value of a counter has (in general) no information
+ content. Discontinuities in the monotonically increasing
+ value normally occur at re-initialization of the
+ management system, and at other times as specified in the
+ description of a schema node using this type. If such
+ other times can occur, for example, the creation of
+ a schema node of type counter64 at times other than
+ re-initialization, then a corresponding schema node
+ should be defined, with an appropriate type, to indicate
+ the last discontinuity.
+
+ The counter64 type should not be used for configuration
+ schema nodes. A default statement SHOULD NOT be used in
+ combination with the type counter64.
+
+ In the value set and its semantics, this type is equivalent
+ to the Counter64 type of the SMIv2.";
+ reference
+ "RFC 2578: Structure of Management Information Version 2
+ (SMIv2)";
+ }
+
+ typedef zero-based-counter64 {
+ type yang:counter64;
+ default "0";
+ description
+ "The zero-based-counter64 type represents a counter64 that
+ has the defined 'initial' value zero.
+
+
+
+
+ A schema node of this type will be set to zero (0) on creation
+ and will thereafter increase monotonically until it reaches
+ a maximum value of 2^64-1 (18446744073709551615 decimal),
+ when it wraps around and starts increasing again from zero.
+
+ Provided that an application discovers a new schema node
+ of this type within the minimum time to wrap, it can use the
+ 'initial' value as a delta. It is important for a management
+ station to be aware of this minimum time and the actual time
+ between polls, and to discard data if the actual time is too
+ long or there is no defined minimum time.
+
+ In the value set and its semantics, this type is equivalent
+ to the ZeroBasedCounter64 textual convention of the SMIv2.";
+ reference
+ "RFC 2856: Textual Conventions for Additional High Capacity
+ Data Types";
+ }
+
+ typedef gauge32 {
+ type uint32;
+ description
+ "The gauge32 type represents a non-negative integer, which
+ may increase or decrease, but shall never exceed a maximum
+ value, nor fall below a minimum value. The maximum value
+ cannot be greater than 2^32-1 (4294967295 decimal), and
+ the minimum value cannot be smaller than 0. The value of
+ a gauge32 has its maximum value whenever the information
+ being modeled is greater than or equal to its maximum
+ value, and has its minimum value whenever the information
+ being modeled is smaller than or equal to its minimum value.
+ If the information being modeled subsequently decreases
+ below (increases above) the maximum (minimum) value, the
+ gauge32 also decreases (increases).
+
+ In the value set and its semantics, this type is equivalent
+ to the Gauge32 type of the SMIv2.";
+ reference
+ "RFC 2578: Structure of Management Information Version 2
+ (SMIv2)";
+ }
+
+ typedef gauge64 {
+ type uint64;
+ description
+ "The gauge64 type represents a non-negative integer, which
+ may increase or decrease, but shall never exceed a maximum
+ value, nor fall below a minimum value. The maximum value
+ cannot be greater than 2^64-1 (18446744073709551615), and
+ the minimum value cannot be smaller than 0. The value of
+ a gauge64 has its maximum value whenever the information
+ being modeled is greater than or equal to its maximum
+ value, and has its minimum value whenever the information
+ being modeled is smaller than or equal to its minimum value.
+ If the information being modeled subsequently decreases
+ below (increases above) the maximum (minimum) value, the
+ gauge64 also decreases (increases).
+
+ In the value set and its semantics, this type is equivalent
+ to the CounterBasedGauge64 SMIv2 textual convention defined
+ in RFC 2856";
+ reference
+ "RFC 2856: Textual Conventions for Additional High Capacity
+ Data Types";
+ }
+
+ /*** collection of identifier-related types ***/
+
+ typedef object-identifier {
+ type string {
+ pattern '(([0-1](\.[1-3]?[0-9]))|(2\.(0|([1-9]\d*))))'
+ + '(\.(0|([1-9]\d*)))*';
+ }
+ description
+ "The object-identifier type represents administratively
+ assigned names in a registration-hierarchical-name tree.
+
+ Values of this type are denoted as a sequence of numerical
+ non-negative sub-identifier values. Each sub-identifier
+ value MUST NOT exceed 2^32-1 (4294967295). Sub-identifiers
+ are separated by single dots and without any intermediate
+ whitespace.
+
+ The ASN.1 standard restricts the value space of the first
+ sub-identifier to 0, 1, or 2. Furthermore, the value space
+ of the second sub-identifier is restricted to the range
+ 0 to 39 if the first sub-identifier is 0 or 1. Finally,
+ the ASN.1 standard requires that an object identifier
+ has always at least two sub-identifiers. The pattern
+ captures these restrictions.
+
+ Although the number of sub-identifiers is not limited,
+ module designers should realize that there may be
+ implementations that stick with the SMIv2 limit of 128
+ sub-identifiers.
+
+ This type is a superset of the SMIv2 OBJECT IDENTIFIER type
+ since it is not restricted to 128 sub-identifiers. Hence,
+ this type SHOULD NOT be used to represent the SMIv2 OBJECT
+ IDENTIFIER type; the object-identifier-128 type SHOULD be
+ used instead.";
+ reference
+ "ISO9834-1: Information technology -- Open Systems
+ Interconnection -- Procedures for the operation of OSI
+ Registration Authorities: General procedures and top
+ arcs of the ASN.1 Object Identifier tree";
+ }
+
+ typedef object-identifier-128 {
+ type object-identifier {
+ pattern '\d*(\.\d*){1,127}';
+ }
+ description
+ "This type represents object-identifiers restricted to 128
+ sub-identifiers.
+
+ In the value set and its semantics, this type is equivalent
+ to the OBJECT IDENTIFIER type of the SMIv2.";
+ reference
+ "RFC 2578: Structure of Management Information Version 2
+ (SMIv2)";
+ }
+
+ typedef yang-identifier {
+ type string {
+ length "1..max";
+ pattern '[a-zA-Z_][a-zA-Z0-9\-_.]*';
+ pattern '.|..|[^xX].*|.[^mM].*|..[^lL].*';
+ }
+ description
+ "A YANG identifier string as defined by the 'identifier'
+ rule in Section 12 of RFC 6020. An identifier must
+ start with an alphabetic character or an underscore
+ followed by an arbitrary sequence of alphabetic or
+ numeric characters, underscores, hyphens, or dots.
+
+ A YANG identifier MUST NOT start with any possible
+ combination of the lowercase or uppercase character
+ sequence 'xml'.";
+ reference
+ "RFC 6020: YANG - A Data Modeling Language for the Network
+ Configuration Protocol (NETCONF)";
+ }
+
+ /*** collection of types related to date and time***/
+
+ typedef date-and-time {
+ type string {
+ pattern '\d{4}-\d{2}-\d{2}T\d{2}:\d{2}:\d{2}(\.\d+)?'
+ + '(Z|[\+\-]\d{2}:\d{2})';
+ }
+ description
+ "The date-and-time type is a profile of the ISO 8601
+ standard for representation of dates and times using the
+ Gregorian calendar. The profile is defined by the
+ date-time production in Section 5.6 of RFC 3339.
+
+ The date-and-time type is compatible with the dateTime XML
+ schema type with the following notable exceptions:
+
+ (a) The date-and-time type does not allow negative years.
+
+ (b) The date-and-time time-offset -00:00 indicates an unknown
+ time zone (see RFC 3339) while -00:00 and +00:00 and Z
+ all represent the same time zone in dateTime.
+
+ (c) The canonical format (see below) of data-and-time values
+ differs from the canonical format used by the dateTime XML
+ schema type, which requires all times to be in UTC using
+ the time-offset 'Z'.
+
+ This type is not equivalent to the DateAndTime textual
+ convention of the SMIv2 since RFC 3339 uses a different
+ separator between full-date and full-time and provides
+ higher resolution of time-secfrac.
+
+ The canonical format for date-and-time values with a known time
+ zone uses a numeric time zone offset that is calculated using
+ the device's configured known offset to UTC time. A change of
+ the device's offset to UTC time will cause date-and-time values
+ to change accordingly. Such changes might happen periodically
+ in case a server follows automatically daylight saving time
+ (DST) time zone offset changes. The canonical format for
+ date-and-time values with an unknown time zone (usually
+ referring to the notion of local time) uses the time-offset
+ -00:00.";
+ reference
+ "RFC 3339: Date and Time on the Internet: Timestamps
+ RFC 2579: Textual Conventions for SMIv2
+ XSD-TYPES: XML Schema Part 2: Datatypes Second Edition";
+ }
+
+ typedef timeticks {
+ type uint32;
+ description
+ "The timeticks type represents a non-negative integer that
+ represents the time, modulo 2^32 (4294967296 decimal), in
+ hundredths of a second between two epochs. When a schema
+ node is defined that uses this type, the description of
+ the schema node identifies both of the reference epochs.
+
+ In the value set and its semantics, this type is equivalent
+ to the TimeTicks type of the SMIv2.";
+ reference
+ "RFC 2578: Structure of Management Information Version 2
+ (SMIv2)";
+ }
+
+ typedef timestamp {
+ type yang:timeticks;
+ description
+ "The timestamp type represents the value of an associated
+ timeticks schema node at which a specific occurrence
+ happened. The specific occurrence must be defined in the
+ description of any schema node defined using this type. When
+ the specific occurrence occurred prior to the last time the
+ associated timeticks attribute was zero, then the timestamp
+ value is zero. Note that this requires all timestamp values
+ to be reset to zero when the value of the associated timeticks
+ attribute reaches 497+ days and wraps around to zero.
+
+ The associated timeticks schema node must be specified
+ in the description of any schema node using this type.
+
+ In the value set and its semantics, this type is equivalent
+ to the TimeStamp textual convention of the SMIv2.";
+ reference
+ "RFC 2579: Textual Conventions for SMIv2";
+ }
+
+ /*** collection of generic address types ***/
+
+ typedef phys-address {
+ type string {
+ pattern '([0-9a-fA-F]{2}(:[0-9a-fA-F]{2})*)?';
+ }
+
+
+
+
+ description
+ "Represents media- or physical-level addresses represented
+ as a sequence octets, each octet represented by two hexadecimal
+ numbers. Octets are separated by colons. The canonical
+ representation uses lowercase characters.
+
+ In the value set and its semantics, this type is equivalent
+ to the PhysAddress textual convention of the SMIv2.";
+ reference
+ "RFC 2579: Textual Conventions for SMIv2";
+ }
+
+ typedef mac-address {
+ type string {
+ pattern '[0-9a-fA-F]{2}(:[0-9a-fA-F]{2}){5}';
+ }
+ description
+ "The mac-address type represents an IEEE 802 MAC address.
+ The canonical representation uses lowercase characters.
+
+ In the value set and its semantics, this type is equivalent
+ to the MacAddress textual convention of the SMIv2.";
+ reference
+ "IEEE 802: IEEE Standard for Local and Metropolitan Area
+ Networks: Overview and Architecture
+ RFC 2579: Textual Conventions for SMIv2";
+ }
+
+ /*** collection of XML-specific types ***/
+
+ typedef xpath1.0 {
+ type string;
+ description
+ "This type represents an XPATH 1.0 expression.
+
+ When a schema node is defined that uses this type, the
+ description of the schema node MUST specify the XPath
+ context in which the XPath expression is evaluated.";
+ reference
+ "XPATH: XML Path Language (XPath) Version 1.0";
+ }
+
+ /*** collection of string types ***/
+
+ typedef hex-string {
+ type string {
+ pattern '([0-9a-fA-F]{2}(:[0-9a-fA-F]{2})*)?';
+ }
+ description
+ "A hexadecimal string with octets represented as hex digits
+ separated by colons. The canonical representation uses
+ lowercase characters.";
+ }
+
+ typedef uuid {
+ type string {
+ pattern '[0-9a-fA-F]{8}-[0-9a-fA-F]{4}-[0-9a-fA-F]{4}-'
+ + '[0-9a-fA-F]{4}-[0-9a-fA-F]{12}';
+ }
+ description
+ "A Universally Unique IDentifier in the string representation
+ defined in RFC 4122. The canonical representation uses
+ lowercase characters.
+
+ The following is an example of a UUID in string representation:
+ f81d4fae-7dec-11d0-a765-00a0c91e6bf6
+ ";
+ reference
+ "RFC 4122: A Universally Unique IDentifier (UUID) URN
+ Namespace";
+ }
+
+ typedef dotted-quad {
+ type string {
+ pattern
+ '(([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\.){3}'
+ + '([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])';
+ }
+ description
+ "An unsigned 32-bit number expressed in the dotted-quad
+ notation, i.e., four octets written as decimal numbers
+ and separated with the '.' (full stop) character.";
+ }
+}