[ONOS-5058][ONOS-4796][ONOS-4893]compiler annotation implementation + defect fix

Change-Id: Ie317409d9ab1d36e626433558b2d51f26daaac82
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/ResolvableType.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/ResolvableType.java
index 1be5cac..c97faa4 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/ResolvableType.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/ResolvableType.java
@@ -54,5 +54,10 @@
     /**
      * Identifies the augment.
      */
-    YANG_AUGMENT
+    YANG_AUGMENT,
+
+    /**
+     * Identifies the compiler annotations.
+     */
+    YANG_COMPILER_ANNOTATION
 }
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangAppDataStructure.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangAppDataStructure.java
index 80ea6c6..d987ad4 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangAppDataStructure.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangAppDataStructure.java
@@ -16,6 +16,7 @@
 
 package org.onosproject.yangutils.datamodel;
 
+import java.io.Serializable;
 import java.util.LinkedList;
 import java.util.List;
 import org.onosproject.yangutils.datamodel.exceptions.DataModelException;
@@ -25,7 +26,10 @@
 /**
  * Represents data model node to maintain information defined in YANG app-data-structure.
  */
-public class YangAppDataStructure implements Parsable {
+public class YangAppDataStructure
+        implements Parsable, Serializable {
+
+    private static final long serialVersionUID = 806201602L;
 
     /**
      * Data structure information.
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangAppExtendedName.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangAppExtended.java
similarity index 93%
rename from datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangAppExtendedName.java
rename to datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangAppExtended.java
index 2ab743e..5423361 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangAppExtendedName.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangAppExtended.java
@@ -16,6 +16,8 @@
 
 package org.onosproject.yangutils.datamodel;
 
+import java.io.Serializable;
+
 import org.onosproject.yangutils.datamodel.exceptions.DataModelException;
 import org.onosproject.yangutils.datamodel.utils.Parsable;
 import org.onosproject.yangutils.datamodel.utils.YangConstructType;
@@ -23,8 +25,10 @@
 /**
  * Represents data model node to maintain information defined in YANG extended name.
  */
-public class YangAppExtendedName implements Parsable {
+public class YangAppExtended
+        implements Parsable, Serializable {
 
+    private static final long serialVersionUID = 806201602L;
     /**
      * App extended name information.
      */
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangCompilerAnnotation.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangCompilerAnnotation.java
index 4d0c2ce..4099f47 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangCompilerAnnotation.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangCompilerAnnotation.java
@@ -16,14 +16,21 @@
 
 package org.onosproject.yangutils.datamodel;
 
+import java.io.Serializable;
+import java.util.LinkedList;
+import java.util.List;
 import org.onosproject.yangutils.datamodel.exceptions.DataModelException;
 import org.onosproject.yangutils.datamodel.utils.Parsable;
+import org.onosproject.yangutils.datamodel.utils.ResolvableStatus;
 import org.onosproject.yangutils.datamodel.utils.YangConstructType;
 
 /**
  * Represents data model node to maintain information defined in YANG compiler-annotation.
  */
-public class YangCompilerAnnotation implements Parsable {
+public class YangCompilerAnnotation
+        implements Parsable, YangXPathResolver, Resolvable, Serializable {
+
+    private static final long serialVersionUID = 806201602L;
 
     /**
      * App data structure information.
@@ -33,7 +40,7 @@
     /**
      * App extended name information.
      */
-    private YangAppExtendedName yangAppExtendedName;
+    private YangAppExtended yangAppExtended;
 
     /**
      * Prefix of compiler-annotation.
@@ -46,6 +53,16 @@
     private String path;
 
     /**
+     * Path of compiler-annotation.
+     */
+    List<YangAtomicPath> atomicPathList = new LinkedList<>();
+
+    /**
+     * Resolution status.
+     */
+    private ResolvableStatus resolvableStatus;
+
+    /**
      * Returns the YANG app data structure information.
      *
      * @return the YANG app data structure information
@@ -104,8 +121,8 @@
      *
      * @return the YANG app extended name information
      */
-    public YangAppExtendedName getYangAppExtendedName() {
-        return yangAppExtendedName;
+    public YangAppExtended getYangAppExtendedName() {
+        return yangAppExtended;
     }
 
     /**
@@ -113,8 +130,26 @@
      *
      * @param yangAppExtendedName the YANG app extended name to set
      */
-    public void setYangAppExtendedName(YangAppExtendedName yangAppExtendedName) {
-        this.yangAppExtendedName = yangAppExtendedName;
+    public void setYangAppExtendedName(YangAppExtended yangAppExtendedName) {
+        this.yangAppExtended = yangAppExtendedName;
+    }
+
+    /**
+     * Returns the list of atomic path.
+     *
+     * @return the list of atomic path
+     */
+    public List<YangAtomicPath> getAtomicPathList() {
+        return atomicPathList;
+    }
+
+    /**
+     * Sets the atomic path.
+     *
+     * @param atomicPathList the atomic path list to set
+     */
+    public void setAtomicPathList(List<YangAtomicPath> atomicPathList) {
+        this.atomicPathList = atomicPathList;
     }
 
     @Override
@@ -131,4 +166,20 @@
     public void validateDataOnExit() throws DataModelException {
         // TODO : to be implemented
     }
+
+    @Override
+    public ResolvableStatus getResolvableStatus() {
+        return resolvableStatus;
+    }
+
+    @Override
+    public void setResolvableStatus(ResolvableStatus resolvableStatus) {
+        this.resolvableStatus = resolvableStatus;
+    }
+
+    @Override
+    public Object resolve()
+            throws DataModelException {
+        return null;
+    }
 }
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangDataStructure.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangDataStructure.java
index 785d460..609f4ee 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangDataStructure.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangDataStructure.java
@@ -21,7 +21,7 @@
  */
 public enum YangDataStructure {
 
-    MAP,
+    QUEUE,
 
     LIST,
 
@@ -33,7 +33,7 @@
      * @param name data structure name from YANG file.
      * @return YANG data structure for corresponding data structure name.
      */
-    public static YangDataStructure getType(String name) {
+    public static YangDataStructure getDataStructureType(String name) {
         name = name.replace("\"", "");
         for (YangDataStructure dataStructure : values()) {
             if (dataStructure.name().toLowerCase().equals(name)) {
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangDerivedInfo.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangDerivedInfo.java
index dee1c98..863d03c 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangDerivedInfo.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangDerivedInfo.java
@@ -386,9 +386,8 @@
      */
     public ResolvableStatus resolveTypeDerivedInfo(YangType<?> baseType)
             throws DataModelException {
-        /*
-         * Check whether the referred typedef is resolved.
-         */
+
+        //Check whether the referred typedef is resolved.
         if (baseType.getResolvableStatus() != INTRA_FILE_RESOLVED && baseType.getResolvableStatus() != RESOLVED) {
             throw new DataModelException("Linker Error: Referred typedef is not resolved for type.");
         }
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangLeafRef.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangLeafRef.java
index 104d701..e29a84f 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangLeafRef.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangLeafRef.java
@@ -379,9 +379,8 @@
 
             if (baseType.getDataType() == YangDataTypes.LEAFREF) {
                 YangLeafRef referredLeafRefInfo = (YangLeafRef) (yangLeaf.getDataType().getDataTypeExtendedInfo());
-                /*
-                 * Check whether the referred typedef is resolved.
-                 */
+
+                //Check whether the referred typedef is resolved.
                 if (referredLeafRefInfo.getResolvableStatus() != INTRA_FILE_RESOLVED
                         && referredLeafRefInfo.getResolvableStatus() != RESOLVED) {
                     throw new DataModelException("Linker Error: Referred typedef is not resolved for type.");
@@ -406,9 +405,8 @@
                 }
                 setEffectiveDataType(referredLeafRefInfo.getEffectiveDataType());
             } else if (baseType.getDataType() == YangDataTypes.DERIVED) {
-                /*
-                 * Check whether the referred typedef is resolved.
-                 */
+
+                // Check whether the referred typedef is resolved.
                 if (baseType.getResolvableStatus() != INTRA_FILE_RESOLVED
                         && baseType.getResolvableStatus() != RESOLVED) {
                     throw new DataModelException("Linker Error: Referred typedef is not resolved for type.");
@@ -441,9 +439,8 @@
 
             if (baseType.getDataType() == YangDataTypes.LEAFREF) {
                 YangLeafRef referredLeafRefInfo = (YangLeafRef) yangLeafList.getDataType().getDataTypeExtendedInfo();
-                /*
-                 * Check whether the referred typedef is resolved.
-                 */
+
+                //Check whether the referred typedef is resolved.
                 if (referredLeafRefInfo.getResolvableStatus() != INTRA_FILE_RESOLVED
                         && referredLeafRefInfo.getResolvableStatus() != RESOLVED) {
                     throw new DataModelException("Linker Error: Referred typedef is not resolved for type.");
@@ -468,9 +465,8 @@
                 }
                 setEffectiveDataType(referredLeafRefInfo.getEffectiveDataType());
             } else if (baseType.getDataType() == YangDataTypes.DERIVED) {
-                /*
-                 * Check whether the referred typedef is resolved.
-                 */
+
+                //Check whether the referred typedef is resolved.
                 if (baseType.getResolvableStatus() != INTRA_FILE_RESOLVED
                         && baseType.getResolvableStatus() != RESOLVED) {
                     throw new DataModelException("Linker Error: Referred typedef is not resolved for type.");
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangList.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangList.java
index e2bd8b5..9571c90 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangList.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangList.java
@@ -165,20 +165,20 @@
 
     /**
      * Reference RFC 6020.
-     * <p>
+     *
      * The "min-elements" statement, which is optional, takes as an argument a
      * non-negative integer that puts a constraint on valid list entries. A
      * valid leaf-list or list MUST have at least min-elements entries.
-     * <p>
+     *
      * If no "min-elements" statement is present, it defaults to zero.
-     * <p>
+     *
      * The behavior of the constraint depends on the type of the leaf-list's or
      * list's closest ancestor node in the schema tree that is not a non-
      * presence container:
-     * <p>
+     *
      * o If this ancestor is a case node, the constraint is enforced if any
      * other node from the case exists.
-     * <p>
+     *
      * o Otherwise, it is enforced if the ancestor node exists.
      */
     private YangMinElement minElements;
@@ -209,6 +209,11 @@
     private List<YangIfFeature> ifFeatureList;
 
     /**
+     * Compiler Annotation.
+     */
+    private transient YangCompilerAnnotation compilerAnnotation;
+
+    /**
      * Creates a YANG list object.
      */
     public YangList() {
@@ -218,6 +223,24 @@
     }
 
     /**
+     * Returns the compiler annotation.
+     *
+     * @return the compiler annotation
+     */
+    public YangCompilerAnnotation getCompilerAnnotation() {
+        return compilerAnnotation;
+    }
+
+    /**
+     * Sets the compiler annotation.
+     *
+     * @param compilerAnnotation the compiler annotation to set
+     */
+    public void setCompilerAnnotation(YangCompilerAnnotation compilerAnnotation) {
+        this.compilerAnnotation = compilerAnnotation;
+    }
+
+    /**
      * Returns the when.
      *
      * @return the when
@@ -549,7 +572,7 @@
         setDefaultConfigValueToChild(leaves, leafLists);
         validateConfig(leaves, leafLists);
 
-        /* A list must have atleast one key leaf if config is true */
+        //A list must have atleast one key leaf if config is true
         if (isConfig && (keys == null || leaves == null) && !isUsesPresentInList()
                 && !isListPresentInGrouping()) {
             throw new DataModelException("A list must have atleast one key leaf if config is true;");
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangModule.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangModule.java
index c2df52f..5d246a4 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangModule.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangModule.java
@@ -85,7 +85,7 @@
 
     /**
      * Reference:RFC 6020.
-     * <p>
+     *
      * The "contact" statement provides contact information for the module. The
      * argument is a string that is used to specify contact information for the
      * person or persons to whom technical queries concerning this module should
@@ -96,7 +96,7 @@
 
     /**
      * Reference:RFC 6020.
-     * <p>
+     *
      * The "description" statement takes as an argument a string that contains a
      * human-readable textual description of this definition. The text is
      * provided in a language (or languages) chosen by the module developer; for
@@ -136,7 +136,7 @@
 
     /**
      * Reference:RFC 6020.
-     * <p>
+     *
      * The "organization" statement defines the party responsible for this
      * module. The argument is a string that is used to specify a textual
      * description of the organization(s) under whose auspices this module was
@@ -233,7 +233,7 @@
     /**
      * Compiler annotation list.
      */
-    private List<YangCompilerAnnotation> compilerAnnotationList;
+    private List<YangResolutionInfo> compilerAnnotationList;
 
     /**
      * Extension list.
@@ -569,33 +569,6 @@
     }
 
     /**
-     * Adds compiler annotation in compiler-annotation list.
-     *
-     * @param compilerAnnotation the compiler-annotation to be added
-     */
-    public void addCompilerAnnotation(YangCompilerAnnotation compilerAnnotation) {
-        getCompilerAnnotationList().add(compilerAnnotation);
-    }
-
-    /**
-     * Returns the compiler annotation list.
-     *
-     * @return the compiler annotation list
-     */
-    public List<YangCompilerAnnotation> getCompilerAnnotationList() {
-        return compilerAnnotationList;
-    }
-
-    /**
-     * Sets the compiler-annotation list.
-     *
-     * @param compilerAnnotationList the list of compiler-annotation
-     */
-    public void setCompilerAnnotationList(List<YangCompilerAnnotation> compilerAnnotationList) {
-        this.compilerAnnotationList = compilerAnnotationList;
-    }
-
-    /**
      * Adds extension in extension list.
      *
      * @param extension the extension to be added
@@ -687,8 +660,10 @@
             return leafRefResolutionList;
         } else if (type == ResolvableType.YANG_BASE) {
             return baseResolutionList;
-        } else {
+        } else if (type == ResolvableType.YANG_IDENTITYREF) {
             return identityRefResolutionList;
+        } else {
+            return compilerAnnotationList;
         }
     }
 
@@ -709,6 +684,8 @@
             augmentResolutionList.add(resolutionInfo);
         } else if (type == ResolvableType.YANG_IDENTITYREF) {
             identityRefResolutionList.add(resolutionInfo);
+        } else if (type == ResolvableType.YANG_COMPILER_ANNOTATION) {
+            compilerAnnotationList.add(resolutionInfo);
         }
     }
 
@@ -729,6 +706,8 @@
             augmentResolutionList = resolutionList;
         } else if (type == ResolvableType.YANG_IDENTITYREF) {
             identityRefResolutionList = resolutionList;
+        } else if (type == ResolvableType.YANG_COMPILER_ANNOTATION) {
+            compilerAnnotationList = resolutionList;
         }
 
     }
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangNode.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangNode.java
index d501b0b..ced0910 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangNode.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangNode.java
@@ -16,7 +16,6 @@
 package org.onosproject.yangutils.datamodel;
 
 import java.io.Serializable;
-
 import org.onosproject.yangutils.datamodel.exceptions.DataModelException;
 import org.onosproject.yangutils.datamodel.utils.Parsable;
 
@@ -248,15 +247,12 @@
         YangNode curNode;
         curNode = getChild();
 
-        /*
-         * Get the predecessor child of new child
-         */
+        // Get the predecessor child of new child
         while (curNode.getNextSibling() != null) {
-
             curNode = curNode.getNextSibling();
         }
 
-        /* If the new node needs to be the last child */
+        // If the new node needs to be the last child
         if (curNode.getNextSibling() == null) {
             curNode.setNextSibling(newChild);
             newChild.setPreviousSibling(curNode);
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangSubModule.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangSubModule.java
index a58eb7d..717ea1a 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangSubModule.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/YangSubModule.java
@@ -226,7 +226,7 @@
     /**
      * Compiler annotation list.
      */
-    private List<YangCompilerAnnotation> compilerAnnotationList;
+    private List<YangResolutionInfo> compilerAnnotationList;
 
     /**
      * extension list.
@@ -256,6 +256,7 @@
         listOfLeaf = new LinkedList<>();
         listOfLeafList = new LinkedList<>();
         extensionList = new LinkedList<>();
+        compilerAnnotationList = new LinkedList<>();
     }
 
     /**
@@ -595,8 +596,10 @@
             return leafRefResolutionList;
         } else if (type == ResolvableType.YANG_BASE) {
             return baseResolutionList;
-        } else {
+        } else if (type == ResolvableType.YANG_IDENTITYREF) {
             return identityRefResolutionList;
+        } else {
+            return compilerAnnotationList;
         }
     }
 
@@ -617,6 +620,8 @@
             augmentResolutionList.add(resolutionInfo);
         } else if (type == ResolvableType.YANG_IDENTITYREF) {
             identityRefResolutionList.add(resolutionInfo);
+        } else if (type == ResolvableType.YANG_COMPILER_ANNOTATION) {
+            compilerAnnotationList.add(resolutionInfo);
         }
     }
 
@@ -637,6 +642,8 @@
             augmentResolutionList = resolutionList;
         } else if (type == ResolvableType.YANG_IDENTITYREF) {
             identityRefResolutionList = resolutionList;
+        } else if (type == ResolvableType.YANG_COMPILER_ANNOTATION) {
+            compilerAnnotationList = resolutionList;
         }
 
     }
@@ -698,34 +705,6 @@
     }
 
     /**
-     * Adds compiler annotation in compiler annotation list.
-     *
-     * @param compilerAnnotation the compiler annotation to be added
-     */
-    public void addCompilerAnnotation(YangCompilerAnnotation compilerAnnotation) {
-        getCompilerAnnotationList().add(compilerAnnotation);
-    }
-
-    /**
-     * Returns the compiler annotation list.
-     *
-     * @return the compiler annotation list
-     */
-    public List<YangCompilerAnnotation> getCompilerAnnotationList() {
-        return compilerAnnotationList;
-    }
-
-    /**
-     * Sets the compiler annotation list.
-     *
-     * @param compilerAnnotationList the list of compiler annotation
-     */
-    public void setCompilerAnnotationList(List<YangCompilerAnnotation> compilerAnnotationList) {
-        this.compilerAnnotationList = compilerAnnotationList;
-    }
-
-
-    /**
      * Adds extension in extension list.
      *
      * @param extension the extension to be added
diff --git a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/utils/DataModelUtils.java b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/utils/DataModelUtils.java
index 1da8a1a..29896ef 100644
--- a/datamodel/src/main/java/org/onosproject/yangutils/datamodel/utils/DataModelUtils.java
+++ b/datamodel/src/main/java/org/onosproject/yangutils/datamodel/utils/DataModelUtils.java
@@ -37,6 +37,7 @@
 import org.onosproject.yangutils.datamodel.YangAtomicPath;
 import org.onosproject.yangutils.datamodel.YangAugment;
 import org.onosproject.yangutils.datamodel.YangBase;
+import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
 import org.onosproject.yangutils.datamodel.YangEntityToResolveInfoImpl;
 import org.onosproject.yangutils.datamodel.YangEnumeration;
 import org.onosproject.yangutils.datamodel.YangIdentityRef;
@@ -210,6 +211,10 @@
             resolutionNode.addToResolutionList(resolutionInfo, ResolvableType.YANG_BASE);
         } else if (resolutionInfo.getEntityToResolveInfo().getEntityToResolve() instanceof YangIdentityRef) {
             resolutionNode.addToResolutionList(resolutionInfo, ResolvableType.YANG_IDENTITYREF);
+        } else if (resolutionInfo.getEntityToResolveInfo()
+                .getEntityToResolve() instanceof YangCompilerAnnotation) {
+            resolutionNode.addToResolutionList(resolutionInfo,
+                    ResolvableType.YANG_COMPILER_ANNOTATION);
         }
     }
 
diff --git a/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangLinkerManager.java b/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangLinkerManager.java
index 754801b..815f220 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangLinkerManager.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangLinkerManager.java
@@ -181,6 +181,8 @@
                         .resolveInterFileLinking(ResolvableType.YANG_IDENTITYREF);
                 ((YangReferenceResolver) yangNode)
                         .resolveInterFileLinking(ResolvableType.YANG_LEAFREF);
+                ((YangReferenceResolver) yangNode)
+                        .resolveInterFileLinking(ResolvableType.YANG_COMPILER_ANNOTATION);
             } catch (DataModelException e) {
                 String errorInfo = "Error in file: " + yangNode.getName() + " at line: "
                         + e.getLineNumber() + " at position: " + e.getCharPositionInLine() + NEW_LINE + e.getMessage();
diff --git a/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangResolutionInfoImpl.java b/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangResolutionInfoImpl.java
index 0cd359b..7df0de2 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangResolutionInfoImpl.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangResolutionInfoImpl.java
@@ -21,7 +21,6 @@
 import java.util.LinkedList;
 import java.util.List;
 import java.util.Stack;
-
 import org.onosproject.yangutils.datamodel.Resolvable;
 import org.onosproject.yangutils.datamodel.ResolvableType;
 import org.onosproject.yangutils.datamodel.TraversalType;
@@ -29,6 +28,7 @@
 import org.onosproject.yangutils.datamodel.YangAugment;
 import org.onosproject.yangutils.datamodel.YangAugmentableNode;
 import org.onosproject.yangutils.datamodel.YangBase;
+import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
 import org.onosproject.yangutils.datamodel.YangDerivedInfo;
 import org.onosproject.yangutils.datamodel.YangEntityToResolveInfo;
 import org.onosproject.yangutils.datamodel.YangEntityToResolveInfoImpl;
@@ -44,6 +44,7 @@
 import org.onosproject.yangutils.datamodel.YangLeaf;
 import org.onosproject.yangutils.datamodel.YangLeafList;
 import org.onosproject.yangutils.datamodel.YangLeafRef;
+import org.onosproject.yangutils.datamodel.YangList;
 import org.onosproject.yangutils.datamodel.YangModule;
 import org.onosproject.yangutils.datamodel.YangNode;
 import org.onosproject.yangutils.datamodel.YangNodeIdentifier;
@@ -308,9 +309,7 @@
 
         YangDerivedInfo derivedInfo = (YangDerivedInfo) yangType.getDataTypeExtendedInfo();
 
-        /*
-         * If the derived types referred type is not leafref/identityref return
-         */
+        // If the derived types referred type is not leafref/identityref return
         if ((derivedInfo.getEffectiveBuiltInType() != YangDataTypes.LEAFREF) &&
                 (derivedInfo.getEffectiveBuiltInType() != YangDataTypes.IDENTITYREF)) {
             return;
@@ -511,9 +510,7 @@
             return;
         }
 
-        /*
-         * In case prefix is not present it's a candidate for inter-file resolution via include list.
-         */
+        //In case prefix is not present it's a candidate for inter-file resolution via include list.
         if (getRefPrefix() == null) {
             ((Resolvable) getCurrentEntityToResolveFromStack()).setResolvableStatus(INTRA_FILE_RESOLVED);
         }
@@ -771,9 +768,8 @@
 
         if ((getCurrentEntityToResolveFromStack() instanceof YangIdentityRef) ||
                 (getCurrentEntityToResolveFromStack() instanceof YangBase)) {
-            /*
-             * Check if name of node name matches with the current reference node.
-             */
+
+            //Check if name of node name matches with the current reference node.
             return currentReferredNode.getName().contentEquals(nameOfIdentityRefBase);
         } else {
             throw new DataModelException("Data Model Exception: Entity to resolved is other than identityref");
@@ -967,9 +963,8 @@
     private void addUnresolvedRecursiveReferenceToStack(YangNode referredNode)
             throws DataModelException {
         if (getCurrentEntityToResolveFromStack() instanceof YangType) {
-            /*
-             * Checks if typedef type is derived
-             */
+
+            //Checks if typedef type is derived
             if (((YangTypeDef) referredNode).getTypeDefBaseType().getDataType() == YangDataTypes.DERIVED) {
 
                 YangEntityToResolveInfoImpl<YangType<?>> unResolvedEntityInfo = new YangEntityToResolveInfoImpl<>();
@@ -992,9 +987,8 @@
             throw new DataModelException("Data Model Exception: Entity to resolved is other than type/uses");
         } else if ((getCurrentEntityToResolveFromStack() instanceof YangBase) ||
                 (getCurrentEntityToResolveFromStack() instanceof YangIdentityRef)) {
-            /*
-             * Search if the identity has any un resolved base, if so return true, else return false.
-             */
+
+            //Search if the identity has any un resolved base, if so return true, else return false.
             addUnResolvedBaseToStack(referredNode);
         } else {
             throw new DataModelException("Data Model Exception: Entity to resolved is other than type/uses/" +
@@ -1009,9 +1003,7 @@
      */
     private void addUnResolvedUsesToStack(YangNode node) {
 
-        /**
-         * Search the grouping node's children for presence of uses node.
-         */
+        //Search the grouping node's children for presence of uses node.
         TraversalType curTraversal = ROOT;
         YangNode curNode = node.getChild();
         while (curNode != null) {
@@ -1222,7 +1214,7 @@
         YangXpathLinker<T> xPathLinker = new YangXpathLinker<T>();
 
         if (entityToResolve instanceof YangAugment) {
-            YangNode targetNode;
+            YangNode targetNode = null;
             YangAugment augment = (YangAugment) entityToResolve;
             targetNode = xPathLinker.processAugmentXpathLinking(augment.getTargetNode(),
                     (YangNode) root);
@@ -1240,6 +1232,25 @@
             } else {
                 throw new LinkerException("Failed to link " + augment.getName());
             }
+        } else if (entityToResolve instanceof YangCompilerAnnotation) {
+            YangNode targetNode;
+            YangCompilerAnnotation ca = (YangCompilerAnnotation) entityToResolve;
+
+            targetNode = xPathLinker.processAugmentXpathLinking(ca.getAtomicPathList(),
+                    (YangNode) root);
+            if (targetNode != null) {
+                if (targetNode instanceof YangList) {
+                    ((YangList) targetNode).setCompilerAnnotation(
+                            (YangCompilerAnnotation) entityToResolve);
+                    Resolvable resolvable = (Resolvable) entityToResolve;
+                    resolvable.setResolvableStatus(RESOLVED);
+                } else {
+                    throw new LinkerException("Invalid target node type " + targetNode.getNodeType() + " for compiler" +
+                            " annotation " + ca.getPath());
+                }
+            } else {
+                throw new LinkerException("Failed to link compiler annotation " + ca.getPath());
+            }
         } else if (entityToResolve instanceof YangLeafRef) {
             YangLeafRef leafRef = (YangLeafRef) entityToResolve;
             Object target = xPathLinker.processLeafRefXpathLinking(leafRef.getAtomicPath(),
@@ -1613,9 +1624,8 @@
      */
     private boolean resolveWithImport()
             throws DataModelException {
-        /*
-         * Run through import list to find the referred typedef/grouping.
-         */
+
+        // Run through import list to find the referred typedef/grouping.
         for (YangImport yangImport : getCurReferenceResolver().getImportList()) {
             /*
              * Match the prefix attached to entity under resolution with the
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppDataStructureListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppDataStructureListener.java
index e6628b3..c541bda 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppDataStructureListener.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppDataStructureListener.java
@@ -24,7 +24,7 @@
 import org.onosproject.yangutils.parser.exceptions.ParserException;
 import org.onosproject.yangutils.parser.impl.TreeWalkListener;
 
-import static org.onosproject.yangutils.datamodel.YangDataStructure.getType;
+import static org.onosproject.yangutils.datamodel.YangDataStructure.getDataStructureType;
 import static org.onosproject.yangutils.datamodel.utils.YangConstructType.APP_DATA_STRUCTURE;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.ENTRY;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.EXIT;
@@ -75,7 +75,7 @@
         checkStackIsNotEmpty(listener, MISSING_HOLDER, APP_DATA_STRUCTURE, "", ENTRY);
 
         String prefix = getValidPrefix(ctx.APP_DATA_STRUCTURE().getText(), APP_DATA_STRUCTURE, ctx);
-        YangDataStructure dataStructure = getType(ctx.appDataStructure().getText());
+        YangDataStructure dataStructure = getDataStructureType(ctx.appDataStructure().getText());
 
         YangAppDataStructure appDataStructure = new YangAppDataStructure();
         appDataStructure.setPrefix(prefix);
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppExtendedNameListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppExtendedNameListener.java
index 3ec31c7..b72b95c 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppExtendedNameListener.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppExtendedNameListener.java
@@ -16,7 +16,7 @@
 
 package org.onosproject.yangutils.parser.impl.listeners;
 
-import org.onosproject.yangutils.datamodel.YangAppExtendedName;
+import org.onosproject.yangutils.datamodel.YangAppExtended;
 import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
 import org.onosproject.yangutils.datamodel.utils.Parsable;
 import org.onosproject.yangutils.parser.antlrgencode.GeneratedYangParser;
@@ -67,7 +67,7 @@
         checkStackIsNotEmpty(listener, MISSING_HOLDER, APP_EXTENDED_NAME_DATA, ctx.extendedName().getText(), ENTRY);
 
         String prefix = getValidPrefix(ctx.APP_EXTENDED().getText(), APP_EXTENDED_NAME_DATA, ctx);
-        YangAppExtendedName extendedName = new YangAppExtendedName();
+        YangAppExtended extendedName = new YangAppExtended();
         extendedName.setPrefix(prefix);
         extendedName.setYangAppExtendedName(removeQuotesAndHandleConcat(ctx.extendedName().getText()));
 
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/CompilerAnnotationListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/CompilerAnnotationListener.java
index c89e99a..8a5627f 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/CompilerAnnotationListener.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/CompilerAnnotationListener.java
@@ -16,21 +16,30 @@
 
 package org.onosproject.yangutils.parser.impl.listeners;
 
+import java.util.List;
+import org.onosproject.yangutils.datamodel.YangAtomicPath;
 import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
 import org.onosproject.yangutils.datamodel.YangModule;
+import org.onosproject.yangutils.datamodel.YangNode;
 import org.onosproject.yangutils.datamodel.YangSubModule;
+import org.onosproject.yangutils.datamodel.exceptions.DataModelException;
 import org.onosproject.yangutils.datamodel.utils.Parsable;
+import org.onosproject.yangutils.linker.impl.YangResolutionInfoImpl;
 import org.onosproject.yangutils.parser.antlrgencode.GeneratedYangParser;
 import org.onosproject.yangutils.parser.exceptions.ParserException;
 import org.onosproject.yangutils.parser.impl.TreeWalkListener;
 
+import static org.onosproject.yangutils.datamodel.utils.DataModelUtils.addResolutionInfo;
 import static org.onosproject.yangutils.datamodel.utils.YangConstructType.COMPILER_ANNOTATION_DATA;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.ENTRY;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.EXIT;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorMessageConstruction.constructExtendedListenerErrorMessage;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorMessageConstruction.constructListenerErrorMessage;
-import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.INVALID_HOLDER;
-import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_CURRENT_HOLDER;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_CURRENT_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.INVALID_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.UNHANDLED_PARSED_DATA;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerUtil.getValidAbsoluteSchemaNodeId;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerUtil.getValidPrefix;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerUtil.removeQuotesAndHandleConcat;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerValidation.checkStackIsNotEmpty;
@@ -81,20 +90,26 @@
         compilerAnnotation.setPrefix(prefix);
         compilerAnnotation.setPath(removeQuotesAndHandleConcat(ctx.string().getText()));
 
+        // Validate augment argument string
+        List<YangAtomicPath> targetNodes = getValidAbsoluteSchemaNodeId(ctx.string().getText(),
+                                                                        COMPILER_ANNOTATION_DATA, ctx);
+
+        compilerAnnotation.setAtomicPathList(targetNodes);
+
+        int line = ctx.getStart().getLine();
+        int charPositionInLine = ctx.getStart().getCharPositionInLine();
+
         Parsable curData = listener.getParsedDataStack().peek();
-        switch (curData.getYangConstructType()) {
-            case MODULE_DATA:
-                YangModule module = ((YangModule) curData);
-                module.addCompilerAnnotation(compilerAnnotation);
-                break;
-            case SUB_MODULE_DATA:
-                YangSubModule subModule = ((YangSubModule) curData);
-                subModule.addCompilerAnnotation(compilerAnnotation);
-                break;
-            default:
-                throw new ParserException(constructListenerErrorMessage(INVALID_HOLDER, COMPILER_ANNOTATION_DATA,
-                        ctx.string().getText(), ENTRY));
+        if (!(curData instanceof YangModule || curData instanceof YangSubModule)) {
+            throw new ParserException(constructListenerErrorMessage(INVALID_HOLDER, COMPILER_ANNOTATION_DATA,
+                                                                    ctx.string().getText(), ENTRY));
         }
+
+        // Add resolution information to the list
+        YangResolutionInfoImpl resolutionInfo = new YangResolutionInfoImpl<YangCompilerAnnotation>(
+                compilerAnnotation, (YangNode) curData, line, charPositionInLine);
+        addToResolutionList(resolutionInfo, ctx);
+
         listener.getParsedDataStack().push(compilerAnnotation);
     }
 
@@ -115,4 +130,21 @@
         }
         listener.getParsedDataStack().pop();
     }
+
+    /**
+     * Adds to resolution list.
+     *
+     * @param resolutionInfo resolution information.
+     * @param ctx            context object of the grammar rule
+     */
+    private static void addToResolutionList(YangResolutionInfoImpl<YangCompilerAnnotation> resolutionInfo,
+            GeneratedYangParser.CompilerAnnotationStatementContext ctx) {
+
+        try {
+            addResolutionInfo(resolutionInfo);
+        } catch (DataModelException e) {
+            throw new ParserException(constructExtendedListenerErrorMessage(UNHANDLED_PARSED_DATA,
+                    COMPILER_ANNOTATION_DATA, ctx.COMPILER_ANNOTATION().getText(), ENTRY, e.getMessage()));
+        }
+    }
 }
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/ListListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/ListListener.java
index 1891595..270c9c1 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/ListListener.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/ListListener.java
@@ -177,8 +177,11 @@
                 yangList.validateDataOnExit();
                 validateUniqueInList(yangList, ctx);
             } catch (DataModelException e) {
-                throw new ParserException(constructExtendedListenerErrorMessage(UNHANDLED_PARSED_DATA,
-                        LIST_DATA, ctx.identifier().getText(), EXIT, e.getMessage()));
+                ParserException parserException = new ParserException(constructExtendedListenerErrorMessage(
+                        UNHANDLED_PARSED_DATA, LIST_DATA, ctx.identifier().getText(), EXIT, e.getMessage()));
+                parserException.setLine(ctx.getStart().getLine());
+                parserException.setCharPosition(ctx.getStart().getCharPositionInLine());
+                throw parserException;
             }
             listener.getParsedDataStack().pop();
         } else {
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/ModuleListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/ModuleListener.java
index 5b50ff9..972d1ef 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/ModuleListener.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/ModuleListener.java
@@ -32,7 +32,9 @@
 import static org.onosproject.yangutils.datamodel.utils.YangConstructType.MODULE_DATA;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.ENTRY;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.EXIT;
-import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorMessageConstruction.constructListenerErrorMessage;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorMessageConstruction
+        .constructListenerErrorMessage;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.INVALID_CHILD;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.INVALID_HOLDER;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_CURRENT_HOLDER;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_HOLDER;
@@ -121,6 +123,14 @@
             ((YangModule) tmpNode).setRevision(currentRevision);
         }
 
+        YangModule module = (YangModule) tmpNode;
+        if (module.getUnresolvedResolutionList(ResolvableType.YANG_COMPILER_ANNOTATION) != null
+                && module.getUnresolvedResolutionList(ResolvableType.YANG_COMPILER_ANNOTATION).size() != 0
+                && module.getChild() != null) {
+            throw new ParserException(constructListenerErrorMessage(INVALID_CHILD, MODULE_DATA,
+                    ctx.identifier().getText(), EXIT));
+        }
+
         try {
             ((YangReferenceResolver) listener.getParsedDataStack()
                     .peek()).resolveSelfFileLinking(ResolvableType.YANG_IF_FEATURE);
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/SubModuleListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/SubModuleListener.java
index d2c4f48..f9c4a27 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/SubModuleListener.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/SubModuleListener.java
@@ -29,10 +29,13 @@
 import org.onosproject.yangutils.parser.impl.TreeWalkListener;
 
 import static org.onosproject.yangutils.datamodel.utils.GeneratedLanguage.JAVA_GENERATION;
+import static org.onosproject.yangutils.datamodel.utils.YangConstructType.MODULE_DATA;
 import static org.onosproject.yangutils.datamodel.utils.YangConstructType.SUB_MODULE_DATA;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.ENTRY;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.EXIT;
-import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorMessageConstruction.constructListenerErrorMessage;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorMessageConstruction
+        .constructListenerErrorMessage;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.INVALID_CHILD;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.INVALID_HOLDER;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_CURRENT_HOLDER;
 import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_HOLDER;
@@ -126,6 +129,14 @@
             ((YangSubModule) tmpNode).setRevision(currentRevision);
         }
 
+        YangSubModule subModule = (YangSubModule) tmpNode;
+        if (subModule.getUnresolvedResolutionList(ResolvableType.YANG_COMPILER_ANNOTATION) != null
+                && subModule.getUnresolvedResolutionList(ResolvableType.YANG_COMPILER_ANNOTATION).size() != 0
+                && subModule.getChild() != null) {
+            throw new ParserException(constructListenerErrorMessage(INVALID_CHILD, MODULE_DATA,
+                    ctx.identifier().getText(), EXIT));
+        }
+
         try {
             ((YangReferenceResolver) listener.getParsedDataStack().peek())
                     .resolveSelfFileLinking(ResolvableType.YANG_IF_FEATURE);
diff --git a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/JavaAttributeInfo.java b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/JavaAttributeInfo.java
index 254ea4a..ffa7b21 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/JavaAttributeInfo.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/JavaAttributeInfo.java
@@ -16,6 +16,7 @@
 
 package org.onosproject.yangutils.translator.tojava;
 
+import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
 import org.onosproject.yangutils.datamodel.YangType;
 import org.onosproject.yangutils.translator.exception.TranslatorException;
 
@@ -54,6 +55,11 @@
     private JavaQualifiedTypeInfoTranslator importInfo;
 
     /**
+     * Compiler annotation attribute info.
+     */
+    private YangCompilerAnnotation compilerAnnotation;
+
+    /**
      * If conflict occurs.
      */
     private boolean isIntConflict;
@@ -184,7 +190,25 @@
     }
 
     /**
-     * Returns true if conflict between int and uInt.
+     * Returns the compiler annotation.
+     *
+     * @return compiler annotation info
+     */
+    public YangCompilerAnnotation getCompilerAnnotation() {
+        return compilerAnnotation;
+    }
+
+    /**
+     * Sets the compiler annotation.
+     *
+     * @param compilerAnnotation the compiler annotation to set
+     */
+    public void setCompilerAnnotation(YangCompilerAnnotation compilerAnnotation) {
+        this.compilerAnnotation = compilerAnnotation;
+    }
+
+    /**
+     * Returns true if conflict between int and uint.
      *
      * @return true if conflict between int and uInt
      */
@@ -247,4 +271,27 @@
 
         return newAttr;
     }
+
+    /**
+     * Returns java attribute info.
+     *
+     * @param importInfo        java qualified type info
+     * @param attributeName     attribute name
+     * @param attributeType     attribute type
+     * @param isQualifiedAccess is the attribute a qualified access
+     * @param isListAttribute   is list attribute
+     * @param compilerAnnotation compiler annotation
+     * @return java attribute info.
+     */
+    public static JavaAttributeInfo getAttributeInfoForTheData(JavaQualifiedTypeInfoTranslator importInfo,
+                                                               String attributeName, YangType<?> attributeType,
+                                                               boolean isQualifiedAccess, boolean isListAttribute,
+                                                               YangCompilerAnnotation compilerAnnotation) {
+        JavaAttributeInfo newAttr = getAttributeInfoForTheData(importInfo, attributeName, attributeType,
+                                                               isQualifiedAccess, isListAttribute);
+
+        newAttr.setCompilerAnnotation(compilerAnnotation);
+
+        return newAttr;
+    }
 }
diff --git a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/JavaImportData.java b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/JavaImportData.java
index aa8b53f..7c82175 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/JavaImportData.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/JavaImportData.java
@@ -41,7 +41,9 @@
 import static org.onosproject.yangutils.utils.UtilConstants.NEW_LINE;
 import static org.onosproject.yangutils.utils.UtilConstants.ONOS_EVENT_PKG;
 import static org.onosproject.yangutils.utils.UtilConstants.PERIOD;
+import static org.onosproject.yangutils.utils.UtilConstants.QUEUE;
 import static org.onosproject.yangutils.utils.UtilConstants.SEMI_COLAN;
+import static org.onosproject.yangutils.utils.UtilConstants.SET;
 import static java.util.Collections.sort;
 
 /**
@@ -55,6 +57,16 @@
     private boolean isListToImport;
 
     /**
+     * Flag to denote if any queue is imported due to compiler annotation.
+     */
+    private boolean isQueueToImport;
+
+    /**
+     * Flag to denote if any set is imported due to compiler annotation.
+     */
+    private boolean isSetToImport;
+
+    /**
      * Sorted set of import info, to be used to maintain the set of classes to
      * be imported in the generated class.
      */
@@ -86,6 +98,42 @@
     }
 
     /**
+     * Is Queue to be imported due to compiler annotations.
+     *
+     * @return status of queue import
+     */
+    public boolean isQueueToImport() {
+        return isQueueToImport;
+    }
+
+    /**
+     * Is Set to be imported due to compiler annotations.
+     *
+     * @return status of set import
+     */
+    public boolean isSetToImport() {
+        return isSetToImport;
+    }
+
+    /**
+     * Sets the status of the queue to be imported due to compiler annotations.
+     *
+     * @param queueToImport status of queue to import
+     */
+    public void setQueueToImport(boolean queueToImport) {
+        isQueueToImport = queueToImport;
+    }
+
+    /**
+     * Sets the status of the set to be imported due to compiler annotations.
+     *
+     * @param setToImport status of set to import
+     */
+    public void setSetToImport(boolean setToImport) {
+        isSetToImport = setToImport;
+    }
+
+    /**
      * Returns the set containing the imported class/interface info.
      *
      * @return the set containing the imported class/interface info
@@ -124,7 +172,7 @@
 
         if (newImportInfo.getClassInfo().contentEquals(className)) {
             /*
-             * if the current class name is same as the attribute class name,
+             * If the current class name is same as the attribute class name,
              * then the attribute must be accessed in a qualified manner.
              */
             return true;
@@ -157,7 +205,7 @@
         }
 
         /*
-         * import is added, so it is a member for non qualified access
+         * Import is added, so it is a member for non qualified access
          */
         getImportSet().add(newImportInfo);
         return false;
@@ -187,6 +235,14 @@
             imports.add(getImportForList());
         }
 
+        if (isQueueToImport()) {
+            imports.add(getImportForQueue());
+        }
+
+        if (isSetToImport()) {
+            imports.add(getImportForSet());
+        }
+
         sort(imports);
         return imports;
     }
@@ -228,6 +284,24 @@
     }
 
     /**
+     * Returns import for queue attribute.
+     *
+     * @return import for queue attribute
+     */
+    public String getImportForQueue() {
+        return IMPORT + COLLECTION_IMPORTS + PERIOD + QUEUE + SEMI_COLAN + NEW_LINE;
+    }
+
+    /**
+     * Returns import for set attribute.
+     *
+     * @return import for set attribute
+     */
+    public String getImportForSet() {
+        return IMPORT + COLLECTION_IMPORTS + PERIOD + SET + SEMI_COLAN + NEW_LINE;
+    }
+
+    /**
      * Returns import string for ListenerService class.
      *
      * @return import string for ListenerService class
diff --git a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/TempJavaEventFragmentFiles.java b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/TempJavaEventFragmentFiles.java
index 609a3d2..42c5e59 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/TempJavaEventFragmentFiles.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/TempJavaEventFragmentFiles.java
@@ -444,7 +444,7 @@
     private void addEventEnum(String notificationName, YangPluginConfig pluginConfig)
             throws IOException {
         appendToFile(getEventEnumTempFileHandle(),
-                getJavaDoc(ENUM_ATTRIBUTE, notificationName, false, pluginConfig) + FOUR_SPACE_INDENTATION
+                getJavaDoc(ENUM_ATTRIBUTE, notificationName, false, pluginConfig, null) + FOUR_SPACE_INDENTATION
                         + getEnumJavaAttribute(notificationName).toUpperCase() + COMMA + NEW_LINE);
     }
 
@@ -464,17 +464,26 @@
     /*Adds getter method for event in event subject class.*/
     private void addEventSubjectGetter(JavaAttributeInfo attr, YangPluginConfig pluginConfig)
             throws IOException {
+        String appDataStructure = null;
+        if (attr.getCompilerAnnotation() != null) {
+            appDataStructure = attr.getCompilerAnnotation().getYangAppDataStructure().getDataStructure().name();
+        }
         appendToFile(getEventSubjectGetterTempFileHandle(),
-                getJavaDoc(GETTER_METHOD, getCapitalCase(attr.getAttributeName()), false, pluginConfig)
-                        + getGetterForClass(attr, GENERATE_EVENT_SUBJECT_CLASS) + NEW_LINE);
+                getJavaDoc(GETTER_METHOD, getCapitalCase(attr.getAttributeName()), false, pluginConfig,
+                        appDataStructure) + getGetterForClass(attr, GENERATE_EVENT_SUBJECT_CLASS) + NEW_LINE);
     }
 
     /*Adds setter method for event in event subject class.*/
     private void addEventSubjectSetter(JavaAttributeInfo attr, YangPluginConfig pluginConfig, String className)
             throws IOException {
+        String appDataStructure = null;
+        if (attr.getCompilerAnnotation() != null) {
+            appDataStructure = attr.getCompilerAnnotation().getYangAppDataStructure().getDataStructure().name();
+        }
         appendToFile(getEventSubjectSetterTempFileHandle(),
-                getJavaDoc(MANAGER_SETTER_METHOD, getCapitalCase(attr.getAttributeName()), false, pluginConfig)
-                        + getSetterForClass(attr, className, GENERATE_EVENT_SUBJECT_CLASS) + NEW_LINE);
+                getJavaDoc(MANAGER_SETTER_METHOD, getCapitalCase(attr.getAttributeName()), false, pluginConfig,
+                        appDataStructure) + getSetterForClass(attr, className, GENERATE_EVENT_SUBJECT_CLASS)
+                        + NEW_LINE);
     }
 
     /**
diff --git a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/TempJavaFragmentFiles.java b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/TempJavaFragmentFiles.java
index 58a0e28..a151f03 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/TempJavaFragmentFiles.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/TempJavaFragmentFiles.java
@@ -22,10 +22,11 @@
 import org.onosproject.yangutils.datamodel.YangAugment;
 import org.onosproject.yangutils.datamodel.YangAugmentableNode;
 import org.onosproject.yangutils.datamodel.YangCase;
+import org.onosproject.yangutils.datamodel.YangModule;
 import org.onosproject.yangutils.datamodel.YangLeaf;
 import org.onosproject.yangutils.datamodel.YangLeafList;
 import org.onosproject.yangutils.datamodel.YangLeavesHolder;
-import org.onosproject.yangutils.datamodel.YangModule;
+import org.onosproject.yangutils.datamodel.YangList;
 import org.onosproject.yangutils.datamodel.YangNode;
 import org.onosproject.yangutils.datamodel.YangSubModule;
 import org.onosproject.yangutils.utils.io.YangPluginConfig;
@@ -447,16 +448,12 @@
             addGeneratedTempFile(FROM_STRING_IMPL_MASK);
         }
 
-        /*
-         * Initialize temp files to generate enum class.
-         */
+        //Initialize temp files to generate enum class.
         if ((getGeneratedJavaFiles() & GENERATE_ENUM_CLASS) != 0) {
             addGeneratedTempFile(FROM_STRING_IMPL_MASK);
         }
 
-        /*
-         * Set temporary file handles.
-         */
+        //Set temporary file handles
         if ((getGeneratedTempFiles() & ATTRIBUTES_MASK) != 0) {
             setAttributesTempFileHandle(getTemporaryFileHandle(ATTRIBUTE_FILE_NAME));
         }
@@ -586,10 +583,38 @@
                     className, fileInfo.getPackage());
         }
 
-        if (isListNode) {
+        boolean collectionSetFlag = false;
+        if (curNode instanceof YangList) {
+            YangList yangList = (YangList) curNode;
+            if (yangList.getCompilerAnnotation() != null && yangList.getCompilerAnnotation()
+                    .getYangAppDataStructure() != null) {
+                switch (yangList.getCompilerAnnotation().getYangAppDataStructure().getDataStructure()) {
+                    case QUEUE: {
+                        parentImportData.setQueueToImport(true);
+                        collectionSetFlag = true;
+                        break;
+                    }
+                    case SET: {
+                        parentImportData.setSetToImport(true);
+                        collectionSetFlag = true;
+                        break;
+                    }
+                    default: {
+                        // TODO : to be implemented
+                    }
+                }
+            }
+        }
+
+        if (isListNode && !(collectionSetFlag)) {
             parentImportData.setIfListImported(true);
         }
 
+        if (curNode instanceof YangList) {
+            return getAttributeInfoForTheData(qualifiedTypeInfo, curNodeName, null, isQualified, isListNode,
+                    ((YangList) curNode).getCompilerAnnotation());
+        }
+
         return getAttributeInfoForTheData(qualifiedTypeInfo, curNodeName, null, isQualified, isListNode);
     }
 
@@ -1121,9 +1146,13 @@
                         getGeneratedJavaFiles()) + NEW_LINE);
             }
         } else {
+            String appDataStructure = null;
+            if (attr.getCompilerAnnotation() != null) {
+                appDataStructure = attr.getCompilerAnnotation().getYangAppDataStructure().getDataStructure().name();
+            }
             appendToFile(getGetterImplTempFileHandle(),
-                    getJavaDoc(GETTER_METHOD, getCapitalCase(attr.getAttributeName()), false, pluginConfig)
-                            + getGetterForClass(attr, getGeneratedJavaFiles()) + NEW_LINE);
+                    getJavaDoc(GETTER_METHOD, getCapitalCase(attr.getAttributeName()), false, pluginConfig,
+                            appDataStructure) + getGetterForClass(attr, getGeneratedJavaFiles()) + NEW_LINE);
         }
     }
 
@@ -1136,7 +1165,7 @@
      */
     private void addAddToListInterface(JavaAttributeInfo attr, YangPluginConfig pluginConfig) throws IOException {
         appendToFile(getAddToListInterfaceTempFileHandle(),
-                getJavaDoc(ADD_TO_LIST, getCapitalCase(attr.getAttributeName()), false, pluginConfig)
+                getJavaDoc(ADD_TO_LIST, getCapitalCase(attr.getAttributeName()), false, pluginConfig, null)
                         + getAddToListMethodInterface(attr) + NEW_LINE);
     }
 
@@ -1322,7 +1351,6 @@
      */
     public String getTemporaryDataFromFileHandle(File file, String absolutePath)
             throws IOException {
-
         String path = getTempDirPath(absolutePath);
         if (new File(path + file.getName()).exists()) {
             return readAppendFile(path + file.getName(), EMPTY_STRING);
@@ -1351,9 +1379,7 @@
      * @return attribute string
      */
     String parseAttribute(JavaAttributeInfo attr, YangPluginConfig pluginConfig) {
-        /*
-         * TODO: check if this utility needs to be called or move to the caller
-         */
+         //TODO: check if this utility needs to be called or move to the caller
         String attributeName = getCamelCase(attr.getAttributeName(), pluginConfig.getConflictResolver());
         String attributeAccessType = PRIVATE;
         if ((javaFileInfo.getGeneratedFileTypes() & GENERATE_INTERFACE_WITH_BUILDER) != 0) {
@@ -1362,10 +1388,10 @@
         if (attr.isQualifiedName()) {
             return getJavaAttributeDefinition(attr.getImportInfo().getPkgInfo(),
                     attr.getImportInfo().getClassInfo(),
-                    attributeName, attr.isListAttr(), attributeAccessType);
+                    attributeName, attr.isListAttr(), attributeAccessType, attr.getCompilerAnnotation());
         } else {
             return getJavaAttributeDefinition(null, attr.getImportInfo().getClassInfo(), attributeName,
-                    attr.isListAttr(), attributeAccessType);
+                    attr.isListAttr(), attributeAccessType, attr.getCompilerAnnotation());
         }
     }
 
@@ -1392,7 +1418,6 @@
      * @param pluginConfig plugin configurations
      */
     void addParentInfoInCurNodeTempFile(YangNode curNode, YangPluginConfig pluginConfig) {
-
         JavaQualifiedTypeInfoTranslator caseImportInfo = new JavaQualifiedTypeInfoTranslator();
         YangNode parent = getParentNodeInGenCode(curNode);
         if (curNode instanceof YangCase && parent instanceof YangAugment) {
@@ -1618,30 +1643,26 @@
             addImportsForAugmentableClass(imports, true, true);
         }
         createPackage(curNode);
-        /*
-         * Generate java code.
-         */
+
+        //Generate java code.
         if ((fileType & INTERFACE_MASK) != 0 || (fileType &
                 BUILDER_INTERFACE_MASK) != 0) {
-            /*
-             * Create interface file.
-             */
+
+            //Create interface file.
             setInterfaceJavaFileHandle(getJavaFileHandle(getJavaClassName(INTERFACE_FILE_NAME_SUFFIX)));
             setInterfaceJavaFileHandle(
                     generateInterfaceFile(getInterfaceJavaFileHandle(), imports, curNode, isAttributePresent()));
             if (!(curNode instanceof YangModule) && !(curNode instanceof YangSubModule)) {
-            /*
-             * Create builder interface file.
-             */
+
+                //Create builder interface file.
                 if ((fileType & BUILDER_INTERFACE_MASK) != 0) {
                     setBuilderInterfaceJavaFileHandle(
                             getJavaFileHandle(getJavaClassName(BUILDER_INTERFACE_FILE_NAME_SUFFIX)));
                     setBuilderInterfaceJavaFileHandle(
                             generateBuilderInterfaceFile(getBuilderInterfaceJavaFileHandle(), curNode,
                                     isAttributePresent()));
-                /*
-                 * Append builder interface file to interface file and close it.
-                 */
+
+                    //Append builder interface file to interface file and close it.
                     mergeJavaFiles(getBuilderInterfaceJavaFileHandle(), getInterfaceJavaFileHandle());
                     validateLineLength(getInterfaceJavaFileHandle());
                 }
@@ -1662,36 +1683,32 @@
                 addInvocationExceptionImport(imports);
             }
             sortImports(imports);
-            /*
-             * Create impl class file.
-             */
+
+            //Create impl class file.
             setImplClassJavaFileHandle(getJavaFileHandle(getImplClassName(curNode)));
             setImplClassJavaFileHandle(
                     generateDefaultClassFile(getImplClassJavaFileHandle(), curNode, isAttributePresent(), imports));
-            /*
-             * Create builder class file.
-             */
+
+            //Create builder class file.
             if ((fileType & BUILDER_CLASS_MASK) != 0) {
                 setBuilderClassJavaFileHandle(getJavaFileHandle(getJavaClassName(BUILDER_CLASS_FILE_NAME_SUFFIX)));
                 setBuilderClassJavaFileHandle(
                         generateBuilderClassFile(getBuilderClassJavaFileHandle(), curNode,
                                 isAttributePresent()));
-                /*
-                 * Append impl class to builder class and close it.
-                 */
+
+                //Append impl class to builder class and close it.
                 mergeJavaFiles(getBuilderClassJavaFileHandle(), getImplClassJavaFileHandle());
                 validateLineLength(getImplClassJavaFileHandle());
             }
             insertDataIntoJavaFile(getImplClassJavaFileHandle(), getJavaClassDefClose());
 
         }
-        /*
-         * Close all the file handles.
-         */
+
+        //Close all the file handles.
         freeTemporaryResources(false);
     }
 
-    /*Adds import for array list.*/
+    //Adds import for array list.
     private void addArrayListImport(List<String> imports) {
         if (imports.contains(getJavaImportData().getImportForList())) {
             imports.add(ARRAY_LIST_IMPORT);
diff --git a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaCodeSnippetGen.java b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaCodeSnippetGen.java
index 29dc4ff..2250a62 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaCodeSnippetGen.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaCodeSnippetGen.java
@@ -18,6 +18,7 @@
 
 import java.util.List;
 
+import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
 import org.onosproject.yangutils.datamodel.YangNode;
 import org.onosproject.yangutils.utils.io.YangPluginConfig;
 import org.onosproject.yangutils.translator.tojava.JavaCodeGeneratorInfo;
@@ -55,7 +56,9 @@
 import static org.onosproject.yangutils.utils.UtilConstants.PRIVATE;
 import static org.onosproject.yangutils.utils.UtilConstants.PUBLIC;
 import static org.onosproject.yangutils.utils.UtilConstants.QUESTION_MARK;
+import static org.onosproject.yangutils.utils.UtilConstants.QUEUE;
 import static org.onosproject.yangutils.utils.UtilConstants.SEMI_COLAN;
+import static org.onosproject.yangutils.utils.UtilConstants.SET;
 import static org.onosproject.yangutils.utils.UtilConstants.SPACE;
 import static org.onosproject.yangutils.utils.UtilConstants.TYPE;
 import static org.onosproject.yangutils.utils.UtilConstants.UINT_MAX_RANGE_ATTR;
@@ -110,11 +113,13 @@
      * @param javaAttributeName    name of the attribute
      * @param isList               is list attribute
      * @param attributeAccessType  attribute access type
+     * @param compilerAnnotation compiler annotation
      * @return the textual java code for attribute definition in class
      */
     public static String getJavaAttributeDefinition(String javaAttributeTypePkg, String javaAttributeType,
                                                     String javaAttributeName, boolean isList,
-                                                    String attributeAccessType) {
+                                                    String attributeAccessType,
+                                                    YangCompilerAnnotation compilerAnnotation) {
 
         String attributeDefinition = attributeAccessType + SPACE;
 
@@ -126,13 +131,43 @@
             attributeDefinition = attributeDefinition + javaAttributeType + SPACE + javaAttributeName + SEMI_COLAN
                     + NEW_LINE;
         } else {
-            attributeDefinition = attributeDefinition + LIST + DIAMOND_OPEN_BRACKET;
+            if (compilerAnnotation != null && compilerAnnotation.getYangAppDataStructure() != null) {
+                switch (compilerAnnotation.getYangAppDataStructure().getDataStructure()) {
+                    case QUEUE: {
+                        attributeDefinition = attributeDefinition + QUEUE + DIAMOND_OPEN_BRACKET;
+                        break;
+                    }
+                    case SET: {
+                        attributeDefinition = attributeDefinition + SET + DIAMOND_OPEN_BRACKET;
+                        break;
+                    }
+                    default: {
+                        attributeDefinition = attributeDefinition + LIST + DIAMOND_OPEN_BRACKET;
+                    }
+                }
+            } else {
+                attributeDefinition = attributeDefinition + LIST + DIAMOND_OPEN_BRACKET;
+            }
+
             if (javaAttributeTypePkg != null) {
                 attributeDefinition = attributeDefinition + javaAttributeTypePkg + PERIOD;
             }
 
-            attributeDefinition = attributeDefinition + javaAttributeType + DIAMOND_CLOSE_BRACKET + SPACE
-                    + javaAttributeName + SPACE + EQUAL + SPACE + NEW + SPACE + ARRAY_LIST + SEMI_COLAN + NEW_LINE;
+            attributeDefinition = attributeDefinition + javaAttributeType;
+
+            if (compilerAnnotation != null && compilerAnnotation.getYangAppDataStructure() != null) {
+                switch (compilerAnnotation.getYangAppDataStructure().getDataStructure()) {
+                    default: {
+                        attributeDefinition = attributeDefinition + DIAMOND_CLOSE_BRACKET + SPACE
+                                + javaAttributeName + SEMI_COLAN + NEW_LINE;
+                    }
+                }
+            } else {
+                attributeDefinition = attributeDefinition + DIAMOND_CLOSE_BRACKET + SPACE
+                        + javaAttributeName + SPACE + EQUAL + SPACE + NEW + SPACE
+                        + ARRAY_LIST + SEMI_COLAN + NEW_LINE;
+            }
+
         }
         return attributeDefinition;
     }
@@ -155,7 +190,7 @@
      * @return string for enum's attribute
      */
     public static String generateEnumAttributeString(String name, int value, YangPluginConfig pluginConfig) {
-        return NEW_LINE + getJavaDoc(ENUM_ATTRIBUTE, name, false, pluginConfig)
+        return NEW_LINE + getJavaDoc(ENUM_ATTRIBUTE, name, false, pluginConfig, null)
                 + EIGHT_SPACE_INDENTATION + getEnumJavaAttribute(name).toUpperCase() + OPEN_PARENTHESIS
                 + value + CLOSE_PARENTHESIS + COMMA + NEW_LINE;
     }
diff --git a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaFileGenerator.java b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaFileGenerator.java
index 033a7d7..9d0ca67 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaFileGenerator.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaFileGenerator.java
@@ -936,7 +936,7 @@
         insertDataIntoJavaFile(file, getEnumsValueAttribute(getCapitalCase(className)));
 
         // Add a constructor for enum.
-        insertDataIntoJavaFile(file, getJavaDoc(TYPE_CONSTRUCTOR, className, false, pluginConfig)
+        insertDataIntoJavaFile(file, getJavaDoc(TYPE_CONSTRUCTOR, className, false, pluginConfig, null)
                 + getEnumsConstructor(getCapitalCase(className)) + NEW_LINE);
 
         TempJavaEnumerationFragmentFiles enumFragFiles = ((TempJavaCodeFragmentFilesContainer) curNode)
@@ -949,7 +949,7 @@
                 + NEW_LINE);
 
         // Add a getter method for enum.
-        insertDataIntoJavaFile(file, getJavaDoc(GETTER_METHOD, className, false, pluginConfig)
+        insertDataIntoJavaFile(file, getJavaDoc(GETTER_METHOD, className, false, pluginConfig, null)
                 + getGetter(INT, className, GENERATE_ENUM_CLASS) + NEW_LINE);
 
         try {
diff --git a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaFileGeneratorUtils.java b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaFileGeneratorUtils.java
index cf753f0..a1000ca 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaFileGeneratorUtils.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/JavaFileGeneratorUtils.java
@@ -538,7 +538,7 @@
             throws IOException {
 
         YangPluginConfig pluginConfig = ((JavaFileInfoContainer) curNode).getJavaFileInfo().getPluginConfig();
-        insertDataIntoJavaFile(file, getJavaDoc(javaDocType, fileName, false, pluginConfig));
+        insertDataIntoJavaFile(file, getJavaDoc(javaDocType, fileName, false, pluginConfig, null));
         insertDataIntoJavaFile(file, generateClassDefinition(genType, fileName, curNode));
     }
 
@@ -555,7 +555,7 @@
     private static void write(File file, String fileName, int genType, JavaDocType javaDocType,
                               YangPluginConfig pluginConfig)
             throws IOException {
-        insertDataIntoJavaFile(file, getJavaDoc(javaDocType, fileName, false, pluginConfig));
+        insertDataIntoJavaFile(file, getJavaDoc(javaDocType, fileName, false, pluginConfig, null));
         insertDataIntoJavaFile(file, generateClassDefinition(genType, fileName));
     }
 
diff --git a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/MethodsGenerator.java b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/MethodsGenerator.java
index 372897c..5f00ecc 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/MethodsGenerator.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/translator/tojava/utils/MethodsGenerator.java
@@ -18,10 +18,10 @@
 
 import java.util.List;
 import java.util.Map;
-
 import org.onosproject.yangutils.datamodel.YangAtomicPath;
 import org.onosproject.yangutils.datamodel.YangAugment;
 import org.onosproject.yangutils.datamodel.YangAugmentableNode;
+import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
 import org.onosproject.yangutils.datamodel.YangCase;
 import org.onosproject.yangutils.datamodel.YangChoice;
 import org.onosproject.yangutils.datamodel.YangLeafRef;
@@ -157,11 +157,13 @@
 import static org.onosproject.yangutils.utils.UtilConstants.PUBLIC;
 import static org.onosproject.yangutils.utils.UtilConstants.PUT;
 import static org.onosproject.yangutils.utils.UtilConstants.QUESTION_MARK;
+import static org.onosproject.yangutils.utils.UtilConstants.QUEUE;
 import static org.onosproject.yangutils.utils.UtilConstants.QUOTES;
 import static org.onosproject.yangutils.utils.UtilConstants.REPLACE_STRING;
 import static org.onosproject.yangutils.utils.UtilConstants.RETURN;
 import static org.onosproject.yangutils.utils.UtilConstants.RPC_INPUT_VAR_NAME;
 import static org.onosproject.yangutils.utils.UtilConstants.SEMI_COLAN;
+import static org.onosproject.yangutils.utils.UtilConstants.SET;
 import static org.onosproject.yangutils.utils.UtilConstants.SET_METHOD_PREFIX;
 import static org.onosproject.yangutils.utils.UtilConstants.SET_SELECT_LEAF;
 import static org.onosproject.yangutils.utils.UtilConstants.SHORT;
@@ -238,7 +240,7 @@
      * @return method string for builder interface
      */
     public static String parseBuilderInterfaceBuildMethodString(String name, YangPluginConfig pluginConfig) {
-        return getJavaDoc(BUILD_METHOD, name, false, pluginConfig) + getBuildForInterface(name);
+        return getJavaDoc(BUILD_METHOD, name, false, pluginConfig, null) + getBuildForInterface(name);
     }
 
     /**
@@ -251,16 +253,21 @@
      */
     public static String getGetterString(JavaAttributeInfo attr, int generatedJavaFiles,
                                          YangPluginConfig pluginConfig) {
-
         String returnType = getReturnType(attr);
         String attributeName = attr.getAttributeName();
+        String appDataStructure = null;
+        if (attr.getCompilerAnnotation() != null) {
+            appDataStructure = attr.getCompilerAnnotation().getYangAppDataStructure().getDataStructure().name();
+        }
         if (generatedJavaFiles == GENERATE_SERVICE_AND_MANAGER) {
             return generateForGetMethodWithAttribute(returnType)
-                    + getGetterForInterface(attributeName, returnType, attr.isListAttr(), generatedJavaFiles);
+                    + getGetterForInterface(attributeName, returnType, attr.isListAttr(), generatedJavaFiles,
+                    attr.getCompilerAnnotation());
         }
 
-        return getJavaDoc(GETTER_METHOD, attributeName, attr.isListAttr(), pluginConfig)
-                + getGetterForInterface(attributeName, returnType, attr.isListAttr(), generatedJavaFiles);
+        return getJavaDoc(GETTER_METHOD, attributeName, attr.isListAttr(), pluginConfig, appDataStructure)
+                + getGetterForInterface(attributeName, returnType, attr.isListAttr(), generatedJavaFiles,
+                attr.getCompilerAnnotation());
     }
 
     /**
@@ -274,7 +281,6 @@
      */
     public static String getSetterString(JavaAttributeInfo attr, String className, int generatedJavaFiles,
                                          YangPluginConfig pluginConfig) {
-
         String attrType = getReturnType(attr);
         String attributeName = attr.getAttributeName();
         JavaDocGen.JavaDocType type;
@@ -284,8 +290,13 @@
             type = SETTER_METHOD;
         }
 
-        return getJavaDoc(type, attributeName, attr.isListAttr(), pluginConfig)
-                + getSetterForInterface(attributeName, attrType, className, attr.isListAttr(), generatedJavaFiles);
+        String appDataStructure = null;
+        if (attr.getCompilerAnnotation() != null) {
+            appDataStructure = attr.getCompilerAnnotation().getYangAppDataStructure().getDataStructure().name();
+        }
+        return getJavaDoc(type, attributeName, attr.isListAttr(), pluginConfig, appDataStructure)
+                + getSetterForInterface(attributeName, attrType, className, attr.isListAttr(), generatedJavaFiles,
+                attr.getCompilerAnnotation());
     }
 
     /**
@@ -296,7 +307,7 @@
      * @return constructor string
      */
     private static String getConstructorString(String name, YangPluginConfig pluginConfig) {
-        return getJavaDoc(CONSTRUCTOR, name, false, pluginConfig);
+        return getJavaDoc(CONSTRUCTOR, name, false, pluginConfig, null);
     }
 
     /**
@@ -309,9 +320,8 @@
      */
     public static String getDefaultConstructorString(String name, String modifierType,
                                                      YangPluginConfig pluginConfig) {
-        return getJavaDoc(DEFAULT_CONSTRUCTOR, name, false, pluginConfig)
-                + getDefaultConstructor(name, modifierType)
-                + NEW_LINE;
+        return getJavaDoc(DEFAULT_CONSTRUCTOR, name, false, pluginConfig, null)
+                + getDefaultConstructor(name, modifierType) + NEW_LINE;
     }
 
     /**
@@ -347,15 +357,14 @@
      * @return getter method for class
      */
     public static String getGetterForClass(JavaAttributeInfo attr, int generatedJavaFiles) {
-
         String attrQualifiedType = getReturnType(attr);
         String attributeName = attr.getAttributeName();
 
         if (!attr.isListAttr()) {
             return getGetter(attrQualifiedType, attributeName, generatedJavaFiles);
         }
-        String listAttr = getListString() + attrQualifiedType + DIAMOND_CLOSE_BRACKET;
-        return getGetter(listAttr, attributeName, generatedJavaFiles);
+        String attrParam = getListAttribute(attrQualifiedType, attr.getCompilerAnnotation());
+        return getGetter(attrParam, attributeName, generatedJavaFiles);
     }
 
     /**
@@ -379,7 +388,6 @@
                     EIGHT_SPACE_INDENTATION + RETURN + SPACE + name + SEMI_COLAN + NEW_LINE + FOUR_SPACE_INDENTATION
                     + CLOSE_CURLY_BRACKET;
         }
-
     }
 
     /*Provides string to return for type.*/
@@ -407,7 +415,6 @@
      * @return setter method for class
      */
     public static String getSetterForClass(JavaAttributeInfo attr, String className, int generatedJavaFiles) {
-
         String attrQualifiedType = getReturnType(attr);
         String attributeName = attr.getAttributeName();
         boolean isTypeNull = false;
@@ -417,8 +424,8 @@
         if (!attr.isListAttr()) {
             return getSetter(className, attributeName, attrQualifiedType, generatedJavaFiles, isTypeNull, false);
         }
-        String listAttr = getListString() + attrQualifiedType + DIAMOND_CLOSE_BRACKET;
-        return getSetter(className, attributeName, listAttr, generatedJavaFiles, isTypeNull, true);
+        String attrParam = getListAttribute(attrQualifiedType, attr.getCompilerAnnotation());
+        return getSetter(className, attributeName, attrParam, generatedJavaFiles, isTypeNull, true);
     }
 
     /**
@@ -508,15 +515,15 @@
      * @param returnType         return type of attribute
      * @param isList             is list attribute
      * @param generatedJavaFiles generated java files
+     * @param compilerAnnotation compiler annotation
      * @return getter method for interface
      */
     static String getGetterForInterface(String yangName, String returnType, boolean isList,
-                                        int generatedJavaFiles) {
-
+                                               int generatedJavaFiles, YangCompilerAnnotation compilerAnnotation) {
         if (!isList) {
             return getGetterInterfaceString(returnType, yangName, generatedJavaFiles);
         }
-        String listAttr = getListString() + returnType + DIAMOND_CLOSE_BRACKET;
+        String listAttr = getListAttribute(returnType, compilerAnnotation);
         return getGetterInterfaceString(listAttr, yangName, generatedJavaFiles);
     }
 
@@ -545,15 +552,17 @@
      * @param className          name of the java class being generated
      * @param isList             is list attribute
      * @param generatedJavaFiles generated java files
+     * @param compilerAnnotation compiler annotations
      * @return setter method for interface
      */
     static String getSetterForInterface(String attrName, String attrType, String className,
-                                        boolean isList, int generatedJavaFiles) {
-
+                                               boolean isList, int generatedJavaFiles,
+                                               YangCompilerAnnotation compilerAnnotation) {
         if (!isList) {
             return getSetterInterfaceString(className, attrName, attrType, generatedJavaFiles);
         }
-        String listAttr = getListString() + attrType + DIAMOND_CLOSE_BRACKET;
+
+        String listAttr = getListAttribute(attrType, compilerAnnotation);
         return getSetterInterfaceString(className, attrName, listAttr, generatedJavaFiles);
     }
 
@@ -592,7 +601,6 @@
      * @return return type
      */
     private static String getReturnType(JavaAttributeInfo attr) {
-
         String returnType = EMPTY_STRING;
         if (attr.isQualifiedName() && attr.getImportInfo().getPkgInfo() != null) {
             returnType = attr.getImportInfo().getPkgInfo() + PERIOD;
@@ -621,7 +629,6 @@
      * @return constructor string
      */
     static String getConstructorStart(String yangName, YangPluginConfig pluginConfig, boolean isRootNode) {
-
         String javadoc = getConstructorString(yangName, pluginConfig);
 
         String returnType = getCapitalCase(DEFAULT) + yangName;
@@ -644,7 +651,6 @@
      */
     public static String getConstructor(JavaAttributeInfo attr, int generatedJavaFiles,
                                         YangPluginConfig pluginConfig) {
-
         String attributeName = attr.getAttributeName();
         String constructor;
 
@@ -675,7 +681,6 @@
      */
     public static String getRpcServiceMethod(String rpcName, String inputName, String outputName,
                                              YangPluginConfig pluginConfig) {
-
         rpcName = getCamelCase(rpcName, pluginConfig.getConflictResolver());
         if (!inputName.equals(EMPTY_STRING)) {
             inputName = inputName + SPACE + RPC_INPUT_VAR_NAME;
@@ -695,7 +700,6 @@
      */
     public static String getRpcManagerMethod(String rpcName, String inputName, String outputName,
                                              YangPluginConfig pluginConfig) {
-
         rpcName = getCamelCase(rpcName, pluginConfig.getConflictResolver());
         if (!inputName.equals(EMPTY_STRING)) {
             inputName = inputName + SPACE + RPC_INPUT_VAR_NAME;
@@ -709,7 +713,6 @@
                     + NEW_LINE;
         }
         method += FOUR_SPACE_INDENTATION + CLOSE_CURLY_BRACKET;
-
         return method;
     }
 
@@ -1084,7 +1087,7 @@
      * @return from string method's open string
      */
     static String getFromStringMethodSignature(String className, YangPluginConfig pluginConfig) {
-        return getJavaDoc(FROM_METHOD, className, false, pluginConfig) + FOUR_SPACE_INDENTATION + PUBLIC + SPACE
+        return getJavaDoc(FROM_METHOD, className, false, pluginConfig, null) + FOUR_SPACE_INDENTATION + PUBLIC + SPACE
                 + STATIC + SPACE + className + SPACE + FROM_STRING_METHOD_NAME + OPEN_PARENTHESIS
                 + STRING_DATA_TYPE + SPACE + FROM_STRING_PARAM_NAME + CLOSE_PARENTHESIS + SPACE
                 + OPEN_CURLY_BRACKET + NEW_LINE;
@@ -1109,7 +1112,6 @@
      */
     public static String getFromStringMethod(JavaAttributeInfo attr,
                                              JavaAttributeInfo fromStringAttributeInfo) {
-
         return EIGHT_SPACE_INDENTATION + getTrySubString() + NEW_LINE + TWELVE_SPACE_INDENTATION
                 + getParsedSubString(attr, fromStringAttributeInfo) + NEW_LINE + TWELVE_SPACE_INDENTATION
                 + getReturnOfSubString() + NEW_LINE + EIGHT_SPACE_INDENTATION + getCatchSubString()
@@ -1152,7 +1154,6 @@
      */
     private static String getParsedSubString(JavaAttributeInfo attr,
                                              JavaAttributeInfo fromStringAttributeInfo) {
-
         String targetDataType = getReturnType(attr);
         if (fromStringAttributeInfo.getAttributeType().getDataType() == BITS) {
             String lines = targetDataType + SPACE + TMP_VAL + SPACE + EQUAL + SPACE + NEW + SPACE + targetDataType
@@ -1286,7 +1287,6 @@
      * @return equals method
      */
     public static String getEqualsMethod(JavaAttributeInfo attr) {
-
         String attributeName = attr.getAttributeName();
         return SIXTEEN_SPACE_INDENTATION + SPACE + OBJECT_STRING + SUFFIX_S + PERIOD + EQUALS_STRING + OPEN_PARENTHESIS
                 + attributeName + COMMA + SPACE + OTHER + PERIOD + attributeName + CLOSE_PARENTHESIS + SPACE + AND
@@ -1301,9 +1301,7 @@
      * @return of method string
      */
     static String getOfMethod(String name, JavaAttributeInfo attr) {
-
         String attrQualifiedType = getReturnType(attr);
-
         return FOUR_SPACE_INDENTATION + PUBLIC + SPACE + STATIC + SPACE + name + SPACE + OF + OPEN_PARENTHESIS
                 + attrQualifiedType + SPACE + VALUE + CLOSE_PARENTHESIS + SPACE + OPEN_CURLY_BRACKET + NEW_LINE
                 + EIGHT_SPACE_INDENTATION + RETURN + SPACE + NEW + SPACE + name + OPEN_PARENTHESIS + VALUE
@@ -1320,11 +1318,10 @@
      */
     public static String getOfMethodStringAndJavaDoc(JavaAttributeInfo attr, String generatedJavaClassName,
                                                      YangPluginConfig pluginConfig) {
-
         String attrType = getReturnType(attr);
         String attrName = attr.getAttributeName();
 
-        return getJavaDoc(OF_METHOD, generatedJavaClassName + " for type " + attrName, false, pluginConfig)
+        return getJavaDoc(OF_METHOD, generatedJavaClassName + " for type " + attrName, false, pluginConfig, null)
                 + getOfMethodString(attrType, generatedJavaClassName);
     }
 
@@ -1336,7 +1333,6 @@
      * @return of method's string
      */
     private static String getOfMethodString(String type, String className) {
-
         return FOUR_SPACE_INDENTATION + PUBLIC + SPACE + STATIC + SPACE + className + SPACE + OF + OPEN_PARENTHESIS
                 + type + SPACE + VALUE + CLOSE_PARENTHESIS + SPACE + OPEN_CURLY_BRACKET + NEW_LINE
                 + EIGHT_SPACE_INDENTATION + RETURN + SPACE + NEW + SPACE + className + OPEN_PARENTHESIS + VALUE
@@ -1354,11 +1350,9 @@
     public static String getTypeConstructorStringAndJavaDoc(JavaAttributeInfo attr,
                                                             String generatedJavaClassName,
                                                             YangPluginConfig pluginConfig) {
-
         String attrType = getReturnType(attr);
         String attrName = attr.getAttributeName();
-
-        return getJavaDoc(TYPE_CONSTRUCTOR, generatedJavaClassName + " for type " + attrName, false, pluginConfig)
+        return getJavaDoc(TYPE_CONSTRUCTOR, generatedJavaClassName + " for type " + attrName, false, pluginConfig, null)
                 + getTypeConstructorString(attrType, attrName, generatedJavaClassName);
     }
 
@@ -1376,7 +1370,6 @@
     public static String getTypeConstructorStringAndJavaDoc(JavaAttributeInfo attr1, JavaAttributeInfo
             attr2, String generatedJavaClassName, YangPluginConfig pluginConfig, ValidatorTypeForUnionTypes type,
                                                             boolean addFirst) {
-
         String attrType = getReturnType(attr1);
         String attrName1 = "";
         String attrName2 = "";
@@ -1387,8 +1380,13 @@
             attrName2 = attr2.getAttributeName();
         }
 
-        return getJavaDoc(TYPE_CONSTRUCTOR, generatedJavaClassName + " for type " + attrName1, false, pluginConfig)
-                + getTypeConstructorString(attrType, attrName1, attrName2, generatedJavaClassName, type, addFirst);
+        String appDataStructure = null;
+        if (attr1.getCompilerAnnotation() != null) {
+            appDataStructure = attr1.getCompilerAnnotation().getYangAppDataStructure().getDataStructure().name();
+        }
+        return getJavaDoc(TYPE_CONSTRUCTOR, generatedJavaClassName + " for type " + attrName1, false, pluginConfig,
+                appDataStructure) + getTypeConstructorString(attrType, attrName1,
+                attrName2, generatedJavaClassName, type, addFirst);
     }
 
     /**
@@ -1400,7 +1398,6 @@
      * @return type constructor string
      */
     private static String getTypeConstructorString(String type, String name, String className) {
-
         return FOUR_SPACE_INDENTATION + PUBLIC + SPACE + className + OPEN_PARENTHESIS + type + SPACE + VALUE
                 + CLOSE_PARENTHESIS + SPACE + OPEN_CURLY_BRACKET + NEW_LINE + EIGHT_SPACE_INDENTATION + THIS + PERIOD
                 + name + SPACE + EQUAL + SPACE + VALUE + SEMI_COLAN + NEW_LINE + FOUR_SPACE_INDENTATION
@@ -1417,7 +1414,6 @@
      */
     private static String getTypeConstructorString(String type, String attr1, String attr2, String className,
                                                    ValidatorTypeForUnionTypes validatorType, boolean addInt) {
-
         String constructor;
         constructor = FOUR_SPACE_INDENTATION + PUBLIC + SPACE + className + OPEN_PARENTHESIS + type + SPACE + VALUE
                 + CLOSE_PARENTHESIS + SPACE + OPEN_CURLY_BRACKET + NEW_LINE;
@@ -1501,7 +1497,7 @@
      * @return implementation of get YANG augment info
      */
     static String getYangAugmentInfoMapInterface(YangPluginConfig pluginConfig) {
-        return getJavaDoc(GETTER_METHOD, getSmallCase(YANG_AUGMENTED_INFO) + MAP, false, pluginConfig)
+        return getJavaDoc(GETTER_METHOD, getSmallCase(YANG_AUGMENTED_INFO) + MAP, false, pluginConfig, null)
                 + FOUR_SPACE_INDENTATION + MAP + DIAMOND_OPEN_BRACKET + CLASS_STRING + DIAMOND_OPEN_BRACKET +
                 QUESTION_MARK + DIAMOND_CLOSE_BRACKET + COMMA + SPACE + OBJECT_STRING + DIAMOND_CLOSE_BRACKET +
                 SPACE + getSmallCase(YANG_AUGMENTED_INFO) + MAP + OPEN_PARENTHESIS +
@@ -1559,7 +1555,6 @@
                 + CLOSE_PARENTHESIS + SPACE + OPEN_CURLY_BRACKET + NEW_LINE;
         int value;
         for (String str : enumList) {
-
             value = enumMap.get(str);
             method = method + TWELVE_SPACE_INDENTATION + CASE + SPACE + value + COLON + NEW_LINE
                     + SIXTEEN_SPACE_INDENTATION + RETURN + SPACE + getCapitalCase(className) + PERIOD
@@ -1569,7 +1564,7 @@
                 + RETURN + SPACE + NULL + SEMI_COLAN + NEW_LINE + EIGHT_SPACE_INDENTATION + CLOSE_CURLY_BRACKET
                 + NEW_LINE + FOUR_SPACE_INDENTATION + CLOSE_CURLY_BRACKET;
 
-        return getJavaDoc(OF_METHOD, getCapitalCase(className) + " for type " + attrName, false, pluginConfig)
+        return getJavaDoc(OF_METHOD, getCapitalCase(className) + " for type " + attrName, false, pluginConfig, null)
                 + method;
     }
 
@@ -1581,7 +1576,6 @@
      * @return parsed string
      */
     private static String getParseFromStringMethod(String targetDataType, YangType<?> yangType) {
-
         YangDataTypes type = yangType.getDataType();
 
         switch (type) {
@@ -1652,11 +1646,10 @@
             methods.append(method);
 
             method = getJavaDoc(MANAGER_SETTER_METHOD, AUGMENTED +
-                    getCapitalCase(parentName) + getCapitalCase(curNodeName), false, pluginConfig) +
+                    getCapitalCase(parentName) + getCapitalCase(curNodeName), false, pluginConfig, null) +
                     getSetterForInterface(getSmallCase(AUGMENTED) + parentName +
-                                    getCapitalCase(curNodeName), returnType, parentName,
-                            false,
-                            GENERATE_SERVICE_AND_MANAGER) + NEW_LINE;
+                                    getCapitalCase(curNodeName), returnType, parentName, false,
+                                    GENERATE_SERVICE_AND_MANAGER, null) + NEW_LINE;
             methods.append(method);
         }
         return methods.toString();
@@ -1968,4 +1961,30 @@
                 "        return this;\n" +
                 "    }\n";
     }
+
+    private static String getListAttribute(String attrType, YangCompilerAnnotation compilerAnnotation) {
+        String listAttr;
+        if (compilerAnnotation != null && compilerAnnotation.getYangAppDataStructure() != null) {
+            switch (compilerAnnotation.getYangAppDataStructure().getDataStructure()) {
+                case QUEUE: {
+                    listAttr = QUEUE + DIAMOND_OPEN_BRACKET + attrType + DIAMOND_CLOSE_BRACKET;
+                    break;
+                }
+                case SET: {
+                    listAttr = SET + DIAMOND_OPEN_BRACKET + attrType + DIAMOND_CLOSE_BRACKET;
+                    break;
+                }
+                case LIST: {
+                    listAttr = getListString() + attrType + DIAMOND_CLOSE_BRACKET;
+                    break;
+                }
+                default: {
+                    listAttr = getListString() + attrType + DIAMOND_CLOSE_BRACKET;
+                }
+            }
+        } else {
+            listAttr = getListString() + attrType + DIAMOND_CLOSE_BRACKET;
+        }
+        return listAttr;
+    }
 }
diff --git a/plugin/src/main/java/org/onosproject/yangutils/utils/UtilConstants.java b/plugin/src/main/java/org/onosproject/yangutils/utils/UtilConstants.java
index 6c2f3dc..23dacfe 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/utils/UtilConstants.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/utils/UtilConstants.java
@@ -1271,7 +1271,17 @@
     public static final String LIST = "List";
 
     /**
-     * Comment to be added for auto generated impl methods.
+     * Static attribute for queue.
+     */
+    public static final String QUEUE = "Queue";
+
+    /**
+     * Static attribute for set.
+     */
+    public static final String SET = "Set";
+
+    /**
+     * Comment to be added for autogenerated impl methods.
      */
     public static final String YANG_UTILS_TODO = "//TODO: YANG utils generated code";
 
diff --git a/plugin/src/main/java/org/onosproject/yangutils/utils/io/impl/JavaDocGen.java b/plugin/src/main/java/org/onosproject/yangutils/utils/io/impl/JavaDocGen.java
index d71d882..31e454f 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/utils/io/impl/JavaDocGen.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/utils/io/impl/JavaDocGen.java
@@ -65,8 +65,10 @@
 import static org.onosproject.yangutils.utils.UtilConstants.PACKAGE_INFO_JAVADOC;
 import static org.onosproject.yangutils.utils.UtilConstants.PACKAGE_INFO_JAVADOC_OF_CHILD;
 import static org.onosproject.yangutils.utils.UtilConstants.PERIOD;
+import static org.onosproject.yangutils.utils.UtilConstants.QUEUE;
 import static org.onosproject.yangutils.utils.UtilConstants.RPC_INPUT_STRING;
 import static org.onosproject.yangutils.utils.UtilConstants.RPC_OUTPUT_STRING;
+import static org.onosproject.yangutils.utils.UtilConstants.SET;
 import static org.onosproject.yangutils.utils.UtilConstants.SPACE;
 import static org.onosproject.yangutils.utils.UtilConstants.STRING_DATA_TYPE;
 import static org.onosproject.yangutils.utils.UtilConstants.VALUE;
@@ -93,9 +95,11 @@
      * @param name         name of the YangNode
      * @param isList       is list attribute
      * @param pluginConfig plugin configurations
-     * @return javaDocs.
+     * @param compilerAnnotation compiler annotations for user defined data type
+     * @return javadocs.
      */
-    public static String getJavaDoc(JavaDocType type, String name, boolean isList, YangPluginConfig pluginConfig) {
+    public static String getJavaDoc(JavaDocType type, String name, boolean isList, YangPluginConfig pluginConfig,
+            String compilerAnnotation) {
 
         name = YangIoUtils.getSmallCase(getCamelCase(name, pluginConfig.getConflictResolver()));
         switch (type) {
@@ -121,16 +125,16 @@
                 return generateForPackage(name, isList);
             }
             case GETTER_METHOD: {
-                return generateForGetters(name, isList);
+                return generateForGetters(name, isList, compilerAnnotation);
             }
             case TYPE_DEF_SETTER_METHOD: {
                 return generateForTypeDefSetter(name);
             }
             case SETTER_METHOD: {
-                return generateForSetters(name, isList);
+                return generateForSetters(name, isList, compilerAnnotation);
             }
             case MANAGER_SETTER_METHOD: {
-                return generateForManagerSetters(name, isList);
+                return generateForManagerSetters(name, isList, compilerAnnotation);
             }
             case OF_METHOD: {
                 return generateForOf(name);
@@ -277,16 +281,39 @@
      *
      * @param attribute attribute
      * @param isList    is list attribute
+     * @param compilerAnnotation compiler annotation
      * @return javaDocs
      */
-    private static String generateForGetters(String attribute, boolean isList) {
+    private static String generateForGetters(String attribute, boolean isList,
+            String compilerAnnotation) {
 
         String getter = NEW_LINE + FOUR_SPACE_INDENTATION + JAVA_DOC_FIRST_LINE + FOUR_SPACE_INDENTATION
                 + JAVA_DOC_GETTERS + attribute + PERIOD + NEW_LINE + FOUR_SPACE_INDENTATION + NEW_LINE_ASTERISK
                 + FOUR_SPACE_INDENTATION + JAVA_DOC_RETURN;
         if (isList) {
-            String listAttribute = LIST.toLowerCase() + SPACE + OF + SPACE;
-            getter = getter + listAttribute;
+            String attrParam;
+            if (compilerAnnotation != null) {
+                switch (compilerAnnotation) {
+                    case QUEUE: {
+                        attrParam = QUEUE.toLowerCase() + SPACE + OF + SPACE;
+                        break;
+                    }
+                    case SET: {
+                        attrParam = SET.toLowerCase() + SPACE + OF + SPACE;
+                        break;
+                    }
+                    case LIST: {
+                        attrParam = LIST.toLowerCase() + SPACE + OF + SPACE;
+                        break;
+                    }
+                    default: {
+                        attrParam = LIST.toLowerCase() + SPACE + OF + SPACE;
+                    }
+                }
+            } else {
+                attrParam = LIST.toLowerCase() + SPACE + OF + SPACE;
+            }
+            getter = getter + attrParam;
         } else {
             getter = getter + VALUE + SPACE + OF + SPACE;
         }
@@ -300,16 +327,41 @@
      *
      * @param attribute attribute
      * @param isList    is list attribute
+     * @param compilerAnnotation compiler annotation
      * @return javaDocs
      */
-    private static String generateForSetters(String attribute, boolean isList) {
+    private static String generateForSetters(String attribute, boolean isList,
+            String compilerAnnotation) {
 
         String setter = NEW_LINE + FOUR_SPACE_INDENTATION + JAVA_DOC_FIRST_LINE + FOUR_SPACE_INDENTATION
                 + JAVA_DOC_SETTERS + attribute + PERIOD + NEW_LINE + FOUR_SPACE_INDENTATION + NEW_LINE_ASTERISK
                 + FOUR_SPACE_INDENTATION + JAVA_DOC_PARAM + attribute + SPACE;
-        if (isList) {
-            String listAttribute = LIST.toLowerCase() + SPACE + OF + SPACE;
-            setter = setter + listAttribute;
+
+        String attributeParam;
+        if (compilerAnnotation != null) {
+            switch (compilerAnnotation) {
+                case QUEUE: {
+                    attributeParam = QUEUE.toLowerCase() + SPACE + OF + SPACE;
+                    setter = setter + attributeParam;
+                    break;
+                }
+                case SET: {
+                    attributeParam = SET.toLowerCase() + SPACE + OF + SPACE;
+                    setter = setter + attributeParam;
+                    break;
+                }
+                case LIST: {
+                    attributeParam = LIST.toLowerCase() + SPACE + OF + SPACE;
+                    setter = setter + attributeParam;
+                    break;
+                }
+                default: {
+
+                }
+            }
+        } else if (isList) {
+            attributeParam = LIST.toLowerCase() + SPACE + OF + SPACE;
+            setter = setter + attributeParam;
         } else {
             setter = setter + VALUE + SPACE + OF + SPACE;
         }
@@ -324,16 +376,41 @@
      *
      * @param attribute attribute
      * @param isList    is list attribute
+     * @param compilerAnnotation compiler annotation
      * @return javaDocs
      */
-    private static String generateForManagerSetters(String attribute, boolean isList) {
+    private static String generateForManagerSetters(String attribute, boolean isList,
+            String compilerAnnotation) {
 
         String setter = NEW_LINE + FOUR_SPACE_INDENTATION + JAVA_DOC_FIRST_LINE + FOUR_SPACE_INDENTATION
                 + JAVA_DOC_MANAGER_SETTERS + attribute + PERIOD + NEW_LINE + FOUR_SPACE_INDENTATION + NEW_LINE_ASTERISK
                 + FOUR_SPACE_INDENTATION + JAVA_DOC_PARAM + attribute + SPACE;
-        if (isList) {
-            String listAttribute = LIST.toLowerCase() + SPACE + OF + SPACE;
-            setter = setter + listAttribute;
+
+        String attributeParam;
+        if (compilerAnnotation != null) {
+            switch (compilerAnnotation) {
+                case QUEUE: {
+                    attributeParam = QUEUE.toLowerCase() + SPACE + OF + SPACE;
+                    setter = setter + attributeParam;
+                    break;
+                }
+                case SET: {
+                    attributeParam = SET.toLowerCase() + SPACE + OF + SPACE;
+                    setter = setter + attributeParam;
+                    break;
+                }
+                case LIST: {
+                    attributeParam = LIST.toLowerCase() + SPACE + OF + SPACE;
+                    setter = setter + attributeParam;
+                    break;
+                }
+                default: {
+
+                }
+            }
+        } else if (isList) {
+            attributeParam = LIST.toLowerCase() + SPACE + OF + SPACE;
+            setter = setter + attributeParam;
         } else {
             setter = setter + VALUE + SPACE + OF + SPACE;
         }
diff --git a/plugin/src/main/java/org/onosproject/yangutils/utils/io/impl/YangIoUtils.java b/plugin/src/main/java/org/onosproject/yangutils/utils/io/impl/YangIoUtils.java
index 5901f25..1c1de71 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/utils/io/impl/YangIoUtils.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/utils/io/impl/YangIoUtils.java
@@ -130,7 +130,8 @@
             BufferedWriter bufferedWriter = new BufferedWriter(fileWriter);
 
             bufferedWriter.write(getCopyrightHeader());
-            bufferedWriter.write(getJavaDoc(PACKAGE_INFO, classInfo, isChildNode, pluginConfig));
+            //TODO: get the compiler annotations and pass the info
+            bufferedWriter.write(getJavaDoc(PACKAGE_INFO, classInfo, isChildNode, pluginConfig, null));
             String pkg = PACKAGE + SPACE + pack + SEMI_COLAN;
             if (pkg.length() > LINE_SIZE) {
                 pkg = whenDelimiterIsPresent(pkg, LINE_SIZE);
diff --git a/plugin/src/main/resources/YangLexer.g4 b/plugin/src/main/resources/YangLexer.g4
index 8abe32f..51a9231 100644
--- a/plugin/src/main/resources/YangLexer.g4
+++ b/plugin/src/main/resources/YangLexer.g4
@@ -133,7 +133,7 @@
     PLUS : '+';
     MINUS: '-';
 
-    STRING : ((~( '\r' | '\n' | '\t' | ' ' | ';' | '{' | '"' | '\'')~( '\r' | '\n' | '\t' | ' ' | ';' | '{' )* ) | SUB_STRING );
+    STRING : ((~( '\r' | '\n' | '\t' | ' ' | ';' | '{' | '"' | '+' | '\'')~( '\r' | '\n' | '\t' | ' ' | ';' | '{' | '+')* ) | SUB_STRING );
 
     //Fragment rules
     fragment SUB_STRING : ('"' (ESC | ~["])*'"') | ('\'' (ESC | ~['])*'\'') ;
diff --git a/plugin/src/test/java/org/onosproject/yangutils/parser/impl/listeners/CompilerAnnotationListenerTest.java b/plugin/src/test/java/org/onosproject/yangutils/parser/impl/listeners/CompilerAnnotationListenerTest.java
deleted file mode 100644
index cbc4009..0000000
--- a/plugin/src/test/java/org/onosproject/yangutils/parser/impl/listeners/CompilerAnnotationListenerTest.java
+++ /dev/null
@@ -1,69 +0,0 @@
-/*
- * Copyright 2016-present Open Networking Laboratory
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *     http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-package org.onosproject.yangutils.parser.impl.listeners;
-
-import java.io.IOException;
-import org.junit.Test;
-import org.onosproject.yangutils.datamodel.YangAppDataStructure;
-import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
-import org.onosproject.yangutils.datamodel.YangDataStructure;
-import org.onosproject.yangutils.datamodel.YangModule;
-import org.onosproject.yangutils.datamodel.YangNode;
-import org.onosproject.yangutils.datamodel.YangNodeType;
-import org.onosproject.yangutils.parser.exceptions.ParserException;
-import org.onosproject.yangutils.parser.impl.YangUtilsParserManager;
-
-import static org.hamcrest.MatcherAssert.assertThat;
-import static org.hamcrest.core.Is.is;
-
-/**
- * Test cases for compiler annotation listener.
- */
-public class CompilerAnnotationListenerTest {
-
-    private final YangUtilsParserManager manager = new YangUtilsParserManager();
-
-    /**
-     * Checks valid compiler annotation statements.
-     */
-    @Test
-    public void processValidCompilerAnnotation() throws IOException, ParserException {
-
-        YangNode node = manager.getDataModel("src/test/resources/ValidCompilerAnnotation.yang");
-
-        // Check whether the data model tree returned is of type module.
-        assertThat((node instanceof YangModule), is(true));
-
-        // Check whether the node type is set properly to module.
-        assertThat(node.getNodeType(), is(YangNodeType.MODULE_NODE));
-
-        // Check whether the module name is set correctly.
-        YangModule yangNode = (YangModule) node;
-        assertThat(yangNode.getName(), is("event"));
-
-        YangCompilerAnnotation compilerAnnotation = yangNode.getCompilerAnnotationList()
-                .iterator().next();
-        assertThat(compilerAnnotation.getPrefix(), is("ca"));
-        assertThat(compilerAnnotation.getPath(), is("/candidate-servers/server"));
-
-        YangAppDataStructure appDataStructure = compilerAnnotation.getYangAppDataStructure();
-        assertThat(appDataStructure.getPrefix(), is("abc"));
-        assertThat(appDataStructure.getDataStructure(), is(YangDataStructure.MAP));
-
-        assertThat(appDataStructure.getKeyList().iterator().next(), is("name"));
-    }
-}
diff --git a/plugin/src/test/java/org/onosproject/yangutils/parser/impl/listeners/TypeListenerTest.java b/plugin/src/test/java/org/onosproject/yangutils/parser/impl/listeners/TypeListenerTest.java
index b6b497a..60da95e 100644
--- a/plugin/src/test/java/org/onosproject/yangutils/parser/impl/listeners/TypeListenerTest.java
+++ b/plugin/src/test/java/org/onosproject/yangutils/parser/impl/listeners/TypeListenerTest.java
@@ -21,6 +21,8 @@
 import org.junit.Test;
 import org.junit.rules.ExpectedException;
 import org.onosproject.yangutils.datamodel.YangContainer;
+import org.onosproject.yangutils.datamodel.YangLeafRef;
+import org.onosproject.yangutils.datamodel.YangTypeDef;
 import org.onosproject.yangutils.datamodel.utils.builtindatatype.YangDataTypes;
 import org.onosproject.yangutils.datamodel.YangLeaf;
 import org.onosproject.yangutils.datamodel.YangLeafList;
@@ -147,4 +149,25 @@
         assertThat(leafInfo.getDataType().getDataTypeName(), is("instance-identifier"));
         assertThat(leafInfo.getDataType().getDataType(), is(YangDataTypes.INSTANCE_IDENTIFIER));
     }
+
+    /**
+     * Checks for leaf ref path concatenation.
+     */
+    @Test
+    public void processLeafRefPathConcatenation() throws IOException, ParserException {
+
+        YangNode node = manager
+                .getDataModel("src/test/resources/leafRefPathConcatenation.yang");
+
+        assertThat((node instanceof YangModule), is(true));
+        assertThat(node.getNodeType(), is(YangNodeType.MODULE_NODE));
+        YangModule yangNode = (YangModule) node;
+        assertThat(yangNode.getName(), is("test"));
+
+        YangTypeDef typeDef = (YangTypeDef) yangNode.getChild();
+        assertThat(typeDef.getName(), is("isis-instance-state-ref"));
+        assertThat(typeDef.getTypeDefBaseType().getDataType(), is(YangDataTypes.LEAFREF));
+        YangLeafRef leafRef = ((YangLeafRef) typeDef.getTypeDefBaseType().getDataTypeExtendedInfo());
+        assertThat(leafRef.getPath(), is("/isis-prefix-ipv4-std/default-metric"));
+    }
 }
diff --git a/plugin/src/test/java/org/onosproject/yangutils/translator/tojava/utils/JavaCodeSnippetGenTest.java b/plugin/src/test/java/org/onosproject/yangutils/translator/tojava/utils/JavaCodeSnippetGenTest.java
index e5021d3..9413e3c 100644
--- a/plugin/src/test/java/org/onosproject/yangutils/translator/tojava/utils/JavaCodeSnippetGenTest.java
+++ b/plugin/src/test/java/org/onosproject/yangutils/translator/tojava/utils/JavaCodeSnippetGenTest.java
@@ -103,23 +103,23 @@
     public void testForJavaAttributeInfo() {
 
         String attributeWithoutTypePkg = getJavaAttributeDefinition(null, STRING_DATA_TYPE, YANG_NAME,
-                false, PRIVATE);
+                false, PRIVATE, null);
         assertThat(true, is(attributeWithoutTypePkg.equals(
                 PRIVATE + SPACE + STRING_DATA_TYPE + SPACE + YANG_NAME + SEMI_COLAN + NEW_LINE)));
 
         String attributeWithTypePkg = getJavaAttributeDefinition(JAVA_LANG, STRING_DATA_TYPE, YANG_NAME,
-                false, PRIVATE);
+                false, PRIVATE, null);
         assertThat(true, is(attributeWithTypePkg.equals(PRIVATE + SPACE + JAVA_LANG + PERIOD
                 + STRING_DATA_TYPE + SPACE + YANG_NAME + SEMI_COLAN + NEW_LINE)));
 
         String attributeWithListPkg = getJavaAttributeDefinition(JAVA_LANG, STRING_DATA_TYPE, YANG_NAME,
-                true, PRIVATE);
+                true, PRIVATE, null);
         assertThat(true, is(attributeWithListPkg.contains(
                 PRIVATE + SPACE + LIST + DIAMOND_OPEN_BRACKET + JAVA_LANG + PERIOD + STRING_DATA_TYPE
                         + DIAMOND_CLOSE_BRACKET + SPACE + YANG_NAME)));
 
         String attributeWithListWithoutPkg = getJavaAttributeDefinition(null, STRING_DATA_TYPE, YANG_NAME,
-                true, PRIVATE);
+                true, PRIVATE, null);
         assertThat(true, is(attributeWithListWithoutPkg.contains(
                 PRIVATE + SPACE + LIST + DIAMOND_OPEN_BRACKET + STRING_DATA_TYPE + DIAMOND_CLOSE_BRACKET + SPACE
                         + YANG_NAME)));
diff --git a/plugin/src/test/java/org/onosproject/yangutils/translator/tojava/utils/MethodsGeneratorTest.java b/plugin/src/test/java/org/onosproject/yangutils/translator/tojava/utils/MethodsGeneratorTest.java
index cbac365..9579b7d 100644
--- a/plugin/src/test/java/org/onosproject/yangutils/translator/tojava/utils/MethodsGeneratorTest.java
+++ b/plugin/src/test/java/org/onosproject/yangutils/translator/tojava/utils/MethodsGeneratorTest.java
@@ -221,7 +221,7 @@
      */
     @Test
     public void getGetterForInterfaceTest() {
-        String method = getGetterForInterface(CLASS_NAME, STRING_DATA_TYPE, false, GENERATE_SERVICE_AND_MANAGER);
+        String method = getGetterForInterface(CLASS_NAME, STRING_DATA_TYPE, false, GENERATE_SERVICE_AND_MANAGER, null);
         assertThat(true, is(method.contains(STRING_DATA_TYPE + SPACE + GET_METHOD_PREFIX)));
     }
 
@@ -244,7 +244,7 @@
     @Test
     public void getSetterForInterfaceTest() {
         String method = getSetterForInterface(CLASS_NAME, STRING_DATA_TYPE, CLASS_NAME, false,
-                GENERATE_SERVICE_AND_MANAGER);
+                GENERATE_SERVICE_AND_MANAGER, null);
         assertThat(true, is(method.contains(VOID + SPACE +
                 SET_METHOD_PREFIX + "Testname")));
     }
diff --git a/plugin/src/test/java/org/onosproject/yangutils/utils/io/impl/JavaDocGenTest.java b/plugin/src/test/java/org/onosproject/yangutils/utils/io/impl/JavaDocGenTest.java
index e229fed..eb2a674 100644
--- a/plugin/src/test/java/org/onosproject/yangutils/utils/io/impl/JavaDocGenTest.java
+++ b/plugin/src/test/java/org/onosproject/yangutils/utils/io/impl/JavaDocGenTest.java
@@ -56,7 +56,7 @@
      */
     @Test
     public void builderClassGenerationTest() {
-        String builderClassJavaDoc = getJavaDoc(BUILDER_CLASS, TEST_NAME, false, getStubPluginConfig());
+        String builderClassJavaDoc = getJavaDoc(BUILDER_CLASS, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true, is(builderClassJavaDoc.contains("Represents the builder implementation of")
                 && builderClassJavaDoc.contains(END_STRING)));
     }
@@ -66,7 +66,7 @@
      */
     @Test
     public void builderInterfaceGenerationTest() {
-        String builderInterfaceJavaDoc = getJavaDoc(BUILDER_INTERFACE, TEST_NAME, false, getStubPluginConfig());
+        String builderInterfaceJavaDoc = getJavaDoc(BUILDER_INTERFACE, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true,
                 is(builderInterfaceJavaDoc.contains("Builder for")
                         && builderInterfaceJavaDoc.contains(END_STRING)));
@@ -77,7 +77,7 @@
      */
     @Test
     public void buildGenerationTest() {
-        String buildDoc = getJavaDoc(BUILD_METHOD, TEST_NAME, false, getStubPluginConfig());
+        String buildDoc = getJavaDoc(BUILD_METHOD, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true, is(buildDoc.contains("Builds object of") && buildDoc.contains(END_STRING)));
     }
 
@@ -109,7 +109,7 @@
      */
     @Test
     public void constructorGenerationTest() {
-        String constructorDoc = getJavaDoc(CONSTRUCTOR, TEST_NAME, false, getStubPluginConfig());
+        String constructorDoc = getJavaDoc(CONSTRUCTOR, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true,
                 is(constructorDoc.contains("Creates an instance of ")
                         && constructorDoc.contains("builder object of")
@@ -121,7 +121,7 @@
      */
     @Test
     public void defaultConstructorGenerationTest() {
-        String defaultConstructorDoc = getJavaDoc(DEFAULT_CONSTRUCTOR, TEST_NAME, false, getStubPluginConfig());
+        String defaultConstructorDoc = getJavaDoc(DEFAULT_CONSTRUCTOR, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true, is(defaultConstructorDoc.contains("Creates an instance of ")
                 && defaultConstructorDoc.contains(END_STRING)));
     }
@@ -131,7 +131,7 @@
      */
     @Test
     public void getterGenerationTest() {
-        String getterJavaDoc = getJavaDoc(GETTER_METHOD, TEST_NAME, false, getStubPluginConfig());
+        String getterJavaDoc = getJavaDoc(GETTER_METHOD, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true,
                 is(getterJavaDoc.contains("Returns the attribute") && getterJavaDoc.contains(END_STRING)));
     }
@@ -141,7 +141,7 @@
      */
     @Test
     public void implClassGenerationTest() {
-        String implClassJavaDoc = getJavaDoc(IMPL_CLASS, TEST_NAME, false, getStubPluginConfig());
+        String implClassJavaDoc = getJavaDoc(IMPL_CLASS, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true,
                 is(implClassJavaDoc.contains("Represents the implementation of")
                         && implClassJavaDoc.contains(END_STRING)));
@@ -152,7 +152,7 @@
      */
     @Test
     public void interfaceGenerationTest() {
-        String interfaceJavaDoc = getJavaDoc(INTERFACE, TEST_NAME, false, getStubPluginConfig());
+        String interfaceJavaDoc = getJavaDoc(INTERFACE, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true,
                 is(interfaceJavaDoc.contains("Abstraction of an entity which represents the functionality of")
                         && interfaceJavaDoc.contains(END_STRING)));
@@ -163,7 +163,7 @@
      */
     @Test
     public void packageInfoGenerationTest() {
-        String packageInfo = getJavaDoc(PACKAGE_INFO, TEST_NAME, false, getStubPluginConfig());
+        String packageInfo = getJavaDoc(PACKAGE_INFO, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true,
                 is(packageInfo.contains("Implementation of YANG node") && packageInfo.contains(END_STRING)));
     }
@@ -173,7 +173,7 @@
      */
     @Test
     public void packageInfoGenerationForChildNodeTest() {
-        String packageInfo = getJavaDoc(PACKAGE_INFO, TEST_NAME, true, getStubPluginConfig());
+        String packageInfo = getJavaDoc(PACKAGE_INFO, TEST_NAME, true, getStubPluginConfig(), null);
         assertThat(true, is(packageInfo.contains("Implementation of YANG node testName's children nodes")
                 && packageInfo.contains(END_STRING)));
     }
@@ -183,7 +183,7 @@
      */
     @Test
     public void setterGenerationTest() {
-        String setterJavaDoc = getJavaDoc(SETTER_METHOD, TEST_NAME, false, getStubPluginConfig());
+        String setterJavaDoc = getJavaDoc(SETTER_METHOD, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true,
                 is(setterJavaDoc.contains("Returns the builder object of") && setterJavaDoc.contains(END_STRING)));
     }
@@ -193,7 +193,7 @@
      */
     @Test
     public void typeDefSetterGenerationTest() {
-        String typeDefSetter = getJavaDoc(TYPE_DEF_SETTER_METHOD, TEST_NAME, false, getStubPluginConfig());
+        String typeDefSetter = getJavaDoc(TYPE_DEF_SETTER_METHOD, TEST_NAME, false, getStubPluginConfig(), null);
         assertThat(true, is(typeDefSetter.contains("Sets the value of") && typeDefSetter.contains(END_STRING)));
     }
 
diff --git a/plugin/src/test/resources/ValidCompilerAnnotation.yang b/plugin/src/test/resources/ValidCompilerAnnotation.yang
deleted file mode 100644
index 7913fab..0000000
--- a/plugin/src/test/resources/ValidCompilerAnnotation.yang
+++ /dev/null
@@ -1,13 +0,0 @@
-module event {
-
-    namespace "http://example.com/event";
-    prefix "ev";
-
-    ca:compiler-annotation "/candidate-servers/server" {
-        abc:app-data-structure "map" {
-            ca:key "name";
-        }
-       xyz:app-extended-name "special-server";
-    }
-}
-
diff --git a/plugin/src/test/resources/leafRefPathConcatenation.yang b/plugin/src/test/resources/leafRefPathConcatenation.yang
new file mode 100644
index 0000000..a9b688e
--- /dev/null
+++ b/plugin/src/test/resources/leafRefPathConcatenation.yang
@@ -0,0 +1,20 @@
+module test {
+    namespace "urn:ietf:params:xml:ns:yang:ietf-isis";
+    prefix isis;
+    typedef isis-instance-state-ref {
+        type leafref {
+            path "/isis-prefix-ipv4-std/"
+            +"default-metric";
+        }
+    }
+    container isis-route-content {
+        leaf metric {
+            type isis-instance-state-ref ;
+        }
+    }
+    container isis-prefix-ipv4-std {
+        leaf default-metric {
+            type string;
+        }
+    }
+}
\ No newline at end of file