[ONOS-4941][ONOS-4883][ONOS-4979]Grouping and uses interfile linking issue + defect fix
Change-Id: I5e8145f05d3ef570d4ecbbe885c93de172de0ea3
diff --git a/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangLinkerManager.java b/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangLinkerManager.java
index 508ec54..754801b 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangLinkerManager.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangLinkerManager.java
@@ -172,7 +172,7 @@
((YangReferenceResolver) yangNode)
.resolveInterFileLinking(ResolvableType.YANG_USES);
((YangReferenceResolver) yangNode)
- .resolveInterFileLinking(ResolvableType.YANG_AUGMENT);
+ .resolveInterFileLinking(ResolvableType.YANG_AUGMENT);
((YangReferenceResolver) yangNode)
.resolveInterFileLinking(ResolvableType.YANG_DERIVED_DATA_TYPE);
((YangReferenceResolver) yangNode)
diff --git a/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangResolutionInfoImpl.java b/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangResolutionInfoImpl.java
index 5c680cd..d7f0428 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangResolutionInfoImpl.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/linker/impl/YangResolutionInfoImpl.java
@@ -1594,11 +1594,7 @@
if (linkedNode != null) {
// Add the link to external entity.
addReferredEntityLink(linkedNode, INTER_FILE_LINKED);
- /*
- * Update the current reference resolver to external
- * module/sub-module containing the referred typedef/grouping.
- */
- setCurReferenceResolver((YangReferenceResolver) yangInclude.getIncludedNode());
+
// Add the type/uses of referred typedef/grouping to the stack.
addUnresolvedRecursiveReferenceToStack(linkedNode);
return true;
@@ -1641,12 +1637,7 @@
if (linkedNode != null) {
// Add the link to external entity.
addReferredEntityLink(linkedNode, INTER_FILE_LINKED);
- /*
- * Update the current reference resolver to external
- * module/sub-module containing the referred
- * typedef/grouping.
- */
- setCurReferenceResolver((YangReferenceResolver) yangImport.getImportedNode());
+
// Add the type/uses of referred typedef/grouping to the
// stack.
addUnresolvedRecursiveReferenceToStack(linkedNode);
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/antlrgencode/GeneratedYangListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/antlrgencode/GeneratedYangListener.java
index 5e55e15..72e7995 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/parser/antlrgencode/GeneratedYangListener.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/antlrgencode/GeneratedYangListener.java
@@ -1835,136 +1835,94 @@
void exitCompilerAnnotationStatement(GeneratedYangParser.CompilerAnnotationStatementContext currentContext);
/**
- * Enters a parse tree produced by GeneratedYangParser for grammar rule annotation statement.
+ * Enters a parse tree produced by GeneratedYangParser for grammar rule compiler annotation body statement.
*
* @param currentContext current context in the parsed tree
*/
- void enterAnnotationStatement(GeneratedYangParser.AnnotationStatementContext currentContext);
-
- /**
- * Exits a parse tree produced by GeneratedYangParser for grammar rule annotation statement.
- *
- * @param currentContext current context in the parsed tree
- */
- void exitAnnotationStatement(GeneratedYangParser.AnnotationStatementContext currentContext);
-
- /**
- * Enters a parse tree produced by GeneratedYangParser for grammar rule annotation type.
- *
- * @param currentContext current context in the parsed tree
- */
- void enterAnnotationType(GeneratedYangParser.AnnotationTypeContext currentContext);
-
- /**
- * Exits a parse tree produced by GeneratedYangParser for grammar rule annotation type.
- *
- * @param currentContext current context in the parsed tree
- */
- void exitAnnotationType(GeneratedYangParser.AnnotationTypeContext currentContext);
-
- /**
- * Enters a parse tree produced by GeneratedYangParser for grammar rule
- * annotation parameter specification.
- *
- * @param currentContext current context in the parsed tree
- */
- void enterAnnotationParameterSpecification(GeneratedYangParser.AnnotationParameterSpecificationContext
- currentContext);
-
- /**
- * Exits a parse tree produced by GeneratedYangParser for grammar rule
- * annotation parameter specification.
- *
- * @param currentContext current context in the parsed tree
- */
- void exitAnnotationParameterSpecification(GeneratedYangParser.AnnotationParameterSpecificationContext
+ void enterCompilerAnnotationBodyStatement(GeneratedYangParser.CompilerAnnotationBodyStatementContext
currentContext);
/**
- * Enters a parse tree produced by GeneratedYangParser for grammar rule
- * annotation parameter specification argument.
+ * Exits a parse tree produced by GeneratedYangParser for grammar rule compiler annotation body statement.
*
* @param currentContext current context in the parsed tree
*/
- void enterAnnotationParameterSpecificationArg(GeneratedYangParser.AnnotationParameterSpecificationArgContext
- currentContext);
+ void exitCompilerAnnotationBodyStatement(GeneratedYangParser.CompilerAnnotationBodyStatementContext
+ currentContext);
/**
- * Exits a parse tree produced by GeneratedYangParser for grammar rule
- * annotation parameter specification argument.
+ * Enters a parse tree produced by GeneratedYangParser for grammar rule app data structure statement.
*
* @param currentContext current context in the parsed tree
*/
- void exitAnnotationParameterSpecificationArg(GeneratedYangParser.AnnotationParameterSpecificationArgContext
- currentContext);
+ void enterAppDataStructureStatement(GeneratedYangParser.AppDataStructureStatementContext
+ currentContext);
/**
- * Enters a parse tree produced by GeneratedYangParser for grammar rule annotation parameter instance.
+ * Exits a parse tree produced by GeneratedYangParser for grammar rule app data structure statement.
*
* @param currentContext current context in the parsed tree
*/
- void enterAnnotationParaInstance(GeneratedYangParser.AnnotationParaInstanceContext
- currentContext);
+ void exitAppDataStructureStatement(GeneratedYangParser.AppDataStructureStatementContext currentContext);
/**
- * Exits a parse tree produced by GeneratedYangParser for grammar rule annotation parameter instance.
+ * Enters a parse tree produced by GeneratedYangParser for grammar rule app data structure.
*
* @param currentContext current context in the parsed tree
*/
- void exitAnnotationParaInstance(GeneratedYangParser.AnnotationParaInstanceContext
- currentContext);
+ void enterAppDataStructure(GeneratedYangParser.AppDataStructureContext currentContext);
+
+ /**
+ * Exits a parse tree produced by GeneratedYangParser for grammar rule app data strcuture.
+ *
+ * @param currentContext current context in the parsed tree
+ */
+ void exitAppDataStructure(GeneratedYangParser.AppDataStructureContext currentContext);
+
+ /**
+ * Enters a parse tree produced by GeneratedYangParser for grammar rule app extended statement.
+ *
+ * @param currentContext current context in the parsed tree
+ */
+ void enterAppExtendedStatement(GeneratedYangParser.AppExtendedStatementContext currentContext);
+
+ /**
+ * Exits a parse tree produced by GeneratedYangParser for grammar rule app extended statement.
+ *
+ * @param currentContext current context in the parsed tree
+ */
+ void exitAppExtendedStatement(GeneratedYangParser.AppExtendedStatementContext currentContext);
+
+ /**
+ * Enters a parse tree produced by GeneratedYangParser for grammar rule extended name.
+ *
+ * @param currentContext current context in the parsed tree
+ */
+ void enterExtendedName(GeneratedYangParser.ExtendedNameContext currentContext);
+
+ /**
+ * Exits a parse tree produced by GeneratedYangParser for grammar rule extended name.
+ *
+ * @param currentContext current context in the parsed tree
+ */
+ void exitExtendedName(GeneratedYangParser.ExtendedNameContext currentContext);
+
/**
* Enters a parse tree produced by GeneratedYangParser for grammar rule
- * annotation parameter type identifier.
+ * data structure key statement.
*
* @param currentContext current context in the parsed tree
*/
- void enterAnnotationParaTypeIdentifier(GeneratedYangParser.AnnotationParaTypeIdentifierContext
- currentContext);
+ void enterDataStructureKeyStatement(GeneratedYangParser.DataStructureKeyStatementContext currentContext);
/**
* Exits a parse tree produced by GeneratedYangParser for grammar rule
- * annotation parameter type identifier.
+ * data structure key statement.
*
* @param currentContext current context in the parsed tree
*/
- void exitAnnotationParaTypeIdentifier(GeneratedYangParser.AnnotationParaTypeIdentifierContext
- currentContext);
-
- /**
- * Enters a parse tree produced by GeneratedYangParser for grammar rule
- * annotation parameter type value.
- *
- * @param currentContext current context in the parsed tree
- */
- void enterAnnotationParaTypeValue(GeneratedYangParser.AnnotationParaTypeValueContext
- currentContext);
-
- /**
- * Exits a parse tree produced by GeneratedYangParser for grammar rule
- * annotation parameter type value.
- *
- * @param currentContext current context in the parsed tree
- */
- void exitAnnotationParaTypeValue(GeneratedYangParser.AnnotationParaTypeValueContext
- currentContext);
-
- /**
- * Enters a parse tree produced by GeneratedYangParser for grammar rule annotation identifier.
- *
- * @param currentContext current context in the parsed tree
- */
- void enterAnnotationIdentifier(GeneratedYangParser.AnnotationIdentifierContext
- currentContext);
-
- /**
- * Exits a parse tree produced by GeneratedYangParser for grammar rule annotation identifier.
- *
- * @param currentContext current context in the parsed tree
- */
- void exitAnnotationIdentifier(GeneratedYangParser.AnnotationIdentifierContext
- currentContext);
+ void exitDataStructureKeyStatement(GeneratedYangParser.DataStructureKeyStatementContext currentContext);
/**
* Enters a parse tree produced by GeneratedYangParser for grammar rule require instance.
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/TreeWalkListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/TreeWalkListener.java
index 2b9021b..116f06d 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/TreeWalkListener.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/TreeWalkListener.java
@@ -24,6 +24,8 @@
import org.onosproject.yangutils.datamodel.utils.YangConstructType;
import org.onosproject.yangutils.parser.antlrgencode.GeneratedYangListener;
import org.onosproject.yangutils.parser.antlrgencode.GeneratedYangParser;
+import org.onosproject.yangutils.parser.impl.listeners.AppDataStructureListener;
+import org.onosproject.yangutils.parser.impl.listeners.AppExtendedNameListener;
import org.onosproject.yangutils.parser.impl.listeners.ArgumentListener;
import org.onosproject.yangutils.parser.impl.listeners.AugmentListener;
import org.onosproject.yangutils.parser.impl.listeners.BaseFileListener;
@@ -33,9 +35,11 @@
import org.onosproject.yangutils.parser.impl.listeners.BitsListener;
import org.onosproject.yangutils.parser.impl.listeners.CaseListener;
import org.onosproject.yangutils.parser.impl.listeners.ChoiceListener;
+import org.onosproject.yangutils.parser.impl.listeners.CompilerAnnotationListener;
import org.onosproject.yangutils.parser.impl.listeners.ConfigListener;
import org.onosproject.yangutils.parser.impl.listeners.ContactListener;
import org.onosproject.yangutils.parser.impl.listeners.ContainerListener;
+import org.onosproject.yangutils.parser.impl.listeners.DataStructureKeyListener;
import org.onosproject.yangutils.parser.impl.listeners.Decimal64Listener;
import org.onosproject.yangutils.parser.impl.listeners.DefaultListener;
import org.onosproject.yangutils.parser.impl.listeners.DescriptionListener;
@@ -1428,95 +1432,72 @@
@Override
public void enterCompilerAnnotationStatement(GeneratedYangParser.CompilerAnnotationStatementContext ctx) {
- // TODO: implement the method.
+ CompilerAnnotationListener.processCompilerAnnotationEntry(this, ctx);
}
@Override
public void exitCompilerAnnotationStatement(GeneratedYangParser.CompilerAnnotationStatementContext ctx) {
- // TODO: implement the method.
+ CompilerAnnotationListener.processCompilerAnnotationExit(this, ctx);
}
@Override
- public void enterAnnotationStatement(GeneratedYangParser.AnnotationStatementContext ctx) {
- // TODO: implement the method.
+ public void enterCompilerAnnotationBodyStatement(GeneratedYangParser.CompilerAnnotationBodyStatementContext ctx) {
+ // do nothing
}
@Override
- public void exitAnnotationStatement(GeneratedYangParser.AnnotationStatementContext ctx) {
- // TODO: implement the method.
+ public void exitCompilerAnnotationBodyStatement(GeneratedYangParser.CompilerAnnotationBodyStatementContext ctx) {
+ // do nothing
}
@Override
- public void enterAnnotationType(GeneratedYangParser.AnnotationTypeContext ctx) {
- // TODO: implement the method.
+ public void enterAppDataStructureStatement(GeneratedYangParser.AppDataStructureStatementContext ctx) {
+ AppDataStructureListener.processAppDataStructureEntry(this, ctx);
}
@Override
- public void exitAnnotationType(GeneratedYangParser.AnnotationTypeContext ctx) {
- // TODO: implement the method.
+ public void exitAppDataStructureStatement(GeneratedYangParser.AppDataStructureStatementContext ctx) {
+ AppDataStructureListener.processAppDataStructureExit(this, ctx);
}
@Override
- public void enterAnnotationParameterSpecification(GeneratedYangParser.AnnotationParameterSpecificationContext
- ctx) {
- // TODO: implement the method.
+ public void enterAppDataStructure(GeneratedYangParser.AppDataStructureContext currentContext) {
+ // do nothing
}
@Override
- public void exitAnnotationParameterSpecification(GeneratedYangParser.AnnotationParameterSpecificationContext ctx) {
- // TODO: implement the method.
+ public void exitAppDataStructure(GeneratedYangParser.AppDataStructureContext currentContext) {
+ // do nothing
}
@Override
- public void enterAnnotationParameterSpecificationArg(GeneratedYangParser.AnnotationParameterSpecificationArgContext
- ctx) {
- // TODO: implement the method.
+ public void enterAppExtendedStatement(GeneratedYangParser.AppExtendedStatementContext currentContext) {
+ AppExtendedNameListener.processAppExtendedNameEntry(this, currentContext);
}
@Override
- public void exitAnnotationParameterSpecificationArg(GeneratedYangParser.AnnotationParameterSpecificationArgContext
- ctx) {
- // TODO: implement the method.
+ public void exitAppExtendedStatement(GeneratedYangParser.AppExtendedStatementContext currentContext) {
+ // TODO : to be implemented
}
@Override
- public void enterAnnotationParaInstance(GeneratedYangParser.AnnotationParaInstanceContext ctx) {
- // TODO: implement the method.
+ public void enterExtendedName(GeneratedYangParser.ExtendedNameContext currentContext) {
+ // do nothing
}
@Override
- public void exitAnnotationParaInstance(GeneratedYangParser.AnnotationParaInstanceContext ctx) {
- // TODO: implement the method.
+ public void exitExtendedName(GeneratedYangParser.ExtendedNameContext currentContext) {
+ // do nothing
}
@Override
- public void enterAnnotationParaTypeIdentifier(GeneratedYangParser.AnnotationParaTypeIdentifierContext ctx) {
- // TODO: implement the method.
+ public void enterDataStructureKeyStatement(GeneratedYangParser.DataStructureKeyStatementContext ctx) {
+ DataStructureKeyListener.processDataStructureKeyEntry(this, ctx);
}
@Override
- public void exitAnnotationParaTypeIdentifier(GeneratedYangParser.AnnotationParaTypeIdentifierContext ctx) {
- // TODO: implement the method.
- }
-
- @Override
- public void enterAnnotationParaTypeValue(GeneratedYangParser.AnnotationParaTypeValueContext ctx) {
- // TODO: implement the method.
- }
-
- @Override
- public void exitAnnotationParaTypeValue(GeneratedYangParser.AnnotationParaTypeValueContext ctx) {
- // TODO: implement the method.
- }
-
- @Override
- public void enterAnnotationIdentifier(GeneratedYangParser.AnnotationIdentifierContext ctx) {
- // TODO: implement the method.
- }
-
- @Override
- public void exitAnnotationIdentifier(GeneratedYangParser.AnnotationIdentifierContext ctx) {
- // TODO: implement the method.
+ public void exitDataStructureKeyStatement(GeneratedYangParser.DataStructureKeyStatementContext ctx) {
+ // do nothing
}
@Override
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppDataStructureListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppDataStructureListener.java
new file mode 100644
index 0000000..e6628b3
--- /dev/null
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppDataStructureListener.java
@@ -0,0 +1,112 @@
+/*
+ * Copyright 2016-present Open Networking Laboratory
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.onosproject.yangutils.parser.impl.listeners;
+
+import org.onosproject.yangutils.datamodel.YangAppDataStructure;
+import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
+import org.onosproject.yangutils.datamodel.YangDataStructure;
+import org.onosproject.yangutils.datamodel.utils.Parsable;
+import org.onosproject.yangutils.parser.antlrgencode.GeneratedYangParser;
+import org.onosproject.yangutils.parser.exceptions.ParserException;
+import org.onosproject.yangutils.parser.impl.TreeWalkListener;
+
+import static org.onosproject.yangutils.datamodel.YangDataStructure.getType;
+import static org.onosproject.yangutils.datamodel.utils.YangConstructType.APP_DATA_STRUCTURE;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.ENTRY;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.EXIT;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorMessageConstruction.constructListenerErrorMessage;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.INVALID_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_CURRENT_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerUtil.getValidPrefix;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerValidation.checkStackIsNotEmpty;
+
+/*
+ * Reference: RFC6020 and YANG ANTLR Grammar
+ *
+ * ABNF grammar as per RFC6020
+ * app-data-structure-stmt = prefix:app-data-structure-keyword string
+ * (";" /
+ * "{"
+ * [data-structure-key-stmt stmtsep]
+ * "}")
+ *
+ * ANTLR grammar rule
+ * appDataStructureStatement : APP_DATA_STRUCTURE appDataStructure (STMTEND | (LEFT_CURLY_BRACE
+ * dataStructureKeyStatement? RIGHT_CURLY_BRACE));
+ */
+
+/**
+ * Represents listener based call back function corresponding to the "app-data-structure"
+ * rule defined in ANTLR grammar file for corresponding ABNF rule in RFC 6020.
+ */
+public final class AppDataStructureListener {
+
+ /**
+ * Creates a new app-data-structure listener.
+ */
+ private AppDataStructureListener() {
+ }
+
+ /**
+ * Performs validation and updates the data model tree. It is called when parser receives an
+ * input matching the grammar rule(app-data-structure).
+ *
+ * @param listener listener's object
+ * @param ctx context object of the grammar rule
+ */
+ public static void processAppDataStructureEntry(TreeWalkListener listener,
+ GeneratedYangParser.AppDataStructureStatementContext ctx) {
+
+ checkStackIsNotEmpty(listener, MISSING_HOLDER, APP_DATA_STRUCTURE, "", ENTRY);
+
+ String prefix = getValidPrefix(ctx.APP_DATA_STRUCTURE().getText(), APP_DATA_STRUCTURE, ctx);
+ YangDataStructure dataStructure = getType(ctx.appDataStructure().getText());
+
+ YangAppDataStructure appDataStructure = new YangAppDataStructure();
+ appDataStructure.setPrefix(prefix);
+ appDataStructure.setDataStructure(dataStructure);
+
+ Parsable curData = listener.getParsedDataStack().peek();
+ if (curData instanceof YangCompilerAnnotation) {
+ YangCompilerAnnotation compilerAnnotation = ((YangCompilerAnnotation) curData);
+ compilerAnnotation.setYangAppDataStructure(appDataStructure);
+ listener.getParsedDataStack().push(appDataStructure);
+ } else {
+ throw new ParserException(constructListenerErrorMessage(INVALID_HOLDER, APP_DATA_STRUCTURE,
+ "", ENTRY));
+ }
+ }
+
+ /**
+ * Performs validation and updates the data model tree. It is called when parser
+ * exits from grammar rule (app-data-structure).
+ *
+ * @param listener listener's object
+ * @param ctx context object of the grammar rule
+ */
+ public static void processAppDataStructureExit(TreeWalkListener listener,
+ GeneratedYangParser.AppDataStructureStatementContext ctx) {
+
+ checkStackIsNotEmpty(listener, MISSING_HOLDER, APP_DATA_STRUCTURE, "", EXIT);
+ if (!(listener.getParsedDataStack().peek() instanceof YangAppDataStructure)) {
+ throw new ParserException(constructListenerErrorMessage(MISSING_CURRENT_HOLDER, APP_DATA_STRUCTURE,
+ "", EXIT));
+ }
+ listener.getParsedDataStack().pop();
+ }
+}
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppExtendedNameListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppExtendedNameListener.java
new file mode 100644
index 0000000..3ec31c7
--- /dev/null
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/AppExtendedNameListener.java
@@ -0,0 +1,83 @@
+/*
+ * Copyright 2016-present Open Networking Laboratory
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.onosproject.yangutils.parser.impl.listeners;
+
+import org.onosproject.yangutils.datamodel.YangAppExtendedName;
+import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
+import org.onosproject.yangutils.datamodel.utils.Parsable;
+import org.onosproject.yangutils.parser.antlrgencode.GeneratedYangParser;
+import org.onosproject.yangutils.parser.exceptions.ParserException;
+import org.onosproject.yangutils.parser.impl.TreeWalkListener;
+
+import static org.onosproject.yangutils.datamodel.utils.YangConstructType.APP_EXTENDED_NAME_DATA;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.ENTRY;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorMessageConstruction.constructListenerErrorMessage;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.INVALID_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerUtil.getValidPrefix;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerUtil.removeQuotesAndHandleConcat;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerValidation.checkStackIsNotEmpty;
+
+/*
+ * Reference: RFC6020 and YANG ANTLR Grammar
+ *
+ * ABNF grammar as per RFC6020
+ * app-extended-stmt = prefix:app-extended-name-keyword string ";"
+ *
+ * ANTLR grammar rule
+ * appExtendedStatement : APP_EXTENDED extendedName STMTEND;
+ */
+
+/**
+ * Represents listener based call back function corresponding to the "app-extended-name"
+ * rule defined in ANTLR grammar file for corresponding ABNF rule in RFC 6020.
+ */
+public final class AppExtendedNameListener {
+
+ /**
+ * Creates a new app-extended-name listener.
+ */
+ private AppExtendedNameListener() {
+ }
+
+ /**
+ * Performs validation and updates the data model tree. It is called when parser receives an
+ * input matching the grammar rule(app-extended-name).
+ *
+ * @param listener listener's object
+ * @param ctx context object of the grammar rule
+ */
+ public static void processAppExtendedNameEntry(TreeWalkListener listener,
+ GeneratedYangParser.AppExtendedStatementContext ctx) {
+
+ checkStackIsNotEmpty(listener, MISSING_HOLDER, APP_EXTENDED_NAME_DATA, ctx.extendedName().getText(), ENTRY);
+
+ String prefix = getValidPrefix(ctx.APP_EXTENDED().getText(), APP_EXTENDED_NAME_DATA, ctx);
+ YangAppExtendedName extendedName = new YangAppExtendedName();
+ extendedName.setPrefix(prefix);
+ extendedName.setYangAppExtendedName(removeQuotesAndHandleConcat(ctx.extendedName().getText()));
+
+ Parsable curData = listener.getParsedDataStack().peek();
+ if (curData instanceof YangCompilerAnnotation) {
+ YangCompilerAnnotation compilerAnnotation = ((YangCompilerAnnotation) curData);
+ compilerAnnotation.setYangAppExtendedName(extendedName);
+ } else {
+ throw new ParserException(constructListenerErrorMessage(INVALID_HOLDER, APP_EXTENDED_NAME_DATA,
+ ctx.extendedName().getText(), ENTRY));
+ }
+ }
+}
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/CompilerAnnotationListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/CompilerAnnotationListener.java
new file mode 100644
index 0000000..c89e99a
--- /dev/null
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/CompilerAnnotationListener.java
@@ -0,0 +1,118 @@
+/*
+ * Copyright 2016-present Open Networking Laboratory
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.onosproject.yangutils.parser.impl.listeners;
+
+import org.onosproject.yangutils.datamodel.YangCompilerAnnotation;
+import org.onosproject.yangutils.datamodel.YangModule;
+import org.onosproject.yangutils.datamodel.YangSubModule;
+import org.onosproject.yangutils.datamodel.utils.Parsable;
+import org.onosproject.yangutils.parser.antlrgencode.GeneratedYangParser;
+import org.onosproject.yangutils.parser.exceptions.ParserException;
+import org.onosproject.yangutils.parser.impl.TreeWalkListener;
+
+import static org.onosproject.yangutils.datamodel.utils.YangConstructType.COMPILER_ANNOTATION_DATA;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.ENTRY;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.EXIT;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorMessageConstruction.constructListenerErrorMessage;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.INVALID_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_CURRENT_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerUtil.getValidPrefix;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerUtil.removeQuotesAndHandleConcat;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerValidation.checkStackIsNotEmpty;
+
+/*
+ * Reference: RFC6020 and YANG ANTLR Grammar
+ *
+ * ABNF grammar as per RFC6020
+ * compiler-annotation-stmt = prefix:compiler-annotation-keyword string
+ * "{"
+ * [app-data-structure-stmt stmtsep]
+ * [app-extended-stmt stmtsep]
+ * "}"
+ *
+ * ANTLR grammar rule
+ * compilerAnnotationStatement : COMPILER_ANNOTATION string LEFT_CURLY_BRACE
+ * compilerAnnotationBodyStatement RIGHT_CURLY_BRACE;
+ *
+ * compilerAnnotationBodyStatement : appDataStructureStatement? appExtendedStatement? ;
+ */
+
+/**
+ * Represents listener based call back function corresponding to the "compiler-annotation"
+ * rule defined in ANTLR grammar file for corresponding ABNF rule in RFC 6020.
+ */
+public final class CompilerAnnotationListener {
+
+ /**
+ * Creates a new compiler-annotation listener.
+ */
+ private CompilerAnnotationListener() {
+ }
+
+ /**
+ * Performs validation and updates the data model tree. It is called when parser receives an
+ * input matching the grammar rule(compiler-annotation).
+ *
+ * @param listener listener's object
+ * @param ctx context object of the grammar rule
+ */
+ public static void processCompilerAnnotationEntry(TreeWalkListener listener,
+ GeneratedYangParser.CompilerAnnotationStatementContext ctx) {
+ // Check for stack to be non empty.
+ checkStackIsNotEmpty(listener, MISSING_HOLDER, COMPILER_ANNOTATION_DATA, ctx.string().getText(), ENTRY);
+ String prefix = getValidPrefix(ctx.COMPILER_ANNOTATION().getText(), COMPILER_ANNOTATION_DATA, ctx);
+
+ YangCompilerAnnotation compilerAnnotation = new YangCompilerAnnotation();
+ compilerAnnotation.setPrefix(prefix);
+ compilerAnnotation.setPath(removeQuotesAndHandleConcat(ctx.string().getText()));
+
+ Parsable curData = listener.getParsedDataStack().peek();
+ switch (curData.getYangConstructType()) {
+ case MODULE_DATA:
+ YangModule module = ((YangModule) curData);
+ module.addCompilerAnnotation(compilerAnnotation);
+ break;
+ case SUB_MODULE_DATA:
+ YangSubModule subModule = ((YangSubModule) curData);
+ subModule.addCompilerAnnotation(compilerAnnotation);
+ break;
+ default:
+ throw new ParserException(constructListenerErrorMessage(INVALID_HOLDER, COMPILER_ANNOTATION_DATA,
+ ctx.string().getText(), ENTRY));
+ }
+ listener.getParsedDataStack().push(compilerAnnotation);
+ }
+
+ /**
+ * Performs validation and updates the data model tree. It is called when parser
+ * exits from grammar rule (compiler-annotation).
+ *
+ * @param listener listener's object
+ * @param ctx context object of the grammar rule
+ */
+ public static void processCompilerAnnotationExit(TreeWalkListener listener,
+ GeneratedYangParser.CompilerAnnotationStatementContext ctx) {
+
+ checkStackIsNotEmpty(listener, MISSING_HOLDER, COMPILER_ANNOTATION_DATA, ctx.string().getText(), EXIT);
+ if (!(listener.getParsedDataStack().peek() instanceof YangCompilerAnnotation)) {
+ throw new ParserException(constructListenerErrorMessage(MISSING_CURRENT_HOLDER, COMPILER_ANNOTATION_DATA,
+ ctx.string().getText(), EXIT));
+ }
+ listener.getParsedDataStack().pop();
+ }
+}
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/DataStructureKeyListener.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/DataStructureKeyListener.java
new file mode 100644
index 0000000..65fc50b
--- /dev/null
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/listeners/DataStructureKeyListener.java
@@ -0,0 +1,87 @@
+/*
+ * Copyright 2016-present Open Networking Laboratory
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.onosproject.yangutils.parser.impl.listeners;
+
+import org.onosproject.yangutils.datamodel.YangAppDataStructure;
+import org.onosproject.yangutils.datamodel.utils.Parsable;
+import org.onosproject.yangutils.parser.antlrgencode.GeneratedYangParser;
+import org.onosproject.yangutils.parser.exceptions.ParserException;
+import org.onosproject.yangutils.parser.impl.TreeWalkListener;
+
+import static org.onosproject.yangutils.datamodel.utils.YangConstructType.KEY_DATA;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorLocation.ENTRY;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorMessageConstruction.constructListenerErrorMessage;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.INVALID_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerErrorType.MISSING_HOLDER;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerUtil.removeQuotesAndHandleConcat;
+import static org.onosproject.yangutils.parser.impl.parserutils.ListenerValidation.checkStackIsNotEmpty;
+import static org.onosproject.yangutils.utils.UtilConstants.SPACE;
+
+/*
+ * Reference: RFC6020 and YANG ANTLR Grammar
+ *
+ * ABNF grammar as per RFC6020
+ * data-structure-key-stmt = prefix:key-keyword string ";"
+ *
+ * ANTLR grammar rule
+ * dataStructureKeyStatement : DATA_STRUCTURE_KEY string STMTEND;
+ */
+
+/**
+ * Represents listener based call back function corresponding to the "key"
+ * rule defined in ANTLR grammar file for corresponding ABNF rule in RFC 6020.
+ */
+public final class DataStructureKeyListener {
+
+ /**
+ * Creates a new data-structure-key listener.
+ */
+ private DataStructureKeyListener() {
+ }
+
+ /**
+ * Performs validation and updates the data model tree. It is called when parser receives an
+ * input matching the grammar rule(key).
+ *
+ * @param listener listener's object
+ * @param ctx context object of the grammar rule
+ */
+ public static void processDataStructureKeyEntry(TreeWalkListener listener,
+ GeneratedYangParser.DataStructureKeyStatementContext ctx) {
+
+ // Check for stack to be non empty.
+ checkStackIsNotEmpty(listener, MISSING_HOLDER, KEY_DATA, ctx.string().getText(), ENTRY);
+
+ Parsable tmpData = listener.getParsedDataStack().peek();
+ if (listener.getParsedDataStack().peek() instanceof YangAppDataStructure) {
+ YangAppDataStructure dataStructure = (YangAppDataStructure) tmpData;
+ String tmpKeyValue = removeQuotesAndHandleConcat(ctx.string().getText());
+ if (tmpKeyValue.contains(SPACE)) {
+ String[] keyValues = tmpKeyValue.split(SPACE);
+ for (String keyValue : keyValues) {
+ dataStructure.addKey(keyValue);
+ }
+ } else {
+ dataStructure.addKey(tmpKeyValue);
+ }
+ } else {
+ throw new ParserException(constructListenerErrorMessage(INVALID_HOLDER, KEY_DATA, ctx.string().getText(),
+ ENTRY));
+ }
+ }
+}
+
diff --git a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/parserutils/ListenerUtil.java b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/parserutils/ListenerUtil.java
index aa38b87..5fe0970 100644
--- a/plugin/src/main/java/org/onosproject/yangutils/parser/impl/parserutils/ListenerUtil.java
+++ b/plugin/src/main/java/org/onosproject/yangutils/parser/impl/parserutils/ListenerUtil.java
@@ -1026,4 +1026,28 @@
throw parserException;
}
}
+
+ /**
+ * Checks and return valid prefix.
+ *
+ * @param inputString string from yang file
+ * @param yangConstruct yang construct for creating error message
+ * @param ctx yang construct's context to get the line number and character position
+ * @return valid prefix
+ */
+ public static String getValidPrefix(String inputString,
+ YangConstructType yangConstruct, ParserRuleContext ctx) {
+ String tmpPrefixString = removeQuotesAndHandleConcat(inputString);
+ String[] tmpData = tmpPrefixString.split(Pattern.quote(COLON));
+ if (tmpData.length == 2) {
+ return tmpData[0];
+ } else {
+ ParserException parserException = new ParserException("YANG file error : " +
+ YangConstructType.getYangConstructType(yangConstruct) + " name " + inputString +
+ " is not valid.");
+ parserException.setLine(ctx.getStart().getLine());
+ parserException.setCharPosition(ctx.getStart().getCharPositionInLine());
+ throw parserException;
+ }
+ }
}