Package renaming - missed the pre-written files in the previous commit.
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/annotations/Immutable.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/annotations/Immutable.java
new file mode 100644
index 0000000..5de2171
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/annotations/Immutable.java
@@ -0,0 +1,13 @@
+package org.projectfloodlight.openflow.annotations;
+
+/**
+ * This annotation marks a class that is considered externally immutable. I.e.,
+ * the externally visible state of the class will not change after its
+ * construction. Such a class can be freely shared between threads and does not
+ * require defensive copying (don't call clone).
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+public @interface Immutable {
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/NonExistantMessage.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/NonExistantMessage.java
new file mode 100644
index 0000000..e5192fd
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/NonExistantMessage.java
@@ -0,0 +1,30 @@
+package org.projectfloodlight.openflow.exceptions;
+
+/**
+ * Error: someone asked to create an OFMessage with wireformat type and version,
+ * but that doesn't exist
+ *
+ * @author capveg
+ */
+public class NonExistantMessage extends Exception {
+
+    private static final long serialVersionUID = 1L;
+    byte type;
+    byte version;
+
+    /**
+     * Error: someone asked to create an OFMessage with wireformat type and
+     * version, but that doesn't exist
+     *
+     * @param type
+     *            the wire format
+     * @param version
+     *            the OpenFlow wireformat version number, e.g. 1 == v1.1, 2 =
+     *            v1.2, etc.
+     */
+    public NonExistantMessage(final byte type, final byte version) {
+        this.type = type;
+        this.version = version;
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFParseError.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFParseError.java
new file mode 100644
index 0000000..658dce7
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFParseError.java
@@ -0,0 +1,22 @@
+package org.projectfloodlight.openflow.exceptions;
+
+public class OFParseError extends Exception {
+    private static final long serialVersionUID = 1L;
+
+    public OFParseError() {
+        super();
+    }
+
+    public OFParseError(final String message, final Throwable cause) {
+        super(message, cause);
+    }
+
+    public OFParseError(final String message) {
+        super(message);
+    }
+
+    public OFParseError(final Throwable cause) {
+        super(cause);
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortRead.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortRead.java
new file mode 100644
index 0000000..c68a678
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortRead.java
@@ -0,0 +1,6 @@
+package org.projectfloodlight.openflow.exceptions;
+
+public class OFShortRead extends Exception {
+    private static final long serialVersionUID = 1L;
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortWrite.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortWrite.java
new file mode 100644
index 0000000..4f99118
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFShortWrite.java
@@ -0,0 +1,7 @@
+package org.projectfloodlight.openflow.exceptions;
+
+public class OFShortWrite extends Exception {
+
+    private static final long serialVersionUID = 1L;
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFUnsupported.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFUnsupported.java
new file mode 100644
index 0000000..fa52c08
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/exceptions/OFUnsupported.java
@@ -0,0 +1,7 @@
+package org.projectfloodlight.openflow.exceptions;
+
+public class OFUnsupported extends Exception {
+
+    private static final long serialVersionUID = 1L;
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFBsnVportQInQT.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFBsnVportQInQT.java
new file mode 100644
index 0000000..ff077ce
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFBsnVportQInQT.java
@@ -0,0 +1,5 @@
+package org.projectfloodlight.openflow.protocol;
+
+public class OFBsnVportQInQT {
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFMatchBmap.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFMatchBmap.java
new file mode 100644
index 0000000..e17796a
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFMatchBmap.java
@@ -0,0 +1,5 @@
+package org.projectfloodlight.openflow.protocol;
+
+public class OFMatchBmap {
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageReader.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageReader.java
new file mode 100644
index 0000000..8837867
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageReader.java
@@ -0,0 +1,8 @@
+package org.projectfloodlight.openflow.protocol;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public interface OFMessageReader<T> {
+    T readFrom(ChannelBuffer bb) throws OFParseError;
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageWriter.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageWriter.java
new file mode 100644
index 0000000..bec5634
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFMessageWriter.java
@@ -0,0 +1,8 @@
+package org.projectfloodlight.openflow.protocol;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public interface OFMessageWriter<T> {
+    public void write(ChannelBuffer bb, T message) throws OFParseError;
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFObject.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFObject.java
new file mode 100644
index 0000000..07759d7
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFObject.java
@@ -0,0 +1,8 @@
+package org.projectfloodlight.openflow.protocol;
+
+
+/**
+ * Base interface of all OpenFlow objects (e.g., messages, actions, stats, etc.)
+ */
+public interface OFObject extends Writeable {
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFObjectFactory.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFObjectFactory.java
new file mode 100644
index 0000000..c5869ef
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFObjectFactory.java
@@ -0,0 +1,7 @@
+package org.projectfloodlight.openflow.protocol;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+public interface OFObjectFactory<T extends OFObject> {
+    T read(ChannelBuffer buffer);
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFOxmList.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFOxmList.java
new file mode 100644
index 0000000..ac48c8d
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFOxmList.java
@@ -0,0 +1,128 @@
+package org.projectfloodlight.openflow.protocol;
+
+import java.util.EnumMap;
+import java.util.Iterator;
+import java.util.List;
+import java.util.Map;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.match.MatchField;
+import org.projectfloodlight.openflow.protocol.match.MatchFields;
+import org.projectfloodlight.openflow.types.OFValueType;
+import org.projectfloodlight.openflow.util.ChannelUtils;
+import org.projectfloodlight.openflow.protocol.oxm.OFOxm;
+
+import com.google.common.collect.ImmutableMap;
+
+public class OFOxmList implements Iterable<OFOxm<?>>, Writeable {
+    private final Map<MatchFields, OFOxm<?>> oxmMap;
+
+    public final static OFOxmList EMPTY = new OFOxmList(ImmutableMap.<MatchFields, OFOxm<?>>of());
+
+    private OFOxmList(Map<MatchFields, OFOxm<?>> oxmMap) {
+        this.oxmMap = oxmMap;
+    }
+
+    @SuppressWarnings("unchecked")
+    public <T extends OFValueType<T>> OFOxm<T> get(MatchField<T> matchField) {
+        return (OFOxm<T>) oxmMap.get(matchField.id);
+    }
+
+    public static class Builder {
+        private final Map<MatchFields, OFOxm<?>> oxmMap;
+
+        public Builder() {
+            oxmMap = new EnumMap<MatchFields, OFOxm<?>>(MatchFields.class);
+        }
+
+        public Builder(EnumMap<MatchFields, OFOxm<?>> oxmMap) {
+            this.oxmMap = oxmMap;
+        }
+
+        public <T extends OFValueType<T>> void set(OFOxm<T> oxm) {
+            oxmMap.put(oxm.getMatchField().id, oxm);
+        }
+
+        public <T extends OFValueType<T>> void unset(MatchField<T> matchField) {
+            oxmMap.remove(matchField.id);
+        }
+
+        public OFOxmList build() {
+            return new OFOxmList(oxmMap);
+        }
+    }
+
+    @Override
+    public Iterator<OFOxm<?>> iterator() {
+        return oxmMap.values().iterator();
+    }
+
+    public static OFOxmList ofList(List<OFOxm<?>> oxmList) {
+        Map<MatchFields, OFOxm<?>> map = new EnumMap<MatchFields, OFOxm<?>>(
+                MatchFields.class);
+        for (OFOxm<?> o : oxmList) {
+            // TODO: if fully masked, ignore oxm.
+            map.put(o.getMatchField().id, o);
+        }
+        return new OFOxmList(map);
+    }
+
+    public static OFOxmList of(OFOxm<?>... oxms) {
+        Map<MatchFields, OFOxm<?>> map = new EnumMap<MatchFields, OFOxm<?>>(
+                MatchFields.class);
+        for (OFOxm<?> o : oxms) {
+            // TODO: if fully masked, ignore oxm.
+            map.put(o.getMatchField().id, o);
+        }
+        return new OFOxmList(map);
+    }
+
+    public static OFOxmList readFrom(ChannelBuffer bb, int length,
+            OFMessageReader<OFOxm<?>> reader) throws OFParseError {
+        return ofList(ChannelUtils.readList(bb, length, reader));
+    }
+
+    @Override
+    public void writeTo(ChannelBuffer bb) {
+        for (OFOxm<?> o : this) {
+            o.writeTo(bb);
+        }
+    }
+
+    public OFOxmList.Builder createBuilder() {
+        return new OFOxmList.Builder(new EnumMap<MatchFields, OFOxm<?>>(oxmMap));
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 31;
+        int result = 1;
+        result = prime * result + ((oxmMap == null) ? 0 : oxmMap.hashCode());
+        return result;
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (this == obj)
+            return true;
+        if (obj == null)
+            return false;
+        if (getClass() != obj.getClass())
+            return false;
+        OFOxmList other = (OFOxmList) obj;
+        if (oxmMap == null) {
+            if (other.oxmMap != null)
+                return false;
+        } else if (!oxmMap.equals(other.oxmMap))
+            return false;
+        return true;
+    }
+
+    @Override
+    public String toString() {
+        return "OFOxmList" + oxmMap;
+    }
+
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFTableFeature.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFTableFeature.java
new file mode 100644
index 0000000..b722228
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFTableFeature.java
@@ -0,0 +1,5 @@
+package org.projectfloodlight.openflow.protocol;
+
+public class OFTableFeature {
+    // FIXME implement
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFVersion.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFVersion.java
new file mode 100644
index 0000000..6f54e5f
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/OFVersion.java
@@ -0,0 +1,16 @@
+package org.projectfloodlight.openflow.protocol;
+
+public enum OFVersion {
+    OF_10(1), OF_11(2), OF_12(3), OF_13(4);
+
+    public final int wireVersion;
+
+    OFVersion(final int wireVersion) {
+        this.wireVersion = wireVersion;
+    }
+
+    public int getWireVersion() {
+        return wireVersion;
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/Wildcards.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/Wildcards.java
new file mode 100644
index 0000000..2268ce6
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/Wildcards.java
@@ -0,0 +1,656 @@
+/**
+ *    Copyright 2013, Big Switch Networks, Inc.
+ *
+ *    Licensed under the Apache License, Version 2.0 (the "License"); you may
+ *    not use this file except in compliance with the License. You may obtain
+ *    a copy of the License at
+ *
+ *         http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *    Unless required by applicable law or agreed to in writing, software
+ *    distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ *    WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ *    License for the specific language governing permissions and limitations
+ *    under the License.
+ **/
+
+package org.projectfloodlight.openflow.protocol;
+
+import java.util.ArrayList;
+import java.util.EnumSet;
+import java.util.Iterator;
+import java.util.List;
+import java.util.Set;
+
+import com.google.common.base.Joiner;
+
+/**
+ * a more user friendly representation of the wildcards bits in an OpenFlow
+ * match. The Wildcards object is
+ * <ul>
+ * <li>immutable (i.e., threadsafe)</li>
+ * <li>instance managed (don't instantiate it yourself), instead call "of"</li>
+ * <ul>
+ * <p>
+ * You can construct a Wildcard object from either its integer representation
+ * </p>
+ * <code>
+ *    Wildcard.of(0x3820e0);
+ *  </code>
+ * <p>
+ * Or start with either an empty or full wildcard, and select/unselect foo.
+ * </p>
+ * <code>
+ *  Wildcard w = Wildcards.NONE
+ *                .set(Flag.DL_SRC, Flag. DL_DST, Flag.DL_VLAN_PCP)
+ *                .setNwDstMask(8)
+ *                .setNwSrcMask(8);
+ *  </code>
+ * <p>
+ * <b>Remember:</b> Wildcards objects are immutable. set... operations have
+ * <b>NO EFFECT</b> on the current wildcard object. You HAVE to use the returned
+ * changed object.
+ * </p>
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+public class Wildcards {
+    public class OFWildcardFlags {
+        final public static int OFPFW_ALL = ((1 << 22) - 1);
+
+        final public static int OFPFW_IN_PORT = 1 << 0; /* Switch input port. */
+        final public static int OFPFW_DL_VLAN = 1 << 1; /* VLAN id. */
+        final public static int OFPFW_DL_SRC = 1 << 2; /* Ethernet source address. */
+        final public static int OFPFW_DL_DST = 1 << 3; /*
+                                                        * Ethernet destination
+                                                        * address.
+                                                        */
+        final public static int OFPFW_DL_TYPE = 1 << 4; /* Ethernet frame type. */
+        final public static int OFPFW_NW_PROTO = 1 << 5; /* IP protocol. */
+        final public static int OFPFW_TP_SRC = 1 << 6; /* TCP/UDP source port. */
+        final public static int OFPFW_TP_DST = 1 << 7; /* TCP/UDP destination port. */
+
+        /*
+         * IP source address wildcard bit count. 0 is exact match, 1 ignores the
+         * LSB, 2 ignores the 2 least-significant bits, ..., 32 and higher wildcard
+         * the entire field. This is the *opposite* of the usual convention where
+         * e.g. /24 indicates that 8 bits (not 24 bits) are wildcarded.
+         */
+        final public static int OFPFW_NW_SRC_SHIFT = 8;
+        final public static int OFPFW_NW_SRC_BITS = 6;
+        final public static int OFPFW_NW_SRC_MASK = ((1 << OFPFW_NW_SRC_BITS) - 1) << OFPFW_NW_SRC_SHIFT;
+        final public static int OFPFW_NW_SRC_ALL = 32 << OFPFW_NW_SRC_SHIFT;
+
+        /* IP destination address wildcard bit count. Same format as source. */
+        final public static int OFPFW_NW_DST_SHIFT = 14;
+        final public static int OFPFW_NW_DST_BITS = 6;
+        final public static int OFPFW_NW_DST_MASK = ((1 << OFPFW_NW_DST_BITS) - 1) << OFPFW_NW_DST_SHIFT;
+        final public static int OFPFW_NW_DST_ALL = 32 << OFPFW_NW_DST_SHIFT;
+
+        final public static int OFPFW_DL_VLAN_PCP = 1 << 20; /* VLAN priority. */
+        final public static int OFPFW_NW_TOS = 1 << 21; /*
+                                                         * IP ToS (DSCP field, 6
+                                                         * bits).
+                                                         */
+
+        final public static int OFPFW_ALL_SANITIZED = (((1 << 22) - 1)
+                                                       & ~OFPFW_NW_SRC_MASK & ~OFPFW_NW_DST_MASK)
+                                                      | OFPFW_NW_SRC_ALL
+                                                      | OFPFW_NW_DST_ALL;
+
+
+    }
+
+    public final static Wildcards FULL = new Wildcards(OFWildcardFlags.OFPFW_ALL_SANITIZED);
+    private static final int FULL_INT = FULL.getInt();
+
+    public final static Wildcards EXACT = new Wildcards(0);
+
+    // floodlight common case: matches on inport + l2
+    public final static int INT_INPORT_L2_MATCH = 0x3820e0;
+    public final static Wildcards INPORT_L2_MATCH = new Wildcards(
+            INT_INPORT_L2_MATCH);
+
+    /**
+     * enum type for the binary flags that can be set in the wildcards field of
+     * an OFWildcardFlags. Replaces the unwieldy c-ish int constants in OFWildcardFlags.
+     */
+    public static enum Flag {
+        IN_PORT(OFWildcardFlags.OFPFW_IN_PORT),  /* Switch input port. */
+        DL_VLAN(OFWildcardFlags.OFPFW_DL_VLAN), /* VLAN id. */
+        DL_SRC(OFWildcardFlags.OFPFW_DL_SRC), /* Ethernet source address. */
+        DL_DST(OFWildcardFlags.OFPFW_DL_DST), /* Ethernet destination addr */
+        DL_TYPE(OFWildcardFlags.OFPFW_DL_TYPE), /* Ethernet frame type. */
+        NW_PROTO(OFWildcardFlags.OFPFW_NW_PROTO), /* IP protocol. */
+        TP_SRC(OFWildcardFlags.OFPFW_TP_SRC), /* TCP/UDP source port. */
+        TP_DST(OFWildcardFlags.OFPFW_TP_DST), /* TCP/UDP destination port. */
+        DL_VLAN_PCP(OFWildcardFlags.OFPFW_DL_VLAN_PCP), /* VLAN priority. */
+        NW_SRC(-1) { /*
+                      * virtual NW_SRC flag => translates to the strange 6 bits
+                      * in the header
+                      */
+            @Override
+            boolean isBolean() {
+                return false;
+            }
+
+            @Override
+            int getInt(int flags) {
+                return ((flags & OFWildcardFlags.OFPFW_NW_SRC_MASK) >> OFWildcardFlags.OFPFW_NW_SRC_SHIFT);
+            }
+
+            @Override
+            int setInt(int flags, int srcMask) {
+                return (flags & ~OFWildcardFlags.OFPFW_NW_SRC_MASK) | (srcMask << OFWildcardFlags.OFPFW_NW_SRC_SHIFT);
+            }
+
+            @Override
+            int wildcard(int flags) {
+                return flags & ~OFWildcardFlags.OFPFW_NW_SRC_MASK;
+            }
+
+            @Override
+            int matchOn(int flags) {
+                return flags | OFWildcardFlags.OFPFW_NW_SRC_ALL;
+            }
+
+            @Override
+            boolean isPartiallyOn(int flags) {
+                int intValue = getInt(flags);
+                return intValue > 0 && intValue < 32;
+            }
+
+            @Override
+            boolean isFullyOn(int flags) {
+                return getInt(flags) >= 32;
+            }
+
+        },
+        NW_DST(-1) { /*
+                      * virtual NW_SRC flag => translates to the strange 6 bits
+                      * in the header
+                      */
+            @Override
+            boolean isBolean() {
+                return false;
+            }
+
+            @Override
+            int getInt(int flags) {
+                return ((flags & OFWildcardFlags.OFPFW_NW_DST_MASK) >> OFWildcardFlags.OFPFW_NW_DST_SHIFT);
+            }
+
+            @Override
+            int setInt(int flags, int srcMask) {
+                return (flags & ~OFWildcardFlags.OFPFW_NW_DST_MASK) | (srcMask << OFWildcardFlags.OFPFW_NW_DST_SHIFT);
+            }
+
+            @Override
+            int wildcard(int flags) {
+                return flags & ~OFWildcardFlags.OFPFW_NW_DST_MASK;
+            }
+
+            @Override
+            int matchOn(int flags) {
+                return flags | OFWildcardFlags.OFPFW_NW_DST_ALL;
+            }
+
+            @Override
+            boolean isFullyOn(int flags) {
+                return getInt(flags) >= 32;
+            }
+        },
+        NW_TOS(OFWildcardFlags.OFPFW_NW_TOS); /* IP ToS (DSCP field, 6 bits). */
+
+        final int bitPosition;
+
+        Flag(int bitPosition) {
+            this.bitPosition = bitPosition;
+        }
+
+        /**
+         * @return a modified OF-1.0 flags field with this flag cleared (match
+         *         on this field)
+         */
+        int matchOn(int flags) {
+            return flags & ~this.bitPosition;
+        }
+
+        /**
+         * @return a modified OF-1.0 flags field with this flag set (wildcard
+         *         this field)
+         */
+        int wildcard(int flags) {
+            return flags | this.bitPosition;
+        }
+
+        /**
+         * @return true iff this is a true boolean flag that can either be off
+         *         or on.True in OF-1.0 for all fields except NW_SRC and NW_DST
+         */
+        boolean isBolean() {
+            return false;
+        }
+
+        /**
+         * @return true iff this wildcard field is currently 'partially on'.
+         *         Always false for true Boolean Flags. Can be true in OF-1.0
+         *         for NW_SRC, NW_DST.
+         */
+        boolean isPartiallyOn(int flags) {
+            return false;
+        }
+
+        /**
+         * @return true iff this wildcard field currently fully on (fully
+         *         wildcarded). Equivalent to the boolean flag being set in the
+         *         bitmask for bit flags, and to the wildcarded bit length set
+         *         to >=32 for NW_SRC and NW_DST
+         * @param flags
+         * @return
+         */
+        boolean isFullyOn(int flags) {
+            return (flags & this.bitPosition) != 0;
+        }
+
+        /**
+         * set the integer representation of this flag. only for NW_SRC and
+         * NW_DST
+         */
+        int setInt(int flags, int srcMask) {
+            throw new UnsupportedOperationException();
+        }
+
+        /**
+         * set the integer representation of this flag. only for NW_SRC and
+         * NW_DST
+         */
+        int getInt(int flags) {
+            throw new UnsupportedOperationException();
+        }
+
+
+    }
+
+    private final int flags;
+
+    /** private constructor. use Wildcard.of() instead */
+    private Wildcards(int flags) {
+        this.flags = flags;
+    }
+
+    /**
+     * return a wildcard object matching the given int flags. May reuse / cache
+     * frequently used wildcard instances. Don't rely on it though (use equals
+     * not ==).
+     *
+     * @param flags
+     * @return
+     */
+    public static Wildcards of(int paramFlags) {
+        int flags = paramFlags; //sanitizeInt(paramFlags);
+        switch(flags) {
+            case 0x0000:
+                return EXACT;
+            case OFWildcardFlags.OFPFW_ALL_SANITIZED:
+                return FULL;
+            case INT_INPORT_L2_MATCH:
+                return INPORT_L2_MATCH;
+            default:
+                return new Wildcards(flags);
+        }
+    }
+
+    /** convience method return a wildcard for exactly one set flag */
+    public static Wildcards of(Wildcards.Flag setFlag) {
+        return Wildcards.of(setFlag.wildcard(0));
+    }
+
+    /** convience method return a wildcard for exactly two set flags */
+    public static Wildcards of(Wildcards.Flag setFlag, Wildcards.Flag setFlag2) {
+        return Wildcards.of(setFlag.wildcard(setFlag2.wildcard(0)));
+    }
+
+    /** convience method return a wildcard for an arbitrary number of set flags */
+    public static Wildcards of(Wildcards.Flag... setFlags) {
+        int flags = 0;
+        for (Wildcards.Flag flag : setFlags)
+            flags = flag.wildcard(0);
+        return Wildcards.of(flags);
+    }
+
+    /** convience method return a wildcards for ofmatches that match on one flag */
+    public static Wildcards ofMatches(Wildcards.Flag setFlag) {
+        return Wildcards.of(setFlag.matchOn(FULL_INT));
+    }
+
+    /**
+     * convience method return a wildcard for for an ofmatch that match on two
+     * flags
+     */
+    public static Wildcards ofMatches(Wildcards.Flag setFlag, Wildcards.Flag setFlag2) {
+        return Wildcards.of(setFlag.matchOn(setFlag2.matchOn(FULL_INT)));
+    }
+
+    /**
+     * convience method return a wildcard for an ofmatch that amtch on an
+     * arbitrary number of set flags
+     */
+    public static Wildcards ofMatches(Wildcards.Flag... setFlags) {
+        int flags = FULL_INT;
+        for (Wildcards.Flag flag : setFlags)
+           flags = flag.matchOn(flags);
+        return Wildcards.of(flags);
+    }
+
+    public static Wildcards ofMatches(Set<Wildcards.Flag> wSet) {
+        int flags = FULL_INT;
+        for (Wildcards.Flag flag : wSet)
+           flags = flag.matchOn(flags);
+        return Wildcards.of(flags);
+    }
+
+    /**
+     * return a Wildcards object that has the given flags set
+     * <p>
+     * <b>NOTE:</b> NOT a mutator function. 'this' wildcard object stays
+     * unmodified. </b>
+     */
+    public Wildcards wildcard(Wildcards.Flag flag) {
+        int flags = flag.wildcard(this.flags);
+        if (flags == this.flags)
+            return this;
+        else
+            return new Wildcards(flags);
+    }
+
+    /**
+     * return a Wildcards object that has the given flags set
+     * <p>
+     * <b>NOTE:</b> NOT a mutator function. 'this' wildcard object stays
+     * unmodified. </b>
+     */
+    public Wildcards wildcard(Wildcards.Flag flag, Wildcards.Flag flag2) {
+        int flags = flag.wildcard(flag2.wildcard(this.flags));
+        if (flags == this.flags)
+            return this;
+        else
+            return new Wildcards(flags);
+    }
+
+    /**
+     * return a Wildcards object that has the given flags wildcarded
+     * <p>
+     * <b>NOTE:</b> NOT a mutator function. 'this' wildcard object stays
+     * unmodified. </b>
+     */
+    public Wildcards wildcard(Wildcards.Flag... setFlags) {
+        int flags = this.flags;
+        for (Wildcards.Flag flag : setFlags)
+            flags = flag.wildcard(flags);
+        if (flags == this.flags)
+            return this;
+        else
+            return new Wildcards(flags);
+    }
+
+    /**
+     * return a Wildcards object that matches on exactly the given flag
+     * <p>
+     * <b>NOTE:</b> NOT a mutator function. 'this' wildcard object stays
+     * unmodified. </b>
+     */
+    public Wildcards matchOn(Wildcards.Flag flag) {
+        int flags = flag.matchOn(this.flags);
+        if (flags == this.flags)
+            return this;
+        else
+            return new Wildcards(flags);
+    }
+
+    /**
+     * return a Wildcards object that matches on exactly the given flags
+     * <p>
+     * <b>NOTE:</b> NOT a mutator function. 'this' wildcard object stays
+     * unmodified. </b>
+     */
+    public Wildcards matchOn(Wildcards.Flag flag, Wildcards.Flag flag2) {
+        int flags = flag.matchOn(flag2.matchOn(this.flags));
+        if (flags == this.flags)
+            return this;
+        else
+            return new Wildcards(flags);
+    }
+
+    /**
+     * return a Wildcards object that matches on exactly the given flags
+     * <p>
+     * <b>NOTE:</b> NOT a mutator function. 'this' wildcard object stays
+     * unmodified. </b>
+     */
+    public Wildcards matchOn(Wildcards.Flag... setFlags) {
+        int flags = this.flags;
+        for (Wildcards.Flag flag : setFlags)
+            flags = flag.matchOn(flags);
+        if (flags == this.flags)
+            return this;
+        else
+            return new Wildcards(flags);
+    }
+
+    /**
+     * return the nw src mask in normal CIDR style, e.g., 8 means x.x.x.x/8
+     * means 8 bits wildcarded
+     */
+    public int getNwSrcMask() {
+        return Math.max(0, 32 - Flag.NW_SRC.getInt(flags));
+    }
+
+    /**
+     * return the nw dst mask in normal CIDR style, e.g., 8 means x.x.x.x/8
+     * means 8 bits wildcarded
+     */
+    public int getNwDstMask() {
+        return Math.max(0, 32 - Flag.NW_DST.getInt(flags));
+    }
+
+    /**
+     * return a Wildcard object that has the given nwSrcCidrMask set.
+     * <b>NOTE:</b> NOT a mutator function. 'this' wildcard object stays
+     * unmodified. </b>
+     *
+     * @param srcCidrMask
+     *            source mask to set in <b>normal CIDR notation</b>, i.e., 8
+     *            means x.x.x.x/8
+     * @return a modified object
+     */
+    public Wildcards withNwSrcMask(int srcCidrMask) {
+        int flags = Flag.NW_SRC.setInt(this.flags, Math.max(0, 32 - srcCidrMask));
+        if (flags == this.flags)
+            return this;
+        else
+            return new Wildcards(flags);
+    }
+
+    /**
+     * return a Wildcard object that has the given nwDstCidrMask set.
+     * <b>NOTE:</b> NOT a mutator function. 'this' wildcard object stays
+     * unmodified. </b>
+     *
+     * @param dstCidrMask
+     *            dest mask to set in <b>normal CIDR notation</b>, i.e., 8 means
+     *            x.x.x.x/8
+     * @return a modified object
+     */
+    public Wildcards withNwDstMask(int dstCidrMask) {
+        int flags = Flag.NW_DST.setInt(this.flags, Math.max(0, 32 - dstCidrMask));
+        if (flags == this.flags)
+            return this;
+        else
+            return new Wildcards(flags);
+    }
+
+    /**
+     * return a Wildcard object that is inverted to this wildcard object.
+     * <b>NOTE:</b> NOT a mutator function. 'this' wildcard object stays
+     * unmodified. </b>
+     * @return a modified object
+     */
+    public Wildcards inverted() {
+        return Wildcards.of(flags ^ OFWildcardFlags.OFPFW_ALL_SANITIZED);
+    }
+
+    public boolean isWildcarded(Flag flag) {
+        return flag.isFullyOn(flags);
+    }
+
+    /**
+     * return all wildcard flags that are fully wildcarded as an EnumSet. Do not
+     * modify. Note: some flags (like NW_SRC and NW_DST) that are partially
+     * wildcarded are not returned in this set.
+     *
+     * @return the EnumSet of wildcards
+     */
+    public EnumSet<Wildcards.Flag> getWildcardedFlags() {
+        EnumSet<Wildcards.Flag> res = EnumSet.noneOf(Wildcards.Flag.class);
+        for (Wildcards.Flag flag : Flag.values()) {
+            if (flag.isFullyOn(flags)) {
+                res.add(flag);
+            }
+        }
+        return res;
+    }
+
+    /** return the OpenFlow 'wire' integer representation of these wildcards */
+    public int getInt() {
+        return flags;
+    }
+
+    /**
+     * return the OpenFlow 'wire' integer representation of these wildcards.
+     * Sanitize nw_src and nw_dst to be max. 32 (values > 32 are technically
+     * possible, but don't make semantic sense)
+     */
+    public static int sanitizeInt(int flags) {
+        if (((flags & OFWildcardFlags.OFPFW_NW_SRC_MASK) >> OFWildcardFlags.OFPFW_NW_SRC_SHIFT) > 32) {
+            flags = (flags & ~OFWildcardFlags.OFPFW_NW_SRC_MASK) | OFWildcardFlags.OFPFW_NW_SRC_ALL;
+        }
+        if (((flags & OFWildcardFlags.OFPFW_NW_DST_MASK) >> OFWildcardFlags.OFPFW_NW_DST_SHIFT) > 32) {
+            flags = (flags & ~OFWildcardFlags.OFPFW_NW_DST_MASK) | OFWildcardFlags.OFPFW_NW_DST_ALL;
+        }
+        return flags;
+    }
+
+    /**
+     * is this a wildcard set that has all flags set + and full (/0) nw_src and
+     * nw_dst wildcarding ?
+     */
+    public boolean isFull() {
+        return flags == OFWildcardFlags.OFPFW_ALL || flags == OFWildcardFlags.OFPFW_ALL_SANITIZED;
+    }
+
+    /** is this a wildcard of an exact match */
+    public boolean isExact() {
+        return flags == 0;
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 31;
+        int result = 1;
+        result = prime * result + flags;
+        return result;
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (this == obj)
+            return true;
+        if (obj == null)
+            return false;
+        if (getClass() != obj.getClass())
+            return false;
+        Wildcards other = (Wildcards) obj;
+        if (flags != other.flags)
+            return false;
+        return true;
+    }
+
+    private final static Joiner pipeJoiner = Joiner.on("|");
+
+    @Override
+    public String toString() {
+        List<String> res = new ArrayList<String>();
+        for (Wildcards.Flag flag : Flag.values()) {
+            if (flag.isFullyOn(flags)) {
+                res.add(flag.name().toLowerCase());
+            }
+        }
+
+        if (Flag.NW_SRC.isPartiallyOn(flags)) {
+            res.add("nw_src(/" + getNwSrcMask() + ")");
+        }
+
+        if (Flag.NW_DST.isPartiallyOn(flags)) {
+            res.add("nw_dst(/" + getNwDstMask() + ")");
+        }
+
+        return pipeJoiner.join(res);
+    }
+
+    private final static Joiner commaJoiner = Joiner.on(", ");
+
+    /** a Java expression that constructs 'this' wildcards set */
+    public String toJava() {
+        if(isFull()) {
+            return "Wildcards.FULL";
+        } else  if (isExact()){
+            return "Wildcards.EXACT";
+        }
+
+        StringBuilder b = new StringBuilder();
+
+        EnumSet<Flag> myFlags = getWildcardedFlags();
+        if (myFlags.size() < 3) {
+            // default to start with empty
+            b.append("Wildcards.of("
+                     + commaJoiner.join(prefix("Flag.", myFlags.iterator())) + ")");
+        } else {
+            // too many - start with full
+
+            EnumSet<Flag> invFlags = inverted().getWildcardedFlags();
+            b.append("Wildcards.ofMatches("
+                     + commaJoiner.join(prefix("Flag.", invFlags.iterator())) + ")");
+        }
+        if (Flag.NW_SRC.isPartiallyOn(flags)) {
+            b.append(".setNwSrcMask(" + getNwSrcMask() + ")");
+        }
+        if (Flag.NW_DST.isPartiallyOn(flags)) {
+            b.append(".setNwDstMask(" + getNwDstMask() + ")");
+        }
+        return b.toString();
+    }
+
+    private Iterator<String> prefix(final String prefix, final Iterator<?> i) {
+        return new Iterator<String>() {
+
+            @Override
+            public boolean hasNext() {
+                return i.hasNext();
+            }
+
+            @Override
+            public String next() {
+                Object next = i.next();
+                return next == null ? null : prefix + next.toString();
+            }
+
+            @Override
+            public void remove() {
+                i.remove();
+            }
+        };
+    }
+
+
+}
\ No newline at end of file
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/Writeable.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/Writeable.java
new file mode 100644
index 0000000..31ae9ab
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/Writeable.java
@@ -0,0 +1,7 @@
+package org.projectfloodlight.openflow.protocol;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+public interface Writeable {
+    void writeTo(ChannelBuffer bb);
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/XidGenerator.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/XidGenerator.java
new file mode 100644
index 0000000..65976dc
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/XidGenerator.java
@@ -0,0 +1,5 @@
+package org.projectfloodlight.openflow.protocol;
+
+public interface XidGenerator {
+    int nextXid();
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/Match.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/Match.java
new file mode 100644
index 0000000..5e68de5
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/Match.java
@@ -0,0 +1,207 @@
+package org.projectfloodlight.openflow.protocol.match;
+
+import org.projectfloodlight.openflow.protocol.OFObject;
+import org.projectfloodlight.openflow.types.Masked;
+import org.projectfloodlight.openflow.types.OFValueType;
+
+/**
+ * Generic interface for version-agnostic immutable Match structure.
+ * The Match structure is defined in the OpenFlow protocol, and it contains information on
+ * the fields to be matched in a specific flow record.
+ * This interface does not assume anything on the fields in the Match structure. If in
+ * some version, the match structure cannot handle a certain field, it may return <code>false</code>
+ * for <code>supports(...)</code> calls, and throw <code>UnsupportedOperationException</code> from all
+ * other methods in such cases.
+ * <br><br>
+ * On wildcards and masks:<br>
+ * This interface defines the following masking notations for fields:
+ * <ul>
+ * <li><b>Exact</b>: field is matched exactly against a single, fixed value (no mask, or mask is all ones).
+ * <li><b>Wildcarded</b>: field is not being matched. It is fully masked (mask=0) and any value of it
+ * will match the flow record having this match.
+ * <li><b>Partially masked</b>: field is matched using a specified mask which is neither 0 nor all ones. Mask can
+ * be either arbitrary or require some specific structure.
+ * </ul>
+ * Implementing classes may or may not support all types of these masking types. They may also support
+ * them in part. For example, OF1.0 supports exact match and (full) wildcarding for all fields, but it
+ * does only supports partial masking for IP source/destination fields, and this partial masking must be
+ * in the CIDR prefix format. Thus, OF1.0 implementation may throw <code>UnsupportedOperationException</code> if given
+ * in <code>setMaksed</code> an IP mask of, for example, 255.0.255.0, or if <code>setMasked</code> is called for any field
+ * which is not IP source/destination address.
+ * <br><br>
+ * On prerequisites:<br>
+ * From the OF1.1 spec, page 28, the OF1.0 spec failed to explicitly specify this, but it
+ * is the behavior of OF1.0 switches:
+ * "Protocol-specific fields within ofp_match will be ignored within a single table when
+ * the corresponding protocol is not specified in the match. The MPLS match fields will
+ * be ignored unless the Ethertype is specified as MPLS. Likewise, the IP header and
+ * transport header fields will be ignored unless the Ethertype is specified as either
+ * IPv4 or ARP. The tp_src and tp_dst fields will be ignored unless the network protocol
+ * specified is as TCP, UDP or SCTP. Fields that are ignored don�t need to be wildcarded
+ * and should be set to 0."
+ * <br><br>
+ * This interface uses generics to assure type safety in users code. However, implementing classes may have to suppress
+ * 'unchecked cast' warnings while making sure they correctly cast base on their implementation details.
+ *
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ */
+public interface Match extends OFObject {
+
+    /**
+     * Returns a value for the given field if:
+     * <ul>
+     * <li>Field is supported
+     * <li>Field is not fully wildcarded
+     * <li>Prerequisites are ok
+     * </ul>
+     * If one of the above conditions does not hold, returns null. Value is returned masked if partially wildcarded.
+     *
+     * @param field Match field to retrieve
+     * @return Value of match field (may be masked), or <code>null</code> if field is one of the conditions above does not hold.
+     * @throws UnsupportedOperationException If field is not supported.
+     */
+    public <F extends OFValueType<F>> F get(MatchField<F> field) throws UnsupportedOperationException;
+
+    /**
+     * Returns the masked value for the given field from this match, along with the mask itself.
+     * Prerequisite: field is partially masked.
+     * If prerequisite is not met, a <code>null</code> is returned.
+     *
+     * @param field Match field to retrieve.
+     * @return Masked value of match field or null if no mask is set.
+     * @throws UnsupportedOperationException If field is not supported.
+     */
+    public <F extends OFValueType<F>> Masked<F> getMasked(MatchField<F> field) throws UnsupportedOperationException;
+
+    /**
+     * Returns true if and only if this match object supports the given match field.
+     *
+     * @param field Match field
+     * @return true if field is supported, false otherwise.
+     */
+    public boolean supports(MatchField<?> field);
+
+    /**
+     * Returns true if and only if this match object supports partially bitmasking of the given field.
+     * (note: not all possible values of this bitmask have to be acceptable)
+     *
+     * @param field Match field.
+     * @return true if field can be partially masked, false otherwise.
+     * @throws UnsupportedOperationException If field is not supported.
+     */
+    public boolean supportsMasked(MatchField<?> field) throws UnsupportedOperationException;
+
+    /**
+     * Returns true if and only if this field is currently specified in the match with an exact value and
+     * no mask. I.e., the specified match will only select packets that match the exact value of getValue(field).
+     *
+     * @param field Match field.
+     * @return true if field has a specific exact value, false if not.
+     * @throws UnsupportedOperationException If field is not supported.
+     */
+    public boolean isExact(MatchField<?> field) throws UnsupportedOperationException;
+
+    /**
+     * True if and only if this field is currently logically unspecified in the match, i.e, the
+     * value returned by getValue(f) has no impact on whether a packet will be selected
+     * by the match or not.
+     *
+     * @param field Match field.
+     * @return true if field is fully wildcarded, false if not.
+     * @throws UnsupportedOperationException If field is not supported.
+     */
+    public boolean isFullyWildcarded(MatchField<?> field) throws UnsupportedOperationException;
+
+    /**
+     * True if and only if this field is currently partially specified in the match, i.e, the
+     * match will only select packets that match (p.value & getMask(field)) == getValue(field),
+     * and getMask(field) != 0.
+     *
+     * @param field Match field.
+     * @return true if field is partially masked, false if not.
+     * @throws UnsupportedOperationException If field is not supported.
+     */
+    public boolean isPartiallyMasked(MatchField<?> field) throws UnsupportedOperationException;
+
+    /**
+     * Returns a builder to build new instances of this type of match object.
+     * @return Match builder
+     */
+    public Builder createBuilder();
+
+    /**
+     * Builder interface for Match objects.
+     * Builder is used to create new Match objects and it creates the match according to the version it
+     * corresponds to. The builder uses the same notation of wildcards and masks, and can also throw
+     * <code>UnsupportedOperationException</code> if it is asked to create some matching that is not supported in
+     * the version it represents.
+     *
+     * While used, MatchBuilder may not be consistent in terms of field prerequisites. However, user must
+     * solve these before using the generated Match object as these prerequisites should be enforced in the
+     * getters.
+     *
+     * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+     */
+    interface Builder {
+        public <F extends OFValueType<F>> F get(MatchField<F> field) throws UnsupportedOperationException;
+
+        public <F extends OFValueType<F>> Masked<F> getMasked(MatchField<F> field) throws UnsupportedOperationException;
+
+        public boolean supports(MatchField<?> field);
+
+        public boolean supportsMasked(MatchField<?> field) throws UnsupportedOperationException;
+
+        public boolean isExact(MatchField<?> field) throws UnsupportedOperationException;
+
+        public boolean isFullyWildcarded(MatchField<?> field) throws UnsupportedOperationException;
+
+        public boolean isPartiallyMasked(MatchField<?> field) throws UnsupportedOperationException;
+
+        /**
+         * Sets a specific exact value for a field.
+         *
+         * @param field Match field to set.
+         * @param value Value of match field.
+         * @return the Builder instance used.
+         * @throws UnsupportedOperationException If field is not supported.
+         */
+        public <F extends OFValueType<F>> Builder setExact(MatchField<F> field, F value) throws UnsupportedOperationException;
+
+        /**
+         * Sets a masked value for a field.
+         *
+         * @param field Match field to set.
+         * @param value Value of field.
+         * @param mask Mask value.
+         * @return the Builder instance used.
+         * @throws UnsupportedOperationException If field is not supported, if field is supported but does not support masking, or if mask structure is not supported.
+         */
+        public <F extends OFValueType<F>> Builder setMasked(MatchField<F> field, F value, F mask) throws UnsupportedOperationException;
+
+        /**
+         * Sets a masked value for a field.
+         *
+         * @param field Match field to set.
+         * @param valueWithMask Compound Masked object contains the value and the mask.
+         * @return the Builder instance used.
+         * @throws UnsupportedOperationException If field is not supported, if field is supported but does not support masking, or if mask structure is not supported.
+         */
+        public <F extends OFValueType<F>> Builder setMasked(MatchField<F> field, Masked<F> valueWithMask) throws UnsupportedOperationException;
+
+        /**
+         * Unsets any value given for the field and wildcards it so that it matches any value.
+         *
+         * @param field Match field to unset.
+         * @return the Builder instance used.
+         * @throws UnsupportedOperationException If field is not supported.
+         */
+        public <F extends OFValueType<F>> Builder wildcard(MatchField<F> field) throws UnsupportedOperationException;
+
+        /**
+         * Returns the match created by this builder.
+         *
+         * @return a Match object.
+         */
+        public Match build();
+    }
+}
\ No newline at end of file
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchField.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchField.java
new file mode 100644
index 0000000..333d25d
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchField.java
@@ -0,0 +1,156 @@
+package org.projectfloodlight.openflow.protocol.match;
+
+import org.projectfloodlight.openflow.types.ArpOpcode;
+import org.projectfloodlight.openflow.types.EthType;
+import org.projectfloodlight.openflow.types.ICMPv4Code;
+import org.projectfloodlight.openflow.types.ICMPv4Type;
+import org.projectfloodlight.openflow.types.IPv4;
+import org.projectfloodlight.openflow.types.IPv6;
+import org.projectfloodlight.openflow.types.IPv6FlowLabel;
+import org.projectfloodlight.openflow.types.IpDscp;
+import org.projectfloodlight.openflow.types.IpEcn;
+import org.projectfloodlight.openflow.types.IpProtocol;
+import org.projectfloodlight.openflow.types.MacAddress;
+import org.projectfloodlight.openflow.types.OFMetadata;
+import org.projectfloodlight.openflow.types.OFPort;
+import org.projectfloodlight.openflow.types.OFValueType;
+import org.projectfloodlight.openflow.types.TransportPort;
+import org.projectfloodlight.openflow.types.VlanPcp;
+import org.projectfloodlight.openflow.types.VlanVid;
+
+@SuppressWarnings("unchecked")
+public class MatchField<F extends OFValueType<F>> {
+    private final String name;
+    public final MatchFields id;
+    private final Prerequisite<?>[] prerequisites;
+
+    private MatchField(final String name, final MatchFields id, Prerequisite<?>... prerequisites) {
+        this.name = name;
+        this.id = id;
+        this.prerequisites = prerequisites;
+    }
+
+    public final static MatchField<OFPort> IN_PORT =
+            new MatchField<OFPort>("in_port", MatchFields.IN_PORT);
+
+    public final static MatchField<OFPort> IN_PHY_PORT =
+            new MatchField<OFPort>("in_phy_port", MatchFields.IN_PHY_PORT,
+                    new Prerequisite<OFPort>(MatchField.IN_PORT));
+
+    public final static MatchField<OFMetadata> METADATA =
+            new MatchField<OFMetadata>("metadata", MatchFields.METADATA);
+
+    public final static MatchField<MacAddress> ETH_DST =
+            new MatchField<MacAddress>("eth_dst", MatchFields.ETH_DST);
+
+    public final static MatchField<MacAddress> ETH_SRC =
+            new MatchField<MacAddress>("eth_src", MatchFields.ETH_SRC);
+
+    public final static MatchField<EthType> ETH_TYPE =
+            new MatchField<EthType>("eth_type", MatchFields.ETH_TYPE);
+
+    public final static MatchField<VlanVid> VLAN_VID =
+            new MatchField<VlanVid>("vlan_vid", MatchFields.VLAN_VID);
+
+    public final static MatchField<VlanPcp> VLAN_PCP =
+            new MatchField<VlanPcp>("vlan_pcp", MatchFields.VLAN_PCP,
+                    new Prerequisite<VlanVid>(MatchField.VLAN_VID));
+
+    public final static MatchField<IpDscp> IP_DSCP =
+            new MatchField<IpDscp>("ip_dscp", MatchFields.IP_DSCP,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_IPv4, EthType.ETH_TYPE_IPv6));
+
+    public final static MatchField<IpEcn> IP_ECN =
+            new MatchField<IpEcn>("ip_dscp", MatchFields.IP_ECN,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_IPv4, EthType.ETH_TYPE_IPv6));
+
+    public final static MatchField<IpProtocol> IP_PROTO =
+            new MatchField<IpProtocol>("ip_proto", MatchFields.IP_PROTO,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_IPv4, EthType.ETH_TYPE_IPv6));
+
+    public final static MatchField<IPv4> IPV4_SRC =
+            new MatchField<IPv4>("ipv4_src", MatchFields.IPV4_SRC,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_IPv4));
+
+    public final static MatchField<IPv4> IPV4_DST =
+            new MatchField<IPv4>("ipv4_dst", MatchFields.IPV4_DST,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_IPv4));
+
+    public final static MatchField<TransportPort> TCP_SRC = new MatchField<TransportPort>(
+            "tcp_src", MatchFields.TCP_SRC,
+            new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.IP_PROTO_TCP));
+
+    public final static MatchField<TransportPort> TCP_DST = new MatchField<TransportPort>(
+            "tcp_dst", MatchFields.TCP_DST,
+            new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.IP_PROTO_TCP));
+
+    public final static MatchField<TransportPort> UDP_SRC = new MatchField<TransportPort>(
+            "udp_src", MatchFields.UDP_SRC,
+            new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.IP_PROTO_UDP));
+
+    public final static MatchField<TransportPort> UDP_DST = new MatchField<TransportPort>(
+            "udp_dst", MatchFields.UDP_DST,
+            new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.IP_PROTO_UDP));
+
+    public final static MatchField<TransportPort> SCTP_SRC = new MatchField<TransportPort>(
+            "sctp_src", MatchFields.SCTP_SRC,
+            new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.IP_PROTO_SCTP));
+
+    public final static MatchField<TransportPort> SCTP_DST = new MatchField<TransportPort>(
+            "sctp_dst", MatchFields.SCTP_DST,
+            new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.IP_PROTO_SCTP));
+
+    public final static MatchField<ICMPv4Type> ICMPV4_TYPE = new MatchField<ICMPv4Type>(
+            "icmpv4_src", MatchFields.ICMPV4_TYPE,
+            new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.IP_PROTO_ICMP));
+
+    public final static MatchField<ICMPv4Code> ICMPV4_CODE = new MatchField<ICMPv4Code>(
+            "icmpv4_dst", MatchFields.ICMPV4_CODE,
+            new Prerequisite<IpProtocol>(MatchField.IP_PROTO, IpProtocol.IP_PROTO_ICMP));
+
+    public final static MatchField<ArpOpcode> ARP_OP = new MatchField<ArpOpcode>(
+            "arp_op", MatchFields.ARP_OP,
+            new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_ARP));
+
+    public final static MatchField<IPv4> ARP_SPA =
+            new MatchField<IPv4>("arp_spa", MatchFields.ARP_SPA,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_ARP));
+
+    public final static MatchField<IPv4> ARP_TPA =
+            new MatchField<IPv4>("arp_tpa", MatchFields.ARP_TPA,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_ARP));
+
+    public final static MatchField<MacAddress> ARP_SHA =
+            new MatchField<MacAddress>("arp_sha", MatchFields.ARP_SHA,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_ARP));
+
+    public final static MatchField<MacAddress> ARP_THA =
+            new MatchField<MacAddress>("arp_tha", MatchFields.ARP_THA,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_ARP));
+
+    public final static MatchField<IPv6> IPV6_SRC =
+            new MatchField<IPv6>("ipv6_src", MatchFields.IPV6_SRC,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_IPv6));
+
+    public final static MatchField<IPv6> IPV6_DST =
+            new MatchField<IPv6>("ipv6_dst", MatchFields.IPV6_DST,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_IPv6));
+
+    public final static MatchField<IPv6FlowLabel> IPV6_FLABEL =
+            new MatchField<IPv6FlowLabel>("ipv6_flabel", MatchFields.IPV6_FLABEL,
+                    new Prerequisite<EthType>(MatchField.ETH_TYPE, EthType.ETH_TYPE_IPv6));
+
+    public String getName() {
+        return name;
+    }
+
+    public boolean arePrerequisitesOK(Match match) {
+        for (Prerequisite<?> p : this.prerequisites) {
+            if (!p.isSatisfied(match)) {
+                return false;
+            }
+        }
+        return true;
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchFields.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchFields.java
new file mode 100644
index 0000000..2fc10ae
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/MatchFields.java
@@ -0,0 +1,34 @@
+package org.projectfloodlight.openflow.protocol.match;
+
+// MUST BE ORDERED BY THE ORDER OF OF SPEC!!!
+public enum MatchFields {
+    IN_PORT,
+    IN_PHY_PORT,
+    METADATA,
+    ETH_DST,
+    ETH_SRC,
+    ETH_TYPE,
+    VLAN_VID,
+    VLAN_PCP,
+    IP_DSCP,
+    IP_ECN,
+    IP_PROTO,
+    IPV4_SRC,
+    IPV4_DST,
+    TCP_SRC,
+    TCP_DST,
+    UDP_SRC,
+    UDP_DST,
+    SCTP_SRC,
+    SCTP_DST,
+    ICMPV4_TYPE,
+    ICMPV4_CODE,
+    ARP_OP,
+    ARP_SPA,
+    ARP_TPA,
+    ARP_SHA,
+    ARP_THA,
+    IPV6_SRC,
+    IPV6_DST,
+    IPV6_FLABEL,
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/Prerequisite.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/Prerequisite.java
new file mode 100644
index 0000000..4e667e7
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/match/Prerequisite.java
@@ -0,0 +1,44 @@
+package org.projectfloodlight.openflow.protocol.match;
+
+import java.util.HashSet;
+import java.util.Set;
+
+import org.projectfloodlight.openflow.types.OFValueType;
+
+public class Prerequisite<T extends OFValueType<T>> {
+    private final MatchField<T> field;
+    private final Set<OFValueType<T>> values;
+    private boolean any;
+
+    public Prerequisite(MatchField<T> field, OFValueType<T>... values) {
+        this.values = new HashSet<OFValueType<T>>();
+        this.field = field;
+        if (values == null || values.length == 0) {
+            this.any = true;
+        } else {
+            this.any = false;
+            for (OFValueType<T> value : values) {
+                this.values.add(value);
+            }
+        }
+    }
+
+    /**
+     * Returns true if this prerequisite is satisfied by the given match object.
+     *
+     * @param match Match object
+     * @return true iff prerequisite is satisfied.
+     */
+    public boolean isSatisfied(Match match) {
+        OFValueType<T> res = match.get(this.field);
+        if (res == null)
+            return false;
+        if (this.any)
+            return true;
+        if (this.values.contains(res)) {
+            return true;
+        }
+        return false;
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver10/ChannelUtilsVer10.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver10/ChannelUtilsVer10.java
new file mode 100644
index 0000000..7a42d20
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver10/ChannelUtilsVer10.java
@@ -0,0 +1,31 @@
+package org.projectfloodlight.openflow.protocol.ver10;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.match.Match;
+import org.projectfloodlight.openflow.protocol.ver10.OFMatchV1Ver10;
+import org.projectfloodlight.openflow.protocol.OFBsnVportQInQ;
+
+/**
+ * Collection of helper functions for reading and writing into ChannelBuffers
+ *
+ * @author capveg
+ */
+
+public class ChannelUtilsVer10 {
+    public static Match readOFMatch(final ChannelBuffer bb) throws OFParseError {
+        return OFMatchV1Ver10.READER.readFrom(bb);
+    }
+
+    // TODO these need to be figured out / removed
+    public static OFBsnVportQInQ readOFBsnVportQInQ(ChannelBuffer bb) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+
+    public static void writeOFBsnVportQInQ(ChannelBuffer bb,
+            OFBsnVportQInQ vport) {
+        throw new UnsupportedOperationException("not implemented");
+
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver11/ChannelUtilsVer11.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver11/ChannelUtilsVer11.java
new file mode 100644
index 0000000..735fe3b
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver11/ChannelUtilsVer11.java
@@ -0,0 +1,39 @@
+package org.projectfloodlight.openflow.protocol.ver11;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMatchBmap;
+import org.projectfloodlight.openflow.protocol.match.Match;
+import org.projectfloodlight.openflow.protocol.ver11.OFMatchV2Ver11;
+import org.projectfloodlight.openflow.protocol.OFBsnVportQInQ;
+
+/**
+ * Collection of helper functions for reading and writing into ChannelBuffers
+ *
+ * @author capveg
+ */
+
+public class ChannelUtilsVer11 {
+    public static Match readOFMatch(final ChannelBuffer bb) throws OFParseError {
+        return OFMatchV2Ver11.READER.readFrom(bb);
+    }
+
+    // TODO these need to be figured out / removed
+    public static OFBsnVportQInQ readOFBsnVportQInQ(ChannelBuffer bb) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+
+    public static void writeOFBsnVportQInQ(ChannelBuffer bb,
+            OFBsnVportQInQ vport) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+
+
+    public static OFMatchBmap readOFMatchBmap(ChannelBuffer bb) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+
+    public static void writeOFMatchBmap(ChannelBuffer bb, OFMatchBmap match) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver12/ChannelUtilsVer12.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver12/ChannelUtilsVer12.java
new file mode 100644
index 0000000..756363d
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver12/ChannelUtilsVer12.java
@@ -0,0 +1,40 @@
+package org.projectfloodlight.openflow.protocol.ver12;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMatchBmap;
+import org.projectfloodlight.openflow.protocol.match.Match;
+import org.projectfloodlight.openflow.protocol.ver12.OFMatchV3Ver12;
+import org.projectfloodlight.openflow.protocol.OFBsnVportQInQ;
+
+/**
+ * Collection of helper functions for reading and writing into ChannelBuffers
+ *
+ * @author capveg
+ */
+
+public class ChannelUtilsVer12 {
+    public static Match readOFMatch(final ChannelBuffer bb) throws OFParseError {
+        return OFMatchV3Ver12.READER.readFrom(bb);
+    }
+
+    // TODO these need to be figured out / removed
+
+    public static OFBsnVportQInQ readOFBsnVportQInQ(ChannelBuffer bb) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+
+    public static void writeOFBsnVportQInQ(ChannelBuffer bb,
+            OFBsnVportQInQ vport) {
+        throw new UnsupportedOperationException("not implemented");
+
+    }
+
+    public static OFMatchBmap readOFMatchBmap(ChannelBuffer bb) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+
+    public static void writeOFMatchBmap(ChannelBuffer bb, OFMatchBmap match) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver13/ChannelUtilsVer13.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver13/ChannelUtilsVer13.java
new file mode 100644
index 0000000..0be26ae
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/protocol/ver13/ChannelUtilsVer13.java
@@ -0,0 +1,39 @@
+package org.projectfloodlight.openflow.protocol.ver13;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMatchBmap;
+import org.projectfloodlight.openflow.protocol.match.Match;
+import org.projectfloodlight.openflow.protocol.ver13.OFMatchV3Ver13;
+import org.projectfloodlight.openflow.protocol.OFBsnVportQInQ;
+
+/**
+ * Collection of helper functions for reading and writing into ChannelBuffers
+ *
+ * @author capveg
+ */
+
+public class ChannelUtilsVer13 {
+    public static Match readOFMatch(final ChannelBuffer bb) throws OFParseError {
+        return OFMatchV3Ver13.READER.readFrom(bb);
+    }
+
+    // TODO these need to be figured out / removed
+
+    public static OFBsnVportQInQ readOFBsnVportQInQ(ChannelBuffer bb) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+
+    public static void writeOFBsnVportQInQ(ChannelBuffer bb,
+            OFBsnVportQInQ vport) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+
+    public static OFMatchBmap readOFMatchBmap(ChannelBuffer bb) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+
+    public static void writeOFMatchBmap(ChannelBuffer bb, OFMatchBmap match) {
+        throw new UnsupportedOperationException("not implemented");
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/ArpOpcode.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/ArpOpcode.java
new file mode 100644
index 0000000..5e710ca
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/ArpOpcode.java
@@ -0,0 +1,158 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+public class ArpOpcode implements OFValueType<ArpOpcode> {
+
+    final static int LENGTH = 2;
+
+    private static final int ARP_OPCODE_VAL_REQUEST   = 1;
+    private static final int ARP_OPCODE_VAL_REPLY = 2;
+    private static final int ARP_OPCODE_VAL_REQUEST_REVERSE   = 3;
+    private static final int ARP_OPCODE_VAL_REPLY_REVERSE = 4;
+    private static final int ARP_OPCODE_VAL_DRARP_REQUEST = 5;
+    private static final int ARP_OPCODE_VAL_DRARP_REPLY   = 6;
+    private static final int ARP_OPCODE_VAL_DRARP_ERROR   = 7;
+    private static final int ARP_OPCODE_VAL_INARP_REQUEST = 8;
+    private static final int ARP_OPCODE_VAL_INARP_REPLY   = 9;
+    private static final int ARP_OPCODE_VAL_ARP_NAK   = 10;
+    private static final int ARP_OPCODE_VAL_MARS_REQUEST  = 11;
+    private static final int ARP_OPCODE_VAL_MARS_MULTI    = 12;
+    private static final int ARP_OPCODE_VAL_MARS_MSERV    = 13;
+    private static final int ARP_OPCODE_VAL_MARS_JOIN = 14;
+    private static final int ARP_OPCODE_VAL_MARS_LEAVE    = 15;
+    private static final int ARP_OPCODE_VAL_MARS_NAK  = 16;
+    private static final int ARP_OPCODE_VAL_MARS_UNSERV   = 17;
+    private static final int ARP_OPCODE_VAL_MARS_SJOIN    = 18;
+    private static final int ARP_OPCODE_VAL_MARS_SLEAVE   = 19;
+    private static final int ARP_OPCODE_VAL_MARS_GROUPLIST_REQUEST    = 20;
+    private static final int ARP_OPCODE_VAL_MARS_GROUPLIST_REPLY  = 21;
+    private static final int ARP_OPCODE_VAL_MARS_REDIRECT_MAP = 22;
+    private static final int ARP_OPCODE_VAL_MAPOS_UNARP   = 23;
+    private static final int ARP_OPCODE_VAL_OP_EXP1   = 24;
+    private static final int ARP_OPCODE_VAL_OP_EXP2   = 25;
+
+    public static final ArpOpcode ARP_OPCODE_REQUEST  = new ArpOpcode(ARP_OPCODE_VAL_REQUEST);
+    public static final ArpOpcode ARP_OPCODE_REPLY    = new ArpOpcode(ARP_OPCODE_VAL_REPLY);
+    public static final ArpOpcode ARP_OPCODE_REQUEST_REVERSE  = new ArpOpcode(ARP_OPCODE_VAL_REQUEST_REVERSE);
+    public static final ArpOpcode ARP_OPCODE_REPLY_REVERSE    = new ArpOpcode(ARP_OPCODE_VAL_REPLY_REVERSE);
+    public static final ArpOpcode ARP_OPCODE_DRARP_REQUEST    = new ArpOpcode(ARP_OPCODE_VAL_DRARP_REQUEST);
+    public static final ArpOpcode ARP_OPCODE_DRARP_REPLY  = new ArpOpcode(ARP_OPCODE_VAL_DRARP_REPLY);
+    public static final ArpOpcode ARP_OPCODE_DRARP_ERROR  = new ArpOpcode(ARP_OPCODE_VAL_DRARP_ERROR);
+    public static final ArpOpcode ARP_OPCODE_INARP_REQUEST    = new ArpOpcode(ARP_OPCODE_VAL_INARP_REQUEST);
+    public static final ArpOpcode ARP_OPCODE_INARP_REPLY  = new ArpOpcode(ARP_OPCODE_VAL_INARP_REPLY);
+    public static final ArpOpcode ARP_OPCODE_ARP_NAK  = new ArpOpcode(ARP_OPCODE_VAL_ARP_NAK);
+    public static final ArpOpcode ARP_OPCODE_MARS_REQUEST = new ArpOpcode(ARP_OPCODE_VAL_MARS_REQUEST);
+    public static final ArpOpcode ARP_OPCODE_MARS_MULTI   = new ArpOpcode(ARP_OPCODE_VAL_MARS_MULTI);
+    public static final ArpOpcode ARP_OPCODE_MARS_MSERV   = new ArpOpcode(ARP_OPCODE_VAL_MARS_MSERV);
+    public static final ArpOpcode ARP_OPCODE_MARS_JOIN    = new ArpOpcode(ARP_OPCODE_VAL_MARS_JOIN);
+    public static final ArpOpcode ARP_OPCODE_MARS_LEAVE   = new ArpOpcode(ARP_OPCODE_VAL_MARS_LEAVE);
+    public static final ArpOpcode ARP_OPCODE_MARS_NAK = new ArpOpcode(ARP_OPCODE_VAL_MARS_NAK);
+    public static final ArpOpcode ARP_OPCODE_MARS_UNSERV  = new ArpOpcode(ARP_OPCODE_VAL_MARS_UNSERV);
+    public static final ArpOpcode ARP_OPCODE_MARS_SJOIN   = new ArpOpcode(ARP_OPCODE_VAL_MARS_SJOIN);
+    public static final ArpOpcode ARP_OPCODE_MARS_SLEAVE  = new ArpOpcode(ARP_OPCODE_VAL_MARS_SLEAVE);
+    public static final ArpOpcode ARP_OPCODE_MARS_GROUPLIST_REQUEST   = new ArpOpcode(ARP_OPCODE_VAL_MARS_GROUPLIST_REQUEST);
+    public static final ArpOpcode ARP_OPCODE_MARS_GROUPLIST_REPLY = new ArpOpcode(ARP_OPCODE_VAL_MARS_GROUPLIST_REPLY);
+    public static final ArpOpcode ARP_OPCODE_MARS_REDIRECT_MAP    = new ArpOpcode(ARP_OPCODE_VAL_MARS_REDIRECT_MAP);
+    public static final ArpOpcode ARP_OPCODE_MAPOS_UNARP  = new ArpOpcode(ARP_OPCODE_VAL_MAPOS_UNARP);
+    public static final ArpOpcode ARP_OPCODE_OP_EXP1  = new ArpOpcode(ARP_OPCODE_VAL_OP_EXP1);
+    public static final ArpOpcode ARP_OPCODE_OP_EXP2  = new ArpOpcode(ARP_OPCODE_VAL_OP_EXP2);
+
+    private static final int MIN_OPCODE = 0;
+    private static final int MAX_OPCODE = 0xFFFF;
+    
+    public static final ArpOpcode NO_MASK = new ArpOpcode(0xFFFFFFFF);
+    public static final ArpOpcode FULL_MASK = new ArpOpcode(0x00000000);
+
+    private final int opcode;
+
+    private ArpOpcode(int opcode) {
+        this.opcode = opcode;
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    public int getOpcode() {
+        return this.opcode;
+    }
+
+    public static ArpOpcode of(int opcode) {
+        if (opcode < MIN_OPCODE || opcode > MAX_OPCODE)
+            throw new IllegalArgumentException("Invalid ARP opcode: " + opcode);
+        switch (opcode) {
+            case ARP_OPCODE_VAL_REQUEST:
+                return ARP_OPCODE_REQUEST;
+            case ARP_OPCODE_VAL_REPLY:
+                return ARP_OPCODE_REPLY;
+            case ARP_OPCODE_VAL_REQUEST_REVERSE:
+                return ARP_OPCODE_REQUEST_REVERSE;
+            case ARP_OPCODE_VAL_REPLY_REVERSE:
+                return ARP_OPCODE_REPLY_REVERSE;
+            case ARP_OPCODE_VAL_DRARP_REQUEST:
+                return ARP_OPCODE_DRARP_REQUEST;
+            case ARP_OPCODE_VAL_DRARP_REPLY:
+                return ARP_OPCODE_DRARP_REPLY;
+            case ARP_OPCODE_VAL_DRARP_ERROR:
+                return ARP_OPCODE_DRARP_ERROR;
+            case ARP_OPCODE_VAL_INARP_REQUEST:
+                return ARP_OPCODE_INARP_REQUEST;
+            case ARP_OPCODE_VAL_INARP_REPLY:
+                return ARP_OPCODE_INARP_REPLY;
+            case ARP_OPCODE_VAL_ARP_NAK:
+                return ARP_OPCODE_ARP_NAK;
+            case ARP_OPCODE_VAL_MARS_REQUEST:
+                return ARP_OPCODE_MARS_REQUEST;
+            case ARP_OPCODE_VAL_MARS_MULTI:
+                return ARP_OPCODE_MARS_MULTI;
+            case ARP_OPCODE_VAL_MARS_MSERV:
+                return ARP_OPCODE_MARS_MSERV;
+            case ARP_OPCODE_VAL_MARS_JOIN:
+                return ARP_OPCODE_MARS_JOIN;
+            case ARP_OPCODE_VAL_MARS_LEAVE:
+                return ARP_OPCODE_MARS_LEAVE;
+            case ARP_OPCODE_VAL_MARS_NAK:
+                return ARP_OPCODE_MARS_NAK;
+            case ARP_OPCODE_VAL_MARS_UNSERV:
+                return ARP_OPCODE_MARS_UNSERV;
+            case ARP_OPCODE_VAL_MARS_SJOIN:
+                return ARP_OPCODE_MARS_SJOIN;
+            case ARP_OPCODE_VAL_MARS_SLEAVE:
+                return ARP_OPCODE_MARS_SLEAVE;
+            case ARP_OPCODE_VAL_MARS_GROUPLIST_REQUEST:
+                return ARP_OPCODE_MARS_GROUPLIST_REQUEST;
+            case ARP_OPCODE_VAL_MARS_GROUPLIST_REPLY:
+                return ARP_OPCODE_MARS_GROUPLIST_REPLY;
+            case ARP_OPCODE_VAL_MARS_REDIRECT_MAP:
+                return ARP_OPCODE_MARS_REDIRECT_MAP;
+            case ARP_OPCODE_VAL_MAPOS_UNARP:
+                return ARP_OPCODE_MAPOS_UNARP;
+            case ARP_OPCODE_VAL_OP_EXP1:
+                return ARP_OPCODE_OP_EXP1;
+            case ARP_OPCODE_VAL_OP_EXP2:
+                return ARP_OPCODE_OP_EXP2;
+            default:
+                return new ArpOpcode(opcode);
+        }
+    }
+    
+    public void write2Bytes(ChannelBuffer c) {
+        c.writeShort(this.opcode);
+    }
+    
+    public static ArpOpcode read2Bytes(ChannelBuffer c) {
+        return ArpOpcode.of(c.readUnsignedShort());
+    }
+
+    @Override
+    public ArpOpcode applyMask(ArpOpcode mask) {
+        return ArpOpcode.of(this.opcode & mask.opcode);
+    }
+    
+    public int getOpCode() {
+        return opcode;
+    }
+    
+}
\ No newline at end of file
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/EthType.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/EthType.java
new file mode 100644
index 0000000..52f5455
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/EthType.java
@@ -0,0 +1,251 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+
+/**
+ * EtherType field representation.
+ * 
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ */
+public class EthType implements OFValueType<EthType> {
+    static final int LENGTH = 2;
+
+    private final int rawValue;
+
+    static final int ETH_TYPE_VAL_IPv4              = 0x0800; // Internet Protocol version 4 (IPv4)
+    static final int ETH_TYPE_VAL_ARP               = 0x0806; // Address Resolution Protocol (ARP)
+    static final int ETH_TYPE_VAL_WAKE_ON_LAN       = 0x0842; // Wake-on-LAN[3]
+    static final int ETH_TYPE_VAL_TRILL             = 0x22F3; // IETF TRILL Protocol
+    static final int ETH_TYPE_VAL_DECNET_IV         = 0x6003; // DECnet Phase IV
+    static final int ETH_TYPE_VAL_REV_ARP           = 0x8035; // Reverse Address Resolution Protocol
+    static final int ETH_TYPE_VAL_APPLE_TALK        = 0x809B; // AppleTalk (Ethertalk)
+    static final int ETH_TYPE_VAL_APPLE_TALK_ARP    = 0x80F3; // AppleTalk Address Resolution Protocol (AARP)
+    static final int ETH_TYPE_VAL_VLAN_FRAME        = 0x8100; // VLAN-tagged frame (IEEE 802.1Q) & Shortest Path Bridging IEEE 802.1aq[4]
+    static final int ETH_TYPE_VAL_IPX_8137          = 0x8137; // IPX
+    static final int ETH_TYPE_VAL_IPX_8138          = 0x8138; // IPX
+    static final int ETH_TYPE_VAL_QNX               = 0x8204; // QNX Qnet
+    static final int ETH_TYPE_VAL_IPv6              = 0x86DD; // Internet Protocol Version 6 (IPv6)
+    static final int ETH_TYPE_VAL_ETH_FLOW          = 0x8808; // Ethernet flow control
+    static final int ETH_TYPE_VAL_SLOW_PROTOCOLS    = 0x8809; // Slow Protocols (IEEE 802.3)
+    static final int ETH_TYPE_VAL_COBRANET          = 0x8819; // CobraNet
+    static final int ETH_TYPE_VAL_MPLS_UNICAST      = 0x8847; // MPLS unicast
+    static final int ETH_TYPE_VAL_MPLS_MULTICAST    = 0x8848; // MPLS multicast
+    static final int ETH_TYPE_VAL_PPPoE_DISCOVERY   = 0x8863; // PPPoE Discovery Stage
+    static final int ETH_TYPE_VAL_PPPoE_SESSION     = 0x8864; // PPPoE Session Stage
+    static final int ETH_TYPE_VAL_JUMBO_FRAMES      = 0x8870; // Jumbo Frames
+    static final int ETH_TYPE_VAL_HOMEPLUG_10       = 0x887B; // HomePlug 1.0 MME
+    static final int ETH_TYPE_VAL_EAP_OVER_LAN      = 0x888E; // EAP over LAN (IEEE 802.1X)
+    static final int ETH_TYPE_VAL_PROFINET          = 0x8892; // PROFINET Protocol
+    static final int ETH_TYPE_VAL_HYPERSCSI         = 0x889A; // HyperSCSI (SCSI over Ethernet)
+    static final int ETH_TYPE_VAL_ATA_OVER_ETH      = 0x88A2; // ATA over Ethernet
+    static final int ETH_TYPE_VAL_ETHERCAT          = 0x88A4; // EtherCAT Protocol
+    static final int ETH_TYPE_VAL_BRIDGING          = 0x88A8; // Provider Bridging (IEEE 802.1ad) & Shortest Path Bridging IEEE 802.1aq[5]
+    static final int ETH_TYPE_VAL_POWERLINK         = 0x88AB; // Ethernet Powerlink[citation needed]
+    static final int ETH_TYPE_VAL_LLDP              = 0x88CC; // Link Layer Discovery Protocol (LLDP)
+    static final int ETH_TYPE_VAL_SERCOS            = 0x88CD; // SERCOS III
+    static final int ETH_TYPE_VAL_HOMEPLUG_AV       = 0x88E1; // HomePlug AV MME[citation needed]
+    static final int ETH_TYPE_VAL_MRP               = 0x88E3; // Media Redundancy Protocol (IEC62439-2)
+    static final int ETH_TYPE_VAL_MAC_SEC           = 0x88E5; // MAC security (IEEE 802.1AE)
+    static final int ETH_TYPE_VAL_PTP               = 0x88F7; // Precision Time Protocol (IEEE 1588)
+    static final int ETH_TYPE_VAL_CFM               = 0x8902; // IEEE 802.1ag Connectivity Fault Management (CFM) Protocol / ITU-T Recommendation Y.1731 (OAM)
+    static final int ETH_TYPE_VAL_FCoE              = 0x8906; // Fibre Channel over Ethernet (FCoE)
+    static final int ETH_TYPE_VAL_FCoE_INIT         = 0x8914; // FCoE Initialization Protocol
+    static final int ETH_TYPE_VAL_RoCE              = 0x8915; // RDMA over Converged Ethernet (RoCE)
+    static final int ETH_TYPE_VAL_HSR               = 0x892F; // High-availability Seamless Redundancy (HSR)
+    static final int ETH_TYPE_VAL_CONF_TEST         = 0x9000; // Ethernet Configuration Testing Protocol[6]
+    static final int ETH_TYPE_VAL_Q_IN_Q            = 0x9100; // Q-in-Q
+    static final int ETH_TYPE_VAL_LLT               = 0xCAFE; // Veritas Low Latency Transport (LLT)[7] for Veritas Cluster Server
+
+    public static final EthType ETH_TYPE_IPv4               = new EthType(ETH_TYPE_VAL_IPv4);
+    public static final EthType ETH_TYPE_ARP                = new EthType(ETH_TYPE_VAL_ARP);
+    public static final EthType ETH_TYPE_WAKE_ON_LAN        = new EthType(ETH_TYPE_VAL_WAKE_ON_LAN);
+    public static final EthType ETH_TYPE_TRILL              = new EthType(ETH_TYPE_VAL_TRILL);
+    public static final EthType ETH_TYPE_DECNET_IV          = new EthType(ETH_TYPE_VAL_DECNET_IV); 
+    public static final EthType ETH_TYPE_REV_ARP            = new EthType(ETH_TYPE_VAL_REV_ARP );
+    public static final EthType ETH_TYPE_APPLE_TALK         = new EthType(ETH_TYPE_VAL_APPLE_TALK); 
+    public static final EthType ETH_TYPE_APPLE_TALK_ARP     = new EthType(ETH_TYPE_VAL_APPLE_TALK_ARP); 
+    public static final EthType ETH_TYPE_VLAN_FRAME         = new EthType(ETH_TYPE_VAL_VLAN_FRAME );
+    public static final EthType ETH_TYPE_IPX_8137           = new EthType(ETH_TYPE_VAL_IPX_8137 );
+    public static final EthType ETH_TYPE_IPX_8138           = new EthType(ETH_TYPE_VAL_IPX_8138 );
+    public static final EthType ETH_TYPE_QNX                = new EthType(ETH_TYPE_VAL_QNX );
+    public static final EthType ETH_TYPE_IPv6               = new EthType(ETH_TYPE_VAL_IPv6 );
+    public static final EthType ETH_TYPE_ETH_FLOW           = new EthType(ETH_TYPE_VAL_ETH_FLOW); 
+    public static final EthType ETH_TYPE_SLOW_PROTOCOLS     = new EthType(ETH_TYPE_VAL_SLOW_PROTOCOLS );
+    public static final EthType ETH_TYPE_COBRANET           = new EthType(ETH_TYPE_VAL_COBRANET );
+    public static final EthType ETH_TYPE_MPLS_UNICAST       = new EthType(ETH_TYPE_VAL_MPLS_UNICAST );
+    public static final EthType ETH_TYPE_MPLS_MULTICAST     = new EthType(ETH_TYPE_VAL_MPLS_MULTICAST );
+    public static final EthType ETH_TYPE_PPPoE_DISCOVERY    = new EthType(ETH_TYPE_VAL_PPPoE_DISCOVERY);
+    public static final EthType ETH_TYPE_PPPoE_SESSION      = new EthType(ETH_TYPE_VAL_PPPoE_SESSION );
+    public static final EthType ETH_TYPE_JUMBO_FRAMES       = new EthType(ETH_TYPE_VAL_JUMBO_FRAMES );
+    public static final EthType ETH_TYPE_HOMEPLUG_10        = new EthType(ETH_TYPE_VAL_HOMEPLUG_10 );
+    public static final EthType ETH_TYPE_EAP_OVER_LAN       = new EthType(ETH_TYPE_VAL_EAP_OVER_LAN );
+    public static final EthType ETH_TYPE_PROFINET           = new EthType(ETH_TYPE_VAL_PROFINET );
+    public static final EthType ETH_TYPE_HYPERSCSI          = new EthType(ETH_TYPE_VAL_HYPERSCSI );
+    public static final EthType ETH_TYPE_ATA_OVER_ETH       = new EthType(ETH_TYPE_VAL_ATA_OVER_ETH); 
+    public static final EthType ETH_TYPE_ETHERCAT           = new EthType(ETH_TYPE_VAL_ETHERCAT );
+    public static final EthType ETH_TYPE_BRIDGING           = new EthType(ETH_TYPE_VAL_BRIDGING );
+    public static final EthType ETH_TYPE_POWERLINK          = new EthType(ETH_TYPE_VAL_POWERLINK );
+    public static final EthType ETH_TYPE_LLDP               = new EthType(ETH_TYPE_VAL_LLDP );
+    public static final EthType ETH_TYPE_SERCOS             = new EthType(ETH_TYPE_VAL_SERCOS );
+    public static final EthType ETH_TYPE_HOMEPLUG_AV        = new EthType(ETH_TYPE_VAL_HOMEPLUG_AV );
+    public static final EthType ETH_TYPE_MRP                = new EthType(ETH_TYPE_VAL_MRP );
+    public static final EthType ETH_TYPE_MAC_SEC            = new EthType(ETH_TYPE_VAL_MAC_SEC); 
+    public static final EthType ETH_TYPE_PTP                = new EthType(ETH_TYPE_VAL_PTP );
+    public static final EthType ETH_TYPE_CFM                = new EthType(ETH_TYPE_VAL_CFM );
+    public static final EthType ETH_TYPE_FCoE               = new EthType(ETH_TYPE_VAL_FCoE );
+    public static final EthType ETH_TYPE_FCoE_INIT          = new EthType(ETH_TYPE_VAL_FCoE_INIT );
+    public static final EthType ETH_TYPE_RoCE               = new EthType(ETH_TYPE_VAL_RoCE );
+    public static final EthType ETH_TYPE_HSR                = new EthType(ETH_TYPE_VAL_HSR );
+    public static final EthType ETH_TYPE_CONF_TEST          = new EthType(ETH_TYPE_VAL_CONF_TEST );
+    public static final EthType ETH_TYPE_Q_IN_Q             = new EthType(ETH_TYPE_VAL_Q_IN_Q );
+    public static final EthType ETH_TYPE_LLT                = new EthType(ETH_TYPE_VAL_LLT );
+
+    public static final EthType NO_MASK = new EthType(0xFFFFFFFF);
+    public static final EthType FULL_MASK = new EthType(0x00000000);
+
+    private EthType(int type) {
+        this.rawValue = type;
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    public static EthType of(int type) {
+        switch (type) {
+            case ETH_TYPE_VAL_IPv4:
+                return ETH_TYPE_IPv4;
+            case ETH_TYPE_VAL_ARP:
+                return ETH_TYPE_ARP;
+            case ETH_TYPE_VAL_WAKE_ON_LAN:
+                return ETH_TYPE_WAKE_ON_LAN;
+            case ETH_TYPE_VAL_TRILL:
+                return ETH_TYPE_TRILL;
+            case ETH_TYPE_VAL_DECNET_IV:
+                return ETH_TYPE_DECNET_IV;
+            case ETH_TYPE_VAL_REV_ARP:
+                return ETH_TYPE_REV_ARP;
+            case ETH_TYPE_VAL_APPLE_TALK:
+                return ETH_TYPE_APPLE_TALK;
+            case ETH_TYPE_VAL_APPLE_TALK_ARP:
+                return ETH_TYPE_APPLE_TALK_ARP;
+            case ETH_TYPE_VAL_VLAN_FRAME:
+                return ETH_TYPE_VLAN_FRAME;
+            case ETH_TYPE_VAL_IPX_8137:
+                return ETH_TYPE_IPX_8137;
+            case ETH_TYPE_VAL_IPX_8138:
+                return ETH_TYPE_IPX_8138;
+            case ETH_TYPE_VAL_QNX:
+                return ETH_TYPE_QNX;
+            case ETH_TYPE_VAL_IPv6:
+                return ETH_TYPE_IPv6;
+            case ETH_TYPE_VAL_ETH_FLOW:
+                return ETH_TYPE_ETH_FLOW;
+            case ETH_TYPE_VAL_SLOW_PROTOCOLS:
+                return ETH_TYPE_SLOW_PROTOCOLS;
+            case ETH_TYPE_VAL_COBRANET:
+                return ETH_TYPE_COBRANET;
+            case ETH_TYPE_VAL_MPLS_UNICAST:
+                return ETH_TYPE_MPLS_UNICAST;
+            case ETH_TYPE_VAL_MPLS_MULTICAST:
+                return ETH_TYPE_MPLS_MULTICAST;
+            case ETH_TYPE_VAL_PPPoE_DISCOVERY:
+                return ETH_TYPE_PPPoE_DISCOVERY;
+            case ETH_TYPE_VAL_PPPoE_SESSION:
+                return ETH_TYPE_PPPoE_SESSION;
+            case ETH_TYPE_VAL_JUMBO_FRAMES:
+                return ETH_TYPE_JUMBO_FRAMES;
+            case ETH_TYPE_VAL_HOMEPLUG_10:
+                return ETH_TYPE_HOMEPLUG_10;
+            case ETH_TYPE_VAL_EAP_OVER_LAN:
+                return ETH_TYPE_EAP_OVER_LAN;
+            case ETH_TYPE_VAL_PROFINET:
+                return ETH_TYPE_PROFINET;
+            case ETH_TYPE_VAL_HYPERSCSI:
+                return ETH_TYPE_HYPERSCSI;
+            case ETH_TYPE_VAL_ATA_OVER_ETH:
+                return ETH_TYPE_ATA_OVER_ETH;
+            case ETH_TYPE_VAL_ETHERCAT:
+                return ETH_TYPE_ETHERCAT;
+            case ETH_TYPE_VAL_BRIDGING:
+                return ETH_TYPE_BRIDGING;
+            case ETH_TYPE_VAL_POWERLINK:
+                return ETH_TYPE_POWERLINK;
+            case ETH_TYPE_VAL_LLDP:
+                return ETH_TYPE_LLDP;
+            case ETH_TYPE_VAL_SERCOS:
+                return ETH_TYPE_SERCOS;
+            case ETH_TYPE_VAL_HOMEPLUG_AV:
+                return ETH_TYPE_HOMEPLUG_AV;
+            case ETH_TYPE_VAL_MRP:
+                return ETH_TYPE_MRP;
+            case ETH_TYPE_VAL_MAC_SEC:
+                return ETH_TYPE_MAC_SEC;
+            case ETH_TYPE_VAL_PTP:
+                return ETH_TYPE_PTP;
+            case ETH_TYPE_VAL_CFM:
+                return ETH_TYPE_CFM;
+            case ETH_TYPE_VAL_FCoE:
+                return ETH_TYPE_FCoE;
+            case ETH_TYPE_VAL_FCoE_INIT:
+                return ETH_TYPE_FCoE_INIT;
+            case ETH_TYPE_VAL_RoCE:
+                return ETH_TYPE_RoCE;
+            case ETH_TYPE_VAL_HSR:
+                return ETH_TYPE_HSR;
+            case ETH_TYPE_VAL_CONF_TEST:
+                return ETH_TYPE_CONF_TEST;
+            case ETH_TYPE_VAL_Q_IN_Q:
+                return ETH_TYPE_Q_IN_Q;
+            case ETH_TYPE_VAL_LLT:
+                return ETH_TYPE_LLT;
+            default:
+                // TODO: What's here?
+                return new EthType(type);
+        }
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (!(obj instanceof EthType))
+            return false;
+        EthType o = (EthType)obj;
+        if (o.rawValue != this.rawValue)
+            return false;
+        return true;
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 37;
+        int result = 1;
+        result = prime * result + rawValue;
+        return result;
+    }
+
+    @Override
+    public String toString() {
+        return Integer.toHexString(rawValue);
+    }
+    
+    public void write2Bytes(ChannelBuffer c) {
+        c.writeShort(this.rawValue);
+    }
+    
+    public static EthType read2Bytes(ChannelBuffer c) {
+        return EthType.of(c.readUnsignedShort());
+    }
+
+    @Override
+    public EthType applyMask(EthType mask) {
+        return EthType.of(this.rawValue & mask.rawValue);
+    }
+    
+    public int getValue() {
+        return rawValue;
+    }
+
+    
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Code.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Code.java
new file mode 100644
index 0000000..46ada58
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Code.java
@@ -0,0 +1,53 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+/**
+ * 
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ *
+ */
+public class ICMPv4Code implements OFValueType<ICMPv4Code> {
+
+    final static int LENGTH = 1;
+    final static short MAX_CODE = 0xFF;
+
+    private final short code;
+    
+    public static final ICMPv4Code NO_MASK = new ICMPv4Code((short)0xFFFF);
+    public static final ICMPv4Code FULL_MASK = new ICMPv4Code((short)0x0000);
+
+    private ICMPv4Code(short code) {
+        this.code = code;
+    }
+
+    public static ICMPv4Code of(short code) {
+        if (code > MAX_CODE || code < 0)
+            throw new IllegalArgumentException("Illegal ICMPv4 code: " + code);
+        return new ICMPv4Code(code);
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+    
+    public short getCode() {
+        return code;
+    }
+    
+    public void writeByte(ChannelBuffer c) {
+        c.writeByte(this.code);
+    }
+    
+    public static ICMPv4Code readByte(ChannelBuffer c) {
+        return ICMPv4Code.of(c.readUnsignedByte());
+    }
+
+    @Override
+    public ICMPv4Code applyMask(ICMPv4Code mask) {
+        return ICMPv4Code.of((short)(this.code & mask.code));
+    }
+
+    
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Type.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Type.java
new file mode 100644
index 0000000..00a789b
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/ICMPv4Type.java
@@ -0,0 +1,167 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+public class ICMPv4Type implements OFValueType<ICMPv4Type> {
+
+    final static int LENGTH = 1;
+
+    private static final short ICMPV4_TYPE_VAL_ECHO_REPLY    = 0;
+    private static final short ICMPV4_TYPE_VAL_DESTINATION_UNREACHABLE   = 3;
+    private static final short ICMPV4_TYPE_VAL_SOURCE_QUENCH = 4;
+    private static final short ICMPV4_TYPE_VAL_REDIRECT  = 5;
+    private static final short ICMPV4_TYPE_VAL_ALTERNATE_HOST_ADDRESS    = 6;
+    private static final short ICMPV4_TYPE_VAL_ECHO  = 8;
+    private static final short ICMPV4_TYPE_VAL_ROUTER_ADVERTISEMENT  = 9;
+    private static final short ICMPV4_TYPE_VAL_ROUTER_SOLICITATION   = 10;
+    private static final short ICMPV4_TYPE_VAL_TIME_EXCEEDED = 11;
+    private static final short ICMPV4_TYPE_VAL_PARAMETER_PROBLEM = 12;
+    private static final short ICMPV4_TYPE_VAL_TIMESTAMP = 13;
+    private static final short ICMPV4_TYPE_VAL_TIMESTAMP_REPLY   = 14;
+    private static final short ICMPV4_TYPE_VAL_INFORMATION_REQUEST   = 15;
+    private static final short ICMPV4_TYPE_VAL_INFORMATION_REPLY = 16;
+    private static final short ICMPV4_TYPE_VAL_ADDRESS_MASK_REQUEST  = 17;
+    private static final short ICMPV4_TYPE_VAL_ADDRESS_MASK_REPLY    = 18;
+    private static final short ICMPV4_TYPE_VAL_TRACEROUTE    = 30;
+    private static final short ICMPV4_TYPE_VAL_DATAGRAM_CONVERSION_ERROR = 31;
+    private static final short ICMPV4_TYPE_VAL_MOBILE_HOST_REDIRECT  = 32;
+    private static final short ICMPV4_TYPE_VAL_IPV6_WHERE_ARE_YOU    = 33;
+    private static final short ICMPV4_TYPE_VAL_IPV6_I_AM_HERE    = 34;
+    private static final short ICMPV4_TYPE_VAL_MOBILE_REGISTRATION_REQUEST   = 35;
+    private static final short ICMPV4_TYPE_VAL_MOBILE_REGISTRATION_REPLY = 36;
+    private static final short ICMPV4_TYPE_VAL_DOMAIN_NAME_REQUEST   = 37;
+    private static final short ICMPV4_TYPE_VAL_DOMAIN_NAME_REPLY = 38;
+    private static final short ICMPV4_TYPE_VAL_SKIP  = 39;
+    private static final short ICMPV4_TYPE_VAL_PHOTURIS  = 40;
+    private static final short ICMPV4_TYPE_VAL_EXPERIMENTAL_MOBILITY = 41;
+
+    public static final ICMPv4Type ICMPV4_TYPE_ECHO_REPLY   = new ICMPv4Type(ICMPV4_TYPE_VAL_ECHO_REPLY);
+    public static final ICMPv4Type ICMPV4_TYPE_DESTINATION_UNREACHABLE  = new ICMPv4Type(ICMPV4_TYPE_VAL_DESTINATION_UNREACHABLE);
+    public static final ICMPv4Type ICMPV4_TYPE_SOURCE_QUENCH    = new ICMPv4Type(ICMPV4_TYPE_VAL_SOURCE_QUENCH);
+    public static final ICMPv4Type ICMPV4_TYPE_REDIRECT = new ICMPv4Type(ICMPV4_TYPE_VAL_REDIRECT);
+    public static final ICMPv4Type ICMPV4_TYPE_ALTERNATE_HOST_ADDRESS   = new ICMPv4Type(ICMPV4_TYPE_VAL_ALTERNATE_HOST_ADDRESS);
+    public static final ICMPv4Type ICMPV4_TYPE_ECHO = new ICMPv4Type(ICMPV4_TYPE_VAL_ECHO);
+    public static final ICMPv4Type ICMPV4_TYPE_ROUTER_ADVERTISEMENT = new ICMPv4Type(ICMPV4_TYPE_VAL_ROUTER_ADVERTISEMENT);
+    public static final ICMPv4Type ICMPV4_TYPE_ROUTER_SOLICITATION  = new ICMPv4Type(ICMPV4_TYPE_VAL_ROUTER_SOLICITATION);
+    public static final ICMPv4Type ICMPV4_TYPE_TIME_EXCEEDED    = new ICMPv4Type(ICMPV4_TYPE_VAL_TIME_EXCEEDED);
+    public static final ICMPv4Type ICMPV4_TYPE_PARAMETER_PROBLEM    = new ICMPv4Type(ICMPV4_TYPE_VAL_PARAMETER_PROBLEM);
+    public static final ICMPv4Type ICMPV4_TYPE_TIMESTAMP    = new ICMPv4Type(ICMPV4_TYPE_VAL_TIMESTAMP);
+    public static final ICMPv4Type ICMPV4_TYPE_TIMESTAMP_REPLY  = new ICMPv4Type(ICMPV4_TYPE_VAL_TIMESTAMP_REPLY);
+    public static final ICMPv4Type ICMPV4_TYPE_INFORMATION_REQUEST  = new ICMPv4Type(ICMPV4_TYPE_VAL_INFORMATION_REQUEST);
+    public static final ICMPv4Type ICMPV4_TYPE_INFORMATION_REPLY    = new ICMPv4Type(ICMPV4_TYPE_VAL_INFORMATION_REPLY);
+    public static final ICMPv4Type ICMPV4_TYPE_ADDRESS_MASK_REQUEST = new ICMPv4Type(ICMPV4_TYPE_VAL_ADDRESS_MASK_REQUEST);
+    public static final ICMPv4Type ICMPV4_TYPE_ADDRESS_MASK_REPLY   = new ICMPv4Type(ICMPV4_TYPE_VAL_ADDRESS_MASK_REPLY);
+    public static final ICMPv4Type ICMPV4_TYPE_TRACEROUTE   = new ICMPv4Type(ICMPV4_TYPE_VAL_TRACEROUTE);
+    public static final ICMPv4Type ICMPV4_TYPE_DATAGRAM_CONVERSION_ERROR    = new ICMPv4Type(ICMPV4_TYPE_VAL_DATAGRAM_CONVERSION_ERROR);
+    public static final ICMPv4Type ICMPV4_TYPE_MOBILE_HOST_REDIRECT = new ICMPv4Type(ICMPV4_TYPE_VAL_MOBILE_HOST_REDIRECT);
+    public static final ICMPv4Type ICMPV4_TYPE_IPV6_WHERE_ARE_YOU  = new ICMPv4Type(ICMPV4_TYPE_VAL_IPV6_WHERE_ARE_YOU);
+    public static final ICMPv4Type ICMPV4_TYPE_IPV6_I_AM_HERE = new ICMPv4Type(ICMPV4_TYPE_VAL_IPV6_I_AM_HERE);
+    public static final ICMPv4Type ICMPV4_TYPE_MOBILE_REGISTRATION_REQUEST  = new ICMPv4Type(ICMPV4_TYPE_VAL_MOBILE_REGISTRATION_REQUEST);
+    public static final ICMPv4Type ICMPV4_TYPE_MOBILE_REGISTRATION_REPLY    = new ICMPv4Type(ICMPV4_TYPE_VAL_MOBILE_REGISTRATION_REPLY);
+    public static final ICMPv4Type ICMPV4_TYPE_DOMAIN_NAME_REQUEST  = new ICMPv4Type(ICMPV4_TYPE_VAL_DOMAIN_NAME_REQUEST);
+    public static final ICMPv4Type ICMPV4_TYPE_DOMAIN_NAME_REPLY    = new ICMPv4Type(ICMPV4_TYPE_VAL_DOMAIN_NAME_REPLY);
+    public static final ICMPv4Type ICMPV4_TYPE_SKIP = new ICMPv4Type(ICMPV4_TYPE_VAL_SKIP);
+    public static final ICMPv4Type ICMPV4_TYPE_PHOTURIS = new ICMPv4Type(ICMPV4_TYPE_VAL_PHOTURIS);
+    public static final ICMPv4Type ICMPV4_TYPE_EXPERIMENTAL_MOBILITY    = new ICMPv4Type(ICMPV4_TYPE_VAL_EXPERIMENTAL_MOBILITY);
+
+    public static final ICMPv4Type NO_MASK = new ICMPv4Type((short)0xFFFF);
+    public static final ICMPv4Type FULL_MASK = new ICMPv4Type((short)0x0000);
+
+    private final short type;
+    
+    private static final int MIN_TYPE = 0;
+    private static final int MAX_TYPE = 0xFF;    
+
+    private ICMPv4Type(short type) {
+        this.type = type;
+    }
+
+    public static ICMPv4Type of(short type) {
+        if (type < MIN_TYPE || type > MAX_TYPE)
+            throw new IllegalArgumentException("Invalid ICMPv4 type: " + type);
+        switch (type) {
+            case ICMPV4_TYPE_VAL_ECHO_REPLY:
+                return ICMPV4_TYPE_ECHO_REPLY;
+            case ICMPV4_TYPE_VAL_DESTINATION_UNREACHABLE:
+                return ICMPV4_TYPE_DESTINATION_UNREACHABLE;
+            case ICMPV4_TYPE_VAL_SOURCE_QUENCH:
+                return ICMPV4_TYPE_SOURCE_QUENCH;
+            case ICMPV4_TYPE_VAL_REDIRECT:
+                return ICMPV4_TYPE_REDIRECT;
+            case ICMPV4_TYPE_VAL_ALTERNATE_HOST_ADDRESS:
+                return ICMPV4_TYPE_ALTERNATE_HOST_ADDRESS;
+            case ICMPV4_TYPE_VAL_ECHO:
+                return ICMPV4_TYPE_ECHO;
+            case ICMPV4_TYPE_VAL_ROUTER_ADVERTISEMENT:
+                return ICMPV4_TYPE_ROUTER_ADVERTISEMENT;
+            case ICMPV4_TYPE_VAL_ROUTER_SOLICITATION:
+                return ICMPV4_TYPE_ROUTER_SOLICITATION;
+            case ICMPV4_TYPE_VAL_TIME_EXCEEDED:
+                return ICMPV4_TYPE_TIME_EXCEEDED;
+            case ICMPV4_TYPE_VAL_PARAMETER_PROBLEM:
+                return ICMPV4_TYPE_PARAMETER_PROBLEM;
+            case ICMPV4_TYPE_VAL_TIMESTAMP:
+                return ICMPV4_TYPE_TIMESTAMP;
+            case ICMPV4_TYPE_VAL_TIMESTAMP_REPLY:
+                return ICMPV4_TYPE_TIMESTAMP_REPLY;
+            case ICMPV4_TYPE_VAL_INFORMATION_REQUEST:
+                return ICMPV4_TYPE_INFORMATION_REQUEST;
+            case ICMPV4_TYPE_VAL_INFORMATION_REPLY:
+                return ICMPV4_TYPE_INFORMATION_REPLY;
+            case ICMPV4_TYPE_VAL_ADDRESS_MASK_REQUEST:
+                return ICMPV4_TYPE_ADDRESS_MASK_REQUEST;
+            case ICMPV4_TYPE_VAL_ADDRESS_MASK_REPLY:
+                return ICMPV4_TYPE_ADDRESS_MASK_REPLY;
+            case ICMPV4_TYPE_VAL_TRACEROUTE:
+                return ICMPV4_TYPE_TRACEROUTE;
+            case ICMPV4_TYPE_VAL_DATAGRAM_CONVERSION_ERROR:
+                return ICMPV4_TYPE_DATAGRAM_CONVERSION_ERROR;
+            case ICMPV4_TYPE_VAL_MOBILE_HOST_REDIRECT:
+                return ICMPV4_TYPE_MOBILE_HOST_REDIRECT;
+            case ICMPV4_TYPE_VAL_IPV6_WHERE_ARE_YOU:
+                return ICMPV4_TYPE_IPV6_WHERE_ARE_YOU;
+            case ICMPV4_TYPE_VAL_IPV6_I_AM_HERE:
+                return ICMPV4_TYPE_IPV6_I_AM_HERE;
+            case ICMPV4_TYPE_VAL_MOBILE_REGISTRATION_REQUEST:
+                return ICMPV4_TYPE_MOBILE_REGISTRATION_REQUEST;
+            case ICMPV4_TYPE_VAL_MOBILE_REGISTRATION_REPLY:
+                return ICMPV4_TYPE_MOBILE_REGISTRATION_REPLY;
+            case ICMPV4_TYPE_VAL_DOMAIN_NAME_REQUEST:
+                return ICMPV4_TYPE_DOMAIN_NAME_REQUEST;
+            case ICMPV4_TYPE_VAL_DOMAIN_NAME_REPLY:
+                return ICMPV4_TYPE_DOMAIN_NAME_REPLY;
+            case ICMPV4_TYPE_VAL_SKIP:
+                return ICMPV4_TYPE_SKIP;
+            case ICMPV4_TYPE_VAL_PHOTURIS:
+                return ICMPV4_TYPE_PHOTURIS;
+            case ICMPV4_TYPE_VAL_EXPERIMENTAL_MOBILITY:
+                return ICMPV4_TYPE_EXPERIMENTAL_MOBILITY;
+            default:
+                return new ICMPv4Type(type);
+        }
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+    
+    public short getType() {
+        return type;
+    }
+    
+    public void writeByte(ChannelBuffer c) {
+        c.writeByte(this.type);
+    }
+    
+    public static ICMPv4Type readByte(ChannelBuffer c) {
+        return ICMPv4Type.of(c.readUnsignedByte());
+    }
+
+    @Override
+    public ICMPv4Type applyMask(ICMPv4Type mask) {
+        return ICMPv4Type.of((short)(this.type & mask.type));
+    }
+
+    
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv4.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv4.java
new file mode 100644
index 0000000..401d79b
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv4.java
@@ -0,0 +1,135 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+
+
+/**
+ * Wrapper around an IPv4 address
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+public class IPv4 implements OFValueType<IPv4> {
+    static final int LENGTH = 4;
+    private final int rawValue;
+    
+    public static final IPv4 NO_MASK = IPv4.of(0xFFFFFFFF);
+    public static final IPv4 FULL_MASK = IPv4.of(0x00000000);
+
+    private IPv4(final int rawValue) {
+        this.rawValue = rawValue;
+    }
+
+    public static IPv4 of(final byte[] address) {
+        if (address.length != LENGTH) {
+            throw new IllegalArgumentException(
+                    "Invalid byte array length for IPv4 address: " + address);
+        }
+
+        int raw =
+                (address[0] & 0xFF) << 24 | (address[1] & 0xFF) << 16
+                        | (address[2] & 0xFF) << 8 | (address[3] & 0xFF) << 0;
+        return IPv4.of(raw);
+    }
+
+    public static IPv4 of(final int raw) {
+        return new IPv4(raw);
+    }
+
+    public static IPv4 of(final String string) {
+        int start = 0;
+        int shift = 24;
+
+        int raw = 0;
+        while (shift >= 0) {
+            int end = string.indexOf('.', start);
+            if (end == start || !((shift > 0) ^ (end < 0)))
+                throw new IllegalArgumentException("IP Address not well formed: " + string);
+
+            String substr =
+                    end > 0 ? string.substring(start, end) : string.substring(start);
+            int val = Integer.parseInt(substr);
+            if (val < 0 || val > 255)
+                throw new IllegalArgumentException("IP Address not well formed: " + string);
+
+            raw |= val << shift;
+
+            shift -= 8;
+            start = end + 1;
+        }
+        return IPv4.of(raw);
+    }
+
+    public int getInt() {
+        return rawValue;
+    }
+
+    volatile byte[] bytesCache = null;
+
+    public byte[] getBytes() {
+        if (bytesCache == null) {
+            synchronized (this) {
+                if (bytesCache == null) {
+                    bytesCache =
+                            new byte[] { (byte) ((rawValue >>> 24) & 0xFF),
+                                    (byte) ((rawValue >>> 16) & 0xFF),
+                                    (byte) ((rawValue >>> 8) & 0xFF),
+                                    (byte) ((rawValue >>> 0) & 0xFF) };
+                }
+            }
+        }
+        return bytesCache;
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    @Override
+    public String toString() {
+        StringBuilder res = new StringBuilder();
+        res.append((rawValue >> 24) & 0xFF).append('.');
+        res.append((rawValue >> 16) & 0xFF).append('.');
+        res.append((rawValue >> 8) & 0xFF).append('.');
+        res.append((rawValue >> 0) & 0xFF);
+        return res.toString();
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 31;
+        int result = 1;
+        result = prime * result + rawValue;
+        return result;
+    }
+
+    @Override
+    public boolean equals(final Object obj) {
+        if (this == obj)
+            return true;
+        if (obj == null)
+            return false;
+        if (getClass() != obj.getClass())
+            return false;
+        IPv4 other = (IPv4) obj;
+        if (rawValue != other.rawValue)
+            return false;
+        return true;
+    }
+    
+    public void write4Bytes(ChannelBuffer c) {
+        c.writeInt(rawValue);
+    }
+    
+    public static IPv4 read4Bytes(ChannelBuffer c) {
+        return IPv4.of(c.readInt());
+    }
+
+    @Override
+    public IPv4 applyMask(IPv4 mask) {
+        return IPv4.of(this.rawValue & mask.rawValue);
+    }
+
+    
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv4WithMask.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv4WithMask.java
new file mode 100644
index 0000000..d2f2cc7
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv4WithMask.java
@@ -0,0 +1,83 @@
+package org.projectfloodlight.openflow.types;
+
+public class IPv4WithMask extends Masked<IPv4> {
+
+    private IPv4WithMask(int rawValue, int rawMask) {
+        super(IPv4.of(rawValue), IPv4.of(rawMask));
+    }
+    
+    private IPv4WithMask(IPv4 value, IPv4 mask) {
+        super(value, mask);
+    }
+    
+    public static IPv4WithMask of(int rawValue, int rawMask) {
+        return new IPv4WithMask(rawValue, rawMask);
+    }
+    
+    public static IPv4WithMask of(IPv4 value, IPv4 mask) {
+        return new IPv4WithMask(value, mask);
+    }
+    
+    @Override
+    public String toString() {
+        StringBuilder res = new StringBuilder();
+        res.append(((IPv4)value).toString());
+        
+        int maskint = ((IPv4)mask).getInt();
+        res.append('/');
+        if (Integer.bitCount((~maskint) + 1) == 1) {
+            // CIDR notation
+            res.append(Integer.bitCount(maskint));
+        } else {
+            // Full address mask
+            res.append(((IPv4)mask).toString());
+        }
+        
+        return res.toString();
+    }
+    
+    public static IPv4WithMask of(final String string) {
+        int slashPos;
+        String ip = string;
+        int maskBits = 0;
+        IPv4 maskAddress = null;
+
+        // Read mask suffix
+        if ((slashPos = string.indexOf('/')) != -1) {
+            ip = string.substring(0, slashPos);
+            try {
+                String suffix = string.substring(slashPos + 1);
+                if (suffix.length() == 0)
+                    throw new IllegalArgumentException("IP Address not well formed: " + string);
+                if (suffix.indexOf('.') != -1) {
+                    // Full mask
+                    maskAddress = IPv4.of(suffix);
+                } else {
+                    // CIDR Suffix
+                    maskBits = Integer.parseInt(suffix);
+                }
+            } catch (NumberFormatException e) {
+                throw new IllegalArgumentException("IP Address not well formed: " + string);
+            }
+            if (maskBits < 0 || maskBits > 32) {
+                throw new IllegalArgumentException("IP Address not well formed: " + string);
+            }
+        }
+        
+        // Read IP
+        IPv4 ipv4 = IPv4.of(ip);
+        
+        if (maskAddress != null) {
+            // Full address mask
+            return IPv4WithMask.of(ipv4, maskAddress);
+        } else if (maskBits == 0) {
+            // No mask
+            return IPv4WithMask.of(ipv4, IPv4.NO_MASK);
+        } else {
+            // With mask
+            int mask = (-1) << (32 - maskBits);
+            return IPv4WithMask.of(ipv4, IPv4.of(mask));
+        }
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv6.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv6.java
new file mode 100644
index 0000000..0907d17
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv6.java
@@ -0,0 +1,289 @@
+package org.projectfloodlight.openflow.types;
+
+import java.util.regex.Pattern;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+/**
+ * IPv6 address object. Instance controlled, immutable. Internal representation:
+ * two 64 bit longs (not that you'd have to know).
+ *
+ * @author Andreas Wundsam <andreas.wundsam@teleteach.de>
+ */
+public class IPv6 implements OFValueType<IPv6> {
+    static final int LENGTH = 16;
+    private final long raw1;
+    private final long raw2;
+
+    public static final IPv6 NO_MASK = IPv6.of(0xFFFFFFFFFFFFFFFFl, 0xFFFFFFFFFFFFFFFFl);
+    public static final IPv6 FULL_MASK = IPv6.of(0x0, 0x0);
+
+    private IPv6(final long raw1, final long raw2) {
+        this.raw1 = raw1;
+        this.raw2 = raw2;
+    }
+
+    public static IPv6 of(final byte[] address) {
+        if (address.length != LENGTH) {
+            throw new IllegalArgumentException(
+                    "Invalid byte array length for IPv6 address: " + address);
+        }
+
+        long raw1 =
+                (address[0] & 0xFFL) << 56 | (address[1] & 0xFFL) << 48
+                        | (address[2] & 0xFFL) << 40 | (address[3] & 0xFFL) << 32
+                        | (address[4] & 0xFFL) << 24 | (address[5] & 0xFFL) << 16
+                        | (address[6] & 0xFFL) << 8 | (address[7]);
+
+        long raw2 =
+                (address[8] & 0xFFL) << 56 | (address[9] & 0xFFL) << 48
+                        | (address[10] & 0xFFL) << 40 | (address[11] & 0xFFL) << 32
+                        | (address[12] & 0xFFL) << 24 | (address[13] & 0xFFL) << 16
+                        | (address[14] & 0xFFL) << 8 | (address[15]);
+
+        return IPv6.of(raw1, raw2);
+    }
+
+    private static class IPv6Builder {
+        private long raw1, raw2;
+
+        public void setUnsignedShortWord(final int i, final int value) {
+            int shift = 48 - (i % 4) * 16;
+
+            if (value < 0 || value > 0xFFFF)
+                throw new IllegalArgumentException("16 bit word must be in [0, 0xFFFF]");
+
+            if (i >= 0 && i < 4)
+                raw1 = raw1 & ~(0xFFFFL << shift) | (value & 0xFFFFL) << shift;
+            else if (i >= 4 && i < 8)
+                raw2 = raw2 & ~(0xFFFFL << shift) | (value & 0xFFFFL) << shift;
+            else
+                throw new IllegalArgumentException("16 bit word index must be in [0,7]");
+        }
+
+        public IPv6 getIPv6() {
+            return IPv6.of(raw1, raw2);
+        }
+    }
+
+    private final static Pattern colonPattern = Pattern.compile(":");
+
+    public static IPv6 of(final String string) {
+        IPv6Builder builder = new IPv6Builder();
+        String[] parts = colonPattern.split(string, -1);
+
+        int leftWord = 0;
+        int leftIndex = 0;
+
+        boolean hitZeroCompression = false;
+
+        for (leftIndex = 0; leftIndex < parts.length; leftIndex++) {
+            String part = parts[leftIndex];
+            if (part.length() == 0) {
+                // hit empty group of zero compression
+                hitZeroCompression = true;
+                break;
+            }
+            builder.setUnsignedShortWord(leftWord++, Integer.parseInt(part, 16));
+        }
+
+        if (hitZeroCompression) {
+            if (leftIndex == 0) {
+                // if colon is at the start, two columns must be at the start,
+                // move to the second empty group
+                leftIndex = 1;
+                if (parts.length < 2 || parts[1].length() > 0)
+                    throw new IllegalArgumentException("Malformed IPv6 address: " + string);
+            }
+
+            int rightWord = 7;
+            int rightIndex;
+            for (rightIndex = parts.length - 1; rightIndex > leftIndex; rightIndex--) {
+                String part = parts[rightIndex];
+                if (part.length() == 0)
+                    break;
+                builder.setUnsignedShortWord(rightWord--, Integer.parseInt(part, 16));
+            }
+            if (rightIndex == parts.length - 1) {
+                // if colon is at the end, two columns must be at the end, move
+                // to the second empty group
+                if (rightIndex < 1 || parts[rightIndex - 1].length() > 0)
+                    throw new IllegalArgumentException("Malformed IPv6 address: " + string);
+                rightIndex--;
+            }
+            if (leftIndex != rightIndex)
+                throw new IllegalArgumentException("Malformed IPv6 address: " + string);
+        } else {
+            if (leftIndex != 8) {
+                throw new IllegalArgumentException("Malformed IPv6 address: " + string);
+            }
+        }
+        return builder.getIPv6();
+    }
+
+    public static IPv6 of(final long raw1, final long raw2) {
+        return new IPv6(raw1, raw2);
+    }
+
+    volatile byte[] bytesCache = null;
+
+    public byte[] getBytes() {
+        if (bytesCache == null) {
+            synchronized (this) {
+                if (bytesCache == null) {
+                    bytesCache =
+                            new byte[] { (byte) ((raw1 >> 56) & 0xFF),
+                                    (byte) ((raw1 >> 48) & 0xFF),
+                                    (byte) ((raw1 >> 40) & 0xFF),
+                                    (byte) ((raw1 >> 32) & 0xFF),
+                                    (byte) ((raw1 >> 24) & 0xFF),
+                                    (byte) ((raw1 >> 16) & 0xFF),
+                                    (byte) ((raw1 >> 8) & 0xFF),
+                                    (byte) ((raw1 >> 0) & 0xFF),
+
+                                    (byte) ((raw2 >> 56) & 0xFF),
+                                    (byte) ((raw2 >> 48) & 0xFF),
+                                    (byte) ((raw2 >> 40) & 0xFF),
+                                    (byte) ((raw2 >> 32) & 0xFF),
+                                    (byte) ((raw2 >> 24) & 0xFF),
+                                    (byte) ((raw2 >> 16) & 0xFF),
+                                    (byte) ((raw2 >> 8) & 0xFF),
+                                    (byte) ((raw2 >> 0) & 0xFF) };
+                }
+            }
+        }
+        return bytesCache;
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    @Override
+    public String toString() {
+        return toString(true, false);
+    }
+
+    public int getUnsignedShortWord(final int i) {
+        if (i >= 0 && i < 4)
+            return (int) ((raw1 >>> (48 - i * 16)) & 0xFFFF);
+        else if (i >= 4 && i < 8)
+            return (int) ((raw2 >>> (48 - (i - 4) * 16)) & 0xFFFF);
+        else
+            throw new IllegalArgumentException("16 bit word index must be in [0,7]");
+    }
+
+    /** get the index of the first word where to apply IPv6 zero compression */
+    public int getZeroCompressStart() {
+        int start = Integer.MAX_VALUE;
+        int maxLength = -1;
+
+        int candidateStart = -1;
+
+        for (int i = 0; i < 8; i++) {
+            if (candidateStart >= 0) {
+                // in a zero octect
+                if (getUnsignedShortWord(i) != 0) {
+                    // end of this candidate word
+                    int candidateLength = i - candidateStart;
+                    if (candidateLength >= maxLength) {
+                        start = candidateStart;
+                        maxLength = candidateLength;
+                    }
+                    candidateStart = -1;
+                }
+            } else {
+                // not in a zero octect
+                if (getUnsignedShortWord(i) == 0) {
+                    candidateStart = i;
+                }
+            }
+        }
+
+        if (candidateStart >= 0) {
+            int candidateLength = 8 - candidateStart;
+            if (candidateLength >= maxLength) {
+                start = candidateStart;
+                maxLength = candidateLength;
+            }
+        }
+
+        return start;
+    }
+
+    public String toString(final boolean zeroCompression, final boolean leadingZeros) {
+        StringBuilder res = new StringBuilder();
+
+        int compressionStart = zeroCompression ? getZeroCompressStart() : Integer.MAX_VALUE;
+        boolean inCompression = false;
+        boolean colonNeeded = false;
+
+        for (int i = 0; i < 8; i++) {
+            int word = getUnsignedShortWord(i);
+
+            if (word == 0) {
+                if (inCompression)
+                    continue;
+                else if (i == compressionStart) {
+                    res.append(':').append(':');
+                    inCompression = true;
+                    colonNeeded = false;
+                    continue;
+                }
+            } else {
+                inCompression = false;
+            }
+
+            if (colonNeeded) {
+                res.append(':');
+                colonNeeded = false;
+            }
+
+            res.append(leadingZeros ? String.format("%04x", word) : Integer.toString(word,
+                    16));
+            colonNeeded = true;
+        }
+        return res.toString();
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 31;
+        int result = 1;
+        result = prime * result + (int) (raw1 ^ (raw1 >>> 32));
+        result = prime * result + (int) (raw2 ^ (raw2 >>> 32));
+        return result;
+    }
+
+    @Override
+    public boolean equals(final Object obj) {
+        if (this == obj)
+            return true;
+        if (obj == null)
+            return false;
+        if (getClass() != obj.getClass())
+            return false;
+        IPv6 other = (IPv6) obj;
+        if (raw1 != other.raw1)
+            return false;
+        if (raw2 != other.raw2)
+            return false;
+        return true;
+    }
+
+    public void write16Bytes(ChannelBuffer c) {
+        c.writeLong(this.raw1);
+        c.writeLong(this.raw2);
+    }
+
+    public static IPv6 read16Bytes(ChannelBuffer c) throws OFParseError {
+        return IPv6.of(c.readLong(), c.readLong());
+    }
+
+    @Override
+    public IPv6 applyMask(IPv6 mask) {
+        return IPv6.of(this.raw1 & mask.raw1, this.raw2 & mask.raw2);
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv6FlowLabel.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv6FlowLabel.java
new file mode 100644
index 0000000..7feb0d9
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv6FlowLabel.java
@@ -0,0 +1,67 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public class IPv6FlowLabel implements OFValueType<IPv6FlowLabel> {
+
+    static final int LENGTH = 4;
+
+    private final int label;
+
+    public static final IPv6FlowLabel NO_MASK = IPv6FlowLabel.of(0xFFFFFFFF);
+    public static final IPv6FlowLabel FULL_MASK = IPv6FlowLabel.of(0x0);
+
+    private IPv6FlowLabel(int label) {
+        this.label = label;
+    }
+
+    public static IPv6FlowLabel of(int label) {
+        return new IPv6FlowLabel(label);
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (!(obj instanceof IPv6FlowLabel))
+            return false;
+        IPv6FlowLabel other = (IPv6FlowLabel)obj;
+        if (other.label != this.label)
+            return false;
+        return true;
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 59;
+        int result = 1;
+        result = prime * result + label;
+        return result;
+    }
+
+    @Override
+    public String toString() {
+        return Integer.toHexString(label);
+    }
+
+    public void write4Bytes(ChannelBuffer c) {
+        c.writeInt(this.label);
+    }
+
+    public static IPv6FlowLabel read4Bytes(ChannelBuffer c) throws OFParseError {
+        return IPv6FlowLabel.of((int)(c.readUnsignedInt() & 0xFFFFFFFF));
+    }
+
+    @Override
+    public IPv6FlowLabel applyMask(IPv6FlowLabel mask) {
+        return IPv6FlowLabel.of(this.label & mask.label);
+    }
+
+    public int getIPv6FlowLabelValue() {
+        return label;
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv6WithMask.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv6WithMask.java
new file mode 100644
index 0000000..894a6dd
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IPv6WithMask.java
@@ -0,0 +1,91 @@
+package org.projectfloodlight.openflow.types;
+
+import java.math.BigInteger;
+import java.util.Arrays;
+
+public class IPv6WithMask extends Masked<IPv6> {
+
+    private IPv6WithMask(IPv6 value, IPv6 mask) {
+        super(value, mask);
+    }
+    
+    public static IPv6WithMask of(IPv6 value, IPv6 mask) {
+        return new IPv6WithMask(value, mask);
+    }
+    
+    @Override
+    public String toString() {
+        StringBuilder res = new StringBuilder();
+        res.append(((IPv6)value).toString());
+        res.append('/');
+        
+        BigInteger maskint = new BigInteger(((IPv6)mask).getBytes());
+        if (maskint.not().add(BigInteger.ONE).bitCount() == 1) {
+            // CIDR notation
+            res.append(maskint.bitCount());
+        } else {
+            // Full address mask
+            res.append(((IPv6)mask).toString());
+        }
+        
+        return res.toString();
+    }
+    
+    public static IPv6WithMask of(final String string) {
+        int slashPos;
+        String ip = string;
+        int maskBits = 0;
+        IPv6 maskAddress = null;
+
+        // Read mask suffix
+        if ((slashPos = string.indexOf('/')) != -1) {
+            ip = string.substring(0, slashPos);
+            try {
+                String suffix = string.substring(slashPos + 1);
+                if (suffix.length() == 0)
+                    throw new IllegalArgumentException("IPv6 Address not well formed: " + string);
+                if (suffix.indexOf(':') != -1) {
+                    // Full mask
+                    maskAddress = IPv6.of(suffix);
+                } else {
+                    // CIDR Suffix
+                    maskBits = Integer.parseInt(suffix);
+                }
+            } catch (NumberFormatException e) {
+                throw new IllegalArgumentException("IPv6 Address not well formed: " + string);
+            }
+            if (maskBits < 0 || maskBits > 128) {
+                throw new IllegalArgumentException("IPv6 Address not well formed: " + string);
+            }
+        }
+        
+        // Read IP
+        IPv6 ipv6 = IPv6.of(ip);
+        
+        if (maskAddress != null) {
+            // Full address mask
+            return IPv6WithMask.of(ipv6, maskAddress);
+        } else if (maskBits == 0) {
+            // No mask
+            return IPv6WithMask.of(ipv6, IPv6.NO_MASK);
+        } else {
+            // With mask
+            BigInteger mask = BigInteger.ONE.negate().shiftLeft(128 - maskBits);
+            byte[] maskBytesTemp = mask.toByteArray();
+            byte[] maskBytes;
+            if (maskBytesTemp.length < 16) {
+                maskBytes = new byte[16];
+                System.arraycopy(maskBytesTemp, 0, maskBytes, 16 - maskBytesTemp.length, maskBytesTemp.length);
+                Arrays.fill(maskBytes, 0, 16 - maskBytesTemp.length, (byte)(0xFF));
+            } else if (maskBytesTemp.length > 16) {
+                maskBytes = new byte[16];
+                System.arraycopy(maskBytesTemp, 0, maskBytes, 0, maskBytes.length);
+            } else {
+                maskBytes = maskBytesTemp;
+            }
+            return IPv6WithMask.of(ipv6, IPv6.of(maskBytes));
+        }
+    }
+
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IpDscp.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IpDscp.java
new file mode 100644
index 0000000..f311d9d
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IpDscp.java
@@ -0,0 +1,245 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public enum IpDscp implements OFValueType<IpDscp> {
+    DSCP_0((byte)0),
+    DSCP_1((byte)1),
+    DSCP_2((byte)2),
+    DSCP_3((byte)3),
+    DSCP_4((byte)4),
+    DSCP_5((byte)5),
+    DSCP_6((byte)6),
+    DSCP_7((byte)7),
+    DSCP_8((byte)8),
+    DSCP_9((byte)9),
+    DSCP_10((byte)10),
+    DSCP_11((byte)11),
+    DSCP_12((byte)12),
+    DSCP_13((byte)13),
+    DSCP_14((byte)14),
+    DSCP_15((byte)15),
+    DSCP_16((byte)16),
+    DSCP_17((byte)17),
+    DSCP_18((byte)18),
+    DSCP_19((byte)19),
+    DSCP_20((byte)20),
+    DSCP_21((byte)21),
+    DSCP_22((byte)22),
+    DSCP_23((byte)23),
+    DSCP_24((byte)24),
+    DSCP_25((byte)25),
+    DSCP_26((byte)26),
+    DSCP_27((byte)27),
+    DSCP_28((byte)28),
+    DSCP_29((byte)29),
+    DSCP_30((byte)30),
+    DSCP_31((byte)31),
+    DSCP_32((byte)32),
+    DSCP_33((byte)33),
+    DSCP_34((byte)34),
+    DSCP_35((byte)35),
+    DSCP_36((byte)36),
+    DSCP_37((byte)37),
+    DSCP_38((byte)38),
+    DSCP_39((byte)39),
+    DSCP_40((byte)40),
+    DSCP_41((byte)41),
+    DSCP_42((byte)42),
+    DSCP_43((byte)43),
+    DSCP_44((byte)44),
+    DSCP_45((byte)45),
+    DSCP_46((byte)46),
+    DSCP_47((byte)47),
+    DSCP_48((byte)48),
+    DSCP_49((byte)49),
+    DSCP_50((byte)50),
+    DSCP_51((byte)51),
+    DSCP_52((byte)52),
+    DSCP_53((byte)53),
+    DSCP_54((byte)54),
+    DSCP_55((byte)55),
+    DSCP_56((byte)56),
+    DSCP_57((byte)57),
+    DSCP_58((byte)58),
+    DSCP_59((byte)59),
+    DSCP_60((byte)60),
+    DSCP_61((byte)61),
+    DSCP_62((byte)62),
+    DSCP_63((byte)63),
+    DSCP_NO_MASK((byte)0xFF);
+
+    static final int LENGTH = 1;
+
+    public static final IpDscp NO_MASK = DSCP_NO_MASK;
+    public static final IpDscp FULL_MASK = DSCP_0;
+
+    private final byte dscp;
+
+    private IpDscp(byte dscp) {
+        this.dscp = dscp;
+    }
+
+    public static IpDscp of(byte dscp) {
+        switch (dscp) {
+            case 0:
+                return DSCP_0;
+            case 1:
+                return DSCP_1;
+            case 2:
+                return DSCP_2;
+            case 3:
+                return DSCP_3;
+            case 4:
+                return DSCP_4;
+            case 5:
+                return DSCP_5;
+            case 6:
+                return DSCP_6;
+            case 7:
+                return DSCP_7;
+            case 8:
+                return DSCP_8;
+            case 9:
+                return DSCP_9;
+            case 10:
+                return DSCP_10;
+            case 11:
+                return DSCP_11;
+            case 12:
+                return DSCP_12;
+            case 13:
+                return DSCP_13;
+            case 14:
+                return DSCP_14;
+            case 15:
+                return DSCP_15;
+            case 16:
+                return DSCP_16;
+            case 17:
+                return DSCP_17;
+            case 18:
+                return DSCP_18;
+            case 19:
+                return DSCP_19;
+            case 20:
+                return DSCP_20;
+            case 21:
+                return DSCP_21;
+            case 22:
+                return DSCP_22;
+            case 23:
+                return DSCP_23;
+            case 24:
+                return DSCP_24;
+            case 25:
+                return DSCP_25;
+            case 26:
+                return DSCP_26;
+            case 27:
+                return DSCP_27;
+            case 28:
+                return DSCP_28;
+            case 29:
+                return DSCP_29;
+            case 30:
+                return DSCP_30;
+            case 31:
+                return DSCP_31;
+            case 32:
+                return DSCP_32;
+            case 33:
+                return DSCP_33;
+            case 34:
+                return DSCP_34;
+            case 35:
+                return DSCP_35;
+            case 36:
+                return DSCP_36;
+            case 37:
+                return DSCP_37;
+            case 38:
+                return DSCP_38;
+            case 39:
+                return DSCP_39;
+            case 40:
+                return DSCP_40;
+            case 41:
+                return DSCP_41;
+            case 42:
+                return DSCP_42;
+            case 43:
+                return DSCP_43;
+            case 44:
+                return DSCP_44;
+            case 45:
+                return DSCP_45;
+            case 46:
+                return DSCP_46;
+            case 47:
+                return DSCP_47;
+            case 48:
+                return DSCP_48;
+            case 49:
+                return DSCP_49;
+            case 50:
+                return DSCP_50;
+            case 51:
+                return DSCP_51;
+            case 52:
+                return DSCP_52;
+            case 53:
+                return DSCP_53;
+            case 54:
+                return DSCP_54;
+            case 55:
+                return DSCP_55;
+            case 56:
+                return DSCP_56;
+            case 57:
+                return DSCP_57;
+            case 58:
+                return DSCP_58;
+            case 59:
+                return DSCP_59;
+            case 60:
+                return DSCP_60;
+            case 61:
+                return DSCP_61;
+            case 62:
+                return DSCP_62;
+            case 63:
+                return DSCP_63;
+            default:
+                throw new IllegalArgumentException("Illegal IPv4 DSCP value: " + dscp);
+        }
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    @Override
+    public String toString() {
+        return Integer.toHexString(dscp);
+    }
+
+    public void writeByte(ChannelBuffer c) {
+        c.writeByte(this.dscp);
+    }
+
+    public static IpDscp readByte(ChannelBuffer c) throws OFParseError {
+        return IpDscp.of((byte)(c.readUnsignedByte()));
+    }
+
+    @Override
+    public IpDscp applyMask(IpDscp mask) {
+        return IpDscp.of((byte)(this.dscp & mask.dscp));
+    }
+
+    public byte getDscpValue() {
+        return dscp;
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IpEcn.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IpEcn.java
new file mode 100644
index 0000000..5ecd251
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IpEcn.java
@@ -0,0 +1,65 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public enum IpEcn implements OFValueType<IpEcn> {
+    ECN_00((byte)0),
+    ECN_01((byte)1),
+    ECN_10((byte)2),
+    ECN_11((byte)3),
+    ECN_NO_MASK((byte)0xFF);
+
+    public static final IpEcn NO_MASK = ECN_NO_MASK;
+    public static final IpEcn FULL_MASK = ECN_00;
+
+    static final int LENGTH = 1;
+
+    private final byte ecn;
+
+    private IpEcn(byte ecn) {
+        this.ecn = ecn;
+    }
+
+    public static IpEcn of(byte ecn) {
+        switch (ecn) {
+            case 0:
+                return ECN_00;
+            case 1:
+                return ECN_01;
+            case 2:
+                return ECN_10;
+            case 3:
+                return ECN_11;
+            default:
+                throw new IllegalArgumentException("Illegal IP ECN value: " + ecn);
+        }
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    @Override
+    public String toString() {
+        return (ecn < 3 ? "0" : "") + Integer.toBinaryString(ecn);
+    }
+
+    public void writeByte(ChannelBuffer c) {
+        c.writeByte(this.ecn);
+    }
+
+    public static IpEcn readByte(ChannelBuffer c) throws OFParseError {
+        return IpEcn.of((byte)(c.readUnsignedByte()));
+    }
+
+    @Override
+    public IpEcn applyMask(IpEcn mask) {
+        return IpEcn.of((byte)(this.ecn & mask.ecn));
+    }
+
+    public byte getEcnValue() {
+        return ecn;
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IpProtocol.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IpProtocol.java
new file mode 100644
index 0000000..e78c97b
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/IpProtocol.java
@@ -0,0 +1,648 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+/**
+ * IP-Protocol field representation
+ * 
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ */
+public class IpProtocol implements OFValueType<IpProtocol> {
+
+    static final short MAX_PROTO = 0xFF;
+    static final int LENGTH = 1;
+
+    private final short proto;
+
+    static final short IP_PROTO_NUM_HOPOPT  = 0x00;
+    static final short IP_PROTO_NUM_ICMP    = 0x01;
+    static final short IP_PROTO_NUM_IGMP    = 0x02;
+    static final short IP_PROTO_NUM_GGP = 0x03;
+    static final short IP_PROTO_NUM_IPv4    = 0x04;
+    static final short IP_PROTO_NUM_ST  = 0x05;
+    static final short IP_PROTO_NUM_TCP = 0x06;
+    static final short IP_PROTO_NUM_CBT = 0x07;
+    static final short IP_PROTO_NUM_EGP = 0x08;
+    static final short IP_PROTO_NUM_IGP = 0x09;
+    static final short IP_PROTO_NUM_BBN_RCC_MON = 0x0A;
+    static final short IP_PROTO_NUM_NVP_II  = 0x0B;
+    static final short IP_PROTO_NUM_PUP = 0x0C;
+    static final short IP_PROTO_NUM_ARGUS   = 0x0D;
+    static final short IP_PROTO_NUM_EMCON   = 0x0E;
+    static final short IP_PROTO_NUM_XNET    = 0x0F;
+    static final short IP_PROTO_NUM_CHAOS   = 0x10;
+    static final short IP_PROTO_NUM_UDP = 0x11;
+    static final short IP_PROTO_NUM_MUX = 0x12;
+    static final short IP_PROTO_NUM_DCN_MEAS    = 0x13;
+    static final short IP_PROTO_NUM_HMP = 0x14;
+    static final short IP_PROTO_NUM_PRM = 0x15;
+    static final short IP_PROTO_NUM_XNS_IDP = 0x16;
+    static final short IP_PROTO_NUM_TRUNK_1 = 0x17;
+    static final short IP_PROTO_NUM_TRUNK_2 = 0x18;
+    static final short IP_PROTO_NUM_LEAF_1  = 0x19;
+    static final short IP_PROTO_NUM_LEAF_2  = 0x1A;
+    static final short IP_PROTO_NUM_RDP = 0x1B;
+    static final short IP_PROTO_NUM_IRTP    = 0x1C;
+    static final short IP_PROTO_NUM_ISO_TP4 = 0x1D;
+    static final short IP_PROTO_NUM_NETBLT  = 0x1E;
+    static final short IP_PROTO_NUM_MFE_NSP = 0x1F;
+    static final short IP_PROTO_NUM_MERIT_INP   = 0x20;
+    static final short IP_PROTO_NUM_DCCP    = 0x21;
+    static final short IP_PROTO_NUM_3PC = 0x22;
+    static final short IP_PROTO_NUM_IDPR    = 0x23;
+    static final short IP_PROTO_NUM_XTP = 0x24;
+    static final short IP_PROTO_NUM_DDP = 0x25;
+    static final short IP_PROTO_NUM_IDPR_CMTP   = 0x26;
+    static final short IP_PROTO_NUM_TP_PP   = 0x27;
+    static final short IP_PROTO_NUM_IL  = 0x28;
+    static final short IP_PROTO_NUM_IPv6    = 0x29;
+    static final short IP_PROTO_NUM_SDRP    = 0x2A;
+    static final short IP_PROTO_NUM_IPv6_ROUTE  = 0x2B;
+    static final short IP_PROTO_NUM_IPv6_FRAG   = 0x2C;
+    static final short IP_PROTO_NUM_IDRP    = 0x2D;
+    static final short IP_PROTO_NUM_RSVP    = 0x2E;
+    static final short IP_PROTO_NUM_GRE = 0x2F;
+    static final short IP_PROTO_NUM_MHRP    = 0x30;
+    static final short IP_PROTO_NUM_BNA = 0x31;
+    static final short IP_PROTO_NUM_ESP = 0x32;
+    static final short IP_PROTO_NUM_AH  = 0x33;
+    static final short IP_PROTO_NUM_I_NLSP  = 0x34;
+    static final short IP_PROTO_NUM_SWIPE   = 0x35;
+    static final short IP_PROTO_NUM_NARP    = 0x36;
+    static final short IP_PROTO_NUM_MOBILE  = 0x37;
+    static final short IP_PROTO_NUM_TLSP    = 0x38;
+    static final short IP_PROTO_NUM_SKIP    = 0x39;
+    static final short IP_PROTO_NUM_IPv6_ICMP   = 0x3A;
+    static final short IP_PROTO_NUM_IPv6_NO_NXT = 0x3B;
+    static final short IP_PROTO_NUM_IPv6_OPTS   = 0x3C;
+    static final short IP_PROTO_NUM_HOST_INTERNAL   = 0x3D;
+    static final short IP_PROTO_NUM_CFTP    = 0x3E;
+    static final short IP_PROTO_NUM_LOCAL_NET   = 0x3F;
+    static final short IP_PROTO_NUM_SAT_EXPAK   = 0x40;
+    static final short IP_PROTO_NUM_KRYPTOLAN   = 0x41;
+    static final short IP_PROTO_NUM_RVD = 0x42;
+    static final short IP_PROTO_NUM_IPPC    = 0x43;
+    static final short IP_PROTO_NUM_DIST_FS = 0x44;
+    static final short IP_PROTO_NUM_SAT_MON = 0x45;
+    static final short IP_PROTO_NUM_VISA    = 0x46;
+    static final short IP_PROTO_NUM_IPCV    = 0x47;
+    static final short IP_PROTO_NUM_CPNX    = 0x48;
+    static final short IP_PROTO_NUM_CPHB    = 0x49;
+    static final short IP_PROTO_NUM_WSN = 0x4A;
+    static final short IP_PROTO_NUM_PVP = 0x4B;
+    static final short IP_PROTO_NUM_BR_SAT_MON  = 0x4C;
+    static final short IP_PROTO_NUM_SUN_ND  = 0x4D;
+    static final short IP_PROTO_NUM_WB_MON  = 0x4E;
+    static final short IP_PROTO_NUM_WB_EXPAK    = 0x4F;
+    static final short IP_PROTO_NUM_ISO_IP  = 0x50;
+    static final short IP_PROTO_NUM_VMTP    = 0x51;
+    static final short IP_PROTO_NUM_SECURE_VMTP = 0x52;
+    static final short IP_PROTO_NUM_VINES   = 0x53;
+    static final short IP_PROTO_NUM_TTP_IPTM = 0x54;
+    static final short IP_PROTO_NUM_NSFNET_IGP  = 0x55;
+    static final short IP_PROTO_NUM_DGP = 0x56;
+    static final short IP_PROTO_NUM_TCF = 0x57;
+    static final short IP_PROTO_NUM_EIGRP   = 0x58;
+    static final short IP_PROTO_NUM_OSPF    = 0x59;
+    static final short IP_PROTO_NUM_Sprite_RPC  = 0x5A;
+    static final short IP_PROTO_NUM_LARP    = 0x5B;
+    static final short IP_PROTO_NUM_MTP = 0x5C;
+    static final short IP_PROTO_NUM_AX_25   = 0x5D;
+    static final short IP_PROTO_NUM_IPIP    = 0x5E;
+    static final short IP_PROTO_NUM_MICP    = 0x5F;
+    static final short IP_PROTO_NUM_SCC_SP  = 0x60;
+    static final short IP_PROTO_NUM_ETHERIP = 0x61;
+    static final short IP_PROTO_NUM_ENCAP   = 0x62;
+    static final short IP_PROTO_NUM_PRIVATE_ENCRYPT = 0x63;
+    static final short IP_PROTO_NUM_GMTP    = 0x64;
+    static final short IP_PROTO_NUM_IFMP    = 0x65;
+    static final short IP_PROTO_NUM_PNNI    = 0x66;
+    static final short IP_PROTO_NUM_PIM = 0x67;
+    static final short IP_PROTO_NUM_ARIS    = 0x68;
+    static final short IP_PROTO_NUM_SCPS    = 0x69;
+    static final short IP_PROTO_NUM_QNX = 0x6A;
+    static final short IP_PROTO_NUM_A_N = 0x6B;
+    static final short IP_PROTO_NUM_IP_COMP = 0x6C;
+    static final short IP_PROTO_NUM_SNP = 0x6D;
+    static final short IP_PROTO_NUM_COMPAQ_PEER = 0x6E;
+    static final short IP_PROTO_NUM_IPX_IN_IP   = 0x6F;
+    static final short IP_PROTO_NUM_VRRP    = 0x70;
+    static final short IP_PROTO_NUM_PGM = 0x71;
+    static final short IP_PROTO_NUM_ZERO_HOP    = 0x72;
+    static final short IP_PROTO_NUM_L2TP    = 0x73;
+    static final short IP_PROTO_NUM_DDX = 0x74;
+    static final short IP_PROTO_NUM_IATP    = 0x75;
+    static final short IP_PROTO_NUM_STP = 0x76;
+    static final short IP_PROTO_NUM_SRP = 0x77;
+    static final short IP_PROTO_NUM_UTI = 0x78;
+    static final short IP_PROTO_NUM_SMP = 0x79;
+    static final short IP_PROTO_NUM_SM  = 0x7A;
+    static final short IP_PROTO_NUM_PTP = 0x7B;
+    static final short IP_PROTO_NUM_IS_IS_OVER_IPv4 = 0x7C;
+    static final short IP_PROTO_NUM_FIRE    = 0x7D;
+    static final short IP_PROTO_NUM_CRTP    = 0x7E;
+    static final short IP_PROTO_NUM_CRUDP   = 0x7F;
+    static final short IP_PROTO_NUM_SSCOPMCE    = 0x80;
+    static final short IP_PROTO_NUM_IPLT    = 0x81;
+    static final short IP_PROTO_NUM_SPS = 0x82;
+    static final short IP_PROTO_NUM_PIPE    = 0x83;
+    static final short IP_PROTO_NUM_SCTP    = 0x84;
+    static final short IP_PROTO_NUM_FC  = 0x85;
+    static final short IP_PROTO_NUM_RSVP_E2E_IGNORE = 0x86;
+    static final short IP_PROTO_NUM_MOBILITY_HEADER = 0x87;
+    static final short IP_PROTO_NUM_UDP_LITE    = 0x88;
+    static final short IP_PROTO_NUM_MPLS_IN_IP  = 0x89;
+    static final short IP_PROTO_NUM_MANET   = 0x8A;
+    static final short IP_PROTO_NUM_HIP = 0x8B;
+    static final short IP_PROTO_NUM_SHIM6   = 0x8C;
+
+    public static final IpProtocol IP_PROTO_HOPOPT = new IpProtocol(IP_PROTO_NUM_HOPOPT);
+    public static final IpProtocol IP_PROTO_ICMP = new IpProtocol(IP_PROTO_NUM_ICMP);
+    public static final IpProtocol IP_PROTO_IGMP = new IpProtocol(IP_PROTO_NUM_IGMP);
+    public static final IpProtocol IP_PROTO_GGP = new IpProtocol(IP_PROTO_NUM_GGP);
+    public static final IpProtocol IP_PROTO_IPv4 = new IpProtocol(IP_PROTO_NUM_IPv4);
+    public static final IpProtocol IP_PROTO_ST = new IpProtocol(IP_PROTO_NUM_ST);
+    public static final IpProtocol IP_PROTO_TCP = new IpProtocol(IP_PROTO_NUM_TCP);
+    public static final IpProtocol IP_PROTO_CBT = new IpProtocol(IP_PROTO_NUM_CBT);
+    public static final IpProtocol IP_PROTO_EGP = new IpProtocol(IP_PROTO_NUM_EGP);
+    public static final IpProtocol IP_PROTO_IGP = new IpProtocol(IP_PROTO_NUM_IGP);
+    public static final IpProtocol IP_PROTO_BBN_RCC_MON = new IpProtocol(IP_PROTO_NUM_BBN_RCC_MON);
+    public static final IpProtocol IP_PROTO_NVP_II = new IpProtocol(IP_PROTO_NUM_NVP_II);
+    public static final IpProtocol IP_PROTO_PUP = new IpProtocol(IP_PROTO_NUM_PUP);
+    public static final IpProtocol IP_PROTO_ARGUS = new IpProtocol(IP_PROTO_NUM_ARGUS);
+    public static final IpProtocol IP_PROTO_EMCON = new IpProtocol(IP_PROTO_NUM_EMCON);
+    public static final IpProtocol IP_PROTO_XNET = new IpProtocol(IP_PROTO_NUM_XNET);
+    public static final IpProtocol IP_PROTO_CHAOS = new IpProtocol(IP_PROTO_NUM_CHAOS);
+    public static final IpProtocol IP_PROTO_UDP = new IpProtocol(IP_PROTO_NUM_UDP);
+    public static final IpProtocol IP_PROTO_MUX = new IpProtocol(IP_PROTO_NUM_MUX);
+    public static final IpProtocol IP_PROTO_DCN_MEAS = new IpProtocol(IP_PROTO_NUM_DCN_MEAS);
+    public static final IpProtocol IP_PROTO_HMP = new IpProtocol(IP_PROTO_NUM_HMP);
+    public static final IpProtocol IP_PROTO_PRM = new IpProtocol(IP_PROTO_NUM_PRM);
+    public static final IpProtocol IP_PROTO_XNS_IDP = new IpProtocol(IP_PROTO_NUM_XNS_IDP);
+    public static final IpProtocol IP_PROTO_TRUNK_1 = new IpProtocol(IP_PROTO_NUM_TRUNK_1);
+    public static final IpProtocol IP_PROTO_TRUNK_2 = new IpProtocol(IP_PROTO_NUM_TRUNK_2);
+    public static final IpProtocol IP_PROTO_LEAF_1 = new IpProtocol(IP_PROTO_NUM_LEAF_1);
+    public static final IpProtocol IP_PROTO_LEAF_2 = new IpProtocol(IP_PROTO_NUM_LEAF_2);
+    public static final IpProtocol IP_PROTO_RDP = new IpProtocol(IP_PROTO_NUM_RDP);
+    public static final IpProtocol IP_PROTO_IRTP = new IpProtocol(IP_PROTO_NUM_IRTP);
+    public static final IpProtocol IP_PROTO_ISO_TP4 = new IpProtocol(IP_PROTO_NUM_ISO_TP4);
+    public static final IpProtocol IP_PROTO_NETBLT = new IpProtocol(IP_PROTO_NUM_NETBLT);
+    public static final IpProtocol IP_PROTO_MFE_NSP = new IpProtocol(IP_PROTO_NUM_MFE_NSP);
+    public static final IpProtocol IP_PROTO_MERIT_INP = new IpProtocol(IP_PROTO_NUM_MERIT_INP);
+    public static final IpProtocol IP_PROTO_DCCP = new IpProtocol(IP_PROTO_NUM_DCCP);
+    public static final IpProtocol IP_PROTO_3PC = new IpProtocol(IP_PROTO_NUM_3PC);
+    public static final IpProtocol IP_PROTO_IDPR = new IpProtocol(IP_PROTO_NUM_IDPR);
+    public static final IpProtocol IP_PROTO_XTP = new IpProtocol(IP_PROTO_NUM_XTP);
+    public static final IpProtocol IP_PROTO_DDP = new IpProtocol(IP_PROTO_NUM_DDP);
+    public static final IpProtocol IP_PROTO_IDPR_CMTP = new IpProtocol(IP_PROTO_NUM_IDPR_CMTP);
+    public static final IpProtocol IP_PROTO_TP_PP = new IpProtocol(IP_PROTO_NUM_TP_PP);
+    public static final IpProtocol IP_PROTO_IL = new IpProtocol(IP_PROTO_NUM_IL);
+    public static final IpProtocol IP_PROTO_IPv6 = new IpProtocol(IP_PROTO_NUM_IPv6);
+    public static final IpProtocol IP_PROTO_SDRP = new IpProtocol(IP_PROTO_NUM_SDRP);
+    public static final IpProtocol IP_PROTO_IPv6_ROUTE = new IpProtocol(IP_PROTO_NUM_IPv6_ROUTE);
+    public static final IpProtocol IP_PROTO_IPv6_FRAG = new IpProtocol(IP_PROTO_NUM_IPv6_FRAG);
+    public static final IpProtocol IP_PROTO_IDRP = new IpProtocol(IP_PROTO_NUM_IDRP);
+    public static final IpProtocol IP_PROTO_RSVP = new IpProtocol(IP_PROTO_NUM_RSVP);
+    public static final IpProtocol IP_PROTO_GRE = new IpProtocol(IP_PROTO_NUM_GRE);
+    public static final IpProtocol IP_PROTO_MHRP = new IpProtocol(IP_PROTO_NUM_MHRP);
+    public static final IpProtocol IP_PROTO_BNA = new IpProtocol(IP_PROTO_NUM_BNA);
+    public static final IpProtocol IP_PROTO_ESP = new IpProtocol(IP_PROTO_NUM_ESP);
+    public static final IpProtocol IP_PROTO_AH = new IpProtocol(IP_PROTO_NUM_AH);
+    public static final IpProtocol IP_PROTO_I_NLSP = new IpProtocol(IP_PROTO_NUM_I_NLSP);
+    public static final IpProtocol IP_PROTO_SWIPE = new IpProtocol(IP_PROTO_NUM_SWIPE);
+    public static final IpProtocol IP_PROTO_NARP = new IpProtocol(IP_PROTO_NUM_NARP);
+    public static final IpProtocol IP_PROTO_MOBILE = new IpProtocol(IP_PROTO_NUM_MOBILE);
+    public static final IpProtocol IP_PROTO_TLSP = new IpProtocol(IP_PROTO_NUM_TLSP);
+    public static final IpProtocol IP_PROTO_SKIP = new IpProtocol(IP_PROTO_NUM_SKIP);
+    public static final IpProtocol IP_PROTO_IPv6_ICMP = new IpProtocol(IP_PROTO_NUM_IPv6_ICMP);
+    public static final IpProtocol IP_PROTO_IPv6_NO_NXT = new IpProtocol(IP_PROTO_NUM_IPv6_NO_NXT);
+    public static final IpProtocol IP_PROTO_IPv6_OPTS = new IpProtocol(IP_PROTO_NUM_IPv6_OPTS);
+    public static final IpProtocol IP_PROTO_HOST_INTERNAL = new IpProtocol(IP_PROTO_NUM_HOST_INTERNAL);
+    public static final IpProtocol IP_PROTO_CFTP = new IpProtocol(IP_PROTO_NUM_CFTP);
+    public static final IpProtocol IP_PROTO_LOCAL_NET = new IpProtocol(IP_PROTO_NUM_LOCAL_NET);
+    public static final IpProtocol IP_PROTO_SAT_EXPAK = new IpProtocol(IP_PROTO_NUM_SAT_EXPAK);
+    public static final IpProtocol IP_PROTO_KRYPTOLAN = new IpProtocol(IP_PROTO_NUM_KRYPTOLAN);
+    public static final IpProtocol IP_PROTO_RVD = new IpProtocol(IP_PROTO_NUM_RVD);
+    public static final IpProtocol IP_PROTO_IPPC = new IpProtocol(IP_PROTO_NUM_IPPC);
+    public static final IpProtocol IP_PROTO_DIST_FS = new IpProtocol(IP_PROTO_NUM_DIST_FS);
+    public static final IpProtocol IP_PROTO_SAT_MON = new IpProtocol(IP_PROTO_NUM_SAT_MON);
+    public static final IpProtocol IP_PROTO_VISA = new IpProtocol(IP_PROTO_NUM_VISA);
+    public static final IpProtocol IP_PROTO_IPCV = new IpProtocol(IP_PROTO_NUM_IPCV);
+    public static final IpProtocol IP_PROTO_CPNX = new IpProtocol(IP_PROTO_NUM_CPNX);
+    public static final IpProtocol IP_PROTO_CPHB = new IpProtocol(IP_PROTO_NUM_CPHB);
+    public static final IpProtocol IP_PROTO_WSN = new IpProtocol(IP_PROTO_NUM_WSN);
+    public static final IpProtocol IP_PROTO_PVP = new IpProtocol(IP_PROTO_NUM_PVP);
+    public static final IpProtocol IP_PROTO_BR_SAT_MON = new IpProtocol(IP_PROTO_NUM_BR_SAT_MON);
+    public static final IpProtocol IP_PROTO_SUN_ND = new IpProtocol(IP_PROTO_NUM_SUN_ND);
+    public static final IpProtocol IP_PROTO_WB_MON = new IpProtocol(IP_PROTO_NUM_WB_MON);
+    public static final IpProtocol IP_PROTO_WB_EXPAK = new IpProtocol(IP_PROTO_NUM_WB_EXPAK);
+    public static final IpProtocol IP_PROTO_ISO_IP = new IpProtocol(IP_PROTO_NUM_ISO_IP);
+    public static final IpProtocol IP_PROTO_VMTP = new IpProtocol(IP_PROTO_NUM_VMTP);
+    public static final IpProtocol IP_PROTO_SECURE_VMTP = new IpProtocol(IP_PROTO_NUM_SECURE_VMTP);
+    public static final IpProtocol IP_PROTO_VINES = new IpProtocol(IP_PROTO_NUM_VINES);
+    public static final IpProtocol IP_PROTO_TTP_IPTM = new IpProtocol(IP_PROTO_NUM_TTP_IPTM);
+    public static final IpProtocol IP_PROTO_NSFNET_IGP = new IpProtocol(IP_PROTO_NUM_NSFNET_IGP);
+    public static final IpProtocol IP_PROTO_DGP = new IpProtocol(IP_PROTO_NUM_DGP);
+    public static final IpProtocol IP_PROTO_TCF = new IpProtocol(IP_PROTO_NUM_TCF);
+    public static final IpProtocol IP_PROTO_EIGRP = new IpProtocol(IP_PROTO_NUM_EIGRP);
+    public static final IpProtocol IP_PROTO_OSPF = new IpProtocol(IP_PROTO_NUM_OSPF);
+    public static final IpProtocol IP_PROTO_Sprite_RPC = new IpProtocol(IP_PROTO_NUM_Sprite_RPC);
+    public static final IpProtocol IP_PROTO_LARP = new IpProtocol(IP_PROTO_NUM_LARP);
+    public static final IpProtocol IP_PROTO_MTP = new IpProtocol(IP_PROTO_NUM_MTP);
+    public static final IpProtocol IP_PROTO_AX_25 = new IpProtocol(IP_PROTO_NUM_AX_25);
+    public static final IpProtocol IP_PROTO_IPIP = new IpProtocol(IP_PROTO_NUM_IPIP);
+    public static final IpProtocol IP_PROTO_MICP = new IpProtocol(IP_PROTO_NUM_MICP);
+    public static final IpProtocol IP_PROTO_SCC_SP = new IpProtocol(IP_PROTO_NUM_SCC_SP);
+    public static final IpProtocol IP_PROTO_ETHERIP = new IpProtocol(IP_PROTO_NUM_ETHERIP);
+    public static final IpProtocol IP_PROTO_ENCAP = new IpProtocol(IP_PROTO_NUM_ENCAP);
+    public static final IpProtocol IP_PROTO_PRIVATE_ENCRYPT = new IpProtocol(IP_PROTO_NUM_PRIVATE_ENCRYPT);
+    public static final IpProtocol IP_PROTO_GMTP = new IpProtocol(IP_PROTO_NUM_GMTP);
+    public static final IpProtocol IP_PROTO_IFMP = new IpProtocol(IP_PROTO_NUM_IFMP);
+    public static final IpProtocol IP_PROTO_PNNI = new IpProtocol(IP_PROTO_NUM_PNNI);
+    public static final IpProtocol IP_PROTO_PIM = new IpProtocol(IP_PROTO_NUM_PIM);
+    public static final IpProtocol IP_PROTO_ARIS = new IpProtocol(IP_PROTO_NUM_ARIS);
+    public static final IpProtocol IP_PROTO_SCPS = new IpProtocol(IP_PROTO_NUM_SCPS);
+    public static final IpProtocol IP_PROTO_QNX = new IpProtocol(IP_PROTO_NUM_QNX);
+    public static final IpProtocol IP_PROTO_A_N = new IpProtocol(IP_PROTO_NUM_A_N);
+    public static final IpProtocol IP_PROTO_IP_COMP = new IpProtocol(IP_PROTO_NUM_IP_COMP);
+    public static final IpProtocol IP_PROTO_SNP = new IpProtocol(IP_PROTO_NUM_SNP);
+    public static final IpProtocol IP_PROTO_COMPAQ_PEER = new IpProtocol(IP_PROTO_NUM_COMPAQ_PEER);
+    public static final IpProtocol IP_PROTO_IPX_IN_IP = new IpProtocol(IP_PROTO_NUM_IPX_IN_IP);
+    public static final IpProtocol IP_PROTO_VRRP = new IpProtocol(IP_PROTO_NUM_VRRP);
+    public static final IpProtocol IP_PROTO_PGM = new IpProtocol(IP_PROTO_NUM_PGM);
+    public static final IpProtocol IP_PROTO_ZERO_HOP = new IpProtocol(IP_PROTO_NUM_ZERO_HOP);
+    public static final IpProtocol IP_PROTO_L2TP = new IpProtocol(IP_PROTO_NUM_L2TP);
+    public static final IpProtocol IP_PROTO_DDX = new IpProtocol(IP_PROTO_NUM_DDX);
+    public static final IpProtocol IP_PROTO_IATP = new IpProtocol(IP_PROTO_NUM_IATP);
+    public static final IpProtocol IP_PROTO_STP = new IpProtocol(IP_PROTO_NUM_STP);
+    public static final IpProtocol IP_PROTO_SRP = new IpProtocol(IP_PROTO_NUM_SRP);
+    public static final IpProtocol IP_PROTO_UTI = new IpProtocol(IP_PROTO_NUM_UTI);
+    public static final IpProtocol IP_PROTO_SMP = new IpProtocol(IP_PROTO_NUM_SMP);
+    public static final IpProtocol IP_PROTO_SM = new IpProtocol(IP_PROTO_NUM_SM);
+    public static final IpProtocol IP_PROTO_PTP = new IpProtocol(IP_PROTO_NUM_PTP);
+    public static final IpProtocol IP_PROTO_IS_IS_OVER_IPv4 = new IpProtocol(IP_PROTO_NUM_IS_IS_OVER_IPv4);
+    public static final IpProtocol IP_PROTO_FIRE = new IpProtocol(IP_PROTO_NUM_FIRE);
+    public static final IpProtocol IP_PROTO_CRTP = new IpProtocol(IP_PROTO_NUM_CRTP);
+    public static final IpProtocol IP_PROTO_CRUDP = new IpProtocol(IP_PROTO_NUM_CRUDP);
+    public static final IpProtocol IP_PROTO_SSCOPMCE = new IpProtocol(IP_PROTO_NUM_SSCOPMCE);
+    public static final IpProtocol IP_PROTO_IPLT = new IpProtocol(IP_PROTO_NUM_IPLT);
+    public static final IpProtocol IP_PROTO_SPS = new IpProtocol(IP_PROTO_NUM_SPS);
+    public static final IpProtocol IP_PROTO_PIPE = new IpProtocol(IP_PROTO_NUM_PIPE);
+    public static final IpProtocol IP_PROTO_SCTP = new IpProtocol(IP_PROTO_NUM_SCTP);
+    public static final IpProtocol IP_PROTO_FC = new IpProtocol(IP_PROTO_NUM_FC);
+    public static final IpProtocol IP_PROTO_RSVP_E2E_IGNORE = new IpProtocol(IP_PROTO_NUM_RSVP_E2E_IGNORE);
+    public static final IpProtocol IP_PROTO_MOBILITY_HEADER = new IpProtocol(IP_PROTO_NUM_MOBILITY_HEADER);
+    public static final IpProtocol IP_PROTO_UDP_LITE = new IpProtocol(IP_PROTO_NUM_UDP_LITE);
+    public static final IpProtocol IP_PROTO_MPLS_IN_IP = new IpProtocol(IP_PROTO_NUM_MPLS_IN_IP);
+    public static final IpProtocol IP_PROTO_MANET = new IpProtocol(IP_PROTO_NUM_MANET);
+    public static final IpProtocol IP_PROTO_HIP = new IpProtocol(IP_PROTO_NUM_HIP);
+    public static final IpProtocol IP_PROTO_SHIM6 = new IpProtocol(IP_PROTO_NUM_SHIM6);
+
+    public static final IpProtocol NO_MASK = IP_PROTO_HOPOPT;
+    public static final IpProtocol FULL_MASK = new IpProtocol((short)0x0000);
+
+    private IpProtocol(short version) {
+        this.proto = version;
+    }
+
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    public static IpProtocol of(short proto) {
+        switch (proto) {
+            case IP_PROTO_NUM_HOPOPT:
+                return IP_PROTO_HOPOPT;
+            case IP_PROTO_NUM_ICMP:
+                return IP_PROTO_ICMP;
+            case IP_PROTO_NUM_IGMP:
+                return IP_PROTO_IGMP;
+            case IP_PROTO_NUM_GGP:
+                return IP_PROTO_GGP;
+            case IP_PROTO_NUM_IPv4:
+                return IP_PROTO_IPv4;
+            case IP_PROTO_NUM_ST:
+                return IP_PROTO_ST;
+            case IP_PROTO_NUM_TCP:
+                return IP_PROTO_TCP;
+            case IP_PROTO_NUM_CBT:
+                return IP_PROTO_CBT;
+            case IP_PROTO_NUM_EGP:
+                return IP_PROTO_EGP;
+            case IP_PROTO_NUM_IGP:
+                return IP_PROTO_IGP;
+            case IP_PROTO_NUM_BBN_RCC_MON:
+                return IP_PROTO_BBN_RCC_MON;
+            case IP_PROTO_NUM_NVP_II:
+                return IP_PROTO_NVP_II;
+            case IP_PROTO_NUM_PUP:
+                return IP_PROTO_PUP;
+            case IP_PROTO_NUM_ARGUS:
+                return IP_PROTO_ARGUS;
+            case IP_PROTO_NUM_EMCON:
+                return IP_PROTO_EMCON;
+            case IP_PROTO_NUM_XNET:
+                return IP_PROTO_XNET;
+            case IP_PROTO_NUM_CHAOS:
+                return IP_PROTO_CHAOS;
+            case IP_PROTO_NUM_UDP:
+                return IP_PROTO_UDP;
+            case IP_PROTO_NUM_MUX:
+                return IP_PROTO_MUX;
+            case IP_PROTO_NUM_DCN_MEAS:
+                return IP_PROTO_DCN_MEAS;
+            case IP_PROTO_NUM_HMP:
+                return IP_PROTO_HMP;
+            case IP_PROTO_NUM_PRM:
+                return IP_PROTO_PRM;
+            case IP_PROTO_NUM_XNS_IDP:
+                return IP_PROTO_XNS_IDP;
+            case IP_PROTO_NUM_TRUNK_1:
+                return IP_PROTO_TRUNK_1;
+            case IP_PROTO_NUM_TRUNK_2:
+                return IP_PROTO_TRUNK_2;
+            case IP_PROTO_NUM_LEAF_1:
+                return IP_PROTO_LEAF_1;
+            case IP_PROTO_NUM_LEAF_2:
+                return IP_PROTO_LEAF_2;
+            case IP_PROTO_NUM_RDP:
+                return IP_PROTO_RDP;
+            case IP_PROTO_NUM_IRTP:
+                return IP_PROTO_IRTP;
+            case IP_PROTO_NUM_ISO_TP4:
+                return IP_PROTO_ISO_TP4;
+            case IP_PROTO_NUM_NETBLT:
+                return IP_PROTO_NETBLT;
+            case IP_PROTO_NUM_MFE_NSP:
+                return IP_PROTO_MFE_NSP;
+            case IP_PROTO_NUM_MERIT_INP:
+                return IP_PROTO_MERIT_INP;
+            case IP_PROTO_NUM_DCCP:
+                return IP_PROTO_DCCP;
+            case IP_PROTO_NUM_3PC:
+                return IP_PROTO_3PC;
+            case IP_PROTO_NUM_IDPR:
+                return IP_PROTO_IDPR;
+            case IP_PROTO_NUM_XTP:
+                return IP_PROTO_XTP;
+            case IP_PROTO_NUM_DDP:
+                return IP_PROTO_DDP;
+            case IP_PROTO_NUM_IDPR_CMTP:
+                return IP_PROTO_IDPR_CMTP;
+            case IP_PROTO_NUM_TP_PP:
+                return IP_PROTO_TP_PP;
+            case IP_PROTO_NUM_IL:
+                return IP_PROTO_IL;
+            case IP_PROTO_NUM_IPv6:
+                return IP_PROTO_IPv6;
+            case IP_PROTO_NUM_SDRP:
+                return IP_PROTO_SDRP;
+            case IP_PROTO_NUM_IPv6_ROUTE:
+                return IP_PROTO_IPv6_ROUTE;
+            case IP_PROTO_NUM_IPv6_FRAG:
+                return IP_PROTO_IPv6_FRAG;
+            case IP_PROTO_NUM_IDRP:
+                return IP_PROTO_IDRP;
+            case IP_PROTO_NUM_RSVP:
+                return IP_PROTO_RSVP;
+            case IP_PROTO_NUM_GRE:
+                return IP_PROTO_GRE;
+            case IP_PROTO_NUM_MHRP:
+                return IP_PROTO_MHRP;
+            case IP_PROTO_NUM_BNA:
+                return IP_PROTO_BNA;
+            case IP_PROTO_NUM_ESP:
+                return IP_PROTO_ESP;
+            case IP_PROTO_NUM_AH:
+                return IP_PROTO_AH;
+            case IP_PROTO_NUM_I_NLSP:
+                return IP_PROTO_I_NLSP;
+            case IP_PROTO_NUM_SWIPE:
+                return IP_PROTO_SWIPE;
+            case IP_PROTO_NUM_NARP:
+                return IP_PROTO_NARP;
+            case IP_PROTO_NUM_MOBILE:
+                return IP_PROTO_MOBILE;
+            case IP_PROTO_NUM_TLSP:
+                return IP_PROTO_TLSP;
+            case IP_PROTO_NUM_SKIP:
+                return IP_PROTO_SKIP;
+            case IP_PROTO_NUM_IPv6_ICMP:
+                return IP_PROTO_IPv6_ICMP;
+            case IP_PROTO_NUM_IPv6_NO_NXT:
+                return IP_PROTO_IPv6_NO_NXT;
+            case IP_PROTO_NUM_IPv6_OPTS:
+                return IP_PROTO_IPv6_OPTS;
+            case IP_PROTO_NUM_HOST_INTERNAL:
+                return IP_PROTO_HOST_INTERNAL;
+            case IP_PROTO_NUM_CFTP:
+                return IP_PROTO_CFTP;
+            case IP_PROTO_NUM_LOCAL_NET:
+                return IP_PROTO_LOCAL_NET;
+            case IP_PROTO_NUM_SAT_EXPAK:
+                return IP_PROTO_SAT_EXPAK;
+            case IP_PROTO_NUM_KRYPTOLAN:
+                return IP_PROTO_KRYPTOLAN;
+            case IP_PROTO_NUM_RVD:
+                return IP_PROTO_RVD;
+            case IP_PROTO_NUM_IPPC:
+                return IP_PROTO_IPPC;
+            case IP_PROTO_NUM_DIST_FS:
+                return IP_PROTO_DIST_FS;
+            case IP_PROTO_NUM_SAT_MON:
+                return IP_PROTO_SAT_MON;
+            case IP_PROTO_NUM_VISA:
+                return IP_PROTO_VISA;
+            case IP_PROTO_NUM_IPCV:
+                return IP_PROTO_IPCV;
+            case IP_PROTO_NUM_CPNX:
+                return IP_PROTO_CPNX;
+            case IP_PROTO_NUM_CPHB:
+                return IP_PROTO_CPHB;
+            case IP_PROTO_NUM_WSN:
+                return IP_PROTO_WSN;
+            case IP_PROTO_NUM_PVP:
+                return IP_PROTO_PVP;
+            case IP_PROTO_NUM_BR_SAT_MON:
+                return IP_PROTO_BR_SAT_MON;
+            case IP_PROTO_NUM_SUN_ND:
+                return IP_PROTO_SUN_ND;
+            case IP_PROTO_NUM_WB_MON:
+                return IP_PROTO_WB_MON;
+            case IP_PROTO_NUM_WB_EXPAK:
+                return IP_PROTO_WB_EXPAK;
+            case IP_PROTO_NUM_ISO_IP:
+                return IP_PROTO_ISO_IP;
+            case IP_PROTO_NUM_VMTP:
+                return IP_PROTO_VMTP;
+            case IP_PROTO_NUM_SECURE_VMTP:
+                return IP_PROTO_SECURE_VMTP;
+            case IP_PROTO_NUM_VINES:
+                return IP_PROTO_VINES;
+            case IP_PROTO_NUM_TTP_IPTM:
+                return IP_PROTO_TTP_IPTM;
+            case IP_PROTO_NUM_NSFNET_IGP:
+                return IP_PROTO_NSFNET_IGP;
+            case IP_PROTO_NUM_DGP:
+                return IP_PROTO_DGP;
+            case IP_PROTO_NUM_TCF:
+                return IP_PROTO_TCF;
+            case IP_PROTO_NUM_EIGRP:
+                return IP_PROTO_EIGRP;
+            case IP_PROTO_NUM_OSPF:
+                return IP_PROTO_OSPF;
+            case IP_PROTO_NUM_Sprite_RPC:
+                return IP_PROTO_Sprite_RPC;
+            case IP_PROTO_NUM_LARP:
+                return IP_PROTO_LARP;
+            case IP_PROTO_NUM_MTP:
+                return IP_PROTO_MTP;
+            case IP_PROTO_NUM_AX_25:
+                return IP_PROTO_AX_25;
+            case IP_PROTO_NUM_IPIP:
+                return IP_PROTO_IPIP;
+            case IP_PROTO_NUM_MICP:
+                return IP_PROTO_MICP;
+            case IP_PROTO_NUM_SCC_SP:
+                return IP_PROTO_SCC_SP;
+            case IP_PROTO_NUM_ETHERIP:
+                return IP_PROTO_ETHERIP;
+            case IP_PROTO_NUM_ENCAP:
+                return IP_PROTO_ENCAP;
+            case IP_PROTO_NUM_PRIVATE_ENCRYPT:
+                return IP_PROTO_PRIVATE_ENCRYPT;
+            case IP_PROTO_NUM_GMTP:
+                return IP_PROTO_GMTP;
+            case IP_PROTO_NUM_IFMP:
+                return IP_PROTO_IFMP;
+            case IP_PROTO_NUM_PNNI:
+                return IP_PROTO_PNNI;
+            case IP_PROTO_NUM_PIM:
+                return IP_PROTO_PIM;
+            case IP_PROTO_NUM_ARIS:
+                return IP_PROTO_ARIS;
+            case IP_PROTO_NUM_SCPS:
+                return IP_PROTO_SCPS;
+            case IP_PROTO_NUM_QNX:
+                return IP_PROTO_QNX;
+            case IP_PROTO_NUM_A_N:
+                return IP_PROTO_A_N;
+            case IP_PROTO_NUM_IP_COMP:
+                return IP_PROTO_IP_COMP;
+            case IP_PROTO_NUM_SNP:
+                return IP_PROTO_SNP;
+            case IP_PROTO_NUM_COMPAQ_PEER:
+                return IP_PROTO_COMPAQ_PEER;
+            case IP_PROTO_NUM_IPX_IN_IP:
+                return IP_PROTO_IPX_IN_IP;
+            case IP_PROTO_NUM_VRRP:
+                return IP_PROTO_VRRP;
+            case IP_PROTO_NUM_PGM:
+                return IP_PROTO_PGM;
+            case IP_PROTO_NUM_ZERO_HOP:
+                return IP_PROTO_ZERO_HOP;
+            case IP_PROTO_NUM_L2TP:
+                return IP_PROTO_L2TP;
+            case IP_PROTO_NUM_DDX:
+                return IP_PROTO_DDX;
+            case IP_PROTO_NUM_IATP:
+                return IP_PROTO_IATP;
+            case IP_PROTO_NUM_STP:
+                return IP_PROTO_STP;
+            case IP_PROTO_NUM_SRP:
+                return IP_PROTO_SRP;
+            case IP_PROTO_NUM_UTI:
+                return IP_PROTO_UTI;
+            case IP_PROTO_NUM_SMP:
+                return IP_PROTO_SMP;
+            case IP_PROTO_NUM_SM:
+                return IP_PROTO_SM;
+            case IP_PROTO_NUM_PTP:
+                return IP_PROTO_PTP;
+            case IP_PROTO_NUM_IS_IS_OVER_IPv4:
+                return IP_PROTO_IS_IS_OVER_IPv4;
+            case IP_PROTO_NUM_FIRE:
+                return IP_PROTO_FIRE;
+            case IP_PROTO_NUM_CRTP:
+                return IP_PROTO_CRTP;
+            case IP_PROTO_NUM_CRUDP:
+                return IP_PROTO_CRUDP;
+            case IP_PROTO_NUM_SSCOPMCE:
+                return IP_PROTO_SSCOPMCE;
+            case IP_PROTO_NUM_IPLT:
+                return IP_PROTO_IPLT;
+            case IP_PROTO_NUM_SPS:
+                return IP_PROTO_SPS;
+            case IP_PROTO_NUM_PIPE:
+                return IP_PROTO_PIPE;
+            case IP_PROTO_NUM_SCTP:
+                return IP_PROTO_SCTP;
+            case IP_PROTO_NUM_FC:
+                return IP_PROTO_FC;
+            case IP_PROTO_NUM_RSVP_E2E_IGNORE:
+                return IP_PROTO_RSVP_E2E_IGNORE;
+            case IP_PROTO_NUM_MOBILITY_HEADER:
+                return IP_PROTO_MOBILITY_HEADER;
+            case IP_PROTO_NUM_UDP_LITE:
+                return IP_PROTO_UDP_LITE;
+            case IP_PROTO_NUM_MPLS_IN_IP:
+                return IP_PROTO_MPLS_IN_IP;
+            case IP_PROTO_NUM_MANET:
+                return IP_PROTO_MANET;
+            case IP_PROTO_NUM_HIP:
+                return IP_PROTO_HIP;
+            case IP_PROTO_NUM_SHIM6:
+                return IP_PROTO_SHIM6;
+            default:
+                if (proto >= MAX_PROTO) {
+                    throw new IllegalArgumentException("Illegal IP protocol number: "
+                            + proto);
+                } else {
+                    return new IpProtocol(proto);
+                }
+        }
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (!(obj instanceof IpProtocol))
+            return false;
+        IpProtocol o = (IpProtocol)obj;
+        if (o.proto != this.proto)
+            return false;
+        return true;
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 37;
+        int result = 1;
+        result = prime * result + proto;
+        return result;
+    }
+
+    @Override
+    public String toString() {
+        return Integer.toHexString(proto);
+    }
+    
+    public void writeByte(ChannelBuffer c) {
+        c.writeByte(this.proto);
+    }
+
+    public static IpProtocol readByte(ChannelBuffer c) {
+        return IpProtocol.of(c.readUnsignedByte());
+    }
+
+    @Override
+    public IpProtocol applyMask(IpProtocol mask) {
+        return IpProtocol.of((short)(this.proto & mask.proto));
+    }
+
+    public short getIpProtocolNumber() {
+        return proto;
+    }
+    
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/MacAddress.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/MacAddress.java
new file mode 100644
index 0000000..040d875
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/MacAddress.java
@@ -0,0 +1,130 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.util.HexString;
+
+/**
+ * Wrapper around a 6 byte mac address.
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+
+public class MacAddress implements OFValueType<MacAddress> {
+    static final int MacAddrLen = 6;
+    private final long rawValue;
+
+    public static final MacAddress NO_MASK = MacAddress.of(0xFFFFFFFFFFFFFFFFl);
+    public static final MacAddress FULL_MASK = MacAddress.of(0x0);
+
+    private MacAddress(final long rawValue) {
+        this.rawValue = rawValue;
+    }
+
+    public static MacAddress of(final byte[] address) {
+        long raw =
+                (address[0] & 0xFFL) << 40 | (address[1] & 0xFFL) << 32
+                        | (address[2] & 0xFFL) << 24 | (address[3] & 0xFFL) << 16
+                        | (address[4] & 0xFFL) << 8 | (address[5] & 0xFFL);
+        return MacAddress.of(raw);
+    }
+
+    public static MacAddress of(final long raw) {
+        return new MacAddress(raw);
+    }
+
+    public static MacAddress of(final String string) {
+        int index = 0;
+        int shift = 40;
+
+        long raw = 0;
+        if (string.length() != 6 * 2 + 5)
+            throw new IllegalArgumentException("Mac address not well formed: " + string);
+
+        while (shift >= 0) {
+            raw |=
+                    ((long) (Character.digit(string.charAt(index++), 16) << 4 | Character
+                            .digit(string.charAt(index++), 16))) << shift;
+
+            if (shift == 0)
+                break;
+            if (string.charAt(index++) != ':')
+                throw new IllegalArgumentException("Mac address not well formed: " + string);
+            shift -= 8;
+        }
+        return MacAddress.of(raw);
+    }
+
+    volatile byte[] bytesCache = null;
+
+    public byte[] getBytes() {
+        if (bytesCache == null) {
+            synchronized (this) {
+                if (bytesCache == null) {
+                    bytesCache =
+                            new byte[] { (byte) ((rawValue >> 40) & 0xFF),
+                                    (byte) ((rawValue >> 32) & 0xFF),
+                                    (byte) ((rawValue >> 24) & 0xFF),
+                                    (byte) ((rawValue >> 16) & 0xFF),
+                                    (byte) ((rawValue >> 8) & 0xFF),
+                                    (byte) ((rawValue >> 0) & 0xFF) };
+                }
+            }
+        }
+        return bytesCache;
+    }
+
+    @Override
+    public int getLength() {
+        return MacAddrLen;
+    }
+
+    @Override
+    public String toString() {
+        return HexString.toHexString(rawValue, 6);
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 31;
+        int result = 1;
+        result = prime * result + (int) (rawValue ^ (rawValue >>> 32));
+        return result;
+    }
+
+    @Override
+    public boolean equals(final Object obj) {
+        if (this == obj)
+            return true;
+        if (obj == null)
+            return false;
+        if (getClass() != obj.getClass())
+            return false;
+        MacAddress other = (MacAddress) obj;
+        if (rawValue != other.rawValue)
+            return false;
+        return true;
+    }
+
+    public long getLong() {
+        return rawValue;
+    }
+
+    public void write6Bytes(ChannelBuffer c) {
+        c.writeInt((int) (this.rawValue >> 16));
+        c.writeShort((int) this.rawValue & 0xFFFF);
+    }
+
+    public static MacAddress read6Bytes(ChannelBuffer c) throws OFParseError {
+        long raw = c.readUnsignedInt() << 16 | c.readUnsignedShort();
+        return MacAddress.of(raw);
+    }
+
+    @Override
+    public MacAddress applyMask(MacAddress mask) {
+        return MacAddress.of(this.rawValue & mask.rawValue);
+    }
+
+
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/Masked.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/Masked.java
new file mode 100644
index 0000000..ead7d62
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/Masked.java
@@ -0,0 +1,61 @@
+package org.projectfloodlight.openflow.types;
+
+
+
+public class Masked<T extends OFValueType<T>> implements OFValueType<Masked<T>> {
+    protected T value;
+    protected T mask;
+    
+    protected Masked(T value, T mask) {
+        this.value = value.applyMask(mask);
+        this.mask = mask;
+    }
+    
+    public T getValue() {
+        return value;
+    }
+    
+    public T getMask() {
+        return mask;
+    }
+    
+    public static <T extends OFValueType<T>> Masked<T> of(T value, T mask) {
+        return new Masked<T>(value, mask);
+    }
+
+    @Override
+    public int getLength() {
+        return this.value.getLength() + this.mask.getLength();
+    }
+        
+    @Override
+    public boolean equals(Object obj) {
+        if (!(obj instanceof Masked<?>))
+            return false;
+        Masked<?> mobj = (Masked<?>)obj;
+        return this.value.equals(mobj.value) && this.mask.equals(mobj.mask);
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 59;
+        int result = 1;
+        result = prime * result + this.value.hashCode();
+        result = prime * result + this.mask.hashCode();
+        return result;
+    }
+
+    @Override
+    public String toString() {
+        // General representation: value/mask
+        StringBuilder sb = new StringBuilder();
+        sb.append(value.toString()).append('/').append(mask.toString());
+        return sb.toString();
+    }
+
+    @Override
+    public Masked<T> applyMask(Masked<T> mask) {
+        return this;
+    }
+    
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFFlowModCmd.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFFlowModCmd.java
new file mode 100644
index 0000000..7173bde
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFFlowModCmd.java
@@ -0,0 +1,11 @@
+package org.projectfloodlight.openflow.types;
+
+/**
+ * Version agnostic view of commands to an OFFlowMod
+ *
+ * @author capveg
+ */
+
+public enum OFFlowModCmd {
+    ADD, MODIFY, MODIFY_STRICT, DELETE, DELETE_STRICT
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFHelloElement.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFHelloElement.java
new file mode 100644
index 0000000..10d06a0
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFHelloElement.java
@@ -0,0 +1,5 @@
+package org.projectfloodlight.openflow.types;
+
+public interface OFHelloElement {
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFMetadata.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFMetadata.java
new file mode 100644
index 0000000..861d4a8
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFMetadata.java
@@ -0,0 +1,66 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+public class OFMetadata implements OFValueType<OFMetadata> {
+
+    static int LENGTH = 8;
+
+    private final U64 u64;
+
+    public static final OFMetadata NO_MASK = OFMetadata.of(U64.ofRaw(0xFFFFFFFFFFFFFFFFl));
+    public static final OFMetadata FULL_MASK = OFMetadata.of(U64.ofRaw(0x0));
+
+    public OFMetadata(U64 ofRaw) {
+        u64 = ofRaw;
+    }
+
+    public static OFMetadata of(U64 u64) {
+        return new OFMetadata(u64);
+    }
+
+    public static OFMetadata ofRaw(long raw) {
+        return new OFMetadata(U64.ofRaw(raw));
+    }
+
+    public static OFMetadata read8Bytes(ChannelBuffer cb) {
+        return OFMetadata.ofRaw(cb.readLong());
+    }
+
+    public void write8Bytes(ChannelBuffer cb) {
+        u64.writeTo(cb);
+    }
+
+    @Override
+    public int getLength() {
+        return u64.getLength();
+    }
+
+    @Override
+    public OFMetadata applyMask(OFMetadata mask) {
+        return OFMetadata.of(this.u64.applyMask(mask.u64));
+    }
+
+    @Override
+    public boolean equals(Object arg0) {
+        if (!(arg0 instanceof OFMetadata))
+            return false;
+        OFMetadata other = (OFMetadata)arg0;
+
+        return this.u64.equals(other.u64);
+    }
+
+    @Override
+    public int hashCode() {
+        int prime = 53;
+        return this.u64.hashCode() * prime;
+    }
+
+    @Override
+    public String toString() {
+        return "Metadata: " + u64.toString();
+    }
+
+
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFPhysicalPort.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFPhysicalPort.java
new file mode 100644
index 0000000..ca662f7
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFPhysicalPort.java
@@ -0,0 +1,90 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+/**
+ * A wrapper around the OpenFlow physical port description. The interfaces to
+ * this object are version agnostic.
+ *
+ * @author capveg
+ */
+
+public class OFPhysicalPort implements OFValueType<OFPhysicalPort>, Writeable {
+
+    static final int LENGTH = 4;
+
+    private final int port;
+
+    public static final OFPhysicalPort NO_MASK = OFPhysicalPort.of(0xFFFFFFFF);
+    public static final OFPhysicalPort FULL_MASK = OFPhysicalPort.of(0x0);
+
+    private OFPhysicalPort(int port) {
+        this.port = port;
+    }
+
+    public static OFPhysicalPort of(int port) {
+        return new OFPhysicalPort(port);
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (!(obj instanceof OFPhysicalPort))
+            return false;
+        OFPhysicalPort other = (OFPhysicalPort)obj;
+        if (other.port != this.port)
+            return false;
+        return true;
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 59;
+        int result = 1;
+        result = prime * result + port;
+        return result;
+    }
+
+    @Override
+    public String toString() {
+        return Integer.toHexString(port);
+    }
+
+    public void write4Bytes(ChannelBuffer c) {
+        c.writeInt(this.port);
+    }
+
+    @Override
+    public void writeTo(ChannelBuffer bb) {
+        write4Bytes(bb);
+    }
+
+    public static OFPhysicalPort read4Bytes(ChannelBuffer c) throws OFParseError {
+        return OFPhysicalPort.of((int)(c.readUnsignedInt() & 0xFFFFFFFF));
+    }
+
+    @Override
+    public OFPhysicalPort applyMask(OFPhysicalPort mask) {
+        return OFPhysicalPort.of(this.port & mask.port);
+    }
+
+    public int getPortNumber() {
+        return port;
+    }
+
+    public final static Reader READER = new Reader();
+    private static class Reader implements OFMessageReader<OFPhysicalPort> {
+        @Override
+        public OFPhysicalPort readFrom(ChannelBuffer bb) throws OFParseError {
+            return OFPhysicalPort.read4Bytes(bb);
+        }
+
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFPort.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFPort.java
new file mode 100644
index 0000000..d65d0aa
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFPort.java
@@ -0,0 +1,541 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.annotations.Immutable;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+/**
+ * Abstraction of an logical / OpenFlow switch port (ofp_port_no) in OpenFlow.
+ * Immutable. Note: Switch port numbers were changed in OpenFlow 1.1 from uint16
+ * to uint32. This class uses a 32 bit representation internally. Port numbers
+ * are converted from/to uint16 when constructed / getPortNumberasShort is
+ * called. If this port is not representable in OpenFlow 1.0, an
+ * IllegalStateException is raised.
+ *
+ * @author Andreas Wundsam <andreas.wundsam@bigswitch.com>
+ */
+@Immutable
+public class OFPort implements OFValueType<OFPort> {
+    static final int LENGTH = 4;
+    
+    // private int constants (OF1.1+) to avoid duplication in the code
+    // should not have to use these outside this class
+    private static final int OFPP_ANY_INT = 0xFFffFFff;
+    private static final int OFPP_LOCAL_INT = 0xFFffFFfe;
+    private static final int OFPP_CONTROLLER_INT = 0xFFffFFfd;
+    private static final int OFPP_ALL_INT = 0xFFffFFfc;
+    private static final int OFPP_FLOOD_INT = 0xFFffFFfb;
+    private static final int OFPP_NORMAL_INT = 0xFFffFFfa;
+    private static final int OFPP_TABLE_INT = 0xFFffFFf9;
+    private static final int OFPP_MAX_INT = 0xFFffFF00;
+    private static final int OFPP_IN_PORT_INT = 0xFFffFFf8;
+
+    // private short constants (OF1.0) to avoid duplication in the code
+    // should not have to use these outside this class
+    private static final short OFPP_ANY_SHORT = (short) 0xFFff;
+    private static final short OFPP_LOCAL_SHORT = (short) 0xFFfe;
+    private static final short OFPP_CONTROLLER_SHORT = (short) 0xFFfd;
+    private static final short OFPP_ALL_SHORT = (short) 0xFFfc;
+    private static final short OFPP_FLOOD_SHORT = (short) 0xFFfb;
+    private static final short OFPP_NORMAL_SHORT = (short) 0xFFfa;
+    private static final short OFPP_TABLE_SHORT = (short) 0xFFf9;
+    private static final short OFPP_IN_PORT_SHORT = (short) 0xFFf8;
+    private static final short OFPP_MAX_SHORT = (short) 0xFF00;
+    private static final int OFPP_MAX_SHORT_UNSIGNED = 0xFF00;
+
+    // ////////////// public constants - use to access well known OpenFlow ports
+
+    /** Maximum number of physical and logical switch ports. */
+    public final static OFPort MAX = new NamedPort(OFPP_MAX_INT, "max");
+
+    /**
+     * Send the packet out the input port. This reserved port must be explicitly
+     * used in order to send back out of the input port.
+     */
+    public final static OFPort IN_PORT = new NamedPort(OFPP_IN_PORT_INT, "in_port");
+
+    /**
+     * Submit the packet to the first flow table NB: This destination port can
+     * only be used in packet-out messages.
+     */
+    public final static OFPort TABLE = new NamedPort(OFPP_TABLE_INT, "table");
+
+    /** Process with normal L2/L3 switching. */
+    public final static OFPort NORMAL = new NamedPort(OFPP_NORMAL_INT, "normal");
+
+    /**
+     * All physical ports in VLAN, except input port and those blocked or link
+     * down
+     */
+    public final static OFPort FLOOD = new NamedPort(OFPP_FLOOD_INT, "flood");
+
+    /** All physical ports except input port */
+    public final static OFPort ALL = new NamedPort(OFPP_ALL_INT, "all");
+
+    /** Send to controller */
+    public final static OFPort CONTROLLER =
+            new NamedPort(OFPP_CONTROLLER_INT, "controller");
+
+    /** local openflow "port" */
+    public final static OFPort LOCAL = new NamedPort(OFPP_LOCAL_INT, "local");
+
+    /**
+     * Wildcard port used only for flow mod (delete) and flow stats requests.
+     * Selects all flows regardless of output port (including flows with no
+     * output port). NOTE: OpenFlow 1.0 calls this 'NONE'
+     */
+    public final static OFPort ANY = new NamedPort(OFPP_ANY_INT, "any");
+
+    public static final OFPort NO_MASK = OFPort.of(0xFFFFFFFF);
+    public static final OFPort FULL_MASK = OFPort.of(0x0);
+    
+    /** cache of frequently used ports */
+    private static class PrecachedPort {
+        private final static OFPort p1 = new OFPort(1);
+        private final static OFPort p2 = new OFPort(2);
+        private final static OFPort p3 = new OFPort(3);
+        private final static OFPort p4 = new OFPort(4);
+        private final static OFPort p5 = new OFPort(5);
+        private final static OFPort p6 = new OFPort(6);
+        private final static OFPort p7 = new OFPort(7);
+        private final static OFPort p8 = new OFPort(8);
+        private final static OFPort p9 = new OFPort(9);
+        private final static OFPort p10 = new OFPort(10);
+        private final static OFPort p11 = new OFPort(11);
+        private final static OFPort p12 = new OFPort(12);
+        private final static OFPort p13 = new OFPort(13);
+        private final static OFPort p14 = new OFPort(14);
+        private final static OFPort p15 = new OFPort(15);
+        private final static OFPort p16 = new OFPort(16);
+        private final static OFPort p17 = new OFPort(17);
+        private final static OFPort p18 = new OFPort(18);
+        private final static OFPort p19 = new OFPort(19);
+        private final static OFPort p20 = new OFPort(20);
+        private final static OFPort p21 = new OFPort(21);
+        private final static OFPort p22 = new OFPort(22);
+        private final static OFPort p23 = new OFPort(23);
+        private final static OFPort p24 = new OFPort(24);
+        private final static OFPort p25 = new OFPort(25);
+        private final static OFPort p26 = new OFPort(26);
+        private final static OFPort p27 = new OFPort(27);
+        private final static OFPort p28 = new OFPort(28);
+        private final static OFPort p29 = new OFPort(29);
+        private final static OFPort p31 = new OFPort(31);
+        private final static OFPort p32 = new OFPort(32);
+        private final static OFPort p33 = new OFPort(33);
+        private final static OFPort p34 = new OFPort(34);
+        private final static OFPort p35 = new OFPort(35);
+        private final static OFPort p36 = new OFPort(36);
+        private final static OFPort p37 = new OFPort(37);
+        private final static OFPort p38 = new OFPort(38);
+        private final static OFPort p39 = new OFPort(39);
+        private final static OFPort p40 = new OFPort(40);
+        private final static OFPort p41 = new OFPort(41);
+        private final static OFPort p42 = new OFPort(42);
+        private final static OFPort p43 = new OFPort(43);
+        private final static OFPort p44 = new OFPort(44);
+        private final static OFPort p45 = new OFPort(45);
+        private final static OFPort p46 = new OFPort(46);
+        private final static OFPort p47 = new OFPort(47);
+        private final static OFPort p48 = new OFPort(48);
+    }
+
+    /** raw openflow port number as a signed 32 bit integer */
+    private final int portNumber;
+
+    /** private constructor. use of*-Factory methods instead */
+    private OFPort(final int portNumber) {
+        this.portNumber = portNumber;
+    }
+
+    /**
+     * get an OFPort object corresponding to a raw 32-bit integer port number.
+     * NOTE: The port object may either be newly allocated or cached. Do not
+     * rely on either behavior.
+     *
+     * @param portNumber
+     * @return a corresponding OFPort
+     */
+    public static OFPort ofInt(final int portNumber) {
+        switch (portNumber) {
+            case 1:
+                return PrecachedPort.p1;
+            case 2:
+                return PrecachedPort.p2;
+            case 3:
+                return PrecachedPort.p3;
+            case 4:
+                return PrecachedPort.p4;
+            case 5:
+                return PrecachedPort.p5;
+            case 6:
+                return PrecachedPort.p6;
+            case 7:
+                return PrecachedPort.p7;
+            case 8:
+                return PrecachedPort.p8;
+            case 9:
+                return PrecachedPort.p9;
+            case 10:
+                return PrecachedPort.p10;
+            case 11:
+                return PrecachedPort.p11;
+            case 12:
+                return PrecachedPort.p12;
+            case 13:
+                return PrecachedPort.p13;
+            case 14:
+                return PrecachedPort.p14;
+            case 15:
+                return PrecachedPort.p15;
+            case 16:
+                return PrecachedPort.p16;
+            case 17:
+                return PrecachedPort.p17;
+            case 18:
+                return PrecachedPort.p18;
+            case 19:
+                return PrecachedPort.p19;
+            case 20:
+                return PrecachedPort.p20;
+            case 21:
+                return PrecachedPort.p21;
+            case 22:
+                return PrecachedPort.p22;
+            case 23:
+                return PrecachedPort.p23;
+            case 24:
+                return PrecachedPort.p24;
+            case 25:
+                return PrecachedPort.p25;
+            case 26:
+                return PrecachedPort.p26;
+            case 27:
+                return PrecachedPort.p27;
+            case 28:
+                return PrecachedPort.p28;
+            case 29:
+                return PrecachedPort.p29;
+            case 31:
+                return PrecachedPort.p31;
+            case 32:
+                return PrecachedPort.p32;
+            case 33:
+                return PrecachedPort.p33;
+            case 34:
+                return PrecachedPort.p34;
+            case 35:
+                return PrecachedPort.p35;
+            case 36:
+                return PrecachedPort.p36;
+            case 37:
+                return PrecachedPort.p37;
+            case 38:
+                return PrecachedPort.p38;
+            case 39:
+                return PrecachedPort.p39;
+            case 40:
+                return PrecachedPort.p40;
+            case 41:
+                return PrecachedPort.p41;
+            case 42:
+                return PrecachedPort.p42;
+            case 43:
+                return PrecachedPort.p43;
+            case 44:
+                return PrecachedPort.p44;
+            case 45:
+                return PrecachedPort.p45;
+            case 46:
+                return PrecachedPort.p46;
+            case 47:
+                return PrecachedPort.p47;
+            case 48:
+                return PrecachedPort.p48;
+            case OFPP_MAX_INT:
+                return MAX;
+            case OFPP_IN_PORT_INT:
+                return IN_PORT;
+            case OFPP_TABLE_INT:
+                return TABLE;
+            case OFPP_NORMAL_INT:
+                return NORMAL;
+            case OFPP_FLOOD_INT:
+                return FLOOD;
+            case OFPP_ALL_INT:
+                return ALL;
+            case OFPP_CONTROLLER_INT:
+                return CONTROLLER;
+            case OFPP_LOCAL_INT:
+                return LOCAL;
+            case OFPP_ANY_INT:
+                return ANY;
+            default:
+                // note: This means effectively : portNumber > OFPP_MAX_SHORT
+                // accounting for
+                // signedness of both portNumber and OFPP_MAX_INT(which is
+                // -256).
+                // Any unsigned integer value > OFPP_MAX_INT will be ]-256:0[
+                // when read signed
+                if (portNumber < 0 && portNumber > OFPP_MAX_INT)
+                    throw new IllegalArgumentException("Unknown special port number: "
+                            + portNumber);
+                return new OFPort(portNumber);
+        }
+    }
+
+    /** convenience function: delegates to ofInt */
+    public static OFPort of(final int portNumber) {
+        return ofInt(portNumber);
+    }
+
+    /**
+     * get an OFPort object corresponding to a raw signed 16-bit integer port
+     * number (OF1.0). Note that the port returned will have the corresponding
+     * 32-bit integer value allocated as its port number. NOTE: The port object
+     * may either be newly allocated or cached. Do not rely on either behavior.
+     *
+     * @param portNumber
+     * @return a corresponding OFPort
+     */
+    public static OFPort ofShort(final short portNumber) {
+        switch (portNumber) {
+            case 1:
+                return PrecachedPort.p1;
+            case 2:
+                return PrecachedPort.p2;
+            case 3:
+                return PrecachedPort.p3;
+            case 4:
+                return PrecachedPort.p4;
+            case 5:
+                return PrecachedPort.p5;
+            case 6:
+                return PrecachedPort.p6;
+            case 7:
+                return PrecachedPort.p7;
+            case 8:
+                return PrecachedPort.p8;
+            case 9:
+                return PrecachedPort.p9;
+            case 10:
+                return PrecachedPort.p10;
+            case 11:
+                return PrecachedPort.p11;
+            case 12:
+                return PrecachedPort.p12;
+            case 13:
+                return PrecachedPort.p13;
+            case 14:
+                return PrecachedPort.p14;
+            case 15:
+                return PrecachedPort.p15;
+            case 16:
+                return PrecachedPort.p16;
+            case 17:
+                return PrecachedPort.p17;
+            case 18:
+                return PrecachedPort.p18;
+            case 19:
+                return PrecachedPort.p19;
+            case 20:
+                return PrecachedPort.p20;
+            case 21:
+                return PrecachedPort.p21;
+            case 22:
+                return PrecachedPort.p22;
+            case 23:
+                return PrecachedPort.p23;
+            case 24:
+                return PrecachedPort.p24;
+            case 25:
+                return PrecachedPort.p25;
+            case 26:
+                return PrecachedPort.p26;
+            case 27:
+                return PrecachedPort.p27;
+            case 28:
+                return PrecachedPort.p28;
+            case 29:
+                return PrecachedPort.p29;
+            case 31:
+                return PrecachedPort.p31;
+            case 32:
+                return PrecachedPort.p32;
+            case 33:
+                return PrecachedPort.p33;
+            case 34:
+                return PrecachedPort.p34;
+            case 35:
+                return PrecachedPort.p35;
+            case 36:
+                return PrecachedPort.p36;
+            case 37:
+                return PrecachedPort.p37;
+            case 38:
+                return PrecachedPort.p38;
+            case 39:
+                return PrecachedPort.p39;
+            case 40:
+                return PrecachedPort.p40;
+            case 41:
+                return PrecachedPort.p41;
+            case 42:
+                return PrecachedPort.p42;
+            case 43:
+                return PrecachedPort.p43;
+            case 44:
+                return PrecachedPort.p44;
+            case 45:
+                return PrecachedPort.p45;
+            case 46:
+                return PrecachedPort.p46;
+            case 47:
+                return PrecachedPort.p47;
+            case 48:
+                return PrecachedPort.p48;
+            case OFPP_MAX_SHORT:
+                return MAX;
+            case OFPP_IN_PORT_SHORT:
+                return IN_PORT;
+            case OFPP_TABLE_SHORT:
+                return TABLE;
+            case OFPP_NORMAL_SHORT:
+                return NORMAL;
+            case OFPP_FLOOD_SHORT:
+                return FLOOD;
+            case OFPP_ALL_SHORT:
+                return ALL;
+            case OFPP_CONTROLLER_SHORT:
+                return CONTROLLER;
+            case OFPP_LOCAL_SHORT:
+                return LOCAL;
+            case OFPP_ANY_SHORT:
+                return ANY;
+            default:
+                // note: This means effectively : portNumber > OFPP_MAX_SHORT
+                // accounting for
+                // signedness of both portNumber and OFPP_MAX_SHORT (which is
+                // -256).
+                // Any unsigned integer value > OFPP_MAX_SHORT will be ]-256:0[
+                // when read signed
+                if (portNumber < 0 && portNumber > OFPP_MAX_SHORT)
+                    throw new IllegalArgumentException("Unknown special port number: "
+                            + portNumber);
+                return new OFPort(portNumber);
+        }
+    }
+
+    /** return the port number as a int32 */
+    public int getPortNumber() {
+        return portNumber;
+    }
+
+    /**
+     * return the port number as int16. Special ports as defined by the OpenFlow
+     * spec will be converted to their OpenFlow 1.0 equivalent. port numbers >=
+     * FF00 will cause a IllegalArgumentException to be thrown
+     *
+     * @throws IllegalArgumentException
+     *             if a regular port number exceeds the maximum value in OF1.0
+     **/
+    public short getShortPortNumber() {
+
+        switch (portNumber) {
+            case OFPP_MAX_INT:
+                return OFPP_MAX_SHORT;
+            case OFPP_IN_PORT_INT:
+                return OFPP_IN_PORT_SHORT;
+            case OFPP_TABLE_INT:
+                return OFPP_TABLE_SHORT;
+            case OFPP_NORMAL_INT:
+                return OFPP_NORMAL_SHORT;
+            case OFPP_FLOOD_INT:
+                return OFPP_FLOOD_SHORT;
+            case OFPP_ALL_INT:
+                return OFPP_ALL_SHORT;
+            case OFPP_CONTROLLER_INT:
+                return OFPP_CONTROLLER_SHORT;
+            case OFPP_LOCAL_INT:
+                return OFPP_LOCAL_SHORT;
+            case OFPP_ANY_INT:
+                return OFPP_ANY_SHORT;
+
+            default:
+                if (portNumber >= OFPP_MAX_SHORT_UNSIGNED || portNumber < 0)
+                    throw new IllegalArgumentException("32bit Port number "
+                            + U32.f(portNumber)
+                            + " cannot be represented as uint16 (OF1.0)");
+
+                return (short) portNumber;
+        }
+    }
+
+    @Override
+    public String toString() {
+        return Long.toString(U32.f(portNumber));
+    }
+
+    /** Extension of OFPort for named ports */
+    static class NamedPort extends OFPort {
+        private final String name;
+
+        NamedPort(final int portNo, final String name) {
+            super(portNo);
+            this.name = name;
+        }
+
+        public String getName() {
+            return name;
+        }
+
+        @Override
+        public String toString() {
+            return name;
+        }
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+    
+    @Override
+    public boolean equals(Object obj) {
+        if (!(obj instanceof OFPort))
+            return false;
+        OFPort other = (OFPort)obj;
+        if (other.portNumber != this.portNumber)
+            return false;
+        return true;
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 53;
+        int result = 1;
+        result = prime * result + portNumber;
+        return result;
+    }
+
+    public void write2Bytes(ChannelBuffer c) {
+        c.writeShort(this.portNumber);
+    }
+
+    public static OFPort read2Bytes(ChannelBuffer c) throws OFParseError {
+        return OFPort.ofShort(c.readShort());
+    }
+
+    public void write4Bytes(ChannelBuffer c) {
+        c.writeInt(this.portNumber);
+    }
+
+    public static OFPort read4Bytes(ChannelBuffer c) throws OFParseError {
+        return OFPort.of((int)(c.readUnsignedInt() & 0xFFFFFFFF));
+    }
+
+    @Override
+    public OFPort applyMask(OFPort mask) {
+        return OFPort.of(this.portNumber & mask.portNumber);
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFValueType.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFValueType.java
new file mode 100644
index 0000000..5f41494
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/OFValueType.java
@@ -0,0 +1,12 @@
+package org.projectfloodlight.openflow.types;
+
+
+
+
+public interface OFValueType<T extends OFValueType<T>> {
+
+    public int getLength();
+    
+    public T applyMask(T mask);
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/TransportPort.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/TransportPort.java
new file mode 100644
index 0000000..4cf5b90
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/TransportPort.java
@@ -0,0 +1,78 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+/**
+ * Represents L4 (Transport Layer) port (TCP, UDP, etc.)
+ *
+ * @author Yotam Harchol (yotam.harchol@bigswitch.com)
+ */
+public class TransportPort implements OFValueType<TransportPort> {
+
+    static final int LENGTH = 2;
+    static final int MAX_PORT = 0xFFFF;
+    static final int MIN_PORT = 0;
+
+    public static final TransportPort NO_MASK = new TransportPort(0xFFFFFFFF);
+    public static final TransportPort FULL_MASK = TransportPort.of(0x0);
+
+    private final int port;
+
+    private TransportPort(int port) {
+        this.port = port;
+    }
+
+    public static TransportPort of(int port) {
+        if (port < MIN_PORT || port > MAX_PORT) {
+            throw new IllegalArgumentException("Illegal transport layer port number: " + port);
+        }
+        return new TransportPort(port);
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    public int getPort() {
+        return port;
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (!(obj instanceof TransportPort))
+            return false;
+        TransportPort other = (TransportPort)obj;
+        if (other.port != this.port)
+            return false;
+        return true;
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 59;
+        int result = 1;
+        result = prime * result + port;
+        return result;
+    }
+
+    @Override
+    public String toString() {
+        return Integer.toString(port);
+    }
+
+    public void write2Bytes(ChannelBuffer c) {
+        c.writeShort(this.port);
+    }
+
+    public static TransportPort read2Bytes(ChannelBuffer c) throws OFParseError {
+        return TransportPort.of((c.readUnsignedShort() & 0x0FFFF));
+    }
+
+    @Override
+    public TransportPort applyMask(TransportPort mask) {
+        return TransportPort.of(this.port & mask.port);
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U16.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U16.java
new file mode 100644
index 0000000..55a467e
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U16.java
@@ -0,0 +1,108 @@
+/**
+ *    Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ *    University
+ *
+ *    Licensed under the Apache License, Version 2.0 (the "License"); you may
+ *    not use this file except in compliance with the License. You may obtain
+ *    a copy of the License at
+ *
+ *         http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *    Unless required by applicable law or agreed to in writing, software
+ *    distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ *    WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ *    License for the specific language governing permissions and limitations
+ *    under the License.
+ **/
+
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+public class U16 implements Writeable, OFValueType<U16> {
+    public static int f(final short i) {
+        return i & 0xffff;
+    }
+
+    public static short t(final int l) {
+        return (short) l;
+    }
+
+    private final short raw;
+
+    private U16(short raw) {
+        this.raw = raw;
+    }
+
+    public static final U16 of(int value) {
+        return new U16(t(value));
+    }
+
+    public static final U16 ofRaw(short value) {
+        return new U16(value);
+    }
+
+    public int getValue() {
+        return f(raw);
+    }
+
+    public short getRaw() {
+        return raw;
+    }
+
+    @Override
+    public String toString() {
+        return "" + f(raw);
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 31;
+        int result = 1;
+        result = prime * result + raw;
+        return result;
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (this == obj)
+            return true;
+        if (obj == null)
+            return false;
+        if (getClass() != obj.getClass())
+            return false;
+        U16 other = (U16) obj;
+        if (raw != other.raw)
+            return false;
+        return true;
+    }
+
+
+    @Override
+    public void writeTo(ChannelBuffer bb) {
+        bb.writeShort(raw);
+    }
+
+
+    public final static Reader READER = new Reader();
+
+    private static class Reader implements OFMessageReader<U16> {
+        @Override
+        public U16 readFrom(ChannelBuffer bb) throws OFParseError {
+            return ofRaw(bb.readShort());
+        }
+    }
+
+    @Override
+    public int getLength() {
+        return 2;
+    }
+
+    @Override
+    public U16 applyMask(U16 mask) {
+        return ofRaw( (short) (raw & mask.raw));
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U32.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U32.java
new file mode 100644
index 0000000..2634ed1
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U32.java
@@ -0,0 +1,108 @@
+/**
+ *    Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ *    University
+ *
+ *    Licensed under the Apache License, Version 2.0 (the "License"); you may
+ *    not use this file except in compliance with the License. You may obtain
+ *    a copy of the License at
+ *
+ *         http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *    Unless required by applicable law or agreed to in writing, software
+ *    distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ *    WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ *    License for the specific language governing permissions and limitations
+ *    under the License.
+ **/
+
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+public class U32 implements Writeable, OFValueType<U32> {
+    private final int raw;
+
+    private U32(int raw) {
+        this.raw = raw;
+    }
+
+    public static U32 of(long value) {
+        return new U32(U32.t(value));
+    }
+
+    public static U32 ofRaw(int value) {
+        return new U32(value);
+    }
+
+    public long getValue() {
+        return f(raw);
+    }
+
+    public int getRaw() {
+        return raw;
+    }
+
+    @Override
+    public String toString() {
+        return "" + f(raw);
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 31;
+        int result = 1;
+        result = prime * result + raw;
+        return result;
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (this == obj)
+            return true;
+        if (obj == null)
+            return false;
+        if (getClass() != obj.getClass())
+            return false;
+        U32 other = (U32) obj;
+        if (raw != other.raw)
+            return false;
+
+        return true;
+    }
+
+    public static long f(final int i) {
+        return i & 0xffffffffL;
+    }
+
+    public static int t(final long l) {
+        return (int) l;
+    }
+
+    @Override
+    public void writeTo(ChannelBuffer bb) {
+        bb.writeInt(raw);
+    }
+
+    public final static Reader READER = new Reader();
+
+    private static class Reader implements OFMessageReader<U32> {
+        @Override
+        public U32 readFrom(ChannelBuffer bb) throws OFParseError {
+            return new U32(bb.readInt());
+        }
+    }
+
+    @Override
+    public int getLength() {
+        return 4;
+    }
+
+    @Override
+    public U32 applyMask(U32 mask) {
+        return ofRaw(raw & mask.raw);
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U64.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U64.java
new file mode 100644
index 0000000..5de62dc
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U64.java
@@ -0,0 +1,112 @@
+/**
+ *    Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ *    University
+ *
+ *    Licensed under the Apache License, Version 2.0 (the "License"); you may
+ *    not use this file except in compliance with the License. You may obtain
+ *    a copy of the License at
+ *
+ *         http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *    Unless required by applicable law or agreed to in writing, software
+ *    distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ *    WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ *    License for the specific language governing permissions and limitations
+ *    under the License.
+ **/
+
+package org.projectfloodlight.openflow.types;
+
+import java.math.BigInteger;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+public class U64 implements Writeable, OFValueType<U64> {
+    private static final long UNSIGNED_MASK = 0x7fffffffffffffffL;
+
+    private final long raw;
+
+    protected U64(final long raw) {
+        this.raw = raw;
+    }
+
+    public static U64 of(long raw) {
+        return ofRaw(raw);
+    }
+
+    public static U64 ofRaw(final long raw) {
+        return new U64(raw);
+    }
+
+    public static U64 parseHex(String hex) {
+        return new U64(new BigInteger(hex, 16).longValue());
+    }
+
+    public long getValue() {
+        return raw;
+    }
+
+    public BigInteger getBigInteger() {
+        BigInteger bigInt = BigInteger.valueOf(raw & UNSIGNED_MASK);
+        if (raw < 0) {
+          bigInt = bigInt.setBit(Long.SIZE - 1);
+        }
+        return bigInt;
+    }
+
+    @Override
+    public String toString() {
+        return getBigInteger().toString();
+    }
+
+    public static BigInteger f(final long value) {
+        BigInteger bigInt = BigInteger.valueOf(value & UNSIGNED_MASK);
+        if (value < 0) {
+          bigInt = bigInt.setBit(Long.SIZE - 1);
+        }
+        return bigInt;
+    }
+
+    public static long t(final BigInteger l) {
+        return l.longValue();
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 31;
+        int result = 1;
+        result = prime * result + (int) (raw ^ (raw >>> 32));
+        return result;
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (this == obj)
+            return true;
+        if (obj == null)
+            return false;
+        if (getClass() != obj.getClass())
+            return false;
+        U64 other = (U64) obj;
+        if (raw != other.raw)
+            return false;
+        return true;
+    }
+
+    @Override
+    public int getLength() {
+        return 8;
+    }
+
+    @Override
+    public U64 applyMask(U64 mask) {
+        return ofRaw(raw & mask.raw);
+    }
+
+    @Override
+    public void writeTo(ChannelBuffer bb) {
+        bb.writeLong(raw);
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U8.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U8.java
new file mode 100644
index 0000000..41e740e
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/U8.java
@@ -0,0 +1,109 @@
+/**
+ *    Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ *    University
+ *
+ *    Licensed under the Apache License, Version 2.0 (the "License"); you may
+ *    not use this file except in compliance with the License. You may obtain
+ *    a copy of the License at
+ *
+ *         http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *    Unless required by applicable law or agreed to in writing, software
+ *    distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ *    WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ *    License for the specific language governing permissions and limitations
+ *    under the License.
+ **/
+
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+public class U8 implements Writeable, OFValueType<U8> {
+    private final byte raw;
+
+    private U8(byte raw) {
+        this.raw = raw;
+    }
+
+    public static final U8 of(short value) {
+        return new U8(t(value));
+    }
+
+    public static final U8 ofRaw(byte value) {
+        return new U8(value);
+    }
+
+    public short getValue() {
+        return f(raw);
+    }
+
+    public byte getRaw() {
+        return raw;
+    }
+
+    @Override
+    public String toString() {
+        return "" + f(raw);
+    }
+
+    @Override
+    public int hashCode() {
+        final int prime = 31;
+        int result = 1;
+        result = prime * result + raw;
+        return result;
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (this == obj)
+            return true;
+        if (obj == null)
+            return false;
+        if (getClass() != obj.getClass())
+            return false;
+        U8 other = (U8) obj;
+        if (raw != other.raw)
+            return false;
+        return true;
+    }
+
+
+    @Override
+    public void writeTo(ChannelBuffer bb) {
+        bb.writeByte(raw);
+    }
+
+    public static short f(final byte i) {
+        return (short) (i & 0xff);
+    }
+
+    public static byte t(final short l) {
+        return (byte) l;
+    }
+
+
+    public final static Reader READER = new Reader();
+
+    private static class Reader implements OFMessageReader<U8> {
+        @Override
+        public U8 readFrom(ChannelBuffer bb) throws OFParseError {
+            return new U8(bb.readByte());
+        }
+    }
+
+    @Override
+    public int getLength() {
+        return 1;
+    }
+
+    @Override
+    public U8 applyMask(U8 mask) {
+        return ofRaw( (byte) (raw & mask.raw));
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/VlanPcp.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/VlanPcp.java
new file mode 100644
index 0000000..9b5ef11
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/VlanPcp.java
@@ -0,0 +1,69 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public class VlanPcp implements OFValueType<VlanPcp> {
+
+    private static final byte VALIDATION_MASK = 0x07;
+    static final int LENGTH = 1;
+
+    private final byte pcp;
+
+    public static final VlanPcp NO_MASK = VlanPcp.of((byte)0xFF);
+    public static final VlanPcp FULL_MASK = VlanPcp.of((byte)0x0);
+
+    private VlanPcp(byte pcp) {
+        this.pcp = pcp;
+    }
+
+    public static VlanPcp of(byte pcp) {
+        if ((pcp & VALIDATION_MASK) != pcp)
+            throw new IllegalArgumentException("Illegal VLAN PCP value: " + pcp);
+        return new VlanPcp(pcp);
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (!(obj instanceof VlanPcp))
+            return false;
+        VlanPcp other = (VlanPcp)obj;
+        if (other.pcp != this.pcp)
+            return false;
+        return true;
+    }
+
+    @Override
+    public int hashCode() {
+        int prime = 20173;
+        return this.pcp * prime;
+    }
+
+    @Override
+    public String toString() {
+        return "0x" + Integer.toHexString(pcp);
+    }
+
+    public byte getValue() {
+        return pcp;
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+    public void writeByte(ChannelBuffer c) {
+        c.writeShort(this.pcp);
+    }
+
+    public static VlanPcp readByte(ChannelBuffer c) throws OFParseError {
+        return VlanPcp.of((byte)(c.readUnsignedByte() & 0xFF));
+    }
+
+    @Override
+    public VlanPcp applyMask(VlanPcp mask) {
+        return VlanPcp.of((byte)(this.pcp & mask.pcp));
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/VlanVid.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/VlanVid.java
new file mode 100644
index 0000000..705464c
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/types/VlanVid.java
@@ -0,0 +1,85 @@
+package org.projectfloodlight.openflow.types;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public class VlanVid implements OFValueType<VlanVid> {
+
+    private static final short VALIDATION_MASK = 0x0FFF;
+    final static int LENGTH = 2;
+
+    public static final VlanVid NO_MASK = VlanVid.of((short)0xFFFF);
+    public static final VlanVid FULL_MASK = VlanVid.of((short)0x0);
+
+    private final short vid;
+
+    private VlanVid(short vid) {
+        this.vid = vid;
+    }
+
+    public static VlanVid of(short vid) {
+        if ((vid & VALIDATION_MASK) != vid)
+            throw new IllegalArgumentException("Illegal VLAN VID value: " + vid);
+        return new VlanVid(vid);
+    }
+
+    @Override
+    public boolean equals(Object obj) {
+        if (!(obj instanceof VlanVid))
+            return false;
+        VlanVid other = (VlanVid)obj;
+        if (other.vid != this.vid)
+            return false;
+        return true;
+    }
+
+    @Override
+    public int hashCode() {
+        int prime = 13873;
+        return this.vid * prime;
+    }
+
+    @Override
+    public String toString() {
+        return "0x" + Integer.toHexString(vid);
+    }
+
+    public short getValue() {
+        return vid;
+    }
+
+    @Override
+    public int getLength() {
+        return LENGTH;
+    }
+
+
+    volatile byte[] bytesCache = null;
+
+    public byte[] getBytes() {
+        if (bytesCache == null) {
+            synchronized (this) {
+                if (bytesCache == null) {
+                    bytesCache =
+                            new byte[] { (byte) ((vid >>> 8) & 0xFF),
+                                         (byte) ((vid >>> 0) & 0xFF) };
+                }
+            }
+        }
+        return bytesCache;
+    }
+
+    public void write2Bytes(ChannelBuffer c) {
+        c.writeShort(this.vid);
+    }
+
+    public static VlanVid read2Bytes(ChannelBuffer c) throws OFParseError {
+        return VlanVid.of(c.readShort());
+    }
+
+    @Override
+    public VlanVid applyMask(VlanVid mask) {
+        return VlanVid.of((short)(this.vid & mask.vid));
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/ChannelUtils.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/ChannelUtils.java
new file mode 100644
index 0000000..ea2c4a9
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/ChannelUtils.java
@@ -0,0 +1,67 @@
+package org.projectfloodlight.openflow.util;
+
+import java.util.List;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+import org.projectfloodlight.openflow.protocol.OFMessageReader;
+import org.projectfloodlight.openflow.protocol.Writeable;
+
+import com.google.common.base.Charsets;
+import com.google.common.collect.ImmutableList;
+import com.google.common.collect.ImmutableList.Builder;
+
+/**
+ * Collection of helper functions for reading and writing into ChannelBuffers
+ *
+ * @author capveg
+ */
+
+public class ChannelUtils {
+    public static String readFixedLengthString(ChannelBuffer bb, int length) {
+        byte[] dst = new byte[length];
+        bb.readBytes(dst, 0, length);
+        return new String(dst, Charsets.US_ASCII);
+    }
+
+    public static void writeFixedLengthString(ChannelBuffer bb, String string,
+            int length) {
+        int l = string.length();
+        if (l > length) {
+            throw new IllegalArgumentException("Error writing string: length="
+                    + l + " > max Length=" + length);
+        }
+        bb.writeBytes(string.getBytes(Charsets.US_ASCII));
+        if (l < length) {
+            bb.writeZero(length - l);
+        }
+    }
+
+    static public byte[] readBytes(final ChannelBuffer bb, final int length) {
+        byte byteArray[] = new byte[length];
+        bb.readBytes(byteArray);
+        return byteArray;
+    }
+
+    static public void writeBytes(final ChannelBuffer bb,
+            final byte byteArray[]) {
+        bb.writeBytes(byteArray);
+    }
+
+    public static <T> List<T> readList(ChannelBuffer bb, int length, OFMessageReader<T> reader) throws OFParseError {
+        int end = bb.readerIndex() + length;
+        Builder<T> builder = ImmutableList.<T>builder();
+        while(bb.readerIndex() < end) {
+            builder.add(reader.readFrom(bb));
+        }
+        if(bb.readerIndex() != end) {
+            throw new IllegalStateException("Overread length: length="+length + " overread by "+ (bb.readerIndex() - end) + " reader: "+reader);
+        }
+        return builder.build();
+    }
+
+    public static void writeList(ChannelBuffer bb, List<? extends Writeable> writeables) {
+        for(Writeable w: writeables)
+            w.writeTo(bb);
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/HexString.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/HexString.java
new file mode 100644
index 0000000..d812236
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/HexString.java
@@ -0,0 +1,98 @@
+/**
+ *    Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ *    University
+ *
+ *    Licensed under the Apache License, Version 2.0 (the "License"); you may
+ *    not use this file except in compliance with the License. You may obtain
+ *    a copy of the License at
+ *
+ *         http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *    Unless required by applicable law or agreed to in writing, software
+ *    distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ *    WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ *    License for the specific language governing permissions and limitations
+ *    under the License.
+ **/
+
+package org.projectfloodlight.openflow.util;
+
+import java.math.BigInteger;
+
+import org.projectfloodlight.openflow.types.U8;
+
+public class HexString {
+    /**
+     * Convert a string of bytes to a ':' separated hex string
+     *
+     * @param bytes
+     * @return "0f:ca:fe:de:ad:be:ef"
+     */
+    public static String toHexString(final byte[] bytes) {
+        int i;
+        String ret = "";
+        String tmp;
+        for (i = 0; i < bytes.length; i++) {
+            if (i > 0)
+                ret += ":";
+            tmp = Integer.toHexString(U8.f(bytes[i]));
+            if (tmp.length() == 1)
+                ret += "0";
+            ret += tmp;
+        }
+        return ret;
+    }
+
+    public static String toHexString(final long val, final int padTo) {
+        char arr[] = Long.toHexString(val).toCharArray();
+        String ret = "";
+        // prepend the right number of leading zeros
+        int i = 0;
+        for (; i < (padTo * 2 - arr.length); i++) {
+            ret += "0";
+            if ((i % 2) == 1)
+                ret += ":";
+        }
+        for (int j = 0; j < arr.length; j++) {
+            ret += arr[j];
+            if ((((i + j) % 2) == 1) && (j < (arr.length - 1)))
+                ret += ":";
+        }
+        return ret;
+    }
+
+    public static String toHexString(final long val) {
+        return toHexString(val, 8);
+    }
+
+    /**
+     * Convert a string of hex values into a string of bytes
+     *
+     * @param values
+     *            "0f:ca:fe:de:ad:be:ef"
+     * @return [15, 5 ,2, 5, 17]
+     * @throws NumberFormatException
+     *             If the string can not be parsed
+     */
+    public static byte[] fromHexString(final String values) throws NumberFormatException {
+        String[] octets = values.split(":");
+        byte[] ret = new byte[octets.length];
+
+        for (int i = 0; i < octets.length; i++) {
+            if (octets[i].length() > 2)
+                throw new NumberFormatException("Invalid octet length");
+            ret[i] = Integer.valueOf(octets[i], 16).byteValue();
+        }
+        return ret;
+    }
+
+    public static long toLong(final String values) throws NumberFormatException {
+        // Long.parseLong() can't handle HexStrings with MSB set. Sigh.
+        BigInteger bi = new BigInteger(values.replaceAll(":", ""), 16);
+        if (bi.bitLength() > 64)
+            throw new NumberFormatException("Input string too big to fit in long: "
+                    + values);
+        return bi.longValue();
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/LRULinkedHashMap.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/LRULinkedHashMap.java
new file mode 100644
index 0000000..7798e67
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/LRULinkedHashMap.java
@@ -0,0 +1,42 @@
+/**
+ *    Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ *    University
+ *
+ *    Licensed under the Apache License, Version 2.0 (the "License"); you may
+ *    not use this file except in compliance with the License. You may obtain
+ *    a copy of the License at
+ *
+ *         http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *    Unless required by applicable law or agreed to in writing, software
+ *    distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ *    WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ *    License for the specific language governing permissions and limitations
+ *    under the License.
+ **/
+
+package org.projectfloodlight.openflow.util;
+
+import java.util.LinkedHashMap;
+
+public class LRULinkedHashMap<K, V> extends LinkedHashMap<K, V> {
+    private static final long serialVersionUID = -2964986094089626647L;
+    protected int maximumCapacity;
+
+    public LRULinkedHashMap(final int initialCapacity, final int maximumCapacity) {
+        super(initialCapacity, 0.75f, true);
+        this.maximumCapacity = maximumCapacity;
+    }
+
+    public LRULinkedHashMap(final int maximumCapacity) {
+        super(16, 0.75f, true);
+        this.maximumCapacity = maximumCapacity;
+    }
+
+    @Override
+    protected boolean removeEldestEntry(final java.util.Map.Entry<K, V> eldest) {
+        if (this.size() > maximumCapacity)
+            return true;
+        return false;
+    }
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/LengthCountingPseudoChannelBuffer.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/LengthCountingPseudoChannelBuffer.java
new file mode 100644
index 0000000..48362da
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/LengthCountingPseudoChannelBuffer.java
@@ -0,0 +1,673 @@
+package org.projectfloodlight.openflow.util;
+
+import java.io.IOException;
+import java.io.InputStream;
+import java.io.OutputStream;
+import java.nio.ByteBuffer;
+import java.nio.ByteOrder;
+import java.nio.channels.GatheringByteChannel;
+import java.nio.channels.ScatteringByteChannel;
+import java.nio.charset.Charset;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+import org.jboss.netty.buffer.ChannelBufferFactory;
+import org.jboss.netty.buffer.ChannelBufferIndexFinder;
+
+public class LengthCountingPseudoChannelBuffer implements ChannelBuffer {
+
+    int writerIndex = 0;
+    private int markedWriterIndex;
+
+    @Override
+    public ChannelBufferFactory factory() {
+        return null;
+    }
+
+    @Override
+    public int capacity() {
+        return Integer.MAX_VALUE;
+    }
+
+    @Override
+    public ByteOrder order() {
+        return ByteOrder.BIG_ENDIAN;
+    }
+
+    @Override
+    public boolean isDirect() {
+        return true;
+    }
+
+    @Override
+    public int readerIndex() {
+        return 0;
+    }
+
+    @Override
+    public void readerIndex(int readerIndex) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int writerIndex() {
+        return writerIndex;
+    }
+
+    @Override
+    public void writerIndex(int writerIndex) {
+        this.writerIndex = writerIndex;
+    }
+
+    @Override
+    public void setIndex(int readerIndex, int writerIndex) {
+        if(readerIndex != 0)
+            throw new UnsupportedOperationException();
+        this.writerIndex = writerIndex;
+    }
+
+    @Override
+    public int readableBytes() {
+        return writerIndex;
+    }
+
+    @Override
+    public int writableBytes() {
+        return Integer.MAX_VALUE - writerIndex;
+    }
+
+    @Override
+    public boolean readable() {
+        return writerIndex > 0;
+    }
+
+    @Override
+    public boolean writable() {
+        return writerIndex < Integer.MAX_VALUE;
+    }
+
+    @Override
+    public void clear() {
+        writerIndex = 0;
+
+    }
+
+    @Override
+    public void markReaderIndex() {
+    }
+
+    @Override
+    public void resetReaderIndex() {
+    }
+
+    @Override
+    public void markWriterIndex() {
+        markedWriterIndex = writerIndex;
+    }
+
+    @Override
+    public void resetWriterIndex() {
+        writerIndex = markedWriterIndex;
+    }
+
+    @Override
+    public void discardReadBytes() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void ensureWritableBytes(int writableBytes) {
+        if(!((Integer.MAX_VALUE - writableBytes) > writerIndex))
+            throw new IllegalStateException();
+    }
+
+    @Override
+    public byte getByte(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public short getUnsignedByte(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public short getShort(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int getUnsignedShort(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int getMedium(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int getUnsignedMedium(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int getInt(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public long getUnsignedInt(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public long getLong(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public char getChar(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public float getFloat(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public double getDouble(int index) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void getBytes(int index, ChannelBuffer dst) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void getBytes(int index, ChannelBuffer dst, int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void getBytes(int index, ChannelBuffer dst, int dstIndex, int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void getBytes(int index, byte[] dst) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void getBytes(int index, byte[] dst, int dstIndex, int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void getBytes(int index, ByteBuffer dst) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void getBytes(int index, OutputStream out, int length)
+            throws IOException {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int getBytes(int index, GatheringByteChannel out, int length)
+            throws IOException {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void setByte(int index, int value) {
+    }
+
+    @Override
+    public void setShort(int index, int value) {
+    }
+
+    @Override
+    public void setMedium(int index, int value) {
+    }
+
+    @Override
+    public void setInt(int index, int value) {
+    }
+
+    @Override
+    public void setLong(int index, long value) {
+    }
+
+    @Override
+    public void setChar(int index, int value) {
+    }
+
+    @Override
+    public void setFloat(int index, float value) {
+    }
+
+    @Override
+    public void setDouble(int index, double value) {
+    }
+
+    @Override
+    public void setBytes(int index, ChannelBuffer src) {
+    }
+
+    @Override
+    public void setBytes(int index, ChannelBuffer src, int length) {
+    }
+
+    @Override
+    public void setBytes(int index, ChannelBuffer src, int srcIndex, int length) {
+    }
+
+    @Override
+    public void setBytes(int index, byte[] src) {
+    }
+
+    @Override
+    public void setBytes(int index, byte[] src, int srcIndex, int length) {
+    }
+
+    @Override
+    public void setBytes(int index, ByteBuffer src) {
+
+    }
+
+    @Override
+    public int setBytes(int index, InputStream in, int length)
+            throws IOException {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int setBytes(int index, ScatteringByteChannel in, int length)
+            throws IOException {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void setZero(int index, int length) {
+    }
+
+    @Override
+    public byte readByte() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public short readUnsignedByte() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public short readShort() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int readUnsignedShort() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int readMedium() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int readUnsignedMedium() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int readInt() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public long readUnsignedInt() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public long readLong() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public char readChar() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public float readFloat() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public double readDouble() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ChannelBuffer readBytes(int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    @Deprecated
+    public ChannelBuffer readBytes(ChannelBufferIndexFinder indexFinder) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ChannelBuffer readSlice(int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    @Deprecated
+    public
+    ChannelBuffer readSlice(ChannelBufferIndexFinder indexFinder) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void readBytes(ChannelBuffer dst) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void readBytes(ChannelBuffer dst, int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void readBytes(ChannelBuffer dst, int dstIndex, int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void readBytes(byte[] dst) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void readBytes(byte[] dst, int dstIndex, int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void readBytes(ByteBuffer dst) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void readBytes(OutputStream out, int length) throws IOException {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int readBytes(GatheringByteChannel out, int length)
+            throws IOException {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void skipBytes(int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    @Deprecated
+    public int skipBytes(ChannelBufferIndexFinder indexFinder) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public void writeByte(int value) {
+        writerIndex++;
+    }
+
+    @Override
+    public void writeShort(int value) {
+    writerIndex += 2;
+}
+
+@Override
+public void writeMedium(int value) {
+    writerIndex += 3;
+}
+
+@Override
+public void writeInt(int value) {
+    writerIndex += 4;
+}
+
+@Override
+public void writeLong(long value) {
+    writerIndex += 8;
+}
+
+
+    @Override
+    public void writeChar(int value) {
+        writeShort(value);
+    }
+
+    @Override
+    public void writeFloat(float value) {
+        writeInt(Float.floatToIntBits(value));
+    }
+
+    @Override
+    public void writeDouble(double value) {
+        writeLong(Double.doubleToLongBits(value));
+
+    }
+
+    @Override
+    public void writeBytes(ChannelBuffer src) {
+        writerIndex += src.readableBytes();
+
+    }
+
+    @Override
+    public void writeBytes(ChannelBuffer src, int length) {
+        writerIndex += src.readableBytes();
+
+    }
+
+    @Override
+    public void writeBytes(ChannelBuffer src, int srcIndex, int length) {
+        writerIndex += length;
+    }
+
+    @Override
+    public void writeBytes(byte[] src) {
+        writerIndex += src.length;
+
+    }
+
+    @Override
+    public void writeBytes(byte[] src, int srcIndex, int length) {
+        writerIndex += length;
+    }
+
+    @Override
+    public void writeBytes(ByteBuffer src) {
+        writerIndex += src.remaining();
+
+    }
+
+    @Override
+    public int writeBytes(InputStream in, int length) throws IOException {
+        writerIndex += length;
+        return length;
+    }
+
+    @Override
+    public int writeBytes(ScatteringByteChannel in, int length)
+            throws IOException {
+        writerIndex += length;
+        return length;
+    }
+
+    @Override
+    public void writeZero(int length) {
+        writerIndex += length;
+
+    }
+
+    @Override
+    public int indexOf(int fromIndex, int toIndex, byte value) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int indexOf(int fromIndex, int toIndex,
+            ChannelBufferIndexFinder indexFinder) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int bytesBefore(byte value) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int bytesBefore(ChannelBufferIndexFinder indexFinder) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int bytesBefore(int length, byte value) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int bytesBefore(int length, ChannelBufferIndexFinder indexFinder) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int bytesBefore(int index, int length, byte value) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int bytesBefore(int index, int length,
+            ChannelBufferIndexFinder indexFinder) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ChannelBuffer copy() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ChannelBuffer copy(int index, int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ChannelBuffer slice() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ChannelBuffer slice(int index, int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ChannelBuffer duplicate() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ByteBuffer toByteBuffer() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ByteBuffer toByteBuffer(int index, int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ByteBuffer[] toByteBuffers() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public ByteBuffer[] toByteBuffers(int index, int length) {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public boolean hasArray() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public byte[] array() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public int arrayOffset() {
+        throw new UnsupportedOperationException();
+    }
+
+    @Override
+    public String toString(Charset charset) {
+        return "LengthCountingPseudoChannelBuffer(length="+writerIndex+")";
+    }
+
+    @Override
+    public String toString(int index, int length, Charset charset) {
+        return toString();
+    }
+
+    @Override
+    @Deprecated
+    public String toString(String charsetName) {
+        return toString();
+    }
+
+    @Override
+    @Deprecated
+    public String toString(String charsetName,
+            ChannelBufferIndexFinder terminatorFinder) {
+        return toString();
+    }
+
+    @Override
+    @Deprecated
+    public String toString(int index, int length, String charsetName) {
+        return toString();
+    }
+
+    @Override
+    @Deprecated
+    public
+    String toString(int index, int length, String charsetName,
+            ChannelBufferIndexFinder terminatorFinder) {
+        return toString();
+    }
+
+    @Override
+    public int compareTo(ChannelBuffer buffer) {
+        throw new UnsupportedOperationException();
+
+    }
+
+}
diff --git a/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/StringByteSerializer.java b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/StringByteSerializer.java
new file mode 100644
index 0000000..6949fb2
--- /dev/null
+++ b/java_gen/pre-written/src/main/java/org/projectfloodlight/openflow/util/StringByteSerializer.java
@@ -0,0 +1,58 @@
+/**
+ *    Copyright (c) 2008 The Board of Trustees of The Leland Stanford Junior
+ *    University
+ *
+ *    Licensed under the Apache License, Version 2.0 (the "License"); you may
+ *    not use this file except in compliance with the License. You may obtain
+ *    a copy of the License at
+ *
+ *         http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *    Unless required by applicable law or agreed to in writing, software
+ *    distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ *    WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ *    License for the specific language governing permissions and limitations
+ *    under the License.
+ **/
+
+package org.projectfloodlight.openflow.util;
+
+import java.io.UnsupportedEncodingException;
+import java.nio.charset.Charset;
+import java.util.Arrays;
+
+import org.jboss.netty.buffer.ChannelBuffer;
+
+public class StringByteSerializer {
+    public static String readFrom(final ChannelBuffer data, final int length) {
+        byte[] stringBytes = new byte[length];
+        data.readBytes(stringBytes);
+        // find the first index of 0
+        int index = 0;
+        for (byte b : stringBytes) {
+            if (0 == b)
+                break;
+            ++index;
+        }
+        return new String(Arrays.copyOf(stringBytes, index), Charset.forName("ascii"));
+    }
+
+    public static void writeTo(final ChannelBuffer data, final int length,
+            final String value) {
+        try {
+            byte[] name = value.getBytes("ASCII");
+            if (name.length < length) {
+                data.writeBytes(name);
+                for (int i = name.length; i < length; ++i) {
+                    data.writeByte((byte) 0);
+                }
+            } else {
+                data.writeBytes(name, 0, length - 1);
+                data.writeByte((byte) 0);
+            }
+        } catch (UnsupportedEncodingException e) {
+            throw new RuntimeException(e);
+        }
+
+    }
+}
diff --git a/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/IPv4Test.java b/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/IPv4Test.java
new file mode 100644
index 0000000..464323f
--- /dev/null
+++ b/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/IPv4Test.java
@@ -0,0 +1,130 @@
+package org.projectfloodlight.openflow.types;
+
+import static org.junit.Assert.assertArrayEquals;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+
+import org.jboss.netty.buffer.ChannelBuffers;
+import org.junit.Test;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public class IPv4Test {
+    byte[][] testAddresses = new byte[][] {
+            {0x01, 0x02, 0x03, 0x04 },
+            {127, 0, 0, 1},
+            {(byte) 192, (byte) 168, 0, 100 },
+            {(byte) 255, (byte) 255, (byte) 255, (byte) 255 }
+    };
+
+    String[] testStrings = {
+            "1.2.3.4",
+            "127.0.0.1",
+            "192.168.0.100",
+            "255.255.255.255"
+    };
+
+    int[] testInts = {
+            0x01020304,
+            0x7f000001,
+            (192 << 24) | (168 << 16) | 100,
+            0xffffffff
+    };
+
+    String[] invalidIPs = {
+            "",
+            ".",
+            "1.2..3.4",
+            "1.2.3.4.",
+            "257.11.225.1",
+            "-1.2.3.4",
+            "1.2.3.4.5",
+            "1.x.3.4",
+            "1.2x.3.4"
+    };
+
+    String[] ipsWithMask = {
+                            "1.2.3.4/24",
+                            "192.168.130.140/255.255.192.0",
+                            "127.0.0.1/8",
+                            "8.8.8.8",
+    };
+
+    boolean[] hasMask = {
+                         true,
+                         true,
+                         true,
+                         false
+    };
+
+    byte[][][] ipsWithMaskValues = {
+                             new byte[][] { new byte[] { (byte)0x01, (byte)0x02, (byte)0x03, (byte)0x04 }, new byte[] { (byte)0xFF, (byte)0xFF, (byte)0xFF, (byte)0x00 } },
+                             new byte[][] { new byte[] { (byte)0xC0, (byte)0xA8, (byte)0x82, (byte)0x8C }, new byte[] { (byte)0xFF, (byte)0xFF, (byte)0xC0, (byte)0x00 } },
+                             new byte[][] { new byte[] { (byte)0x7F, (byte)0x00, (byte)0x00, (byte)0x01 }, new byte[] { (byte)0xFF, (byte)0x00, (byte)0x00, (byte)0x00 } },
+                             new byte[][] { new byte[] { (byte)0x08, (byte)0x08, (byte)0x08, (byte)0x08 }, null }
+    };
+
+
+    @Test
+    public void testOfString() {
+        for(int i=0; i < testAddresses.length; i++ ) {
+            IPv4 ip = IPv4.of(testStrings[i]);
+            assertEquals(testInts[i], ip.getInt());
+            assertArrayEquals(testAddresses[i], ip.getBytes());
+            assertEquals(testStrings[i], ip.toString());
+        }
+    }
+
+    @Test
+    public void testOfByteArray() {
+        for(int i=0; i < testAddresses.length; i++ ) {
+            IPv4 ip = IPv4.of(testAddresses[i]);
+            assertEquals(testInts[i], ip.getInt());
+            assertArrayEquals(testAddresses[i], ip.getBytes());
+            assertEquals(testStrings[i], ip.toString());
+        }
+    }
+
+    @Test
+    public void testReadFrom() throws OFParseError {
+        for(int i=0; i < testAddresses.length; i++ ) {
+            IPv4 ip = IPv4.read4Bytes(ChannelBuffers.copiedBuffer(testAddresses[i]));
+            assertEquals(testInts[i], ip.getInt());
+            assertArrayEquals(testAddresses[i], ip.getBytes());
+            assertEquals(testStrings[i], ip.toString());
+        }
+    }
+
+
+    @Test
+    public void testInvalidIPs() throws OFParseError {
+        for(String invalid : invalidIPs) {
+            try {
+                IPv4.of(invalid);
+                fail("Invalid IP "+invalid+ " should have raised IllegalArgumentException");
+            } catch(IllegalArgumentException e) {
+                // ok
+            }
+        }
+    }
+
+    @Test
+    public void testOfMasked() throws OFParseError {
+        for (int i = 0; i < ipsWithMask.length; i++) {
+            IPv4WithMask value = IPv4WithMask.of(ipsWithMask[i]);
+            if (!hasMask[i]) {
+                IPv4 ip = value.getValue();
+                assertArrayEquals(ipsWithMaskValues[i][0], ip.getBytes());
+            } else if (hasMask[i]) {
+                byte[] ipBytes = new byte[4];
+                System.arraycopy(ipsWithMaskValues[i][0], 0, ipBytes, 0, 4);
+                assertEquals(ipBytes.length, value.getValue().getBytes().length);
+                for (int j = 0; j < ipBytes.length; j++) {
+                    ipBytes[j] &= ipsWithMaskValues[i][1][j];
+                }
+
+                assertArrayEquals(ipBytes, value.getValue().getBytes());
+                assertArrayEquals(ipsWithMaskValues[i][1], value.getMask().getBytes());
+            }
+        }
+    }
+}
diff --git a/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/IPv6Test.java b/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/IPv6Test.java
new file mode 100644
index 0000000..092dacb
--- /dev/null
+++ b/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/IPv6Test.java
@@ -0,0 +1,147 @@
+package org.projectfloodlight.openflow.types;
+
+import static org.junit.Assert.assertArrayEquals;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+
+import java.net.Inet6Address;
+import java.net.InetAddress;
+import java.net.UnknownHostException;
+
+import org.jboss.netty.buffer.ChannelBuffers;
+import org.junit.Test;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public class IPv6Test {
+
+    String[] testStrings = {
+            "::",
+            "::1",
+            "ffe0::",
+            "1:2:3:4:5:6:7:8"
+    };
+
+    String[] ipsWithMask = {
+                            "1::1/80",
+                            "1:2:3:4::/ffff:ffff:ffff:ff00::",
+                            "ffff:ffee:1::/ff00:ff00:ff00:ff00::",
+                            "8:8:8:8:8:8:8:8",
+    };
+
+    byte[][] masks = {
+                    new byte[] { (byte)0xff, (byte)0xff, (byte)0xff, (byte)0xff,
+                                 (byte)0xff, (byte)0xff, (byte)0xff, (byte)0xff,
+                                 (byte)0xff, (byte)0xff, (byte)0x00, (byte)0x00,
+                                 (byte)0x00, (byte)0x00, (byte)0x00, (byte)0x00 },
+                    new byte[] { (byte)0xff, (byte)0xff, (byte)0xff, (byte)0xff,
+                                 (byte)0xff, (byte)0xff, (byte)0xff, (byte)0x00,
+                                 (byte)0x00, (byte)0x00, (byte)0x00, (byte)0x00,
+                                 (byte)0x00, (byte)0x00, (byte)0x00, (byte)0x00 },
+                    new byte[] { (byte)0xff, (byte)0x00, (byte)0xff, (byte)0x00,
+                                 (byte)0xff, (byte)0x00, (byte)0xff, (byte)0x00,
+                                 (byte)0x00, (byte)0x00, (byte)0x00, (byte)0x00,
+                                 (byte)0x00, (byte)0x00, (byte)0x00, (byte)0x00 },
+                    new byte[] { (byte)0x00, (byte)0x00, (byte)0x00, (byte)0x00,
+                                 (byte)0x00, (byte)0x00, (byte)0x00, (byte)0x00,
+                                 (byte)0x00, (byte)0x00, (byte)0x00, (byte)0x00,
+                                 (byte)0x00, (byte)0x00, (byte)0x00, (byte)0x00 }
+    };
+
+    boolean[] hasMask = {
+                         true,
+                         true,
+                         true,
+                         false
+    };
+
+    @Test
+    public void testMasked() throws UnknownHostException {
+        for(int i=0; i < ipsWithMask.length; i++ ) {
+            IPv6WithMask value = IPv6WithMask.of(ipsWithMask[i]);
+            if (!hasMask[i]) {
+                IPv6 ip = value.getValue();
+                InetAddress inetAddress = InetAddress.getByName(ipsWithMask[i]);
+
+                assertArrayEquals(ip.getBytes(), inetAddress.getAddress());
+                assertEquals(ipsWithMask[i], ip.toString());
+            } else if (value instanceof IPv6WithMask && hasMask[i]) {
+                InetAddress inetAddress = InetAddress.getByName(ipsWithMask[i].substring(0, ipsWithMask[i].indexOf('/')));
+
+                byte[] address = inetAddress.getAddress();
+                assertEquals(address.length, value.getValue().getBytes().length);
+
+                for (int j = 0; j < address.length; j++) {
+                    address[j] &= masks[i][j];
+                }
+
+                assertArrayEquals(value.getValue().getBytes(), address);
+                assertArrayEquals(masks[i], value.getMask().getBytes());
+            }
+        }
+    }
+
+
+    @Test
+    public void testOfString() throws UnknownHostException {
+        for(int i=0; i < testStrings.length; i++ ) {
+            IPv6 ip = IPv6.of(testStrings[i]);
+            InetAddress inetAddress = InetAddress.getByName(testStrings[i]);
+
+            assertArrayEquals(ip.getBytes(), inetAddress.getAddress());
+            assertEquals(testStrings[i], ip.toString());
+        }
+    }
+
+    @Test
+    public void testOfByteArray() throws UnknownHostException {
+        for(int i=0; i < testStrings.length; i++ ) {
+            byte[] bytes = Inet6Address.getByName(testStrings[i]).getAddress();
+            IPv6 ip = IPv6.of(bytes);
+            assertEquals(testStrings[i], ip.toString());
+            assertArrayEquals(bytes, ip.getBytes());
+        }
+    }
+
+    @Test
+    public void testReadFrom() throws OFParseError, UnknownHostException {
+        for(int i=0; i < testStrings.length; i++ ) {
+            byte[] bytes = Inet6Address.getByName(testStrings[i]).getAddress();
+            IPv6 ip = IPv6.read16Bytes(ChannelBuffers.copiedBuffer(bytes));
+            assertEquals(testStrings[i], ip.toString());
+            assertArrayEquals(bytes, ip.getBytes());
+        }
+    }
+
+    String[] invalidIPs = {
+            "",
+            ":",
+            "1:2:3:4:5:6:7:8:9",
+            "1:2:3:4:5:6:7:8:",
+            "1:2:3:4:5:6:7:8g",
+            "1:2:3:",
+            "12345::",
+            "1::3::8",
+            "::3::"
+    };
+
+    @Test
+    public void testInvalidIPs() throws OFParseError {
+        for(String invalid : invalidIPs) {
+            try {
+                IPv6.of(invalid);
+                fail("Invalid IP "+invalid+ " should have raised IllegalArgumentException");
+            } catch(IllegalArgumentException e) {
+                // ok
+            }
+        }
+    }
+
+    @Test
+    public void testZeroCompression() throws OFParseError {
+        assertEquals("::", IPv6.of("::").toString(true, false));
+        assertEquals("0:0:0:0:0:0:0:0", IPv6.of("::").toString(false, false));
+        assertEquals("0000:0000:0000:0000:0000:0000:0000:0000", IPv6.of("::").toString(false, true));
+        assertEquals("1::4:5:6:0:8", IPv6.of("1:0:0:4:5:6:0:8").toString(true, false));
+        assertEquals("1:0:0:4::8", IPv6.of("1:0:0:4:0:0:0:8").toString(true, false));
+    }
+}
diff --git a/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/MacAddressTest.java b/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/MacAddressTest.java
new file mode 100644
index 0000000..dc25b12
--- /dev/null
+++ b/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/MacAddressTest.java
@@ -0,0 +1,85 @@
+package org.projectfloodlight.openflow.types;
+
+import static org.junit.Assert.assertArrayEquals;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.fail;
+
+import java.util.Arrays;
+
+import org.jboss.netty.buffer.ChannelBuffers;
+import org.junit.Test;
+import org.projectfloodlight.openflow.exceptions.OFParseError;
+
+public class MacAddressTest {
+    byte[][] testAddresses = new byte[][] {
+            {0x01, 0x02, 0x03, 0x04, 0x05, 0x06 },
+            {(byte) 0x80, 0x0, 0x0, 0x0, 0x0, 0x01},
+            {(byte) 255, (byte) 255, (byte) 255, (byte) 255, (byte) 255, (byte) 255 }
+    };
+
+    String[] testStrings = {
+            "01:02:03:04:05:06",
+            "80:00:00:00:00:01",
+            "ff:ff:ff:ff:ff:ff"
+    };
+
+    long[] testInts = {
+            0x00010203040506L,
+            0x00800000000001L,
+            0x00ffffffffffffL
+    };
+
+    String[] invalidMacs = {
+            "",
+            "1.2.3.4",
+            "00:ff:ef:12:12:ff:",
+            "00:fff:ef:12:12:ff",
+            "01:02:03:04:05;06",
+            "0:1:2:3:4:5:6",
+            "01:02:03:04"
+    };
+
+
+    @Test
+    public void testOfString() {
+        for(int i=0; i < testAddresses.length; i++ ) {
+            MacAddress ip = MacAddress.of(testStrings[i]);
+            assertEquals(testInts[i], ip.getLong());
+            assertArrayEquals(testAddresses[i], ip.getBytes());
+            assertEquals(testStrings[i], ip.toString());
+        }
+    }
+
+    @Test
+    public void testOfByteArray() {
+        for(int i=0; i < testAddresses.length; i++ ) {
+            MacAddress ip = MacAddress.of(testAddresses[i]);
+            assertEquals("error checking long representation of "+Arrays.toString(testAddresses[i]) + "(should be "+Long.toHexString(testInts[i]) +")", testInts[i],  ip.getLong());
+            assertArrayEquals(testAddresses[i], ip.getBytes());
+            assertEquals(testStrings[i], ip.toString());
+        }
+    }
+
+    @Test
+    public void testReadFrom() throws OFParseError {
+        for(int i=0; i < testAddresses.length; i++ ) {
+            MacAddress ip = MacAddress.read6Bytes(ChannelBuffers.copiedBuffer(testAddresses[i]));
+            assertEquals(testInts[i], ip.getLong());
+            assertArrayEquals(testAddresses[i], ip.getBytes());
+            assertEquals(testStrings[i], ip.toString());
+        }
+    }
+
+
+    @Test
+    public void testInvalidMacss() throws OFParseError {
+        for(String invalid : invalidMacs) {
+            try {
+                MacAddress.of(invalid);
+                fail("Invalid IP "+invalid+ " should have raised IllegalArgumentException");
+            } catch(IllegalArgumentException e) {
+                // ok
+            }
+        }
+    }
+}
diff --git a/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/U64Test.java b/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/U64Test.java
new file mode 100644
index 0000000..e45e8a0
--- /dev/null
+++ b/java_gen/pre-written/src/test/java/org/projectfloodlight/openflow/types/U64Test.java
@@ -0,0 +1,26 @@
+package org.projectfloodlight.openflow.types;
+
+import static org.junit.Assert.assertEquals;
+
+import java.math.BigInteger;
+
+import org.junit.Test;
+
+public class U64Test {
+
+    @Test
+    public void testPositiveRaws() {
+        for(long positive: new long[] { 0, 1, 100, Long.MAX_VALUE }) {
+            assertEquals(positive, U64.ofRaw(positive).getValue());
+            assertEquals(BigInteger.valueOf(positive), U64.ofRaw(positive).getBigInteger());
+        }
+    }
+
+    @Test
+    public void testNegativeRaws() {
+        long minus_1 = 0xFFffFFffFFffFFffL;
+        assertEquals(minus_1, U64.ofRaw(minus_1).getValue());
+        assertEquals(new BigInteger("FFffFFffFFffFFff", 16),  U64.ofRaw(minus_1).getBigInteger());
+        assertEquals(new BigInteger("18446744073709551615"),  U64.ofRaw(minus_1).getBigInteger());
+    }
+}