initial import
Change-Id: Ief25aef0066ea96bd2c329ccef974c072b3a5a73
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/annotations/Immutable.java b/of/lib/src/main/java/org/projectfloodlight/openflow/annotations/Immutable.java
new file mode 100644
index 0000000..5de2171
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/annotations/Immutable.java
@@ -0,0 +1,13 @@
+package org.projectfloodlight.openflow.annotations;
+
+/**
+ * This annotation marks a class that is considered externally immutable. I.e.,
+ * the externally visible state of the class will not change after its
+ * construction. Such a class can be freely shared between threads and does not
+ * require defensive copying (don't call clone).
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+public @interface Immutable {
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/NonExistantMessage.java b/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/NonExistantMessage.java
new file mode 100644
index 0000000..e5192fd
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/NonExistantMessage.java
@@ -0,0 +1,30 @@
+package org.projectfloodlight.openflow.exceptions;
+
+/**
+ * Error: someone asked to create an OFMessage with wireformat type and version,
+ * but that doesn't exist
+ *
+ * @author capveg
+ */
+public class NonExistantMessage extends Exception {
+
+ private static final long serialVersionUID = 1L;
+ byte type;
+ byte version;
+
+ /**
+ * Error: someone asked to create an OFMessage with wireformat type and
+ * version, but that doesn't exist
+ *
+ * @param type
+ * the wire format
+ * @param version
+ * the OpenFlow wireformat version number, e.g. 1 == v1.1, 2 =
+ * v1.2, etc.
+ */
+ public NonExistantMessage(final byte type, final byte version) {
+ this.type = type;
+ this.version = version;
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFParseError.java b/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFParseError.java
new file mode 100644
index 0000000..658dce7
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFParseError.java
@@ -0,0 +1,22 @@
+package org.projectfloodlight.openflow.exceptions;
+
+public class OFParseError extends Exception {
+ private static final long serialVersionUID = 1L;
+
+ public OFParseError() {
+ super();
+ }
+
+ public OFParseError(final String message, final Throwable cause) {
+ super(message, cause);
+ }
+
+ public OFParseError(final String message) {
+ super(message);
+ }
+
+ public OFParseError(final Throwable cause) {
+ super(cause);
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortRead.java b/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortRead.java
new file mode 100644
index 0000000..c68a678
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortRead.java
@@ -0,0 +1,6 @@
+package org.projectfloodlight.openflow.exceptions;
+
+public class OFShortRead extends Exception {
+ private static final long serialVersionUID = 1L;
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortWrite.java b/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortWrite.java
new file mode 100644
index 0000000..4f99118
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortWrite.java
@@ -0,0 +1,7 @@
+package org.projectfloodlight.openflow.exceptions;
+
+public class OFShortWrite extends Exception {
+
+ private static final long serialVersionUID = 1L;
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFUnsupported.java b/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFUnsupported.java
new file mode 100644
index 0000000..fa52c08
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/exceptions/OFUnsupported.java
@@ -0,0 +1,7 @@
+package org.projectfloodlight.openflow.exceptions;
+
+public class OFUnsupported extends Exception {
+
+ private static final long serialVersionUID = 1L;
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFBsnVportQInQT.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFBsnVportQInQT.java
new file mode 100644
index 0000000..ff077ce
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFBsnVportQInQT.java
@@ -0,0 +1,5 @@
+package org.projectfloodlight.openflow.protocol;
+
+public class OFBsnVportQInQT {
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFMatchBmap.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFMatchBmap.java
new file mode 100644
index 0000000..68ca86d
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFMatchBmap.java
@@ -0,0 +1,13 @@
+package org.projectfloodlight.openflow.protocol;
+
+import org.projectfloodlight.openflow.types.PrimitiveSinkable;
+
+import com.google.common.hash.PrimitiveSink;
+
+public class OFMatchBmap implements PrimitiveSinkable{
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageReader.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageReader.java
new file mode 100644
index 0000000..8837867
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageReader.java
@@ -0,0 +1,8 @@
+package org.projectfloodlight.openflow.protocol;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public interface OFMessageReader<T> {
+ T readFrom(ChannelBuffer bb) throws OFParseError;
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageWriter.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageWriter.java
new file mode 100644
index 0000000..bec5634
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageWriter.java
@@ -0,0 +1,8 @@
+package org.projectfloodlight.openflow.protocol;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public interface OFMessageWriter<T> {
+ public void write(ChannelBuffer bb, T message) throws OFParseError;
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFObject.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFObject.java
new file mode 100644
index 0000000..5d37987
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFObject.java
@@ -0,0 +1,11 @@
+package org.projectfloodlight.openflow.protocol;
+
+import org.projectfloodlight.openflow.types.PrimitiveSinkable;
+
+
+/**
+ * Base interface of all OpenFlow objects (e.g., messages, actions, stats, etc.)
+ */
+public interface OFObject extends Writeable, PrimitiveSinkable {
+ OFVersion getVersion();
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFObjectFactory.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFObjectFactory.java
new file mode 100644
index 0000000..c5869ef
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFObjectFactory.java
@@ -0,0 +1,7 @@
+package org.projectfloodlight.openflow.protocol;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+public interface OFObjectFactory<T extends OFObject> {
+ T read(ChannelBuffer buffer);
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFOxmList.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFOxmList.java
new file mode 100644
index 0000000..7f66110
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFOxmList.java
@@ -0,0 +1,154 @@
+package org.projectfloodlight.openflow.protocol;
+
+import java.util.EnumMap;
+import java.util.Iterator;
+import java.util.Map;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.match.MatchField;
+import org.projectfloodlight.openflow.protocol.match.MatchFields;
+import org.projectfloodlight.openflow.protocol.oxm.OFOxm;
+import org.projectfloodlight.openflow.types.OFValueType;
+import org.projectfloodlight.openflow.types.PrimitiveSinkable;
+import org.projectfloodlight.openflow.util.ChannelUtils;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import com.google.common.base.Objects;
+import com.google.common.collect.ImmutableMap;
+import com.google.common.hash.PrimitiveSink;
+
+public class OFOxmList implements Iterable<OFOxm<?>>, Writeable, PrimitiveSinkable {
+ private static final Logger logger = LoggerFactory.getLogger(OFOxmList.class);
+
+ private final Map<MatchFields, OFOxm<?>> oxmMap;
+
+ public final static OFOxmList EMPTY = new OFOxmList(ImmutableMap.<MatchFields, OFOxm<?>>of());
+
+ private OFOxmList(Map<MatchFields, OFOxm<?>> oxmMap) {
+ this.oxmMap = oxmMap;
+ }
+
+ @SuppressWarnings("unchecked")
+ public <T extends OFValueType<T>> OFOxm<T> get(MatchField<T> matchField) {
+ return (OFOxm<T>) oxmMap.get(matchField.id);
+ }
+
+ public static class Builder {
+ private final Map<MatchFields, OFOxm<?>> oxmMap;
+
+ public Builder() {
+ oxmMap = new EnumMap<MatchFields, OFOxm<?>>(MatchFields.class);
+ }
+
+ public Builder(EnumMap<MatchFields, OFOxm<?>> oxmMap) {
+ this.oxmMap = oxmMap;
+ }
+
+ public <T extends OFValueType<T>> void set(OFOxm<T> oxm) {
+ oxmMap.put(oxm.getMatchField().id, oxm);
+ }
+
+ public <T extends OFValueType<T>> void unset(MatchField<T> matchField) {
+ oxmMap.remove(matchField.id);
+ }
+
+ public OFOxmList build() {
+ return OFOxmList.ofList(oxmMap.values());
+ }
+ }
+
+ @Override
+ public Iterator<OFOxm<?>> iterator() {
+ return oxmMap.values().iterator();
+ }
+
+ public static OFOxmList ofList(Iterable<OFOxm<?>> oxmList) {
+ Map<MatchFields, OFOxm<?>> map = new EnumMap<MatchFields, OFOxm<?>>(
+ MatchFields.class);
+ for (OFOxm<?> o : oxmList) {
+ OFOxm<?> canonical = o.getCanonical();
+
+ if(logger.isDebugEnabled() && !Objects.equal(o, canonical)) {
+ logger.debug("OFOxmList: normalized non-canonical OXM {} to {}", o, canonical);
+ }
+
+ if(canonical != null)
+ map.put(canonical.getMatchField().id, canonical);
+
+ }
+ return new OFOxmList(map);
+ }
+
+ public static OFOxmList of(OFOxm<?>... oxms) {
+ Map<MatchFields, OFOxm<?>> map = new EnumMap<MatchFields, OFOxm<?>>(
+ MatchFields.class);
+ for (OFOxm<?> o : oxms) {
+ OFOxm<?> canonical = o.getCanonical();
+
+ if(logger.isDebugEnabled() && !Objects.equal(o, canonical)) {
+ logger.debug("OFOxmList: normalized non-canonical OXM {} to {}", o, canonical);
+ }
+
+ if(canonical != null)
+ map.put(canonical.getMatchField().id, canonical);
+ }
+ return new OFOxmList(map);
+ }
+
+ public static OFOxmList readFrom(ChannelBuffer bb, int length,
+ OFMessageReader<OFOxm<?>> reader) throws OFParseError {
+ return ofList(ChannelUtils.readList(bb, length, reader));
+ }
+
+ @Override
+ public void writeTo(ChannelBuffer bb) {
+ for (OFOxm<?> o : this) {
+ o.writeTo(bb);
+ }
+ }
+
+ public OFOxmList.Builder createBuilder() {
+ return new OFOxmList.Builder(new EnumMap<MatchFields, OFOxm<?>>(oxmMap));
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + ((oxmMap == null) ? 0 : oxmMap.hashCode());
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ OFOxmList other = (OFOxmList) obj;
+ if (oxmMap == null) {
+ if (other.oxmMap != null)
+ return false;
+ } else if (!oxmMap.equals(other.oxmMap))
+ return false;
+ return true;
+ }
+
+ @Override
+ public String toString() {
+ return "OFOxmList" + oxmMap;
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ for (OFOxm<?> o : this) {
+ o.putTo(sink);
+ }
+ }
+
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFRequest.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFRequest.java
new file mode 100644
index 0000000..6666943
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFRequest.java
@@ -0,0 +1,5 @@
+package org.projectfloodlight.openflow.protocol;
+
+/** Type safety interface. Enables type safe combinations of requests and replies */
+public interface OFRequest<REPLY extends OFMessage> extends OFMessage {
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFTableFeature.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFTableFeature.java
new file mode 100644
index 0000000..b722228
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFTableFeature.java
@@ -0,0 +1,5 @@
+package org.projectfloodlight.openflow.protocol;
+
+public class OFTableFeature {
+ // FIXME implement
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFVersion.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFVersion.java
new file mode 100644
index 0000000..6f54e5f
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/OFVersion.java
@@ -0,0 +1,16 @@
+package org.projectfloodlight.openflow.protocol;
+
+public enum OFVersion {
+ OF_10(1), OF_11(2), OF_12(3), OF_13(4);
+
+ public final int wireVersion;
+
+ OFVersion(final int wireVersion) {
+ this.wireVersion = wireVersion;
+ }
+
+ public int getWireVersion() {
+ return wireVersion;
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/Writeable.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/Writeable.java
new file mode 100644
index 0000000..31ae9ab
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/Writeable.java
@@ -0,0 +1,7 @@
+package org.projectfloodlight.openflow.protocol;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+public interface Writeable {
+ void writeTo(ChannelBuffer bb);
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/XidGenerator.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/XidGenerator.java
new file mode 100644
index 0000000..2ee2764
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/XidGenerator.java
@@ -0,0 +1,5 @@
+package org.projectfloodlight.openflow.protocol;
+
+public interface XidGenerator {
+ long nextXid();
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/XidGenerators.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/XidGenerators.java
new file mode 100644
index 0000000..4609afa
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/XidGenerators.java
@@ -0,0 +1,38 @@
+package org.projectfloodlight.openflow.protocol;
+
+import java.util.concurrent.atomic.AtomicLong;
+
+public class XidGenerators {
+ private static final XidGenerator GLOBAL_XID_GENERATOR = new StandardXidGenerator();
+
+ public static XidGenerator create() {
+ return new StandardXidGenerator();
+ }
+
+ public static XidGenerator global() {
+ return GLOBAL_XID_GENERATOR;
+ }
+}
+
+class StandardXidGenerator implements XidGenerator {
+
+ private final AtomicLong xidGen = new AtomicLong();
+ long MAX_XID = 0xFFffFFffL;
+
+ @Override
+ public long nextXid() {
+ long xid;
+ do {
+ xid = xidGen.incrementAndGet();
+ if(xid > MAX_XID) {
+ synchronized(this) {
+ if(xidGen.get() > MAX_XID) {
+ xidGen.set(0);
+ }
+ }
+ }
+ } while(xid > MAX_XID);
+ return xid;
+ }
+
+}
\ No newline at end of file
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/Match.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/Match.java
new file mode 100644
index 0000000..0efdcbb
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/Match.java
@@ -0,0 +1,216 @@
+package org.projectfloodlight.openflow.protocol.match;
+
+import org.projectfloodlight.openflow.protocol.OFObject;
+import org.projectfloodlight.openflow.types.Masked;
+import org.projectfloodlight.openflow.types.OFValueType;
+
+/**
+ * Generic interface for version-agnostic immutable Match structure.
+ * The Match structure is defined in the OpenFlow protocol, and it contains information on
+ * the fields to be matched in a specific flow record.
+ * This interface does not assume anything on the fields in the Match structure. If in
+ * some version, the match structure cannot handle a certain field, it may return <code>false</code>
+ * for <code>supports(...)</code> calls, and throw <code>UnsupportedOperationException</code> from all
+ * other methods in such cases.
+ * <br><br>
+ * On wildcards and masks:<br>
+ * This interface defines the following masking notations for fields:
+ * <ul>
+ * <li><b>Exact</b>: field is matched exactly against a single, fixed value (no mask, or mask is all ones).
+ * <li><b>Wildcarded</b>: field is not being matched. It is fully masked (mask=0) and any value of it
+ * will match the flow record having this match.
+ * <li><b>Partially masked</b>: field is matched using a specified mask which is neither 0 nor all ones. Mask can
+ * be either arbitrary or require some specific structure.
+ * </ul>
+ * Implementing classes may or may not support all types of these masking types. They may also support
+ * them in part. For example, OF1.0 supports exact match and (full) wildcarding for all fields, but it
+ * does only supports partial masking for IP source/destination fields, and this partial masking must be
+ * in the CIDR prefix format. Thus, OF1.0 implementation may throw <code>UnsupportedOperationException</code> if given
+ * in <code>setMasked</code> an IP mask of, for example, 255.0.255.0, or if <code>setMasked</code> is called for any field
+ * which is not IP source/destination address.
+ * <br><br>
+ * On prerequisites:<br>
+ * From the OF1.1 spec, page 28, the OF1.0 spec failed to explicitly specify this, but it
+ * is the behavior of OF1.0 switches:
+ * "Protocol-specific fields within ofp_match will be ignored within a single table when
+ * the corresponding protocol is not specified in the match. The MPLS match fields will
+ * be ignored unless the Ethertype is specified as MPLS. Likewise, the IP header and
+ * transport header fields will be ignored unless the Ethertype is specified as either
+ * IPv4 or ARP. The tp_src and tp_dst fields will be ignored unless the network protocol
+ * specified is as TCP, UDP or SCTP. Fields that are ignored don't need to be wildcarded
+ * and should be set to 0."
+ * <br><br>
+ * This interface uses generics to assure type safety in users code. However, implementing classes may have to suppress
+ * 'unchecked cast' warnings while making sure they correctly cast base on their implementation details.
+ *
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ */
+public interface Match extends OFObject {
+
+ /**
+ * Returns a value for the given field if:
+ * <ul>
+ * <li>Field is supported
+ * <li>Field is not fully wildcarded
+ * <li>Prerequisites are ok
+ * </ul>
+ * If one of the above conditions does not hold, returns null. Value is returned masked if partially wildcarded.
+ *
+ * @param field Match field to retrieve
+ * @return Value of match field (may be masked), or <code>null</code> if field is one of the conditions above does not hold.
+ * @throws UnsupportedOperationException If field is not supported.
+ */
+ public <F extends OFValueType<F>> F get(MatchField<F> field) throws UnsupportedOperationException;
+
+ /**
+ * Returns the masked value for the given field from this match, along with the mask itself.
+ * Prerequisite: field is partially masked.
+ * If prerequisite is not met, a <code>null</code> is returned.
+ *
+ * @param field Match field to retrieve.
+ * @return Masked value of match field or null if no mask is set.
+ * @throws UnsupportedOperationException If field is not supported.
+ */
+ public <F extends OFValueType<F>> Masked<F> getMasked(MatchField<F> field) throws UnsupportedOperationException;
+
+ /**
+ * Returns true if and only if this match object supports the given match field.
+ *
+ * @param field Match field
+ * @return true if field is supported, false otherwise.
+ */
+ public boolean supports(MatchField<?> field);
+
+ /**
+ * Returns true if and only if this match object supports partially bitmasking of the given field.
+ * (note: not all possible values of this bitmask have to be acceptable)
+ *
+ * @param field Match field.
+ * @return true if field can be partially masked, false otherwise.
+ * @throws UnsupportedOperationException If field is not supported.
+ */
+ public boolean supportsMasked(MatchField<?> field) throws UnsupportedOperationException;
+
+ /**
+ * Returns true if and only if this field is currently specified in the match with an exact value and
+ * no mask. I.e., the specified match will only select packets that match the exact value of getValue(field).
+ *
+ * @param field Match field.
+ * @return true if field has a specific exact value, false if not.
+ * @throws UnsupportedOperationException If field is not supported.
+ */
+ public boolean isExact(MatchField<?> field) throws UnsupportedOperationException;
+
+ /**
+ * True if and only if this field is currently logically unspecified in the match, i.e, the
+ * value returned by getValue(f) has no impact on whether a packet will be selected
+ * by the match or not.
+ *
+ * @param field Match field.
+ * @return true if field is fully wildcarded, false if not.
+ * @throws UnsupportedOperationException If field is not supported.
+ */
+ public boolean isFullyWildcarded(MatchField<?> field) throws UnsupportedOperationException;
+
+ /**
+ * True if and only if this field is currently partially specified in the match, i.e, the
+ * match will only select packets that match (p.value & getMask(field)) == getValue(field),
+ * and getMask(field) != 0.
+ *
+ * @param field Match field.
+ * @return true if field is partially masked, false if not.
+ * @throws UnsupportedOperationException If field is not supported.
+ */
+ public boolean isPartiallyMasked(MatchField<?> field) throws UnsupportedOperationException;
+
+ /**
+ * Get an Iterable over the match fields that have been specified for the
+ * match. This includes the match fields that are exact or masked match
+ * (but not fully wildcarded).
+ *
+ * @return
+ */
+ public Iterable<MatchField<?>> getMatchFields();
+
+ /**
+ * Returns a builder to build new instances of this type of match object.
+ * @return Match builder
+ */
+ public Builder createBuilder();
+
+ /**
+ * Builder interface for Match objects.
+ * Builder is used to create new Match objects and it creates the match according to the version it
+ * corresponds to. The builder uses the same notation of wildcards and masks, and can also throw
+ * <code>UnsupportedOperationException</code> if it is asked to create some matching that is not supported in
+ * the version it represents.
+ *
+ * While used, MatchBuilder may not be consistent in terms of field prerequisites. However, user must
+ * solve these before using the generated Match object as these prerequisites should be enforced in the
+ * getters.
+ *
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ */
+ interface Builder {
+ public <F extends OFValueType<F>> F get(MatchField<F> field) throws UnsupportedOperationException;
+
+ public <F extends OFValueType<F>> Masked<F> getMasked(MatchField<F> field) throws UnsupportedOperationException;
+
+ public boolean supports(MatchField<?> field);
+
+ public boolean supportsMasked(MatchField<?> field) throws UnsupportedOperationException;
+
+ public boolean isExact(MatchField<?> field) throws UnsupportedOperationException;
+
+ public boolean isFullyWildcarded(MatchField<?> field) throws UnsupportedOperationException;
+
+ public boolean isPartiallyMasked(MatchField<?> field) throws UnsupportedOperationException;
+
+ /**
+ * Sets a specific exact value for a field.
+ *
+ * @param field Match field to set.
+ * @param value Value of match field.
+ * @return the Builder instance used.
+ * @throws UnsupportedOperationException If field is not supported.
+ */
+ public <F extends OFValueType<F>> Builder setExact(MatchField<F> field, F value) throws UnsupportedOperationException;
+
+ /**
+ * Sets a masked value for a field.
+ *
+ * @param field Match field to set.
+ * @param value Value of field.
+ * @param mask Mask value.
+ * @return the Builder instance used.
+ * @throws UnsupportedOperationException If field is not supported, if field is supported but does not support masking, or if mask structure is not supported.
+ */
+ public <F extends OFValueType<F>> Builder setMasked(MatchField<F> field, F value, F mask) throws UnsupportedOperationException;
+
+ /**
+ * Sets a masked value for a field.
+ *
+ * @param field Match field to set.
+ * @param valueWithMask Compound Masked object contains the value and the mask.
+ * @return the Builder instance used.
+ * @throws UnsupportedOperationException If field is not supported, if field is supported but does not support masking, or if mask structure is not supported.
+ */
+ public <F extends OFValueType<F>> Builder setMasked(MatchField<F> field, Masked<F> valueWithMask) throws UnsupportedOperationException;
+
+ /**
+ * Unsets any value given for the field and wildcards it so that it matches any value.
+ *
+ * @param field Match field to unset.
+ * @return the Builder instance used.
+ * @throws UnsupportedOperationException If field is not supported.
+ */
+ public <F extends OFValueType<F>> Builder wildcard(MatchField<F> field) throws UnsupportedOperationException;
+
+ /**
+ * Returns the match created by this builder.
+ *
+ * @return a Match object.
+ */
+ public Match build();
+ }
+}
\ No newline at end of file
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchField.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchField.java
new file mode 100644
index 0000000..f103230
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchField.java
@@ -0,0 +1,248 @@
+package org.projectfloodlight.openflow.protocol.match;
+
+import org.projectfloodlight.openflow.types.ArpOpcode;
+import org.projectfloodlight.openflow.types.ClassId;
+import org.projectfloodlight.openflow.types.EthType;
+import org.projectfloodlight.openflow.types.ICMPv4Code;
+import org.projectfloodlight.openflow.types.ICMPv4Type;
+import org.projectfloodlight.openflow.types.IPv4Address;
+import org.projectfloodlight.openflow.types.IPv6Address;
+import org.projectfloodlight.openflow.types.IPv6FlowLabel;
+import org.projectfloodlight.openflow.types.IpDscp;
+import org.projectfloodlight.openflow.types.IpEcn;
+import org.projectfloodlight.openflow.types.IpProtocol;
+import org.projectfloodlight.openflow.types.LagId;
+import org.projectfloodlight.openflow.types.MacAddress;
+import org.projectfloodlight.openflow.types.OFBitMask128;
+import org.projectfloodlight.openflow.types.OFBooleanValue;
+import org.projectfloodlight.openflow.types.OFMetadata;
+import org.projectfloodlight.openflow.types.OFPort;
+import org.projectfloodlight.openflow.types.OFValueType;
+import org.projectfloodlight.openflow.types.OFVlanVidMatch;
+import org.projectfloodlight.openflow.types.TransportPort;
+import org.projectfloodlight.openflow.types.U16;
+import org.projectfloodlight.openflow.types.U64;
+import org.projectfloodlight.openflow.types.U32;
+import org.projectfloodlight.openflow.types.U8;
+import org.projectfloodlight.openflow.types.UDF;
+import org.projectfloodlight.openflow.types.VRF;
+import org.projectfloodlight.openflow.types.VlanPcp;
+
+@SuppressWarnings("unchecked")
+public class MatchField<F extends OFValueType<F>> {
+ private final String name;
+ public final MatchFields id;
+ private final Prerequisite<?>[] prerequisites;
+
+ private MatchField(final String name, final MatchFields id, Prerequisite<?>... prerequisites) {
+ this.name = name;
+ this.id = id;
+ this.prerequisites = prerequisites;
+ }
+
+ public final static MatchField<OFPort> IN_PORT =
+ new MatchField<OFPort>("in_port", MatchFields.IN_PORT);
+
+ public final static MatchField<OFPort> IN_PHY_PORT =
+ new MatchField<OFPort>("in_phy_port", MatchFields.IN_PHY_PORT,
+ new Prerequisite<OFPort>(MatchField.IN_PORT));
+
+ public final static MatchField<OFMetadata> METADATA =
+ new MatchField<OFMetadata>("metadata", MatchFields.METADATA);
+
+ public final static MatchField<MacAddress> ETH_DST =
+ new MatchField<MacAddress>("eth_dst", MatchFields.ETH_DST);
+
+ public final static MatchField<MacAddress> ETH_SRC =
+ new MatchField<MacAddress>("eth_src", MatchFields.ETH_SRC);
+
+ public final static MatchField<EthType> ETH_TYPE =
+ new MatchField<EthType>("eth_type", MatchFields.ETH_TYPE);
+
+ public final static MatchField<OFVlanVidMatch> VLAN_VID =
+ new MatchField<OFVlanVidMatch>("vlan_vid", MatchFields.VLAN_VID);
+
+ public final static MatchField<VlanPcp> VLAN_PCP =
+ new MatchField<VlanPcp>("vlan_pcp", MatchFields.VLAN_PCP,
+ new Prerequisite<OFVlanVidMatch>(MatchField.VLAN_VID));
+
+ public final static MatchField<IpDscp> IP_DSCP =
+ new MatchField<IpDscp>("ip_dscp", MatchFields.IP_DSCP,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.IPv4, EthType.IPv6));
+
+ public final static MatchField<IpEcn> IP_ECN =
+ new MatchField<IpEcn>("ip_ecn", MatchFields.IP_ECN,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.IPv4, EthType.IPv6));
+
+ public final static MatchField<IpProtocol> IP_PROTO =
+ new MatchField<IpProtocol>("ip_proto", MatchFields.IP_PROTO,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.IPv4, EthType.IPv6));
+
+ public final static MatchField<IPv4Address> IPV4_SRC =
+ new MatchField<IPv4Address>("ipv4_src", MatchFields.IPV4_SRC,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.IPv4));
+
+ public final static MatchField<IPv4Address> IPV4_DST =
+ new MatchField<IPv4Address>("ipv4_dst", MatchFields.IPV4_DST,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.IPv4));
+
+ public final static MatchField<TransportPort> TCP_SRC = new MatchField<TransportPort>(
+ "tcp_src", MatchFields.TCP_SRC,
+ new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.TCP));
+
+ public final static MatchField<TransportPort> TCP_DST = new MatchField<TransportPort>(
+ "tcp_dst", MatchFields.TCP_DST,
+ new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.TCP));
+
+ public final static MatchField<TransportPort> UDP_SRC = new MatchField<TransportPort>(
+ "udp_src", MatchFields.UDP_SRC,
+ new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.UDP));
+
+ public final static MatchField<TransportPort> UDP_DST = new MatchField<TransportPort>(
+ "udp_dst", MatchFields.UDP_DST,
+ new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.UDP));
+
+ public final static MatchField<TransportPort> SCTP_SRC = new MatchField<TransportPort>(
+ "sctp_src", MatchFields.SCTP_SRC,
+ new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.SCTP));
+
+ public final static MatchField<TransportPort> SCTP_DST = new MatchField<TransportPort>(
+ "sctp_dst", MatchFields.SCTP_DST,
+ new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.SCTP));
+
+ public final static MatchField<ICMPv4Type> ICMPV4_TYPE = new MatchField<ICMPv4Type>(
+ "icmpv4_type", MatchFields.ICMPV4_TYPE,
+ new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.ICMP));
+
+ public final static MatchField<ICMPv4Code> ICMPV4_CODE = new MatchField<ICMPv4Code>(
+ "icmpv4_code", MatchFields.ICMPV4_CODE,
+ new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.ICMP));
+
+ public final static MatchField<ArpOpcode> ARP_OP = new MatchField<ArpOpcode>(
+ "arp_op", MatchFields.ARP_OP,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ARP));
+
+ public final static MatchField<IPv4Address> ARP_SPA =
+ new MatchField<IPv4Address>("arp_spa", MatchFields.ARP_SPA,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ARP));
+
+ public final static MatchField<IPv4Address> ARP_TPA =
+ new MatchField<IPv4Address>("arp_tpa", MatchFields.ARP_TPA,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ARP));
+
+ public final static MatchField<MacAddress> ARP_SHA =
+ new MatchField<MacAddress>("arp_sha", MatchFields.ARP_SHA,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ARP));
+
+ public final static MatchField<MacAddress> ARP_THA =
+ new MatchField<MacAddress>("arp_tha", MatchFields.ARP_THA,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ARP));
+
+ public final static MatchField<IPv6Address> IPV6_SRC =
+ new MatchField<IPv6Address>("ipv6_src", MatchFields.IPV6_SRC,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.IPv6));
+
+ public final static MatchField<IPv6Address> IPV6_DST =
+ new MatchField<IPv6Address>("ipv6_dst", MatchFields.IPV6_DST,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.IPv6));
+
+ public final static MatchField<IPv6FlowLabel> IPV6_FLABEL =
+ new MatchField<IPv6FlowLabel>("ipv6_flabel", MatchFields.IPV6_FLABEL,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.IPv6));
+
+ public final static MatchField<U8> ICMPV6_TYPE =
+ new MatchField<U8>("icmpv6_type", MatchFields.ICMPV6_TYPE,
+ new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.IPv6_ICMP));
+
+ public final static MatchField<U8> ICMPV6_CODE =
+ new MatchField<U8>("icmpv6_code", MatchFields.ICMPV6_CODE,
+ new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.IPv6_ICMP));
+
+ public final static MatchField<IPv6Address> IPV6_ND_TARGET =
+ new MatchField<IPv6Address>("ipv6_nd_target", MatchFields.IPV6_ND_TARGET,
+ new Prerequisite<U8>(MatchField.ICMPV6_TYPE, U8.of((short)135), U8.of((short)136)));
+
+ public final static MatchField<MacAddress> IPV6_ND_SLL =
+ new MatchField<MacAddress>("ipv6_nd_sll", MatchFields.IPV6_ND_SLL,
+ new Prerequisite<U8>(MatchField.ICMPV6_TYPE, U8.of((short)135)));
+
+ public final static MatchField<MacAddress> IPV6_ND_TLL =
+ new MatchField<MacAddress>("ipv6_nd_tll", MatchFields.IPV6_ND_TLL,
+ new Prerequisite<U8>(MatchField.ICMPV6_TYPE, U8.of((short)136)));
+
+ public final static MatchField<U32> MPLS_LABEL =
+ new MatchField<U32>("mpls_label", MatchFields.MPLS_LABEL,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.MPLS_UNICAST, EthType.MPLS_MULTICAST));
+
+ public final static MatchField<U8> MPLS_TC =
+ new MatchField<U8>("mpls_tc", MatchFields.MPLS_TC,
+ new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.MPLS_UNICAST, EthType.MPLS_MULTICAST));
+
+ public final static MatchField<U64> TUNNEL_ID =
+ new MatchField<U64>("tunnel_id", MatchFields.TUNNEL_ID);
+
+ public final static MatchField<OFBitMask128> BSN_IN_PORTS_128 =
+ new MatchField<OFBitMask128>("bsn_in_ports_128", MatchFields.BSN_IN_PORTS_128);
+
+ public final static MatchField<LagId> BSN_LAG_ID =
+ new MatchField<LagId>("bsn_lag_id", MatchFields.BSN_LAG_ID);
+
+ public final static MatchField<VRF> BSN_VRF =
+ new MatchField<VRF>("bsn_vrf", MatchFields.BSN_VRF);
+
+ public final static MatchField<OFBooleanValue> BSN_GLOBAL_VRF_ALLOWED =
+ new MatchField<OFBooleanValue>("bsn_global_vrf_allowed", MatchFields.BSN_GLOBAL_VRF_ALLOWED);
+
+ public final static MatchField<ClassId> BSN_L3_INTERFACE_CLASS_ID =
+ new MatchField<ClassId>("bsn_l3_interface_class_id", MatchFields.BSN_L3_INTERFACE_CLASS_ID);
+
+ public final static MatchField<ClassId> BSN_L3_SRC_CLASS_ID =
+ new MatchField<ClassId>("bsn_l3_src_class_id", MatchFields.BSN_L3_SRC_CLASS_ID);
+
+ public final static MatchField<ClassId> BSN_L3_DST_CLASS_ID =
+ new MatchField<ClassId>("bsn_l3_dst_class_id", MatchFields.BSN_L3_DST_CLASS_ID);
+
+ public final static MatchField<ClassId> BSN_EGR_PORT_GROUP_ID =
+ new MatchField<ClassId>("bsn_egr_port_group_id", MatchFields.BSN_EGR_PORT_GROUP_ID);
+
+ public final static MatchField<UDF> BSN_UDF0 =
+ new MatchField<UDF>("bsn_udf", MatchFields.BSN_UDF0);
+
+ public final static MatchField<UDF> BSN_UDF1 =
+ new MatchField<UDF>("bsn_udf", MatchFields.BSN_UDF1);
+
+ public final static MatchField<UDF> BSN_UDF2 =
+ new MatchField<UDF>("bsn_udf", MatchFields.BSN_UDF2);
+
+ public final static MatchField<UDF> BSN_UDF3 =
+ new MatchField<UDF>("bsn_udf", MatchFields.BSN_UDF3);
+
+ public final static MatchField<UDF> BSN_UDF4 =
+ new MatchField<UDF>("bsn_udf", MatchFields.BSN_UDF4);
+
+ public final static MatchField<UDF> BSN_UDF5 =
+ new MatchField<UDF>("bsn_udf", MatchFields.BSN_UDF5);
+
+ public final static MatchField<UDF> BSN_UDF6 =
+ new MatchField<UDF>("bsn_udf", MatchFields.BSN_UDF6);
+
+ public final static MatchField<UDF> BSN_UDF7 =
+ new MatchField<UDF>("bsn_udf", MatchFields.BSN_UDF7);
+
+ public final static MatchField<U16> BSN_TCP_FLAGS =
+ new MatchField<U16>("bsn_tcp_flags", MatchFields.BSN_TCP_FLAGS);
+
+ public String getName() {
+ return name;
+ }
+
+ public boolean arePrerequisitesOK(Match match) {
+ for (Prerequisite<?> p : this.prerequisites) {
+ if (!p.isSatisfied(match)) {
+ return false;
+ }
+ }
+ return true;
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchFields.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchFields.java
new file mode 100644
index 0000000..354a528
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchFields.java
@@ -0,0 +1,59 @@
+package org.projectfloodlight.openflow.protocol.match;
+
+// MUST BE ORDERED BY THE ORDER OF OF SPEC!!!
+public enum MatchFields {
+ IN_PORT,
+ IN_PHY_PORT,
+ METADATA,
+ ETH_DST,
+ ETH_SRC,
+ ETH_TYPE,
+ VLAN_VID,
+ VLAN_PCP,
+ IP_DSCP,
+ IP_ECN,
+ IP_PROTO,
+ IPV4_SRC,
+ IPV4_DST,
+ TCP_SRC,
+ TCP_DST,
+ UDP_SRC,
+ UDP_DST,
+ SCTP_SRC,
+ SCTP_DST,
+ ICMPV4_TYPE,
+ ICMPV4_CODE,
+ ARP_OP,
+ ARP_SPA,
+ ARP_TPA,
+ ARP_SHA,
+ ARP_THA,
+ IPV6_SRC,
+ IPV6_DST,
+ IPV6_FLABEL,
+ ICMPV6_TYPE,
+ ICMPV6_CODE,
+ IPV6_ND_TARGET,
+ IPV6_ND_SLL,
+ IPV6_ND_TLL,
+ MPLS_LABEL,
+ MPLS_TC,
+ TUNNEL_ID,
+ BSN_IN_PORTS_128,
+ BSN_LAG_ID,
+ BSN_VRF,
+ BSN_GLOBAL_VRF_ALLOWED,
+ BSN_L3_INTERFACE_CLASS_ID,
+ BSN_L3_SRC_CLASS_ID,
+ BSN_L3_DST_CLASS_ID,
+ BSN_EGR_PORT_GROUP_ID,
+ BSN_UDF0,
+ BSN_UDF1,
+ BSN_UDF2,
+ BSN_UDF3,
+ BSN_UDF4,
+ BSN_UDF5,
+ BSN_UDF6,
+ BSN_UDF7,
+ BSN_TCP_FLAGS,
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/Prerequisite.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/Prerequisite.java
new file mode 100644
index 0000000..03d5e79
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/match/Prerequisite.java
@@ -0,0 +1,45 @@
+package org.projectfloodlight.openflow.protocol.match;
+
+import java.util.HashSet;
+import java.util.Set;
+
+import org.projectfloodlight.openflow.types.OFValueType;
+
+public class Prerequisite<T extends OFValueType<T>> {
+ private final MatchField<T> field;
+ private final Set<OFValueType<T>> values;
+ private boolean any;
+
+ @SafeVarargs
+ public Prerequisite(MatchField<T> field, OFValueType<T>... values) {
+ this.values = new HashSet<OFValueType<T>>();
+ this.field = field;
+ if (values == null || values.length == 0) {
+ this.any = true;
+ } else {
+ this.any = false;
+ for (OFValueType<T> value : values) {
+ this.values.add(value);
+ }
+ }
+ }
+
+ /**
+ * Returns true if this prerequisite is satisfied by the given match object.
+ *
+ * @param match Match object
+ * @return true iff prerequisite is satisfied.
+ */
+ public boolean isSatisfied(Match match) {
+ OFValueType<T> res = match.get(this.field);
+ if (res == null)
+ return false;
+ if (this.any)
+ return true;
+ if (this.values.contains(res)) {
+ return true;
+ }
+ return false;
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver10/ChannelUtilsVer10.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver10/ChannelUtilsVer10.java
new file mode 100644
index 0000000..b4937ba
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver10/ChannelUtilsVer10.java
@@ -0,0 +1,91 @@
+package org.projectfloodlight.openflow.protocol.ver10;
+
+import java.util.EnumSet;
+import java.util.Set;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFActionType;
+import org.projectfloodlight.openflow.protocol.match.Match;
+
+import com.google.common.hash.PrimitiveSink;
+
+/**
+ * Collection of helper functions for reading and writing into ChannelBuffers
+ *
+ * @author capveg
+ */
+
+public class ChannelUtilsVer10 {
+ public static Match readOFMatch(final ChannelBuffer bb) throws OFParseError {
+ return OFMatchV1Ver10.READER.readFrom(bb);
+ }
+
+ public static Set<OFActionType> readSupportedActions(ChannelBuffer bb) {
+ int actions = bb.readInt();
+ EnumSet<OFActionType> supportedActions = EnumSet.noneOf(OFActionType.class);
+ if ((actions & (1 << OFActionTypeSerializerVer10.OUTPUT_VAL)) != 0)
+ supportedActions.add(OFActionType.OUTPUT);
+ if ((actions & (1 << OFActionTypeSerializerVer10.SET_VLAN_VID_VAL)) != 0)
+ supportedActions.add(OFActionType.SET_VLAN_VID);
+ if ((actions & (1 << OFActionTypeSerializerVer10.SET_VLAN_PCP_VAL)) != 0)
+ supportedActions.add(OFActionType.SET_VLAN_PCP);
+ if ((actions & (1 << OFActionTypeSerializerVer10.STRIP_VLAN_VAL)) != 0)
+ supportedActions.add(OFActionType.STRIP_VLAN);
+ if ((actions & (1 << OFActionTypeSerializerVer10.SET_DL_SRC_VAL)) != 0)
+ supportedActions.add(OFActionType.SET_DL_SRC);
+ if ((actions & (1 << OFActionTypeSerializerVer10.SET_DL_DST_VAL)) != 0)
+ supportedActions.add(OFActionType.SET_DL_DST);
+ if ((actions & (1 << OFActionTypeSerializerVer10.SET_NW_SRC_VAL)) != 0)
+ supportedActions.add(OFActionType.SET_NW_SRC);
+ if ((actions & (1 << OFActionTypeSerializerVer10.SET_NW_DST_VAL)) != 0)
+ supportedActions.add(OFActionType.SET_NW_DST);
+ if ((actions & (1 << OFActionTypeSerializerVer10.SET_NW_TOS_VAL)) != 0)
+ supportedActions.add(OFActionType.SET_NW_TOS);
+ if ((actions & (1 << OFActionTypeSerializerVer10.SET_TP_SRC_VAL)) != 0)
+ supportedActions.add(OFActionType.SET_TP_SRC);
+ if ((actions & (1 << OFActionTypeSerializerVer10.SET_TP_DST_VAL)) != 0)
+ supportedActions.add(OFActionType.SET_TP_DST);
+ if ((actions & (1 << OFActionTypeSerializerVer10.ENQUEUE_VAL)) != 0)
+ supportedActions.add(OFActionType.ENQUEUE);
+ return supportedActions;
+ }
+
+ public static int supportedActionsToWire(Set<OFActionType> supportedActions) {
+ int supportedActionsVal = 0;
+ if (supportedActions.contains(OFActionType.OUTPUT))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.OUTPUT_VAL);
+ if (supportedActions.contains(OFActionType.SET_VLAN_VID))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.SET_VLAN_VID_VAL);
+ if (supportedActions.contains(OFActionType.SET_VLAN_PCP))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.SET_VLAN_PCP_VAL);
+ if (supportedActions.contains(OFActionType.STRIP_VLAN))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.STRIP_VLAN_VAL);
+ if (supportedActions.contains(OFActionType.SET_DL_SRC))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.SET_DL_SRC_VAL);
+ if (supportedActions.contains(OFActionType.SET_DL_DST))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.SET_DL_DST_VAL);
+ if (supportedActions.contains(OFActionType.SET_NW_SRC))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.SET_NW_SRC_VAL);
+ if (supportedActions.contains(OFActionType.SET_NW_DST))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.SET_NW_DST_VAL);
+ if (supportedActions.contains(OFActionType.SET_NW_TOS))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.SET_NW_TOS_VAL);
+ if (supportedActions.contains(OFActionType.SET_TP_SRC))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.SET_TP_SRC_VAL);
+ if (supportedActions.contains(OFActionType.SET_TP_DST))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.SET_TP_DST_VAL);
+ if (supportedActions.contains(OFActionType.ENQUEUE))
+ supportedActionsVal |= (1 << OFActionTypeSerializerVer10.ENQUEUE_VAL);
+ return supportedActionsVal;
+ }
+
+ public static void putSupportedActionsTo(Set<OFActionType> supportedActions, PrimitiveSink sink) {
+ sink.putInt(supportedActionsToWire(supportedActions));
+ }
+
+ public static void writeSupportedActions(ChannelBuffer bb, Set<OFActionType> supportedActions) {
+ bb.writeInt(supportedActionsToWire(supportedActions));
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver11/ChannelUtilsVer11.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver11/ChannelUtilsVer11.java
new file mode 100644
index 0000000..b090e47
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver11/ChannelUtilsVer11.java
@@ -0,0 +1,26 @@
+package org.projectfloodlight.openflow.protocol.ver11;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMatchBmap;
+import org.projectfloodlight.openflow.protocol.match.Match;
+
+/**
+ * Collection of helper functions for reading and writing into ChannelBuffers
+ *
+ * @author capveg
+ */
+
+public class ChannelUtilsVer11 {
+ public static Match readOFMatch(final ChannelBuffer bb) throws OFParseError {
+ return OFMatchV2Ver11.READER.readFrom(bb);
+ }
+
+ public static OFMatchBmap readOFMatchBmap(ChannelBuffer bb) {
+ throw new UnsupportedOperationException("not implemented");
+ }
+
+ public static void writeOFMatchBmap(ChannelBuffer bb, OFMatchBmap match) {
+ throw new UnsupportedOperationException("not implemented");
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver12/ChannelUtilsVer12.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver12/ChannelUtilsVer12.java
new file mode 100644
index 0000000..756363d
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver12/ChannelUtilsVer12.java
@@ -0,0 +1,40 @@
+package org.projectfloodlight.openflow.protocol.ver12;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMatchBmap;
+import org.projectfloodlight.openflow.protocol.match.Match;
+import org.projectfloodlight.openflow.protocol.ver12.OFMatchV3Ver12;
+import org.projectfloodlight.openflow.protocol.OFBsnVportQInQ;
+
+/**
+ * Collection of helper functions for reading and writing into ChannelBuffers
+ *
+ * @author capveg
+ */
+
+public class ChannelUtilsVer12 {
+ public static Match readOFMatch(final ChannelBuffer bb) throws OFParseError {
+ return OFMatchV3Ver12.READER.readFrom(bb);
+ }
+
+ // TODO these need to be figured out / removed
+
+ public static OFBsnVportQInQ readOFBsnVportQInQ(ChannelBuffer bb) {
+ throw new UnsupportedOperationException("not implemented");
+ }
+
+ public static void writeOFBsnVportQInQ(ChannelBuffer bb,
+ OFBsnVportQInQ vport) {
+ throw new UnsupportedOperationException("not implemented");
+
+ }
+
+ public static OFMatchBmap readOFMatchBmap(ChannelBuffer bb) {
+ throw new UnsupportedOperationException("not implemented");
+ }
+
+ public static void writeOFMatchBmap(ChannelBuffer bb, OFMatchBmap match) {
+ throw new UnsupportedOperationException("not implemented");
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver13/ChannelUtilsVer13.java b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver13/ChannelUtilsVer13.java
new file mode 100644
index 0000000..8216bb0
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/protocol/ver13/ChannelUtilsVer13.java
@@ -0,0 +1,26 @@
+package org.projectfloodlight.openflow.protocol.ver13;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMatchBmap;
+import org.projectfloodlight.openflow.protocol.match.Match;
+
+/**
+ * Collection of helper functions for reading and writing into ChannelBuffers
+ *
+ * @author capveg
+ */
+
+public class ChannelUtilsVer13 {
+ public static Match readOFMatch(final ChannelBuffer bb) throws OFParseError {
+ return OFMatchV3Ver13.READER.readFrom(bb);
+ }
+
+ public static OFMatchBmap readOFMatchBmap(ChannelBuffer bb) {
+ throw new UnsupportedOperationException("not implemented");
+ }
+
+ public static void writeOFMatchBmap(ChannelBuffer bb, OFMatchBmap match) {
+ throw new UnsupportedOperationException("not implemented");
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/ArpOpcode.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/ArpOpcode.java
new file mode 100644
index 0000000..dd50d29
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/ArpOpcode.java
@@ -0,0 +1,198 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+public class ArpOpcode implements OFValueType<ArpOpcode> {
+
+ final static int LENGTH = 2;
+
+ private static final int VAL_REQUEST = 1;
+ private static final int VAL_REPLY = 2;
+ private static final int VAL_REQUEST_REVERSE = 3;
+ private static final int VAL_REPLY_REVERSE = 4;
+ private static final int VAL_DRARP_REQUEST = 5;
+ private static final int VAL_DRARP_REPLY = 6;
+ private static final int VAL_DRARP_ERROR = 7;
+ private static final int VAL_INARP_REQUEST = 8;
+ private static final int VAL_INARP_REPLY = 9;
+ private static final int VAL_ARP_NAK = 10;
+ private static final int VAL_MARS_REQUEST = 11;
+ private static final int VAL_MARS_MULTI = 12;
+ private static final int VAL_MARS_MSERV = 13;
+ private static final int VAL_MARS_JOIN = 14;
+ private static final int VAL_MARS_LEAVE = 15;
+ private static final int VAL_MARS_NAK = 16;
+ private static final int VAL_MARS_UNSERV = 17;
+ private static final int VAL_MARS_SJOIN = 18;
+ private static final int VAL_MARS_SLEAVE = 19;
+ private static final int VAL_MARS_GROUPLIST_REQUEST = 20;
+ private static final int VAL_MARS_GROUPLIST_REPLY = 21;
+ private static final int VAL_MARS_REDIRECT_MAP = 22;
+ private static final int VAL_MAPOS_UNARP = 23;
+ private static final int VAL_OP_EXP1 = 24;
+ private static final int VAL_OP_EXP2 = 25;
+
+ public static final ArpOpcode REQUEST = new ArpOpcode(VAL_REQUEST);
+ public static final ArpOpcode REPLY = new ArpOpcode(VAL_REPLY);
+ public static final ArpOpcode REQUEST_REVERSE = new ArpOpcode(VAL_REQUEST_REVERSE);
+ public static final ArpOpcode REPLY_REVERSE = new ArpOpcode(VAL_REPLY_REVERSE);
+ public static final ArpOpcode DRARP_REQUEST = new ArpOpcode(VAL_DRARP_REQUEST);
+ public static final ArpOpcode DRARP_REPLY = new ArpOpcode(VAL_DRARP_REPLY);
+ public static final ArpOpcode DRARP_ERROR = new ArpOpcode(VAL_DRARP_ERROR);
+ public static final ArpOpcode INARP_REQUEST = new ArpOpcode(VAL_INARP_REQUEST);
+ public static final ArpOpcode INARP_REPLY = new ArpOpcode(VAL_INARP_REPLY);
+ public static final ArpOpcode ARP_NAK = new ArpOpcode(VAL_ARP_NAK);
+ public static final ArpOpcode MARS_REQUEST = new ArpOpcode(VAL_MARS_REQUEST);
+ public static final ArpOpcode MARS_MULTI = new ArpOpcode(VAL_MARS_MULTI);
+ public static final ArpOpcode MARS_MSERV = new ArpOpcode(VAL_MARS_MSERV);
+ public static final ArpOpcode MARS_JOIN = new ArpOpcode(VAL_MARS_JOIN);
+ public static final ArpOpcode MARS_LEAVE = new ArpOpcode(VAL_MARS_LEAVE);
+ public static final ArpOpcode MARS_NAK = new ArpOpcode(VAL_MARS_NAK);
+ public static final ArpOpcode MARS_UNSERV = new ArpOpcode(VAL_MARS_UNSERV);
+ public static final ArpOpcode MARS_SJOIN = new ArpOpcode(VAL_MARS_SJOIN);
+ public static final ArpOpcode MARS_SLEAVE = new ArpOpcode(VAL_MARS_SLEAVE);
+ public static final ArpOpcode MARS_GROUPLIST_REQUEST = new ArpOpcode(VAL_MARS_GROUPLIST_REQUEST);
+ public static final ArpOpcode MARS_GROUPLIST_REPLY = new ArpOpcode(VAL_MARS_GROUPLIST_REPLY);
+ public static final ArpOpcode MARS_REDIRECT_MAP = new ArpOpcode(VAL_MARS_REDIRECT_MAP);
+ public static final ArpOpcode MAPOS_UNARP = new ArpOpcode(VAL_MAPOS_UNARP);
+ public static final ArpOpcode OP_EXP1 = new ArpOpcode(VAL_OP_EXP1);
+ public static final ArpOpcode OP_EXP2 = new ArpOpcode(VAL_OP_EXP2);
+
+ private static final int MIN_OPCODE = 0;
+ private static final int MAX_OPCODE = 0xFFFF;
+
+ private static final int NONE_VAL = 0;
+ public static final ArpOpcode NONE = new ArpOpcode(NONE_VAL);
+
+ public static final ArpOpcode NO_MASK = new ArpOpcode(0xFFFFFFFF);
+ public static final ArpOpcode FULL_MASK = new ArpOpcode(0x00000000);
+
+ private final int opcode;
+
+ private ArpOpcode(int opcode) {
+ this.opcode = opcode;
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ public int getOpcode() {
+ return this.opcode;
+ }
+
+ public static ArpOpcode of(int opcode) {
+ if (opcode < MIN_OPCODE || opcode > MAX_OPCODE)
+ throw new IllegalArgumentException("Invalid ARP opcode: " + opcode);
+ switch (opcode) {
+ case NONE_VAL:
+ return NONE;
+ case VAL_REQUEST:
+ return REQUEST;
+ case VAL_REPLY:
+ return REPLY;
+ case VAL_REQUEST_REVERSE:
+ return REQUEST_REVERSE;
+ case VAL_REPLY_REVERSE:
+ return REPLY_REVERSE;
+ case VAL_DRARP_REQUEST:
+ return DRARP_REQUEST;
+ case VAL_DRARP_REPLY:
+ return DRARP_REPLY;
+ case VAL_DRARP_ERROR:
+ return DRARP_ERROR;
+ case VAL_INARP_REQUEST:
+ return INARP_REQUEST;
+ case VAL_INARP_REPLY:
+ return INARP_REPLY;
+ case VAL_ARP_NAK:
+ return ARP_NAK;
+ case VAL_MARS_REQUEST:
+ return MARS_REQUEST;
+ case VAL_MARS_MULTI:
+ return MARS_MULTI;
+ case VAL_MARS_MSERV:
+ return MARS_MSERV;
+ case VAL_MARS_JOIN:
+ return MARS_JOIN;
+ case VAL_MARS_LEAVE:
+ return MARS_LEAVE;
+ case VAL_MARS_NAK:
+ return MARS_NAK;
+ case VAL_MARS_UNSERV:
+ return MARS_UNSERV;
+ case VAL_MARS_SJOIN:
+ return MARS_SJOIN;
+ case VAL_MARS_SLEAVE:
+ return MARS_SLEAVE;
+ case VAL_MARS_GROUPLIST_REQUEST:
+ return MARS_GROUPLIST_REQUEST;
+ case VAL_MARS_GROUPLIST_REPLY:
+ return MARS_GROUPLIST_REPLY;
+ case VAL_MARS_REDIRECT_MAP:
+ return MARS_REDIRECT_MAP;
+ case VAL_MAPOS_UNARP:
+ return MAPOS_UNARP;
+ case VAL_OP_EXP1:
+ return OP_EXP1;
+ case VAL_OP_EXP2:
+ return OP_EXP2;
+ default:
+ return new ArpOpcode(opcode);
+ }
+ }
+
+ public void write2Bytes(ChannelBuffer c) {
+ c.writeShort(this.opcode);
+ }
+
+ public static ArpOpcode read2Bytes(ChannelBuffer c) {
+ return ArpOpcode.of(c.readUnsignedShort());
+ }
+
+ @Override
+ public ArpOpcode applyMask(ArpOpcode mask) {
+ return ArpOpcode.of(this.opcode & mask.opcode);
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + opcode;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ ArpOpcode other = (ArpOpcode) obj;
+ if (opcode != other.opcode)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int compareTo(ArpOpcode o) {
+ return UnsignedInts.compare(opcode, o.opcode);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putShort((short) this.opcode);
+ }
+
+ @Override
+ public String toString() {
+ return String.valueOf(this.opcode);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/ClassId.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/ClassId.java
new file mode 100644
index 0000000..7d7c38e
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/ClassId.java
@@ -0,0 +1,92 @@
+package org.projectfloodlight.openflow.types;
+
+import javax.annotation.concurrent.Immutable;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+@Immutable
+public class ClassId implements OFValueType<ClassId> {
+ static final int LENGTH = 4;
+
+ private final static int NONE_VAL = 0;
+ public final static ClassId NONE = new ClassId(NONE_VAL);
+
+ private final static int NO_MASK_VAL = 0xFFFFFFFF;
+ public final static ClassId NO_MASK = new ClassId(NO_MASK_VAL);
+ public final static ClassId FULL_MASK = NONE;
+
+ private final int rawValue;
+
+ private ClassId(final int rawValue) {
+ this.rawValue = rawValue;
+ }
+
+ public static ClassId of(final int raw) {
+ if(raw == NONE_VAL)
+ return NONE;
+ else if(raw == NO_MASK_VAL)
+ return NO_MASK;
+ return new ClassId(raw);
+ }
+
+ public int getInt() {
+ return rawValue;
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public String toString() {
+ return Integer.toString(rawValue);
+ }
+
+ @Override
+ public ClassId applyMask(ClassId mask) {
+ return ClassId.of(rawValue & mask.rawValue); }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + rawValue;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ ClassId other = (ClassId) obj;
+ if (rawValue != other.rawValue)
+ return false;
+ return true;
+ }
+
+ public void write4Bytes(ChannelBuffer c) {
+ c.writeInt(rawValue);
+ }
+
+ public static ClassId read4Bytes(ChannelBuffer c) {
+ return ClassId.of(c.readInt());
+ }
+
+ @Override
+ public int compareTo(ClassId o) {
+ return UnsignedInts.compare(rawValue, rawValue);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(rawValue);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/DatapathId.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/DatapathId.java
new file mode 100644
index 0000000..79fa14f
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/DatapathId.java
@@ -0,0 +1,87 @@
+package org.projectfloodlight.openflow.types;
+
+import org.projectfloodlight.openflow.annotations.Immutable;
+import org.projectfloodlight.openflow.util.HexString;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Longs;
+import com.google.common.primitives.UnsignedLongs;
+
+/**
+ * Abstraction of a datapath ID that can be set and/or accessed as either a
+ * long value or a colon-separated string. Immutable
+ *
+ * @author Rob Vaterlaus <rob.vaterlaus@bigswitch.com>
+ */
+@Immutable
+public class DatapathId implements PrimitiveSinkable, Comparable<DatapathId> {
+
+ public static final DatapathId NONE = new DatapathId(0);
+
+ private final long rawValue;
+
+ private DatapathId(long rawValue) {
+ this.rawValue = rawValue;
+ }
+
+ public static DatapathId of(long rawValue) {
+ return new DatapathId(rawValue);
+ }
+
+ public static DatapathId of(String s) {
+ return new DatapathId(HexString.toLong(s));
+ }
+
+ public static DatapathId of(byte[] bytes) {
+ return new DatapathId(Longs.fromByteArray(bytes));
+ }
+
+ public long getLong() {
+ return rawValue;
+ }
+
+ public U64 getUnsignedLong() {
+ return U64.of(rawValue);
+ }
+
+ public byte[] getBytes() {
+ return Longs.toByteArray(rawValue);
+ }
+
+ @Override
+ public String toString() {
+ return HexString.toHexString(rawValue);
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + (int) (rawValue ^ (rawValue >>> 32));
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ DatapathId other = (DatapathId) obj;
+ if (rawValue != other.rawValue)
+ return false;
+ return true;
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putLong(rawValue);
+ }
+
+ @Override
+ public int compareTo(DatapathId o) {
+ return UnsignedLongs.compare(rawValue, o.rawValue);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/EthType.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/EthType.java
new file mode 100644
index 0000000..c5f4f86
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/EthType.java
@@ -0,0 +1,270 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+
+/**
+ * EtherType field representation.
+ *
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ */
+public class EthType implements OFValueType<EthType> {
+ static final int LENGTH = 2;
+
+ private final int rawValue;
+
+ static final int VAL_IPv4 = 0x0800; // Internet Protocol version 4 (IPv4)
+ static final int VAL_ARP = 0x0806; // Address Resolution Protocol (ARP)
+ static final int VAL_WAKE_ON_LAN = 0x0842; // Wake-on-LAN[3]
+ static final int VAL_TRILL = 0x22F3; // IETF TRILL Protocol
+ static final int VAL_DECNET_IV = 0x6003; // DECnet Phase IV
+ static final int VAL_REV_ARP = 0x8035; // Reverse Address Resolution Protocol
+ static final int VAL_APPLE_TALK = 0x809B; // AppleTalk (Ethertalk)
+ static final int VAL_APPLE_TALK_ARP = 0x80F3; // AppleTalk Address Resolution Protocol (AARP)
+ static final int VAL_VLAN_FRAME = 0x8100; // VLAN-tagged frame (IEEE 802.1Q) & Shortest Path Bridging IEEE 802.1aq[4]
+ static final int VAL_IPX_8137 = 0x8137; // IPX
+ static final int VAL_IPX_8138 = 0x8138; // IPX
+ static final int VAL_QNX = 0x8204; // QNX Qnet
+ static final int VAL_IPv6 = 0x86DD; // Internet Protocol Version 6 (IPv6)
+ static final int VAL_ETH_FLOW = 0x8808; // Ethernet flow control
+ static final int VAL_SLOW_PROTOCOLS = 0x8809; // Slow Protocols (IEEE 802.3)
+ static final int VAL_COBRANET = 0x8819; // CobraNet
+ static final int VAL_MPLS_UNICAST = 0x8847; // MPLS unicast
+ static final int VAL_MPLS_MULTICAST = 0x8848; // MPLS multicast
+ static final int VAL_PPPoE_DISCOVERY = 0x8863; // PPPoE Discovery Stage
+ static final int VAL_PPPoE_SESSION = 0x8864; // PPPoE Session Stage
+ static final int VAL_JUMBO_FRAMES = 0x8870; // Jumbo Frames
+ static final int VAL_HOMEPLUG_10 = 0x887B; // HomePlug 1.0 MME
+ static final int VAL_EAP_OVER_LAN = 0x888E; // EAP over LAN (IEEE 802.1X)
+ static final int VAL_PROFINET = 0x8892; // PROFINET Protocol
+ static final int VAL_HYPERSCSI = 0x889A; // HyperSCSI (SCSI over Ethernet)
+ static final int VAL_ATA_OVER_ETH = 0x88A2; // ATA over Ethernet
+ static final int VAL_ETHERCAT = 0x88A4; // EtherCAT Protocol
+ static final int VAL_BRIDGING = 0x88A8; // Provider Bridging (IEEE 802.1ad) & Shortest Path Bridging IEEE 802.1aq[5]
+ static final int VAL_POWERLINK = 0x88AB; // Ethernet Powerlink[citation needed]
+ static final int VAL_LLDP = 0x88CC; // Link Layer Discovery Protocol (LLDP)
+ static final int VAL_SERCOS = 0x88CD; // SERCOS III
+ static final int VAL_HOMEPLUG_AV = 0x88E1; // HomePlug AV MME[citation needed]
+ static final int VAL_MRP = 0x88E3; // Media Redundancy Protocol (IEC62439-2)
+ static final int VAL_MAC_SEC = 0x88E5; // MAC security (IEEE 802.1AE)
+ static final int VAL_PTP = 0x88F7; // Precision Time Protocol (IEEE 1588)
+ static final int VAL_CFM = 0x8902; // IEEE 802.1ag Connectivity Fault Management (CFM) Protocol / ITU-T Recommendation Y.1731 (OAM)
+ static final int VAL_FCoE = 0x8906; // Fibre Channel over Ethernet (FCoE)
+ static final int VAL_FCoE_INIT = 0x8914; // FCoE Initialization Protocol
+ static final int VAL_RoCE = 0x8915; // RDMA over Converged Ethernet (RoCE)
+ static final int VAL_HSR = 0x892F; // High-availability Seamless Redundancy (HSR)
+ static final int VAL_CONF_TEST = 0x9000; // Ethernet Configuration Testing Protocol[6]
+ static final int VAL_Q_IN_Q = 0x9100; // Q-in-Q
+ static final int VAL_LLT = 0xCAFE; // Veritas Low Latency Transport (LLT)[7] for Veritas Cluster Server
+
+ public static final EthType IPv4 = new EthType(VAL_IPv4);
+ public static final EthType ARP = new EthType(VAL_ARP);
+ public static final EthType WAKE_ON_LAN = new EthType(VAL_WAKE_ON_LAN);
+ public static final EthType TRILL = new EthType(VAL_TRILL);
+ public static final EthType DECNET_IV = new EthType(VAL_DECNET_IV);
+ public static final EthType REV_ARP = new EthType(VAL_REV_ARP );
+ public static final EthType APPLE_TALK = new EthType(VAL_APPLE_TALK);
+ public static final EthType APPLE_TALK_ARP = new EthType(VAL_APPLE_TALK_ARP);
+ public static final EthType VLAN_FRAME = new EthType(VAL_VLAN_FRAME );
+ public static final EthType IPX_8137 = new EthType(VAL_IPX_8137 );
+ public static final EthType IPX_8138 = new EthType(VAL_IPX_8138 );
+ public static final EthType QNX = new EthType(VAL_QNX );
+ public static final EthType IPv6 = new EthType(VAL_IPv6 );
+ public static final EthType ETH_FLOW = new EthType(VAL_ETH_FLOW);
+ public static final EthType SLOW_PROTOCOLS = new EthType(VAL_SLOW_PROTOCOLS );
+ public static final EthType COBRANET = new EthType(VAL_COBRANET );
+ public static final EthType MPLS_UNICAST = new EthType(VAL_MPLS_UNICAST );
+ public static final EthType MPLS_MULTICAST = new EthType(VAL_MPLS_MULTICAST );
+ public static final EthType PPPoE_DISCOVERY = new EthType(VAL_PPPoE_DISCOVERY);
+ public static final EthType PPPoE_SESSION = new EthType(VAL_PPPoE_SESSION );
+ public static final EthType JUMBO_FRAMES = new EthType(VAL_JUMBO_FRAMES );
+ public static final EthType HOMEPLUG_10 = new EthType(VAL_HOMEPLUG_10 );
+ public static final EthType EAP_OVER_LAN = new EthType(VAL_EAP_OVER_LAN );
+ public static final EthType PROFINET = new EthType(VAL_PROFINET );
+ public static final EthType HYPERSCSI = new EthType(VAL_HYPERSCSI );
+ public static final EthType ATA_OVER_ETH = new EthType(VAL_ATA_OVER_ETH);
+ public static final EthType ETHERCAT = new EthType(VAL_ETHERCAT );
+ public static final EthType BRIDGING = new EthType(VAL_BRIDGING );
+ public static final EthType POWERLINK = new EthType(VAL_POWERLINK );
+ public static final EthType LLDP = new EthType(VAL_LLDP );
+ public static final EthType SERCOS = new EthType(VAL_SERCOS );
+ public static final EthType HOMEPLUG_AV = new EthType(VAL_HOMEPLUG_AV );
+ public static final EthType MRP = new EthType(VAL_MRP );
+ public static final EthType MAC_SEC = new EthType(VAL_MAC_SEC);
+ public static final EthType PTP = new EthType(VAL_PTP );
+ public static final EthType CFM = new EthType(VAL_CFM );
+ public static final EthType FCoE = new EthType(VAL_FCoE );
+ public static final EthType FCoE_INIT = new EthType(VAL_FCoE_INIT );
+ public static final EthType RoCE = new EthType(VAL_RoCE );
+ public static final EthType HSR = new EthType(VAL_HSR );
+ public static final EthType CONF_TEST = new EthType(VAL_CONF_TEST );
+ public static final EthType Q_IN_Q = new EthType(VAL_Q_IN_Q );
+ public static final EthType LLT = new EthType(VAL_LLT );
+
+
+ private static final int NONE_VAL = 0x0;
+ public static final EthType NONE = new EthType(NONE_VAL);
+
+ public static final EthType NO_MASK = new EthType(0xFFFFFFFF);
+ public static final EthType FULL_MASK = new EthType(0x00000000);
+
+ private EthType(int type) {
+ this.rawValue = type;
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ public static EthType of(int type) {
+ switch (type) {
+ case NONE_VAL:
+ return NONE;
+ case VAL_IPv4:
+ return IPv4;
+ case VAL_ARP:
+ return ARP;
+ case VAL_WAKE_ON_LAN:
+ return WAKE_ON_LAN;
+ case VAL_TRILL:
+ return TRILL;
+ case VAL_DECNET_IV:
+ return DECNET_IV;
+ case VAL_REV_ARP:
+ return REV_ARP;
+ case VAL_APPLE_TALK:
+ return APPLE_TALK;
+ case VAL_APPLE_TALK_ARP:
+ return APPLE_TALK_ARP;
+ case VAL_VLAN_FRAME:
+ return VLAN_FRAME;
+ case VAL_IPX_8137:
+ return IPX_8137;
+ case VAL_IPX_8138:
+ return IPX_8138;
+ case VAL_QNX:
+ return QNX;
+ case VAL_IPv6:
+ return IPv6;
+ case VAL_ETH_FLOW:
+ return ETH_FLOW;
+ case VAL_SLOW_PROTOCOLS:
+ return SLOW_PROTOCOLS;
+ case VAL_COBRANET:
+ return COBRANET;
+ case VAL_MPLS_UNICAST:
+ return MPLS_UNICAST;
+ case VAL_MPLS_MULTICAST:
+ return MPLS_MULTICAST;
+ case VAL_PPPoE_DISCOVERY:
+ return PPPoE_DISCOVERY;
+ case VAL_PPPoE_SESSION:
+ return PPPoE_SESSION;
+ case VAL_JUMBO_FRAMES:
+ return JUMBO_FRAMES;
+ case VAL_HOMEPLUG_10:
+ return HOMEPLUG_10;
+ case VAL_EAP_OVER_LAN:
+ return EAP_OVER_LAN;
+ case VAL_PROFINET:
+ return PROFINET;
+ case VAL_HYPERSCSI:
+ return HYPERSCSI;
+ case VAL_ATA_OVER_ETH:
+ return ATA_OVER_ETH;
+ case VAL_ETHERCAT:
+ return ETHERCAT;
+ case VAL_BRIDGING:
+ return BRIDGING;
+ case VAL_POWERLINK:
+ return POWERLINK;
+ case VAL_LLDP:
+ return LLDP;
+ case VAL_SERCOS:
+ return SERCOS;
+ case VAL_HOMEPLUG_AV:
+ return HOMEPLUG_AV;
+ case VAL_MRP:
+ return MRP;
+ case VAL_MAC_SEC:
+ return MAC_SEC;
+ case VAL_PTP:
+ return PTP;
+ case VAL_CFM:
+ return CFM;
+ case VAL_FCoE:
+ return FCoE;
+ case VAL_FCoE_INIT:
+ return FCoE_INIT;
+ case VAL_RoCE:
+ return RoCE;
+ case VAL_HSR:
+ return HSR;
+ case VAL_CONF_TEST:
+ return CONF_TEST;
+ case VAL_Q_IN_Q:
+ return Q_IN_Q;
+ case VAL_LLT:
+ return LLT;
+ default:
+ // TODO: What's here?
+ return new EthType(type);
+ }
+ }
+
+ @Override
+ public String toString() {
+ return Integer.toHexString(rawValue);
+ }
+
+ public void write2Bytes(ChannelBuffer c) {
+ c.writeShort(this.rawValue);
+ }
+
+ public static EthType read2Bytes(ChannelBuffer c) {
+ return EthType.of(c.readUnsignedShort());
+ }
+
+ @Override
+ public EthType applyMask(EthType mask) {
+ return EthType.of(this.rawValue & mask.rawValue);
+ }
+
+ public int getValue() {
+ return rawValue;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof EthType))
+ return false;
+ EthType o = (EthType)obj;
+ if (o.rawValue != this.rawValue)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 37;
+ int result = 1;
+ result = prime * result + rawValue;
+ return result;
+ }
+
+ @Override
+ public int compareTo(EthType o) {
+ return UnsignedInts.compare(rawValue, o.rawValue);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(rawValue);
+ }
+
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/GenTableId.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/GenTableId.java
new file mode 100644
index 0000000..cfa7cdf
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/GenTableId.java
@@ -0,0 +1,93 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+public class GenTableId implements OFValueType<GenTableId>, Comparable<GenTableId> {
+ final static int LENGTH = 2;
+
+ private static final int VALIDATION_MASK = 0xFFFF;
+
+ private static final int ALL_VAL = 0xFFFF;
+ private static final int NONE_VAL = 0x0000;
+ public static final GenTableId NONE = new GenTableId(NONE_VAL);
+
+ public static final GenTableId ALL = new GenTableId(ALL_VAL);
+ public static final GenTableId ZERO = NONE;
+
+ private final int id;
+
+ private GenTableId(int id) {
+ this.id = id;
+ }
+
+ public static GenTableId of(int id) {
+ switch(id) {
+ case NONE_VAL:
+ return NONE;
+ case ALL_VAL:
+ return ALL;
+ default:
+ if ((id & VALIDATION_MASK) != id)
+ throw new IllegalArgumentException("Illegal Table id value: " + id);
+ return new GenTableId(id);
+ }
+ }
+
+ @Override
+ public String toString() {
+ return "0x" + Integer.toHexString(id);
+ }
+
+ public int getValue() {
+ return id;
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ public void write2Bytes(ChannelBuffer c) {
+ c.writeShort(this.id);
+ }
+
+ public static GenTableId read2Bytes(ChannelBuffer c) throws OFParseError {
+ return GenTableId.of(c.readUnsignedShort());
+ }
+
+ @Override
+ public GenTableId applyMask(GenTableId mask) {
+ return GenTableId.of(this.id & mask.id);
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof GenTableId))
+ return false;
+ GenTableId other = (GenTableId)obj;
+ if (other.id != this.id)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ int prime = 13873;
+ return this.id * prime;
+ }
+
+ @Override
+ public int compareTo(GenTableId other) {
+ return UnsignedInts.compare(this.id, other.id);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putShort((byte) id);
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/HashValue.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/HashValue.java
new file mode 100644
index 0000000..1dd55d5
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/HashValue.java
@@ -0,0 +1,54 @@
+package org.projectfloodlight.openflow.types;
+
+import javax.annotation.concurrent.Immutable;
+
+/** a hash value that supports bit-wise combinations, mainly to calculate hash values for
+ * reconciliation operations.
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ *
+ * @param <H> - this type, for return type safety.
+ */
+@Immutable
+public interface HashValue<H extends HashValue<H>> {
+ /** return the "numBits" highest-order bits of the hash.
+ * @param numBits number of higest-order bits to return [0-32].
+ * @return a numberic value of the 0-32 highest-order bits.
+ */
+ int prefixBits(int numBits);
+
+ /** @return the bitwise inverse of this value */
+ H inverse();
+
+ /** or this value with another value value of the same type */
+ H or(H other);
+
+ /** and this value with another value value of the same type */
+ H and(H other);
+
+ /** xor this value with another value value of the same type */
+ H xor(H other);
+
+ /** calculate a combined hash value of this hash value (the <b>Key</b>) and the hash value
+ * specified as a parameter (the <b>Value</b>).
+ * <p>
+ * The value is constructed as follows:
+ * <ul>
+ * <li>the first keyBits bits are taken only from the Key
+ * <li>the other bits are taken from key xor value.
+ * </ul>
+ * The overall result looks like this:
+ * <pre>
+ * MSB LSB
+ * +---------+--------------+
+ * | key | key ^ value |
+ * +---------+--------------+
+ * |-keyBits-|
+ * </pre>
+ *
+ * @param value - hash value to be compared with this value (the key)
+ * @param keyBits number of prefix bits that are just taken from key
+ * @return the combined value.
+ */
+ H combineWithValue(H value, int keyBits);
+}
\ No newline at end of file
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/HashValueUtils.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/HashValueUtils.java
new file mode 100644
index 0000000..15f8a9b
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/HashValueUtils.java
@@ -0,0 +1,29 @@
+package org.projectfloodlight.openflow.types;
+
+import com.google.common.base.Preconditions;
+
+public class HashValueUtils {
+ private HashValueUtils() { }
+
+ public static long combineWithValue(long key, long value, int keyBits) {
+ Preconditions.checkArgument(keyBits >= 0 && keyBits <= 64, "keyBits must be [0,64]");
+
+ int valueBits = 64 - keyBits;
+ long valueMask = valueBits == 64 ? 0xFFFFFFFFFFFFFFFFL : (1L << valueBits) - 1;
+
+ return key ^ (value & valueMask);
+ }
+
+ public static int prefixBits(long raw1, int numBits) {
+ Preconditions.checkArgument(numBits >= 0 && numBits <= 32,
+ "numBits must be in range [0, 32]");
+
+ if(numBits == 0)
+ return 0;
+
+ final int shiftDown = 64 - numBits;
+
+ return (int) (raw1 >>> shiftDown);
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Code.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Code.java
new file mode 100644
index 0000000..ced5737
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Code.java
@@ -0,0 +1,98 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Shorts;
+
+/**
+ *
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ *
+ */
+public class ICMPv4Code implements OFValueType<ICMPv4Code> {
+
+ final static int LENGTH = 1;
+ final static short MAX_CODE = 0xFF;
+
+ private final short code;
+
+ private static final short NONE_VAL = 0;
+ public static final ICMPv4Code NONE = new ICMPv4Code(NONE_VAL);
+
+ public static final ICMPv4Code NO_MASK = new ICMPv4Code((short)0xFFFF);
+ public static final ICMPv4Code FULL_MASK = new ICMPv4Code((short)0x0000);
+
+ private ICMPv4Code(short code) {
+ this.code = code;
+ }
+
+ public static ICMPv4Code of(short code) {
+ if(code == NONE_VAL)
+ return NONE;
+
+ if (code > MAX_CODE || code < 0)
+ throw new IllegalArgumentException("Illegal ICMPv4 code: " + code);
+ return new ICMPv4Code(code);
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ public short getCode() {
+ return code;
+ }
+
+ public void writeByte(ChannelBuffer c) {
+ c.writeByte(this.code);
+ }
+
+ public static ICMPv4Code readByte(ChannelBuffer c) {
+ return ICMPv4Code.of(c.readUnsignedByte());
+ }
+
+ @Override
+ public ICMPv4Code applyMask(ICMPv4Code mask) {
+ return ICMPv4Code.of((short)(this.code & mask.code));
+ }
+
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + code;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ ICMPv4Code other = (ICMPv4Code) obj;
+ if (code != other.code)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int compareTo(ICMPv4Code o) {
+ return Shorts.compare(code, o.code);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putShort(code);
+ }
+
+ @Override
+ public String toString() {
+ return String.valueOf(this.code);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Type.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Type.java
new file mode 100644
index 0000000..634bc03
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Type.java
@@ -0,0 +1,207 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Shorts;
+
+public class ICMPv4Type implements OFValueType<ICMPv4Type> {
+ final static int LENGTH = 1;
+
+ private static final short VAL_ECHO_REPLY = 0;
+ private static final short VAL_DESTINATION_UNREACHABLE = 3;
+ private static final short VAL_SOURCE_QUENCH = 4;
+ private static final short VAL_REDIRECT = 5;
+ private static final short VAL_ALTERNATE_HOST_ADDRESS = 6;
+ private static final short VAL_ECHO = 8;
+ private static final short VAL_ROUTER_ADVERTISEMENT = 9;
+ private static final short VAL_ROUTER_SOLICITATION = 10;
+ private static final short VAL_TIME_EXCEEDED = 11;
+ private static final short VAL_PARAMETER_PROBLEM = 12;
+ private static final short VAL_TIMESTAMP = 13;
+ private static final short VAL_TIMESTAMP_REPLY = 14;
+ private static final short VAL_INFORMATION_REQUEST = 15;
+ private static final short VAL_INFORMATION_REPLY = 16;
+ private static final short VAL_ADDRESS_MASK_REQUEST = 17;
+ private static final short VAL_ADDRESS_MASK_REPLY = 18;
+ private static final short VAL_TRACEROUTE = 30;
+ private static final short VAL_DATAGRAM_CONVERSION_ERROR = 31;
+ private static final short VAL_MOBILE_HOST_REDIRECT = 32;
+ private static final short VAL_IPV6_WHERE_ARE_YOU = 33;
+ private static final short VAL_IPV6_I_AM_HERE = 34;
+ private static final short VAL_MOBILE_REGISTRATION_REQUEST = 35;
+ private static final short VAL_MOBILE_REGISTRATION_REPLY = 36;
+ private static final short VAL_DOMAIN_NAME_REQUEST = 37;
+ private static final short VAL_DOMAIN_NAME_REPLY = 38;
+ private static final short VAL_SKIP = 39;
+ private static final short VAL_PHOTURIS = 40;
+ private static final short VAL_EXPERIMENTAL_MOBILITY = 41;
+
+ public static final ICMPv4Type ECHO_REPLY = new ICMPv4Type(VAL_ECHO_REPLY);
+ public static final ICMPv4Type DESTINATION_UNREACHABLE = new ICMPv4Type(VAL_DESTINATION_UNREACHABLE);
+ public static final ICMPv4Type SOURCE_QUENCH = new ICMPv4Type(VAL_SOURCE_QUENCH);
+ public static final ICMPv4Type REDIRECT = new ICMPv4Type(VAL_REDIRECT);
+ public static final ICMPv4Type ALTERNATE_HOST_ADDRESS = new ICMPv4Type(VAL_ALTERNATE_HOST_ADDRESS);
+ public static final ICMPv4Type ECHO = new ICMPv4Type(VAL_ECHO);
+ public static final ICMPv4Type ROUTER_ADVERTISEMENT = new ICMPv4Type(VAL_ROUTER_ADVERTISEMENT);
+ public static final ICMPv4Type ROUTER_SOLICITATION = new ICMPv4Type(VAL_ROUTER_SOLICITATION);
+ public static final ICMPv4Type TIME_EXCEEDED = new ICMPv4Type(VAL_TIME_EXCEEDED);
+ public static final ICMPv4Type PARAMETER_PROBLEM = new ICMPv4Type(VAL_PARAMETER_PROBLEM);
+ public static final ICMPv4Type TIMESTAMP = new ICMPv4Type(VAL_TIMESTAMP);
+ public static final ICMPv4Type TIMESTAMP_REPLY = new ICMPv4Type(VAL_TIMESTAMP_REPLY);
+ public static final ICMPv4Type INFORMATION_REQUEST = new ICMPv4Type(VAL_INFORMATION_REQUEST);
+ public static final ICMPv4Type INFORMATION_REPLY = new ICMPv4Type(VAL_INFORMATION_REPLY);
+ public static final ICMPv4Type ADDRESS_MASK_REQUEST = new ICMPv4Type(VAL_ADDRESS_MASK_REQUEST);
+ public static final ICMPv4Type ADDRESS_MASK_REPLY = new ICMPv4Type(VAL_ADDRESS_MASK_REPLY);
+ public static final ICMPv4Type TRACEROUTE = new ICMPv4Type(VAL_TRACEROUTE);
+ public static final ICMPv4Type DATAGRAM_CONVERSION_ERROR = new ICMPv4Type(VAL_DATAGRAM_CONVERSION_ERROR);
+ public static final ICMPv4Type MOBILE_HOST_REDIRECT = new ICMPv4Type(VAL_MOBILE_HOST_REDIRECT);
+ public static final ICMPv4Type IPV6_WHERE_ARE_YOU = new ICMPv4Type(VAL_IPV6_WHERE_ARE_YOU);
+ public static final ICMPv4Type IPV6_I_AM_HERE = new ICMPv4Type(VAL_IPV6_I_AM_HERE);
+ public static final ICMPv4Type MOBILE_REGISTRATION_REQUEST = new ICMPv4Type(VAL_MOBILE_REGISTRATION_REQUEST);
+ public static final ICMPv4Type MOBILE_REGISTRATION_REPLY = new ICMPv4Type(VAL_MOBILE_REGISTRATION_REPLY);
+ public static final ICMPv4Type DOMAIN_NAME_REQUEST = new ICMPv4Type(VAL_DOMAIN_NAME_REQUEST);
+ public static final ICMPv4Type DOMAIN_NAME_REPLY = new ICMPv4Type(VAL_DOMAIN_NAME_REPLY);
+ public static final ICMPv4Type SKIP = new ICMPv4Type(VAL_SKIP);
+ public static final ICMPv4Type PHOTURIS = new ICMPv4Type(VAL_PHOTURIS);
+ public static final ICMPv4Type EXPERIMENTAL_MOBILITY = new ICMPv4Type(VAL_EXPERIMENTAL_MOBILITY);
+
+ // HACK alert - we're disapproriating ECHO_REPLY (value 0) as 'none' as well
+ public static final ICMPv4Type NONE = ECHO_REPLY;
+
+ public static final ICMPv4Type NO_MASK = new ICMPv4Type((short)0xFFFF);
+ public static final ICMPv4Type FULL_MASK = new ICMPv4Type((short)0x0000);
+
+ private final short type;
+
+ private static final int MIN_TYPE = 0;
+ private static final int MAX_TYPE = 0xFF;
+
+ private ICMPv4Type(short type) {
+ this.type = type;
+ }
+
+ public static ICMPv4Type of(short type) {
+ if (type < MIN_TYPE || type > MAX_TYPE)
+ throw new IllegalArgumentException("Invalid ICMPv4 type: " + type);
+ switch (type) {
+ case VAL_ECHO_REPLY:
+ return ECHO_REPLY;
+ case VAL_DESTINATION_UNREACHABLE:
+ return DESTINATION_UNREACHABLE;
+ case VAL_SOURCE_QUENCH:
+ return SOURCE_QUENCH;
+ case VAL_REDIRECT:
+ return REDIRECT;
+ case VAL_ALTERNATE_HOST_ADDRESS:
+ return ALTERNATE_HOST_ADDRESS;
+ case VAL_ECHO:
+ return ECHO;
+ case VAL_ROUTER_ADVERTISEMENT:
+ return ROUTER_ADVERTISEMENT;
+ case VAL_ROUTER_SOLICITATION:
+ return ROUTER_SOLICITATION;
+ case VAL_TIME_EXCEEDED:
+ return TIME_EXCEEDED;
+ case VAL_PARAMETER_PROBLEM:
+ return PARAMETER_PROBLEM;
+ case VAL_TIMESTAMP:
+ return TIMESTAMP;
+ case VAL_TIMESTAMP_REPLY:
+ return TIMESTAMP_REPLY;
+ case VAL_INFORMATION_REQUEST:
+ return INFORMATION_REQUEST;
+ case VAL_INFORMATION_REPLY:
+ return INFORMATION_REPLY;
+ case VAL_ADDRESS_MASK_REQUEST:
+ return ADDRESS_MASK_REQUEST;
+ case VAL_ADDRESS_MASK_REPLY:
+ return ADDRESS_MASK_REPLY;
+ case VAL_TRACEROUTE:
+ return TRACEROUTE;
+ case VAL_DATAGRAM_CONVERSION_ERROR:
+ return DATAGRAM_CONVERSION_ERROR;
+ case VAL_MOBILE_HOST_REDIRECT:
+ return MOBILE_HOST_REDIRECT;
+ case VAL_IPV6_WHERE_ARE_YOU:
+ return IPV6_WHERE_ARE_YOU;
+ case VAL_IPV6_I_AM_HERE:
+ return IPV6_I_AM_HERE;
+ case VAL_MOBILE_REGISTRATION_REQUEST:
+ return MOBILE_REGISTRATION_REQUEST;
+ case VAL_MOBILE_REGISTRATION_REPLY:
+ return MOBILE_REGISTRATION_REPLY;
+ case VAL_DOMAIN_NAME_REQUEST:
+ return DOMAIN_NAME_REQUEST;
+ case VAL_DOMAIN_NAME_REPLY:
+ return DOMAIN_NAME_REPLY;
+ case VAL_SKIP:
+ return SKIP;
+ case VAL_PHOTURIS:
+ return PHOTURIS;
+ case VAL_EXPERIMENTAL_MOBILITY:
+ return EXPERIMENTAL_MOBILITY;
+ default:
+ return new ICMPv4Type(type);
+ }
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ public short getType() {
+ return type;
+ }
+
+ public void writeByte(ChannelBuffer c) {
+ c.writeByte(this.type);
+ }
+
+ public static ICMPv4Type readByte(ChannelBuffer c) {
+ return ICMPv4Type.of(c.readUnsignedByte());
+ }
+
+ @Override
+ public ICMPv4Type applyMask(ICMPv4Type mask) {
+ return ICMPv4Type.of((short)(this.type & mask.type));
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + type;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ ICMPv4Type other = (ICMPv4Type) obj;
+ if (type != other.type)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int compareTo(ICMPv4Type o) {
+ return Shorts.compare(type, o.type);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putShort(type);
+ }
+
+ @Override
+ public String toString() {
+ return String.valueOf(this.type);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPAddress.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPAddress.java
new file mode 100644
index 0000000..5e4e818
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPAddress.java
@@ -0,0 +1,101 @@
+package org.projectfloodlight.openflow.types;
+
+import java.net.Inet4Address;
+import java.net.Inet6Address;
+import java.net.InetAddress;
+
+import javax.annotation.Nonnull;
+
+import com.google.common.base.Preconditions;
+
+public abstract class IPAddress<F extends IPAddress<F>> implements OFValueType<F> {
+
+ public abstract IPVersion getIpVersion();
+
+ /**
+ * Checks if this IPAddress represents a valid CIDR style netmask, i.e.,
+ * it has a set of leading "1" bits followed by only "0" bits
+ * @return true if this represents a valid CIDR style netmask, false
+ * otherwise
+ */
+ public abstract boolean isCidrMask();
+
+ /**
+ * If this IPAddress represents a valid CIDR style netmask (see
+ * isCidrMask()) returns the length of the prefix (the number of "1" bits).
+ * @return length of CIDR mask if this represents a valid CIDR mask
+ * @throws IllegalStateException if isCidrMask() == false
+ */
+ public abstract int asCidrMaskLength();
+
+ /**
+ * Checks if the IPAddress is the global broadcast address
+ * 255.255.255.255 in case of IPv4
+ * @return boolean true or false
+ */
+ public abstract boolean isBroadcast();
+
+ /**
+ * Perform a low level AND operation on the bits of two IPAddress<?> objects
+ * @param other IPAddress<?>
+ * @return new IPAddress<?> object after the AND oper
+ */
+ public abstract F and(F other);
+
+ /**
+ * Perform a low level OR operation on the bits of two IPAddress<?> objects
+ * @param other IPAddress<?>
+ * @return new IPAddress<?> object after the AND oper
+ */
+ public abstract F or(F other);
+
+ /**
+ * Returns a new IPAddress object with the bits inverted
+ * @return IPAddress<?>
+ */
+ public abstract F not();
+
+ @Override
+ public abstract boolean equals(Object other);
+
+ @Override
+ public abstract int hashCode();
+
+ /** parse an IPv4Address or IPv6Address from their conventional string representation.
+ * For details on supported representations, refer to {@link IPv4Address#of(String)}
+ * and {@link IPv6Address#of(String)}
+ *
+ * @param ip a string representation of an IP address
+ * @return the parsed IP address
+ * @throws NullPointerException if ip is null
+ * @throws IllegalArgumentException if string is not a valid IP address
+ */
+ @Nonnull
+ public static IPAddress<?> of(@Nonnull String ip) {
+ Preconditions.checkNotNull(ip, "ip must not be null");
+ if (ip.indexOf('.') != -1)
+ return IPv4Address.of(ip);
+ else if (ip.indexOf(':') != -1)
+ return IPv6Address.of(ip);
+ else
+ throw new IllegalArgumentException("IP Address not well formed: " + ip);
+ }
+
+ /**
+ * Factory function for InetAddress values.
+ * @param address the InetAddress you wish to parse into an IPAddress object.
+ * @return the IPAddress object.
+ * @throws NullPointerException if address is null
+ */
+ @Nonnull
+ public static IPAddress<?> fromInetAddress(@Nonnull InetAddress address) {
+ Preconditions.checkNotNull(address, "address must not be null");
+ byte [] bytes = address.getAddress();
+ if(address instanceof Inet4Address)
+ return IPv4Address.of(bytes);
+ else if (address instanceof Inet6Address)
+ return IPv6Address.of(bytes);
+ else
+ return IPAddress.of(address.getHostAddress());
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPAddressWithMask.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPAddressWithMask.java
new file mode 100644
index 0000000..ba7eb93
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPAddressWithMask.java
@@ -0,0 +1,53 @@
+package org.projectfloodlight.openflow.types;
+
+
+public abstract class IPAddressWithMask<F extends IPAddress<F>> extends Masked<F> {
+
+ protected IPAddressWithMask(F value, F mask) {
+ super(value, mask);
+ }
+
+ public abstract IPVersion getIpVersion();
+
+ public F getSubnetBroadcastAddress() {
+ if (!mask.isCidrMask()) {
+ throw new IllegalArgumentException("Mask Invalid " + mask +
+ " cannot get subnet for non CIDR mask");
+ }
+ return value.or(mask.not());
+ }
+
+ public boolean isSubnetBroadcastAddress(F candidate) {
+ return getSubnetBroadcastAddress().equals(candidate);
+ }
+
+ public static IPAddressWithMask<?> of(String ip) {
+ if (ip == null) {
+ throw new NullPointerException("String ip must not be null");
+ }
+ if (ip.indexOf('.') != -1)
+ return IPv4AddressWithMask.of(ip);
+ else if (ip.indexOf(':') != -1)
+ return IPv6AddressWithMask.of(ip);
+ else
+ throw new IllegalArgumentException("IP Address not well formed: " + ip);
+ }
+
+ @Override
+ public String toString() {
+ StringBuilder res = new StringBuilder();
+ res.append(value.toString());
+
+ res.append('/');
+ if (mask.isCidrMask()) {
+ // CIDR notation
+ res.append(mask.asCidrMaskLength());
+ } else {
+ // Full address mask
+ res.append(mask.toString());
+ }
+
+ return res.toString();
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPVersion.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPVersion.java
new file mode 100644
index 0000000..5bfc6d8
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPVersion.java
@@ -0,0 +1,6 @@
+package org.projectfloodlight.openflow.types;
+
+public enum IPVersion {
+ IPv4,
+ IPv6
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv4Address.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv4Address.java
new file mode 100644
index 0000000..865fb79
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv4Address.java
@@ -0,0 +1,245 @@
+package org.projectfloodlight.openflow.types;
+
+import java.util.Arrays;
+
+import javax.annotation.Nonnull;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+
+
+/**
+ * Wrapper around an IPv4Address address
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+public class IPv4Address extends IPAddress<IPv4Address> {
+ static final int LENGTH = 4;
+ private final int rawValue;
+
+ private static final int NOT_A_CIDR_MASK = -1;
+ private static final int CIDR_MASK_CACHE_UNSET = -2;
+ // Must appear before the static IPv4Address constant assignments
+ private volatile int cidrMaskLengthCache = CIDR_MASK_CACHE_UNSET;
+
+ private final static int NONE_VAL = 0x0;
+ public final static IPv4Address NONE = new IPv4Address(NONE_VAL);
+
+ public static final IPv4Address NO_MASK = IPv4Address.of(0xFFFFFFFF);
+ public static final IPv4Address FULL_MASK = IPv4Address.of(0x00000000);
+
+ private IPv4Address(final int rawValue) {
+ this.rawValue = rawValue;
+ }
+
+ @Override
+ public IPVersion getIpVersion() {
+ return IPVersion.IPv4;
+ }
+
+ private int asCidrMaskLengthInternal() {
+ if (cidrMaskLengthCache == CIDR_MASK_CACHE_UNSET) {
+ // No lock required. We only write cidrMaskLengthCache once
+ int maskint = getInt();
+ if (maskint == 0) {
+ cidrMaskLengthCache = 0;
+ } else if (Integer.bitCount((~maskint) + 1) == 1) {
+ // IP represents a true CIDR prefix length
+ cidrMaskLengthCache = Integer.bitCount(maskint);
+ } else {
+ cidrMaskLengthCache = NOT_A_CIDR_MASK;
+ }
+ }
+ return cidrMaskLengthCache;
+ }
+
+ @Override
+ public boolean isCidrMask() {
+ return asCidrMaskLengthInternal() != NOT_A_CIDR_MASK;
+ }
+
+ @Override
+ public int asCidrMaskLength() {
+ if (!isCidrMask()) {
+ throw new IllegalStateException("IP is not a valid CIDR prefix " +
+ "mask " + toString());
+ } else {
+ return asCidrMaskLengthInternal();
+ }
+ }
+
+ @Override
+ public boolean isBroadcast() {
+ return this.equals(NO_MASK);
+ }
+
+ @Override
+ public IPv4Address and(IPv4Address other) {
+ if (other == null) {
+ throw new NullPointerException("Other IP Address must not be null");
+ }
+ IPv4Address otherIp = (IPv4Address) other;
+ return IPv4Address.of(rawValue & otherIp.rawValue);
+ }
+
+ @Override
+ public IPv4Address or(IPv4Address other) {
+ if (other == null) {
+ throw new NullPointerException("Other IP Address must not be null");
+ }
+ IPv4Address otherIp = (IPv4Address) other;
+ return IPv4Address.of(rawValue | otherIp.rawValue);
+ }
+
+ @Override
+ public IPv4Address not() {
+ return IPv4Address.of(~rawValue);
+ }
+
+ public static IPv4Address of(final byte[] address) {
+ if (address == null) {
+ throw new NullPointerException("Address must not be null");
+ }
+ if (address.length != LENGTH) {
+ throw new IllegalArgumentException(
+ "Invalid byte array length for IPv4Address address: " + address.length);
+ }
+
+ int raw =
+ (address[0] & 0xFF) << 24 | (address[1] & 0xFF) << 16
+ | (address[2] & 0xFF) << 8 | (address[3] & 0xFF) << 0;
+ return IPv4Address.of(raw);
+ }
+
+ /** construct an IPv4Address from a 32-bit integer value.
+ *
+ * @param raw the IPAdress represented as a 32-bit integer
+ * @return the constructed IPv4Address
+ */
+ public static IPv4Address of(final int raw) {
+ if(raw == NONE_VAL)
+ return NONE;
+ return new IPv4Address(raw);
+ }
+
+ /** parse an IPv4Address from the canonical dotted-quad representation
+ * (1.2.3.4).
+ *
+ * @param string an IPv4 address in dotted-quad representation
+ * @return the parsed IPv4 address
+ * @throws NullPointerException if string is null
+ * @throws IllegalArgumentException if string is not a valid IPv4Address
+ */
+ @Nonnull
+ public static IPv4Address of(@Nonnull final String string) throws IllegalArgumentException {
+ if (string == null) {
+ throw new NullPointerException("String must not be null");
+ }
+ int start = 0;
+ int shift = 24;
+
+ int raw = 0;
+ while (shift >= 0) {
+ int end = string.indexOf('.', start);
+ if (end == start || !((shift > 0) ^ (end < 0)))
+ throw new IllegalArgumentException("IP Address not well formed: " + string);
+
+ String substr =
+ end > 0 ? string.substring(start, end) : string.substring(start);
+ int val = Integer.parseInt(substr);
+ if (val < 0 || val > 255)
+ throw new IllegalArgumentException("IP Address not well formed: " + string);
+
+ raw |= val << shift;
+
+ shift -= 8;
+ start = end + 1;
+ }
+ return IPv4Address.of(raw);
+ }
+
+ public int getInt() {
+ return rawValue;
+ }
+
+ private volatile byte[] bytesCache = null;
+
+ public byte[] getBytes() {
+ if (bytesCache == null) {
+ synchronized (this) {
+ if (bytesCache == null) {
+ bytesCache =
+ new byte[] { (byte) ((rawValue >>> 24) & 0xFF),
+ (byte) ((rawValue >>> 16) & 0xFF),
+ (byte) ((rawValue >>> 8) & 0xFF),
+ (byte) ((rawValue >>> 0) & 0xFF) };
+ }
+ }
+ }
+ return Arrays.copyOf(bytesCache, bytesCache.length);
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public String toString() {
+ StringBuilder res = new StringBuilder();
+ res.append((rawValue >> 24) & 0xFF).append('.');
+ res.append((rawValue >> 16) & 0xFF).append('.');
+ res.append((rawValue >> 8) & 0xFF).append('.');
+ res.append((rawValue >> 0) & 0xFF);
+ return res.toString();
+ }
+
+ public void write4Bytes(ChannelBuffer c) {
+ c.writeInt(rawValue);
+ }
+
+ public static IPv4Address read4Bytes(ChannelBuffer c) {
+ return IPv4Address.of(c.readInt());
+ }
+
+ @Override
+ public IPv4Address applyMask(IPv4Address mask) {
+ return and(mask);
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + rawValue;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ IPv4Address other = (IPv4Address) obj;
+ if (rawValue != other.rawValue)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int compareTo(IPv4Address o) {
+ return UnsignedInts.compare(rawValue, o.rawValue);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(rawValue);
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv4AddressWithMask.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv4AddressWithMask.java
new file mode 100644
index 0000000..9b60c6a
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv4AddressWithMask.java
@@ -0,0 +1,84 @@
+package org.projectfloodlight.openflow.types;
+
+
+public class IPv4AddressWithMask extends IPAddressWithMask<IPv4Address> {
+ public final static IPv4AddressWithMask NONE = of(IPv4Address.NONE, IPv4Address.NONE);
+
+ private IPv4AddressWithMask(int rawValue, int rawMask) {
+ super(IPv4Address.of(rawValue), IPv4Address.of(rawMask));
+ }
+
+ private IPv4AddressWithMask(IPv4Address value, IPv4Address mask) {
+ super(value, mask);
+ }
+
+ @Override
+ public IPVersion getIpVersion() {
+ return IPVersion.IPv4;
+ }
+
+ public static IPv4AddressWithMask of(int rawValue, int rawMask) {
+ return new IPv4AddressWithMask(rawValue, rawMask);
+ }
+
+ public static IPv4AddressWithMask of(IPv4Address value, IPv4Address mask) {
+ if (value == null) {
+ throw new NullPointerException("Value must not be null");
+ }
+ if (mask == null) {
+ throw new NullPointerException("Mask must not be null");
+ }
+ return new IPv4AddressWithMask(value, mask);
+ }
+
+ public static IPv4AddressWithMask of(final String string) {
+ if (string == null) {
+ throw new NullPointerException("String must not be null");
+ }
+ int slashPos;
+ String ip = string;
+ int maskBits = 32;
+ IPv4Address maskAddress = null;
+
+ // Read mask suffix
+ if ((slashPos = string.indexOf('/')) != -1) {
+ ip = string.substring(0, slashPos);
+ try {
+ String suffix = string.substring(slashPos + 1);
+ if (suffix.length() == 0)
+ throw new IllegalArgumentException("IP Address not well formed: " + string);
+ if (suffix.indexOf('.') != -1) {
+ // Full mask
+ maskAddress = IPv4Address.of(suffix);
+ } else {
+ // CIDR Suffix
+ maskBits = Integer.parseInt(suffix);
+ }
+ } catch (NumberFormatException e) {
+ throw new IllegalArgumentException("IP Address not well formed: " + string);
+ }
+ if (maskBits < 0 || maskBits > 32) {
+ throw new IllegalArgumentException("IP Address not well formed: " + string);
+ }
+ }
+
+ // Read IP
+ IPv4Address ipv4 = IPv4Address.of(ip);
+
+ if (maskAddress != null) {
+ // Full address mask
+ return IPv4AddressWithMask.of(ipv4, maskAddress);
+ } else if (maskBits == 32) {
+ // No mask
+ return IPv4AddressWithMask.of(ipv4, IPv4Address.NO_MASK);
+ } else if (maskBits == 0) {
+ // No mask
+ return IPv4AddressWithMask.of(ipv4, IPv4Address.FULL_MASK);
+ } else {
+ // With mask
+ int mask = (-1) << (32 - maskBits);
+ return IPv4AddressWithMask.of(ipv4, IPv4Address.of(mask));
+ }
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv6Address.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv6Address.java
new file mode 100644
index 0000000..83fb31a
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv6Address.java
@@ -0,0 +1,433 @@
+package org.projectfloodlight.openflow.types;
+
+import java.util.Arrays;
+import java.util.regex.Pattern;
+
+import javax.annotation.Nonnull;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Longs;
+
+/**
+ * IPv6 address object. Instance controlled, immutable. Internal representation:
+ * two 64 bit longs (not that you'd have to know).
+ *
+ * @author Andreas Wundsam <andreas.wundsam@teleteach.de>
+ */
+public class IPv6Address extends IPAddress<IPv6Address> {
+ static final int LENGTH = 16;
+ private final long raw1;
+ private final long raw2;
+
+ private static final int NOT_A_CIDR_MASK = -1;
+ private static final int CIDR_MASK_CACHE_UNSET = -2;
+ // Must appear before the static IPv4Address constant assignments
+ private volatile int cidrMaskLengthCache = CIDR_MASK_CACHE_UNSET;
+
+ private final static long NONE_VAL1 = 0x0L;
+ private final static long NONE_VAL2 = 0x0L;
+ public static final IPv6Address NONE = new IPv6Address(NONE_VAL1, NONE_VAL2);
+
+
+ public static final IPv6Address NO_MASK = IPv6Address.of(0xFFFFFFFFFFFFFFFFl, 0xFFFFFFFFFFFFFFFFl);
+ public static final IPv6Address FULL_MASK = IPv6Address.of(0x0, 0x0);
+
+ private IPv6Address(final long raw1, final long raw2) {
+ this.raw1 = raw1;
+ this.raw2 = raw2;
+ }
+
+ @Override
+ public IPVersion getIpVersion() {
+ return IPVersion.IPv6;
+ }
+
+
+ private int computeCidrMask64(long raw) {
+ long mask = raw;
+ if (raw == 0)
+ return 0;
+ else if (Long.bitCount((~mask) + 1) == 1) {
+ // represent a true CIDR prefix length
+ return Long.bitCount(mask);
+ }
+ else {
+ // Not a true prefix
+ return NOT_A_CIDR_MASK;
+ }
+ }
+
+ private int asCidrMaskLengthInternal() {
+ if (cidrMaskLengthCache == CIDR_MASK_CACHE_UNSET) {
+ // No synchronization needed. Writing cidrMaskLengthCache only once
+ if (raw1 == 0 && raw2 == 0) {
+ cidrMaskLengthCache = 0;
+ } else if (raw1 == -1L) {
+ // top half is all 1 bits
+ int tmpLength = computeCidrMask64(raw2);
+ if (tmpLength != NOT_A_CIDR_MASK)
+ tmpLength += 64;
+ cidrMaskLengthCache = tmpLength;
+ } else if (raw2 == 0) {
+ cidrMaskLengthCache = computeCidrMask64(raw1);
+ } else {
+ cidrMaskLengthCache = NOT_A_CIDR_MASK;
+ }
+ }
+ return cidrMaskLengthCache;
+ }
+
+ @Override
+ public boolean isCidrMask() {
+ return asCidrMaskLengthInternal() != NOT_A_CIDR_MASK;
+ }
+
+ @Override
+ public int asCidrMaskLength() {
+ if (!isCidrMask()) {
+ throw new IllegalStateException("IP is not a valid CIDR prefix " +
+ "mask " + toString());
+ } else {
+ return asCidrMaskLengthInternal();
+ }
+ }
+
+ @Override
+ public boolean isBroadcast() {
+ return this.equals(NO_MASK);
+ }
+
+ @Override
+ public IPv6Address and(IPv6Address other) {
+ if (other == null) {
+ throw new NullPointerException("Other IP Address must not be null");
+ }
+ IPv6Address otherIp = (IPv6Address) other;
+ return IPv6Address.of((raw1 & otherIp.raw1), (raw2 & otherIp.raw2));
+ }
+
+ @Override
+ public IPv6Address or(IPv6Address other) {
+ if (other == null) {
+ throw new NullPointerException("Other IP Address must not be null");
+ }
+ IPv6Address otherIp = (IPv6Address) other;
+ return IPv6Address.of((raw1 | otherIp.raw1), (raw2 | otherIp.raw2));
+ }
+
+ @Override
+ public IPv6Address not() {
+ return IPv6Address.of(~raw1, ~raw2);
+ }
+
+ public static IPv6Address of(final byte[] address) {
+ if (address == null) {
+ throw new NullPointerException("Address must not be null");
+ }
+ if (address.length != LENGTH) {
+ throw new IllegalArgumentException(
+ "Invalid byte array length for IPv6 address: " + address.length);
+ }
+
+ long raw1 =
+ (address[0] & 0xFFL) << 56 | (address[1] & 0xFFL) << 48
+ | (address[2] & 0xFFL) << 40 | (address[3] & 0xFFL) << 32
+ | (address[4] & 0xFFL) << 24 | (address[5] & 0xFFL) << 16
+ | (address[6] & 0xFFL) << 8 | (address[7]);
+
+ long raw2 =
+ (address[8] & 0xFFL) << 56 | (address[9] & 0xFFL) << 48
+ | (address[10] & 0xFFL) << 40 | (address[11] & 0xFFL) << 32
+ | (address[12] & 0xFFL) << 24 | (address[13] & 0xFFL) << 16
+ | (address[14] & 0xFFL) << 8 | (address[15]);
+
+ return IPv6Address.of(raw1, raw2);
+ }
+
+ private static class IPv6Builder {
+ private long raw1, raw2;
+
+ public void setUnsignedShortWord(final int i, final int value) {
+ int shift = 48 - (i % 4) * 16;
+
+ if (value < 0 || value > 0xFFFF)
+ throw new IllegalArgumentException("16 bit word must be in [0, 0xFFFF]");
+
+ if (i >= 0 && i < 4)
+ raw1 = raw1 & ~(0xFFFFL << shift) | (value & 0xFFFFL) << shift;
+ else if (i >= 4 && i < 8)
+ raw2 = raw2 & ~(0xFFFFL << shift) | (value & 0xFFFFL) << shift;
+ else
+ throw new IllegalArgumentException("16 bit word index must be in [0,7]");
+ }
+
+ public IPv6Address getIPv6() {
+ return IPv6Address.of(raw1, raw2);
+ }
+ }
+
+ private final static Pattern colonPattern = Pattern.compile(":");
+
+ /** parse an IPv6Address from its conventional string representation.
+ * <p>
+ * Expects up to 8 groups of 16-bit hex words seperated by colons
+ * (e.g., 2001:db8:85a3:8d3:1319:8a2e:370:7348).
+ * <p>
+ * Supports zero compression (e.g., 2001:db8::7348).
+ * Does <b>not</b> currently support embedding a dotted-quad IPv4 address
+ * into the IPv6 address (e.g., 2001:db8::192.168.0.1).
+ *
+ * @param string a string representation of an IPv6 address
+ * @return the parsed IPv6 address
+ * @throws NullPointerException if string is null
+ * @throws IllegalArgumentException if string is not a valid IPv6Address
+ */
+ @Nonnull
+ public static IPv6Address of(@Nonnull final String string) throws IllegalArgumentException {
+ if (string == null) {
+ throw new NullPointerException("String must not be null");
+ }
+ IPv6Builder builder = new IPv6Builder();
+ String[] parts = colonPattern.split(string, -1);
+
+ int leftWord = 0;
+ int leftIndex = 0;
+
+ boolean hitZeroCompression = false;
+
+ for (leftIndex = 0; leftIndex < parts.length; leftIndex++) {
+ String part = parts[leftIndex];
+ if (part.length() == 0) {
+ // hit empty group of zero compression
+ hitZeroCompression = true;
+ break;
+ }
+ builder.setUnsignedShortWord(leftWord++, Integer.parseInt(part, 16));
+ }
+
+ if (hitZeroCompression) {
+ if (leftIndex == 0) {
+ // if colon is at the start, two columns must be at the start,
+ // move to the second empty group
+ leftIndex = 1;
+ if (parts.length < 2 || parts[1].length() > 0)
+ throw new IllegalArgumentException("Malformed IPv6 address: " + string);
+ }
+
+ int rightWord = 7;
+ int rightIndex;
+ for (rightIndex = parts.length - 1; rightIndex > leftIndex; rightIndex--) {
+ String part = parts[rightIndex];
+ if (part.length() == 0)
+ break;
+ builder.setUnsignedShortWord(rightWord--, Integer.parseInt(part, 16));
+ }
+ if (rightIndex == parts.length - 1) {
+ // if colon is at the end, two columns must be at the end, move
+ // to the second empty group
+ if (rightIndex < 1 || parts[rightIndex - 1].length() > 0)
+ throw new IllegalArgumentException("Malformed IPv6 address: " + string);
+ rightIndex--;
+ }
+ if (leftIndex != rightIndex)
+ throw new IllegalArgumentException("Malformed IPv6 address: " + string);
+ } else {
+ if (leftIndex != 8) {
+ throw new IllegalArgumentException("Malformed IPv6 address: " + string);
+ }
+ }
+ return builder.getIPv6();
+ }
+
+ /** construct an IPv6 adress from two 64 bit integers representing the first and
+ * second 8-byte blocks of the address.
+ *
+ * @param raw1 - the first 8 byte block of the address
+ * @param raw2 - the second 8 byte block of the address
+ * @return the constructed IPv6Address
+ */
+ public static IPv6Address of(final long raw1, final long raw2) {
+ if(raw1==NONE_VAL1 && raw2 == NONE_VAL2)
+ return NONE;
+ return new IPv6Address(raw1, raw2);
+ }
+
+ private volatile byte[] bytesCache = null;
+
+ public byte[] getBytes() {
+ if (bytesCache == null) {
+ synchronized (this) {
+ if (bytesCache == null) {
+ bytesCache =
+ new byte[] { (byte) ((raw1 >> 56) & 0xFF),
+ (byte) ((raw1 >> 48) & 0xFF),
+ (byte) ((raw1 >> 40) & 0xFF),
+ (byte) ((raw1 >> 32) & 0xFF),
+ (byte) ((raw1 >> 24) & 0xFF),
+ (byte) ((raw1 >> 16) & 0xFF),
+ (byte) ((raw1 >> 8) & 0xFF),
+ (byte) ((raw1 >> 0) & 0xFF),
+
+ (byte) ((raw2 >> 56) & 0xFF),
+ (byte) ((raw2 >> 48) & 0xFF),
+ (byte) ((raw2 >> 40) & 0xFF),
+ (byte) ((raw2 >> 32) & 0xFF),
+ (byte) ((raw2 >> 24) & 0xFF),
+ (byte) ((raw2 >> 16) & 0xFF),
+ (byte) ((raw2 >> 8) & 0xFF),
+ (byte) ((raw2 >> 0) & 0xFF) };
+ }
+ }
+ }
+ return Arrays.copyOf(bytesCache, bytesCache.length);
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public String toString() {
+ return toString(true, false);
+ }
+
+ public int getUnsignedShortWord(final int i) {
+ if (i >= 0 && i < 4)
+ return (int) ((raw1 >>> (48 - i * 16)) & 0xFFFF);
+ else if (i >= 4 && i < 8)
+ return (int) ((raw2 >>> (48 - (i - 4) * 16)) & 0xFFFF);
+ else
+ throw new IllegalArgumentException("16 bit word index must be in [0,7]");
+ }
+
+ /** get the index of the first word where to apply IPv6 zero compression */
+ public int getZeroCompressStart() {
+ int start = Integer.MAX_VALUE;
+ int maxLength = -1;
+
+ int candidateStart = -1;
+
+ for (int i = 0; i < 8; i++) {
+ if (candidateStart >= 0) {
+ // in a zero octect
+ if (getUnsignedShortWord(i) != 0) {
+ // end of this candidate word
+ int candidateLength = i - candidateStart;
+ if (candidateLength >= maxLength) {
+ start = candidateStart;
+ maxLength = candidateLength;
+ }
+ candidateStart = -1;
+ }
+ } else {
+ // not in a zero octect
+ if (getUnsignedShortWord(i) == 0) {
+ candidateStart = i;
+ }
+ }
+ }
+
+ if (candidateStart >= 0) {
+ int candidateLength = 8 - candidateStart;
+ if (candidateLength >= maxLength) {
+ start = candidateStart;
+ maxLength = candidateLength;
+ }
+ }
+
+ return start;
+ }
+
+ public String toString(final boolean zeroCompression, final boolean leadingZeros) {
+ StringBuilder res = new StringBuilder();
+
+ int compressionStart = zeroCompression ? getZeroCompressStart() : Integer.MAX_VALUE;
+ boolean inCompression = false;
+ boolean colonNeeded = false;
+
+ for (int i = 0; i < 8; i++) {
+ int word = getUnsignedShortWord(i);
+
+ if (word == 0) {
+ if (inCompression)
+ continue;
+ else if (i == compressionStart) {
+ res.append(':').append(':');
+ inCompression = true;
+ colonNeeded = false;
+ continue;
+ }
+ } else {
+ inCompression = false;
+ }
+
+ if (colonNeeded) {
+ res.append(':');
+ colonNeeded = false;
+ }
+
+ res.append(leadingZeros ? String.format("%04x", word) : Integer.toString(word,
+ 16));
+ colonNeeded = true;
+ }
+ return res.toString();
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + (int) (raw1 ^ (raw1 >>> 32));
+ result = prime * result + (int) (raw2 ^ (raw2 >>> 32));
+ return result;
+ }
+
+ @Override
+ public boolean equals(final Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ IPv6Address other = (IPv6Address) obj;
+ if (raw1 != other.raw1)
+ return false;
+ if (raw2 != other.raw2)
+ return false;
+ return true;
+ }
+
+ public void write16Bytes(ChannelBuffer c) {
+ c.writeLong(this.raw1);
+ c.writeLong(this.raw2);
+ }
+
+ public static IPv6Address read16Bytes(ChannelBuffer c) throws OFParseError {
+ return IPv6Address.of(c.readLong(), c.readLong());
+ }
+
+ @Override
+ public IPv6Address applyMask(IPv6Address mask) {
+ return and(mask);
+ }
+
+ @Override
+ public int compareTo(IPv6Address o) {
+ int res = Longs.compare(raw1, o.raw1);
+ if(res != 0)
+ return res;
+ else
+ return Longs.compare(raw2, o.raw2);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putLong(raw1);
+ sink.putLong(raw2);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv6AddressWithMask.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv6AddressWithMask.java
new file mode 100644
index 0000000..7259c7f
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv6AddressWithMask.java
@@ -0,0 +1,92 @@
+package org.projectfloodlight.openflow.types;
+
+import java.math.BigInteger;
+import java.util.Arrays;
+
+public class IPv6AddressWithMask extends IPAddressWithMask<IPv6Address> {
+ public final static IPv6AddressWithMask NONE = of(IPv6Address.NONE, IPv6Address.NONE);
+
+ private IPv6AddressWithMask(IPv6Address value, IPv6Address mask) {
+ super(value, mask);
+ }
+
+ @Override
+ public IPVersion getIpVersion() {
+ return IPVersion.IPv6;
+ }
+
+ public static IPv6AddressWithMask of(IPv6Address value, IPv6Address mask) {
+ if (value == null) {
+ throw new NullPointerException("Value must not be null");
+ }
+ if (mask == null) {
+ throw new NullPointerException("Mask must not be null");
+ }
+ return new IPv6AddressWithMask(value, mask);
+ }
+
+
+ public static IPv6AddressWithMask of(final String string) {
+ if (string == null) {
+ throw new NullPointerException("String must not be null");
+ }
+ int slashPos;
+ String ip = string;
+ int maskBits = 128;
+ IPv6Address maskAddress = null;
+
+ // Read mask suffix
+ if ((slashPos = string.indexOf('/')) != -1) {
+ ip = string.substring(0, slashPos);
+ try {
+ String suffix = string.substring(slashPos + 1);
+ if (suffix.length() == 0)
+ throw new IllegalArgumentException("IPv6 Address not well formed: " + string);
+ if (suffix.indexOf(':') != -1) {
+ // Full mask
+ maskAddress = IPv6Address.of(suffix);
+ } else {
+ // CIDR Suffix
+ maskBits = Integer.parseInt(suffix);
+ }
+ } catch (NumberFormatException e) {
+ throw new IllegalArgumentException("IPv6 Address not well formed: " + string);
+ }
+ if (maskBits < 0 || maskBits > 128) {
+ throw new IllegalArgumentException("IPv6 Address not well formed: " + string);
+ }
+ }
+
+ // Read IP
+ IPv6Address ipv6 = IPv6Address.of(ip);
+
+ if (maskAddress != null) {
+ // Full address mask
+ return IPv6AddressWithMask.of(ipv6, maskAddress);
+ } else if (maskBits == 128) {
+ // No mask
+ return IPv6AddressWithMask.of(ipv6, IPv6Address.NO_MASK);
+ } else if (maskBits == 0) {
+ // Entirely masked out
+ return IPv6AddressWithMask.of(ipv6, IPv6Address.FULL_MASK);
+ }else {
+ // With mask
+ BigInteger mask = BigInteger.ONE.negate().shiftLeft(128 - maskBits);
+ byte[] maskBytesTemp = mask.toByteArray();
+ byte[] maskBytes;
+ if (maskBytesTemp.length < 16) {
+ maskBytes = new byte[16];
+ System.arraycopy(maskBytesTemp, 0, maskBytes, 16 - maskBytesTemp.length, maskBytesTemp.length);
+ Arrays.fill(maskBytes, 0, 16 - maskBytesTemp.length, (byte)(0xFF));
+ } else if (maskBytesTemp.length > 16) {
+ maskBytes = new byte[16];
+ System.arraycopy(maskBytesTemp, 0, maskBytes, 0, maskBytes.length);
+ } else {
+ maskBytes = maskBytesTemp;
+ }
+ return IPv6AddressWithMask.of(ipv6, IPv6Address.of(maskBytes));
+ }
+ }
+
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv6FlowLabel.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv6FlowLabel.java
new file mode 100644
index 0000000..de49b51
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IPv6FlowLabel.java
@@ -0,0 +1,85 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+public class IPv6FlowLabel implements OFValueType<IPv6FlowLabel> {
+
+ static final int LENGTH = 4;
+
+ private final int label;
+
+ private final static int NONE_VAL = 0x0;
+ public static final IPv6FlowLabel NONE = new IPv6FlowLabel(NONE_VAL);
+
+ public static final IPv6FlowLabel NO_MASK = IPv6FlowLabel.of(0xFFFFFFFF);
+ public static final IPv6FlowLabel FULL_MASK = IPv6FlowLabel.of(0x0);
+
+ private IPv6FlowLabel(int label) {
+ this.label = label;
+ }
+
+ public static IPv6FlowLabel of(int label) {
+ if(label == NONE_VAL)
+ return NONE;
+ return new IPv6FlowLabel(label);
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof IPv6FlowLabel))
+ return false;
+ IPv6FlowLabel other = (IPv6FlowLabel)obj;
+ if (other.label != this.label)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 59;
+ int result = 1;
+ result = prime * result + label;
+ return result;
+ }
+
+ @Override
+ public String toString() {
+ return Integer.toHexString(label);
+ }
+
+ public void write4Bytes(ChannelBuffer c) {
+ c.writeInt(this.label);
+ }
+
+ public static IPv6FlowLabel read4Bytes(ChannelBuffer c) throws OFParseError {
+ return IPv6FlowLabel.of((int)(c.readUnsignedInt() & 0xFFFFFFFF));
+ }
+
+ @Override
+ public IPv6FlowLabel applyMask(IPv6FlowLabel mask) {
+ return IPv6FlowLabel.of(this.label & mask.label);
+ }
+
+ public int getIPv6FlowLabelValue() {
+ return label;
+ }
+
+ @Override
+ public int compareTo(IPv6FlowLabel o) {
+ return UnsignedInts.compare(label, o.label);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(this.label);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IpDscp.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IpDscp.java
new file mode 100644
index 0000000..27596b7
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IpDscp.java
@@ -0,0 +1,254 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+
+public enum IpDscp implements OFValueType<IpDscp> {
+ DSCP_0((byte)0),
+ DSCP_1((byte)1),
+ DSCP_2((byte)2),
+ DSCP_3((byte)3),
+ DSCP_4((byte)4),
+ DSCP_5((byte)5),
+ DSCP_6((byte)6),
+ DSCP_7((byte)7),
+ DSCP_8((byte)8),
+ DSCP_9((byte)9),
+ DSCP_10((byte)10),
+ DSCP_11((byte)11),
+ DSCP_12((byte)12),
+ DSCP_13((byte)13),
+ DSCP_14((byte)14),
+ DSCP_15((byte)15),
+ DSCP_16((byte)16),
+ DSCP_17((byte)17),
+ DSCP_18((byte)18),
+ DSCP_19((byte)19),
+ DSCP_20((byte)20),
+ DSCP_21((byte)21),
+ DSCP_22((byte)22),
+ DSCP_23((byte)23),
+ DSCP_24((byte)24),
+ DSCP_25((byte)25),
+ DSCP_26((byte)26),
+ DSCP_27((byte)27),
+ DSCP_28((byte)28),
+ DSCP_29((byte)29),
+ DSCP_30((byte)30),
+ DSCP_31((byte)31),
+ DSCP_32((byte)32),
+ DSCP_33((byte)33),
+ DSCP_34((byte)34),
+ DSCP_35((byte)35),
+ DSCP_36((byte)36),
+ DSCP_37((byte)37),
+ DSCP_38((byte)38),
+ DSCP_39((byte)39),
+ DSCP_40((byte)40),
+ DSCP_41((byte)41),
+ DSCP_42((byte)42),
+ DSCP_43((byte)43),
+ DSCP_44((byte)44),
+ DSCP_45((byte)45),
+ DSCP_46((byte)46),
+ DSCP_47((byte)47),
+ DSCP_48((byte)48),
+ DSCP_49((byte)49),
+ DSCP_50((byte)50),
+ DSCP_51((byte)51),
+ DSCP_52((byte)52),
+ DSCP_53((byte)53),
+ DSCP_54((byte)54),
+ DSCP_55((byte)55),
+ DSCP_56((byte)56),
+ DSCP_57((byte)57),
+ DSCP_58((byte)58),
+ DSCP_59((byte)59),
+ DSCP_60((byte)60),
+ DSCP_61((byte)61),
+ DSCP_62((byte)62),
+ DSCP_63((byte)63),
+ DSCP_NO_MASK((byte)0xFF);
+
+ static final int LENGTH = 1;
+
+ public static final IpDscp NONE = DSCP_0;
+
+ public static final IpDscp NO_MASK = DSCP_NO_MASK;
+ public static final IpDscp FULL_MASK = DSCP_0;
+
+ private final byte dscp;
+
+ private IpDscp(byte dscp) {
+ this.dscp = dscp;
+ }
+
+ public static IpDscp of(byte dscp) {
+ switch (dscp) {
+ case 0:
+ return DSCP_0;
+ case 1:
+ return DSCP_1;
+ case 2:
+ return DSCP_2;
+ case 3:
+ return DSCP_3;
+ case 4:
+ return DSCP_4;
+ case 5:
+ return DSCP_5;
+ case 6:
+ return DSCP_6;
+ case 7:
+ return DSCP_7;
+ case 8:
+ return DSCP_8;
+ case 9:
+ return DSCP_9;
+ case 10:
+ return DSCP_10;
+ case 11:
+ return DSCP_11;
+ case 12:
+ return DSCP_12;
+ case 13:
+ return DSCP_13;
+ case 14:
+ return DSCP_14;
+ case 15:
+ return DSCP_15;
+ case 16:
+ return DSCP_16;
+ case 17:
+ return DSCP_17;
+ case 18:
+ return DSCP_18;
+ case 19:
+ return DSCP_19;
+ case 20:
+ return DSCP_20;
+ case 21:
+ return DSCP_21;
+ case 22:
+ return DSCP_22;
+ case 23:
+ return DSCP_23;
+ case 24:
+ return DSCP_24;
+ case 25:
+ return DSCP_25;
+ case 26:
+ return DSCP_26;
+ case 27:
+ return DSCP_27;
+ case 28:
+ return DSCP_28;
+ case 29:
+ return DSCP_29;
+ case 30:
+ return DSCP_30;
+ case 31:
+ return DSCP_31;
+ case 32:
+ return DSCP_32;
+ case 33:
+ return DSCP_33;
+ case 34:
+ return DSCP_34;
+ case 35:
+ return DSCP_35;
+ case 36:
+ return DSCP_36;
+ case 37:
+ return DSCP_37;
+ case 38:
+ return DSCP_38;
+ case 39:
+ return DSCP_39;
+ case 40:
+ return DSCP_40;
+ case 41:
+ return DSCP_41;
+ case 42:
+ return DSCP_42;
+ case 43:
+ return DSCP_43;
+ case 44:
+ return DSCP_44;
+ case 45:
+ return DSCP_45;
+ case 46:
+ return DSCP_46;
+ case 47:
+ return DSCP_47;
+ case 48:
+ return DSCP_48;
+ case 49:
+ return DSCP_49;
+ case 50:
+ return DSCP_50;
+ case 51:
+ return DSCP_51;
+ case 52:
+ return DSCP_52;
+ case 53:
+ return DSCP_53;
+ case 54:
+ return DSCP_54;
+ case 55:
+ return DSCP_55;
+ case 56:
+ return DSCP_56;
+ case 57:
+ return DSCP_57;
+ case 58:
+ return DSCP_58;
+ case 59:
+ return DSCP_59;
+ case 60:
+ return DSCP_60;
+ case 61:
+ return DSCP_61;
+ case 62:
+ return DSCP_62;
+ case 63:
+ return DSCP_63;
+ default:
+ throw new IllegalArgumentException("Illegal IPv4 DSCP value: " + dscp);
+ }
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public String toString() {
+ return Integer.toHexString(dscp);
+ }
+
+ public void writeByte(ChannelBuffer c) {
+ c.writeByte(this.dscp);
+ }
+
+ public static IpDscp readByte(ChannelBuffer c) throws OFParseError {
+ return IpDscp.of((byte)(c.readUnsignedByte()));
+ }
+
+ @Override
+ public IpDscp applyMask(IpDscp mask) {
+ return IpDscp.of((byte)(this.dscp & mask.dscp));
+ }
+
+ public byte getDscpValue() {
+ return dscp;
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putByte(dscp);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IpEcn.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IpEcn.java
new file mode 100644
index 0000000..654df01
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IpEcn.java
@@ -0,0 +1,73 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+
+public enum IpEcn implements OFValueType<IpEcn> {
+ ECN_00((byte)0),
+ ECN_01((byte)1),
+ ECN_10((byte)2),
+ ECN_11((byte)3),
+ ECN_NO_MASK((byte)0xFF);
+
+ public static final IpEcn NONE = ECN_00;
+ public static final IpEcn NO_MASK = ECN_NO_MASK;
+ public static final IpEcn FULL_MASK = ECN_00;
+
+ static final int LENGTH = 1;
+
+ private final byte ecn;
+
+ private IpEcn(byte ecn) {
+ this.ecn = ecn;
+ }
+
+ public static IpEcn of(byte ecn) {
+ switch (ecn) {
+ case 0:
+ return ECN_00;
+ case 1:
+ return ECN_01;
+ case 2:
+ return ECN_10;
+ case 3:
+ return ECN_11;
+ default:
+ throw new IllegalArgumentException("Illegal IP ECN value: " + ecn);
+ }
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public String toString() {
+ return (ecn < 3 ? "0" : "") + Integer.toBinaryString(ecn);
+ }
+
+ public void writeByte(ChannelBuffer c) {
+ c.writeByte(this.ecn);
+ }
+
+ public static IpEcn readByte(ChannelBuffer c) throws OFParseError {
+ return IpEcn.of((byte)(c.readUnsignedByte()));
+ }
+
+ @Override
+ public IpEcn applyMask(IpEcn mask) {
+ return IpEcn.of((byte)(this.ecn & mask.ecn));
+ }
+
+ public byte getEcnValue() {
+ return ecn;
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putByte(ecn);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/IpProtocol.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IpProtocol.java
new file mode 100644
index 0000000..69f497e
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/IpProtocol.java
@@ -0,0 +1,665 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Shorts;
+
+/**
+ * IP-Protocol field representation
+ *
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ */
+public class IpProtocol implements OFValueType<IpProtocol> {
+
+ static final short MAX_PROTO = 0xFF;
+ static final int LENGTH = 1;
+
+ private final short proto;
+
+ static final short NUM_HOPOPT = 0x00;
+ static final short NUM_ICMP = 0x01;
+ static final short NUM_IGMP = 0x02;
+ static final short NUM_GGP = 0x03;
+ static final short NUM_IPv4 = 0x04;
+ static final short NUM_ST = 0x05;
+ static final short NUM_TCP = 0x06;
+ static final short NUM_CBT = 0x07;
+ static final short NUM_EGP = 0x08;
+ static final short NUM_IGP = 0x09;
+ static final short NUM_BBN_RCC_MON = 0x0A;
+ static final short NUM_NVP_II = 0x0B;
+ static final short NUM_PUP = 0x0C;
+ static final short NUM_ARGUS = 0x0D;
+ static final short NUM_EMCON = 0x0E;
+ static final short NUM_XNET = 0x0F;
+ static final short NUM_CHAOS = 0x10;
+ static final short NUM_UDP = 0x11;
+ static final short NUM_MUX = 0x12;
+ static final short NUM_DCN_MEAS = 0x13;
+ static final short NUM_HMP = 0x14;
+ static final short NUM_PRM = 0x15;
+ static final short NUM_XNS_IDP = 0x16;
+ static final short NUM_TRUNK_1 = 0x17;
+ static final short NUM_TRUNK_2 = 0x18;
+ static final short NUM_LEAF_1 = 0x19;
+ static final short NUM_LEAF_2 = 0x1A;
+ static final short NUM_RDP = 0x1B;
+ static final short NUM_IRTP = 0x1C;
+ static final short NUM_ISO_TP4 = 0x1D;
+ static final short NUM_NETBLT = 0x1E;
+ static final short NUM_MFE_NSP = 0x1F;
+ static final short NUM_MERIT_INP = 0x20;
+ static final short NUM_DCCP = 0x21;
+ static final short NUM_3PC = 0x22;
+ static final short NUM_IDPR = 0x23;
+ static final short NUM_XTP = 0x24;
+ static final short NUM_DDP = 0x25;
+ static final short NUM_IDPR_CMTP = 0x26;
+ static final short NUM_TP_PP = 0x27;
+ static final short NUM_IL = 0x28;
+ static final short NUM_IPv6 = 0x29;
+ static final short NUM_SDRP = 0x2A;
+ static final short NUM_IPv6_ROUTE = 0x2B;
+ static final short NUM_IPv6_FRAG = 0x2C;
+ static final short NUM_IDRP = 0x2D;
+ static final short NUM_RSVP = 0x2E;
+ static final short NUM_GRE = 0x2F;
+ static final short NUM_MHRP = 0x30;
+ static final short NUM_BNA = 0x31;
+ static final short NUM_ESP = 0x32;
+ static final short NUM_AH = 0x33;
+ static final short NUM_I_NLSP = 0x34;
+ static final short NUM_SWIPE = 0x35;
+ static final short NUM_NARP = 0x36;
+ static final short NUM_MOBILE = 0x37;
+ static final short NUM_TLSP = 0x38;
+ static final short NUM_SKIP = 0x39;
+ static final short NUM_IPv6_ICMP = 0x3A;
+ static final short NUM_IPv6_NO_NXT = 0x3B;
+ static final short NUM_IPv6_OPTS = 0x3C;
+ static final short NUM_HOST_INTERNAL = 0x3D;
+ static final short NUM_CFTP = 0x3E;
+ static final short NUM_LOCAL_NET = 0x3F;
+ static final short NUM_SAT_EXPAK = 0x40;
+ static final short NUM_KRYPTOLAN = 0x41;
+ static final short NUM_RVD = 0x42;
+ static final short NUM_IPPC = 0x43;
+ static final short NUM_DIST_FS = 0x44;
+ static final short NUM_SAT_MON = 0x45;
+ static final short NUM_VISA = 0x46;
+ static final short NUM_IPCV = 0x47;
+ static final short NUM_CPNX = 0x48;
+ static final short NUM_CPHB = 0x49;
+ static final short NUM_WSN = 0x4A;
+ static final short NUM_PVP = 0x4B;
+ static final short NUM_BR_SAT_MON = 0x4C;
+ static final short NUM_SUN_ND = 0x4D;
+ static final short NUM_WB_MON = 0x4E;
+ static final short NUM_WB_EXPAK = 0x4F;
+ static final short NUM_ISO_IP = 0x50;
+ static final short NUM_VMTP = 0x51;
+ static final short NUM_SECURE_VMTP = 0x52;
+ static final short NUM_VINES = 0x53;
+ static final short NUM_TTP_IPTM = 0x54;
+ static final short NUM_NSFNET_IGP = 0x55;
+ static final short NUM_DGP = 0x56;
+ static final short NUM_TCF = 0x57;
+ static final short NUM_EIGRP = 0x58;
+ static final short NUM_OSPF = 0x59;
+ static final short NUM_Sprite_RPC = 0x5A;
+ static final short NUM_LARP = 0x5B;
+ static final short NUM_MTP = 0x5C;
+ static final short NUM_AX_25 = 0x5D;
+ static final short NUM_IPIP = 0x5E;
+ static final short NUM_MICP = 0x5F;
+ static final short NUM_SCC_SP = 0x60;
+ static final short NUM_ETHERIP = 0x61;
+ static final short NUM_ENCAP = 0x62;
+ static final short NUM_PRIVATE_ENCRYPT = 0x63;
+ static final short NUM_GMTP = 0x64;
+ static final short NUM_IFMP = 0x65;
+ static final short NUM_PNNI = 0x66;
+ static final short NUM_PIM = 0x67;
+ static final short NUM_ARIS = 0x68;
+ static final short NUM_SCPS = 0x69;
+ static final short NUM_QNX = 0x6A;
+ static final short NUM_A_N = 0x6B;
+ static final short NUM_IP_COMP = 0x6C;
+ static final short NUM_SNP = 0x6D;
+ static final short NUM_COMPAQ_PEER = 0x6E;
+ static final short NUM_IPX_IN_IP = 0x6F;
+ static final short NUM_VRRP = 0x70;
+ static final short NUM_PGM = 0x71;
+ static final short NUM_ZERO_HOP = 0x72;
+ static final short NUM_L2TP = 0x73;
+ static final short NUM_DDX = 0x74;
+ static final short NUM_IATP = 0x75;
+ static final short NUM_STP = 0x76;
+ static final short NUM_SRP = 0x77;
+ static final short NUM_UTI = 0x78;
+ static final short NUM_SMP = 0x79;
+ static final short NUM_SM = 0x7A;
+ static final short NUM_PTP = 0x7B;
+ static final short NUM_IS_IS_OVER_IPv4 = 0x7C;
+ static final short NUM_FIRE = 0x7D;
+ static final short NUM_CRTP = 0x7E;
+ static final short NUM_CRUDP = 0x7F;
+ static final short NUM_SSCOPMCE = 0x80;
+ static final short NUM_IPLT = 0x81;
+ static final short NUM_SPS = 0x82;
+ static final short NUM_PIPE = 0x83;
+ static final short NUM_SCTP = 0x84;
+ static final short NUM_FC = 0x85;
+ static final short NUM_RSVP_E2E_IGNORE = 0x86;
+ static final short NUM_MOBILITY_HEADER = 0x87;
+ static final short NUM_UDP_LITE = 0x88;
+ static final short NUM_MPLS_IN_IP = 0x89;
+ static final short NUM_MANET = 0x8A;
+ static final short NUM_HIP = 0x8B;
+ static final short NUM_SHIM6 = 0x8C;
+
+ public static final IpProtocol HOPOPT = new IpProtocol(NUM_HOPOPT);
+ public static final IpProtocol ICMP = new IpProtocol(NUM_ICMP);
+ public static final IpProtocol IGMP = new IpProtocol(NUM_IGMP);
+ public static final IpProtocol GGP = new IpProtocol(NUM_GGP);
+ public static final IpProtocol IPv4 = new IpProtocol(NUM_IPv4);
+ public static final IpProtocol ST = new IpProtocol(NUM_ST);
+ public static final IpProtocol TCP = new IpProtocol(NUM_TCP);
+ public static final IpProtocol CBT = new IpProtocol(NUM_CBT);
+ public static final IpProtocol EGP = new IpProtocol(NUM_EGP);
+ public static final IpProtocol IGP = new IpProtocol(NUM_IGP);
+ public static final IpProtocol BBN_RCC_MON = new IpProtocol(NUM_BBN_RCC_MON);
+ public static final IpProtocol NVP_II = new IpProtocol(NUM_NVP_II);
+ public static final IpProtocol PUP = new IpProtocol(NUM_PUP);
+ public static final IpProtocol ARGUS = new IpProtocol(NUM_ARGUS);
+ public static final IpProtocol EMCON = new IpProtocol(NUM_EMCON);
+ public static final IpProtocol XNET = new IpProtocol(NUM_XNET);
+ public static final IpProtocol CHAOS = new IpProtocol(NUM_CHAOS);
+ public static final IpProtocol UDP = new IpProtocol(NUM_UDP);
+ public static final IpProtocol MUX = new IpProtocol(NUM_MUX);
+ public static final IpProtocol DCN_MEAS = new IpProtocol(NUM_DCN_MEAS);
+ public static final IpProtocol HMP = new IpProtocol(NUM_HMP);
+ public static final IpProtocol PRM = new IpProtocol(NUM_PRM);
+ public static final IpProtocol XNS_IDP = new IpProtocol(NUM_XNS_IDP);
+ public static final IpProtocol TRUNK_1 = new IpProtocol(NUM_TRUNK_1);
+ public static final IpProtocol TRUNK_2 = new IpProtocol(NUM_TRUNK_2);
+ public static final IpProtocol LEAF_1 = new IpProtocol(NUM_LEAF_1);
+ public static final IpProtocol LEAF_2 = new IpProtocol(NUM_LEAF_2);
+ public static final IpProtocol RDP = new IpProtocol(NUM_RDP);
+ public static final IpProtocol IRTP = new IpProtocol(NUM_IRTP);
+ public static final IpProtocol ISO_TP4 = new IpProtocol(NUM_ISO_TP4);
+ public static final IpProtocol NETBLT = new IpProtocol(NUM_NETBLT);
+ public static final IpProtocol MFE_NSP = new IpProtocol(NUM_MFE_NSP);
+ public static final IpProtocol MERIT_INP = new IpProtocol(NUM_MERIT_INP);
+ public static final IpProtocol DCCP = new IpProtocol(NUM_DCCP);
+ public static final IpProtocol _3PC = new IpProtocol(NUM_3PC);
+ public static final IpProtocol IDPR = new IpProtocol(NUM_IDPR);
+ public static final IpProtocol XTP = new IpProtocol(NUM_XTP);
+ public static final IpProtocol DDP = new IpProtocol(NUM_DDP);
+ public static final IpProtocol IDPR_CMTP = new IpProtocol(NUM_IDPR_CMTP);
+ public static final IpProtocol TP_PP = new IpProtocol(NUM_TP_PP);
+ public static final IpProtocol IL = new IpProtocol(NUM_IL);
+ public static final IpProtocol IPv6 = new IpProtocol(NUM_IPv6);
+ public static final IpProtocol SDRP = new IpProtocol(NUM_SDRP);
+ public static final IpProtocol IPv6_ROUTE = new IpProtocol(NUM_IPv6_ROUTE);
+ public static final IpProtocol IPv6_FRAG = new IpProtocol(NUM_IPv6_FRAG);
+ public static final IpProtocol IDRP = new IpProtocol(NUM_IDRP);
+ public static final IpProtocol RSVP = new IpProtocol(NUM_RSVP);
+ public static final IpProtocol GRE = new IpProtocol(NUM_GRE);
+ public static final IpProtocol MHRP = new IpProtocol(NUM_MHRP);
+ public static final IpProtocol BNA = new IpProtocol(NUM_BNA);
+ public static final IpProtocol ESP = new IpProtocol(NUM_ESP);
+ public static final IpProtocol AH = new IpProtocol(NUM_AH);
+ public static final IpProtocol I_NLSP = new IpProtocol(NUM_I_NLSP);
+ public static final IpProtocol SWIPE = new IpProtocol(NUM_SWIPE);
+ public static final IpProtocol NARP = new IpProtocol(NUM_NARP);
+ public static final IpProtocol MOBILE = new IpProtocol(NUM_MOBILE);
+ public static final IpProtocol TLSP = new IpProtocol(NUM_TLSP);
+ public static final IpProtocol SKIP = new IpProtocol(NUM_SKIP);
+ public static final IpProtocol IPv6_ICMP = new IpProtocol(NUM_IPv6_ICMP);
+ public static final IpProtocol IPv6_NO_NXT = new IpProtocol(NUM_IPv6_NO_NXT);
+ public static final IpProtocol IPv6_OPTS = new IpProtocol(NUM_IPv6_OPTS);
+ public static final IpProtocol HOST_INTERNAL = new IpProtocol(NUM_HOST_INTERNAL);
+ public static final IpProtocol CFTP = new IpProtocol(NUM_CFTP);
+ public static final IpProtocol LOCAL_NET = new IpProtocol(NUM_LOCAL_NET);
+ public static final IpProtocol SAT_EXPAK = new IpProtocol(NUM_SAT_EXPAK);
+ public static final IpProtocol KRYPTOLAN = new IpProtocol(NUM_KRYPTOLAN);
+ public static final IpProtocol RVD = new IpProtocol(NUM_RVD);
+ public static final IpProtocol IPPC = new IpProtocol(NUM_IPPC);
+ public static final IpProtocol DIST_FS = new IpProtocol(NUM_DIST_FS);
+ public static final IpProtocol SAT_MON = new IpProtocol(NUM_SAT_MON);
+ public static final IpProtocol VISA = new IpProtocol(NUM_VISA);
+ public static final IpProtocol IPCV = new IpProtocol(NUM_IPCV);
+ public static final IpProtocol CPNX = new IpProtocol(NUM_CPNX);
+ public static final IpProtocol CPHB = new IpProtocol(NUM_CPHB);
+ public static final IpProtocol WSN = new IpProtocol(NUM_WSN);
+ public static final IpProtocol PVP = new IpProtocol(NUM_PVP);
+ public static final IpProtocol BR_SAT_MON = new IpProtocol(NUM_BR_SAT_MON);
+ public static final IpProtocol SUN_ND = new IpProtocol(NUM_SUN_ND);
+ public static final IpProtocol WB_MON = new IpProtocol(NUM_WB_MON);
+ public static final IpProtocol WB_EXPAK = new IpProtocol(NUM_WB_EXPAK);
+ public static final IpProtocol ISO_IP = new IpProtocol(NUM_ISO_IP);
+ public static final IpProtocol VMTP = new IpProtocol(NUM_VMTP);
+ public static final IpProtocol SECURE_VMTP = new IpProtocol(NUM_SECURE_VMTP);
+ public static final IpProtocol VINES = new IpProtocol(NUM_VINES);
+ public static final IpProtocol TTP_IPTM = new IpProtocol(NUM_TTP_IPTM);
+ public static final IpProtocol NSFNET_IGP = new IpProtocol(NUM_NSFNET_IGP);
+ public static final IpProtocol DGP = new IpProtocol(NUM_DGP);
+ public static final IpProtocol TCF = new IpProtocol(NUM_TCF);
+ public static final IpProtocol EIGRP = new IpProtocol(NUM_EIGRP);
+ public static final IpProtocol OSPF = new IpProtocol(NUM_OSPF);
+ public static final IpProtocol Sprite_RPC = new IpProtocol(NUM_Sprite_RPC);
+ public static final IpProtocol LARP = new IpProtocol(NUM_LARP);
+ public static final IpProtocol MTP = new IpProtocol(NUM_MTP);
+ public static final IpProtocol AX_25 = new IpProtocol(NUM_AX_25);
+ public static final IpProtocol IPIP = new IpProtocol(NUM_IPIP);
+ public static final IpProtocol MICP = new IpProtocol(NUM_MICP);
+ public static final IpProtocol SCC_SP = new IpProtocol(NUM_SCC_SP);
+ public static final IpProtocol ETHERIP = new IpProtocol(NUM_ETHERIP);
+ public static final IpProtocol ENCAP = new IpProtocol(NUM_ENCAP);
+ public static final IpProtocol PRIVATE_ENCRYPT = new IpProtocol(NUM_PRIVATE_ENCRYPT);
+ public static final IpProtocol GMTP = new IpProtocol(NUM_GMTP);
+ public static final IpProtocol IFMP = new IpProtocol(NUM_IFMP);
+ public static final IpProtocol PNNI = new IpProtocol(NUM_PNNI);
+ public static final IpProtocol PIM = new IpProtocol(NUM_PIM);
+ public static final IpProtocol ARIS = new IpProtocol(NUM_ARIS);
+ public static final IpProtocol SCPS = new IpProtocol(NUM_SCPS);
+ public static final IpProtocol QNX = new IpProtocol(NUM_QNX);
+ public static final IpProtocol A_N = new IpProtocol(NUM_A_N);
+ public static final IpProtocol IP_COMP = new IpProtocol(NUM_IP_COMP);
+ public static final IpProtocol SNP = new IpProtocol(NUM_SNP);
+ public static final IpProtocol COMPAQ_PEER = new IpProtocol(NUM_COMPAQ_PEER);
+ public static final IpProtocol IPX_IN_IP = new IpProtocol(NUM_IPX_IN_IP);
+ public static final IpProtocol VRRP = new IpProtocol(NUM_VRRP);
+ public static final IpProtocol PGM = new IpProtocol(NUM_PGM);
+ public static final IpProtocol ZERO_HOP = new IpProtocol(NUM_ZERO_HOP);
+ public static final IpProtocol L2TP = new IpProtocol(NUM_L2TP);
+ public static final IpProtocol DDX = new IpProtocol(NUM_DDX);
+ public static final IpProtocol IATP = new IpProtocol(NUM_IATP);
+ public static final IpProtocol STP = new IpProtocol(NUM_STP);
+ public static final IpProtocol SRP = new IpProtocol(NUM_SRP);
+ public static final IpProtocol UTI = new IpProtocol(NUM_UTI);
+ public static final IpProtocol SMP = new IpProtocol(NUM_SMP);
+ public static final IpProtocol SM = new IpProtocol(NUM_SM);
+ public static final IpProtocol PTP = new IpProtocol(NUM_PTP);
+ public static final IpProtocol IS_IS_OVER_IPv4 = new IpProtocol(NUM_IS_IS_OVER_IPv4);
+ public static final IpProtocol FIRE = new IpProtocol(NUM_FIRE);
+ public static final IpProtocol CRTP = new IpProtocol(NUM_CRTP);
+ public static final IpProtocol CRUDP = new IpProtocol(NUM_CRUDP);
+ public static final IpProtocol SSCOPMCE = new IpProtocol(NUM_SSCOPMCE);
+ public static final IpProtocol IPLT = new IpProtocol(NUM_IPLT);
+ public static final IpProtocol SPS = new IpProtocol(NUM_SPS);
+ public static final IpProtocol PIPE = new IpProtocol(NUM_PIPE);
+ public static final IpProtocol SCTP = new IpProtocol(NUM_SCTP);
+ public static final IpProtocol FC = new IpProtocol(NUM_FC);
+ public static final IpProtocol RSVP_E2E_IGNORE = new IpProtocol(NUM_RSVP_E2E_IGNORE);
+ public static final IpProtocol MOBILITY_HEADER = new IpProtocol(NUM_MOBILITY_HEADER);
+ public static final IpProtocol UDP_LITE = new IpProtocol(NUM_UDP_LITE);
+ public static final IpProtocol MPLS_IN_IP = new IpProtocol(NUM_MPLS_IN_IP);
+ public static final IpProtocol MANET = new IpProtocol(NUM_MANET);
+ public static final IpProtocol HIP = new IpProtocol(NUM_HIP);
+ public static final IpProtocol SHIM6 = new IpProtocol(NUM_SHIM6);
+
+ public static final IpProtocol NONE = HOPOPT;
+
+ public static final IpProtocol NO_MASK = HOPOPT;
+ public static final IpProtocol FULL_MASK = new IpProtocol((short)0x0000);
+
+ private IpProtocol(short version) {
+ this.proto = version;
+ }
+
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ public static IpProtocol of(short proto) {
+ switch (proto) {
+ case NUM_HOPOPT:
+ return HOPOPT;
+ case NUM_ICMP:
+ return ICMP;
+ case NUM_IGMP:
+ return IGMP;
+ case NUM_GGP:
+ return GGP;
+ case NUM_IPv4:
+ return IPv4;
+ case NUM_ST:
+ return ST;
+ case NUM_TCP:
+ return TCP;
+ case NUM_CBT:
+ return CBT;
+ case NUM_EGP:
+ return EGP;
+ case NUM_IGP:
+ return IGP;
+ case NUM_BBN_RCC_MON:
+ return BBN_RCC_MON;
+ case NUM_NVP_II:
+ return NVP_II;
+ case NUM_PUP:
+ return PUP;
+ case NUM_ARGUS:
+ return ARGUS;
+ case NUM_EMCON:
+ return EMCON;
+ case NUM_XNET:
+ return XNET;
+ case NUM_CHAOS:
+ return CHAOS;
+ case NUM_UDP:
+ return UDP;
+ case NUM_MUX:
+ return MUX;
+ case NUM_DCN_MEAS:
+ return DCN_MEAS;
+ case NUM_HMP:
+ return HMP;
+ case NUM_PRM:
+ return PRM;
+ case NUM_XNS_IDP:
+ return XNS_IDP;
+ case NUM_TRUNK_1:
+ return TRUNK_1;
+ case NUM_TRUNK_2:
+ return TRUNK_2;
+ case NUM_LEAF_1:
+ return LEAF_1;
+ case NUM_LEAF_2:
+ return LEAF_2;
+ case NUM_RDP:
+ return RDP;
+ case NUM_IRTP:
+ return IRTP;
+ case NUM_ISO_TP4:
+ return ISO_TP4;
+ case NUM_NETBLT:
+ return NETBLT;
+ case NUM_MFE_NSP:
+ return MFE_NSP;
+ case NUM_MERIT_INP:
+ return MERIT_INP;
+ case NUM_DCCP:
+ return DCCP;
+ case NUM_3PC:
+ return _3PC;
+ case NUM_IDPR:
+ return IDPR;
+ case NUM_XTP:
+ return XTP;
+ case NUM_DDP:
+ return DDP;
+ case NUM_IDPR_CMTP:
+ return IDPR_CMTP;
+ case NUM_TP_PP:
+ return TP_PP;
+ case NUM_IL:
+ return IL;
+ case NUM_IPv6:
+ return IPv6;
+ case NUM_SDRP:
+ return SDRP;
+ case NUM_IPv6_ROUTE:
+ return IPv6_ROUTE;
+ case NUM_IPv6_FRAG:
+ return IPv6_FRAG;
+ case NUM_IDRP:
+ return IDRP;
+ case NUM_RSVP:
+ return RSVP;
+ case NUM_GRE:
+ return GRE;
+ case NUM_MHRP:
+ return MHRP;
+ case NUM_BNA:
+ return BNA;
+ case NUM_ESP:
+ return ESP;
+ case NUM_AH:
+ return AH;
+ case NUM_I_NLSP:
+ return I_NLSP;
+ case NUM_SWIPE:
+ return SWIPE;
+ case NUM_NARP:
+ return NARP;
+ case NUM_MOBILE:
+ return MOBILE;
+ case NUM_TLSP:
+ return TLSP;
+ case NUM_SKIP:
+ return SKIP;
+ case NUM_IPv6_ICMP:
+ return IPv6_ICMP;
+ case NUM_IPv6_NO_NXT:
+ return IPv6_NO_NXT;
+ case NUM_IPv6_OPTS:
+ return IPv6_OPTS;
+ case NUM_HOST_INTERNAL:
+ return HOST_INTERNAL;
+ case NUM_CFTP:
+ return CFTP;
+ case NUM_LOCAL_NET:
+ return LOCAL_NET;
+ case NUM_SAT_EXPAK:
+ return SAT_EXPAK;
+ case NUM_KRYPTOLAN:
+ return KRYPTOLAN;
+ case NUM_RVD:
+ return RVD;
+ case NUM_IPPC:
+ return IPPC;
+ case NUM_DIST_FS:
+ return DIST_FS;
+ case NUM_SAT_MON:
+ return SAT_MON;
+ case NUM_VISA:
+ return VISA;
+ case NUM_IPCV:
+ return IPCV;
+ case NUM_CPNX:
+ return CPNX;
+ case NUM_CPHB:
+ return CPHB;
+ case NUM_WSN:
+ return WSN;
+ case NUM_PVP:
+ return PVP;
+ case NUM_BR_SAT_MON:
+ return BR_SAT_MON;
+ case NUM_SUN_ND:
+ return SUN_ND;
+ case NUM_WB_MON:
+ return WB_MON;
+ case NUM_WB_EXPAK:
+ return WB_EXPAK;
+ case NUM_ISO_IP:
+ return ISO_IP;
+ case NUM_VMTP:
+ return VMTP;
+ case NUM_SECURE_VMTP:
+ return SECURE_VMTP;
+ case NUM_VINES:
+ return VINES;
+ case NUM_TTP_IPTM:
+ return TTP_IPTM;
+ case NUM_NSFNET_IGP:
+ return NSFNET_IGP;
+ case NUM_DGP:
+ return DGP;
+ case NUM_TCF:
+ return TCF;
+ case NUM_EIGRP:
+ return EIGRP;
+ case NUM_OSPF:
+ return OSPF;
+ case NUM_Sprite_RPC:
+ return Sprite_RPC;
+ case NUM_LARP:
+ return LARP;
+ case NUM_MTP:
+ return MTP;
+ case NUM_AX_25:
+ return AX_25;
+ case NUM_IPIP:
+ return IPIP;
+ case NUM_MICP:
+ return MICP;
+ case NUM_SCC_SP:
+ return SCC_SP;
+ case NUM_ETHERIP:
+ return ETHERIP;
+ case NUM_ENCAP:
+ return ENCAP;
+ case NUM_PRIVATE_ENCRYPT:
+ return PRIVATE_ENCRYPT;
+ case NUM_GMTP:
+ return GMTP;
+ case NUM_IFMP:
+ return IFMP;
+ case NUM_PNNI:
+ return PNNI;
+ case NUM_PIM:
+ return PIM;
+ case NUM_ARIS:
+ return ARIS;
+ case NUM_SCPS:
+ return SCPS;
+ case NUM_QNX:
+ return QNX;
+ case NUM_A_N:
+ return A_N;
+ case NUM_IP_COMP:
+ return IP_COMP;
+ case NUM_SNP:
+ return SNP;
+ case NUM_COMPAQ_PEER:
+ return COMPAQ_PEER;
+ case NUM_IPX_IN_IP:
+ return IPX_IN_IP;
+ case NUM_VRRP:
+ return VRRP;
+ case NUM_PGM:
+ return PGM;
+ case NUM_ZERO_HOP:
+ return ZERO_HOP;
+ case NUM_L2TP:
+ return L2TP;
+ case NUM_DDX:
+ return DDX;
+ case NUM_IATP:
+ return IATP;
+ case NUM_STP:
+ return STP;
+ case NUM_SRP:
+ return SRP;
+ case NUM_UTI:
+ return UTI;
+ case NUM_SMP:
+ return SMP;
+ case NUM_SM:
+ return SM;
+ case NUM_PTP:
+ return PTP;
+ case NUM_IS_IS_OVER_IPv4:
+ return IS_IS_OVER_IPv4;
+ case NUM_FIRE:
+ return FIRE;
+ case NUM_CRTP:
+ return CRTP;
+ case NUM_CRUDP:
+ return CRUDP;
+ case NUM_SSCOPMCE:
+ return SSCOPMCE;
+ case NUM_IPLT:
+ return IPLT;
+ case NUM_SPS:
+ return SPS;
+ case NUM_PIPE:
+ return PIPE;
+ case NUM_SCTP:
+ return SCTP;
+ case NUM_FC:
+ return FC;
+ case NUM_RSVP_E2E_IGNORE:
+ return RSVP_E2E_IGNORE;
+ case NUM_MOBILITY_HEADER:
+ return MOBILITY_HEADER;
+ case NUM_UDP_LITE:
+ return UDP_LITE;
+ case NUM_MPLS_IN_IP:
+ return MPLS_IN_IP;
+ case NUM_MANET:
+ return MANET;
+ case NUM_HIP:
+ return HIP;
+ case NUM_SHIM6:
+ return SHIM6;
+ default:
+ if (proto >= MAX_PROTO) {
+ throw new IllegalArgumentException("Illegal IP protocol number: "
+ + proto);
+ } else {
+ return new IpProtocol(proto);
+ }
+ }
+ }
+
+ @Override
+ public String toString() {
+ return Integer.toHexString(proto);
+ }
+
+ public void writeByte(ChannelBuffer c) {
+ c.writeByte(this.proto);
+ }
+
+ public static IpProtocol readByte(ChannelBuffer c) {
+ return IpProtocol.of(c.readUnsignedByte());
+ }
+
+ @Override
+ public IpProtocol applyMask(IpProtocol mask) {
+ return IpProtocol.of((short)(this.proto & mask.proto));
+ }
+
+ public short getIpProtocolNumber() {
+ return proto;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof IpProtocol))
+ return false;
+ IpProtocol o = (IpProtocol)obj;
+ if (o.proto != this.proto)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 37;
+ int result = 1;
+ result = prime * result + proto;
+ return result;
+ }
+
+
+ @Override
+ public int compareTo(IpProtocol o) {
+ return Shorts.compare(proto, o.proto);
+ }
+
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putShort(proto);
+ }
+
+}
\ No newline at end of file
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/LagId.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/LagId.java
new file mode 100644
index 0000000..51364e1
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/LagId.java
@@ -0,0 +1,92 @@
+package org.projectfloodlight.openflow.types;
+
+import javax.annotation.concurrent.Immutable;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+@Immutable
+public class LagId implements OFValueType<LagId> {
+ static final int LENGTH = 4;
+ private final int rawValue;
+
+ private final static int NONE_VAL = 0;
+ public final static LagId NONE = new LagId(NONE_VAL);
+
+ private final static int NO_MASK_VAL = 0xFFFFFFFF;
+ public final static LagId NO_MASK = new LagId(NO_MASK_VAL);
+ public final static LagId FULL_MASK = NONE;
+
+ private LagId(final int rawValue) {
+ this.rawValue = rawValue;
+ }
+
+ public static LagId of(final int raw) {
+ if(raw == NONE_VAL)
+ return NONE;
+ else if (raw == NO_MASK_VAL)
+ return NO_MASK;
+ return new LagId(raw);
+ }
+
+ public int getInt() {
+ return rawValue;
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + rawValue;
+ return result;
+ }
+
+ @Override
+ public String toString() {
+ return Integer.toString(rawValue);
+ }
+
+ @Override
+ public boolean equals(final Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ LagId other = (LagId) obj;
+ if (rawValue != other.rawValue)
+ return false;
+ return true;
+ }
+
+ public void write4Bytes(ChannelBuffer c) {
+ c.writeInt(rawValue);
+ }
+
+ public static LagId read4Bytes(ChannelBuffer c) {
+ return LagId.of(c.readInt());
+ }
+
+ @Override
+ public int compareTo(LagId o) {
+ return UnsignedInts.compare(rawValue, o.rawValue);
+ }
+
+ @Override
+ public LagId applyMask(LagId mask) {
+ return LagId.of(rawValue & mask.rawValue);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(rawValue);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/MacAddress.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/MacAddress.java
new file mode 100644
index 0000000..d7f044e
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/MacAddress.java
@@ -0,0 +1,207 @@
+package org.projectfloodlight.openflow.types;
+
+import java.util.Arrays;
+
+import javax.annotation.Nonnull;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.util.HexString;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Longs;
+
+/**
+ * Wrapper around a 6 byte mac address.
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+
+public class MacAddress implements OFValueType<MacAddress> {
+ static final int MacAddrLen = 6;
+ private final long rawValue;
+
+ private final static long NONE_VAL = 0x0L;
+ public static final MacAddress NONE = new MacAddress(NONE_VAL);
+
+ private final static long BROADCAST_VAL = 0x0000FFFFFFFFFFFFL;
+ public static final MacAddress BROADCAST = new MacAddress(BROADCAST_VAL);
+
+ public static final MacAddress NO_MASK = MacAddress.of(0xFFFFFFFFFFFFFFFFl);
+ public static final MacAddress FULL_MASK = MacAddress.of(0x0);
+
+ private static final long LLDP_MAC_ADDRESS_MASK = 0xfffffffffff0L;
+ private static final long LLDP_MAC_ADDRESS_VALUE = 0x0180c2000000L;
+
+ private MacAddress(final long rawValue) {
+ this.rawValue = rawValue;
+ }
+
+ public static MacAddress of(final byte[] address) {
+ if (address.length != MacAddrLen)
+ throw new IllegalArgumentException(
+ "Mac address byte array must be exactly 6 bytes long; length = " + address.length);
+ long raw =
+ (address[0] & 0xFFL) << 40 | (address[1] & 0xFFL) << 32
+ | (address[2] & 0xFFL) << 24 | (address[3] & 0xFFL) << 16
+ | (address[4] & 0xFFL) << 8 | (address[5] & 0xFFL);
+ return MacAddress.of(raw);
+ }
+
+ public static MacAddress of(long raw) {
+ raw &= BROADCAST_VAL;
+ if(raw == NONE_VAL)
+ return NONE;
+ if (raw == BROADCAST_VAL)
+ return BROADCAST;
+ return new MacAddress(raw);
+ }
+
+ /** Parse a mac adress from the canonical string representation as
+ * 6 hex bytes separated by colons (01:02:03:04:05:06).
+ *
+ * @param macString - a mac address in canonical string representation
+ * @return the parsed MacAddress
+ * @throws IllegalArgumentException if macString is not a valid mac adddress
+ */
+ @Nonnull
+ public static MacAddress of(@Nonnull final String macString) throws IllegalArgumentException {
+ if (macString == null) {
+ throw new NullPointerException("macString must not be null");
+ }
+ int index = 0;
+ int shift = 40;
+ final String FORMAT_ERROR = "Mac address is not well-formed. " +
+ "It must consist of 6 hex digit pairs separated by colons: ";
+
+ long raw = 0;
+ if (macString.length() != 6 * 2 + 5)
+ throw new IllegalArgumentException(FORMAT_ERROR + macString);
+
+ while (shift >= 0) {
+ int digit1 = Character.digit(macString.charAt(index++), 16);
+ int digit2 = Character.digit(macString.charAt(index++), 16);
+ if ((digit1 < 0) || (digit2 < 0))
+ throw new IllegalArgumentException(FORMAT_ERROR + macString);
+ raw |= ((long) (digit1 << 4 | digit2)) << shift;
+
+ if (shift == 0)
+ break;
+ if (macString.charAt(index++) != ':')
+ throw new IllegalArgumentException(FORMAT_ERROR + macString);
+ shift -= 8;
+ }
+ return MacAddress.of(raw);
+ }
+
+ private volatile byte[] bytesCache = null;
+
+ public byte[] getBytes() {
+ if (bytesCache == null) {
+ synchronized (this) {
+ if (bytesCache == null) {
+ bytesCache =
+ new byte[] { (byte) ((rawValue >> 40) & 0xFF),
+ (byte) ((rawValue >> 32) & 0xFF),
+ (byte) ((rawValue >> 24) & 0xFF),
+ (byte) ((rawValue >> 16) & 0xFF),
+ (byte) ((rawValue >> 8) & 0xFF),
+ (byte) ((rawValue >> 0) & 0xFF) };
+ }
+ }
+ }
+ return Arrays.copyOf(bytesCache, bytesCache.length);
+ }
+
+ /**
+ * Returns {@code true} if the MAC address is the broadcast address.
+ * @return {@code true} if the MAC address is the broadcast address.
+ */
+ public boolean isBroadcast() {
+ return this == BROADCAST;
+ }
+
+ /**
+ * Returns {@code true} if the MAC address is a multicast address.
+ * @return {@code true} if the MAC address is a multicast address.
+ */
+ public boolean isMulticast() {
+ if (isBroadcast()) {
+ return false;
+ }
+ return (rawValue & (0x01L << 40)) != 0;
+ }
+
+ /**
+ * Returns {@code true} if the MAC address is an LLDP mac address.
+ * @return {@code true} if the MAC address is an LLDP mac address.
+ */
+ public boolean isLLDPAddress() {
+ return (rawValue & LLDP_MAC_ADDRESS_MASK) == LLDP_MAC_ADDRESS_VALUE;
+ }
+
+ @Override
+ public int getLength() {
+ return MacAddrLen;
+ }
+
+ @Override
+ public String toString() {
+ return HexString.toHexString(rawValue, 6);
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + (int) (rawValue ^ (rawValue >>> 32));
+ return result;
+ }
+
+ @Override
+ public boolean equals(final Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ MacAddress other = (MacAddress) obj;
+ if (rawValue != other.rawValue)
+ return false;
+ return true;
+ }
+
+ public long getLong() {
+ return rawValue;
+ }
+
+ public void write6Bytes(ChannelBuffer c) {
+ c.writeInt((int) (this.rawValue >> 16));
+ c.writeShort((int) this.rawValue & 0xFFFF);
+ }
+
+ public static MacAddress read6Bytes(ChannelBuffer c) throws OFParseError {
+ long raw = c.readUnsignedInt() << 16 | c.readUnsignedShort();
+ return MacAddress.of(raw);
+ }
+
+ @Override
+ public MacAddress applyMask(MacAddress mask) {
+ return MacAddress.of(this.rawValue & mask.rawValue);
+ }
+
+ @Override
+ public int compareTo(MacAddress o) {
+ return Longs.compare(rawValue, o.rawValue);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt((int) (this.rawValue >> 16));
+ sink.putShort((short) (this.rawValue & 0xFFFF));
+ }
+
+
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/Masked.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/Masked.java
new file mode 100644
index 0000000..b5a995d
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/Masked.java
@@ -0,0 +1,97 @@
+package org.projectfloodlight.openflow.types;
+
+import com.google.common.hash.PrimitiveSink;
+
+
+
+public class Masked<T extends OFValueType<T>> implements OFValueType<Masked<T>> {
+ protected final T value;
+
+ /** bitmask of the value. Note: a set (1) bit in this mask means 'match on this value'.
+ * This the natural mask represenation as in IPv[46] netmasks. It is the inverse of the
+ * OpenFlow 1.0 'wildcard' meaning.
+ */
+ protected final T mask;
+
+ protected Masked(T value, T mask) {
+ this.value = value.applyMask(mask);
+ this.mask = mask;
+ }
+
+ public T getValue() {
+ return value;
+ }
+
+ public T getMask() {
+ return mask;
+ }
+
+ public static <T extends OFValueType<T>> Masked<T> of(T value, T mask) {
+ return new Masked<T>(value, mask);
+ }
+
+ @Override
+ public int getLength() {
+ return this.value.getLength() + this.mask.getLength();
+ }
+
+ @Override
+ public String toString() {
+ // General representation: value/mask
+ StringBuilder sb = new StringBuilder();
+ sb.append(value.toString()).append('/').append(mask.toString());
+ return sb.toString();
+ }
+
+ /** Determine whether candidate value is matched by this masked value
+ * (i.e., does candiate lie in the 'network/range' specified by this masked
+ * value).
+ *
+ * @param candidate the candidate value to test
+ * @return true iff the candidate lies in the area specified by this masked
+ * value.
+ */
+ public boolean matches(T candidate) {
+ // candidate lies in the area of this masked value if its
+ // value with the masked bit zero'ed out equals this's value
+ // (e.g., our 'network address' for networks)
+ return candidate.applyMask(this.mask).equals(this.value);
+ }
+
+ @Override
+ public Masked<T> applyMask(Masked<T> mask) {
+ return this;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof Masked<?>))
+ return false;
+ Masked<?> mobj = (Masked<?>)obj;
+ return this.value.equals(mobj.value) && this.mask.equals(mobj.mask);
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 59;
+ int result = 1;
+ result = prime * result + this.value.hashCode();
+ result = prime * result + this.mask.hashCode();
+ return result;
+ }
+
+ @Override
+ public int compareTo(Masked<T> o) {
+ int res = value.compareTo(o.value);
+ if(res != 0)
+ return res;
+ else
+ return mask.compareTo(o.mask);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ value.putTo(sink);
+ mask.putTo(sink);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFAuxId.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFAuxId.java
new file mode 100644
index 0000000..c8e04d2
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFAuxId.java
@@ -0,0 +1,86 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Shorts;
+
+public class OFAuxId implements Comparable<OFAuxId>, PrimitiveSinkable {
+
+ private static final short VALIDATION_MASK = 0xFF;
+
+ private static final short MAIN_VAL = 0x0000;
+
+ public static final OFAuxId MAIN = new OFAuxId(MAIN_VAL);
+
+ private final short id;
+
+ private OFAuxId(short id) {
+ this.id = id;
+ }
+
+ public static OFAuxId of(short id) {
+ switch(id) {
+ case MAIN_VAL:
+ return MAIN;
+ default:
+ if ((id & VALIDATION_MASK) != id)
+ throw new IllegalArgumentException("Illegal Aux id value: " + id);
+ return new OFAuxId(id);
+ }
+ }
+
+ public static OFAuxId of(int id) {
+ if((id & VALIDATION_MASK) != id)
+ throw new IllegalArgumentException("Illegal Aux id value: "+id);
+ return of((short) id);
+ }
+
+ @Override
+ public String toString() {
+ return "0x" + Integer.toHexString(id);
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + id;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj) return true;
+ if (obj == null) return false;
+ if (getClass() != obj.getClass()) return false;
+ OFAuxId other = (OFAuxId) obj;
+ if (id != other.id) return false;
+ return true;
+ }
+
+ public short getValue() {
+ return id;
+ }
+
+ public void writeByte(ChannelBuffer c) {
+ c.writeByte(this.id);
+ }
+
+ public static OFAuxId readByte(ChannelBuffer c) throws OFParseError {
+ return OFAuxId.of(c.readUnsignedByte());
+ }
+
+
+ @Override
+ public int compareTo(OFAuxId other) {
+ return Shorts.compare(this.id, other.id);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putByte((byte) id);
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFBitMask128.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFBitMask128.java
new file mode 100644
index 0000000..93f5a2d
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFBitMask128.java
@@ -0,0 +1,103 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+
+public class OFBitMask128 implements OFValueType<OFBitMask128> {
+
+ static final int LENGTH = 16;
+
+ private final long raw1; // MSBs (ports 64-127)
+ private final long raw2; // LSBs (ports 0-63)
+
+ public static final OFBitMask128 ALL = new OFBitMask128(-1, -1);
+ public static final OFBitMask128 NONE = new OFBitMask128(0, 0);
+
+ public static final OFBitMask128 NO_MASK = ALL;
+ public static final OFBitMask128 FULL_MASK = NONE;
+
+ private OFBitMask128(long raw1, long raw2) {
+ this.raw1 = raw1;
+ this.raw2 = raw2;
+ }
+
+ public static OFBitMask128 of(long raw1, long raw2) {
+ if (raw1 == -1 && raw2 == -1)
+ return ALL;
+ if (raw1 == 0 && raw2 == 0)
+ return NONE;
+ return new OFBitMask128(raw1, raw2);
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public OFBitMask128 applyMask(OFBitMask128 mask) {
+ return of(this.raw1 & mask.raw1, this.raw2 & mask.raw2);
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof OFBitMask128))
+ return false;
+ OFBitMask128 other = (OFBitMask128)obj;
+ return (other.raw1 == this.raw1 && other.raw2 == this.raw2);
+ }
+
+ @Override
+ public int hashCode() {
+ return (int)(31 * raw1 + raw2);
+ }
+
+ protected static boolean isBitOn(long raw1, long raw2, int bit) {
+ if (bit < 0 || bit >= 128)
+ throw new IndexOutOfBoundsException();
+ long word;
+ if (bit < 64) {
+ word = raw2; // ports 0-63
+ } else {
+ word = raw1; // ports 64-127
+ bit -= 64;
+ }
+ return (word & ((long)1 << bit)) != 0;
+ }
+
+ public void write16Bytes(ChannelBuffer cb) {
+ cb.writeLong(raw1);
+ cb.writeLong(raw2);
+ }
+
+ public static OFBitMask128 read16Bytes(ChannelBuffer cb) {
+ long raw1 = cb.readLong();
+ long raw2 = cb.readLong();
+ return of(raw1, raw2);
+ }
+
+ public boolean isOn(int bit) {
+ return isBitOn(raw1, raw2, bit);
+ }
+
+ @Override
+ public String toString() {
+ return (String.format("%64s", Long.toBinaryString(raw2)) + String.format("%64s", Long.toBinaryString(raw1))).replaceAll(" ", "0");
+ }
+
+ @Override
+ public int compareTo(OFBitMask128 o) {
+ long c = this.raw1 - o.raw1;
+ if (c != 0)
+ return Long.signum(c);
+ return Long.signum(this.raw2 - o.raw2);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putLong(raw1);
+ sink.putLong(raw2);
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFBooleanValue.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFBooleanValue.java
new file mode 100644
index 0000000..e276092
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFBooleanValue.java
@@ -0,0 +1,110 @@
+/**
+ * Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ * University
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License"); you may
+ * not use this file except in compliance with the License. You may obtain
+ * a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations
+ * under the License.
+ **/
+
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+import com.google.common.hash.PrimitiveSink;
+
+public class OFBooleanValue implements Writeable, OFValueType<OFBooleanValue> {
+ public final static OFBooleanValue TRUE = new OFBooleanValue(true);
+ public final static OFBooleanValue FALSE = new OFBooleanValue(false);
+
+ public final static OFBooleanValue NO_MASK = TRUE;
+ public final static OFBooleanValue FULL_MASK = FALSE;
+
+ private final boolean value;
+
+ private OFBooleanValue(boolean value) {
+ this.value = value;
+ }
+
+ public static OFBooleanValue of(boolean value) {
+ return value ? TRUE : FALSE;
+ }
+
+ public boolean getValue() {
+ return value;
+ }
+
+ public int getInt() {
+ return value ? 1 : 0;
+ }
+
+ @Override
+ public String toString() {
+ return "" + value;
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + getInt();
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ OFBooleanValue other = (OFBooleanValue) obj;
+ if (value != other.value)
+ return false;
+ return true;
+ }
+
+ @Override
+ public void writeTo(ChannelBuffer bb) {
+ bb.writeByte(getInt());
+ }
+
+ private static class Reader implements OFMessageReader<OFBooleanValue> {
+ @Override
+ public OFBooleanValue readFrom(ChannelBuffer bb) throws OFParseError {
+ return of(bb.readByte() != 0);
+ }
+ }
+
+ @Override
+ public int getLength() {
+ return 1;
+ }
+
+ @Override
+ public OFBooleanValue applyMask(OFBooleanValue mask) {
+ return of(value && mask.value);
+ }
+
+ @Override
+ public int compareTo(OFBooleanValue o) {
+ return getInt() - o.getInt();
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putByte((byte)getInt());
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFBufferId.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFBufferId.java
new file mode 100644
index 0000000..7f76b4d
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFBufferId.java
@@ -0,0 +1,69 @@
+package org.projectfloodlight.openflow.types;
+
+import org.projectfloodlight.openflow.annotations.Immutable;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+/**
+ * Abstraction of a buffer id in OpenFlow. Immutable.
+ *
+ * @author Rob Vaterlaus <rob.vaterlaus@bigswitch.com>
+ */
+@Immutable
+public class OFBufferId implements Comparable<OFBufferId>, PrimitiveSinkable {
+ public static final OFBufferId NO_BUFFER = new OFBufferId(0xFFFFFFFF);
+
+ private final int rawValue;
+
+ private OFBufferId(int rawValue) {
+ this.rawValue = rawValue;
+ }
+
+ public static OFBufferId of(final int rawValue) {
+ if (rawValue == NO_BUFFER.getInt())
+ return NO_BUFFER;
+ return new OFBufferId(rawValue);
+ }
+
+ public int getInt() {
+ return rawValue;
+ }
+
+ @Override
+ public String toString() {
+ return Long.toString(U32.f(rawValue));
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + rawValue;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ OFBufferId other = (OFBufferId) obj;
+ if (rawValue != other.rawValue)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int compareTo(OFBufferId o) {
+ return UnsignedInts.compare(rawValue, o.rawValue);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(rawValue);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFErrorCauseData.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFErrorCauseData.java
new file mode 100644
index 0000000..824b809
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFErrorCauseData.java
@@ -0,0 +1,127 @@
+package org.projectfloodlight.openflow.types;
+
+import java.util.Arrays;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.jboss.netty.buffer.ChannelBuffers;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFErrorMsg;
+import org.projectfloodlight.openflow.protocol.OFFactories;
+import org.projectfloodlight.openflow.protocol.OFFactory;
+import org.projectfloodlight.openflow.protocol.OFMessage;
+import org.projectfloodlight.openflow.protocol.OFVersion;
+import org.projectfloodlight.openflow.protocol.Writeable;
+import org.projectfloodlight.openflow.util.ChannelUtils;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import com.google.common.base.Optional;
+import com.google.common.hash.PrimitiveSink;
+
+/** A special-purpose wrapper for the 'data' field in an {@link OFErrorMsg} message
+ * that contains a byte serialization of the offending message.
+ *
+ * This attempts to parse the offending message on demand, and if successful
+ * will present the parsed message.
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+public class OFErrorCauseData implements Writeable, PrimitiveSinkable {
+ private static final Logger logger =
+ LoggerFactory.getLogger(OFErrorCauseData.class);
+
+ /** A default 'empty' cause. Note: the OFVersion OF_13 passed in here is irrelevant,
+ * because parsing of the 0-byte array will always return null, irrespective of the
+ * version.
+ */
+ public static final OFErrorCauseData NONE = new OFErrorCauseData(new byte[0], OFVersion.OF_13);
+
+ private final byte[] data;
+ private final OFVersion version;
+
+ private OFErrorCauseData(byte[] data, OFVersion version) {
+ this.data = data;
+ this.version = version;
+ }
+
+ public static OFErrorCauseData of(byte[] data, OFVersion version) {
+ return new OFErrorCauseData(Arrays.copyOf(data, data.length), version);
+ }
+
+ public byte[] getData() {
+ return Arrays.copyOf(data, data.length);
+ }
+
+ public Optional<OFMessage> getParsedMessage() {
+ OFFactory factory = OFFactories.getFactory(version);
+ try {
+ OFMessage msg = factory.getReader().readFrom(ChannelBuffers.wrappedBuffer(data));
+ if(msg != null)
+ return Optional.of(msg);
+ else
+ return Optional.absent();
+ } catch (OFParseError e) {
+ logger.debug("Error parsing error cause data as OFMessage: {}", e.getMessage(), e);
+ return Optional.absent();
+ }
+ }
+
+ public static OFErrorCauseData read(ChannelBuffer bb, int length, OFVersion version) {
+ byte[] bytes = ChannelUtils.readBytes(bb, length);
+ return of(bytes, version);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putBytes(data);
+ }
+
+ @Override
+ public void writeTo(ChannelBuffer bb) {
+ bb.writeBytes(data);
+ }
+
+ @Override
+ public String toString() {
+ Optional<OFMessage> parsedMessage = getParsedMessage();
+ if(parsedMessage.isPresent()) {
+ return String.valueOf(parsedMessage.get());
+ } else {
+ StringBuilder b = new StringBuilder();
+ b.append("[unparsed: ");
+ for(int i=0; i<data.length; i++) {
+ if(i>0)
+ b.append(" ");
+ b.append(String.format("%02x", data[i]));
+ }
+ b.append("]");
+ return b.toString();
+ }
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + Arrays.hashCode(data);
+ result = prime * result + ((version == null) ? 0 : version.hashCode());
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ OFErrorCauseData other = (OFErrorCauseData) obj;
+ if (!Arrays.equals(data, other.data))
+ return false;
+ if (version != other.version)
+ return false;
+ return true;
+ }
+
+}
\ No newline at end of file
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFGroup.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFGroup.java
new file mode 100644
index 0000000..b05d5fa
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFGroup.java
@@ -0,0 +1,156 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.annotations.Immutable;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+/**
+ * Abstraction of an logical / OpenFlow group (ofp_group) in OpenFlow.
+ * Immutable.
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+@Immutable
+public class OFGroup implements OFValueType<OFGroup> {
+ static final int LENGTH = 4;
+
+ // private int constants (OF1.1+) to avoid duplication in the code
+ // should not have to use these outside this class
+ private static final int ZERO_VAL = 0x00;
+ private static final int MAX_VAL = 0xffffff00;
+ private static final int ALL_VAL = 0xfffffffc;
+ private static final int ANY_VAL = 0xffffffff;
+
+
+ // ////////////// public constants - use to access well known OpenFlow group constants
+
+ /** Maximum number of physical and logical switch groups. */
+ public final static OFGroup MAX = new NamedGroup(MAX_VAL, "max");
+
+ /** All groups */
+ public final static OFGroup ALL = new NamedGroup(ALL_VAL, "all");
+
+ /**
+ * Wildcard group used only for flow mod (delete) and flow stats requests. */
+ public final static OFGroup ANY = new NamedGroup(ANY_VAL, "any");
+
+ /** group 0 in case we need it */
+ public static final OFGroup ZERO = OFGroup.of(ZERO_VAL);
+
+ public static final OFGroup NO_MASK = ANY;
+ public static final OFGroup FULL_MASK = ZERO;
+
+ /** raw openflow group number as a signed 32 bit integer */
+ private final int groupNumber;
+
+ /** private constructor. use of*-Factory methods instead */
+ private OFGroup(final int portNumber) {
+ this.groupNumber = portNumber;
+ }
+
+ /**
+ * get an OFGroup object corresponding to a raw 32-bit integer group number.
+ * NOTE: The group object may either be newly allocated or cached. Do not
+ * rely on either behavior.
+ *
+ * @param groupNumber the raw 32-bit group number
+ * @return a corresponding OFPort
+ */
+ public static OFGroup of(final int groupNumber) {
+ switch(groupNumber) {
+ case ZERO_VAL:
+ return MAX;
+ case MAX_VAL:
+ return MAX;
+ case ALL_VAL:
+ return ALL;
+ case ANY_VAL:
+ return ANY;
+ default:
+ if(UnsignedInts.compare(groupNumber, MAX_VAL) > 0) {
+ // greater than max_val, but not one of the reserved values
+ throw new IllegalArgumentException("Unknown special group number: "
+ + groupNumber);
+ }
+ return new OFGroup(groupNumber);
+ }
+ }
+
+ /** return the group number as a int32 */
+ public int getGroupNumber() {
+ return groupNumber;
+ }
+
+ @Override
+ public String toString() {
+ return UnsignedInts.toString(groupNumber);
+ }
+
+ /** Extension of OFGroup for named groups */
+ static class NamedGroup extends OFGroup {
+ private final String name;
+
+ NamedGroup(final int portNo, final String name) {
+ super(portNo);
+ this.name = name;
+ }
+
+ public String getName() {
+ return name;
+ }
+
+ @Override
+ public String toString() {
+ return name;
+ }
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof OFGroup))
+ return false;
+ OFGroup other = (OFGroup)obj;
+ if (other.groupNumber != this.groupNumber)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 53;
+ int result = 1;
+ result = prime * result + groupNumber;
+ return result;
+ }
+
+ public void write4Bytes(ChannelBuffer c) {
+ c.writeInt(this.groupNumber);
+ }
+
+ public static OFGroup read4Bytes(ChannelBuffer c) throws OFParseError {
+ return OFGroup.of(c.readInt());
+ }
+
+ @Override
+ public OFGroup applyMask(OFGroup mask) {
+ return OFGroup.of(this.groupNumber & mask.groupNumber);
+ }
+
+ @Override
+ public int compareTo(OFGroup o) {
+ return UnsignedInts.compare(this.groupNumber, o.groupNumber);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(groupNumber);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFHelloElement.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFHelloElement.java
new file mode 100644
index 0000000..10d06a0
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFHelloElement.java
@@ -0,0 +1,5 @@
+package org.projectfloodlight.openflow.types;
+
+public interface OFHelloElement {
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFMetadata.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFMetadata.java
new file mode 100644
index 0000000..fcabdcd
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFMetadata.java
@@ -0,0 +1,81 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+
+public class OFMetadata implements OFValueType<OFMetadata> {
+
+ static int LENGTH = 8;
+
+ private final U64 u64;
+
+ public static final OFMetadata NONE = OFMetadata.of(U64.ZERO);
+
+ public static final OFMetadata NO_MASK = OFMetadata.of(U64.ofRaw(0xFFFFFFFFFFFFFFFFl));
+ public static final OFMetadata FULL_MASK = OFMetadata.of(U64.ofRaw(0x0));
+
+ public OFMetadata(U64 ofRaw) {
+ u64 = ofRaw;
+ }
+
+ public static OFMetadata of(U64 u64) {
+ return new OFMetadata(u64);
+ }
+
+ public static OFMetadata ofRaw(long raw) {
+ return new OFMetadata(U64.ofRaw(raw));
+ }
+
+ public U64 getValue() {
+ return u64;
+ }
+
+ public static OFMetadata read8Bytes(ChannelBuffer cb) {
+ return OFMetadata.ofRaw(cb.readLong());
+ }
+
+ public void write8Bytes(ChannelBuffer cb) {
+ u64.writeTo(cb);
+ }
+
+ @Override
+ public int getLength() {
+ return u64.getLength();
+ }
+
+ @Override
+ public OFMetadata applyMask(OFMetadata mask) {
+ return OFMetadata.of(this.u64.applyMask(mask.u64));
+ }
+
+ @Override
+ public boolean equals(Object arg0) {
+ if (!(arg0 instanceof OFMetadata))
+ return false;
+ OFMetadata other = (OFMetadata)arg0;
+
+ return this.u64.equals(other.u64);
+ }
+
+ @Override
+ public int hashCode() {
+ int prime = 53;
+ return this.u64.hashCode() * prime;
+ }
+
+ @Override
+ public String toString() {
+ return "Metadata: " + u64.toString();
+ }
+
+ @Override
+ public int compareTo(OFMetadata o) {
+ return u64.compareTo(o.u64);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ u64.putTo(sink);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFPort.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFPort.java
new file mode 100644
index 0000000..155a9db
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFPort.java
@@ -0,0 +1,563 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.annotations.Immutable;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+/**
+ * Abstraction of an logical / OpenFlow switch port (ofp_port_no) in OpenFlow.
+ * Immutable. Note: Switch port numbers were changed in OpenFlow 1.1 from uint16
+ * to uint32. This class uses a 32 bit representation internally. Port numbers
+ * are converted from/to uint16 when constructed / getPortNumberasShort is
+ * called. If this port is not representable in OpenFlow 1.0, an
+ * IllegalStateException is raised.
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+@Immutable
+public class OFPort implements OFValueType<OFPort> {
+ static final int LENGTH = 4;
+
+ // private int constants (OF1.1+) to avoid duplication in the code
+ // should not have to use these outside this class
+ private static final int OFPP_ANY_INT = 0xFFffFFff;
+ private static final int OFPP_LOCAL_INT = 0xFFffFFfe;
+ private static final int OFPP_CONTROLLER_INT = 0xFFffFFfd;
+ private static final int OFPP_ALL_INT = 0xFFffFFfc;
+ private static final int OFPP_FLOOD_INT = 0xFFffFFfb;
+ private static final int OFPP_NORMAL_INT = 0xFFffFFfa;
+ private static final int OFPP_TABLE_INT = 0xFFffFFf9;
+ private static final int OFPP_MAX_INT = 0xFFffFF00;
+ private static final int OFPP_IN_PORT_INT = 0xFFffFFf8;
+
+ // private short constants (OF1.0) to avoid duplication in the code
+ // should not have to use these outside this class
+ private static final short OFPP_ANY_SHORT = (short) 0xFFff;
+ private static final short OFPP_LOCAL_SHORT = (short) 0xFFfe;
+ private static final short OFPP_CONTROLLER_SHORT = (short) 0xFFfd;
+ private static final short OFPP_ALL_SHORT = (short) 0xFFfc;
+ private static final short OFPP_FLOOD_SHORT = (short) 0xFFfb;
+ private static final short OFPP_NORMAL_SHORT = (short) 0xFFfa;
+ private static final short OFPP_TABLE_SHORT = (short) 0xFFf9;
+ private static final short OFPP_IN_PORT_SHORT = (short) 0xFFf8;
+ private static final short OFPP_MAX_SHORT = (short) 0xFF00;
+ private static final int OFPP_MAX_SHORT_UNSIGNED = 0xFF00;
+
+ // ////////////// public constants - use to access well known OpenFlow ports
+
+ /** Maximum number of physical and logical switch ports. */
+ public final static OFPort MAX = new NamedPort(OFPP_MAX_INT, "max");
+
+ /**
+ * Send the packet out the input port. This reserved port must be explicitly
+ * used in order to send back out of the input port.
+ */
+ public final static OFPort IN_PORT = new NamedPort(OFPP_IN_PORT_INT, "in_port");
+
+ /**
+ * Submit the packet to the first flow table NB: This destination port can
+ * only be used in packet-out messages.
+ */
+ public final static OFPort TABLE = new NamedPort(OFPP_TABLE_INT, "table");
+
+ /** Process with normal L2/L3 switching. */
+ public final static OFPort NORMAL = new NamedPort(OFPP_NORMAL_INT, "normal");
+
+ /**
+ * All physical ports in VLAN, except input port and those blocked or link
+ * down
+ */
+ public final static OFPort FLOOD = new NamedPort(OFPP_FLOOD_INT, "flood");
+
+ /** All physical ports except input port */
+ public final static OFPort ALL = new NamedPort(OFPP_ALL_INT, "all");
+
+ /** Send to controller */
+ public final static OFPort CONTROLLER =
+ new NamedPort(OFPP_CONTROLLER_INT, "controller");
+
+ /** local openflow "port" */
+ public final static OFPort LOCAL = new NamedPort(OFPP_LOCAL_INT, "local");
+
+ /**
+ * Wildcard port used only for flow mod (delete) and flow stats requests.
+ * Selects all flows regardless of output port (including flows with no
+ * output port). NOTE: OpenFlow 1.0 calls this 'NONE'
+ */
+ public final static OFPort ANY = new NamedPort(OFPP_ANY_INT, "any");
+ /** the wildcarded default for OpenFlow 1.0 (value: 0). Elsewhere in OpenFlow
+ * we need "ANY" as the default
+ */
+ public static final OFPort ZERO = OFPort.of(0);
+
+ public static final OFPort NO_MASK = OFPort.of(0xFFFFFFFF);
+ public static final OFPort FULL_MASK = ZERO;
+
+ /** cache of frequently used ports */
+ private static class PrecachedPort {
+ private final static OFPort p0 = new OFPort(0);
+ private final static OFPort p1 = new OFPort(1);
+ private final static OFPort p2 = new OFPort(2);
+ private final static OFPort p3 = new OFPort(3);
+ private final static OFPort p4 = new OFPort(4);
+ private final static OFPort p5 = new OFPort(5);
+ private final static OFPort p6 = new OFPort(6);
+ private final static OFPort p7 = new OFPort(7);
+ private final static OFPort p8 = new OFPort(8);
+ private final static OFPort p9 = new OFPort(9);
+ private final static OFPort p10 = new OFPort(10);
+ private final static OFPort p11 = new OFPort(11);
+ private final static OFPort p12 = new OFPort(12);
+ private final static OFPort p13 = new OFPort(13);
+ private final static OFPort p14 = new OFPort(14);
+ private final static OFPort p15 = new OFPort(15);
+ private final static OFPort p16 = new OFPort(16);
+ private final static OFPort p17 = new OFPort(17);
+ private final static OFPort p18 = new OFPort(18);
+ private final static OFPort p19 = new OFPort(19);
+ private final static OFPort p20 = new OFPort(20);
+ private final static OFPort p21 = new OFPort(21);
+ private final static OFPort p22 = new OFPort(22);
+ private final static OFPort p23 = new OFPort(23);
+ private final static OFPort p24 = new OFPort(24);
+ private final static OFPort p25 = new OFPort(25);
+ private final static OFPort p26 = new OFPort(26);
+ private final static OFPort p27 = new OFPort(27);
+ private final static OFPort p28 = new OFPort(28);
+ private final static OFPort p29 = new OFPort(29);
+ private final static OFPort p31 = new OFPort(31);
+ private final static OFPort p32 = new OFPort(32);
+ private final static OFPort p33 = new OFPort(33);
+ private final static OFPort p34 = new OFPort(34);
+ private final static OFPort p35 = new OFPort(35);
+ private final static OFPort p36 = new OFPort(36);
+ private final static OFPort p37 = new OFPort(37);
+ private final static OFPort p38 = new OFPort(38);
+ private final static OFPort p39 = new OFPort(39);
+ private final static OFPort p40 = new OFPort(40);
+ private final static OFPort p41 = new OFPort(41);
+ private final static OFPort p42 = new OFPort(42);
+ private final static OFPort p43 = new OFPort(43);
+ private final static OFPort p44 = new OFPort(44);
+ private final static OFPort p45 = new OFPort(45);
+ private final static OFPort p46 = new OFPort(46);
+ private final static OFPort p47 = new OFPort(47);
+ private final static OFPort p48 = new OFPort(48);
+ }
+
+ /** raw openflow port number as a signed 32 bit integer */
+ private final int portNumber;
+
+ /** private constructor. use of*-Factory methods instead */
+ private OFPort(final int portNumber) {
+ this.portNumber = portNumber;
+ }
+
+ /**
+ * get an OFPort object corresponding to a raw 32-bit integer port number.
+ * NOTE: The port object may either be newly allocated or cached. Do not
+ * rely on either behavior.
+ *
+ * @param portNumber
+ * @return a corresponding OFPort
+ */
+ public static OFPort ofInt(final int portNumber) {
+ switch (portNumber) {
+ case 0:
+ return PrecachedPort.p0;
+ case 1:
+ return PrecachedPort.p1;
+ case 2:
+ return PrecachedPort.p2;
+ case 3:
+ return PrecachedPort.p3;
+ case 4:
+ return PrecachedPort.p4;
+ case 5:
+ return PrecachedPort.p5;
+ case 6:
+ return PrecachedPort.p6;
+ case 7:
+ return PrecachedPort.p7;
+ case 8:
+ return PrecachedPort.p8;
+ case 9:
+ return PrecachedPort.p9;
+ case 10:
+ return PrecachedPort.p10;
+ case 11:
+ return PrecachedPort.p11;
+ case 12:
+ return PrecachedPort.p12;
+ case 13:
+ return PrecachedPort.p13;
+ case 14:
+ return PrecachedPort.p14;
+ case 15:
+ return PrecachedPort.p15;
+ case 16:
+ return PrecachedPort.p16;
+ case 17:
+ return PrecachedPort.p17;
+ case 18:
+ return PrecachedPort.p18;
+ case 19:
+ return PrecachedPort.p19;
+ case 20:
+ return PrecachedPort.p20;
+ case 21:
+ return PrecachedPort.p21;
+ case 22:
+ return PrecachedPort.p22;
+ case 23:
+ return PrecachedPort.p23;
+ case 24:
+ return PrecachedPort.p24;
+ case 25:
+ return PrecachedPort.p25;
+ case 26:
+ return PrecachedPort.p26;
+ case 27:
+ return PrecachedPort.p27;
+ case 28:
+ return PrecachedPort.p28;
+ case 29:
+ return PrecachedPort.p29;
+ case 31:
+ return PrecachedPort.p31;
+ case 32:
+ return PrecachedPort.p32;
+ case 33:
+ return PrecachedPort.p33;
+ case 34:
+ return PrecachedPort.p34;
+ case 35:
+ return PrecachedPort.p35;
+ case 36:
+ return PrecachedPort.p36;
+ case 37:
+ return PrecachedPort.p37;
+ case 38:
+ return PrecachedPort.p38;
+ case 39:
+ return PrecachedPort.p39;
+ case 40:
+ return PrecachedPort.p40;
+ case 41:
+ return PrecachedPort.p41;
+ case 42:
+ return PrecachedPort.p42;
+ case 43:
+ return PrecachedPort.p43;
+ case 44:
+ return PrecachedPort.p44;
+ case 45:
+ return PrecachedPort.p45;
+ case 46:
+ return PrecachedPort.p46;
+ case 47:
+ return PrecachedPort.p47;
+ case 48:
+ return PrecachedPort.p48;
+ case OFPP_MAX_INT:
+ return MAX;
+ case OFPP_IN_PORT_INT:
+ return IN_PORT;
+ case OFPP_TABLE_INT:
+ return TABLE;
+ case OFPP_NORMAL_INT:
+ return NORMAL;
+ case OFPP_FLOOD_INT:
+ return FLOOD;
+ case OFPP_ALL_INT:
+ return ALL;
+ case OFPP_CONTROLLER_INT:
+ return CONTROLLER;
+ case OFPP_LOCAL_INT:
+ return LOCAL;
+ case OFPP_ANY_INT:
+ return ANY;
+ default:
+ // note: This means effectively : portNumber > OFPP_MAX_SHORT
+ // accounting for
+ // signedness of both portNumber and OFPP_MAX_INT(which is
+ // -256).
+ // Any unsigned integer value > OFPP_MAX_INT will be ]-256:0[
+ // when read signed
+ if (portNumber < 0 && portNumber > OFPP_MAX_INT)
+ throw new IllegalArgumentException("Unknown special port number: "
+ + portNumber);
+ return new OFPort(portNumber);
+ }
+ }
+
+ /** convenience function: delegates to ofInt */
+ public static OFPort of(final int portNumber) {
+ return ofInt(portNumber);
+ }
+
+ /**
+ * get an OFPort object corresponding to a raw signed 16-bit integer port
+ * number (OF1.0). Note that the port returned will have the corresponding
+ * 32-bit integer value allocated as its port number. NOTE: The port object
+ * may either be newly allocated or cached. Do not rely on either behavior.
+ *
+ * @param portNumber
+ * @return a corresponding OFPort
+ */
+ public static OFPort ofShort(final short portNumber) {
+ switch (portNumber) {
+ case 0:
+ return PrecachedPort.p0;
+ case 1:
+ return PrecachedPort.p1;
+ case 2:
+ return PrecachedPort.p2;
+ case 3:
+ return PrecachedPort.p3;
+ case 4:
+ return PrecachedPort.p4;
+ case 5:
+ return PrecachedPort.p5;
+ case 6:
+ return PrecachedPort.p6;
+ case 7:
+ return PrecachedPort.p7;
+ case 8:
+ return PrecachedPort.p8;
+ case 9:
+ return PrecachedPort.p9;
+ case 10:
+ return PrecachedPort.p10;
+ case 11:
+ return PrecachedPort.p11;
+ case 12:
+ return PrecachedPort.p12;
+ case 13:
+ return PrecachedPort.p13;
+ case 14:
+ return PrecachedPort.p14;
+ case 15:
+ return PrecachedPort.p15;
+ case 16:
+ return PrecachedPort.p16;
+ case 17:
+ return PrecachedPort.p17;
+ case 18:
+ return PrecachedPort.p18;
+ case 19:
+ return PrecachedPort.p19;
+ case 20:
+ return PrecachedPort.p20;
+ case 21:
+ return PrecachedPort.p21;
+ case 22:
+ return PrecachedPort.p22;
+ case 23:
+ return PrecachedPort.p23;
+ case 24:
+ return PrecachedPort.p24;
+ case 25:
+ return PrecachedPort.p25;
+ case 26:
+ return PrecachedPort.p26;
+ case 27:
+ return PrecachedPort.p27;
+ case 28:
+ return PrecachedPort.p28;
+ case 29:
+ return PrecachedPort.p29;
+ case 31:
+ return PrecachedPort.p31;
+ case 32:
+ return PrecachedPort.p32;
+ case 33:
+ return PrecachedPort.p33;
+ case 34:
+ return PrecachedPort.p34;
+ case 35:
+ return PrecachedPort.p35;
+ case 36:
+ return PrecachedPort.p36;
+ case 37:
+ return PrecachedPort.p37;
+ case 38:
+ return PrecachedPort.p38;
+ case 39:
+ return PrecachedPort.p39;
+ case 40:
+ return PrecachedPort.p40;
+ case 41:
+ return PrecachedPort.p41;
+ case 42:
+ return PrecachedPort.p42;
+ case 43:
+ return PrecachedPort.p43;
+ case 44:
+ return PrecachedPort.p44;
+ case 45:
+ return PrecachedPort.p45;
+ case 46:
+ return PrecachedPort.p46;
+ case 47:
+ return PrecachedPort.p47;
+ case 48:
+ return PrecachedPort.p48;
+ case OFPP_MAX_SHORT:
+ return MAX;
+ case OFPP_IN_PORT_SHORT:
+ return IN_PORT;
+ case OFPP_TABLE_SHORT:
+ return TABLE;
+ case OFPP_NORMAL_SHORT:
+ return NORMAL;
+ case OFPP_FLOOD_SHORT:
+ return FLOOD;
+ case OFPP_ALL_SHORT:
+ return ALL;
+ case OFPP_CONTROLLER_SHORT:
+ return CONTROLLER;
+ case OFPP_LOCAL_SHORT:
+ return LOCAL;
+ case OFPP_ANY_SHORT:
+ return ANY;
+ default:
+ // note: This means effectively : portNumber > OFPP_MAX_SHORT
+ // accounting for
+ // signedness of both portNumber and OFPP_MAX_SHORT (which is
+ // -256).
+ // Any unsigned integer value > OFPP_MAX_SHORT will be ]-256:0[
+ // when read signed
+ if (portNumber < 0 && portNumber > OFPP_MAX_SHORT)
+ throw new IllegalArgumentException("Unknown special port number: "
+ + portNumber);
+ return new OFPort(portNumber);
+ }
+ }
+
+ /** return the port number as a int32 */
+ public int getPortNumber() {
+ return portNumber;
+ }
+
+ /**
+ * return the port number as int16. Special ports as defined by the OpenFlow
+ * spec will be converted to their OpenFlow 1.0 equivalent. port numbers >=
+ * FF00 will cause a IllegalArgumentException to be thrown
+ *
+ * @throws IllegalArgumentException
+ * if a regular port number exceeds the maximum value in OF1.0
+ **/
+ public short getShortPortNumber() {
+
+ switch (portNumber) {
+ case OFPP_MAX_INT:
+ return OFPP_MAX_SHORT;
+ case OFPP_IN_PORT_INT:
+ return OFPP_IN_PORT_SHORT;
+ case OFPP_TABLE_INT:
+ return OFPP_TABLE_SHORT;
+ case OFPP_NORMAL_INT:
+ return OFPP_NORMAL_SHORT;
+ case OFPP_FLOOD_INT:
+ return OFPP_FLOOD_SHORT;
+ case OFPP_ALL_INT:
+ return OFPP_ALL_SHORT;
+ case OFPP_CONTROLLER_INT:
+ return OFPP_CONTROLLER_SHORT;
+ case OFPP_LOCAL_INT:
+ return OFPP_LOCAL_SHORT;
+ case OFPP_ANY_INT:
+ return OFPP_ANY_SHORT;
+
+ default:
+ if (portNumber >= OFPP_MAX_SHORT_UNSIGNED || portNumber < 0)
+ throw new IllegalArgumentException("32bit Port number "
+ + U32.f(portNumber)
+ + " cannot be represented as uint16 (OF1.0)");
+
+ return (short) portNumber;
+ }
+ }
+
+ @Override
+ public String toString() {
+ return Long.toString(U32.f(portNumber));
+ }
+
+ /** Extension of OFPort for named ports */
+ static class NamedPort extends OFPort {
+ private final String name;
+
+ NamedPort(final int portNo, final String name) {
+ super(portNo);
+ this.name = name;
+ }
+
+ public String getName() {
+ return name;
+ }
+
+ @Override
+ public String toString() {
+ return name;
+ }
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof OFPort))
+ return false;
+ OFPort other = (OFPort)obj;
+ if (other.portNumber != this.portNumber)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 53;
+ int result = 1;
+ result = prime * result + portNumber;
+ return result;
+ }
+
+ public void write2Bytes(ChannelBuffer c) {
+ c.writeShort(this.portNumber);
+ }
+
+ public static OFPort read2Bytes(ChannelBuffer c) throws OFParseError {
+ return OFPort.ofShort(c.readShort());
+ }
+
+ public void write4Bytes(ChannelBuffer c) {
+ c.writeInt(this.portNumber);
+ }
+
+ public static OFPort read4Bytes(ChannelBuffer c) throws OFParseError {
+ return OFPort.of((int)(c.readUnsignedInt() & 0xFFFFFFFF));
+ }
+
+ @Override
+ public OFPort applyMask(OFPort mask) {
+ return OFPort.of(this.portNumber & mask.portNumber);
+ }
+
+ @Override
+ public int compareTo(OFPort o) {
+ return UnsignedInts.compare(this.portNumber, o.portNumber);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(portNumber);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFPortBitMap.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFPortBitMap.java
new file mode 100644
index 0000000..63b97f3
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFPortBitMap.java
@@ -0,0 +1,165 @@
+package org.projectfloodlight.openflow.types;
+
+import java.util.ArrayList;
+
+import javax.annotation.concurrent.Immutable;
+
+
+/** User-facing object representing a bitmap of ports that can be matched on.
+ * This is implemented by the custom BSN OXM type of_oxm_bsn_in_ports_182.
+ *
+ * You can call set() on the builder for all the Ports you want to match on
+ * and unset to exclude the port.
+ *
+ * <b>Implementation note:</b> to comply with the matching semantics of OXM (which is a logical "AND" not "OR")
+ * the underlying match uses a data format which is very unintuitive. The value is always
+ * 0, and the mask has the bits set for the ports that should <b>NOT</b> be included in the
+ * range.
+ *
+ * For the curious: We transformed the bitmap (a logical OR) problem into a logical
+ * AND NOT problem.
+ *
+ * We logically mean: Inport is 1 OR 3
+ * We technically say: Inport IS NOT 2 AND IS NOT 4 AND IS NOT 5 AND IS NOT ....
+ * The second term cannot be represented in OXM, the second can.
+ *
+ * That said, all that craziness is hidden from the user of this object.
+ *
+ * <h2>Usage</h2>
+ * OFPortBitmap is meant to be used with MatchField <tt>BSN_IN_PORTS_128</tt> in place
+ * of the raw type Masked<OFBitMask128>.
+ *
+ * <h3>Example:</h3>:
+ * <pre>
+ * OFPortBitMap portBitMap;
+ * Match.Builder matchBuilder;
+ * // initialize
+ * matchBuilder.setMasked(MatchField.BSN_IN_PORTS_128, portBitmap);
+ * </pre>
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+@Immutable
+public class OFPortBitMap extends Masked<OFBitMask128> {
+
+ private OFPortBitMap(OFBitMask128 mask) {
+ super(OFBitMask128.NONE, mask);
+ }
+
+ /** @return whether or not the given port is logically included in the
+ * match, i.e., whether a packet from in-port <emph>port</emph> be matched by
+ * this OXM.
+ */
+ public boolean isOn(OFPort port) {
+ // see the implementation note above about the logical inversion of the mask
+ return !(this.mask.isOn(port.getPortNumber()));
+ }
+
+ public static OFPortBitMap ofPorts(OFPort... ports) {
+ Builder builder = new Builder();
+ for (OFPort port: ports) {
+ builder.set(port);
+ }
+ return builder.build();
+ }
+
+ /** @return an OFPortBitmap based on the 'mask' part of an OFBitMask128, as, e.g., returned
+ * by the switch.
+ **/
+ public static OFPortBitMap of(OFBitMask128 mask) {
+ return new OFPortBitMap(mask);
+ }
+
+ /** @return iterating over all ports that are logically included in the
+ * match, i.e., whether a packet from in-port <emph>port</emph> be matched by
+ * this OXM.
+ */
+ public Iterable<OFPort> getOnPorts() {
+ ArrayList<OFPort> ports = new ArrayList<>();
+ for(int i=0; i < 127; i++) {
+ if(!(this.mask.isOn(i))) {
+ ports.add(OFPort.of(i));
+ }
+ }
+ return ports;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof OFPortBitMap))
+ return false;
+ OFPortBitMap other = (OFPortBitMap)obj;
+ return (other.value.equals(this.value) && other.mask.equals(this.mask));
+ }
+
+ @Override
+ public int hashCode() {
+ return 619 * mask.hashCode() + 257 * value.hashCode();
+ }
+
+ public static class Builder {
+ private long raw1 = -1, raw2 = -1;
+
+ public Builder() {
+
+ }
+
+ /** @return whether or not the given port is logically included in the
+ * match, i.e., whether a packet from in-port <emph>port</emph> be matched by
+ * this OXM.
+ */
+ public boolean isOn(OFPort port) {
+ // see the implementation note above about the logical inversion of the mask
+ return !(OFBitMask128.isBitOn(raw1, raw2, port.getPortNumber()));
+ }
+
+ /** remove this port from the match, i.e., packets from this in-port
+ * will NOT be matched.
+ */
+ public Builder unset(OFPort port) {
+ // see the implementation note above about the logical inversion of the mask
+ int bit = port.getPortNumber();
+ if (bit < 0 || bit > 127)
+ throw new IndexOutOfBoundsException("Port number is out of bounds");
+ else if (bit == 127)
+ // the highest order bit in the bitmask is reserved. The switch will
+ // set that bit for all ports >= 127. The reason is that we don't want
+ // the OFPortMap to match all ports out of its range (i.e., a packet
+ // coming in on port 181 would match *any* OFPortMap).
+ throw new IndexOutOfBoundsException("The highest order bit in the bitmask is reserved.");
+ else if (bit < 64) {
+ raw2 |= ((long)1 << bit);
+ } else {
+ raw1 |= ((long)1 << (bit - 64));
+ }
+ return this;
+ }
+
+ /** add this port from the match, i.e., packets from this in-port
+ * will NOT be matched.
+ */
+ public Builder set(OFPort port) {
+ // see the implementation note above about the logical inversion of the mask
+ int bit = port.getPortNumber();
+ if (bit < 0 || bit > 127)
+ throw new IndexOutOfBoundsException("Port number is out of bounds");
+ else if (bit == 127)
+ // the highest order bit in the bitmask is reserved. The switch will
+ // set that bit for all ports >= 127. The reason is that we don't want
+ // the OFPortMap to match all ports out of its range (i.e., a packet
+ // coming in on port 181 would match *any* OFPortMap).
+ throw new IndexOutOfBoundsException("The highest order bit in the bitmask is reserved.");
+ else if (bit < 64) {
+ raw2 &= ~((long)1 << bit);
+ } else {
+ raw1 &= ~((long)1 << (bit - 64));
+ }
+ return this;
+ }
+
+ public OFPortBitMap build() {
+ return new OFPortBitMap(OFBitMask128.of(raw1, raw2));
+ }
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFValueType.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFValueType.java
new file mode 100644
index 0000000..03e84dd
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFValueType.java
@@ -0,0 +1,11 @@
+package org.projectfloodlight.openflow.types;
+
+
+
+
+public interface OFValueType<T extends OFValueType<T>> extends Comparable<T>, PrimitiveSinkable {
+ public int getLength();
+
+ public T applyMask(T mask);
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFVlanVidMatch.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFVlanVidMatch.java
new file mode 100644
index 0000000..0a35926
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFVlanVidMatch.java
@@ -0,0 +1,204 @@
+package org.projectfloodlight.openflow.types;
+
+import java.util.Arrays;
+
+import javax.annotation.Nullable;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Shorts;
+
+/** Represents an OpenFlow Vlan VID for use in Matches, as specified by the OpenFlow 1.3 spec.
+ *
+ * <b> Note: this is not just the 12-bit vlan tag. OpenFlow defines
+ * the additional mask bits 0x1000 to represent the presence of a vlan
+ * tag. This additional bit will be stripped when writing a OF1.0 value
+ * tag.
+ * </b>
+ *
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ *
+ */
+public class OFVlanVidMatch implements OFValueType<OFVlanVidMatch> {
+ private static final Logger logger = LoggerFactory.getLogger(OFVlanVidMatch.class);
+
+ private static final short VALIDATION_MASK = 0x1FFF;
+ private static final short PRESENT_VAL = 0x1000;
+ private static final short VLAN_MASK = 0x0FFF;
+ private static final short NONE_VAL = 0x0000;
+ private static final short UNTAGGED_VAL_OF13 = (short) 0x0000;
+ private static final short UNTAGGED_VAL_OF10 = (short) 0xFFFF;
+ final static int LENGTH = 2;
+
+ /** presence of a VLAN tag is indicated by the presence of bit 0x1000 */
+ public static final OFVlanVidMatch PRESENT = new OFVlanVidMatch(PRESENT_VAL);
+
+ /** this value means 'not set' in OF1.0 (e.g., in a match). not used elsewhere */
+ public static final OFVlanVidMatch NONE = new OFVlanVidMatch(NONE_VAL);
+
+ /** for use with masking operations */
+ public static final OFVlanVidMatch NO_MASK = new OFVlanVidMatch((short)0xFFFF);
+ public static final OFVlanVidMatch FULL_MASK = NONE;
+
+ /** an untagged packet is specified as 0000 in OF 1.0, but 0xFFFF in OF1.0. Special case that. */
+ public static final OFVlanVidMatch UNTAGGED = new OFVlanVidMatch(NONE_VAL) {
+ @Override
+ public void write2BytesOF10(ChannelBuffer c) {
+ c.writeShort(UNTAGGED_VAL_OF10);
+ }
+ };
+
+ private final short vid;
+
+ private OFVlanVidMatch(short vid) {
+ this.vid = vid;
+ }
+
+ public static OFVlanVidMatch ofRawVid(short vid) {
+ if(vid == UNTAGGED_VAL_OF13)
+ return UNTAGGED;
+ else if(vid == PRESENT_VAL)
+ return PRESENT;
+ else if(vid == UNTAGGED_VAL_OF10) {
+ // workaround for IVS sometimes sending 0F1.0 untagged (0xFFFF) values
+ logger.warn("Warning: received OF1.0 untagged vlan value (0xFFFF) in OF1.3 VlanVid. Treating as UNTAGGED");
+ return UNTAGGED;
+ } else if ((vid & VALIDATION_MASK) != vid)
+ throw new IllegalArgumentException(String.format("Illegal VLAN value: %x", vid));
+ return new OFVlanVidMatch(vid);
+ }
+
+ public static OFVlanVidMatch ofVlanVid(VlanVid vid) {
+ if(vid == null)
+ return UNTAGGED;
+ else if(VlanVid.NO_MASK.equals(vid))
+ // NO_MASK is a special value in that it doesn't fit in the
+ // allowed value space (0x1FFF) of this type. Do a manual conversion
+ return NO_MASK;
+ else
+ return ofVlan(vid.getVlan());
+ }
+
+
+ public static OFVlanVidMatch ofVlan(int vlan) {
+ if( (vlan & VLAN_MASK) != vlan)
+ throw new IllegalArgumentException(String.format("Illegal VLAN value: %x", vlan));
+ return ofRawVid( (short) (vlan | PRESENT_VAL));
+ }
+
+ public static OFVlanVidMatch ofVlanOF10(short of10vlan) {
+ if(of10vlan == NONE_VAL) {
+ return NONE;
+ } else if(of10vlan == UNTAGGED_VAL_OF10) {
+ return UNTAGGED;
+ } else {
+ return ofVlan(of10vlan);
+ }
+ }
+
+ /** @return whether or not this VlanId has the present (0x1000) bit set */
+ public boolean isPresentBitSet() {
+ return (vid & PRESENT_VAL) != 0;
+ }
+
+ /** @return the actual VLAN tag this vid identifies */
+ public short getVlan() {
+ return (short) (vid & VLAN_MASK);
+ }
+
+ /** @return the actual vlan tag this vid identifies as a VlanVid object, if this
+ * VlanVidMatch has the present bit set (i.e., identifies a tagged VLAN).
+ * Else, returns null.
+ */
+ @Nullable
+ public VlanVid getVlanVid() {
+ if(this.equals(NO_MASK))
+ return VlanVid.NO_MASK;
+ else if(isPresentBitSet())
+ return VlanVid.ofVlan((short) (vid & VLAN_MASK));
+ else
+ return null;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof OFVlanVidMatch))
+ return false;
+ OFVlanVidMatch other = (OFVlanVidMatch)obj;
+ if (other.vid != this.vid)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ int prime = 13873;
+ return this.vid * prime;
+ }
+
+ @Override
+ public String toString() {
+ return "0x" + Integer.toHexString(vid);
+ }
+
+ public short getRawVid() {
+ return vid;
+ }
+
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+
+ private volatile byte[] bytesCache = null;
+
+ public byte[] getBytes() {
+ if (bytesCache == null) {
+ synchronized (this) {
+ if (bytesCache == null) {
+ bytesCache =
+ new byte[] { (byte) ((vid >>> 8) & 0xFF),
+ (byte) ((vid >>> 0) & 0xFF) };
+ }
+ }
+ }
+ return Arrays.copyOf(bytesCache, bytesCache.length);
+ }
+
+ public void write2Bytes(ChannelBuffer c) {
+ c.writeShort(this.vid);
+ }
+
+ public void write2BytesOF10(ChannelBuffer c) {
+ c.writeShort(this.getVlan());
+ }
+
+ public static OFVlanVidMatch read2Bytes(ChannelBuffer c) throws OFParseError {
+ return OFVlanVidMatch.ofRawVid(c.readShort());
+ }
+
+ public static OFVlanVidMatch read2BytesOF10(ChannelBuffer c) throws OFParseError {
+ return OFVlanVidMatch.ofVlanOF10(c.readShort());
+ }
+
+ @Override
+ public OFVlanVidMatch applyMask(OFVlanVidMatch mask) {
+ return OFVlanVidMatch.ofRawVid((short)(this.vid & mask.vid));
+ }
+
+ @Override
+ public int compareTo(OFVlanVidMatch o) {
+ return Shorts.compare(vid, o.vid);
+ }
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putShort(vid);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFVlanVidMatchWithMask.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFVlanVidMatchWithMask.java
new file mode 100644
index 0000000..c91c28c
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/OFVlanVidMatchWithMask.java
@@ -0,0 +1,10 @@
+package org.projectfloodlight.openflow.types;
+
+public class OFVlanVidMatchWithMask extends Masked<OFVlanVidMatch> {
+ private OFVlanVidMatchWithMask(OFVlanVidMatch value, OFVlanVidMatch mask) {
+ super(value, mask);
+ }
+
+ /* a combination of Vlan Vid and mask that matches any tagged packet */
+ public final static OFVlanVidMatchWithMask ANY_TAGGED = new OFVlanVidMatchWithMask(OFVlanVidMatch.PRESENT, OFVlanVidMatch.PRESENT);
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/PortSpeed.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/PortSpeed.java
new file mode 100644
index 0000000..6affab8
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/PortSpeed.java
@@ -0,0 +1,33 @@
+package org.projectfloodlight.openflow.types;
+
+/**
+ * Represents the speed of a port
+ */
+public enum PortSpeed {
+ /** no speed set */
+ SPEED_NONE(0),
+ SPEED_10MB(10),
+ SPEED_100MB(100),
+ SPEED_1GB(1_000),
+ SPEED_10GB(10_000),
+ SPEED_40GB(40_000),
+ SPEED_100GB(100_000),
+ SPEED_1TB(1_000_000);
+
+ private long speedInBps;
+ private PortSpeed(int speedInMbps) {
+ this.speedInBps = speedInMbps * 1000L*1000L;
+ }
+
+ public long getSpeedBps() {
+ return this.speedInBps;
+ }
+
+ public static PortSpeed max(PortSpeed s1, PortSpeed s2) {
+ return (s1.getSpeedBps() > s2.getSpeedBps()) ? s1 : s2;
+ }
+
+ public static PortSpeed min(PortSpeed s1, PortSpeed s2) {
+ return (s1.getSpeedBps() < s2.getSpeedBps()) ? s1 : s2;
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/PrimitiveSinkable.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/PrimitiveSinkable.java
new file mode 100644
index 0000000..e50cb75
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/PrimitiveSinkable.java
@@ -0,0 +1,7 @@
+package org.projectfloodlight.openflow.types;
+
+import com.google.common.hash.PrimitiveSink;
+
+public interface PrimitiveSinkable {
+ public void putTo(PrimitiveSink sink);
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/TableId.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/TableId.java
new file mode 100644
index 0000000..950087d
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/TableId.java
@@ -0,0 +1,100 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Shorts;
+
+public class TableId implements OFValueType<TableId>, Comparable<TableId> {
+
+ final static int LENGTH = 1;
+
+ private static final short VALIDATION_MASK = 0x00FF;
+
+ private static final short ALL_VAL = 0x00FF;
+ private static final short NONE_VAL = 0x0000;
+ public static final TableId NONE = new TableId(NONE_VAL);
+
+ public static final TableId ALL = new TableId(ALL_VAL);
+ public static final TableId ZERO = NONE;
+
+ private final short id;
+
+ private TableId(short id) {
+ this.id = id;
+ }
+
+ public static TableId of(short id) {
+ switch(id) {
+ case NONE_VAL:
+ return NONE;
+ case ALL_VAL:
+ return ALL;
+ default:
+ if ((id & VALIDATION_MASK) != id)
+ throw new IllegalArgumentException("Illegal Table id value: " + id);
+ return new TableId(id);
+ }
+ }
+
+ public static TableId of(int id) {
+ if((id & VALIDATION_MASK) != id)
+ throw new IllegalArgumentException("Illegal Table id value: "+id);
+ return of((short) id);
+ }
+
+ @Override
+ public String toString() {
+ return "0x" + Integer.toHexString(id);
+ }
+
+ public short getValue() {
+ return id;
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ public void writeByte(ChannelBuffer c) {
+ c.writeByte(this.id);
+ }
+
+ public static TableId readByte(ChannelBuffer c) throws OFParseError {
+ return TableId.of(c.readUnsignedByte());
+ }
+
+ @Override
+ public TableId applyMask(TableId mask) {
+ return TableId.of((short)(this.id & mask.id));
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof TableId))
+ return false;
+ TableId other = (TableId)obj;
+ if (other.id != this.id)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ int prime = 13873;
+ return this.id * prime;
+ }
+
+ @Override
+ public int compareTo(TableId other) {
+ return Shorts.compare(this.id, other.id);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putByte((byte) id);
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/TransportPort.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/TransportPort.java
new file mode 100644
index 0000000..6ab0254
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/TransportPort.java
@@ -0,0 +1,98 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Ints;
+
+/**
+ * Represents L4 (Transport Layer) port (TCP, UDP, etc.)
+ *
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ */
+public class TransportPort implements OFValueType<TransportPort> {
+
+ static final int LENGTH = 2;
+ static final int MAX_PORT = 0xFFFF;
+ static final int MIN_PORT = 0;
+
+ private final static int NONE_VAL = 0;
+ public final static TransportPort NONE = new TransportPort(NONE_VAL);
+
+ public static final TransportPort NO_MASK = new TransportPort(0xFFFFFFFF);
+ public static final TransportPort FULL_MASK = TransportPort.of(0x0);
+
+ private final int port;
+
+ private TransportPort(int port) {
+ this.port = port;
+ }
+
+ public static TransportPort of(int port) {
+ if(port == NONE_VAL)
+ return NONE;
+ else if (port == NO_MASK.port)
+ return NO_MASK;
+ else if (port < MIN_PORT || port > MAX_PORT) {
+ throw new IllegalArgumentException("Illegal transport layer port number: " + port);
+ }
+ return new TransportPort(port);
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ public int getPort() {
+ return port;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof TransportPort))
+ return false;
+ TransportPort other = (TransportPort)obj;
+ if (other.port != this.port)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 59;
+ int result = 1;
+ result = prime * result + port;
+ return result;
+ }
+
+ @Override
+ public String toString() {
+ return Integer.toString(port);
+ }
+
+ public void write2Bytes(ChannelBuffer c) {
+ c.writeShort(this.port);
+ }
+
+ public static TransportPort read2Bytes(ChannelBuffer c) throws OFParseError {
+ return TransportPort.of((c.readUnsignedShort() & 0x0FFFF));
+ }
+
+ @Override
+ public TransportPort applyMask(TransportPort mask) {
+ return TransportPort.of(this.port & mask.port);
+ }
+
+ @Override
+ public int compareTo(TransportPort o) {
+ return Ints.compare(port, o.port);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putShort((short) port);
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/U128.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/U128.java
new file mode 100644
index 0000000..35ef846
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/U128.java
@@ -0,0 +1,137 @@
+package org.projectfloodlight.openflow.types;
+
+import javax.annotation.Nonnull;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedLongs;
+
+public class U128 implements OFValueType<U128>, HashValue<U128> {
+
+ static final int LENGTH = 16;
+
+ private final long raw1; // MSBs
+ private final long raw2; // LSBs
+
+ public static final U128 ZERO = new U128(0, 0);
+
+ private U128(long raw1, long raw2) {
+ this.raw1 = raw1;
+ this.raw2 = raw2;
+ }
+
+ public static U128 of(long raw1, long raw2) {
+ if (raw1 == 0 && raw2 == 0)
+ return ZERO;
+ return new U128(raw1, raw2);
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+
+ public long getMsb() {
+ return raw1;
+ }
+
+ public long getLsb() {
+ return raw2;
+ }
+
+ @Override
+ public U128 applyMask(U128 mask) {
+ return and(mask);
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + (int) (raw1 ^ (raw1 >>> 32));
+ result = prime * result + (int) (raw2 ^ (raw2 >>> 32));
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ U128 other = (U128) obj;
+ if (raw1 != other.raw1)
+ return false;
+ if (raw2 != other.raw2)
+ return false;
+ return true;
+ }
+
+ public void write16Bytes(ChannelBuffer cb) {
+ cb.writeLong(raw1);
+ cb.writeLong(raw2);
+ }
+
+ public static U128 read16Bytes(ChannelBuffer cb) {
+ long raw1 = cb.readLong();
+ long raw2 = cb.readLong();
+ return of(raw1, raw2);
+ }
+
+ @Override
+ public String toString() {
+ return String.format("0x%016x%016x", raw1, raw2);
+ }
+
+ @Override
+ public int compareTo(@Nonnull U128 o) {
+ int msb = UnsignedLongs.compare(this.raw1, o.raw1);
+ if(msb != 0)
+ return msb;
+ else
+ return UnsignedLongs.compare(this.raw2, o.raw2);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putLong(raw1);
+ sink.putLong(raw2);
+ }
+
+ @Override
+ public U128 inverse() {
+ return U128.of(~raw1, ~raw2);
+ }
+
+ @Override
+ public U128 or(U128 other) {
+ return U128.of(raw1 | other.raw1, raw2 | other.raw2);
+ }
+
+ @Override
+ public U128 and(U128 other) {
+ return U128.of(raw1 & other.raw1, raw2 & other.raw2);
+ }
+
+ @Override
+ public U128 xor(U128 other) {
+ return U128.of(raw1 ^ other.raw1, raw2 ^ other.raw2);
+ }
+
+ @Override
+ public int prefixBits(int numBits) {
+ return HashValueUtils.prefixBits(this.raw1, numBits);
+ }
+
+ @Override
+ public U128 combineWithValue(U128 value, int keyBits) {
+ return U128.of(
+ HashValueUtils.combineWithValue(this.raw1, value.raw1, Math.min(64, keyBits)),
+ HashValueUtils.combineWithValue(this.raw2, value.raw2, Math.max(0,keyBits-64))
+ );
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/U16.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/U16.java
new file mode 100644
index 0000000..2466ffc
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/U16.java
@@ -0,0 +1,130 @@
+/**
+ * Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ * University
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License"); you may
+ * not use this file except in compliance with the License. You may obtain
+ * a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations
+ * under the License.
+ **/
+
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Ints;
+
+public class U16 implements Writeable, OFValueType<U16> {
+ private final static short ZERO_VAL = 0;
+ public final static U16 ZERO = new U16(ZERO_VAL);
+
+ private static final short NO_MASK_VAL = (short)0xFFff;
+ public final static U16 NO_MASK = new U16(NO_MASK_VAL);
+ public static final U16 FULL_MASK = ZERO;
+
+ public static int f(final short i) {
+ return i & 0xffff;
+ }
+
+ public static short t(final int l) {
+ return (short) l;
+ }
+
+ private final short raw;
+
+ private U16(short raw) {
+ this.raw = raw;
+ }
+
+ public static final U16 of(int value) {
+ return ofRaw(t(value));
+ }
+
+ public static final U16 ofRaw(short raw) {
+ if(raw == ZERO_VAL)
+ return ZERO;
+ return new U16(raw);
+ }
+
+ public int getValue() {
+ return f(raw);
+ }
+
+ public short getRaw() {
+ return raw;
+ }
+
+ @Override
+ public String toString() {
+ return String.format("0x%04x", raw);
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + raw;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ U16 other = (U16) obj;
+ if (raw != other.raw)
+ return false;
+ return true;
+ }
+
+
+ @Override
+ public void writeTo(ChannelBuffer bb) {
+ bb.writeShort(raw);
+ }
+
+
+ public final static Reader READER = new Reader();
+
+ private static class Reader implements OFMessageReader<U16> {
+ @Override
+ public U16 readFrom(ChannelBuffer bb) throws OFParseError {
+ return ofRaw(bb.readShort());
+ }
+ }
+
+ @Override
+ public int getLength() {
+ return 2;
+ }
+
+ @Override
+ public U16 applyMask(U16 mask) {
+ return ofRaw( (short) (raw & mask.raw));
+ }
+
+ @Override
+ public int compareTo(U16 o) {
+ return Ints.compare(f(raw), f(o.raw));
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putShort(raw);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/U32.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/U32.java
new file mode 100644
index 0000000..c69786c
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/U32.java
@@ -0,0 +1,130 @@
+/**
+ * Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ * University
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License"); you may
+ * not use this file except in compliance with the License. You may obtain
+ * a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations
+ * under the License.
+ **/
+
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+public class U32 implements Writeable, OFValueType<U32> {
+ private final static int ZERO_VAL = 0;
+ public final static U32 ZERO = new U32(ZERO_VAL);
+
+ private static final int NO_MASK_VAL = 0xFFffFFff;
+ public final static U32 NO_MASK = new U32(NO_MASK_VAL);
+ public static final U32 FULL_MASK = ZERO;
+
+ private final int raw;
+
+ private U32(int raw) {
+ this.raw = raw;
+ }
+
+ public static U32 of(long value) {
+ return ofRaw(U32.t(value));
+ }
+
+ public static U32 ofRaw(int raw) {
+ if(raw == ZERO_VAL)
+ return ZERO;
+ if(raw == NO_MASK_VAL)
+ return NO_MASK;
+ return new U32(raw);
+ }
+
+ public long getValue() {
+ return f(raw);
+ }
+
+ public int getRaw() {
+ return raw;
+ }
+
+ @Override
+ public String toString() {
+ return String.format("0x%08x", raw);
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + raw;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ U32 other = (U32) obj;
+ if (raw != other.raw)
+ return false;
+
+ return true;
+ }
+
+ public static long f(final int i) {
+ return i & 0xffffffffL;
+ }
+
+ public static int t(final long l) {
+ return (int) l;
+ }
+
+ @Override
+ public void writeTo(ChannelBuffer bb) {
+ bb.writeInt(raw);
+ }
+
+ public final static Reader READER = new Reader();
+
+ private static class Reader implements OFMessageReader<U32> {
+ @Override
+ public U32 readFrom(ChannelBuffer bb) throws OFParseError {
+ return new U32(bb.readInt());
+ }
+ }
+
+ @Override
+ public int getLength() {
+ return 4;
+ }
+
+ @Override
+ public U32 applyMask(U32 mask) {
+ return ofRaw(raw & mask.raw);
+ }
+
+ @Override
+ public int compareTo(U32 o) {
+ return UnsignedInts.compare(raw, o.raw);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(raw);
+ }}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/U64.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/U64.java
new file mode 100644
index 0000000..1353b42
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/U64.java
@@ -0,0 +1,178 @@
+/**
+ * Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ * University
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License"); you may
+ * not use this file except in compliance with the License. You may obtain
+ * a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations
+ * under the License.
+ **/
+
+package org.projectfloodlight.openflow.types;
+
+import java.math.BigInteger;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedLongs;
+
+public class U64 implements Writeable, OFValueType<U64>, HashValue<U64> {
+ private static final long UNSIGNED_MASK = 0x7fffffffffffffffL;
+ private final static long ZERO_VAL = 0;
+ public final static U64 ZERO = new U64(ZERO_VAL);
+
+ private static final long NO_MASK_VAL = 0xFFffFFffFFffFFffL;
+ public final static U64 NO_MASK = new U64(NO_MASK_VAL);
+ public static final U64 FULL_MASK = ZERO;
+
+ private final long raw;
+
+ protected U64(final long raw) {
+ this.raw = raw;
+ }
+
+ public static U64 of(long raw) {
+ return ofRaw(raw);
+ }
+
+ public static U64 ofRaw(final long raw) {
+ if(raw == ZERO_VAL)
+ return ZERO;
+ return new U64(raw);
+ }
+
+ public static U64 parseHex(String hex) {
+ return new U64(new BigInteger(hex, 16).longValue());
+ }
+
+ public long getValue() {
+ return raw;
+ }
+
+ public BigInteger getBigInteger() {
+ BigInteger bigInt = BigInteger.valueOf(raw & UNSIGNED_MASK);
+ if (raw < 0) {
+ bigInt = bigInt.setBit(Long.SIZE - 1);
+ }
+ return bigInt;
+ }
+
+ @Override
+ public String toString() {
+ return String.format("0x%016x", raw);
+ }
+
+ public static BigInteger f(final long value) {
+ BigInteger bigInt = BigInteger.valueOf(value & UNSIGNED_MASK);
+ if (value < 0) {
+ bigInt = bigInt.setBit(Long.SIZE - 1);
+ }
+ return bigInt;
+ }
+
+ public static long t(final BigInteger l) {
+ return l.longValue();
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + (int) (raw ^ (raw >>> 32));
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ U64 other = (U64) obj;
+ if (raw != other.raw)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int getLength() {
+ return 8;
+ }
+
+ @Override
+ public U64 applyMask(U64 mask) {
+ return and(mask);
+ }
+
+ @Override
+ public void writeTo(ChannelBuffer bb) {
+ bb.writeLong(raw);
+ }
+
+ @Override
+ public int compareTo(U64 o) {
+ return UnsignedLongs.compare(raw, o.raw);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putLong(raw);
+ }
+
+ @Override
+ public U64 inverse() {
+ return U64.of(~raw);
+ }
+
+ @Override
+ public U64 or(U64 other) {
+ return U64.of(raw | other.raw);
+ }
+
+ @Override
+ public U64 and(U64 other) {
+ return ofRaw(raw & other.raw);
+ }
+ @Override
+ public U64 xor(U64 other) {
+ return U64.of(raw ^ other.raw);
+ }
+
+ /** return the "numBits" highest-order bits of the hash.
+ * @param numBits number of higest-order bits to return [0-32].
+ * @return a numberic value of the 0-32 highest-order bits.
+ */
+ @Override
+ public int prefixBits(int numBits) {
+ return HashValueUtils.prefixBits(raw, numBits);
+ }
+
+ @Override
+ public U64 combineWithValue(U64 value, int keyBits) {
+ return U64.of(HashValueUtils.combineWithValue(this.raw, value.raw, keyBits));
+ }
+
+ public final static Reader READER = new Reader();
+
+ private static class Reader implements OFMessageReader<U64> {
+ @Override
+ public U64 readFrom(ChannelBuffer bb) throws OFParseError {
+ return U64.ofRaw(bb.readLong());
+ }
+ }
+
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/U8.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/U8.java
new file mode 100644
index 0000000..17191af
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/U8.java
@@ -0,0 +1,133 @@
+/**
+ * Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ * University
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License"); you may
+ * not use this file except in compliance with the License. You may obtain
+ * a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations
+ * under the License.
+ **/
+
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedBytes;
+
+public class U8 implements Writeable, OFValueType<U8> {
+ private final static byte ZERO_VAL = 0;
+ public final static U8 ZERO = new U8(ZERO_VAL);
+
+ private static final byte NO_MASK_VAL = (byte) 0xFF;
+ public static final U8 NO_MASK = new U8(NO_MASK_VAL);
+ public static final U8 FULL_MASK = ZERO;
+
+ private final byte raw;
+
+ private U8(byte raw) {
+ this.raw = raw;
+ }
+
+ public static final U8 of(short value) {
+ if(value == ZERO_VAL)
+ return ZERO;
+ if(value == NO_MASK_VAL)
+ return NO_MASK;
+
+ return new U8(t(value));
+ }
+
+ public static final U8 ofRaw(byte value) {
+ return new U8(value);
+ }
+
+ public short getValue() {
+ return f(raw);
+ }
+
+ public byte getRaw() {
+ return raw;
+ }
+
+ @Override
+ public String toString() {
+ return String.format("0x%02x", raw);
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + raw;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ U8 other = (U8) obj;
+ if (raw != other.raw)
+ return false;
+ return true;
+ }
+
+
+ @Override
+ public void writeTo(ChannelBuffer bb) {
+ bb.writeByte(raw);
+ }
+
+ public static short f(final byte i) {
+ return (short) (i & 0xff);
+ }
+
+ public static byte t(final short l) {
+ return (byte) l;
+ }
+
+
+ public final static Reader READER = new Reader();
+
+ private static class Reader implements OFMessageReader<U8> {
+ @Override
+ public U8 readFrom(ChannelBuffer bb) throws OFParseError {
+ return new U8(bb.readByte());
+ }
+ }
+
+ @Override
+ public int getLength() {
+ return 1;
+ }
+
+ @Override
+ public U8 applyMask(U8 mask) {
+ return ofRaw( (byte) (raw & mask.raw));
+ }
+
+ @Override
+ public int compareTo(U8 o) {
+ return UnsignedBytes.compare(raw, o.raw);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putByte(raw);
+ }
+ }
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/UDF.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/UDF.java
new file mode 100644
index 0000000..e537c20
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/UDF.java
@@ -0,0 +1,85 @@
+package org.projectfloodlight.openflow.types;
+
+import javax.annotation.concurrent.Immutable;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+@Immutable
+public class UDF implements OFValueType<UDF> {
+ static final int LENGTH = 4;
+ private final int rawValue;
+
+ public static final UDF ZERO = UDF.of(0x0);
+ public static final UDF NO_MASK = UDF.of(0xFFFFFFFF);
+ public static final UDF FULL_MASK = UDF.of(0x00000000);
+
+ private UDF(final int rawValue) {
+ this.rawValue = rawValue;
+ }
+
+ public static UDF of(final int raw) {
+ return new UDF(raw);
+ }
+
+ public int getInt() {
+ return rawValue;
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + rawValue;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ UDF other = (UDF) obj;
+ if (rawValue != other.rawValue)
+ return false;
+ return true;
+ }
+
+ @Override
+ public String toString() {
+ return Integer.toString(rawValue);
+ }
+
+ public void write4Bytes(ChannelBuffer c) {
+ c.writeInt(rawValue);
+ }
+
+ public static UDF read4Bytes(ChannelBuffer c) {
+ return UDF.of(c.readInt());
+ }
+
+ @Override
+ public UDF applyMask(UDF mask) {
+ return UDF.of(this.rawValue & mask.rawValue);
+ }
+
+ @Override
+ public int compareTo(UDF o) {
+ return UnsignedInts.compare(rawValue, o.rawValue);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(rawValue);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/VRF.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/VRF.java
new file mode 100644
index 0000000..b742da5
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/VRF.java
@@ -0,0 +1,85 @@
+package org.projectfloodlight.openflow.types;
+
+import javax.annotation.concurrent.Immutable;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedInts;
+
+@Immutable
+public class VRF implements OFValueType<VRF> {
+ static final int LENGTH = 4;
+ private final int rawValue;
+
+ public static final VRF ZERO = VRF.of(0x0);
+ public static final VRF NO_MASK = VRF.of(0xFFFFFFFF);
+ public static final VRF FULL_MASK = VRF.of(0x00000000);
+
+ private VRF(final int rawValue) {
+ this.rawValue = rawValue;
+ }
+
+ public static VRF of(final int raw) {
+ return new VRF(raw);
+ }
+
+ public int getInt() {
+ return rawValue;
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ @Override
+ public int hashCode() {
+ final int prime = 31;
+ int result = 1;
+ result = prime * result + rawValue;
+ return result;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (this == obj)
+ return true;
+ if (obj == null)
+ return false;
+ if (getClass() != obj.getClass())
+ return false;
+ VRF other = (VRF) obj;
+ if (rawValue != other.rawValue)
+ return false;
+ return true;
+ }
+
+ @Override
+ public String toString() {
+ return Integer.toString(rawValue);
+ }
+
+ public void write4Bytes(ChannelBuffer c) {
+ c.writeInt(rawValue);
+ }
+
+ public static VRF read4Bytes(ChannelBuffer c) {
+ return VRF.of(c.readInt());
+ }
+
+ @Override
+ public VRF applyMask(VRF mask) {
+ return VRF.of(this.rawValue & mask.rawValue);
+ }
+
+ @Override
+ public int compareTo(VRF o) {
+ return UnsignedInts.compare(rawValue, o.rawValue);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putInt(rawValue);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/VlanPcp.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/VlanPcp.java
new file mode 100644
index 0000000..cbb7004
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/VlanPcp.java
@@ -0,0 +1,82 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.UnsignedBytes;
+
+public class VlanPcp implements OFValueType<VlanPcp> {
+
+ private static final byte VALIDATION_MASK = 0x07;
+ private static final byte NONE_VAL = 0x00;
+ static final int LENGTH = 1;
+
+ private final byte pcp;
+
+ public static final VlanPcp NONE = new VlanPcp(NONE_VAL);
+ public static final VlanPcp NO_MASK = new VlanPcp((byte)0xFF);
+ public static final VlanPcp FULL_MASK = VlanPcp.of((byte)0x0);
+
+ private VlanPcp(byte pcp) {
+ this.pcp = pcp;
+ }
+
+ public static VlanPcp of(byte pcp) {
+ if ((pcp & VALIDATION_MASK) != pcp)
+ throw new IllegalArgumentException("Illegal VLAN PCP value: " + pcp);
+ return new VlanPcp(pcp);
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof VlanPcp))
+ return false;
+ VlanPcp other = (VlanPcp)obj;
+ if (other.pcp != this.pcp)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ int prime = 20173;
+ return this.pcp * prime;
+ }
+
+ @Override
+ public String toString() {
+ return "0x" + Integer.toHexString(pcp);
+ }
+
+ public byte getValue() {
+ return pcp;
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ public void writeByte(ChannelBuffer c) {
+ c.writeByte(this.pcp);
+ }
+
+ public static VlanPcp readByte(ChannelBuffer c) throws OFParseError {
+ return VlanPcp.of((byte)(c.readUnsignedByte() & 0xFF));
+ }
+
+ @Override
+ public VlanPcp applyMask(VlanPcp mask) {
+ return VlanPcp.of((byte)(this.pcp & mask.pcp));
+ }
+
+ @Override
+ public int compareTo(VlanPcp o) {
+ return UnsignedBytes.compare(pcp, o.pcp);
+ }
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putByte(pcp);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/types/VlanVid.java b/of/lib/src/main/java/org/projectfloodlight/openflow/types/VlanVid.java
new file mode 100644
index 0000000..ee605de
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/types/VlanVid.java
@@ -0,0 +1,115 @@
+package org.projectfloodlight.openflow.types;
+
+import java.util.Arrays;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+import com.google.common.hash.PrimitiveSink;
+import com.google.common.primitives.Shorts;
+
+/** Represents an 802.1Q Vlan VID (12 bits).
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ *
+ */
+public class VlanVid implements OFValueType<VlanVid> {
+
+ private static final short VALIDATION_MASK = 0x0FFF;
+ private static final short ZERO_VAL = 0x0000;
+ final static int LENGTH = 2;
+
+ /** this value means 'not set' in OF1.0 (e.g., in a match). not used elsewhere */
+ public static final VlanVid ZERO = new VlanVid(ZERO_VAL);
+
+ /** for use with masking operations */
+ public static final VlanVid NO_MASK = new VlanVid((short)0xFFFF);
+ public static final VlanVid FULL_MASK = ZERO;
+
+ private final short vid;
+
+ private VlanVid(short vid) {
+ this.vid = vid;
+ }
+
+ public static VlanVid ofVlan(int vid) {
+ if (vid == NO_MASK.vid)
+ return NO_MASK;
+ if ((vid & VALIDATION_MASK) != vid)
+ throw new IllegalArgumentException(String.format("Illegal VLAN value: %x", vid));
+ return new VlanVid((short) vid);
+ }
+
+ /** @return the actual VLAN tag this vid identifies */
+ public short getVlan() {
+ return vid;
+ }
+
+ @Override
+ public boolean equals(Object obj) {
+ if (!(obj instanceof VlanVid))
+ return false;
+ VlanVid other = (VlanVid)obj;
+ if (other.vid != this.vid)
+ return false;
+ return true;
+ }
+
+ @Override
+ public int hashCode() {
+ int prime = 13873;
+ return this.vid * prime;
+ }
+
+ @Override
+ public String toString() {
+ return "0x" + Integer.toHexString(vid);
+ }
+
+ @Override
+ public int getLength() {
+ return LENGTH;
+ }
+
+ private volatile byte[] bytesCache = null;
+
+ public byte[] getBytes() {
+ if (bytesCache == null) {
+ synchronized (this) {
+ if (bytesCache == null) {
+ bytesCache =
+ new byte[] { (byte) ((vid >>> 8) & 0xFF),
+ (byte) ((vid >>> 0) & 0xFF) };
+ }
+ }
+ }
+ return Arrays.copyOf(bytesCache, bytesCache.length);
+ }
+
+ public void write2Bytes(ChannelBuffer c) {
+ c.writeShort(this.vid);
+ }
+
+ public void write2BytesOF10(ChannelBuffer c) {
+ c.writeShort(this.getVlan());
+ }
+
+ public static VlanVid read2Bytes(ChannelBuffer c) throws OFParseError {
+ return VlanVid.ofVlan(c.readShort());
+ }
+
+ @Override
+ public VlanVid applyMask(VlanVid mask) {
+ return VlanVid.ofVlan((short)(this.vid & mask.vid));
+ }
+
+ @Override
+ public int compareTo(VlanVid o) {
+ return Shorts.compare(vid, o.vid);
+ }
+
+ @Override
+ public void putTo(PrimitiveSink sink) {
+ sink.putShort(vid);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/util/ActionUtils.java b/of/lib/src/main/java/org/projectfloodlight/openflow/util/ActionUtils.java
new file mode 100644
index 0000000..e0553a9
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/util/ActionUtils.java
@@ -0,0 +1,43 @@
+package org.projectfloodlight.openflow.util;
+
+import java.util.List;
+
+import org.projectfloodlight.openflow.protocol.OFFlowMod;
+import org.projectfloodlight.openflow.protocol.OFFlowStatsEntry;
+import org.projectfloodlight.openflow.protocol.OFInstructionType;
+import org.projectfloodlight.openflow.protocol.OFVersion;
+import org.projectfloodlight.openflow.protocol.action.OFAction;
+import org.projectfloodlight.openflow.protocol.instruction.OFInstruction;
+import org.projectfloodlight.openflow.protocol.instruction.OFInstructionApplyActions;
+
+import com.google.common.collect.ImmutableList;
+
+public class ActionUtils {
+ private ActionUtils() {}
+
+ public static List<OFAction> getActions(OFFlowStatsEntry e) {
+ if(e.getVersion() == OFVersion.OF_10) {
+ return e.getActions();
+ } else {
+ for(OFInstruction i: e.getInstructions()) {
+ if(i.getType() == OFInstructionType.APPLY_ACTIONS) {
+ return ((OFInstructionApplyActions) i).getActions();
+ }
+ }
+ return ImmutableList.of();
+ }
+ }
+
+ public static List<OFAction> getActions(OFFlowMod e) {
+ if(e.getVersion() == OFVersion.OF_10) {
+ return e.getActions();
+ } else {
+ for(OFInstruction i: e.getInstructions()) {
+ if(i.getType() == OFInstructionType.APPLY_ACTIONS) {
+ return ((OFInstructionApplyActions) i).getActions();
+ }
+ }
+ return ImmutableList.of();
+ }
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/util/ChannelUtils.java b/of/lib/src/main/java/org/projectfloodlight/openflow/util/ChannelUtils.java
new file mode 100644
index 0000000..1a1ac6a
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/util/ChannelUtils.java
@@ -0,0 +1,80 @@
+package org.projectfloodlight.openflow.util;
+
+import java.util.List;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import com.google.common.base.Charsets;
+import com.google.common.collect.ImmutableList;
+import com.google.common.collect.ImmutableList.Builder;
+
+/**
+ * Collection of helper functions for reading and writing into ChannelBuffers
+ *
+ * @author capveg
+ */
+
+public class ChannelUtils {
+ private static final Logger logger = LoggerFactory.getLogger(ChannelUtils.class);
+ public static String readFixedLengthString(ChannelBuffer bb, int length) {
+ byte[] dst = new byte[length];
+ bb.readBytes(dst, 0, length);
+ int validLength = 0;
+ for (validLength = 0; validLength < length; validLength++) {
+ if (dst[validLength] == 0)
+ break;
+ }
+ return new String(dst, 0, validLength, Charsets.US_ASCII);
+ }
+
+ public static void writeFixedLengthString(ChannelBuffer bb, String string,
+ int length) {
+ int l = string.length();
+ if (l > length) {
+ throw new IllegalArgumentException("Error writing string: length="
+ + l + " > max Length=" + length);
+ }
+ bb.writeBytes(string.getBytes(Charsets.US_ASCII));
+ if (l < length) {
+ bb.writeZero(length - l);
+ }
+ }
+
+ static public byte[] readBytes(final ChannelBuffer bb, final int length) {
+ byte byteArray[] = new byte[length];
+ bb.readBytes(byteArray);
+ return byteArray;
+ }
+
+ static public void writeBytes(final ChannelBuffer bb,
+ final byte byteArray[]) {
+ bb.writeBytes(byteArray);
+ }
+
+ public static <T> List<T> readList(ChannelBuffer bb, int length, OFMessageReader<T> reader) throws OFParseError {
+ int end = bb.readerIndex() + length;
+ Builder<T> builder = ImmutableList.<T>builder();
+ if(logger.isTraceEnabled())
+ logger.trace("readList(length={}, reader={})", length, reader.getClass());
+ while(bb.readerIndex() < end) {
+ T read = reader.readFrom(bb);
+ if(logger.isTraceEnabled())
+ logger.trace("readList: read={}, left={}", read, end - bb.readerIndex());
+ builder.add(read);
+ }
+ if(bb.readerIndex() != end) {
+ throw new IllegalStateException("Overread length: length="+length + " overread by "+ (bb.readerIndex() - end) + " reader: "+reader);
+ }
+ return builder.build();
+ }
+
+ public static void writeList(ChannelBuffer bb, List<? extends Writeable> writeables) {
+ for(Writeable w: writeables)
+ w.writeTo(bb);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/util/FunnelUtils.java b/of/lib/src/main/java/org/projectfloodlight/openflow/util/FunnelUtils.java
new file mode 100644
index 0000000..f62d7f9
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/util/FunnelUtils.java
@@ -0,0 +1,14 @@
+package org.projectfloodlight.openflow.util;
+
+import java.util.List;
+
+import org.projectfloodlight.openflow.types.PrimitiveSinkable;
+
+import com.google.common.hash.PrimitiveSink;
+
+public class FunnelUtils {
+ public static void putList(List<? extends PrimitiveSinkable> sinkables, PrimitiveSink sink) {
+ for(PrimitiveSinkable p: sinkables)
+ p.putTo(sink);
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/util/HexString.java b/of/lib/src/main/java/org/projectfloodlight/openflow/util/HexString.java
new file mode 100644
index 0000000..bcc46f7
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/util/HexString.java
@@ -0,0 +1,100 @@
+/**
+ * Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ * University
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License"); you may
+ * not use this file except in compliance with the License. You may obtain
+ * a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations
+ * under the License.
+ **/
+
+package org.projectfloodlight.openflow.util;
+
+import org.projectfloodlight.openflow.types.U8;
+
+public class HexString {
+ /**
+ * Convert a string of bytes to a ':' separated hex string
+ *
+ * @param bytes
+ * @return "0f:ca:fe:de:ad:be:ef"
+ */
+ public static String toHexString(final byte[] bytes) {
+ int i;
+ String ret = "";
+ String tmp;
+ for (i = 0; i < bytes.length; i++) {
+ if (i > 0)
+ ret += ":";
+ tmp = Integer.toHexString(U8.f(bytes[i]));
+ if (tmp.length() == 1)
+ ret += "0";
+ ret += tmp;
+ }
+ return ret;
+ }
+
+ public static String toHexString(final long val, final int padTo) {
+ char arr[] = Long.toHexString(val).toCharArray();
+ String ret = "";
+ // prepend the right number of leading zeros
+ int i = 0;
+ for (; i < (padTo * 2 - arr.length); i++) {
+ ret += "0";
+ if ((i % 2) != 0)
+ ret += ":";
+ }
+ for (int j = 0; j < arr.length; j++) {
+ ret += arr[j];
+ if ((((i + j) % 2) != 0) && (j < (arr.length - 1)))
+ ret += ":";
+ }
+ return ret;
+ }
+
+ public static String toHexString(final long val) {
+ return toHexString(val, 8);
+ }
+
+ /**
+ * Convert a string of hex values into a string of bytes
+ *
+ * @param values
+ * "0f:ca:fe:de:ad:be:ef"
+ * @return [15, 5 ,2, 5, 17]
+ * @throws NumberFormatException
+ * If the string can not be parsed
+ */
+ public static byte[] fromHexString(final String values) throws NumberFormatException {
+ String[] octets = values.split(":");
+ byte[] ret = new byte[octets.length];
+
+ for (int i = 0; i < octets.length; i++) {
+ if (octets[i].length() > 2)
+ throw new NumberFormatException("Invalid octet length");
+ ret[i] = Integer.valueOf(octets[i], 16).byteValue();
+ }
+ return ret;
+ }
+
+ public static long toLong(String value) throws NumberFormatException {
+ String[] octets = value.split(":");
+ if (octets.length > 8)
+ throw new NumberFormatException("Input string is too big to fit in long: " + value);
+ long l = 0;
+ for (String octet: octets) {
+ if (octet.length() > 2)
+ throw new NumberFormatException("Each colon-separated byte component must consist of 1 or 2 hex digits: " + value);
+ short s = Short.parseShort(octet, 16);
+ l = (l << 8) + s;
+ }
+ return l;
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/util/LRULinkedHashMap.java b/of/lib/src/main/java/org/projectfloodlight/openflow/util/LRULinkedHashMap.java
new file mode 100644
index 0000000..7798e67
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/util/LRULinkedHashMap.java
@@ -0,0 +1,42 @@
+/**
+ * Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ * University
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License"); you may
+ * not use this file except in compliance with the License. You may obtain
+ * a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations
+ * under the License.
+ **/
+
+package org.projectfloodlight.openflow.util;
+
+import java.util.LinkedHashMap;
+
+public class LRULinkedHashMap<K, V> extends LinkedHashMap<K, V> {
+ private static final long serialVersionUID = -2964986094089626647L;
+ protected int maximumCapacity;
+
+ public LRULinkedHashMap(final int initialCapacity, final int maximumCapacity) {
+ super(initialCapacity, 0.75f, true);
+ this.maximumCapacity = maximumCapacity;
+ }
+
+ public LRULinkedHashMap(final int maximumCapacity) {
+ super(16, 0.75f, true);
+ this.maximumCapacity = maximumCapacity;
+ }
+
+ @Override
+ protected boolean removeEldestEntry(final java.util.Map.Entry<K, V> eldest) {
+ if (this.size() > maximumCapacity)
+ return true;
+ return false;
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/util/LengthCountingPseudoChannelBuffer.java b/of/lib/src/main/java/org/projectfloodlight/openflow/util/LengthCountingPseudoChannelBuffer.java
new file mode 100644
index 0000000..48362da
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/util/LengthCountingPseudoChannelBuffer.java
@@ -0,0 +1,673 @@
+package org.projectfloodlight.openflow.util;
+
+import java.io.IOException;
+import java.io.InputStream;
+import java.io.OutputStream;
+import java.nio.ByteBuffer;
+import java.nio.ByteOrder;
+import java.nio.channels.GatheringByteChannel;
+import java.nio.channels.ScatteringByteChannel;
+import java.nio.charset.Charset;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.jboss.netty.buffer.ChannelBufferFactory;
+import org.jboss.netty.buffer.ChannelBufferIndexFinder;
+
+public class LengthCountingPseudoChannelBuffer implements ChannelBuffer {
+
+ int writerIndex = 0;
+ private int markedWriterIndex;
+
+ @Override
+ public ChannelBufferFactory factory() {
+ return null;
+ }
+
+ @Override
+ public int capacity() {
+ return Integer.MAX_VALUE;
+ }
+
+ @Override
+ public ByteOrder order() {
+ return ByteOrder.BIG_ENDIAN;
+ }
+
+ @Override
+ public boolean isDirect() {
+ return true;
+ }
+
+ @Override
+ public int readerIndex() {
+ return 0;
+ }
+
+ @Override
+ public void readerIndex(int readerIndex) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int writerIndex() {
+ return writerIndex;
+ }
+
+ @Override
+ public void writerIndex(int writerIndex) {
+ this.writerIndex = writerIndex;
+ }
+
+ @Override
+ public void setIndex(int readerIndex, int writerIndex) {
+ if(readerIndex != 0)
+ throw new UnsupportedOperationException();
+ this.writerIndex = writerIndex;
+ }
+
+ @Override
+ public int readableBytes() {
+ return writerIndex;
+ }
+
+ @Override
+ public int writableBytes() {
+ return Integer.MAX_VALUE - writerIndex;
+ }
+
+ @Override
+ public boolean readable() {
+ return writerIndex > 0;
+ }
+
+ @Override
+ public boolean writable() {
+ return writerIndex < Integer.MAX_VALUE;
+ }
+
+ @Override
+ public void clear() {
+ writerIndex = 0;
+
+ }
+
+ @Override
+ public void markReaderIndex() {
+ }
+
+ @Override
+ public void resetReaderIndex() {
+ }
+
+ @Override
+ public void markWriterIndex() {
+ markedWriterIndex = writerIndex;
+ }
+
+ @Override
+ public void resetWriterIndex() {
+ writerIndex = markedWriterIndex;
+ }
+
+ @Override
+ public void discardReadBytes() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void ensureWritableBytes(int writableBytes) {
+ if(!((Integer.MAX_VALUE - writableBytes) > writerIndex))
+ throw new IllegalStateException();
+ }
+
+ @Override
+ public byte getByte(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public short getUnsignedByte(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public short getShort(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int getUnsignedShort(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int getMedium(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int getUnsignedMedium(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int getInt(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public long getUnsignedInt(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public long getLong(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public char getChar(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public float getFloat(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public double getDouble(int index) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void getBytes(int index, ChannelBuffer dst) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void getBytes(int index, ChannelBuffer dst, int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void getBytes(int index, ChannelBuffer dst, int dstIndex, int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void getBytes(int index, byte[] dst) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void getBytes(int index, byte[] dst, int dstIndex, int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void getBytes(int index, ByteBuffer dst) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void getBytes(int index, OutputStream out, int length)
+ throws IOException {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int getBytes(int index, GatheringByteChannel out, int length)
+ throws IOException {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void setByte(int index, int value) {
+ }
+
+ @Override
+ public void setShort(int index, int value) {
+ }
+
+ @Override
+ public void setMedium(int index, int value) {
+ }
+
+ @Override
+ public void setInt(int index, int value) {
+ }
+
+ @Override
+ public void setLong(int index, long value) {
+ }
+
+ @Override
+ public void setChar(int index, int value) {
+ }
+
+ @Override
+ public void setFloat(int index, float value) {
+ }
+
+ @Override
+ public void setDouble(int index, double value) {
+ }
+
+ @Override
+ public void setBytes(int index, ChannelBuffer src) {
+ }
+
+ @Override
+ public void setBytes(int index, ChannelBuffer src, int length) {
+ }
+
+ @Override
+ public void setBytes(int index, ChannelBuffer src, int srcIndex, int length) {
+ }
+
+ @Override
+ public void setBytes(int index, byte[] src) {
+ }
+
+ @Override
+ public void setBytes(int index, byte[] src, int srcIndex, int length) {
+ }
+
+ @Override
+ public void setBytes(int index, ByteBuffer src) {
+
+ }
+
+ @Override
+ public int setBytes(int index, InputStream in, int length)
+ throws IOException {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int setBytes(int index, ScatteringByteChannel in, int length)
+ throws IOException {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void setZero(int index, int length) {
+ }
+
+ @Override
+ public byte readByte() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public short readUnsignedByte() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public short readShort() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int readUnsignedShort() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int readMedium() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int readUnsignedMedium() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int readInt() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public long readUnsignedInt() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public long readLong() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public char readChar() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public float readFloat() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public double readDouble() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ChannelBuffer readBytes(int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ @Deprecated
+ public ChannelBuffer readBytes(ChannelBufferIndexFinder indexFinder) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ChannelBuffer readSlice(int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ @Deprecated
+ public
+ ChannelBuffer readSlice(ChannelBufferIndexFinder indexFinder) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void readBytes(ChannelBuffer dst) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void readBytes(ChannelBuffer dst, int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void readBytes(ChannelBuffer dst, int dstIndex, int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void readBytes(byte[] dst) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void readBytes(byte[] dst, int dstIndex, int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void readBytes(ByteBuffer dst) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void readBytes(OutputStream out, int length) throws IOException {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int readBytes(GatheringByteChannel out, int length)
+ throws IOException {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void skipBytes(int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ @Deprecated
+ public int skipBytes(ChannelBufferIndexFinder indexFinder) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public void writeByte(int value) {
+ writerIndex++;
+ }
+
+ @Override
+ public void writeShort(int value) {
+ writerIndex += 2;
+}
+
+@Override
+public void writeMedium(int value) {
+ writerIndex += 3;
+}
+
+@Override
+public void writeInt(int value) {
+ writerIndex += 4;
+}
+
+@Override
+public void writeLong(long value) {
+ writerIndex += 8;
+}
+
+
+ @Override
+ public void writeChar(int value) {
+ writeShort(value);
+ }
+
+ @Override
+ public void writeFloat(float value) {
+ writeInt(Float.floatToIntBits(value));
+ }
+
+ @Override
+ public void writeDouble(double value) {
+ writeLong(Double.doubleToLongBits(value));
+
+ }
+
+ @Override
+ public void writeBytes(ChannelBuffer src) {
+ writerIndex += src.readableBytes();
+
+ }
+
+ @Override
+ public void writeBytes(ChannelBuffer src, int length) {
+ writerIndex += src.readableBytes();
+
+ }
+
+ @Override
+ public void writeBytes(ChannelBuffer src, int srcIndex, int length) {
+ writerIndex += length;
+ }
+
+ @Override
+ public void writeBytes(byte[] src) {
+ writerIndex += src.length;
+
+ }
+
+ @Override
+ public void writeBytes(byte[] src, int srcIndex, int length) {
+ writerIndex += length;
+ }
+
+ @Override
+ public void writeBytes(ByteBuffer src) {
+ writerIndex += src.remaining();
+
+ }
+
+ @Override
+ public int writeBytes(InputStream in, int length) throws IOException {
+ writerIndex += length;
+ return length;
+ }
+
+ @Override
+ public int writeBytes(ScatteringByteChannel in, int length)
+ throws IOException {
+ writerIndex += length;
+ return length;
+ }
+
+ @Override
+ public void writeZero(int length) {
+ writerIndex += length;
+
+ }
+
+ @Override
+ public int indexOf(int fromIndex, int toIndex, byte value) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int indexOf(int fromIndex, int toIndex,
+ ChannelBufferIndexFinder indexFinder) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int bytesBefore(byte value) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int bytesBefore(ChannelBufferIndexFinder indexFinder) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int bytesBefore(int length, byte value) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int bytesBefore(int length, ChannelBufferIndexFinder indexFinder) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int bytesBefore(int index, int length, byte value) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int bytesBefore(int index, int length,
+ ChannelBufferIndexFinder indexFinder) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ChannelBuffer copy() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ChannelBuffer copy(int index, int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ChannelBuffer slice() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ChannelBuffer slice(int index, int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ChannelBuffer duplicate() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ByteBuffer toByteBuffer() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ByteBuffer toByteBuffer(int index, int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ByteBuffer[] toByteBuffers() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public ByteBuffer[] toByteBuffers(int index, int length) {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public boolean hasArray() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public byte[] array() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public int arrayOffset() {
+ throw new UnsupportedOperationException();
+ }
+
+ @Override
+ public String toString(Charset charset) {
+ return "LengthCountingPseudoChannelBuffer(length="+writerIndex+")";
+ }
+
+ @Override
+ public String toString(int index, int length, Charset charset) {
+ return toString();
+ }
+
+ @Override
+ @Deprecated
+ public String toString(String charsetName) {
+ return toString();
+ }
+
+ @Override
+ @Deprecated
+ public String toString(String charsetName,
+ ChannelBufferIndexFinder terminatorFinder) {
+ return toString();
+ }
+
+ @Override
+ @Deprecated
+ public String toString(int index, int length, String charsetName) {
+ return toString();
+ }
+
+ @Override
+ @Deprecated
+ public
+ String toString(int index, int length, String charsetName,
+ ChannelBufferIndexFinder terminatorFinder) {
+ return toString();
+ }
+
+ @Override
+ public int compareTo(ChannelBuffer buffer) {
+ throw new UnsupportedOperationException();
+
+ }
+
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/util/MultiplePktInReasonUtil.java b/of/lib/src/main/java/org/projectfloodlight/openflow/util/MultiplePktInReasonUtil.java
new file mode 100644
index 0000000..a919f62
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/util/MultiplePktInReasonUtil.java
@@ -0,0 +1,46 @@
+package org.projectfloodlight.openflow.util;
+
+import java.util.Set;
+
+import com.google.common.collect.ImmutableSet;
+
+import org.projectfloodlight.openflow.types.U64;
+import org.projectfloodlight.openflow.protocol.OFBsnPktinFlag;
+import org.projectfloodlight.openflow.protocol.OFPacketIn;
+import org.projectfloodlight.openflow.protocol.OFVersion;
+import org.projectfloodlight.openflow.protocol.match.MatchField;
+import org.projectfloodlight.openflow.protocol.match.Match;
+import org.projectfloodlight.openflow.protocol.ver13.OFBsnPktinFlagSerializerVer13;
+import org.projectfloodlight.openflow.types.OFMetadata;
+
+
+public class MultiplePktInReasonUtil {
+ private MultiplePktInReasonUtil() {}
+
+ /**
+ * This function is used in BVS T5/6 to decode the multiple packet in
+ * reasons in Match.MetaData field.
+ * */
+ public static Set<OFBsnPktinFlag> getOFBsnPktinFlags(OFPacketIn pktIn) {
+ if(pktIn.getVersion() != OFVersion.OF_13) {
+ throw new IllegalArgumentException("multiple pkt in reasons are "
+ + "only supported by BVS using "
+ + "openflow 1.3");
+ }
+
+ Match match = pktIn.getMatch();
+ if(match == null) {
+ return ImmutableSet.<OFBsnPktinFlag>of();
+ }
+ OFMetadata metaData = match.get(MatchField.METADATA);
+ if(metaData == null) {
+ return ImmutableSet.<OFBsnPktinFlag>of();
+ }
+ U64 metaDataValue = metaData.getValue();
+ if(metaDataValue == null) {
+ return ImmutableSet.<OFBsnPktinFlag>of();
+ }
+ return OFBsnPktinFlagSerializerVer13.ofWireValue(metaDataValue
+ .getValue());
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/util/PrimitiveSinkUtils.java b/of/lib/src/main/java/org/projectfloodlight/openflow/util/PrimitiveSinkUtils.java
new file mode 100644
index 0000000..28eb3a4
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/util/PrimitiveSinkUtils.java
@@ -0,0 +1,75 @@
+package org.projectfloodlight.openflow.util;
+
+import java.util.List;
+import java.util.SortedSet;
+
+import javax.annotation.Nullable;
+
+import org.projectfloodlight.openflow.types.PrimitiveSinkable;
+
+import com.google.common.hash.PrimitiveSink;
+
+/** Utility methods for dumping collections into primitive sinks.
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+public class PrimitiveSinkUtils {
+ private PrimitiveSinkUtils() {}
+
+ /** puts a nullable String into a primitive sink. The entry is prepended by a 'presence'
+ * boolean bit and the string length;
+ *
+ *
+ * @param sink the sink to put the object
+ * @param nullableObj the potentially null string to put in the sink
+ */
+ public static void putNullableStringTo(PrimitiveSink sink,
+ @Nullable CharSequence nullableChars) {
+
+ sink.putBoolean(nullableChars != null);
+ if(nullableChars != null) {
+ sink.putInt(nullableChars.length());
+ sink.putUnencodedChars(nullableChars);
+ }
+ }
+
+ /** puts a nullable element into a primitive sink. The entry is prepended by a 'present' bit.
+ *
+ * @param sink the sink to put the object
+ * @param nullableObj the nullable object
+ */
+ public static void putNullableTo(PrimitiveSink sink,
+ @Nullable PrimitiveSinkable nullableObj) {
+ sink.putBoolean(nullableObj != null);
+ if(nullableObj != null)
+ nullableObj.putTo(sink);
+ }
+
+ /** puts the elements of a sorted set into the {@link PrimitiveSink}. Does not support null
+ * elements. The elements are assumed to be self-delimitating.
+ *
+ * @param sink
+ * @param set
+ */
+ public static void putSortedSetTo(PrimitiveSink sink,
+ SortedSet<? extends PrimitiveSinkable> set) {
+ sink.putInt(set.size());
+ for(PrimitiveSinkable e: set) {
+ e.putTo(sink);
+ }
+ }
+
+ /** puts the elements of a list into the {@link PrimitiveSink}. Does not support null
+ * elements. The elements are assumed to be self-delimitating.
+ *
+ * @param sink
+ * @param set
+ */
+ public static void putListTo(PrimitiveSink sink,
+ List<? extends PrimitiveSinkable> set) {
+ sink.putInt(set.size());
+ for(PrimitiveSinkable e: set) {
+ e.putTo(sink);
+ }
+ }
+}
diff --git a/of/lib/src/main/java/org/projectfloodlight/openflow/util/StringByteSerializer.java b/of/lib/src/main/java/org/projectfloodlight/openflow/util/StringByteSerializer.java
new file mode 100644
index 0000000..6949fb2
--- /dev/null
+++ b/of/lib/src/main/java/org/projectfloodlight/openflow/util/StringByteSerializer.java
@@ -0,0 +1,58 @@
+/**
+ * Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ * University
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License"); you may
+ * not use this file except in compliance with the License. You may obtain
+ * a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations
+ * under the License.
+ **/
+
+package org.projectfloodlight.openflow.util;
+
+import java.io.UnsupportedEncodingException;
+import java.nio.charset.Charset;
+import java.util.Arrays;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+public class StringByteSerializer {
+ public static String readFrom(final ChannelBuffer data, final int length) {
+ byte[] stringBytes = new byte[length];
+ data.readBytes(stringBytes);
+ // find the first index of 0
+ int index = 0;
+ for (byte b : stringBytes) {
+ if (0 == b)
+ break;
+ ++index;
+ }
+ return new String(Arrays.copyOf(stringBytes, index), Charset.forName("ascii"));
+ }
+
+ public static void writeTo(final ChannelBuffer data, final int length,
+ final String value) {
+ try {
+ byte[] name = value.getBytes("ASCII");
+ if (name.length < length) {
+ data.writeBytes(name);
+ for (int i = name.length; i < length; ++i) {
+ data.writeByte((byte) 0);
+ }
+ } else {
+ data.writeBytes(name, 0, length - 1);
+ data.writeByte((byte) 0);
+ }
+ } catch (UnsupportedEncodingException e) {
+ throw new RuntimeException(e);
+ }
+
+ }
+}